Merge branch 'for-linus' of git://gitserver.sunplusct.com/linux-2.6-score

* 'for-linus' of git://gitserver.sunplusct.com/linux-2.6-score:
  score: update email address in MAINTAINERS.
  score: Cleanup linker script using new macros.
  score: Make THREAD_SIZE available to assembly files.
  score: Make PAGE_SIZE available to assembly.
diff --git a/Documentation/ABI/testing/sysfs-gpio b/Documentation/ABI/testing/sysfs-gpio
index 8aab809..80f4c94 100644
--- a/Documentation/ABI/testing/sysfs-gpio
+++ b/Documentation/ABI/testing/sysfs-gpio
@@ -19,6 +19,7 @@
 	/gpioN ... for each exported GPIO #N
 	    /value ... always readable, writes fail for input GPIOs
 	    /direction ... r/w as: in, out (default low); write: high, low
+	    /edge ... r/w as: none, falling, rising, both
 	/gpiochipN ... for each gpiochip; #N is its first GPIO
 	    /base ... (r/o) same as N
 	    /label ... (r/o) descriptive, not necessarily unique
diff --git a/Documentation/accounting/getdelays.c b/Documentation/accounting/getdelays.c
index aa73e72..6e25c26 100644
--- a/Documentation/accounting/getdelays.c
+++ b/Documentation/accounting/getdelays.c
@@ -116,7 +116,7 @@
 }
 
 
-int send_cmd(int sd, __u16 nlmsg_type, __u32 nlmsg_pid,
+static int send_cmd(int sd, __u16 nlmsg_type, __u32 nlmsg_pid,
 	     __u8 genl_cmd, __u16 nla_type,
 	     void *nla_data, int nla_len)
 {
@@ -160,7 +160,7 @@
  * Probe the controller in genetlink to find the family id
  * for the TASKSTATS family
  */
-int get_family_id(int sd)
+static int get_family_id(int sd)
 {
 	struct {
 		struct nlmsghdr n;
@@ -190,7 +190,7 @@
 	return id;
 }
 
-void print_delayacct(struct taskstats *t)
+static void print_delayacct(struct taskstats *t)
 {
 	printf("\n\nCPU   %15s%15s%15s%15s\n"
 	       "      %15llu%15llu%15llu%15llu\n"
@@ -216,7 +216,7 @@
 	       (unsigned long long)t->freepages_delay_total);
 }
 
-void task_context_switch_counts(struct taskstats *t)
+static void task_context_switch_counts(struct taskstats *t)
 {
 	printf("\n\nTask   %15s%15s\n"
 	       "       %15llu%15llu\n",
@@ -224,7 +224,7 @@
 	       (unsigned long long)t->nvcsw, (unsigned long long)t->nivcsw);
 }
 
-void print_cgroupstats(struct cgroupstats *c)
+static void print_cgroupstats(struct cgroupstats *c)
 {
 	printf("sleeping %llu, blocked %llu, running %llu, stopped %llu, "
 		"uninterruptible %llu\n", (unsigned long long)c->nr_sleeping,
@@ -235,7 +235,7 @@
 }
 
 
-void print_ioacct(struct taskstats *t)
+static void print_ioacct(struct taskstats *t)
 {
 	printf("%s: read=%llu, write=%llu, cancelled_write=%llu\n",
 		t->ac_comm,
diff --git a/Documentation/auxdisplay/cfag12864b-example.c b/Documentation/auxdisplay/cfag12864b-example.c
index 2caeea5..1d2c010 100644
--- a/Documentation/auxdisplay/cfag12864b-example.c
+++ b/Documentation/auxdisplay/cfag12864b-example.c
@@ -62,7 +62,7 @@
  * Unable to open: return = -1
  * Unable to mmap: return = -2
  */
-int cfag12864b_init(char *path)
+static int cfag12864b_init(char *path)
 {
 	cfag12864b_fd = open(path, O_RDWR);
 	if (cfag12864b_fd == -1)
@@ -81,7 +81,7 @@
 /*
  * exit a cfag12864b framebuffer device
  */
-void cfag12864b_exit(void)
+static void cfag12864b_exit(void)
 {
 	munmap(cfag12864b_mem, CFAG12864B_SIZE);
 	close(cfag12864b_fd);
@@ -90,7 +90,7 @@
 /*
  * set (x, y) pixel
  */
-void cfag12864b_set(unsigned char x, unsigned char y)
+static void cfag12864b_set(unsigned char x, unsigned char y)
 {
 	if (CFAG12864B_CHECK(x, y))
 		cfag12864b_buffer[CFAG12864B_ADDRESS(x, y)] |=
@@ -100,7 +100,7 @@
 /*
  * unset (x, y) pixel
  */
-void cfag12864b_unset(unsigned char x, unsigned char y)
+static void cfag12864b_unset(unsigned char x, unsigned char y)
 {
 	if (CFAG12864B_CHECK(x, y))
 		cfag12864b_buffer[CFAG12864B_ADDRESS(x, y)] &=
@@ -113,7 +113,7 @@
  * Pixel off: return = 0
  * Pixel on:  return = 1
  */
-unsigned char cfag12864b_isset(unsigned char x, unsigned char y)
+static unsigned char cfag12864b_isset(unsigned char x, unsigned char y)
 {
 	if (CFAG12864B_CHECK(x, y))
 		if (cfag12864b_buffer[CFAG12864B_ADDRESS(x, y)] &
@@ -126,7 +126,7 @@
 /*
  * not (x, y) pixel
  */
-void cfag12864b_not(unsigned char x, unsigned char y)
+static void cfag12864b_not(unsigned char x, unsigned char y)
 {
 	if (cfag12864b_isset(x, y))
 		cfag12864b_unset(x, y);
@@ -137,7 +137,7 @@
 /*
  * fill (set all pixels)
  */
-void cfag12864b_fill(void)
+static void cfag12864b_fill(void)
 {
 	unsigned short i;
 
@@ -148,7 +148,7 @@
 /*
  * clear (unset all pixels)
  */
-void cfag12864b_clear(void)
+static void cfag12864b_clear(void)
 {
 	unsigned short i;
 
@@ -162,7 +162,7 @@
  * Pixel off: src[i] = 0
  * Pixel on:  src[i] > 0
  */
-void cfag12864b_format(unsigned char * matrix)
+static void cfag12864b_format(unsigned char * matrix)
 {
 	unsigned char i, j, n;
 
@@ -182,7 +182,7 @@
 /*
  * blit buffer to lcd
  */
-void cfag12864b_blit(void)
+static void cfag12864b_blit(void)
 {
 	memcpy(cfag12864b_mem, cfag12864b_buffer, CFAG12864B_SIZE);
 }
@@ -198,7 +198,7 @@
 
 #define EXAMPLES	6
 
-void example(unsigned char n)
+static void example(unsigned char n)
 {
 	unsigned short i, j;
 	unsigned char matrix[CFAG12864B_WIDTH * CFAG12864B_HEIGHT];
diff --git a/Documentation/fb/ep93xx-fb.txt b/Documentation/fb/ep93xx-fb.txt
new file mode 100644
index 0000000..5af1bd9
--- /dev/null
+++ b/Documentation/fb/ep93xx-fb.txt
@@ -0,0 +1,135 @@
+================================
+Driver for EP93xx LCD controller
+================================
+
+The EP93xx LCD controller can drive both standard desktop monitors and
+embedded LCD displays. If you have a standard desktop monitor then you
+can use the standard Linux video mode database. In your board file:
+
+	static struct ep93xxfb_mach_info some_board_fb_info = {
+		.num_modes	= EP93XXFB_USE_MODEDB,
+		.bpp		= 16,
+	};
+
+If you have an embedded LCD display then you need to define a video
+mode for it as follows:
+
+	static struct fb_videomode some_board_video_modes[] = {
+		{
+			.name		= "some_lcd_name",
+			/* Pixel clock, porches, etc */
+		},
+	};
+
+Note that the pixel clock value is in pico-seconds. You can use the
+KHZ2PICOS macro to convert the pixel clock value. Most other values
+are in pixel clocks. See Documentation/fb/framebuffer.txt for further
+details.
+
+The ep93xxfb_mach_info structure for your board should look like the
+following:
+
+	static struct ep93xxfb_mach_info some_board_fb_info = {
+		.num_modes	= ARRAY_SIZE(some_board_video_modes),
+		.modes		= some_board_video_modes,
+		.default_mode	= &some_board_video_modes[0],
+		.bpp		= 16,
+	};
+
+The framebuffer device can be registered by adding the following to
+your board initialisation function:
+
+	ep93xx_register_fb(&some_board_fb_info);
+
+=====================
+Video Attribute Flags
+=====================
+
+The ep93xxfb_mach_info structure has a flags field which can be used
+to configure the controller. The video attributes flags are fully
+documented in section 7 of the EP93xx users' guide. The following
+flags are available:
+
+EP93XXFB_PCLK_FALLING		Clock data on the falling edge of the
+				pixel clock. The default is to clock
+				data on the rising edge.
+
+EP93XXFB_SYNC_BLANK_HIGH	Blank signal is active high. By
+				default the blank signal is active low.
+
+EP93XXFB_SYNC_HORIZ_HIGH	Horizontal sync is active high. By
+				default the horizontal sync is active low.
+
+EP93XXFB_SYNC_VERT_HIGH		Vertical sync is active high. By
+				default the vertical sync is active high.
+
+The physical address of the framebuffer can be controlled using the
+following flags:
+
+EP93XXFB_USE_SDCSN0		Use SDCSn[0] for the framebuffer. This
+				is the default setting.
+
+EP93XXFB_USE_SDCSN1		Use SDCSn[1] for the framebuffer.
+
+EP93XXFB_USE_SDCSN2		Use SDCSn[2] for the framebuffer.
+
+EP93XXFB_USE_SDCSN3		Use SDCSn[3] for the framebuffer.
+
+==================
+Platform callbacks
+==================
+
+The EP93xx framebuffer driver supports three optional platform
+callbacks: setup, teardown and blank. The setup and teardown functions
+are called when the framebuffer driver is installed and removed
+respectively. The blank function is called whenever the display is
+blanked or unblanked.
+
+The setup and teardown devices pass the platform_device structure as
+an argument. The fb_info and ep93xxfb_mach_info structures can be
+obtained as follows:
+
+	static int some_board_fb_setup(struct platform_device *pdev)
+	{
+		struct ep93xxfb_mach_info *mach_info = pdev->dev.platform_data;
+		struct fb_info *fb_info = platform_get_drvdata(pdev);
+
+		/* Board specific framebuffer setup */
+	}
+
+======================
+Setting the video mode
+======================
+
+The video mode is set using the following syntax:
+
+	video=XRESxYRES[-BPP][@REFRESH]
+
+If the EP93xx video driver is built-in then the video mode is set on
+the Linux kernel command line, for example:
+
+	video=ep93xx-fb:800x600-16@60
+
+If the EP93xx video driver is built as a module then the video mode is
+set when the module is installed:
+
+	modprobe ep93xx-fb video=320x240
+
+==============
+Screenpage bug
+==============
+
+At least on the EP9315 there is a silicon bug which causes bit 27 of
+the VIDSCRNPAGE (framebuffer physical offset) to be tied low. There is
+an unofficial errata for this bug at:
+	http://marc.info/?l=linux-arm-kernel&m=110061245502000&w=2
+
+By default the EP93xx framebuffer driver checks if the allocated physical
+address has bit 27 set. If it does, then the memory is freed and an
+error is returned. The check can be disabled by adding the following
+option when loading the driver:
+
+      ep93xx-fb.check_screenpage_bug=0
+
+In some cases it may be possible to reconfigure your SDRAM layout to
+avoid this bug. See section 13 of the EP93xx users' guide for details.
diff --git a/Documentation/fb/matroxfb.txt b/Documentation/fb/matroxfb.txt
index ad7a677..e5ce8a1 100644
--- a/Documentation/fb/matroxfb.txt
+++ b/Documentation/fb/matroxfb.txt
@@ -186,9 +186,7 @@
 dev:X    - bind driver to device X. Driver numbers device from 0 up to N,
            where device 0 is first `known' device found, 1 second and so on.
 	   lspci lists devices in this order.
-	   Default is `every' known device for driver with multihead support
-	   and first working device (usually dev:0) for driver without
-	   multihead support.
+	   Default is `every' known device.
 nohwcursor - disables hardware cursor (use software cursor instead).
 hwcursor - enables hardware cursor. It is default. If you are using
            non-accelerated mode (`noaccel' or `fbset -accel false'), software
diff --git a/Documentation/filesystems/ncpfs.txt b/Documentation/filesystems/ncpfs.txt
index f12c30c..5af164f 100644
--- a/Documentation/filesystems/ncpfs.txt
+++ b/Documentation/filesystems/ncpfs.txt
@@ -7,6 +7,6 @@
 will have it as well.
 
 Related products are linware and mars_nwe, which will give Linux partial
-NetWare server functionality.  Linware's home site is
-klokan.sh.cvut.cz/pub/linux/linware; mars_nwe can be found on
-ftp.gwdg.de/pub/linux/misc/ncpfs.
+NetWare server functionality.
+
+mars_nwe can be found on ftp.gwdg.de/pub/linux/misc/ncpfs.
diff --git a/Documentation/filesystems/proc.txt b/Documentation/filesystems/proc.txt
index 75988ba..b5aee78 100644
--- a/Documentation/filesystems/proc.txt
+++ b/Documentation/filesystems/proc.txt
@@ -176,6 +176,7 @@
   CapBnd: ffffffffffffffff
   voluntary_ctxt_switches:        0
   nonvoluntary_ctxt_switches:     1
+  Stack usage:    12 kB
 
 This shows you nearly the same information you would get if you viewed it with
 the ps  command.  In  fact,  ps  uses  the  proc  file  system  to  obtain its
@@ -229,6 +230,7 @@
  Mems_allowed_list           Same as previous, but in "list format"
  voluntary_ctxt_switches     number of voluntary context switches
  nonvoluntary_ctxt_switches  number of non voluntary context switches
+ Stack usage:                stack usage high water mark (round up to page size)
 ..............................................................................
 
 Table 1-3: Contents of the statm files (as of 2.6.8-rc3)
@@ -307,7 +309,7 @@
 08049000-0804a000 rw-p 00001000 03:00 8312       /opt/test
 0804a000-0806b000 rw-p 00000000 00:00 0          [heap]
 a7cb1000-a7cb2000 ---p 00000000 00:00 0
-a7cb2000-a7eb2000 rw-p 00000000 00:00 0
+a7cb2000-a7eb2000 rw-p 00000000 00:00 0          [threadstack:001ff4b4]
 a7eb2000-a7eb3000 ---p 00000000 00:00 0
 a7eb3000-a7ed5000 rw-p 00000000 00:00 0
 a7ed5000-a8008000 r-xp 00000000 03:00 4222       /lib/libc.so.6
@@ -343,6 +345,7 @@
  [stack]                  = the stack of the main process
  [vdso]                   = the "virtual dynamic shared object",
                             the kernel system call handler
+ [threadstack:xxxxxxxx]   = the stack of the thread, xxxxxxxx is the stack size
 
  or if empty, the mapping is anonymous.
 
diff --git a/Documentation/gpio.txt b/Documentation/gpio.txt
index e4b6985..fa4dc07 100644
--- a/Documentation/gpio.txt
+++ b/Documentation/gpio.txt
@@ -524,6 +524,13 @@
 		is configured as an output, this value may be written;
 		any nonzero value is treated as high.
 
+	"edge" ... reads as either "none", "rising", "falling", or
+		"both". Write these strings to select the signal edge(s)
+		that will make poll(2) on the "value" file return.
+
+		This file exists only if the pin can be configured as an
+		interrupt generating input pin.
+
 GPIO controllers have paths like /sys/class/gpio/chipchip42/ (for the
 controller implementing GPIOs starting at #42) and have the following
 read-only attributes:
@@ -555,6 +562,11 @@
 	/* reverse gpio_export() */
 	void gpio_unexport();
 
+	/* create a sysfs link to an exported GPIO node */
+	int gpio_export_link(struct device *dev, const char *name,
+		unsigned gpio)
+
+
 After a kernel driver requests a GPIO, it may only be made available in
 the sysfs interface by gpio_export().  The driver can control whether the
 signal direction may change.  This helps drivers prevent userspace code
@@ -563,3 +575,8 @@
 This explicit exporting can help with debugging (by making some kinds
 of experiments easier), or can provide an always-there interface that's
 suitable for documenting as part of a board support package.
+
+After the GPIO has been exported, gpio_export_link() allows creating
+symlinks from elsewhere in sysfs to the GPIO sysfs node.  Drivers can
+use this to provide the interface under their own device in sysfs with
+a descriptive name.
diff --git a/Documentation/ia64/aliasing-test.c b/Documentation/ia64/aliasing-test.c
index d23610f..3dfb76c 100644
--- a/Documentation/ia64/aliasing-test.c
+++ b/Documentation/ia64/aliasing-test.c
@@ -24,7 +24,7 @@
 
 int sum;
 
-int map_mem(char *path, off_t offset, size_t length, int touch)
+static int map_mem(char *path, off_t offset, size_t length, int touch)
 {
 	int fd, rc;
 	void *addr;
@@ -62,7 +62,7 @@
 	return 0;
 }
 
-int scan_tree(char *path, char *file, off_t offset, size_t length, int touch)
+static int scan_tree(char *path, char *file, off_t offset, size_t length, int touch)
 {
 	struct dirent **namelist;
 	char *name, *path2;
@@ -119,7 +119,7 @@
 
 char buf[1024];
 
-int read_rom(char *path)
+static int read_rom(char *path)
 {
 	int fd, rc;
 	size_t size = 0;
@@ -146,7 +146,7 @@
 	return size;
 }
 
-int scan_rom(char *path, char *file)
+static int scan_rom(char *path, char *file)
 {
 	struct dirent **namelist;
 	char *name, *path2;
diff --git a/Documentation/pcmcia/crc32hash.c b/Documentation/pcmcia/crc32hash.c
index 4210e5a..44f8bee 100644
--- a/Documentation/pcmcia/crc32hash.c
+++ b/Documentation/pcmcia/crc32hash.c
@@ -8,7 +8,7 @@
 #include <ctype.h>
 #include <stdlib.h>
 
-unsigned int crc32(unsigned char const *p, unsigned int len)
+static unsigned int crc32(unsigned char const *p, unsigned int len)
 {
 	int i;
 	unsigned int crc = 0;
diff --git a/Documentation/powerpc/dts-bindings/fsl/esdhc.txt b/Documentation/powerpc/dts-bindings/fsl/esdhc.txt
index 3ed3797..8a00407 100644
--- a/Documentation/powerpc/dts-bindings/fsl/esdhc.txt
+++ b/Documentation/powerpc/dts-bindings/fsl/esdhc.txt
@@ -10,6 +10,8 @@
   - interrupts : should contain eSDHC interrupt.
   - interrupt-parent : interrupt source phandle.
   - clock-frequency : specifies eSDHC base clock frequency.
+  - sdhci,wp-inverted : (optional) specifies that eSDHC controller
+    reports inverted write-protect state;
   - sdhci,1-bit-only : (optional) specifies that a controller can
     only handle 1-bit data transfers.
 
diff --git a/Documentation/rtc.txt b/Documentation/rtc.txt
index 8deffcd..9104c10 100644
--- a/Documentation/rtc.txt
+++ b/Documentation/rtc.txt
@@ -135,6 +135,30 @@
 the system clock from the discrete RTC, but use the integrated one for all
 other tasks, because of its greater functionality.
 
+SYSFS INTERFACE
+---------------
+
+The sysfs interface under /sys/class/rtc/rtcN provides access to various
+rtc attributes without requiring the use of ioctls. All dates and times
+are in the RTC's timezone, rather than in system time.
+
+date:  	   	 RTC-provided date
+hctosys:   	 1 if the RTC provided the system time at boot via the
+		 CONFIG_RTC_HCTOSYS kernel option, 0 otherwise
+max_user_freq:	 The maximum interrupt rate an unprivileged user may request
+		 from this RTC.
+name:		 The name of the RTC corresponding to this sysfs directory
+since_epoch:	 The number of seconds since the epoch according to the RTC
+time:		 RTC-provided time
+wakealarm:	 The time at which the clock will generate a system wakeup
+		 event. This is a one shot wakeup event, so must be reset
+		 after wake if a daily wakeup is required. Format is either
+		 seconds since the epoch or, if there's a leading +, seconds
+		 in the future.
+
+IOCTL INTERFACE
+---------------
+
 The ioctl() calls supported by /dev/rtc are also supported by the RTC class
 framework.  However, because the chips and systems are not standardized,
 some PC/AT functionality might not be provided.  And in the same way, some
@@ -185,6 +209,8 @@
 	hardware in the irq_set_freq function.  If it isn't, return -EINVAL.  If
 	you cannot actually change the frequency, do not define irq_set_freq.
 
+    *	RTC_PIE_ON, RTC_PIE_OFF: the irq_set_state function will be called.
+
 If all else fails, check out the rtc-test.c driver!
 
 
diff --git a/Documentation/spi/spi-summary b/Documentation/spi/spi-summary
index 4a02d25..deab51d 100644
--- a/Documentation/spi/spi-summary
+++ b/Documentation/spi/spi-summary
@@ -350,7 +350,7 @@
 		.resume		= CHIP_resume,
 	};
 
-The driver core will autmatically attempt to bind this driver to any SPI
+The driver core will automatically attempt to bind this driver to any SPI
 device whose board_info gave a modalias of "CHIP".  Your probe() code
 might look like this unless you're creating a device which is managing
 a bus (appearing under /sys/class/spi_master).
diff --git a/Documentation/spi/spidev_test.c b/Documentation/spi/spidev_test.c
index c1a5aad..10abd37 100644
--- a/Documentation/spi/spidev_test.c
+++ b/Documentation/spi/spidev_test.c
@@ -69,7 +69,7 @@
 	puts("");
 }
 
-void print_usage(const char *prog)
+static void print_usage(const char *prog)
 {
 	printf("Usage: %s [-DsbdlHOLC3]\n", prog);
 	puts("  -D --device   device to use (default /dev/spidev1.1)\n"
@@ -85,7 +85,7 @@
 	exit(1);
 }
 
-void parse_opts(int argc, char *argv[])
+static void parse_opts(int argc, char *argv[])
 {
 	while (1) {
 		static const struct option lopts[] = {
diff --git a/Documentation/sysctl/kernel.txt b/Documentation/sysctl/kernel.txt
index 3e5b63e..b3d8b49 100644
--- a/Documentation/sysctl/kernel.txt
+++ b/Documentation/sysctl/kernel.txt
@@ -313,6 +313,14 @@
 
 ==============================================================
 
+printk_delay:
+
+Delay each printk message in printk_delay milliseconds
+
+Value from 0 - 10000 is allowed.
+
+==============================================================
+
 randomize-va-space:
 
 This option can be used to select the type of process address
diff --git a/Documentation/video4linux/v4lgrab.c b/Documentation/video4linux/v4lgrab.c
index 05769cf..c8ded17 100644
--- a/Documentation/video4linux/v4lgrab.c
+++ b/Documentation/video4linux/v4lgrab.c
@@ -89,7 +89,7 @@
 	}                                                               \
 }
 
-int get_brightness_adj(unsigned char *image, long size, int *brightness) {
+static int get_brightness_adj(unsigned char *image, long size, int *brightness) {
   long i, tot = 0;
   for (i=0;i<size*3;i++)
     tot += image[i];
diff --git a/Documentation/vm/page-types.c b/Documentation/vm/page-types.c
index 0833f44..3eda8ea 100644
--- a/Documentation/vm/page-types.c
+++ b/Documentation/vm/page-types.c
@@ -158,12 +158,12 @@
 	type __min2 = (y);			\
 	__min1 < __min2 ? __min1 : __min2; })
 
-unsigned long pages2mb(unsigned long pages)
+static unsigned long pages2mb(unsigned long pages)
 {
 	return (pages * page_size) >> 20;
 }
 
-void fatal(const char *x, ...)
+static void fatal(const char *x, ...)
 {
 	va_list ap;
 
@@ -178,7 +178,7 @@
  * page flag names
  */
 
-char *page_flag_name(uint64_t flags)
+static char *page_flag_name(uint64_t flags)
 {
 	static char buf[65];
 	int present;
@@ -197,7 +197,7 @@
 	return buf;
 }
 
-char *page_flag_longname(uint64_t flags)
+static char *page_flag_longname(uint64_t flags)
 {
 	static char buf[1024];
 	int i, n;
@@ -221,7 +221,7 @@
  * page list and summary
  */
 
-void show_page_range(unsigned long offset, uint64_t flags)
+static void show_page_range(unsigned long offset, uint64_t flags)
 {
 	static uint64_t      flags0;
 	static unsigned long index;
@@ -241,12 +241,12 @@
 	count  = 1;
 }
 
-void show_page(unsigned long offset, uint64_t flags)
+static void show_page(unsigned long offset, uint64_t flags)
 {
 	printf("%lu\t%s\n", offset, page_flag_name(flags));
 }
 
-void show_summary(void)
+static void show_summary(void)
 {
 	int i;
 
@@ -272,7 +272,7 @@
  * page flag filters
  */
 
-int bit_mask_ok(uint64_t flags)
+static int bit_mask_ok(uint64_t flags)
 {
 	int i;
 
@@ -289,7 +289,7 @@
 	return 1;
 }
 
-uint64_t expand_overloaded_flags(uint64_t flags)
+static uint64_t expand_overloaded_flags(uint64_t flags)
 {
 	/* SLOB/SLUB overload several page flags */
 	if (flags & BIT(SLAB)) {
@@ -308,7 +308,7 @@
 	return flags;
 }
 
-uint64_t well_known_flags(uint64_t flags)
+static uint64_t well_known_flags(uint64_t flags)
 {
 	/* hide flags intended only for kernel hacker */
 	flags &= ~KPF_HACKERS_BITS;
@@ -325,7 +325,7 @@
  * page frame walker
  */
 
-int hash_slot(uint64_t flags)
+static int hash_slot(uint64_t flags)
 {
 	int k = HASH_KEY(flags);
 	int i;
@@ -352,7 +352,7 @@
 	exit(EXIT_FAILURE);
 }
 
-void add_page(unsigned long offset, uint64_t flags)
+static void add_page(unsigned long offset, uint64_t flags)
 {
 	flags = expand_overloaded_flags(flags);
 
@@ -371,7 +371,7 @@
 	total_pages++;
 }
 
-void walk_pfn(unsigned long index, unsigned long count)
+static void walk_pfn(unsigned long index, unsigned long count)
 {
 	unsigned long batch;
 	unsigned long n;
@@ -404,7 +404,7 @@
 	}
 }
 
-void walk_addr_ranges(void)
+static void walk_addr_ranges(void)
 {
 	int i;
 
@@ -428,7 +428,7 @@
  * user interface
  */
 
-const char *page_flag_type(uint64_t flag)
+static const char *page_flag_type(uint64_t flag)
 {
 	if (flag & KPF_HACKERS_BITS)
 		return "(r)";
@@ -437,7 +437,7 @@
 	return "   ";
 }
 
-void usage(void)
+static void usage(void)
 {
 	int i, j;
 
@@ -482,7 +482,7 @@
 		"(r) raw mode bits  (o) overloaded bits\n");
 }
 
-unsigned long long parse_number(const char *str)
+static unsigned long long parse_number(const char *str)
 {
 	unsigned long long n;
 
@@ -494,16 +494,16 @@
 	return n;
 }
 
-void parse_pid(const char *str)
+static void parse_pid(const char *str)
 {
 	opt_pid = parse_number(str);
 }
 
-void parse_file(const char *name)
+static void parse_file(const char *name)
 {
 }
 
-void add_addr_range(unsigned long offset, unsigned long size)
+static void add_addr_range(unsigned long offset, unsigned long size)
 {
 	if (nr_addr_ranges >= MAX_ADDR_RANGES)
 		fatal("too much addr ranges\n");
@@ -513,7 +513,7 @@
 	nr_addr_ranges++;
 }
 
-void parse_addr_range(const char *optarg)
+static void parse_addr_range(const char *optarg)
 {
 	unsigned long offset;
 	unsigned long size;
@@ -547,7 +547,7 @@
 	add_addr_range(offset, size);
 }
 
-void add_bits_filter(uint64_t mask, uint64_t bits)
+static void add_bits_filter(uint64_t mask, uint64_t bits)
 {
 	if (nr_bit_filters >= MAX_BIT_FILTERS)
 		fatal("too much bit filters\n");
@@ -557,7 +557,7 @@
 	nr_bit_filters++;
 }
 
-uint64_t parse_flag_name(const char *str, int len)
+static uint64_t parse_flag_name(const char *str, int len)
 {
 	int i;
 
@@ -577,7 +577,7 @@
 	return parse_number(str);
 }
 
-uint64_t parse_flag_names(const char *str, int all)
+static uint64_t parse_flag_names(const char *str, int all)
 {
 	const char *p    = str;
 	uint64_t   flags = 0;
@@ -596,7 +596,7 @@
 	return flags;
 }
 
-void parse_bits_mask(const char *optarg)
+static void parse_bits_mask(const char *optarg)
 {
 	uint64_t mask;
 	uint64_t bits;
@@ -621,7 +621,7 @@
 }
 
 
-struct option opts[] = {
+static struct option opts[] = {
 	{ "raw"       , 0, NULL, 'r' },
 	{ "pid"       , 1, NULL, 'p' },
 	{ "file"      , 1, NULL, 'f' },
diff --git a/Documentation/vm/slabinfo.c b/Documentation/vm/slabinfo.c
index df32276..92e729f 100644
--- a/Documentation/vm/slabinfo.c
+++ b/Documentation/vm/slabinfo.c
@@ -87,7 +87,7 @@
 
 regex_t pattern;
 
-void fatal(const char *x, ...)
+static void fatal(const char *x, ...)
 {
 	va_list ap;
 
@@ -97,7 +97,7 @@
 	exit(EXIT_FAILURE);
 }
 
-void usage(void)
+static void usage(void)
 {
 	printf("slabinfo 5/7/2007. (c) 2007 sgi.\n\n"
 		"slabinfo [-ahnpvtsz] [-d debugopts] [slab-regexp]\n"
@@ -131,7 +131,7 @@
 	);
 }
 
-unsigned long read_obj(const char *name)
+static unsigned long read_obj(const char *name)
 {
 	FILE *f = fopen(name, "r");
 
@@ -151,7 +151,7 @@
 /*
  * Get the contents of an attribute
  */
-unsigned long get_obj(const char *name)
+static unsigned long get_obj(const char *name)
 {
 	if (!read_obj(name))
 		return 0;
@@ -159,7 +159,7 @@
 	return atol(buffer);
 }
 
-unsigned long get_obj_and_str(const char *name, char **x)
+static unsigned long get_obj_and_str(const char *name, char **x)
 {
 	unsigned long result = 0;
 	char *p;
@@ -178,7 +178,7 @@
 	return result;
 }
 
-void set_obj(struct slabinfo *s, const char *name, int n)
+static void set_obj(struct slabinfo *s, const char *name, int n)
 {
 	char x[100];
 	FILE *f;
@@ -192,7 +192,7 @@
 	fclose(f);
 }
 
-unsigned long read_slab_obj(struct slabinfo *s, const char *name)
+static unsigned long read_slab_obj(struct slabinfo *s, const char *name)
 {
 	char x[100];
 	FILE *f;
@@ -215,7 +215,7 @@
 /*
  * Put a size string together
  */
-int store_size(char *buffer, unsigned long value)
+static int store_size(char *buffer, unsigned long value)
 {
 	unsigned long divisor = 1;
 	char trailer = 0;
@@ -247,7 +247,7 @@
 	return n;
 }
 
-void decode_numa_list(int *numa, char *t)
+static void decode_numa_list(int *numa, char *t)
 {
 	int node;
 	int nr;
@@ -272,7 +272,7 @@
 	}
 }
 
-void slab_validate(struct slabinfo *s)
+static void slab_validate(struct slabinfo *s)
 {
 	if (strcmp(s->name, "*") == 0)
 		return;
@@ -280,7 +280,7 @@
 	set_obj(s, "validate", 1);
 }
 
-void slab_shrink(struct slabinfo *s)
+static void slab_shrink(struct slabinfo *s)
 {
 	if (strcmp(s->name, "*") == 0)
 		return;
@@ -290,7 +290,7 @@
 
 int line = 0;
 
-void first_line(void)
+static void first_line(void)
 {
 	if (show_activity)
 		printf("Name                   Objects      Alloc       Free   %%Fast Fallb O\n");
@@ -302,7 +302,7 @@
 /*
  * Find the shortest alias of a slab
  */
-struct aliasinfo *find_one_alias(struct slabinfo *find)
+static struct aliasinfo *find_one_alias(struct slabinfo *find)
 {
 	struct aliasinfo *a;
 	struct aliasinfo *best = NULL;
@@ -318,18 +318,18 @@
 	return best;
 }
 
-unsigned long slab_size(struct slabinfo *s)
+static unsigned long slab_size(struct slabinfo *s)
 {
 	return 	s->slabs * (page_size << s->order);
 }
 
-unsigned long slab_activity(struct slabinfo *s)
+static unsigned long slab_activity(struct slabinfo *s)
 {
 	return 	s->alloc_fastpath + s->free_fastpath +
 		s->alloc_slowpath + s->free_slowpath;
 }
 
-void slab_numa(struct slabinfo *s, int mode)
+static void slab_numa(struct slabinfo *s, int mode)
 {
 	int node;
 
@@ -374,7 +374,7 @@
 	line++;
 }
 
-void show_tracking(struct slabinfo *s)
+static void show_tracking(struct slabinfo *s)
 {
 	printf("\n%s: Kernel object allocation\n", s->name);
 	printf("-----------------------------------------------------------------------\n");
@@ -392,7 +392,7 @@
 
 }
 
-void ops(struct slabinfo *s)
+static void ops(struct slabinfo *s)
 {
 	if (strcmp(s->name, "*") == 0)
 		return;
@@ -405,14 +405,14 @@
 		printf("\n%s has no kmem_cache operations\n", s->name);
 }
 
-const char *onoff(int x)
+static const char *onoff(int x)
 {
 	if (x)
 		return "On ";
 	return "Off";
 }
 
-void slab_stats(struct slabinfo *s)
+static void slab_stats(struct slabinfo *s)
 {
 	unsigned long total_alloc;
 	unsigned long total_free;
@@ -477,7 +477,7 @@
 			s->deactivate_to_tail, (s->deactivate_to_tail * 100) / total);
 }
 
-void report(struct slabinfo *s)
+static void report(struct slabinfo *s)
 {
 	if (strcmp(s->name, "*") == 0)
 		return;
@@ -518,7 +518,7 @@
 	slab_stats(s);
 }
 
-void slabcache(struct slabinfo *s)
+static void slabcache(struct slabinfo *s)
 {
 	char size_str[20];
 	char dist_str[40];
@@ -593,7 +593,7 @@
 /*
  * Analyze debug options. Return false if something is amiss.
  */
-int debug_opt_scan(char *opt)
+static int debug_opt_scan(char *opt)
 {
 	if (!opt || !opt[0] || strcmp(opt, "-") == 0)
 		return 1;
@@ -642,7 +642,7 @@
 	return 1;
 }
 
-int slab_empty(struct slabinfo *s)
+static int slab_empty(struct slabinfo *s)
 {
 	if (s->objects > 0)
 		return 0;
@@ -657,7 +657,7 @@
 	return 1;
 }
 
-void slab_debug(struct slabinfo *s)
+static void slab_debug(struct slabinfo *s)
 {
 	if (strcmp(s->name, "*") == 0)
 		return;
@@ -717,7 +717,7 @@
 		set_obj(s, "trace", 1);
 }
 
-void totals(void)
+static void totals(void)
 {
 	struct slabinfo *s;
 
@@ -976,7 +976,7 @@
 			b1,	b2,	b3);
 }
 
-void sort_slabs(void)
+static void sort_slabs(void)
 {
 	struct slabinfo *s1,*s2;
 
@@ -1005,7 +1005,7 @@
 	}
 }
 
-void sort_aliases(void)
+static void sort_aliases(void)
 {
 	struct aliasinfo *a1,*a2;
 
@@ -1030,7 +1030,7 @@
 	}
 }
 
-void link_slabs(void)
+static void link_slabs(void)
 {
 	struct aliasinfo *a;
 	struct slabinfo *s;
@@ -1048,7 +1048,7 @@
 	}
 }
 
-void alias(void)
+static void alias(void)
 {
 	struct aliasinfo *a;
 	char *active = NULL;
@@ -1079,7 +1079,7 @@
 }
 
 
-void rename_slabs(void)
+static void rename_slabs(void)
 {
 	struct slabinfo *s;
 	struct aliasinfo *a;
@@ -1102,12 +1102,12 @@
 	}
 }
 
-int slab_mismatch(char *slab)
+static int slab_mismatch(char *slab)
 {
 	return regexec(&pattern, slab, 0, NULL, 0);
 }
 
-void read_slab_dir(void)
+static void read_slab_dir(void)
 {
 	DIR *dir;
 	struct dirent *de;
@@ -1209,7 +1209,7 @@
 		fatal("Too many aliases\n");
 }
 
-void output_slabs(void)
+static void output_slabs(void)
 {
 	struct slabinfo *slab;
 
diff --git a/Documentation/watchdog/src/watchdog-test.c b/Documentation/watchdog/src/watchdog-test.c
index 65f6c19..a750532 100644
--- a/Documentation/watchdog/src/watchdog-test.c
+++ b/Documentation/watchdog/src/watchdog-test.c
@@ -18,7 +18,7 @@
  * the PC Watchdog card to reset its internal timer so it doesn't trigger
  * a computer reset.
  */
-void keep_alive(void)
+static void keep_alive(void)
 {
     int dummy;
 
diff --git a/MAINTAINERS b/MAINTAINERS
index 4467da2..ed6cd99 100644
--- a/MAINTAINERS
+++ b/MAINTAINERS
@@ -3527,7 +3527,6 @@
 
 NCP FILESYSTEM
 M:	Petr Vandrovec <vandrove@vc.cvut.cz>
-L:	linware@sh.cvut.cz
 S:	Maintained
 F:	fs/ncpfs/
 
@@ -3769,7 +3768,13 @@
 M:	Jarkko Lavinen <jarkko.lavinen@nokia.com>
 L:	linux-omap@vger.kernel.org
 S:	Maintained
-F:	drivers/mmc/host/*omap*
+F:	drivers/mmc/host/omap.c
+
+OMAP HS MMC SUPPORT
+M:	Madhusudhan Chikkature <madhu.cr@ti.com>
+L:	linux-omap@vger.kernel.org
+S:	Maintained
+F:	drivers/mmc/host/omap_hsmmc.c
 
 OMAP RANDOM NUMBER GENERATOR SUPPORT
 M:	Deepak Saxena <dsaxena@plexity.net>
diff --git a/arch/arm/configs/n770_defconfig b/arch/arm/configs/n770_defconfig
index 672f6db..a1657b7 100644
--- a/arch/arm/configs/n770_defconfig
+++ b/arch/arm/configs/n770_defconfig
@@ -875,7 +875,7 @@
 CONFIG_FB_OMAP_LCDC_HWA742=y
 # CONFIG_FB_OMAP_LCDC_BLIZZARD is not set
 CONFIG_FB_OMAP_MANUAL_UPDATE=y
-# CONFIG_FB_OMAP_LCD_MIPID is not set
+CONFIG_FB_OMAP_LCD_MIPID=y
 # CONFIG_FB_OMAP_BOOTLOADER_INIT is not set
 CONFIG_FB_OMAP_CONSISTENT_DMA_SIZE=2
 # CONFIG_FB_OMAP_DMA_TUNE is not set
diff --git a/arch/arm/configs/omap3_beagle_defconfig b/arch/arm/configs/omap3_beagle_defconfig
index 51c0fa8..357d402 100644
--- a/arch/arm/configs/omap3_beagle_defconfig
+++ b/arch/arm/configs/omap3_beagle_defconfig
@@ -778,7 +778,33 @@
 #
 # CONFIG_VGASTATE is not set
 # CONFIG_VIDEO_OUTPUT_CONTROL is not set
-# CONFIG_FB is not set
+CONFIG_FB=y
+# CONFIG_FIRMWARE_EDID is not set
+# CONFIG_FB_DDC is not set
+CONFIG_FB_CFB_FILLRECT=y
+CONFIG_FB_CFB_COPYAREA=y
+CONFIG_FB_CFB_IMAGEBLIT=y
+# CONFIG_FB_CFB_REV_PIXELS_IN_BYTE is not set
+# CONFIG_FB_SYS_FILLRECT is not set
+# CONFIG_FB_SYS_COPYAREA is not set
+# CONFIG_FB_SYS_IMAGEBLIT is not set
+# CONFIG_FB_FOREIGN_ENDIAN is not set
+# CONFIG_FB_SYS_FOPS is not set
+# CONFIG_FB_SVGALIB is not set
+# CONFIG_FB_MACMODES is not set
+# CONFIG_FB_BACKLIGHT is not set
+# CONFIG_FB_MODE_HELPERS is not set
+# CONFIG_FB_TILEBLITTING is not set
+
+#
+# Frame buffer hardware drivers
+#
+# CONFIG_FB_S1D13XXX is not set
+# CONFIG_FB_VIRTUAL is not set
+CONFIG_FB_OMAP=y
+# CONFIG_FB_OMAP_LCDC_EXTERNAL is not set
+# CONFIG_FB_OMAP_BOOTLOADER_INIT is not set
+CONFIG_FB_OMAP_CONSISTENT_DMA_SIZE=2
 # CONFIG_BACKLIGHT_LCD_SUPPORT is not set
 
 #
@@ -791,6 +817,25 @@
 #
 # CONFIG_VGA_CONSOLE is not set
 CONFIG_DUMMY_CONSOLE=y
+CONFIG_FRAMEBUFFER_CONSOLE=y
+# CONFIG_FRAMEBUFFER_CONSOLE_DETECT_PRIMARY is not set
+CONFIG_FRAMEBUFFER_CONSOLE_ROTATION=y
+CONFIG_FONTS=y
+CONFIG_FONT_8x8=y
+CONFIG_FONT_8x16=y
+# CONFIG_FONT_6x11 is not set
+# CONFIG_FONT_7x14 is not set
+# CONFIG_FONT_PEARL_8x8 is not set
+# CONFIG_FONT_ACORN_8x8 is not set
+# CONFIG_FONT_MINI_4x6 is not set
+# CONFIG_FONT_SUN8x16 is not set
+# CONFIG_FONT_SUN12x22 is not set
+# CONFIG_FONT_10x18 is not set
+# CONFIG_LOGO is not set
+
+#
+# Sound
+#
 # CONFIG_SOUND is not set
 # CONFIG_HID_SUPPORT is not set
 CONFIG_USB_SUPPORT=y
diff --git a/arch/arm/configs/omap_3430sdp_defconfig b/arch/arm/configs/omap_3430sdp_defconfig
index 9a510ea..8a4a7e2 100644
--- a/arch/arm/configs/omap_3430sdp_defconfig
+++ b/arch/arm/configs/omap_3430sdp_defconfig
@@ -1313,8 +1313,33 @@
 # Graphics support
 #
 # CONFIG_VGASTATE is not set
-# CONFIG_VIDEO_OUTPUT_CONTROL is not set
-# CONFIG_FB is not set
+CONFIG_FB=y
+# CONFIG_FIRMWARE_EDID is not set
+# CONFIG_FB_DDC is not set
+CONFIG_FB_CFB_FILLRECT=y
+CONFIG_FB_CFB_COPYAREA=y
+CONFIG_FB_CFB_IMAGEBLIT=y
+# CONFIG_FB_CFB_REV_PIXELS_IN_BYTE is not set
+# CONFIG_FB_SYS_FILLRECT is not set
+# CONFIG_FB_SYS_COPYAREA is not set
+# CONFIG_FB_SYS_IMAGEBLIT is not set
+# CONFIG_FB_FOREIGN_ENDIAN is not set
+# CONFIG_FB_SYS_FOPS is not set
+# CONFIG_FB_SVGALIB is not set
+# CONFIG_FB_MACMODES is not set
+# CONFIG_FB_BACKLIGHT is not set
+# CONFIG_FB_MODE_HELPERS is not set
+# CONFIG_FB_TILEBLITTING is not set
+
+#
+# Frame buffer hardware drivers
+#
+# CONFIG_FB_S1D13XXX is not set
+# CONFIG_FB_VIRTUAL is not set
+CONFIG_FB_OMAP=y
+# CONFIG_FB_OMAP_LCDC_EXTERNAL is not set
+# CONFIG_FB_OMAP_BOOTLOADER_INIT is not set
+CONFIG_FB_OMAP_CONSISTENT_DMA_SIZE=2
 # CONFIG_BACKLIGHT_LCD_SUPPORT is not set
 
 #
@@ -1331,6 +1356,16 @@
 #
 # CONFIG_VGA_CONSOLE is not set
 CONFIG_DUMMY_CONSOLE=y
+CONFIG_FRAMEBUFFER_CONSOLE=y
+# CONFIG_FRAMEBUFFER_CONSOLE_DETECT_PRIMARY is not set
+# CONFIG_FRAMEBUFFER_CONSOLE_ROTATION is not set
+# CONFIG_FONTS is not set
+CONFIG_FONT_8x8=y
+CONFIG_FONT_8x16=y
+CONFIG_LOGO=y
+CONFIG_LOGO_LINUX_MONO=y
+CONFIG_LOGO_LINUX_VGA16=y
+CONFIG_LOGO_LINUX_CLUT224=y
 CONFIG_SOUND=y
 CONFIG_SOUND_OSS_CORE=y
 CONFIG_SND=y
diff --git a/arch/arm/configs/omap_ldp_defconfig b/arch/arm/configs/omap_ldp_defconfig
index 679a4a3..b9c4891 100644
--- a/arch/arm/configs/omap_ldp_defconfig
+++ b/arch/arm/configs/omap_ldp_defconfig
@@ -690,6 +690,7 @@
 # CONFIG_GPIO_MAX732X is not set
 # CONFIG_GPIO_PCA953X is not set
 # CONFIG_GPIO_PCF857X is not set
+CONFIG_GPIO_TWL4030=y
 
 #
 # PCI GPIO expanders:
@@ -742,6 +743,7 @@
 # CONFIG_MFD_SM501 is not set
 # CONFIG_HTC_EGPIO is not set
 # CONFIG_HTC_PASIC3 is not set
+CONFIG_TWL4030_CORE=y
 # CONFIG_MFD_TMIO is not set
 # CONFIG_MFD_T7L66XB is not set
 # CONFIG_MFD_TC6387XB is not set
@@ -767,8 +769,46 @@
 #
 # CONFIG_VGASTATE is not set
 CONFIG_VIDEO_OUTPUT_CONTROL=m
-# CONFIG_FB is not set
-# CONFIG_BACKLIGHT_LCD_SUPPORT is not set
+CONFIG_FB=y
+CONFIG_FIRMWARE_EDID=y
+# CONFIG_FB_DDC is not set
+# CONFIG_FB_BOOT_VESA_SUPPORT is not set
+CONFIG_FB_CFB_FILLRECT=y
+CONFIG_FB_CFB_COPYAREA=y
+CONFIG_FB_CFB_IMAGEBLIT=y
+# CONFIG_FB_CFB_REV_PIXELS_IN_BYTE is not set
+# CONFIG_FB_SYS_FILLRECT is not set
+# CONFIG_FB_SYS_COPYAREA is not set
+# CONFIG_FB_SYS_IMAGEBLIT is not set
+# CONFIG_FB_FOREIGN_ENDIAN is not set
+# CONFIG_FB_SYS_FOPS is not set
+# CONFIG_FB_SVGALIB is not set
+# CONFIG_FB_MACMODES is not set
+# CONFIG_FB_BACKLIGHT is not set
+CONFIG_FB_MODE_HELPERS=y
+CONFIG_FB_TILEBLITTING=y
+
+#
+# Frame buffer hardware drivers
+#
+# CONFIG_FB_S1D13XXX is not set
+# CONFIG_FB_VIRTUAL is not set
+# CONFIG_FB_METRONOME is not set
+CONFIG_FB_OMAP=y
+CONFIG_FB_OMAP_LCD_VGA=y
+# CONFIG_FB_OMAP_LCDC_EXTERNAL is not set
+# CONFIG_FB_OMAP_BOOTLOADER_INIT is not set
+CONFIG_FB_OMAP_CONSISTENT_DMA_SIZE=4
+CONFIG_BACKLIGHT_LCD_SUPPORT=y
+CONFIG_LCD_CLASS_DEVICE=y
+# CONFIG_LCD_LTV350QV is not set
+# CONFIG_LCD_ILI9320 is not set
+# CONFIG_LCD_TDO24M is not set
+# CONFIG_LCD_VGG2432A4 is not set
+CONFIG_LCD_PLATFORM=y
+CONFIG_BACKLIGHT_CLASS_DEVICE=y
+# CONFIG_BACKLIGHT_CORGI is not set
+# CONFIG_BACKLIGHT_GENERIC is not set
 
 #
 # Display device support
@@ -780,6 +820,16 @@
 #
 # CONFIG_VGA_CONSOLE is not set
 CONFIG_DUMMY_CONSOLE=y
+CONFIG_FRAMEBUFFER_CONSOLE=y
+# CONFIG_FRAMEBUFFER_CONSOLE_DETECT_PRIMARY is not set
+# CONFIG_FRAMEBUFFER_CONSOLE_ROTATION is not set
+# CONFIG_FONTS is not set
+CONFIG_FONT_8x8=y
+CONFIG_FONT_8x16=y
+CONFIG_LOGO=y
+CONFIG_LOGO_LINUX_MONO=y
+CONFIG_LOGO_LINUX_VGA16=y
+CONFIG_LOGO_LINUX_CLUT224=y
 CONFIG_SOUND=y
 CONFIG_SND=y
 # CONFIG_SND_SEQUENCER is not set
diff --git a/arch/arm/mach-at91/Kconfig b/arch/arm/mach-at91/Kconfig
index a24d824..e35d54d 100644
--- a/arch/arm/mach-at91/Kconfig
+++ b/arch/arm/mach-at91/Kconfig
@@ -289,6 +289,13 @@
 	help
 	  Select this if you are using the Adeneo Neocore 926 board.
 
+config MACH_AT91SAM9G20EK_2MMC
+	bool "Atmel AT91SAM9G20-EK Evaluation Kit modified for 2 MMC Slots"
+	depends on ARCH_AT91SAM9G20
+	help
+	  Select this if you are using an Atmel AT91SAM9G20-EK Evaluation Kit
+	  Rev A or B modified for 2 MMC Slots.
+
 endif
 
 # ----------------------------------------------------------
diff --git a/arch/arm/mach-at91/Makefile b/arch/arm/mach-at91/Makefile
index a6ed015..ada440a 100644
--- a/arch/arm/mach-at91/Makefile
+++ b/arch/arm/mach-at91/Makefile
@@ -59,6 +59,7 @@
 
 # AT91SAM9G20 board-specific support
 obj-$(CONFIG_MACH_AT91SAM9G20EK) += board-sam9g20ek.o
+obj-$(CONFIG_MACH_AT91SAM9G20EK_2MMC) += board-sam9g20ek-2slot-mmc.o
 obj-$(CONFIG_MACH_CPU9G20)	+= board-cpu9krea.o
 
 # AT91SAM9G45 board-specific support
diff --git a/arch/arm/mach-at91/at91sam9260_devices.c b/arch/arm/mach-at91/at91sam9260_devices.c
index ee4ea0e7..07eb7b0 100644
--- a/arch/arm/mach-at91/at91sam9260_devices.c
+++ b/arch/arm/mach-at91/at91sam9260_devices.c
@@ -278,6 +278,102 @@
 void __init at91_add_device_mmc(short mmc_id, struct at91_mmc_data *data) {}
 #endif
 
+/* --------------------------------------------------------------------
+ *  MMC / SD Slot for Atmel MCI Driver
+ * -------------------------------------------------------------------- */
+
+#if defined(CONFIG_MMC_ATMELMCI) || defined(CONFIG_MMC_ATMELMCI_MODULE)
+static u64 mmc_dmamask = DMA_BIT_MASK(32);
+static struct mci_platform_data mmc_data;
+
+static struct resource mmc_resources[] = {
+	[0] = {
+		.start	= AT91SAM9260_BASE_MCI,
+		.end	= AT91SAM9260_BASE_MCI + SZ_16K - 1,
+		.flags	= IORESOURCE_MEM,
+	},
+	[1] = {
+		.start	= AT91SAM9260_ID_MCI,
+		.end	= AT91SAM9260_ID_MCI,
+		.flags	= IORESOURCE_IRQ,
+	},
+};
+
+static struct platform_device at91sam9260_mmc_device = {
+	.name		= "atmel_mci",
+	.id		= -1,
+	.dev		= {
+				.dma_mask		= &mmc_dmamask,
+				.coherent_dma_mask	= DMA_BIT_MASK(32),
+				.platform_data		= &mmc_data,
+	},
+	.resource	= mmc_resources,
+	.num_resources	= ARRAY_SIZE(mmc_resources),
+};
+
+void __init at91_add_device_mci(short mmc_id, struct mci_platform_data *data)
+{
+	unsigned int i;
+	unsigned int slot_count = 0;
+
+	if (!data)
+		return;
+
+	for (i = 0; i < ATMEL_MCI_MAX_NR_SLOTS; i++) {
+		if (data->slot[i].bus_width) {
+			/* input/irq */
+			if (data->slot[i].detect_pin) {
+				at91_set_gpio_input(data->slot[i].detect_pin, 1);
+				at91_set_deglitch(data->slot[i].detect_pin, 1);
+			}
+			if (data->slot[i].wp_pin)
+				at91_set_gpio_input(data->slot[i].wp_pin, 1);
+
+			switch (i) {
+			case 0:
+				/* CMD */
+				at91_set_A_periph(AT91_PIN_PA7, 1);
+				/* DAT0, maybe DAT1..DAT3 */
+				at91_set_A_periph(AT91_PIN_PA6, 1);
+				if (data->slot[i].bus_width == 4) {
+					at91_set_A_periph(AT91_PIN_PA9, 1);
+					at91_set_A_periph(AT91_PIN_PA10, 1);
+					at91_set_A_periph(AT91_PIN_PA11, 1);
+				}
+				slot_count++;
+				break;
+			case 1:
+				/* CMD */
+				at91_set_B_periph(AT91_PIN_PA1, 1);
+				/* DAT0, maybe DAT1..DAT3 */
+				at91_set_B_periph(AT91_PIN_PA0, 1);
+				if (data->slot[i].bus_width == 4) {
+					at91_set_B_periph(AT91_PIN_PA5, 1);
+					at91_set_B_periph(AT91_PIN_PA4, 1);
+					at91_set_B_periph(AT91_PIN_PA3, 1);
+				}
+				slot_count++;
+				break;
+			default:
+				printk(KERN_ERR
+					"AT91: SD/MMC slot %d not available\n", i);
+				break;
+			}
+		}
+	}
+
+	if (slot_count) {
+		/* CLK */
+		at91_set_A_periph(AT91_PIN_PA8, 0);
+
+		mmc_data = *data;
+		platform_device_register(&at91sam9260_mmc_device);
+	}
+}
+#else
+void __init at91_add_device_mci(short mmc_id, struct mci_platform_data *data) {}
+#endif
+
 
 /* --------------------------------------------------------------------
  *  NAND / SmartMedia
diff --git a/arch/arm/mach-at91/board-sam9g20ek-2slot-mmc.c b/arch/arm/mach-at91/board-sam9g20ek-2slot-mmc.c
new file mode 100644
index 0000000..a28e53f
--- /dev/null
+++ b/arch/arm/mach-at91/board-sam9g20ek-2slot-mmc.c
@@ -0,0 +1,277 @@
+/*
+ *  Copyright (C) 2005 SAN People
+ *  Copyright (C) 2008 Atmel
+ *  Copyright (C) 2009 Rob Emanuele
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License as published by
+ * the Free Software Foundation; either version 2 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA  02111-1307  USA
+ */
+
+#include <linux/types.h>
+#include <linux/init.h>
+#include <linux/mm.h>
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/spi/spi.h>
+#include <linux/spi/at73c213.h>
+#include <linux/clk.h>
+
+#include <mach/hardware.h>
+#include <asm/setup.h>
+#include <asm/mach-types.h>
+#include <asm/irq.h>
+
+#include <asm/mach/arch.h>
+#include <asm/mach/map.h>
+#include <asm/mach/irq.h>
+
+#include <mach/board.h>
+#include <mach/gpio.h>
+#include <mach/at91sam9_smc.h>
+
+#include "sam9_smc.h"
+#include "generic.h"
+
+
+static void __init ek_map_io(void)
+{
+	/* Initialize processor: 18.432 MHz crystal */
+	at91sam9260_initialize(18432000);
+
+	/* DGBU on ttyS0. (Rx & Tx only) */
+	at91_register_uart(0, 0, 0);
+
+	/* USART0 on ttyS1. (Rx, Tx, CTS, RTS, DTR, DSR, DCD, RI) */
+	at91_register_uart(AT91SAM9260_ID_US0, 1, ATMEL_UART_CTS | ATMEL_UART_RTS
+			   | ATMEL_UART_DTR | ATMEL_UART_DSR | ATMEL_UART_DCD
+			   | ATMEL_UART_RI);
+
+	/* USART1 on ttyS2. (Rx, Tx, RTS, CTS) */
+	at91_register_uart(AT91SAM9260_ID_US1, 2, ATMEL_UART_CTS | ATMEL_UART_RTS);
+
+	/* set serial console to ttyS0 (ie, DBGU) */
+	at91_set_serial_console(0);
+}
+
+static void __init ek_init_irq(void)
+{
+	at91sam9260_init_interrupts(NULL);
+}
+
+
+/*
+ * USB Host port
+ */
+static struct at91_usbh_data __initdata ek_usbh_data = {
+	.ports		= 2,
+};
+
+/*
+ * USB Device port
+ */
+static struct at91_udc_data __initdata ek_udc_data = {
+	.vbus_pin	= AT91_PIN_PC5,
+	.pullup_pin	= 0,		/* pull-up driven by UDC */
+};
+
+
+/*
+ * SPI devices.
+ */
+static struct spi_board_info ek_spi_devices[] = {
+#if !defined(CONFIG_MMC_ATMELMCI)
+	{	/* DataFlash chip */
+		.modalias	= "mtd_dataflash",
+		.chip_select	= 1,
+		.max_speed_hz	= 15 * 1000 * 1000,
+		.bus_num	= 0,
+	},
+#if defined(CONFIG_MTD_AT91_DATAFLASH_CARD)
+	{	/* DataFlash card */
+		.modalias	= "mtd_dataflash",
+		.chip_select	= 0,
+		.max_speed_hz	= 15 * 1000 * 1000,
+		.bus_num	= 0,
+	},
+#endif
+#endif
+};
+
+
+/*
+ * MACB Ethernet device
+ */
+static struct at91_eth_data __initdata ek_macb_data = {
+	.phy_irq_pin	= AT91_PIN_PC12,
+	.is_rmii	= 1,
+};
+
+
+/*
+ * NAND flash
+ */
+static struct mtd_partition __initdata ek_nand_partition[] = {
+	{
+		.name   = "Bootstrap",
+		.offset = 0,
+		.size   = 4 * SZ_1M,
+	},
+	{
+		.name	= "Partition 1",
+		.offset	= MTDPART_OFS_NXTBLK,
+		.size	= 60 * SZ_1M,
+	},
+	{
+		.name	= "Partition 2",
+		.offset	= MTDPART_OFS_NXTBLK,
+		.size	= MTDPART_SIZ_FULL,
+	},
+};
+
+static struct mtd_partition * __init nand_partitions(int size, int *num_partitions)
+{
+	*num_partitions = ARRAY_SIZE(ek_nand_partition);
+	return ek_nand_partition;
+}
+
+/* det_pin is not connected */
+static struct atmel_nand_data __initdata ek_nand_data = {
+	.ale		= 21,
+	.cle		= 22,
+	.rdy_pin	= AT91_PIN_PC13,
+	.enable_pin	= AT91_PIN_PC14,
+	.partition_info	= nand_partitions,
+#if defined(CONFIG_MTD_NAND_ATMEL_BUSWIDTH_16)
+	.bus_width_16	= 1,
+#else
+	.bus_width_16	= 0,
+#endif
+};
+
+static struct sam9_smc_config __initdata ek_nand_smc_config = {
+	.ncs_read_setup		= 0,
+	.nrd_setup		= 2,
+	.ncs_write_setup	= 0,
+	.nwe_setup		= 2,
+
+	.ncs_read_pulse		= 4,
+	.nrd_pulse		= 4,
+	.ncs_write_pulse	= 4,
+	.nwe_pulse		= 4,
+
+	.read_cycle		= 7,
+	.write_cycle		= 7,
+
+	.mode			= AT91_SMC_READMODE | AT91_SMC_WRITEMODE | AT91_SMC_EXNWMODE_DISABLE,
+	.tdf_cycles		= 3,
+};
+
+static void __init ek_add_device_nand(void)
+{
+	/* setup bus-width (8 or 16) */
+	if (ek_nand_data.bus_width_16)
+		ek_nand_smc_config.mode |= AT91_SMC_DBW_16;
+	else
+		ek_nand_smc_config.mode |= AT91_SMC_DBW_8;
+
+	/* configure chip-select 3 (NAND) */
+	sam9_smc_configure(3, &ek_nand_smc_config);
+
+	at91_add_device_nand(&ek_nand_data);
+}
+
+
+/*
+ * MCI (SD/MMC)
+ * det_pin and wp_pin are not connected
+ */
+#if defined(CONFIG_MMC_ATMELMCI) || defined(CONFIG_MMC_ATMELMCI_MODULE)
+static struct mci_platform_data __initdata ek_mmc_data = {
+	.slot[0] = {
+		.bus_width	= 4,
+		.detect_pin	= -ENODEV,
+		.wp_pin		= -ENODEV,
+	},
+	.slot[1] = {
+		.bus_width	= 4,
+		.detect_pin	= -ENODEV,
+		.wp_pin		= -ENODEV,
+	},
+
+};
+#else
+static struct amci_platform_data __initdata ek_mmc_data = {
+};
+#endif
+
+/*
+ * LEDs
+ */
+static struct gpio_led ek_leds[] = {
+	{	/* "bottom" led, green, userled1 to be defined */
+		.name			= "ds5",
+		.gpio			= AT91_PIN_PB12,
+		.active_low		= 1,
+		.default_trigger	= "none",
+	},
+	{	/* "power" led, yellow */
+		.name			= "ds1",
+		.gpio			= AT91_PIN_PB13,
+		.default_trigger	= "heartbeat",
+	}
+};
+
+static struct i2c_board_info __initdata ek_i2c_devices[] = {
+	{
+		I2C_BOARD_INFO("24c512", 0x50),
+	},
+};
+
+
+static void __init ek_board_init(void)
+{
+	/* Serial */
+	at91_add_device_serial();
+	/* USB Host */
+	at91_add_device_usbh(&ek_usbh_data);
+	/* USB Device */
+	at91_add_device_udc(&ek_udc_data);
+	/* SPI */
+	at91_add_device_spi(ek_spi_devices, ARRAY_SIZE(ek_spi_devices));
+	/* NAND */
+	ek_add_device_nand();
+	/* Ethernet */
+	at91_add_device_eth(&ek_macb_data);
+	/* MMC */
+	at91_add_device_mci(0, &ek_mmc_data);
+	/* I2C */
+	at91_add_device_i2c(ek_i2c_devices, ARRAY_SIZE(ek_i2c_devices));
+	/* LEDs */
+	at91_gpio_leds(ek_leds, ARRAY_SIZE(ek_leds));
+	/* PCK0 provides MCLK to the WM8731 */
+	at91_set_B_periph(AT91_PIN_PC1, 0);
+	/* SSC (for WM8731) */
+	at91_add_device_ssc(AT91SAM9260_ID_SSC, ATMEL_SSC_TX);
+}
+
+MACHINE_START(AT91SAM9G20EK_2MMC, "Atmel AT91SAM9G20-EK 2 MMC Slot Mod")
+	/* Maintainer: Rob Emanuele */
+	.phys_io	= AT91_BASE_SYS,
+	.io_pg_offst	= (AT91_VA_BASE_SYS >> 18) & 0xfffc,
+	.boot_params	= AT91_SDRAM_BASE + 0x100,
+	.timer		= &at91sam926x_timer,
+	.map_io		= ek_map_io,
+	.init_irq	= ek_init_irq,
+	.init_machine	= ek_board_init,
+MACHINE_END
diff --git a/arch/arm/mach-at91/include/mach/board.h b/arch/arm/mach-at91/include/mach/board.h
index 13f27a4..583f38a3 100644
--- a/arch/arm/mach-at91/include/mach/board.h
+++ b/arch/arm/mach-at91/include/mach/board.h
@@ -37,6 +37,7 @@
 #include <linux/leds.h>
 #include <linux/spi/spi.h>
 #include <linux/usb/atmel_usba_udc.h>
+#include <linux/atmel-mci.h>
 #include <sound/atmel-ac97c.h>
 
  /* USB Device */
@@ -64,6 +65,7 @@
 extern void __init at91_add_device_cf(struct at91_cf_data *data);
 
  /* MMC / SD */
+  /* at91_mci platform config */
 struct at91_mmc_data {
 	u8		det_pin;	/* card detect IRQ */
 	unsigned	slot_b:1;	/* uses Slot B */
@@ -73,6 +75,9 @@
 };
 extern void __init at91_add_device_mmc(short mmc_id, struct at91_mmc_data *data);
 
+  /* atmel-mci platform config */
+extern void __init at91_add_device_mci(short mmc_id, struct mci_platform_data *data);
+
  /* Ethernet (EMAC & MACB) */
 struct at91_eth_data {
 	u32		phy_mask;
diff --git a/arch/arm/mach-ep93xx/clock.c b/arch/arm/mach-ep93xx/clock.c
index 3dd0e2a..dda19cd7 100644
--- a/arch/arm/mach-ep93xx/clock.c
+++ b/arch/arm/mach-ep93xx/clock.c
@@ -37,7 +37,7 @@
 static unsigned long get_uart_rate(struct clk *clk);
 
 static int set_keytchclk_rate(struct clk *clk, unsigned long rate);
-
+static int set_div_rate(struct clk *clk, unsigned long rate);
 
 static struct clk clk_uart1 = {
 	.sw_locked	= 1,
@@ -76,6 +76,13 @@
 	.rate		= EP93XX_EXT_CLK_RATE,
 };
 
+static struct clk clk_video = {
+	.sw_locked	= 1,
+	.enable_reg     = EP93XX_SYSCON_VIDCLKDIV,
+	.enable_mask    = EP93XX_SYSCON_CLKDIV_ENABLE,
+	.set_rate	= set_div_rate,
+};
+
 /* DMA Clocks */
 static struct clk clk_m2p0 = {
 	.enable_reg	= EP93XX_SYSCON_PWRCNT,
@@ -140,6 +147,7 @@
 	INIT_CK(NULL,			"pll2",		&clk_pll2),
 	INIT_CK("ep93xx-ohci",		NULL,		&clk_usb_host),
 	INIT_CK("ep93xx-keypad",	NULL,		&clk_keypad),
+	INIT_CK("ep93xx-fb",		NULL,		&clk_video),
 	INIT_CK(NULL,			"pwm_clk",	&clk_pwm),
 	INIT_CK(NULL,			"m2p0",		&clk_m2p0),
 	INIT_CK(NULL,			"m2p1",		&clk_m2p1),
@@ -236,6 +244,84 @@
 	return 0;
 }
 
+static unsigned long calc_clk_div(unsigned long rate, int *psel, int *esel,
+				  int *pdiv, int *div)
+{
+	unsigned long max_rate, best_rate = 0,
+		actual_rate = 0, mclk_rate = 0, rate_err = -1;
+	int i, found = 0, __div = 0, __pdiv = 0;
+
+	/* Don't exceed the maximum rate */
+	max_rate = max(max(clk_pll1.rate / 4, clk_pll2.rate / 4),
+		       (unsigned long)EP93XX_EXT_CLK_RATE / 4);
+	rate = min(rate, max_rate);
+
+	/*
+	 * Try the two pll's and the external clock
+	 * Because the valid predividers are 2, 2.5 and 3, we multiply
+	 * all the clocks by 2 to avoid floating point math.
+	 *
+	 * This is based on the algorithm in the ep93xx raster guide:
+	 * http://be-a-maverick.com/en/pubs/appNote/AN269REV1.pdf
+	 *
+	 */
+	for (i = 0; i < 3; i++) {
+		if (i == 0)
+			mclk_rate = EP93XX_EXT_CLK_RATE * 2;
+		else if (i == 1)
+			mclk_rate = clk_pll1.rate * 2;
+		else if (i == 2)
+			mclk_rate = clk_pll2.rate * 2;
+
+		/* Try each predivider value */
+		for (__pdiv = 4; __pdiv <= 6; __pdiv++) {
+			__div = mclk_rate / (rate * __pdiv);
+			if (__div < 2 || __div > 127)
+				continue;
+
+			actual_rate = mclk_rate / (__pdiv * __div);
+
+			if (!found || abs(actual_rate - rate) < rate_err) {
+				*pdiv = __pdiv - 3;
+				*div = __div;
+				*psel = (i == 2);
+				*esel = (i != 0);
+				best_rate = actual_rate;
+				rate_err = abs(actual_rate - rate);
+				found = 1;
+			}
+		}
+	}
+
+	if (!found)
+		return 0;
+
+	return best_rate;
+}
+
+static int set_div_rate(struct clk *clk, unsigned long rate)
+{
+	unsigned long actual_rate;
+	int psel = 0, esel = 0, pdiv = 0, div = 0;
+	u32 val;
+
+	actual_rate = calc_clk_div(rate, &psel, &esel, &pdiv, &div);
+	if (actual_rate == 0)
+		return -EINVAL;
+	clk->rate = actual_rate;
+
+	/* Clear the esel, psel, pdiv and div bits */
+	val = __raw_readl(clk->enable_reg);
+	val &= ~0x7fff;
+
+	/* Set the new esel, psel, pdiv and div bits for the new clock rate */
+	val |= (esel ? EP93XX_SYSCON_CLKDIV_ESEL : 0) |
+		(psel ? EP93XX_SYSCON_CLKDIV_PSEL : 0) |
+		(pdiv << EP93XX_SYSCON_CLKDIV_PDIV_SHIFT) | div;
+	ep93xx_syscon_swlocked_write(val, clk->enable_reg);
+	return 0;
+}
+
 int clk_set_rate(struct clk *clk, unsigned long rate)
 {
 	if (clk->set_rate)
diff --git a/arch/arm/mach-ep93xx/core.c b/arch/arm/mach-ep93xx/core.c
index 16b92c3..f7ebed9 100644
--- a/arch/arm/mach-ep93xx/core.c
+++ b/arch/arm/mach-ep93xx/core.c
@@ -30,6 +30,7 @@
 #include <linux/i2c-gpio.h>
 
 #include <mach/hardware.h>
+#include <mach/fb.h>
 
 #include <asm/mach/map.h>
 #include <asm/mach/time.h>
@@ -682,6 +683,37 @@
 EXPORT_SYMBOL(ep93xx_pwm_release_gpio);
 
 
+/*************************************************************************
+ * EP93xx video peripheral handling
+ *************************************************************************/
+static struct ep93xxfb_mach_info ep93xxfb_data;
+
+static struct resource ep93xx_fb_resource[] = {
+	{
+		.start		= EP93XX_RASTER_PHYS_BASE,
+		.end		= EP93XX_RASTER_PHYS_BASE + 0x800 - 1,
+		.flags		= IORESOURCE_MEM,
+	},
+};
+
+static struct platform_device ep93xx_fb_device = {
+	.name			= "ep93xx-fb",
+	.id			= -1,
+	.dev			= {
+		.platform_data	= &ep93xxfb_data,
+		.coherent_dma_mask	= DMA_BIT_MASK(32),
+		.dma_mask		= &ep93xx_fb_device.dev.coherent_dma_mask,
+	},
+	.num_resources		= ARRAY_SIZE(ep93xx_fb_resource),
+	.resource		= ep93xx_fb_resource,
+};
+
+void __init ep93xx_register_fb(struct ep93xxfb_mach_info *data)
+{
+	ep93xxfb_data = *data;
+	platform_device_register(&ep93xx_fb_device);
+}
+
 extern void ep93xx_gpio_init(void);
 
 void __init ep93xx_init_devices(void)
diff --git a/arch/arm/mach-ep93xx/include/mach/ep93xx-regs.h b/arch/arm/mach-ep93xx/include/mach/ep93xx-regs.h
index ea78e90..0fbf87b 100644
--- a/arch/arm/mach-ep93xx/include/mach/ep93xx-regs.h
+++ b/arch/arm/mach-ep93xx/include/mach/ep93xx-regs.h
@@ -70,6 +70,7 @@
 #define EP93XX_USB_PHYS_BASE		(EP93XX_AHB_PHYS_BASE + 0x00020000)
 #define EP93XX_USB_BASE			EP93XX_AHB_IOMEM(0x00020000)
 
+#define EP93XX_RASTER_PHYS_BASE		(EP93XX_AHB_PHYS_BASE + 0x00030000)
 #define EP93XX_RASTER_BASE		EP93XX_AHB_IOMEM(0x00030000)
 
 #define EP93XX_GRAPHICS_ACCEL_BASE	EP93XX_AHB_IOMEM(0x00040000)
@@ -207,6 +208,11 @@
 #define EP93XX_SYSCON_DEVCFG_ADCPD	(1<<2)
 #define EP93XX_SYSCON_DEVCFG_KEYS	(1<<1)
 #define EP93XX_SYSCON_DEVCFG_SHENA	(1<<0)
+#define EP93XX_SYSCON_VIDCLKDIV		EP93XX_SYSCON_REG(0x84)
+#define EP93XX_SYSCON_CLKDIV_ENABLE	(1<<15)
+#define EP93XX_SYSCON_CLKDIV_ESEL	(1<<14)
+#define EP93XX_SYSCON_CLKDIV_PSEL	(1<<13)
+#define EP93XX_SYSCON_CLKDIV_PDIV_SHIFT	8
 #define EP93XX_SYSCON_KEYTCHCLKDIV	EP93XX_SYSCON_REG(0x90)
 #define EP93XX_SYSCON_KEYTCHCLKDIV_TSEN	(1<<31)
 #define EP93XX_SYSCON_KEYTCHCLKDIV_ADIV	(1<<16)
diff --git a/arch/arm/mach-ep93xx/include/mach/fb.h b/arch/arm/mach-ep93xx/include/mach/fb.h
new file mode 100644
index 0000000..d5ae11d7
--- /dev/null
+++ b/arch/arm/mach-ep93xx/include/mach/fb.h
@@ -0,0 +1,56 @@
+/*
+ * arch/arm/mach-ep93xx/include/mach/fb.h
+ */
+
+#ifndef __ASM_ARCH_EP93XXFB_H
+#define __ASM_ARCH_EP93XXFB_H
+
+struct platform_device;
+struct fb_videomode;
+struct fb_info;
+
+#define EP93XXFB_USE_MODEDB		0
+
+/* VideoAttributes flags */
+#define EP93XXFB_STATE_MACHINE_ENABLE	(1 << 0)
+#define EP93XXFB_PIXEL_CLOCK_ENABLE	(1 << 1)
+#define EP93XXFB_VSYNC_ENABLE		(1 << 2)
+#define EP93XXFB_PIXEL_DATA_ENABLE	(1 << 3)
+#define EP93XXFB_COMPOSITE_SYNC		(1 << 4)
+#define EP93XXFB_SYNC_VERT_HIGH		(1 << 5)
+#define EP93XXFB_SYNC_HORIZ_HIGH	(1 << 6)
+#define EP93XXFB_SYNC_BLANK_HIGH	(1 << 7)
+#define EP93XXFB_PCLK_FALLING		(1 << 8)
+#define EP93XXFB_ENABLE_AC		(1 << 9)
+#define EP93XXFB_ENABLE_LCD		(1 << 10)
+#define EP93XXFB_ENABLE_CCIR		(1 << 12)
+#define EP93XXFB_USE_PARALLEL_INTERFACE	(1 << 13)
+#define EP93XXFB_ENABLE_INTERRUPT	(1 << 14)
+#define EP93XXFB_USB_INTERLACE		(1 << 16)
+#define EP93XXFB_USE_EQUALIZATION	(1 << 17)
+#define EP93XXFB_USE_DOUBLE_HORZ	(1 << 18)
+#define EP93XXFB_USE_DOUBLE_VERT	(1 << 19)
+#define EP93XXFB_USE_BLANK_PIXEL	(1 << 20)
+#define EP93XXFB_USE_SDCSN0		(0 << 21)
+#define EP93XXFB_USE_SDCSN1		(1 << 21)
+#define EP93XXFB_USE_SDCSN2		(2 << 21)
+#define EP93XXFB_USE_SDCSN3		(3 << 21)
+
+#define EP93XXFB_ENABLE			(EP93XXFB_STATE_MACHINE_ENABLE	| \
+					 EP93XXFB_PIXEL_CLOCK_ENABLE	| \
+					 EP93XXFB_VSYNC_ENABLE		| \
+					 EP93XXFB_PIXEL_DATA_ENABLE)
+
+struct ep93xxfb_mach_info {
+	unsigned int			num_modes;
+	const struct fb_videomode	*modes;
+	const struct fb_videomode	*default_mode;
+	int				bpp;
+	unsigned int			flags;
+
+	int	(*setup)(struct platform_device *pdev);
+	void	(*teardown)(struct platform_device *pdev);
+	void	(*blank)(int blank_mode, struct fb_info *info);
+};
+
+#endif /* __ASM_ARCH_EP93XXFB_H */
diff --git a/arch/arm/mach-ep93xx/include/mach/platform.h b/arch/arm/mach-ep93xx/include/mach/platform.h
index 5f5fa65..01a0f08 100644
--- a/arch/arm/mach-ep93xx/include/mach/platform.h
+++ b/arch/arm/mach-ep93xx/include/mach/platform.h
@@ -6,6 +6,7 @@
 
 struct i2c_board_info;
 struct platform_device;
+struct ep93xxfb_mach_info;
 
 struct ep93xx_eth_data
 {
@@ -33,6 +34,7 @@
 
 void ep93xx_register_eth(struct ep93xx_eth_data *data, int copy_addr);
 void ep93xx_register_i2c(struct i2c_board_info *devices, int num);
+void ep93xx_register_fb(struct ep93xxfb_mach_info *data);
 void ep93xx_register_pwm(int pwm0, int pwm1);
 int ep93xx_pwm_acquire_gpio(struct platform_device *pdev);
 void ep93xx_pwm_release_gpio(struct platform_device *pdev);
diff --git a/arch/arm/mach-omap2/board-rx51-peripherals.c b/arch/arm/mach-omap2/board-rx51-peripherals.c
index e70baa7..e6e8290 100644
--- a/arch/arm/mach-omap2/board-rx51-peripherals.c
+++ b/arch/arm/mach-omap2/board-rx51-peripherals.c
@@ -19,6 +19,7 @@
 #include <linux/delay.h>
 #include <linux/regulator/machine.h>
 #include <linux/gpio.h>
+#include <linux/mmc/host.h>
 
 #include <mach/mcspi.h>
 #include <mach/mux.h>
@@ -102,6 +103,7 @@
 		.cover_only	= true,
 		.gpio_cd	= 160,
 		.gpio_wp	= -EINVAL,
+		.power_saving	= true,
 	},
 	{
 		.name		= "internal",
@@ -109,6 +111,8 @@
 		.wires		= 8,
 		.gpio_cd	= -EINVAL,
 		.gpio_wp	= -EINVAL,
+		.nonremovable	= true,
+		.power_saving	= true,
 	},
 	{}	/* Terminator */
 };
diff --git a/arch/arm/mach-omap2/devices.c b/arch/arm/mach-omap2/devices.c
index a2e9156..bcfcfc7 100644
--- a/arch/arm/mach-omap2/devices.c
+++ b/arch/arm/mach-omap2/devices.c
@@ -257,6 +257,11 @@
 #define OMAP2_MCSPI3_BASE		0x480b8000
 #define OMAP2_MCSPI4_BASE		0x480ba000
 
+#define OMAP4_MCSPI1_BASE		0x48098100
+#define OMAP4_MCSPI2_BASE		0x4809a100
+#define OMAP4_MCSPI3_BASE		0x480b8100
+#define OMAP4_MCSPI4_BASE		0x480ba100
+
 static struct omap2_mcspi_platform_config omap2_mcspi1_config = {
 	.num_cs		= 4,
 };
@@ -301,7 +306,8 @@
 	},
 };
 
-#if defined(CONFIG_ARCH_OMAP2430) || defined(CONFIG_ARCH_OMAP3)
+#if defined(CONFIG_ARCH_OMAP2430) || defined(CONFIG_ARCH_OMAP3) || \
+	defined(CONFIG_ARCH_OMAP4)
 static struct omap2_mcspi_platform_config omap2_mcspi3_config = {
 	.num_cs		= 2,
 };
@@ -325,7 +331,7 @@
 };
 #endif
 
-#ifdef CONFIG_ARCH_OMAP3
+#if defined(CONFIG_ARCH_OMAP3) || defined(CONFIG_ARCH_OMAP4)
 static struct omap2_mcspi_platform_config omap2_mcspi4_config = {
 	.num_cs		= 1,
 };
@@ -351,14 +357,25 @@
 
 static void omap_init_mcspi(void)
 {
+	if (cpu_is_omap44xx()) {
+		omap2_mcspi1_resources[0].start	= OMAP4_MCSPI1_BASE;
+		omap2_mcspi1_resources[0].end	= OMAP4_MCSPI1_BASE + 0xff;
+		omap2_mcspi2_resources[0].start	= OMAP4_MCSPI2_BASE;
+		omap2_mcspi2_resources[0].end	= OMAP4_MCSPI2_BASE + 0xff;
+		omap2_mcspi3_resources[0].start	= OMAP4_MCSPI3_BASE;
+		omap2_mcspi3_resources[0].end	= OMAP4_MCSPI3_BASE + 0xff;
+		omap2_mcspi4_resources[0].start	= OMAP4_MCSPI4_BASE;
+		omap2_mcspi4_resources[0].end	= OMAP4_MCSPI4_BASE + 0xff;
+	}
 	platform_device_register(&omap2_mcspi1);
 	platform_device_register(&omap2_mcspi2);
-#if defined(CONFIG_ARCH_OMAP2430) || defined(CONFIG_ARCH_OMAP3)
-	if (cpu_is_omap2430() || cpu_is_omap343x())
+#if defined(CONFIG_ARCH_OMAP2430) || defined(CONFIG_ARCH_OMAP3) || \
+	defined(CONFIG_ARCH_OMAP4)
+	if (cpu_is_omap2430() || cpu_is_omap343x() || cpu_is_omap44xx())
 		platform_device_register(&omap2_mcspi3);
 #endif
-#ifdef CONFIG_ARCH_OMAP3
-	if (cpu_is_omap343x())
+#if defined(CONFIG_ARCH_OMAP3) || defined(CONFIG_ARCH_OMAP4)
+	if (cpu_is_omap343x() || cpu_is_omap44xx())
 		platform_device_register(&omap2_mcspi4);
 #endif
 }
@@ -397,7 +414,7 @@
 
 /*-------------------------------------------------------------------------*/
 
-#ifdef CONFIG_ARCH_OMAP3
+#if defined(CONFIG_ARCH_OMAP3) || defined(CONFIG_ARCH_OMAP4)
 
 #define MMCHS_SYSCONFIG			0x0010
 #define MMCHS_SYSCONFIG_SWRESET		(1 << 1)
@@ -424,8 +441,8 @@
  **/
 static void __init omap_hsmmc_reset(void)
 {
-	u32 i, nr_controllers = cpu_is_omap34xx() ? OMAP34XX_NR_MMC :
-		OMAP24XX_NR_MMC;
+	u32 i, nr_controllers = cpu_is_omap44xx() ? OMAP44XX_NR_MMC :
+		(cpu_is_omap34xx() ? OMAP34XX_NR_MMC : OMAP24XX_NR_MMC);
 
 	for (i = 0; i < nr_controllers; i++) {
 		u32 v, base = 0;
@@ -442,8 +459,21 @@
 		case 2:
 			base = OMAP3_MMC3_BASE;
 			break;
+		case 3:
+			if (!cpu_is_omap44xx())
+				return;
+			base = OMAP4_MMC4_BASE;
+			break;
+		case 4:
+			if (!cpu_is_omap44xx())
+				return;
+			base = OMAP4_MMC5_BASE;
+			break;
 		}
 
+		if (cpu_is_omap44xx())
+			base += OMAP4_MMC_REG_OFFSET;
+
 		dummy_pdev.id = i;
 		dev_set_name(&dummy_pdev.dev, "mmci-omap-hs.%d", i);
 		iclk = clk_get(dev, "ick");
@@ -581,11 +611,23 @@
 			irq = INT_24XX_MMC2_IRQ;
 			break;
 		case 2:
-			if (!cpu_is_omap34xx())
+			if (!cpu_is_omap44xx() && !cpu_is_omap34xx())
 				return;
 			base = OMAP3_MMC3_BASE;
 			irq = INT_34XX_MMC3_IRQ;
 			break;
+		case 3:
+			if (!cpu_is_omap44xx())
+				return;
+			base = OMAP4_MMC4_BASE + OMAP4_MMC_REG_OFFSET;
+			irq = INT_44XX_MMC4_IRQ;
+			break;
+		case 4:
+			if (!cpu_is_omap44xx())
+				return;
+			base = OMAP4_MMC5_BASE + OMAP4_MMC_REG_OFFSET;
+			irq = INT_44XX_MMC5_IRQ;
+			break;
 		default:
 			continue;
 		}
@@ -593,8 +635,15 @@
 		if (cpu_is_omap2420()) {
 			size = OMAP2420_MMC_SIZE;
 			name = "mmci-omap";
+		} else if (cpu_is_omap44xx()) {
+			if (i < 3) {
+				base += OMAP4_MMC_REG_OFFSET;
+				irq += IRQ_GIC_START;
+			}
+			size = OMAP4_HSMMC_SIZE;
+			name = "mmci-omap-hs";
 		} else {
-			size = HSMMC_SIZE;
+			size = OMAP3_HSMMC_SIZE;
 			name = "mmci-omap-hs";
 		}
 		omap_mmc_add(name, i, base, size, irq, mmc_data[i]);
diff --git a/arch/arm/mach-omap2/mmc-twl4030.c b/arch/arm/mach-omap2/mmc-twl4030.c
index 3c04c2f..c9c59a2 100644
--- a/arch/arm/mach-omap2/mmc-twl4030.c
+++ b/arch/arm/mach-omap2/mmc-twl4030.c
@@ -198,6 +198,18 @@
 #define twl_mmc_resume	NULL
 #endif
 
+#if defined(CONFIG_ARCH_OMAP3) && defined(CONFIG_PM)
+
+static int twl4030_mmc_get_context_loss(struct device *dev)
+{
+	/* FIXME: PM DPS not implemented yet */
+	return 0;
+}
+
+#else
+#define twl4030_mmc_get_context_loss NULL
+#endif
+
 static int twl_mmc1_set_power(struct device *dev, int slot, int power_on,
 				int vdd)
 {
@@ -328,6 +340,61 @@
 	return ret;
 }
 
+static int twl_mmc1_set_sleep(struct device *dev, int slot, int sleep, int vdd,
+			      int cardsleep)
+{
+	struct twl_mmc_controller *c = &hsmmc[0];
+	int mode = sleep ? REGULATOR_MODE_STANDBY : REGULATOR_MODE_NORMAL;
+
+	return regulator_set_mode(c->vcc, mode);
+}
+
+static int twl_mmc23_set_sleep(struct device *dev, int slot, int sleep, int vdd,
+			       int cardsleep)
+{
+	struct twl_mmc_controller *c = NULL;
+	struct omap_mmc_platform_data *mmc = dev->platform_data;
+	int i, err, mode;
+
+	for (i = 1; i < ARRAY_SIZE(hsmmc); i++) {
+		if (mmc == hsmmc[i].mmc) {
+			c = &hsmmc[i];
+			break;
+		}
+	}
+
+	if (c == NULL)
+		return -ENODEV;
+
+	/*
+	 * If we don't see a Vcc regulator, assume it's a fixed
+	 * voltage always-on regulator.
+	 */
+	if (!c->vcc)
+		return 0;
+
+	mode = sleep ? REGULATOR_MODE_STANDBY : REGULATOR_MODE_NORMAL;
+
+	if (!c->vcc_aux)
+		return regulator_set_mode(c->vcc, mode);
+
+	if (cardsleep) {
+		/* VCC can be turned off if card is asleep */
+		struct regulator *vcc_aux = c->vcc_aux;
+
+		c->vcc_aux = NULL;
+		if (sleep)
+			err = twl_mmc23_set_power(dev, slot, 0, 0);
+		else
+			err = twl_mmc23_set_power(dev, slot, 1, vdd);
+		c->vcc_aux = vcc_aux;
+	} else
+		err = regulator_set_mode(c->vcc, mode);
+	if (err)
+		return err;
+	return regulator_set_mode(c->vcc_aux, mode);
+}
+
 static struct omap_mmc_platform_data *hsmmc_data[OMAP34XX_NR_MMC] __initdata;
 
 void __init twl4030_mmc_init(struct twl4030_hsmmc_info *controllers)
@@ -390,6 +457,9 @@
 		} else
 			mmc->slots[0].switch_pin = -EINVAL;
 
+		mmc->get_context_loss_count =
+				twl4030_mmc_get_context_loss;
+
 		/* write protect normally uses an OMAP gpio */
 		if (gpio_is_valid(c->gpio_wp)) {
 			gpio_request(c->gpio_wp, "mmc_wp");
@@ -400,6 +470,12 @@
 		} else
 			mmc->slots[0].gpio_wp = -EINVAL;
 
+		if (c->nonremovable)
+			mmc->slots[0].nonremovable = 1;
+
+		if (c->power_saving)
+			mmc->slots[0].power_saving = 1;
+
 		/* NOTE:  MMC slots should have a Vcc regulator set up.
 		 * This may be from a TWL4030-family chip, another
 		 * controllable regulator, or a fixed supply.
@@ -412,6 +488,7 @@
 		case 1:
 			/* on-chip level shifting via PBIAS0/PBIAS1 */
 			mmc->slots[0].set_power = twl_mmc1_set_power;
+			mmc->slots[0].set_sleep = twl_mmc1_set_sleep;
 			break;
 		case 2:
 			if (c->ext_clock)
@@ -422,6 +499,7 @@
 		case 3:
 			/* off-chip level shifting, or none */
 			mmc->slots[0].set_power = twl_mmc23_set_power;
+			mmc->slots[0].set_sleep = twl_mmc23_set_sleep;
 			break;
 		default:
 			pr_err("MMC%d configuration not supported!\n", c->mmc);
diff --git a/arch/arm/mach-omap2/mmc-twl4030.h b/arch/arm/mach-omap2/mmc-twl4030.h
index 3807c45..a47e685 100644
--- a/arch/arm/mach-omap2/mmc-twl4030.h
+++ b/arch/arm/mach-omap2/mmc-twl4030.h
@@ -12,6 +12,8 @@
 	bool	transceiver;	/* MMC-2 option */
 	bool	ext_clock;	/* use external pin for input clock */
 	bool	cover_only;	/* No card detect - just cover switch */
+	bool	nonremovable;	/* Nonremovable e.g. eMMC */
+	bool	power_saving;	/* Try to sleep or power off when possible */
 	int	gpio_cd;	/* or -EINVAL */
 	int	gpio_wp;	/* or -EINVAL */
 	char	*name;		/* or NULL for default */
diff --git a/arch/arm/plat-mxc/include/mach/spi.h b/arch/arm/plat-mxc/include/mach/spi.h
new file mode 100644
index 0000000..08be445
--- /dev/null
+++ b/arch/arm/plat-mxc/include/mach/spi.h
@@ -0,0 +1,27 @@
+
+#ifndef __MACH_SPI_H_
+#define __MACH_SPI_H_
+
+/*
+ * struct spi_imx_master - device.platform_data for SPI controller devices.
+ * @chipselect: Array of chipselects for this master. Numbers >= 0 mean gpio
+ *              pins, numbers < 0 mean internal CSPI chipselects according
+ *              to MXC_SPI_CS(). Normally you want to use gpio based chip
+ *              selects as the CSPI module tries to be intelligent about
+ *              when to assert the chipselect: The CSPI module deasserts the
+ *              chipselect once it runs out of input data. The other problem
+ *              is that it is not possible to mix between high active and low
+ *              active chipselects on one single bus using the internal
+ *              chipselects. Unfortunately Freescale decided to put some
+ *              chipselects on dedicated pins which are not usable as gpios,
+ *              so we have to support the internal chipselects.
+ * @num_chipselect: ARRAY_SIZE(chipselect)
+ */
+struct spi_imx_master {
+	int	*chipselect;
+	int	num_chipselect;
+};
+
+#define MXC_SPI_CS(no)	((no) - 32)
+
+#endif /* __MACH_SPI_H_*/
diff --git a/arch/arm/plat-omap/include/mach/irqs.h b/arch/arm/plat-omap/include/mach/irqs.h
index fb7cb77..28a1650 100644
--- a/arch/arm/plat-omap/include/mach/irqs.h
+++ b/arch/arm/plat-omap/include/mach/irqs.h
@@ -503,6 +503,7 @@
 #define INT_44XX_FPKA_READY_IRQ	(50 + IRQ_GIC_START)
 #define INT_44XX_SHA1MD51_IRQ	(51 + IRQ_GIC_START)
 #define INT_44XX_RNG_IRQ	(52 + IRQ_GIC_START)
+#define INT_44XX_MMC5_IRQ	(59 + IRQ_GIC_START)
 #define INT_44XX_I2C3_IRQ	(61 + IRQ_GIC_START)
 #define INT_44XX_FPKA_ERROR_IRQ	(64 + IRQ_GIC_START)
 #define INT_44XX_PBIAS_IRQ	(75 + IRQ_GIC_START)
@@ -511,6 +512,7 @@
 #define INT_44XX_TLL_IRQ	(78 + IRQ_GIC_START)
 #define INT_44XX_PARTHASH_IRQ	(79 + IRQ_GIC_START)
 #define INT_44XX_MMC3_IRQ	(94 + IRQ_GIC_START)
+#define INT_44XX_MMC4_IRQ	(96 + IRQ_GIC_START)
 
 
 /* Max. 128 level 2 IRQs (OMAP1610), 192 GPIOs (OMAP730/850) and
diff --git a/arch/arm/plat-omap/include/mach/lcd_mipid.h b/arch/arm/plat-omap/include/mach/lcd_mipid.h
index f8fbc48..8e52c65 100644
--- a/arch/arm/plat-omap/include/mach/lcd_mipid.h
+++ b/arch/arm/plat-omap/include/mach/lcd_mipid.h
@@ -16,7 +16,12 @@
 struct mipid_platform_data {
 	int	nreset_gpio;
 	int	data_lines;
+
 	void	(*shutdown)(struct mipid_platform_data *pdata);
+	void	(*set_bklight_level)(struct mipid_platform_data *pdata,
+				     int level);
+	int	(*get_bklight_level)(struct mipid_platform_data *pdata);
+	int	(*get_bklight_max)(struct mipid_platform_data *pdata);
 };
 
 #endif
diff --git a/arch/arm/plat-omap/include/mach/mmc.h b/arch/arm/plat-omap/include/mach/mmc.h
index 81d5b36..7229b95 100644
--- a/arch/arm/plat-omap/include/mach/mmc.h
+++ b/arch/arm/plat-omap/include/mach/mmc.h
@@ -25,11 +25,18 @@
 
 #define OMAP24XX_NR_MMC		2
 #define OMAP34XX_NR_MMC		3
+#define OMAP44XX_NR_MMC		5
 #define OMAP2420_MMC_SIZE	OMAP1_MMC_SIZE
-#define HSMMC_SIZE		0x200
+#define OMAP3_HSMMC_SIZE	0x200
+#define OMAP4_HSMMC_SIZE	0x1000
 #define OMAP2_MMC1_BASE		0x4809c000
 #define OMAP2_MMC2_BASE		0x480b4000
 #define OMAP3_MMC3_BASE		0x480ad000
+#define OMAP4_MMC4_BASE		0x480d1000
+#define OMAP4_MMC5_BASE		0x480d5000
+#define OMAP4_MMC_REG_OFFSET	0x100
+#define HSMMC5			(1 << 4)
+#define HSMMC4			(1 << 3)
 #define HSMMC3			(1 << 2)
 #define HSMMC2			(1 << 1)
 #define HSMMC1			(1 << 0)
@@ -59,6 +66,9 @@
 	int (*suspend)(struct device *dev, int slot);
 	int (*resume)(struct device *dev, int slot);
 
+	/* Return context loss count due to PM states changing */
+	int (*get_context_loss_count)(struct device *dev);
+
 	u64 dma_mask;
 
 	struct omap_mmc_slot_data {
@@ -80,12 +90,20 @@
 		/* use the internal clock */
 		unsigned internal_clock:1;
 
+		/* nonremovable e.g. eMMC */
+		unsigned nonremovable:1;
+
+		/* Try to sleep or power off when possible */
+		unsigned power_saving:1;
+
 		int switch_pin;			/* gpio (card detect) */
 		int gpio_wp;			/* gpio (write protect) */
 
 		int (* set_bus_mode)(struct device *dev, int slot, int bus_mode);
 		int (* set_power)(struct device *dev, int slot, int power_on, int vdd);
 		int (* get_ro)(struct device *dev, int slot);
+		int (*set_sleep)(struct device *dev, int slot, int sleep,
+				 int vdd, int cardsleep);
 
 		/* return MMC cover switch state, can be NULL if not supported.
 		 *
diff --git a/arch/arm/plat-omap/include/mach/omapfb.h b/arch/arm/plat-omap/include/mach/omapfb.h
index 7b74d12..b226bdf 100644
--- a/arch/arm/plat-omap/include/mach/omapfb.h
+++ b/arch/arm/plat-omap/include/mach/omapfb.h
@@ -276,8 +276,8 @@
 					  void *fbi);
 
 struct omapfb_mem_region {
-	dma_addr_t	paddr;
-	void		*vaddr;
+	u32		paddr;
+	void __iomem	*vaddr;
 	unsigned long	size;
 	u8		type;		/* OMAPFB_PLANE_MEM_* */
 	unsigned	alloc:1;	/* allocated by the driver */
diff --git a/arch/blackfin/include/asm/sections.h b/arch/blackfin/include/asm/sections.h
index e7fd0ec..ae4dae1 100644
--- a/arch/blackfin/include/asm/sections.h
+++ b/arch/blackfin/include/asm/sections.h
@@ -1,9 +1,6 @@
 #ifndef _BLACKFIN_SECTIONS_H
 #define _BLACKFIN_SECTIONS_H
 
-/* nothing to see, move along */
-#include <asm-generic/sections.h>
-
 /* only used when MTD_UCLINUX */
 extern unsigned long memory_mtd_start, memory_mtd_end, mtd_size;
 
@@ -15,4 +12,39 @@
 	_stext_l2[], _etext_l2[], _sdata_l2[], _edata_l2[], _sbss_l2[],
 	_ebss_l2[], _l2_lma_start[];
 
+#include <asm/mem_map.h>
+
+/* Blackfin systems have discontinuous memory map and no virtualized memory */
+static inline int arch_is_kernel_text(unsigned long addr)
+{
+	return
+		(L1_CODE_LENGTH &&
+		 addr >= (unsigned long)_stext_l1 &&
+		 addr <  (unsigned long)_etext_l1)
+		||
+		(L2_LENGTH &&
+		 addr >= (unsigned long)_stext_l2 &&
+		 addr <  (unsigned long)_etext_l2);
+}
+#define arch_is_kernel_text(addr) arch_is_kernel_text(addr)
+
+static inline int arch_is_kernel_data(unsigned long addr)
+{
+	return
+		(L1_DATA_A_LENGTH &&
+		 addr >= (unsigned long)_sdata_l1 &&
+		 addr <  (unsigned long)_ebss_l1)
+		||
+		(L1_DATA_B_LENGTH &&
+		 addr >= (unsigned long)_sdata_b_l1 &&
+		 addr <  (unsigned long)_ebss_b_l1)
+		||
+		(L2_LENGTH &&
+		 addr >= (unsigned long)_sdata_l2 &&
+		 addr <  (unsigned long)_ebss_l2);
+}
+#define arch_is_kernel_data(addr) arch_is_kernel_data(addr)
+
+#include <asm-generic/sections.h>
+
 #endif
diff --git a/arch/ia64/Kconfig b/arch/ia64/Kconfig
index 011a1cd..6851e52 100644
--- a/arch/ia64/Kconfig
+++ b/arch/ia64/Kconfig
@@ -500,6 +500,10 @@
 	def_bool y
 	depends on NUMA
 
+config ARCH_PROC_KCORE_TEXT
+	def_bool y
+	depends on PROC_KCORE
+
 config IA32_SUPPORT
 	bool "Support for Linux/x86 binaries"
 	help
diff --git a/arch/ia64/mm/init.c b/arch/ia64/mm/init.c
index 1d28624..1857766 100644
--- a/arch/ia64/mm/init.c
+++ b/arch/ia64/mm/init.c
@@ -617,7 +617,6 @@
 	long reserved_pages, codesize, datasize, initsize;
 	pg_data_t *pgdat;
 	int i;
-	static struct kcore_list kcore_mem, kcore_vmem, kcore_kernel;
 
 	BUG_ON(PTRS_PER_PGD * sizeof(pgd_t) != PAGE_SIZE);
 	BUG_ON(PTRS_PER_PMD * sizeof(pmd_t) != PAGE_SIZE);
@@ -639,10 +638,6 @@
 
 	high_memory = __va(max_low_pfn * PAGE_SIZE);
 
-	kclist_add(&kcore_mem, __va(0), max_low_pfn * PAGE_SIZE);
-	kclist_add(&kcore_vmem, (void *)VMALLOC_START, VMALLOC_END-VMALLOC_START);
-	kclist_add(&kcore_kernel, _stext, _end - _stext);
-
 	for_each_online_pgdat(pgdat)
 		if (pgdat->bdata->node_bootmem_map)
 			totalram_pages += free_all_bootmem_node(pgdat);
diff --git a/arch/mips/mm/init.c b/arch/mips/mm/init.c
index 1f4ee47..15aa190 100644
--- a/arch/mips/mm/init.c
+++ b/arch/mips/mm/init.c
@@ -352,7 +352,6 @@
 	free_area_init_nodes(max_zone_pfns);
 }
 
-static struct kcore_list kcore_mem, kcore_vmalloc;
 #ifdef CONFIG_64BIT
 static struct kcore_list kcore_kseg0;
 #endif
@@ -409,11 +408,9 @@
 	if ((unsigned long) &_text > (unsigned long) CKSEG0)
 		/* The -4 is a hack so that user tools don't have to handle
 		   the overflow.  */
-		kclist_add(&kcore_kseg0, (void *) CKSEG0, 0x80000000 - 4);
+		kclist_add(&kcore_kseg0, (void *) CKSEG0,
+				0x80000000 - 4, KCORE_TEXT);
 #endif
-	kclist_add(&kcore_mem, __va(0), max_low_pfn << PAGE_SHIFT);
-	kclist_add(&kcore_vmalloc, (void *)VMALLOC_START,
-		   VMALLOC_END-VMALLOC_START);
 
 	printk(KERN_INFO "Memory: %luk/%luk available (%ldk kernel code, "
 	       "%ldk reserved, %ldk data, %ldk init, %ldk highmem)\n",
diff --git a/arch/mn10300/kernel/setup.c b/arch/mn10300/kernel/setup.c
index 79890ed..3f24c29 100644
--- a/arch/mn10300/kernel/setup.c
+++ b/arch/mn10300/kernel/setup.c
@@ -285,7 +285,7 @@
 {
 }
 
-struct seq_operations cpuinfo_op = {
+const struct seq_operations cpuinfo_op = {
 	.start	= c_start,
 	.next	= c_next,
 	.stop	= c_stop,
diff --git a/arch/powerpc/boot/dts/mpc8377_mds.dts b/arch/powerpc/boot/dts/mpc8377_mds.dts
index f32c281..855782c 100644
--- a/arch/powerpc/boot/dts/mpc8377_mds.dts
+++ b/arch/powerpc/boot/dts/mpc8377_mds.dts
@@ -159,6 +159,7 @@
 				reg = <0x2e000 0x1000>;
 				interrupts = <42 0x8>;
 				interrupt-parent = <&ipic>;
+				sdhci,wp-inverted;
 				/* Filled in by U-Boot */
 				clock-frequency = <0>;
 			};
diff --git a/arch/powerpc/boot/dts/mpc8377_rdb.dts b/arch/powerpc/boot/dts/mpc8377_rdb.dts
index 28e022a..9e2264b 100644
--- a/arch/powerpc/boot/dts/mpc8377_rdb.dts
+++ b/arch/powerpc/boot/dts/mpc8377_rdb.dts
@@ -173,6 +173,7 @@
 				reg = <0x2e000 0x1000>;
 				interrupts = <42 0x8>;
 				interrupt-parent = <&ipic>;
+				sdhci,wp-inverted;
 				/* Filled in by U-Boot */
 				clock-frequency = <111111111>;
 			};
diff --git a/arch/powerpc/boot/dts/mpc8377_wlan.dts b/arch/powerpc/boot/dts/mpc8377_wlan.dts
index 3febc4e..9a60369 100644
--- a/arch/powerpc/boot/dts/mpc8377_wlan.dts
+++ b/arch/powerpc/boot/dts/mpc8377_wlan.dts
@@ -150,6 +150,7 @@
 				reg = <0x2e000 0x1000>;
 				interrupts = <42 0x8>;
 				interrupt-parent = <&ipic>;
+				sdhci,wp-inverted;
 				clock-frequency = <133333333>;
 			};
 		};
diff --git a/arch/powerpc/boot/dts/mpc8378_mds.dts b/arch/powerpc/boot/dts/mpc8378_mds.dts
index f720ab9..f70cf60 100644
--- a/arch/powerpc/boot/dts/mpc8378_mds.dts
+++ b/arch/powerpc/boot/dts/mpc8378_mds.dts
@@ -159,6 +159,7 @@
 				reg = <0x2e000 0x1000>;
 				interrupts = <42 0x8>;
 				interrupt-parent = <&ipic>;
+				sdhci,wp-inverted;
 				/* Filled in by U-Boot */
 				clock-frequency = <0>;
 			};
diff --git a/arch/powerpc/boot/dts/mpc8378_rdb.dts b/arch/powerpc/boot/dts/mpc8378_rdb.dts
index a11ead8..4e6a1a4 100644
--- a/arch/powerpc/boot/dts/mpc8378_rdb.dts
+++ b/arch/powerpc/boot/dts/mpc8378_rdb.dts
@@ -173,6 +173,7 @@
 				reg = <0x2e000 0x1000>;
 				interrupts = <42 0x8>;
 				interrupt-parent = <&ipic>;
+				sdhci,wp-inverted;
 				/* Filled in by U-Boot */
 				clock-frequency = <111111111>;
 			};
diff --git a/arch/powerpc/boot/dts/mpc8379_mds.dts b/arch/powerpc/boot/dts/mpc8379_mds.dts
index 4fa221f..645ec51 100644
--- a/arch/powerpc/boot/dts/mpc8379_mds.dts
+++ b/arch/powerpc/boot/dts/mpc8379_mds.dts
@@ -157,6 +157,7 @@
 				reg = <0x2e000 0x1000>;
 				interrupts = <42 0x8>;
 				interrupt-parent = <&ipic>;
+				sdhci,wp-inverted;
 				/* Filled in by U-Boot */
 				clock-frequency = <0>;
 			};
diff --git a/arch/powerpc/boot/dts/mpc8379_rdb.dts b/arch/powerpc/boot/dts/mpc8379_rdb.dts
index e35dfba..72336d5 100644
--- a/arch/powerpc/boot/dts/mpc8379_rdb.dts
+++ b/arch/powerpc/boot/dts/mpc8379_rdb.dts
@@ -171,6 +171,7 @@
 				reg = <0x2e000 0x1000>;
 				interrupts = <42 0x8>;
 				interrupt-parent = <&ipic>;
+				sdhci,wp-inverted;
 				/* Filled in by U-Boot */
 				clock-frequency = <111111111>;
 			};
diff --git a/arch/powerpc/kernel/setup-common.c b/arch/powerpc/kernel/setup-common.c
index 02fed27..1d5570a 100644
--- a/arch/powerpc/kernel/setup-common.c
+++ b/arch/powerpc/kernel/setup-common.c
@@ -328,7 +328,7 @@
 {
 }
 
-struct seq_operations cpuinfo_op = {
+const struct seq_operations cpuinfo_op = {
 	.start =c_start,
 	.next =	c_next,
 	.stop =	c_stop,
diff --git a/arch/powerpc/mm/init_32.c b/arch/powerpc/mm/init_32.c
index 3ef5084..9ddcfb4 100644
--- a/arch/powerpc/mm/init_32.c
+++ b/arch/powerpc/mm/init_32.c
@@ -242,39 +242,3 @@
 }
 #endif
 
-#ifdef CONFIG_PROC_KCORE
-static struct kcore_list kcore_vmem;
-
-static int __init setup_kcore(void)
-{
-	int i;
-
-	for (i = 0; i < lmb.memory.cnt; i++) {
-		unsigned long base;
-		unsigned long size;
-		struct kcore_list *kcore_mem;
-
-		base = lmb.memory.region[i].base;
-		size = lmb.memory.region[i].size;
-
-		kcore_mem = kmalloc(sizeof(struct kcore_list), GFP_ATOMIC);
-		if (!kcore_mem)
-			panic("%s: kmalloc failed\n", __func__);
-
-		/* must stay under 32 bits */
-		if ( 0xfffffffful - (unsigned long)__va(base) < size) {
-			size = 0xfffffffful - (unsigned long)(__va(base));
-			printk(KERN_DEBUG "setup_kcore: restrict size=%lx\n",
-						size);
-		}
-
-		kclist_add(kcore_mem, __va(base), size);
-	}
-
-	kclist_add(&kcore_vmem, (void *)VMALLOC_START,
-		VMALLOC_END-VMALLOC_START);
-
-	return 0;
-}
-module_init(setup_kcore);
-#endif
diff --git a/arch/powerpc/mm/init_64.c b/arch/powerpc/mm/init_64.c
index 3158232..335c578 100644
--- a/arch/powerpc/mm/init_64.c
+++ b/arch/powerpc/mm/init_64.c
@@ -109,35 +109,6 @@
 }
 #endif
 
-#ifdef CONFIG_PROC_KCORE
-static struct kcore_list kcore_vmem;
-
-static int __init setup_kcore(void)
-{
-	int i;
-
-	for (i=0; i < lmb.memory.cnt; i++) {
-		unsigned long base, size;
-		struct kcore_list *kcore_mem;
-
-		base = lmb.memory.region[i].base;
-		size = lmb.memory.region[i].size;
-
-		/* GFP_ATOMIC to avoid might_sleep warnings during boot */
-		kcore_mem = kmalloc(sizeof(struct kcore_list), GFP_ATOMIC);
-		if (!kcore_mem)
-			panic("%s: kmalloc failed\n", __func__);
-
-		kclist_add(kcore_mem, __va(base), size);
-	}
-
-	kclist_add(&kcore_vmem, (void *)VMALLOC_START, VMALLOC_END-VMALLOC_START);
-
-	return 0;
-}
-module_init(setup_kcore);
-#endif
-
 static void pgd_ctor(void *addr)
 {
 	memset(addr, 0, PGD_TABLE_SIZE);
diff --git a/arch/powerpc/mm/mem.c b/arch/powerpc/mm/mem.c
index 0e5c59b..5973631 100644
--- a/arch/powerpc/mm/mem.c
+++ b/arch/powerpc/mm/mem.c
@@ -143,8 +143,8 @@
  * memory regions, find holes and callback for contiguous regions.
  */
 int
-walk_memory_resource(unsigned long start_pfn, unsigned long nr_pages, void *arg,
-			int (*func)(unsigned long, unsigned long, void *))
+walk_system_ram_range(unsigned long start_pfn, unsigned long nr_pages,
+		void *arg, int (*func)(unsigned long, unsigned long, void *))
 {
 	struct lmb_property res;
 	unsigned long pfn, len;
@@ -166,7 +166,7 @@
 	}
 	return ret;
 }
-EXPORT_SYMBOL_GPL(walk_memory_resource);
+EXPORT_SYMBOL_GPL(walk_system_ram_range);
 
 /*
  * Initialize the bootmem system and give it all the memory we
diff --git a/arch/powerpc/platforms/pseries/hvCall_inst.c b/arch/powerpc/platforms/pseries/hvCall_inst.c
index eae51ef..3631a4f 100644
--- a/arch/powerpc/platforms/pseries/hvCall_inst.c
+++ b/arch/powerpc/platforms/pseries/hvCall_inst.c
@@ -71,7 +71,7 @@
 	return 0;
 }
 
-static struct seq_operations hcall_inst_seq_ops = {
+static const struct seq_operations hcall_inst_seq_ops = {
         .start = hc_start,
         .next  = hc_next,
         .stop  = hc_stop,
diff --git a/arch/sh/mm/init.c b/arch/sh/mm/init.c
index fabb7c6..8173e38 100644
--- a/arch/sh/mm/init.c
+++ b/arch/sh/mm/init.c
@@ -186,8 +186,6 @@
 	set_fixmap_nocache(FIX_UNCACHED, __pa(&__uncached_start));
 }
 
-static struct kcore_list kcore_mem, kcore_vmalloc;
-
 void __init mem_init(void)
 {
 	int codesize, datasize, initsize;
@@ -226,10 +224,6 @@
 	datasize =  (unsigned long) &_edata - (unsigned long) &_etext;
 	initsize =  (unsigned long) &__init_end - (unsigned long) &__init_begin;
 
-	kclist_add(&kcore_mem, __va(0), max_low_pfn << PAGE_SHIFT);
-	kclist_add(&kcore_vmalloc, (void *)VMALLOC_START,
-		   VMALLOC_END - VMALLOC_START);
-
 	printk(KERN_INFO "Memory: %luk/%luk available (%dk kernel code, "
 	       "%dk data, %dk init)\n",
 		nr_free_pages() << (PAGE_SHIFT-10),
diff --git a/arch/sparc/include/asm/vio.h b/arch/sparc/include/asm/vio.h
index d4de32f..6cdbf7e 100644
--- a/arch/sparc/include/asm/vio.h
+++ b/arch/sparc/include/asm/vio.h
@@ -258,7 +258,7 @@
 static inline u32 vio_dring_avail(struct vio_dring_state *dr,
 				  unsigned int ring_size)
 {
-	BUILD_BUG_ON(!is_power_of_2(ring_size));
+	MAYBE_BUILD_BUG_ON(!is_power_of_2(ring_size));
 
 	return (dr->pending -
 		((dr->prod - dr->cons) & (ring_size - 1)));
diff --git a/arch/x86/Kconfig b/arch/x86/Kconfig
index e4ff5d1..7c7a54b 100644
--- a/arch/x86/Kconfig
+++ b/arch/x86/Kconfig
@@ -1204,6 +1204,10 @@
 	def_bool y
 	depends on NUMA && X86_32
 
+config ARCH_PROC_KCORE_TEXT
+	def_bool y
+	depends on X86_64 && PROC_KCORE
+
 config ARCH_SPARSEMEM_DEFAULT
 	def_bool y
 	depends on X86_64
diff --git a/arch/x86/include/asm/syscall.h b/arch/x86/include/asm/syscall.h
index d82f39b..8d33bc5 100644
--- a/arch/x86/include/asm/syscall.h
+++ b/arch/x86/include/asm/syscall.h
@@ -1,7 +1,7 @@
 /*
  * Access to user system call parameters and results
  *
- * Copyright (C) 2008 Red Hat, Inc.  All rights reserved.
+ * Copyright (C) 2008-2009 Red Hat, Inc.  All rights reserved.
  *
  * This copyrighted material is made available to anyone wishing to use,
  * modify, copy, or redistribute it subject to the terms and conditions
@@ -16,13 +16,13 @@
 #include <linux/sched.h>
 #include <linux/err.h>
 
-static inline long syscall_get_nr(struct task_struct *task,
-				  struct pt_regs *regs)
+/*
+ * Only the low 32 bits of orig_ax are meaningful, so we return int.
+ * This importantly ignores the high bits on 64-bit, so comparisons
+ * sign-extend the low 32 bits.
+ */
+static inline int syscall_get_nr(struct task_struct *task, struct pt_regs *regs)
 {
-	/*
-	 * We always sign-extend a -1 value being set here,
-	 * so this is always either -1L or a syscall number.
-	 */
 	return regs->orig_ax;
 }
 
diff --git a/arch/x86/kernel/ptrace.c b/arch/x86/kernel/ptrace.c
index 8d7d5c9..7b058a2 100644
--- a/arch/x86/kernel/ptrace.c
+++ b/arch/x86/kernel/ptrace.c
@@ -325,16 +325,6 @@
 		return set_flags(child, value);
 
 #ifdef CONFIG_X86_64
-	/*
-	 * Orig_ax is really just a flag with small positive and
-	 * negative values, so make sure to always sign-extend it
-	 * from 32 bits so that it works correctly regardless of
-	 * whether we come from a 32-bit environment or not.
-	 */
-	case offsetof(struct user_regs_struct, orig_ax):
-		value = (long) (s32) value;
-		break;
-
 	case offsetof(struct user_regs_struct,fs_base):
 		if (value >= TASK_SIZE_OF(child))
 			return -EIO;
@@ -1126,10 +1116,15 @@
 
 	case offsetof(struct user32, regs.orig_eax):
 		/*
-		 * Sign-extend the value so that orig_eax = -1
-		 * causes (long)orig_ax < 0 tests to fire correctly.
+		 * A 32-bit debugger setting orig_eax means to restore
+		 * the state of the task restarting a 32-bit syscall.
+		 * Make sure we interpret the -ERESTART* codes correctly
+		 * in case the task is not actually still sitting at the
+		 * exit from a 32-bit syscall with TS_COMPAT still set.
 		 */
-		regs->orig_ax = (long) (s32) value;
+		regs->orig_ax = value;
+		if (syscall_get_nr(child, regs) >= 0)
+			task_thread_info(child)->status |= TS_COMPAT;
 		break;
 
 	case offsetof(struct user32, regs.eflags):
diff --git a/arch/x86/mm/init_32.c b/arch/x86/mm/init_32.c
index b49b4f6..30938c1 100644
--- a/arch/x86/mm/init_32.c
+++ b/arch/x86/mm/init_32.c
@@ -857,8 +857,6 @@
 	}
 }
 
-static struct kcore_list kcore_mem, kcore_vmalloc;
-
 void __init mem_init(void)
 {
 	int codesize, reservedpages, datasize, initsize;
@@ -886,10 +884,6 @@
 	datasize =  (unsigned long) &_edata - (unsigned long) &_etext;
 	initsize =  (unsigned long) &__init_end - (unsigned long) &__init_begin;
 
-	kclist_add(&kcore_mem, __va(0), max_low_pfn << PAGE_SHIFT);
-	kclist_add(&kcore_vmalloc, (void *)VMALLOC_START,
-		   VMALLOC_END-VMALLOC_START);
-
 	printk(KERN_INFO "Memory: %luk/%luk available (%dk kernel code, "
 			"%dk reserved, %dk data, %dk init, %ldk highmem)\n",
 		nr_free_pages() << (PAGE_SHIFT-10),
diff --git a/arch/x86/mm/init_64.c b/arch/x86/mm/init_64.c
index 810bd31..5a4398a 100644
--- a/arch/x86/mm/init_64.c
+++ b/arch/x86/mm/init_64.c
@@ -647,8 +647,7 @@
 
 #endif /* CONFIG_MEMORY_HOTPLUG */
 
-static struct kcore_list kcore_mem, kcore_vmalloc, kcore_kernel,
-			 kcore_modules, kcore_vsyscall;
+static struct kcore_list kcore_vsyscall;
 
 void __init mem_init(void)
 {
@@ -677,13 +676,8 @@
 	initsize =  (unsigned long) &__init_end - (unsigned long) &__init_begin;
 
 	/* Register memory areas for /proc/kcore */
-	kclist_add(&kcore_mem, __va(0), max_low_pfn << PAGE_SHIFT);
-	kclist_add(&kcore_vmalloc, (void *)VMALLOC_START,
-		   VMALLOC_END-VMALLOC_START);
-	kclist_add(&kcore_kernel, &_stext, _end - _stext);
-	kclist_add(&kcore_modules, (void *)MODULES_VADDR, MODULES_LEN);
 	kclist_add(&kcore_vsyscall, (void *)VSYSCALL_START,
-				 VSYSCALL_END - VSYSCALL_START);
+			 VSYSCALL_END - VSYSCALL_START, KCORE_OTHER);
 
 	printk(KERN_INFO "Memory: %luk/%luk available (%ldk kernel code, "
 			 "%ldk absent, %ldk reserved, %ldk data, %ldk init)\n",
diff --git a/drivers/block/DAC960.c b/drivers/block/DAC960.c
index c77b6f3..6fa7b0f 100644
--- a/drivers/block/DAC960.c
+++ b/drivers/block/DAC960.c
@@ -6562,7 +6562,7 @@
   if (copy_from_user(CommandBuffer, Buffer, Count)) return -EFAULT;
   CommandBuffer[Count] = '\0';
   Length = strlen(CommandBuffer);
-  if (CommandBuffer[Length-1] == '\n')
+  if (Length > 0 && CommandBuffer[Length-1] == '\n')
     CommandBuffer[--Length] = '\0';
   if (Controller->FirmwareType == DAC960_V1_Controller)
     return (DAC960_V1_ExecuteUserCommand(Controller, CommandBuffer)
diff --git a/drivers/block/cciss.c b/drivers/block/cciss.c
index 4f19105f..24c3e21 100644
--- a/drivers/block/cciss.c
+++ b/drivers/block/cciss.c
@@ -363,7 +363,7 @@
 	h->busy_configuring = 0;
 }
 
-static struct seq_operations cciss_seq_ops = {
+static const struct seq_operations cciss_seq_ops = {
 	.start = cciss_seq_start,
 	.show  = cciss_seq_show,
 	.next  = cciss_seq_next,
diff --git a/drivers/char/misc.c b/drivers/char/misc.c
index 1ee27cc..07fa612 100644
--- a/drivers/char/misc.c
+++ b/drivers/char/misc.c
@@ -91,7 +91,7 @@
 }
 
 
-static struct seq_operations misc_seq_ops = {
+static const struct seq_operations misc_seq_ops = {
 	.start = misc_seq_start,
 	.next  = misc_seq_next,
 	.stop  = misc_seq_stop,
diff --git a/drivers/char/tpm/tpm.c b/drivers/char/tpm/tpm.c
index b0603b2..32b957e 100644
--- a/drivers/char/tpm/tpm.c
+++ b/drivers/char/tpm/tpm.c
@@ -696,7 +696,7 @@
 
 	cmd.header.in = pcrread_header;
 	cmd.params.pcrread_in.pcr_idx = cpu_to_be32(pcr_idx);
-	BUILD_BUG_ON(cmd.header.in.length > READ_PCR_RESULT_SIZE);
+	BUG_ON(cmd.header.in.length > READ_PCR_RESULT_SIZE);
 	rc = transmit_cmd(chip, &cmd, cmd.header.in.length,
 			  "attempting to read a pcr value");
 
@@ -760,7 +760,7 @@
 		return -ENODEV;
 
 	cmd.header.in = pcrextend_header;
-	BUILD_BUG_ON(be32_to_cpu(cmd.header.in.length) > EXTEND_PCR_SIZE);
+	BUG_ON(be32_to_cpu(cmd.header.in.length) > EXTEND_PCR_SIZE);
 	cmd.params.pcrextend_in.pcr_idx = cpu_to_be32(pcr_idx);
 	memcpy(cmd.params.pcrextend_in.hash, hash, TPM_DIGEST_SIZE);
 	rc = transmit_cmd(chip, &cmd, cmd.header.in.length,
diff --git a/drivers/char/tpm/tpm_bios.c b/drivers/char/tpm/tpm_bios.c
index 0c2f55a..bf2170f 100644
--- a/drivers/char/tpm/tpm_bios.c
+++ b/drivers/char/tpm/tpm_bios.c
@@ -343,14 +343,14 @@
 	return 0;
 }
 
-static struct seq_operations tpm_ascii_b_measurments_seqops = {
+static const struct seq_operations tpm_ascii_b_measurments_seqops = {
 	.start = tpm_bios_measurements_start,
 	.next = tpm_bios_measurements_next,
 	.stop = tpm_bios_measurements_stop,
 	.show = tpm_ascii_bios_measurements_show,
 };
 
-static struct seq_operations tpm_binary_b_measurments_seqops = {
+static const struct seq_operations tpm_binary_b_measurments_seqops = {
 	.start = tpm_bios_measurements_start,
 	.next = tpm_bios_measurements_next,
 	.stop = tpm_bios_measurements_stop,
diff --git a/drivers/connector/cn_proc.c b/drivers/connector/cn_proc.c
index 85e5dc0..abf4a25 100644
--- a/drivers/connector/cn_proc.c
+++ b/drivers/connector/cn_proc.c
@@ -139,6 +139,31 @@
 	cn_netlink_send(msg, CN_IDX_PROC, GFP_KERNEL);
 }
 
+void proc_sid_connector(struct task_struct *task)
+{
+	struct cn_msg *msg;
+	struct proc_event *ev;
+	struct timespec ts;
+	__u8 buffer[CN_PROC_MSG_SIZE];
+
+	if (atomic_read(&proc_event_num_listeners) < 1)
+		return;
+
+	msg = (struct cn_msg *)buffer;
+	ev = (struct proc_event *)msg->data;
+	get_seq(&msg->seq, &ev->cpu);
+	ktime_get_ts(&ts); /* get high res monotonic timestamp */
+	put_unaligned(timespec_to_ns(&ts), (__u64 *)&ev->timestamp_ns);
+	ev->what = PROC_EVENT_SID;
+	ev->event_data.sid.process_pid = task->pid;
+	ev->event_data.sid.process_tgid = task->tgid;
+
+	memcpy(&msg->id, &cn_proc_event_id, sizeof(msg->id));
+	msg->ack = 0; /* not used */
+	msg->len = sizeof(*ev);
+	cn_netlink_send(msg, CN_IDX_PROC, GFP_KERNEL);
+}
+
 void proc_exit_connector(struct task_struct *task)
 {
 	struct cn_msg *msg;
diff --git a/drivers/gpio/Kconfig b/drivers/gpio/Kconfig
index 6b4c484..2ad0128 100644
--- a/drivers/gpio/Kconfig
+++ b/drivers/gpio/Kconfig
@@ -162,6 +162,16 @@
 	  Say yes here to access the GPIO signals of WM831x power management
 	  chips from Wolfson Microelectronics.
 
+config GPIO_ADP5520
+	tristate "GPIO Support for ADP5520 PMIC"
+	depends on PMIC_ADP5520
+	help
+	  This option enables support for on-chip GPIO found
+	  on Analog Devices ADP5520 PMICs.
+
+	  To compile this driver as a module, choose M here: the module will
+	  be called adp5520-gpio.
+
 comment "PCI GPIO expanders:"
 
 config GPIO_BT8XX
@@ -180,6 +190,12 @@
 
 	  If unsure, say N.
 
+config GPIO_LANGWELL
+	bool "Intel Moorestown Platform Langwell GPIO support"
+	depends on PCI
+	help
+	  Say Y here to support Intel Moorestown platform GPIO.
+
 comment "SPI GPIO expanders:"
 
 config GPIO_MAX7301
@@ -195,4 +211,23 @@
 	  SPI driver for Microchip MCP23S08 I/O expander.  This provides
 	  a GPIO interface supporting inputs and outputs.
 
+config GPIO_MC33880
+	tristate "Freescale MC33880 high-side/low-side switch"
+	depends on SPI_MASTER
+	help
+	  SPI driver for Freescale MC33880 high-side/low-side switch.
+	  This provides GPIO interface supporting inputs and outputs.
+
+comment "AC97 GPIO expanders:"
+
+config GPIO_UCB1400
+	bool "Philips UCB1400 GPIO"
+	depends on UCB1400_CORE
+	help
+	  This enables support for the Philips UCB1400 GPIO pins.
+	  The UCB1400 is an AC97 audio codec.
+
+	  To compile this driver as a module, choose M here: the
+	  module will be called ucb1400_gpio.
+
 endif
diff --git a/drivers/gpio/Makefile b/drivers/gpio/Makefile
index ea7c745..00a532c 100644
--- a/drivers/gpio/Makefile
+++ b/drivers/gpio/Makefile
@@ -4,13 +4,17 @@
 
 obj-$(CONFIG_GPIOLIB)		+= gpiolib.o
 
+obj-$(CONFIG_GPIO_ADP5520)	+= adp5520-gpio.o
+obj-$(CONFIG_GPIO_LANGWELL)	+= langwell_gpio.o
 obj-$(CONFIG_GPIO_MAX7301)	+= max7301.o
 obj-$(CONFIG_GPIO_MAX732X)	+= max732x.o
+obj-$(CONFIG_GPIO_MC33880)	+= mc33880.o
 obj-$(CONFIG_GPIO_MCP23S08)	+= mcp23s08.o
 obj-$(CONFIG_GPIO_PCA953X)	+= pca953x.o
 obj-$(CONFIG_GPIO_PCF857X)	+= pcf857x.o
 obj-$(CONFIG_GPIO_PL061)	+= pl061.o
 obj-$(CONFIG_GPIO_TWL4030)	+= twl4030-gpio.o
+obj-$(CONFIG_GPIO_UCB1400)	+= ucb1400_gpio.o
 obj-$(CONFIG_GPIO_XILINX)	+= xilinx_gpio.o
 obj-$(CONFIG_GPIO_BT8XX)	+= bt8xxgpio.o
 obj-$(CONFIG_GPIO_VR41XX)	+= vr41xx_giu.o
diff --git a/drivers/gpio/adp5520-gpio.c b/drivers/gpio/adp5520-gpio.c
new file mode 100644
index 0000000..ad05bbc
--- /dev/null
+++ b/drivers/gpio/adp5520-gpio.c
@@ -0,0 +1,206 @@
+/*
+ * GPIO driver for Analog Devices ADP5520 MFD PMICs
+ *
+ * Copyright 2009 Analog Devices Inc.
+ *
+ * Licensed under the GPL-2 or later.
+ */
+
+#include <linux/module.h>
+#include <linux/kernel.h>
+#include <linux/init.h>
+#include <linux/platform_device.h>
+#include <linux/mfd/adp5520.h>
+
+#include <linux/gpio.h>
+
+struct adp5520_gpio {
+	struct device *master;
+	struct gpio_chip gpio_chip;
+	unsigned char lut[ADP5520_MAXGPIOS];
+	unsigned long output;
+};
+
+static int adp5520_gpio_get_value(struct gpio_chip *chip, unsigned off)
+{
+	struct adp5520_gpio *dev;
+	uint8_t reg_val;
+
+	dev = container_of(chip, struct adp5520_gpio, gpio_chip);
+
+	/*
+	 * There are dedicated registers for GPIO IN/OUT.
+	 * Make sure we return the right value, even when configured as output
+	 */
+
+	if (test_bit(off, &dev->output))
+		adp5520_read(dev->master, GPIO_OUT, &reg_val);
+	else
+		adp5520_read(dev->master, GPIO_IN, &reg_val);
+
+	return !!(reg_val & dev->lut[off]);
+}
+
+static void adp5520_gpio_set_value(struct gpio_chip *chip,
+		unsigned off, int val)
+{
+	struct adp5520_gpio *dev;
+	dev = container_of(chip, struct adp5520_gpio, gpio_chip);
+
+	if (val)
+		adp5520_set_bits(dev->master, GPIO_OUT, dev->lut[off]);
+	else
+		adp5520_clr_bits(dev->master, GPIO_OUT, dev->lut[off]);
+}
+
+static int adp5520_gpio_direction_input(struct gpio_chip *chip, unsigned off)
+{
+	struct adp5520_gpio *dev;
+	dev = container_of(chip, struct adp5520_gpio, gpio_chip);
+
+	clear_bit(off, &dev->output);
+
+	return adp5520_clr_bits(dev->master, GPIO_CFG_2, dev->lut[off]);
+}
+
+static int adp5520_gpio_direction_output(struct gpio_chip *chip,
+		unsigned off, int val)
+{
+	struct adp5520_gpio *dev;
+	int ret = 0;
+	dev = container_of(chip, struct adp5520_gpio, gpio_chip);
+
+	set_bit(off, &dev->output);
+
+	if (val)
+		ret |= adp5520_set_bits(dev->master, GPIO_OUT, dev->lut[off]);
+	else
+		ret |= adp5520_clr_bits(dev->master, GPIO_OUT, dev->lut[off]);
+
+	ret |= adp5520_set_bits(dev->master, GPIO_CFG_2, dev->lut[off]);
+
+	return ret;
+}
+
+static int __devinit adp5520_gpio_probe(struct platform_device *pdev)
+{
+	struct adp5520_gpio_platfrom_data *pdata = pdev->dev.platform_data;
+	struct adp5520_gpio *dev;
+	struct gpio_chip *gc;
+	int ret, i, gpios;
+	unsigned char ctl_mask = 0;
+
+	if (pdata == NULL) {
+		dev_err(&pdev->dev, "missing platform data\n");
+		return -ENODEV;
+	}
+
+	if (pdev->id != ID_ADP5520) {
+		dev_err(&pdev->dev, "only ADP5520 supports GPIO\n");
+		return -ENODEV;
+	}
+
+	dev = kzalloc(sizeof(*dev), GFP_KERNEL);
+	if (dev == NULL) {
+		dev_err(&pdev->dev, "failed to alloc memory\n");
+		return -ENOMEM;
+	}
+
+	dev->master = pdev->dev.parent;
+
+	for (gpios = 0, i = 0; i < ADP5520_MAXGPIOS; i++)
+		if (pdata->gpio_en_mask & (1 << i))
+			dev->lut[gpios++] = 1 << i;
+
+	if (gpios < 1) {
+		ret = -EINVAL;
+		goto err;
+	}
+
+	gc = &dev->gpio_chip;
+	gc->direction_input  = adp5520_gpio_direction_input;
+	gc->direction_output = adp5520_gpio_direction_output;
+	gc->get = adp5520_gpio_get_value;
+	gc->set = adp5520_gpio_set_value;
+	gc->can_sleep = 1;
+
+	gc->base = pdata->gpio_start;
+	gc->ngpio = gpios;
+	gc->label = pdev->name;
+	gc->owner = THIS_MODULE;
+
+	ret = adp5520_clr_bits(dev->master, GPIO_CFG_1,
+		pdata->gpio_en_mask);
+
+	if (pdata->gpio_en_mask & GPIO_C3)
+		ctl_mask |= C3_MODE;
+
+	if (pdata->gpio_en_mask & GPIO_R3)
+		ctl_mask |= R3_MODE;
+
+	if (ctl_mask)
+		ret = adp5520_set_bits(dev->master, LED_CONTROL,
+			ctl_mask);
+
+	ret |= adp5520_set_bits(dev->master, GPIO_PULLUP,
+		pdata->gpio_pullup_mask);
+
+	if (ret) {
+		dev_err(&pdev->dev, "failed to write\n");
+		goto err;
+	}
+
+	ret = gpiochip_add(&dev->gpio_chip);
+	if (ret)
+		goto err;
+
+	platform_set_drvdata(pdev, dev);
+	return 0;
+
+err:
+	kfree(dev);
+	return ret;
+}
+
+static int __devexit adp5520_gpio_remove(struct platform_device *pdev)
+{
+	struct adp5520_gpio *dev;
+	int ret;
+
+	dev = platform_get_drvdata(pdev);
+	ret = gpiochip_remove(&dev->gpio_chip);
+	if (ret) {
+		dev_err(&pdev->dev, "%s failed, %d\n",
+				"gpiochip_remove()", ret);
+		return ret;
+	}
+
+	kfree(dev);
+	return 0;
+}
+
+static struct platform_driver adp5520_gpio_driver = {
+	.driver	= {
+		.name	= "adp5520-gpio",
+		.owner	= THIS_MODULE,
+	},
+	.probe		= adp5520_gpio_probe,
+	.remove		= __devexit_p(adp5520_gpio_remove),
+};
+
+static int __init adp5520_gpio_init(void)
+{
+	return platform_driver_register(&adp5520_gpio_driver);
+}
+module_init(adp5520_gpio_init);
+
+static void __exit adp5520_gpio_exit(void)
+{
+	platform_driver_unregister(&adp5520_gpio_driver);
+}
+module_exit(adp5520_gpio_exit);
+
+MODULE_AUTHOR("Michael Hennerich <hennerich@blackfin.uclinux.org>");
+MODULE_DESCRIPTION("GPIO ADP5520 Driver");
+MODULE_LICENSE("GPL");
+MODULE_ALIAS("platform:adp5520-gpio");
diff --git a/drivers/gpio/bt8xxgpio.c b/drivers/gpio/bt8xxgpio.c
index 5590414..2559f22 100644
--- a/drivers/gpio/bt8xxgpio.c
+++ b/drivers/gpio/bt8xxgpio.c
@@ -46,8 +46,7 @@
 #include <linux/module.h>
 #include <linux/pci.h>
 #include <linux/spinlock.h>
-
-#include <asm/gpio.h>
+#include <linux/gpio.h>
 
 /* Steal the hardware definitions from the bttv driver. */
 #include "../media/video/bt8xx/bt848.h"
diff --git a/drivers/gpio/gpiolib.c b/drivers/gpio/gpiolib.c
index 51a8d41..bb11a42 100644
--- a/drivers/gpio/gpiolib.c
+++ b/drivers/gpio/gpiolib.c
@@ -1,5 +1,6 @@
 #include <linux/kernel.h>
 #include <linux/module.h>
+#include <linux/interrupt.h>
 #include <linux/irq.h>
 #include <linux/spinlock.h>
 #include <linux/device.h>
@@ -7,6 +8,7 @@
 #include <linux/debugfs.h>
 #include <linux/seq_file.h>
 #include <linux/gpio.h>
+#include <linux/idr.h>
 
 
 /* Optional implementation infrastructure for GPIO interfaces.
@@ -49,6 +51,13 @@
 #define FLAG_RESERVED	2
 #define FLAG_EXPORT	3	/* protected by sysfs_lock */
 #define FLAG_SYSFS	4	/* exported via /sys/class/gpio/control */
+#define FLAG_TRIG_FALL	5	/* trigger on falling edge */
+#define FLAG_TRIG_RISE	6	/* trigger on rising edge */
+
+#define PDESC_ID_SHIFT	16	/* add new flags before this one */
+
+#define GPIO_FLAGS_MASK		((1 << PDESC_ID_SHIFT) - 1)
+#define GPIO_TRIGGER_MASK	(BIT(FLAG_TRIG_FALL) | BIT(FLAG_TRIG_RISE))
 
 #ifdef CONFIG_DEBUG_FS
 	const char		*label;
@@ -56,6 +65,15 @@
 };
 static struct gpio_desc gpio_desc[ARCH_NR_GPIOS];
 
+#ifdef CONFIG_GPIO_SYSFS
+struct poll_desc {
+	struct work_struct	work;
+	struct sysfs_dirent	*value_sd;
+};
+
+static struct idr pdesc_idr;
+#endif
+
 static inline void desc_set_label(struct gpio_desc *d, const char *label)
 {
 #ifdef CONFIG_DEBUG_FS
@@ -188,10 +206,10 @@
  *   /value
  *      * always readable, subject to hardware behavior
  *      * may be writable, as zero/nonzero
- *
- * REVISIT there will likely be an attribute for configuring async
- * notifications, e.g. to specify polling interval or IRQ trigger type
- * that would for example trigger a poll() on the "value".
+ *   /edge
+ *      * configures behavior of poll(2) on /value
+ *      * available only if pin can generate IRQs on input
+ *      * is read/write as "none", "falling", "rising", or "both"
  */
 
 static ssize_t gpio_direction_show(struct device *dev,
@@ -288,6 +306,175 @@
 static /*const*/ DEVICE_ATTR(value, 0644,
 		gpio_value_show, gpio_value_store);
 
+static irqreturn_t gpio_sysfs_irq(int irq, void *priv)
+{
+	struct work_struct	*work = priv;
+
+	schedule_work(work);
+	return IRQ_HANDLED;
+}
+
+static void gpio_notify_sysfs(struct work_struct *work)
+{
+	struct poll_desc	*pdesc;
+
+	pdesc = container_of(work, struct poll_desc, work);
+	sysfs_notify_dirent(pdesc->value_sd);
+}
+
+static int gpio_setup_irq(struct gpio_desc *desc, struct device *dev,
+		unsigned long gpio_flags)
+{
+	struct poll_desc	*pdesc;
+	unsigned long		irq_flags;
+	int			ret, irq, id;
+
+	if ((desc->flags & GPIO_TRIGGER_MASK) == gpio_flags)
+		return 0;
+
+	irq = gpio_to_irq(desc - gpio_desc);
+	if (irq < 0)
+		return -EIO;
+
+	id = desc->flags >> PDESC_ID_SHIFT;
+	pdesc = idr_find(&pdesc_idr, id);
+	if (pdesc) {
+		free_irq(irq, &pdesc->work);
+		cancel_work_sync(&pdesc->work);
+	}
+
+	desc->flags &= ~GPIO_TRIGGER_MASK;
+
+	if (!gpio_flags) {
+		ret = 0;
+		goto free_sd;
+	}
+
+	irq_flags = IRQF_SHARED;
+	if (test_bit(FLAG_TRIG_FALL, &gpio_flags))
+		irq_flags |= IRQF_TRIGGER_FALLING;
+	if (test_bit(FLAG_TRIG_RISE, &gpio_flags))
+		irq_flags |= IRQF_TRIGGER_RISING;
+
+	if (!pdesc) {
+		pdesc = kmalloc(sizeof(*pdesc), GFP_KERNEL);
+		if (!pdesc) {
+			ret = -ENOMEM;
+			goto err_out;
+		}
+
+		do {
+			ret = -ENOMEM;
+			if (idr_pre_get(&pdesc_idr, GFP_KERNEL))
+				ret = idr_get_new_above(&pdesc_idr,
+						pdesc, 1, &id);
+		} while (ret == -EAGAIN);
+
+		if (ret)
+			goto free_mem;
+
+		desc->flags &= GPIO_FLAGS_MASK;
+		desc->flags |= (unsigned long)id << PDESC_ID_SHIFT;
+
+		if (desc->flags >> PDESC_ID_SHIFT != id) {
+			ret = -ERANGE;
+			goto free_id;
+		}
+
+		pdesc->value_sd = sysfs_get_dirent(dev->kobj.sd, "value");
+		if (!pdesc->value_sd) {
+			ret = -ENODEV;
+			goto free_id;
+		}
+		INIT_WORK(&pdesc->work, gpio_notify_sysfs);
+	}
+
+	ret = request_irq(irq, gpio_sysfs_irq, irq_flags,
+			"gpiolib", &pdesc->work);
+	if (ret)
+		goto free_sd;
+
+	desc->flags |= gpio_flags;
+	return 0;
+
+free_sd:
+	sysfs_put(pdesc->value_sd);
+free_id:
+	idr_remove(&pdesc_idr, id);
+	desc->flags &= GPIO_FLAGS_MASK;
+free_mem:
+	kfree(pdesc);
+err_out:
+	return ret;
+}
+
+static const struct {
+	const char *name;
+	unsigned long flags;
+} trigger_types[] = {
+	{ "none",    0 },
+	{ "falling", BIT(FLAG_TRIG_FALL) },
+	{ "rising",  BIT(FLAG_TRIG_RISE) },
+	{ "both",    BIT(FLAG_TRIG_FALL) | BIT(FLAG_TRIG_RISE) },
+};
+
+static ssize_t gpio_edge_show(struct device *dev,
+		struct device_attribute *attr, char *buf)
+{
+	const struct gpio_desc	*desc = dev_get_drvdata(dev);
+	ssize_t			status;
+
+	mutex_lock(&sysfs_lock);
+
+	if (!test_bit(FLAG_EXPORT, &desc->flags))
+		status = -EIO;
+	else {
+		int i;
+
+		status = 0;
+		for (i = 0; i < ARRAY_SIZE(trigger_types); i++)
+			if ((desc->flags & GPIO_TRIGGER_MASK)
+					== trigger_types[i].flags) {
+				status = sprintf(buf, "%s\n",
+						 trigger_types[i].name);
+				break;
+			}
+	}
+
+	mutex_unlock(&sysfs_lock);
+	return status;
+}
+
+static ssize_t gpio_edge_store(struct device *dev,
+		struct device_attribute *attr, const char *buf, size_t size)
+{
+	struct gpio_desc	*desc = dev_get_drvdata(dev);
+	ssize_t			status;
+	int			i;
+
+	for (i = 0; i < ARRAY_SIZE(trigger_types); i++)
+		if (sysfs_streq(trigger_types[i].name, buf))
+			goto found;
+	return -EINVAL;
+
+found:
+	mutex_lock(&sysfs_lock);
+
+	if (!test_bit(FLAG_EXPORT, &desc->flags))
+		status = -EIO;
+	else {
+		status = gpio_setup_irq(desc, dev, trigger_types[i].flags);
+		if (!status)
+			status = size;
+	}
+
+	mutex_unlock(&sysfs_lock);
+
+	return status;
+}
+
+static DEVICE_ATTR(edge, 0644, gpio_edge_show, gpio_edge_store);
+
 static const struct attribute *gpio_attrs[] = {
 	&dev_attr_direction.attr,
 	&dev_attr_value.attr,
@@ -473,7 +660,7 @@
 		struct device	*dev;
 
 		dev = device_create(&gpio_class, desc->chip->dev, MKDEV(0, 0),
-				    desc, ioname ? ioname : "gpio%d", gpio);
+				desc, ioname ? ioname : "gpio%d", gpio);
 		if (dev) {
 			if (direction_may_change)
 				status = sysfs_create_group(&dev->kobj,
@@ -481,6 +668,14 @@
 			else
 				status = device_create_file(dev,
 						&dev_attr_value);
+
+			if (!status && gpio_to_irq(gpio) >= 0
+					&& (direction_may_change
+						|| !test_bit(FLAG_IS_OUT,
+							&desc->flags)))
+				status = device_create_file(dev,
+						&dev_attr_edge);
+
 			if (status != 0)
 				device_unregister(dev);
 		} else
@@ -505,6 +700,51 @@
 }
 
 /**
+ * gpio_export_link - create a sysfs link to an exported GPIO node
+ * @dev: device under which to create symlink
+ * @name: name of the symlink
+ * @gpio: gpio to create symlink to, already exported
+ *
+ * Set up a symlink from /sys/.../dev/name to /sys/class/gpio/gpioN
+ * node. Caller is responsible for unlinking.
+ *
+ * Returns zero on success, else an error.
+ */
+int gpio_export_link(struct device *dev, const char *name, unsigned gpio)
+{
+	struct gpio_desc	*desc;
+	int			status = -EINVAL;
+
+	if (!gpio_is_valid(gpio))
+		goto done;
+
+	mutex_lock(&sysfs_lock);
+
+	desc = &gpio_desc[gpio];
+
+	if (test_bit(FLAG_EXPORT, &desc->flags)) {
+		struct device *tdev;
+
+		tdev = class_find_device(&gpio_class, NULL, desc, match_export);
+		if (tdev != NULL) {
+			status = sysfs_create_link(&dev->kobj, &tdev->kobj,
+						name);
+		} else {
+			status = -ENODEV;
+		}
+	}
+
+	mutex_unlock(&sysfs_lock);
+
+done:
+	if (status)
+		pr_debug("%s: gpio%d status %d\n", __func__, gpio, status);
+
+	return status;
+}
+EXPORT_SYMBOL_GPL(gpio_export_link);
+
+/**
  * gpio_unexport - reverse effect of gpio_export()
  * @gpio: gpio to make unavailable
  *
@@ -527,6 +767,7 @@
 
 		dev = class_find_device(&gpio_class, NULL, desc, match_export);
 		if (dev) {
+			gpio_setup_irq(desc, dev, 0);
 			clear_bit(FLAG_EXPORT, &desc->flags);
 			put_device(dev);
 			device_unregister(dev);
@@ -611,6 +852,8 @@
 	unsigned long	flags;
 	unsigned	gpio;
 
+	idr_init(&pdesc_idr);
+
 	status = class_register(&gpio_class);
 	if (status < 0)
 		return status;
diff --git a/drivers/gpio/langwell_gpio.c b/drivers/gpio/langwell_gpio.c
new file mode 100644
index 0000000..5711ce5
--- /dev/null
+++ b/drivers/gpio/langwell_gpio.c
@@ -0,0 +1,297 @@
+/* langwell_gpio.c Moorestown platform Langwell chip GPIO driver
+ * Copyright (c) 2008 - 2009,  Intel Corporation.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
+ */
+
+/* Supports:
+ * Moorestown platform Langwell chip.
+ */
+
+#include <linux/module.h>
+#include <linux/pci.h>
+#include <linux/kernel.h>
+#include <linux/delay.h>
+#include <linux/stddef.h>
+#include <linux/interrupt.h>
+#include <linux/init.h>
+#include <linux/irq.h>
+#include <linux/io.h>
+#include <linux/gpio.h>
+
+struct lnw_gpio_register {
+	u32	GPLR[2];
+	u32	GPDR[2];
+	u32	GPSR[2];
+	u32	GPCR[2];
+	u32	GRER[2];
+	u32	GFER[2];
+	u32	GEDR[2];
+};
+
+struct lnw_gpio {
+	struct gpio_chip		chip;
+	struct lnw_gpio_register 	*reg_base;
+	spinlock_t			lock;
+	unsigned			irq_base;
+};
+
+static int lnw_gpio_get(struct gpio_chip *chip, unsigned offset)
+{
+	struct lnw_gpio *lnw = container_of(chip, struct lnw_gpio, chip);
+	u8 reg = offset / 32;
+	void __iomem *gplr;
+
+	gplr = (void __iomem *)(&lnw->reg_base->GPLR[reg]);
+	return readl(gplr) & BIT(offset % 32);
+}
+
+static void lnw_gpio_set(struct gpio_chip *chip, unsigned offset, int value)
+{
+	struct lnw_gpio *lnw = container_of(chip, struct lnw_gpio, chip);
+	u8 reg = offset / 32;
+	void __iomem *gpsr, *gpcr;
+
+	if (value) {
+		gpsr = (void __iomem *)(&lnw->reg_base->GPSR[reg]);
+		writel(BIT(offset % 32), gpsr);
+	} else {
+		gpcr = (void __iomem *)(&lnw->reg_base->GPCR[reg]);
+		writel(BIT(offset % 32), gpcr);
+	}
+}
+
+static int lnw_gpio_direction_input(struct gpio_chip *chip, unsigned offset)
+{
+	struct lnw_gpio *lnw = container_of(chip, struct lnw_gpio, chip);
+	u8 reg = offset / 32;
+	u32 value;
+	unsigned long flags;
+	void __iomem *gpdr;
+
+	gpdr = (void __iomem *)(&lnw->reg_base->GPDR[reg]);
+	spin_lock_irqsave(&lnw->lock, flags);
+	value = readl(gpdr);
+	value &= ~BIT(offset % 32);
+	writel(value, gpdr);
+	spin_unlock_irqrestore(&lnw->lock, flags);
+	return 0;
+}
+
+static int lnw_gpio_direction_output(struct gpio_chip *chip,
+			unsigned offset, int value)
+{
+	struct lnw_gpio *lnw = container_of(chip, struct lnw_gpio, chip);
+	u8 reg = offset / 32;
+	unsigned long flags;
+	void __iomem *gpdr;
+
+	lnw_gpio_set(chip, offset, value);
+	gpdr = (void __iomem *)(&lnw->reg_base->GPDR[reg]);
+	spin_lock_irqsave(&lnw->lock, flags);
+	value = readl(gpdr);
+	value |= BIT(offset % 32);;
+	writel(value, gpdr);
+	spin_unlock_irqrestore(&lnw->lock, flags);
+	return 0;
+}
+
+static int lnw_gpio_to_irq(struct gpio_chip *chip, unsigned offset)
+{
+	struct lnw_gpio *lnw = container_of(chip, struct lnw_gpio, chip);
+	return lnw->irq_base + offset;
+}
+
+static int lnw_irq_type(unsigned irq, unsigned type)
+{
+	struct lnw_gpio *lnw = get_irq_chip_data(irq);
+	u32 gpio = irq - lnw->irq_base;
+	u8 reg = gpio / 32;
+	unsigned long flags;
+	u32 value;
+	void __iomem *grer = (void __iomem *)(&lnw->reg_base->GRER[reg]);
+	void __iomem *gfer = (void __iomem *)(&lnw->reg_base->GFER[reg]);
+
+	if (gpio < 0 || gpio > lnw->chip.ngpio)
+		return -EINVAL;
+	spin_lock_irqsave(&lnw->lock, flags);
+	if (type & IRQ_TYPE_EDGE_RISING)
+		value = readl(grer) | BIT(gpio % 32);
+	else
+		value = readl(grer) & (~BIT(gpio % 32));
+	writel(value, grer);
+
+	if (type & IRQ_TYPE_EDGE_FALLING)
+		value = readl(gfer) | BIT(gpio % 32);
+	else
+		value = readl(gfer) & (~BIT(gpio % 32));
+	writel(value, gfer);
+	spin_unlock_irqrestore(&lnw->lock, flags);
+
+	return 0;
+};
+
+static void lnw_irq_unmask(unsigned irq)
+{
+	struct lnw_gpio *lnw = get_irq_chip_data(irq);
+	u32 gpio = irq - lnw->irq_base;
+	u8 reg = gpio / 32;
+	void __iomem *gedr;
+
+	gedr = (void __iomem *)(&lnw->reg_base->GEDR[reg]);
+	writel(BIT(gpio % 32), gedr);
+};
+
+static void lnw_irq_mask(unsigned irq)
+{
+};
+
+static struct irq_chip lnw_irqchip = {
+	.name		= "LNW-GPIO",
+	.mask		= lnw_irq_mask,
+	.unmask		= lnw_irq_unmask,
+	.set_type	= lnw_irq_type,
+};
+
+static struct pci_device_id lnw_gpio_ids[] = {
+	{ PCI_DEVICE(PCI_VENDOR_ID_INTEL, 0x080f) },
+	{ 0, }
+};
+MODULE_DEVICE_TABLE(pci, lnw_gpio_ids);
+
+static void lnw_irq_handler(unsigned irq, struct irq_desc *desc)
+{
+	struct lnw_gpio *lnw = (struct lnw_gpio *)get_irq_data(irq);
+	u32 reg, gpio;
+	void __iomem *gedr;
+	u32 gedr_v;
+
+	/* check GPIO controller to check which pin triggered the interrupt */
+	for (reg = 0; reg < lnw->chip.ngpio / 32; reg++) {
+		gedr = (void __iomem *)(&lnw->reg_base->GEDR[reg]);
+		gedr_v = readl(gedr);
+		if (!gedr_v)
+			continue;
+		for (gpio = reg*32; gpio < reg*32+32; gpio++) {
+			gedr_v = readl(gedr);
+			if (gedr_v & BIT(gpio % 32)) {
+				pr_debug("pin %d triggered\n", gpio);
+				generic_handle_irq(lnw->irq_base + gpio);
+			}
+		}
+		/* clear the edge detect status bit */
+		writel(gedr_v, gedr);
+	}
+	desc->chip->eoi(irq);
+}
+
+static int __devinit lnw_gpio_probe(struct pci_dev *pdev,
+			const struct pci_device_id *id)
+{
+	void *base;
+	int i;
+	resource_size_t start, len;
+	struct lnw_gpio *lnw;
+	u32 irq_base;
+	u32 gpio_base;
+	int retval = 0;
+
+	retval = pci_enable_device(pdev);
+	if (retval)
+		goto done;
+
+	retval = pci_request_regions(pdev, "langwell_gpio");
+	if (retval) {
+		dev_err(&pdev->dev, "error requesting resources\n");
+		goto err2;
+	}
+	/* get the irq_base from bar1 */
+	start = pci_resource_start(pdev, 1);
+	len = pci_resource_len(pdev, 1);
+	base = ioremap_nocache(start, len);
+	if (!base) {
+		dev_err(&pdev->dev, "error mapping bar1\n");
+		goto err3;
+	}
+	irq_base = *(u32 *)base;
+	gpio_base = *((u32 *)base + 1);
+	/* release the IO mapping, since we already get the info from bar1 */
+	iounmap(base);
+	/* get the register base from bar0 */
+	start = pci_resource_start(pdev, 0);
+	len = pci_resource_len(pdev, 0);
+	base = ioremap_nocache(start, len);
+	if (!base) {
+		dev_err(&pdev->dev, "error mapping bar0\n");
+		retval = -EFAULT;
+		goto err3;
+	}
+
+	lnw = kzalloc(sizeof(struct lnw_gpio), GFP_KERNEL);
+	if (!lnw) {
+		dev_err(&pdev->dev, "can't allocate langwell_gpio chip data\n");
+		retval = -ENOMEM;
+		goto err4;
+	}
+	lnw->reg_base = base;
+	lnw->irq_base = irq_base;
+	lnw->chip.label = dev_name(&pdev->dev);
+	lnw->chip.direction_input = lnw_gpio_direction_input;
+	lnw->chip.direction_output = lnw_gpio_direction_output;
+	lnw->chip.get = lnw_gpio_get;
+	lnw->chip.set = lnw_gpio_set;
+	lnw->chip.to_irq = lnw_gpio_to_irq;
+	lnw->chip.base = gpio_base;
+	lnw->chip.ngpio = 64;
+	lnw->chip.can_sleep = 0;
+	pci_set_drvdata(pdev, lnw);
+	retval = gpiochip_add(&lnw->chip);
+	if (retval) {
+		dev_err(&pdev->dev, "langwell gpiochip_add error %d\n", retval);
+		goto err5;
+	}
+	set_irq_data(pdev->irq, lnw);
+	set_irq_chained_handler(pdev->irq, lnw_irq_handler);
+	for (i = 0; i < lnw->chip.ngpio; i++) {
+		set_irq_chip_and_handler_name(i + lnw->irq_base, &lnw_irqchip,
+					handle_simple_irq, "demux");
+		set_irq_chip_data(i + lnw->irq_base, lnw);
+	}
+
+	spin_lock_init(&lnw->lock);
+	goto done;
+err5:
+	kfree(lnw);
+err4:
+	iounmap(base);
+err3:
+	pci_release_regions(pdev);
+err2:
+	pci_disable_device(pdev);
+done:
+	return retval;
+}
+
+static struct pci_driver lnw_gpio_driver = {
+	.name		= "langwell_gpio",
+	.id_table	= lnw_gpio_ids,
+	.probe		= lnw_gpio_probe,
+};
+
+static int __init lnw_gpio_init(void)
+{
+	return pci_register_driver(&lnw_gpio_driver);
+}
+
+device_initcall(lnw_gpio_init);
diff --git a/drivers/gpio/max7301.c b/drivers/gpio/max7301.c
index 7b82eaa..480956f 100644
--- a/drivers/gpio/max7301.c
+++ b/drivers/gpio/max7301.c
@@ -339,3 +339,4 @@
 MODULE_AUTHOR("Juergen Beisert");
 MODULE_LICENSE("GPL v2");
 MODULE_DESCRIPTION("MAX7301 SPI based GPIO-Expander");
+MODULE_ALIAS("spi:" DRIVER_NAME);
diff --git a/drivers/gpio/mc33880.c b/drivers/gpio/mc33880.c
new file mode 100644
index 0000000..e7d01bd
--- /dev/null
+++ b/drivers/gpio/mc33880.c
@@ -0,0 +1,196 @@
+/*
+ * mc33880.c MC33880 high-side/low-side switch GPIO driver
+ * Copyright (c) 2009 Intel Corporation
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
+ */
+
+/* Supports:
+ * Freescale MC33880 high-side/low-side switch
+ */
+
+#include <linux/init.h>
+#include <linux/mutex.h>
+#include <linux/spi/spi.h>
+#include <linux/spi/mc33880.h>
+#include <linux/gpio.h>
+
+#define DRIVER_NAME "mc33880"
+
+/*
+ * Pin configurations, see MAX7301 datasheet page 6
+ */
+#define PIN_CONFIG_MASK 0x03
+#define PIN_CONFIG_IN_PULLUP 0x03
+#define PIN_CONFIG_IN_WO_PULLUP 0x02
+#define PIN_CONFIG_OUT 0x01
+
+#define PIN_NUMBER 8
+
+
+/*
+ * Some registers must be read back to modify.
+ * To save time we cache them here in memory
+ */
+struct mc33880 {
+	struct mutex	lock;	/* protect from simultanous accesses */
+	u8		port_config;
+	struct gpio_chip chip;
+	struct spi_device *spi;
+};
+
+static int mc33880_write_config(struct mc33880 *mc)
+{
+	return spi_write(mc->spi, &mc->port_config, sizeof(mc->port_config));
+}
+
+
+static int __mc33880_set(struct mc33880 *mc, unsigned offset, int value)
+{
+	if (value)
+		mc->port_config |= 1 << offset;
+	else
+		mc->port_config &= ~(1 << offset);
+
+	return mc33880_write_config(mc);
+}
+
+
+static void mc33880_set(struct gpio_chip *chip, unsigned offset, int value)
+{
+	struct mc33880 *mc = container_of(chip, struct mc33880, chip);
+
+	mutex_lock(&mc->lock);
+
+	__mc33880_set(mc, offset, value);
+
+	mutex_unlock(&mc->lock);
+}
+
+static int __devinit mc33880_probe(struct spi_device *spi)
+{
+	struct mc33880 *mc;
+	struct mc33880_platform_data *pdata;
+	int ret;
+
+	pdata = spi->dev.platform_data;
+	if (!pdata || !pdata->base) {
+		dev_dbg(&spi->dev, "incorrect or missing platform data\n");
+		return -EINVAL;
+	}
+
+	/*
+	 * bits_per_word cannot be configured in platform data
+	 */
+	spi->bits_per_word = 8;
+
+	ret = spi_setup(spi);
+	if (ret < 0)
+		return ret;
+
+	mc = kzalloc(sizeof(struct mc33880), GFP_KERNEL);
+	if (!mc)
+		return -ENOMEM;
+
+	mutex_init(&mc->lock);
+
+	dev_set_drvdata(&spi->dev, mc);
+
+	mc->spi = spi;
+
+	mc->chip.label = DRIVER_NAME,
+	mc->chip.set = mc33880_set;
+	mc->chip.base = pdata->base;
+	mc->chip.ngpio = PIN_NUMBER;
+	mc->chip.can_sleep = 1;
+	mc->chip.dev = &spi->dev;
+	mc->chip.owner = THIS_MODULE;
+
+	mc->port_config = 0x00;
+	/* write twice, because during initialisation the first setting
+	 * is just for testing SPI communication, and the second is the
+	 * "real" configuration
+	 */
+	ret = mc33880_write_config(mc);
+	mc->port_config = 0x00;
+	if (!ret)
+		ret = mc33880_write_config(mc);
+
+	if (ret) {
+		printk(KERN_ERR "Failed writing to " DRIVER_NAME ": %d\n", ret);
+		goto exit_destroy;
+	}
+
+	ret = gpiochip_add(&mc->chip);
+	if (ret)
+		goto exit_destroy;
+
+	return ret;
+
+exit_destroy:
+	dev_set_drvdata(&spi->dev, NULL);
+	mutex_destroy(&mc->lock);
+	kfree(mc);
+	return ret;
+}
+
+static int mc33880_remove(struct spi_device *spi)
+{
+	struct mc33880 *mc;
+	int ret;
+
+	mc = dev_get_drvdata(&spi->dev);
+	if (mc == NULL)
+		return -ENODEV;
+
+	dev_set_drvdata(&spi->dev, NULL);
+
+	ret = gpiochip_remove(&mc->chip);
+	if (!ret) {
+		mutex_destroy(&mc->lock);
+		kfree(mc);
+	} else
+		dev_err(&spi->dev, "Failed to remove the GPIO controller: %d\n",
+			ret);
+
+	return ret;
+}
+
+static struct spi_driver mc33880_driver = {
+	.driver = {
+		.name		= DRIVER_NAME,
+		.owner		= THIS_MODULE,
+	},
+	.probe		= mc33880_probe,
+	.remove		= __devexit_p(mc33880_remove),
+};
+
+static int __init mc33880_init(void)
+{
+	return spi_register_driver(&mc33880_driver);
+}
+/* register after spi postcore initcall and before
+ * subsys initcalls that may rely on these GPIOs
+ */
+subsys_initcall(mc33880_init);
+
+static void __exit mc33880_exit(void)
+{
+	spi_unregister_driver(&mc33880_driver);
+}
+module_exit(mc33880_exit);
+
+MODULE_AUTHOR("Mocean Laboratories <info@mocean-labs.com>");
+MODULE_LICENSE("GPL v2");
+
diff --git a/drivers/gpio/mcp23s08.c b/drivers/gpio/mcp23s08.c
index f6fae0e..cd651ec 100644
--- a/drivers/gpio/mcp23s08.c
+++ b/drivers/gpio/mcp23s08.c
@@ -6,12 +6,10 @@
 #include <linux/device.h>
 #include <linux/workqueue.h>
 #include <linux/mutex.h>
-
+#include <linux/gpio.h>
 #include <linux/spi/spi.h>
 #include <linux/spi/mcp23s08.h>
 
-#include <asm/gpio.h>
-
 
 /* Registers are all 8 bits wide.
  *
@@ -433,3 +431,4 @@
 module_exit(mcp23s08_exit);
 
 MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:mcp23s08");
diff --git a/drivers/gpio/pca953x.c b/drivers/gpio/pca953x.c
index cdb6574..6a2fb3f 100644
--- a/drivers/gpio/pca953x.c
+++ b/drivers/gpio/pca953x.c
@@ -13,6 +13,7 @@
 
 #include <linux/module.h>
 #include <linux/init.h>
+#include <linux/gpio.h>
 #include <linux/i2c.h>
 #include <linux/i2c/pca953x.h>
 #ifdef CONFIG_OF_GPIO
@@ -20,8 +21,6 @@
 #include <linux/of_gpio.h>
 #endif
 
-#include <asm/gpio.h>
-
 #define PCA953X_INPUT          0
 #define PCA953X_OUTPUT         1
 #define PCA953X_INVERT         2
@@ -40,6 +39,7 @@
 	{ "pca9557", 8, },
 
 	{ "max7310", 8, },
+	{ "max7315", 8, },
 	{ "pca6107", 8, },
 	{ "tca6408", 8, },
 	{ "tca6416", 16, },
diff --git a/drivers/gpio/pcf857x.c b/drivers/gpio/pcf857x.c
index 9525724..72f2449 100644
--- a/drivers/gpio/pcf857x.c
+++ b/drivers/gpio/pcf857x.c
@@ -20,11 +20,10 @@
 
 #include <linux/kernel.h>
 #include <linux/slab.h>
+#include <linux/gpio.h>
 #include <linux/i2c.h>
 #include <linux/i2c/pcf857x.h>
 
-#include <asm/gpio.h>
-
 
 static const struct i2c_device_id pcf857x_id[] = {
 	{ "pcf8574", 8 },
diff --git a/drivers/gpio/ucb1400_gpio.c b/drivers/gpio/ucb1400_gpio.c
new file mode 100644
index 0000000..50e6bd1
--- /dev/null
+++ b/drivers/gpio/ucb1400_gpio.c
@@ -0,0 +1,125 @@
+/*
+ * Philips UCB1400 GPIO driver
+ *
+ * Author: Marek Vasut <marek.vasut@gmail.com>
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ */
+
+#include <linux/module.h>
+#include <linux/ucb1400.h>
+
+struct ucb1400_gpio_data *ucbdata;
+
+static int ucb1400_gpio_dir_in(struct gpio_chip *gc, unsigned off)
+{
+	struct ucb1400_gpio *gpio;
+	gpio = container_of(gc, struct ucb1400_gpio, gc);
+	ucb1400_gpio_set_direction(gpio->ac97, off, 0);
+	return 0;
+}
+
+static int ucb1400_gpio_dir_out(struct gpio_chip *gc, unsigned off, int val)
+{
+	struct ucb1400_gpio *gpio;
+	gpio = container_of(gc, struct ucb1400_gpio, gc);
+	ucb1400_gpio_set_direction(gpio->ac97, off, 1);
+	ucb1400_gpio_set_value(gpio->ac97, off, val);
+	return 0;
+}
+
+static int ucb1400_gpio_get(struct gpio_chip *gc, unsigned off)
+{
+	struct ucb1400_gpio *gpio;
+	gpio = container_of(gc, struct ucb1400_gpio, gc);
+	return ucb1400_gpio_get_value(gpio->ac97, off);
+}
+
+static void ucb1400_gpio_set(struct gpio_chip *gc, unsigned off, int val)
+{
+	struct ucb1400_gpio *gpio;
+	gpio = container_of(gc, struct ucb1400_gpio, gc);
+	ucb1400_gpio_set_value(gpio->ac97, off, val);
+}
+
+static int ucb1400_gpio_probe(struct platform_device *dev)
+{
+	struct ucb1400_gpio *ucb = dev->dev.platform_data;
+	int err = 0;
+
+	if (!(ucbdata && ucbdata->gpio_offset)) {
+		err = -EINVAL;
+		goto err;
+	}
+
+	platform_set_drvdata(dev, ucb);
+
+	ucb->gc.label = "ucb1400_gpio";
+	ucb->gc.base = ucbdata->gpio_offset;
+	ucb->gc.ngpio = 10;
+	ucb->gc.owner = THIS_MODULE;
+
+	ucb->gc.direction_input = ucb1400_gpio_dir_in;
+	ucb->gc.direction_output = ucb1400_gpio_dir_out;
+	ucb->gc.get = ucb1400_gpio_get;
+	ucb->gc.set = ucb1400_gpio_set;
+	ucb->gc.can_sleep = 1;
+
+	err = gpiochip_add(&ucb->gc);
+	if (err)
+		goto err;
+
+	if (ucbdata && ucbdata->gpio_setup)
+		err = ucbdata->gpio_setup(&dev->dev, ucb->gc.ngpio);
+
+err:
+	return err;
+
+}
+
+static int ucb1400_gpio_remove(struct platform_device *dev)
+{
+	int err = 0;
+	struct ucb1400_gpio *ucb = platform_get_drvdata(dev);
+
+	if (ucbdata && ucbdata->gpio_teardown) {
+		err = ucbdata->gpio_teardown(&dev->dev, ucb->gc.ngpio);
+		if (err)
+			return err;
+	}
+
+	err = gpiochip_remove(&ucb->gc);
+	return err;
+}
+
+static struct platform_driver ucb1400_gpio_driver = {
+	.probe	= ucb1400_gpio_probe,
+	.remove	= ucb1400_gpio_remove,
+	.driver	= {
+		.name	= "ucb1400_gpio"
+	},
+};
+
+static int __init ucb1400_gpio_init(void)
+{
+	return platform_driver_register(&ucb1400_gpio_driver);
+}
+
+static void __exit ucb1400_gpio_exit(void)
+{
+	platform_driver_unregister(&ucb1400_gpio_driver);
+}
+
+void __init ucb1400_gpio_set_data(struct ucb1400_gpio_data *data)
+{
+	ucbdata = data;
+}
+
+module_init(ucb1400_gpio_init);
+module_exit(ucb1400_gpio_exit);
+
+MODULE_DESCRIPTION("Philips UCB1400 GPIO driver");
+MODULE_LICENSE("GPL");
diff --git a/drivers/hwmon/adcxx.c b/drivers/hwmon/adcxx.c
index 242294d..5e9e095 100644
--- a/drivers/hwmon/adcxx.c
+++ b/drivers/hwmon/adcxx.c
@@ -43,6 +43,7 @@
 #include <linux/hwmon.h>
 #include <linux/hwmon-sysfs.h>
 #include <linux/mutex.h>
+#include <linux/mod_devicetable.h>
 #include <linux/spi/spi.h>
 
 #define DRVNAME		"adcxx"
@@ -157,8 +158,9 @@
 
 /*----------------------------------------------------------------------*/
 
-static int __devinit adcxx_probe(struct spi_device *spi, int channels)
+static int __devinit adcxx_probe(struct spi_device *spi)
 {
+	int channels = spi_get_device_id(spi)->driver_data;
 	struct adcxx *adc;
 	int status;
 	int i;
@@ -204,26 +206,6 @@
 	return status;
 }
 
-static int __devinit adcxx1s_probe(struct spi_device *spi)
-{
-	return adcxx_probe(spi, 1);
-}
-
-static int __devinit adcxx2s_probe(struct spi_device *spi)
-{
-	return adcxx_probe(spi, 2);
-}
-
-static int __devinit adcxx4s_probe(struct spi_device *spi)
-{
-	return adcxx_probe(spi, 4);
-}
-
-static int __devinit adcxx8s_probe(struct spi_device *spi)
-{
-	return adcxx_probe(spi, 8);
-}
-
 static int __devexit adcxx_remove(struct spi_device *spi)
 {
 	struct adcxx *adc = dev_get_drvdata(&spi->dev);
@@ -241,79 +223,33 @@
 	return 0;
 }
 
-static struct spi_driver adcxx1s_driver = {
-	.driver = {
-		.name	= "adcxx1s",
-		.owner	= THIS_MODULE,
-	},
-	.probe	= adcxx1s_probe,
-	.remove	= __devexit_p(adcxx_remove),
+static const struct spi_device_id adcxx_ids[] = {
+	{ "adcxx1s", 1 },
+	{ "adcxx2s", 2 },
+	{ "adcxx4s", 4 },
+	{ "adcxx8s", 8 },
+	{ },
 };
+MODULE_DEVICE_TABLE(spi, adcxx_ids);
 
-static struct spi_driver adcxx2s_driver = {
+static struct spi_driver adcxx_driver = {
 	.driver = {
-		.name	= "adcxx2s",
+		.name	= "adcxx",
 		.owner	= THIS_MODULE,
 	},
-	.probe	= adcxx2s_probe,
-	.remove	= __devexit_p(adcxx_remove),
-};
-
-static struct spi_driver adcxx4s_driver = {
-	.driver = {
-		.name	= "adcxx4s",
-		.owner	= THIS_MODULE,
-	},
-	.probe	= adcxx4s_probe,
-	.remove	= __devexit_p(adcxx_remove),
-};
-
-static struct spi_driver adcxx8s_driver = {
-	.driver = {
-		.name	= "adcxx8s",
-		.owner	= THIS_MODULE,
-	},
-	.probe	= adcxx8s_probe,
+	.id_table = adcxx_ids,
+	.probe	= adcxx_probe,
 	.remove	= __devexit_p(adcxx_remove),
 };
 
 static int __init init_adcxx(void)
 {
-	int status;
-	status = spi_register_driver(&adcxx1s_driver);
-	if (status)
-		goto reg_1_failed;
-
-	status = spi_register_driver(&adcxx2s_driver);
-	if (status)
-		goto reg_2_failed;
-
-	status = spi_register_driver(&adcxx4s_driver);
-	if (status)
-		goto reg_4_failed;
-
-	status = spi_register_driver(&adcxx8s_driver);
-	if (status)
-		goto reg_8_failed;
-
-	return status;
-
-reg_8_failed:
-	spi_unregister_driver(&adcxx4s_driver);
-reg_4_failed:
-	spi_unregister_driver(&adcxx2s_driver);
-reg_2_failed:
-	spi_unregister_driver(&adcxx1s_driver);
-reg_1_failed:
-	return status;
+	return spi_register_driver(&adcxx_driver);
 }
 
 static void __exit exit_adcxx(void)
 {
-	spi_unregister_driver(&adcxx1s_driver);
-	spi_unregister_driver(&adcxx2s_driver);
-	spi_unregister_driver(&adcxx4s_driver);
-	spi_unregister_driver(&adcxx8s_driver);
+	spi_unregister_driver(&adcxx_driver);
 }
 
 module_init(init_adcxx);
@@ -322,8 +258,3 @@
 MODULE_AUTHOR("Marc Pignat");
 MODULE_DESCRIPTION("National Semiconductor adcxx8sxxx Linux driver");
 MODULE_LICENSE("GPL");
-
-MODULE_ALIAS("adcxx1s");
-MODULE_ALIAS("adcxx2s");
-MODULE_ALIAS("adcxx4s");
-MODULE_ALIAS("adcxx8s");
diff --git a/drivers/hwmon/dme1737.c b/drivers/hwmon/dme1737.c
index 9814d51..2c2cb1ec 100644
--- a/drivers/hwmon/dme1737.c
+++ b/drivers/hwmon/dme1737.c
@@ -1134,7 +1134,7 @@
 		res = PWM_FREQ_FROM_REG(data->pwm_freq[ix]);
 		break;
 	case SYS_PWM_ENABLE:
-		if (ix > 3) {
+		if (ix >= 3) {
 			res = 1; /* pwm[5-6] hard-wired to manual mode */
 		} else {
 			res = PWM_EN_FROM_REG(data->pwm_config[ix]);
diff --git a/drivers/hwmon/lis3lv02d_spi.c b/drivers/hwmon/lis3lv02d_spi.c
index 82ebca5..ecd7395 100644
--- a/drivers/hwmon/lis3lv02d_spi.c
+++ b/drivers/hwmon/lis3lv02d_spi.c
@@ -139,4 +139,4 @@
 MODULE_AUTHOR("Daniel Mack <daniel@caiaq.de>");
 MODULE_DESCRIPTION("lis3lv02d SPI glue layer");
 MODULE_LICENSE("GPL");
-
+MODULE_ALIAS("spi:" DRV_NAME);
diff --git a/drivers/hwmon/lm70.c b/drivers/hwmon/lm70.c
index ae6204f..ab8a5d3 100644
--- a/drivers/hwmon/lm70.c
+++ b/drivers/hwmon/lm70.c
@@ -32,6 +32,7 @@
 #include <linux/sysfs.h>
 #include <linux/hwmon.h>
 #include <linux/mutex.h>
+#include <linux/mod_devicetable.h>
 #include <linux/spi/spi.h>
 
 
@@ -130,11 +131,20 @@
 
 /*----------------------------------------------------------------------*/
 
-static int __devinit common_probe(struct spi_device *spi, int chip)
+static int __devinit lm70_probe(struct spi_device *spi)
 {
+	int chip = spi_get_device_id(spi)->driver_data;
 	struct lm70 *p_lm70;
 	int status;
 
+	/* signaling is SPI_MODE_0 for both LM70 and TMP121 */
+	if (spi->mode & (SPI_CPOL | SPI_CPHA))
+		return -EINVAL;
+
+	/* 3-wire link (shared SI/SO) for LM70 */
+	if (chip == LM70_CHIP_LM70 && !(spi->mode & SPI_3WIRE))
+		return -EINVAL;
+
 	/* NOTE:  we assume 8-bit words, and convert to 16 bits manually */
 
 	p_lm70 = kzalloc(sizeof *p_lm70, GFP_KERNEL);
@@ -170,24 +180,6 @@
 	return status;
 }
 
-static int __devinit lm70_probe(struct spi_device *spi)
-{
-	/* signaling is SPI_MODE_0 on a 3-wire link (shared SI/SO) */
-	if ((spi->mode & (SPI_CPOL | SPI_CPHA)) || !(spi->mode & SPI_3WIRE))
-		return -EINVAL;
-
-	return common_probe(spi, LM70_CHIP_LM70);
-}
-
-static int __devinit tmp121_probe(struct spi_device *spi)
-{
-	/* signaling is SPI_MODE_0 with only MISO connected */
-	if (spi->mode & (SPI_CPOL | SPI_CPHA))
-		return -EINVAL;
-
-	return common_probe(spi, LM70_CHIP_TMP121);
-}
-
 static int __devexit lm70_remove(struct spi_device *spi)
 {
 	struct lm70 *p_lm70 = dev_get_drvdata(&spi->dev);
@@ -201,41 +193,32 @@
 	return 0;
 }
 
-static struct spi_driver tmp121_driver = {
-	.driver = {
-		.name	= "tmp121",
-		.owner	= THIS_MODULE,
-	},
-	.probe	= tmp121_probe,
-	.remove	= __devexit_p(lm70_remove),
+
+static const struct spi_device_id lm70_ids[] = {
+	{ "lm70",   LM70_CHIP_LM70 },
+	{ "tmp121", LM70_CHIP_TMP121 },
+	{ },
 };
+MODULE_DEVICE_TABLE(spi, lm70_ids);
 
 static struct spi_driver lm70_driver = {
 	.driver = {
 		.name	= "lm70",
 		.owner	= THIS_MODULE,
 	},
+	.id_table = lm70_ids,
 	.probe	= lm70_probe,
 	.remove	= __devexit_p(lm70_remove),
 };
 
 static int __init init_lm70(void)
 {
-	int ret = spi_register_driver(&lm70_driver);
-	if (ret)
-		return ret;
-
-	ret = spi_register_driver(&tmp121_driver);
-	if (ret)
-		spi_unregister_driver(&lm70_driver);
-
-	return ret;
+	return spi_register_driver(&lm70_driver);
 }
 
 static void __exit cleanup_lm70(void)
 {
 	spi_unregister_driver(&lm70_driver);
-	spi_unregister_driver(&tmp121_driver);
 }
 
 module_init(init_lm70);
diff --git a/drivers/hwmon/max1111.c b/drivers/hwmon/max1111.c
index bfaa665..9ac4972 100644
--- a/drivers/hwmon/max1111.c
+++ b/drivers/hwmon/max1111.c
@@ -242,3 +242,4 @@
 MODULE_AUTHOR("Eric Miao <eric.miao@marvell.com>");
 MODULE_DESCRIPTION("MAX1111 ADC Driver");
 MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:max1111");
diff --git a/drivers/infiniband/hw/ehca/ehca_mrmw.c b/drivers/infiniband/hw/ehca/ehca_mrmw.c
index 7663a2a..7550a53 100644
--- a/drivers/infiniband/hw/ehca/ehca_mrmw.c
+++ b/drivers/infiniband/hw/ehca/ehca_mrmw.c
@@ -2463,7 +2463,7 @@
 	int ret;
 
 	ehca_mr_len = 0;
-	ret = walk_memory_resource(0, 1ULL << MAX_PHYSMEM_BITS, NULL,
+	ret = walk_system_ram_range(0, 1ULL << MAX_PHYSMEM_BITS, NULL,
 				   ehca_create_busmap_callback);
 	return ret;
 }
diff --git a/drivers/input/touchscreen/ad7877.c b/drivers/input/touchscreen/ad7877.c
index ecaeb7e..eb83939c 100644
--- a/drivers/input/touchscreen/ad7877.c
+++ b/drivers/input/touchscreen/ad7877.c
@@ -842,3 +842,4 @@
 MODULE_AUTHOR("Michael Hennerich <hennerich@blackfin.uclinux.org>");
 MODULE_DESCRIPTION("AD7877 touchscreen Driver");
 MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:ad7877");
diff --git a/drivers/input/touchscreen/ad7879.c b/drivers/input/touchscreen/ad7879.c
index 5d8a703..19b4db7e 100644
--- a/drivers/input/touchscreen/ad7879.c
+++ b/drivers/input/touchscreen/ad7879.c
@@ -779,3 +779,4 @@
 MODULE_AUTHOR("Michael Hennerich <hennerich@blackfin.uclinux.org>");
 MODULE_DESCRIPTION("AD7879(-1) touchscreen Driver");
 MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:ad7879");
diff --git a/drivers/input/touchscreen/ads7846.c b/drivers/input/touchscreen/ads7846.c
index ba9d38c..09c8109 100644
--- a/drivers/input/touchscreen/ads7846.c
+++ b/drivers/input/touchscreen/ads7846.c
@@ -1256,3 +1256,4 @@
 
 MODULE_DESCRIPTION("ADS7846 TouchScreen Driver");
 MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:ads7846");
diff --git a/drivers/isdn/capi/kcapi_proc.c b/drivers/isdn/capi/kcapi_proc.c
index 50ed778..09d4db7 100644
--- a/drivers/isdn/capi/kcapi_proc.c
+++ b/drivers/isdn/capi/kcapi_proc.c
@@ -89,14 +89,14 @@
 	return 0;
 }
 
-static struct seq_operations seq_controller_ops = {
+static const struct seq_operations seq_controller_ops = {
 	.start	= controller_start,
 	.next	= controller_next,
 	.stop	= controller_stop,
 	.show	= controller_show,
 };
 
-static struct seq_operations seq_contrstats_ops = {
+static const struct seq_operations seq_contrstats_ops = {
 	.start	= controller_start,
 	.next	= controller_next,
 	.stop	= controller_stop,
@@ -194,14 +194,14 @@
 	return 0;
 }
 
-static struct seq_operations seq_applications_ops = {
+static const struct seq_operations seq_applications_ops = {
 	.start	= applications_start,
 	.next	= applications_next,
 	.stop	= applications_stop,
 	.show	= applications_show,
 };
 
-static struct seq_operations seq_applstats_ops = {
+static const struct seq_operations seq_applstats_ops = {
 	.start	= applications_start,
 	.next	= applications_next,
 	.stop	= applications_stop,
@@ -264,7 +264,7 @@
 	return 0;
 }
 
-static struct seq_operations seq_capi_driver_ops = {
+static const struct seq_operations seq_capi_driver_ops = {
 	.start	= capi_driver_start,
 	.next	= capi_driver_next,
 	.stop	= capi_driver_stop,
diff --git a/drivers/leds/leds-dac124s085.c b/drivers/leds/leds-dac124s085.c
index 098d9aa..2913d76 100644
--- a/drivers/leds/leds-dac124s085.c
+++ b/drivers/leds/leds-dac124s085.c
@@ -148,3 +148,4 @@
 MODULE_AUTHOR("Guennadi Liakhovetski <lg@denx.de>");
 MODULE_DESCRIPTION("DAC124S085 LED driver");
 MODULE_LICENSE("GPL v2");
+MODULE_ALIAS("spi:dac124s085");
diff --git a/drivers/mfd/ezx-pcap.c b/drivers/mfd/ezx-pcap.c
index 016be49..87628891 100644
--- a/drivers/mfd/ezx-pcap.c
+++ b/drivers/mfd/ezx-pcap.c
@@ -548,3 +548,4 @@
 MODULE_LICENSE("GPL");
 MODULE_AUTHOR("Daniel Ribeiro / Harald Welte");
 MODULE_DESCRIPTION("Motorola PCAP2 ASIC Driver");
+MODULE_ALIAS("spi:ezx-pcap");
diff --git a/drivers/mfd/ucb1400_core.c b/drivers/mfd/ucb1400_core.c
index 78c2135..2afc080 100644
--- a/drivers/mfd/ucb1400_core.c
+++ b/drivers/mfd/ucb1400_core.c
@@ -48,9 +48,11 @@
 	int err;
 	struct ucb1400 *ucb;
 	struct ucb1400_ts ucb_ts;
+	struct ucb1400_gpio ucb_gpio;
 	struct snd_ac97 *ac97;
 
 	memset(&ucb_ts, 0, sizeof(ucb_ts));
+	memset(&ucb_gpio, 0, sizeof(ucb_gpio));
 
 	ucb = kzalloc(sizeof(struct ucb1400), GFP_KERNEL);
 	if (!ucb) {
@@ -68,25 +70,44 @@
 		goto err0;
 	}
 
+	/* GPIO */
+	ucb_gpio.ac97 = ac97;
+	ucb->ucb1400_gpio = platform_device_alloc("ucb1400_gpio", -1);
+	if (!ucb->ucb1400_gpio) {
+		err = -ENOMEM;
+		goto err0;
+	}
+	err = platform_device_add_data(ucb->ucb1400_gpio, &ucb_gpio,
+					sizeof(ucb_gpio));
+	if (err)
+		goto err1;
+	err = platform_device_add(ucb->ucb1400_gpio);
+	if (err)
+		goto err1;
+
 	/* TOUCHSCREEN */
 	ucb_ts.ac97 = ac97;
 	ucb->ucb1400_ts = platform_device_alloc("ucb1400_ts", -1);
 	if (!ucb->ucb1400_ts) {
 		err = -ENOMEM;
-		goto err0;
+		goto err2;
 	}
 	err = platform_device_add_data(ucb->ucb1400_ts, &ucb_ts,
 					sizeof(ucb_ts));
 	if (err)
-		goto err1;
+		goto err3;
 	err = platform_device_add(ucb->ucb1400_ts);
 	if (err)
-		goto err1;
+		goto err3;
 
 	return 0;
 
-err1:
+err3:
 	platform_device_put(ucb->ucb1400_ts);
+err2:
+	platform_device_unregister(ucb->ucb1400_gpio);
+err1:
+	platform_device_put(ucb->ucb1400_gpio);
 err0:
 	kfree(ucb);
 err:
@@ -98,6 +119,8 @@
 	struct ucb1400 *ucb = dev_get_drvdata(dev);
 
 	platform_device_unregister(ucb->ucb1400_ts);
+	platform_device_unregister(ucb->ucb1400_gpio);
+
 	kfree(ucb);
 	return 0;
 }
diff --git a/drivers/misc/eeprom/at25.c b/drivers/misc/eeprom/at25.c
index 2e535a0..d902d81 100644
--- a/drivers/misc/eeprom/at25.c
+++ b/drivers/misc/eeprom/at25.c
@@ -417,4 +417,4 @@
 MODULE_DESCRIPTION("Driver for most SPI EEPROMs");
 MODULE_AUTHOR("David Brownell");
 MODULE_LICENSE("GPL");
-
+MODULE_ALIAS("spi:at25");
diff --git a/drivers/misc/lkdtm.c b/drivers/misc/lkdtm.c
index 1bfe5d1..3648b23 100644
--- a/drivers/misc/lkdtm.c
+++ b/drivers/misc/lkdtm.c
@@ -283,7 +283,7 @@
 
 	switch (cpoint) {
 	case INT_HARDWARE_ENTRY:
-		lkdtm.kp.symbol_name = "__do_IRQ";
+		lkdtm.kp.symbol_name = "do_IRQ";
 		lkdtm.entry = (kprobe_opcode_t*) jp_do_irq;
 		break;
 	case INT_HW_IRQ_EN:
diff --git a/drivers/mmc/core/core.c b/drivers/mmc/core/core.c
index d84c880..7dab2e5 100644
--- a/drivers/mmc/core/core.c
+++ b/drivers/mmc/core/core.c
@@ -344,6 +344,101 @@
 EXPORT_SYMBOL(mmc_align_data_size);
 
 /**
+ *	mmc_host_enable - enable a host.
+ *	@host: mmc host to enable
+ *
+ *	Hosts that support power saving can use the 'enable' and 'disable'
+ *	methods to exit and enter power saving states. For more information
+ *	see comments for struct mmc_host_ops.
+ */
+int mmc_host_enable(struct mmc_host *host)
+{
+	if (!(host->caps & MMC_CAP_DISABLE))
+		return 0;
+
+	if (host->en_dis_recurs)
+		return 0;
+
+	if (host->nesting_cnt++)
+		return 0;
+
+	cancel_delayed_work_sync(&host->disable);
+
+	if (host->enabled)
+		return 0;
+
+	if (host->ops->enable) {
+		int err;
+
+		host->en_dis_recurs = 1;
+		err = host->ops->enable(host);
+		host->en_dis_recurs = 0;
+
+		if (err) {
+			pr_debug("%s: enable error %d\n",
+				 mmc_hostname(host), err);
+			return err;
+		}
+	}
+	host->enabled = 1;
+	return 0;
+}
+EXPORT_SYMBOL(mmc_host_enable);
+
+static int mmc_host_do_disable(struct mmc_host *host, int lazy)
+{
+	if (host->ops->disable) {
+		int err;
+
+		host->en_dis_recurs = 1;
+		err = host->ops->disable(host, lazy);
+		host->en_dis_recurs = 0;
+
+		if (err < 0) {
+			pr_debug("%s: disable error %d\n",
+				 mmc_hostname(host), err);
+			return err;
+		}
+		if (err > 0) {
+			unsigned long delay = msecs_to_jiffies(err);
+
+			mmc_schedule_delayed_work(&host->disable, delay);
+		}
+	}
+	host->enabled = 0;
+	return 0;
+}
+
+/**
+ *	mmc_host_disable - disable a host.
+ *	@host: mmc host to disable
+ *
+ *	Hosts that support power saving can use the 'enable' and 'disable'
+ *	methods to exit and enter power saving states. For more information
+ *	see comments for struct mmc_host_ops.
+ */
+int mmc_host_disable(struct mmc_host *host)
+{
+	int err;
+
+	if (!(host->caps & MMC_CAP_DISABLE))
+		return 0;
+
+	if (host->en_dis_recurs)
+		return 0;
+
+	if (--host->nesting_cnt)
+		return 0;
+
+	if (!host->enabled)
+		return 0;
+
+	err = mmc_host_do_disable(host, 0);
+	return err;
+}
+EXPORT_SYMBOL(mmc_host_disable);
+
+/**
  *	__mmc_claim_host - exclusively claim a host
  *	@host: mmc host to claim
  *	@abort: whether or not the operation should be aborted
@@ -366,25 +461,111 @@
 	while (1) {
 		set_current_state(TASK_UNINTERRUPTIBLE);
 		stop = abort ? atomic_read(abort) : 0;
-		if (stop || !host->claimed)
+		if (stop || !host->claimed || host->claimer == current)
 			break;
 		spin_unlock_irqrestore(&host->lock, flags);
 		schedule();
 		spin_lock_irqsave(&host->lock, flags);
 	}
 	set_current_state(TASK_RUNNING);
-	if (!stop)
+	if (!stop) {
 		host->claimed = 1;
-	else
+		host->claimer = current;
+		host->claim_cnt += 1;
+	} else
 		wake_up(&host->wq);
 	spin_unlock_irqrestore(&host->lock, flags);
 	remove_wait_queue(&host->wq, &wait);
+	if (!stop)
+		mmc_host_enable(host);
 	return stop;
 }
 
 EXPORT_SYMBOL(__mmc_claim_host);
 
 /**
+ *	mmc_try_claim_host - try exclusively to claim a host
+ *	@host: mmc host to claim
+ *
+ *	Returns %1 if the host is claimed, %0 otherwise.
+ */
+int mmc_try_claim_host(struct mmc_host *host)
+{
+	int claimed_host = 0;
+	unsigned long flags;
+
+	spin_lock_irqsave(&host->lock, flags);
+	if (!host->claimed || host->claimer == current) {
+		host->claimed = 1;
+		host->claimer = current;
+		host->claim_cnt += 1;
+		claimed_host = 1;
+	}
+	spin_unlock_irqrestore(&host->lock, flags);
+	return claimed_host;
+}
+EXPORT_SYMBOL(mmc_try_claim_host);
+
+static void mmc_do_release_host(struct mmc_host *host)
+{
+	unsigned long flags;
+
+	spin_lock_irqsave(&host->lock, flags);
+	if (--host->claim_cnt) {
+		/* Release for nested claim */
+		spin_unlock_irqrestore(&host->lock, flags);
+	} else {
+		host->claimed = 0;
+		host->claimer = NULL;
+		spin_unlock_irqrestore(&host->lock, flags);
+		wake_up(&host->wq);
+	}
+}
+
+void mmc_host_deeper_disable(struct work_struct *work)
+{
+	struct mmc_host *host =
+		container_of(work, struct mmc_host, disable.work);
+
+	/* If the host is claimed then we do not want to disable it anymore */
+	if (!mmc_try_claim_host(host))
+		return;
+	mmc_host_do_disable(host, 1);
+	mmc_do_release_host(host);
+}
+
+/**
+ *	mmc_host_lazy_disable - lazily disable a host.
+ *	@host: mmc host to disable
+ *
+ *	Hosts that support power saving can use the 'enable' and 'disable'
+ *	methods to exit and enter power saving states. For more information
+ *	see comments for struct mmc_host_ops.
+ */
+int mmc_host_lazy_disable(struct mmc_host *host)
+{
+	if (!(host->caps & MMC_CAP_DISABLE))
+		return 0;
+
+	if (host->en_dis_recurs)
+		return 0;
+
+	if (--host->nesting_cnt)
+		return 0;
+
+	if (!host->enabled)
+		return 0;
+
+	if (host->disable_delay) {
+		mmc_schedule_delayed_work(&host->disable,
+				msecs_to_jiffies(host->disable_delay));
+		return 0;
+	} else
+		return mmc_host_do_disable(host, 1);
+}
+EXPORT_SYMBOL(mmc_host_lazy_disable);
+
+/**
  *	mmc_release_host - release a host
  *	@host: mmc host to release
  *
@@ -393,15 +574,11 @@
  */
 void mmc_release_host(struct mmc_host *host)
 {
-	unsigned long flags;
-
 	WARN_ON(!host->claimed);
 
-	spin_lock_irqsave(&host->lock, flags);
-	host->claimed = 0;
-	spin_unlock_irqrestore(&host->lock, flags);
+	mmc_host_lazy_disable(host);
 
-	wake_up(&host->wq);
+	mmc_do_release_host(host);
 }
 
 EXPORT_SYMBOL(mmc_release_host);
@@ -687,7 +864,13 @@
  */
 static void mmc_power_up(struct mmc_host *host)
 {
-	int bit = fls(host->ocr_avail) - 1;
+	int bit;
+
+	/* If ocr is set, we use it */
+	if (host->ocr)
+		bit = ffs(host->ocr) - 1;
+	else
+		bit = fls(host->ocr_avail) - 1;
 
 	host->ios.vdd = bit;
 	if (mmc_host_is_spi(host)) {
@@ -947,6 +1130,8 @@
 	spin_unlock_irqrestore(&host->lock, flags);
 #endif
 
+	if (host->caps & MMC_CAP_DISABLE)
+		cancel_delayed_work(&host->disable);
 	cancel_delayed_work(&host->detect);
 	mmc_flush_scheduled_work();
 
@@ -958,6 +1143,8 @@
 		mmc_claim_host(host);
 		mmc_detach_bus(host);
 		mmc_release_host(host);
+		mmc_bus_put(host);
+		return;
 	}
 	mmc_bus_put(host);
 
@@ -966,6 +1153,80 @@
 	mmc_power_off(host);
 }
 
+void mmc_power_save_host(struct mmc_host *host)
+{
+	mmc_bus_get(host);
+
+	if (!host->bus_ops || host->bus_dead || !host->bus_ops->power_restore) {
+		mmc_bus_put(host);
+		return;
+	}
+
+	if (host->bus_ops->power_save)
+		host->bus_ops->power_save(host);
+
+	mmc_bus_put(host);
+
+	mmc_power_off(host);
+}
+EXPORT_SYMBOL(mmc_power_save_host);
+
+void mmc_power_restore_host(struct mmc_host *host)
+{
+	mmc_bus_get(host);
+
+	if (!host->bus_ops || host->bus_dead || !host->bus_ops->power_restore) {
+		mmc_bus_put(host);
+		return;
+	}
+
+	mmc_power_up(host);
+	host->bus_ops->power_restore(host);
+
+	mmc_bus_put(host);
+}
+EXPORT_SYMBOL(mmc_power_restore_host);
+
+int mmc_card_awake(struct mmc_host *host)
+{
+	int err = -ENOSYS;
+
+	mmc_bus_get(host);
+
+	if (host->bus_ops && !host->bus_dead && host->bus_ops->awake)
+		err = host->bus_ops->awake(host);
+
+	mmc_bus_put(host);
+
+	return err;
+}
+EXPORT_SYMBOL(mmc_card_awake);
+
+int mmc_card_sleep(struct mmc_host *host)
+{
+	int err = -ENOSYS;
+
+	mmc_bus_get(host);
+
+	if (host->bus_ops && !host->bus_dead && host->bus_ops->awake)
+		err = host->bus_ops->sleep(host);
+
+	mmc_bus_put(host);
+
+	return err;
+}
+EXPORT_SYMBOL(mmc_card_sleep);
+
+int mmc_card_can_sleep(struct mmc_host *host)
+{
+	struct mmc_card *card = host->card;
+
+	if (card && mmc_card_mmc(card) && card->ext_csd.rev >= 3)
+		return 1;
+	return 0;
+}
+EXPORT_SYMBOL(mmc_card_can_sleep);
+
 #ifdef CONFIG_PM
 
 /**
@@ -975,27 +1236,36 @@
  */
 int mmc_suspend_host(struct mmc_host *host, pm_message_t state)
 {
+	int err = 0;
+
+	if (host->caps & MMC_CAP_DISABLE)
+		cancel_delayed_work(&host->disable);
 	cancel_delayed_work(&host->detect);
 	mmc_flush_scheduled_work();
 
 	mmc_bus_get(host);
 	if (host->bus_ops && !host->bus_dead) {
 		if (host->bus_ops->suspend)
-			host->bus_ops->suspend(host);
-		if (!host->bus_ops->resume) {
+			err = host->bus_ops->suspend(host);
+		if (err == -ENOSYS || !host->bus_ops->resume) {
+			/*
+			 * We simply "remove" the card in this case.
+			 * It will be redetected on resume.
+			 */
 			if (host->bus_ops->remove)
 				host->bus_ops->remove(host);
-
 			mmc_claim_host(host);
 			mmc_detach_bus(host);
 			mmc_release_host(host);
+			err = 0;
 		}
 	}
 	mmc_bus_put(host);
 
-	mmc_power_off(host);
+	if (!err)
+		mmc_power_off(host);
 
-	return 0;
+	return err;
 }
 
 EXPORT_SYMBOL(mmc_suspend_host);
@@ -1006,12 +1276,26 @@
  */
 int mmc_resume_host(struct mmc_host *host)
 {
+	int err = 0;
+
 	mmc_bus_get(host);
 	if (host->bus_ops && !host->bus_dead) {
 		mmc_power_up(host);
 		mmc_select_voltage(host, host->ocr);
 		BUG_ON(!host->bus_ops->resume);
-		host->bus_ops->resume(host);
+		err = host->bus_ops->resume(host);
+		if (err) {
+			printk(KERN_WARNING "%s: error %d during resume "
+					    "(card was removed?)\n",
+					    mmc_hostname(host), err);
+			if (host->bus_ops->remove)
+				host->bus_ops->remove(host);
+			mmc_claim_host(host);
+			mmc_detach_bus(host);
+			mmc_release_host(host);
+			/* no need to bother upper layers */
+			err = 0;
+		}
 	}
 	mmc_bus_put(host);
 
@@ -1021,7 +1305,7 @@
 	 */
 	mmc_detect_change(host, 1);
 
-	return 0;
+	return err;
 }
 
 EXPORT_SYMBOL(mmc_resume_host);
diff --git a/drivers/mmc/core/core.h b/drivers/mmc/core/core.h
index c819eff..67ae6ab 100644
--- a/drivers/mmc/core/core.h
+++ b/drivers/mmc/core/core.h
@@ -16,10 +16,14 @@
 #define MMC_CMD_RETRIES        3
 
 struct mmc_bus_ops {
+	int (*awake)(struct mmc_host *);
+	int (*sleep)(struct mmc_host *);
 	void (*remove)(struct mmc_host *);
 	void (*detect)(struct mmc_host *);
-	void (*suspend)(struct mmc_host *);
-	void (*resume)(struct mmc_host *);
+	int (*suspend)(struct mmc_host *);
+	int (*resume)(struct mmc_host *);
+	void (*power_save)(struct mmc_host *);
+	void (*power_restore)(struct mmc_host *);
 };
 
 void mmc_attach_bus(struct mmc_host *host, const struct mmc_bus_ops *ops);
diff --git a/drivers/mmc/core/host.c b/drivers/mmc/core/host.c
index 5e945e6..a268d12 100644
--- a/drivers/mmc/core/host.c
+++ b/drivers/mmc/core/host.c
@@ -83,6 +83,7 @@
 	spin_lock_init(&host->lock);
 	init_waitqueue_head(&host->wq);
 	INIT_DELAYED_WORK(&host->detect, mmc_rescan);
+	INIT_DELAYED_WORK_DEFERRABLE(&host->disable, mmc_host_deeper_disable);
 
 	/*
 	 * By default, hosts do not support SGIO or large requests.
diff --git a/drivers/mmc/core/host.h b/drivers/mmc/core/host.h
index c2dc3d2..8c87e11 100644
--- a/drivers/mmc/core/host.h
+++ b/drivers/mmc/core/host.h
@@ -14,5 +14,7 @@
 int mmc_register_host_class(void);
 void mmc_unregister_host_class(void);
 
+void mmc_host_deeper_disable(struct work_struct *work);
+
 #endif
 
diff --git a/drivers/mmc/core/mmc.c b/drivers/mmc/core/mmc.c
index 2fb9d5f..bfefce3 100644
--- a/drivers/mmc/core/mmc.c
+++ b/drivers/mmc/core/mmc.c
@@ -160,7 +160,6 @@
 {
 	int err;
 	u8 *ext_csd;
-	unsigned int ext_csd_struct;
 
 	BUG_ON(!card);
 
@@ -180,11 +179,11 @@
 
 	err = mmc_send_ext_csd(card, ext_csd);
 	if (err) {
-		/*
-		 * We all hosts that cannot perform the command
-		 * to fail more gracefully
-		 */
-		if (err != -EINVAL)
+		/* If the host or the card can't do the switch,
+		 * fail more gracefully. */
+		if ((err != -EINVAL)
+		 && (err != -ENOSYS)
+		 && (err != -EFAULT))
 			goto out;
 
 		/*
@@ -207,16 +206,16 @@
 		goto out;
 	}
 
-	ext_csd_struct = ext_csd[EXT_CSD_REV];
-	if (ext_csd_struct > 3) {
+	card->ext_csd.rev = ext_csd[EXT_CSD_REV];
+	if (card->ext_csd.rev > 3) {
 		printk(KERN_ERR "%s: unrecognised EXT_CSD structure "
 			"version %d\n", mmc_hostname(card->host),
-			ext_csd_struct);
+			card->ext_csd.rev);
 		err = -EINVAL;
 		goto out;
 	}
 
-	if (ext_csd_struct >= 2) {
+	if (card->ext_csd.rev >= 2) {
 		card->ext_csd.sectors =
 			ext_csd[EXT_CSD_SEC_CNT + 0] << 0 |
 			ext_csd[EXT_CSD_SEC_CNT + 1] << 8 |
@@ -241,6 +240,15 @@
 		goto out;
 	}
 
+	if (card->ext_csd.rev >= 3) {
+		u8 sa_shift = ext_csd[EXT_CSD_S_A_TIMEOUT];
+
+		/* Sleep / awake timeout in 100ns units */
+		if (sa_shift > 0 && sa_shift <= 0x17)
+			card->ext_csd.sa_timeout =
+					1 << ext_csd[EXT_CSD_S_A_TIMEOUT];
+	}
+
 out:
 	kfree(ext_csd);
 
@@ -408,12 +416,17 @@
 		(host->caps & MMC_CAP_MMC_HIGHSPEED)) {
 		err = mmc_switch(card, EXT_CSD_CMD_SET_NORMAL,
 			EXT_CSD_HS_TIMING, 1);
-		if (err)
+		if (err && err != -EBADMSG)
 			goto free_card;
 
-		mmc_card_set_highspeed(card);
-
-		mmc_set_timing(card->host, MMC_TIMING_MMC_HS);
+		if (err) {
+			printk(KERN_WARNING "%s: switch to highspeed failed\n",
+			       mmc_hostname(card->host));
+			err = 0;
+		} else {
+			mmc_card_set_highspeed(card);
+			mmc_set_timing(card->host, MMC_TIMING_MMC_HS);
+		}
 	}
 
 	/*
@@ -448,10 +461,17 @@
 		err = mmc_switch(card, EXT_CSD_CMD_SET_NORMAL,
 				 EXT_CSD_BUS_WIDTH, ext_csd_bit);
 
-		if (err)
+		if (err && err != -EBADMSG)
 			goto free_card;
 
-		mmc_set_bus_width(card->host, bus_width);
+		if (err) {
+			printk(KERN_WARNING "%s: switch to bus width %d "
+			       "failed\n", mmc_hostname(card->host),
+			       1 << bus_width);
+			err = 0;
+		} else {
+			mmc_set_bus_width(card->host, bus_width);
+		}
 	}
 
 	if (!oldcard)
@@ -507,12 +527,10 @@
 	}
 }
 
-#ifdef CONFIG_MMC_UNSAFE_RESUME
-
 /*
  * Suspend callback from host.
  */
-static void mmc_suspend(struct mmc_host *host)
+static int mmc_suspend(struct mmc_host *host)
 {
 	BUG_ON(!host);
 	BUG_ON(!host->card);
@@ -522,6 +540,8 @@
 		mmc_deselect_cards(host);
 	host->card->state &= ~MMC_STATE_HIGHSPEED;
 	mmc_release_host(host);
+
+	return 0;
 }
 
 /*
@@ -530,7 +550,7 @@
  * This function tries to determine if the same card is still present
  * and, if so, restore all state to it.
  */
-static void mmc_resume(struct mmc_host *host)
+static int mmc_resume(struct mmc_host *host)
 {
 	int err;
 
@@ -541,30 +561,99 @@
 	err = mmc_init_card(host, host->ocr, host->card);
 	mmc_release_host(host);
 
-	if (err) {
-		mmc_remove(host);
-
-		mmc_claim_host(host);
-		mmc_detach_bus(host);
-		mmc_release_host(host);
-	}
-
+	return err;
 }
 
-#else
+static void mmc_power_restore(struct mmc_host *host)
+{
+	host->card->state &= ~MMC_STATE_HIGHSPEED;
+	mmc_claim_host(host);
+	mmc_init_card(host, host->ocr, host->card);
+	mmc_release_host(host);
+}
 
-#define mmc_suspend NULL
-#define mmc_resume NULL
+static int mmc_sleep(struct mmc_host *host)
+{
+	struct mmc_card *card = host->card;
+	int err = -ENOSYS;
 
-#endif
+	if (card && card->ext_csd.rev >= 3) {
+		err = mmc_card_sleepawake(host, 1);
+		if (err < 0)
+			pr_debug("%s: Error %d while putting card into sleep",
+				 mmc_hostname(host), err);
+	}
+
+	return err;
+}
+
+static int mmc_awake(struct mmc_host *host)
+{
+	struct mmc_card *card = host->card;
+	int err = -ENOSYS;
+
+	if (card && card->ext_csd.rev >= 3) {
+		err = mmc_card_sleepawake(host, 0);
+		if (err < 0)
+			pr_debug("%s: Error %d while awaking sleeping card",
+				 mmc_hostname(host), err);
+	}
+
+	return err;
+}
+
+#ifdef CONFIG_MMC_UNSAFE_RESUME
 
 static const struct mmc_bus_ops mmc_ops = {
+	.awake = mmc_awake,
+	.sleep = mmc_sleep,
 	.remove = mmc_remove,
 	.detect = mmc_detect,
 	.suspend = mmc_suspend,
 	.resume = mmc_resume,
+	.power_restore = mmc_power_restore,
 };
 
+static void mmc_attach_bus_ops(struct mmc_host *host)
+{
+	mmc_attach_bus(host, &mmc_ops);
+}
+
+#else
+
+static const struct mmc_bus_ops mmc_ops = {
+	.awake = mmc_awake,
+	.sleep = mmc_sleep,
+	.remove = mmc_remove,
+	.detect = mmc_detect,
+	.suspend = NULL,
+	.resume = NULL,
+	.power_restore = mmc_power_restore,
+};
+
+static const struct mmc_bus_ops mmc_ops_unsafe = {
+	.awake = mmc_awake,
+	.sleep = mmc_sleep,
+	.remove = mmc_remove,
+	.detect = mmc_detect,
+	.suspend = mmc_suspend,
+	.resume = mmc_resume,
+	.power_restore = mmc_power_restore,
+};
+
+static void mmc_attach_bus_ops(struct mmc_host *host)
+{
+	const struct mmc_bus_ops *bus_ops;
+
+	if (host->caps & MMC_CAP_NONREMOVABLE)
+		bus_ops = &mmc_ops_unsafe;
+	else
+		bus_ops = &mmc_ops;
+	mmc_attach_bus(host, bus_ops);
+}
+
+#endif
+
 /*
  * Starting point for MMC card init.
  */
@@ -575,7 +664,7 @@
 	BUG_ON(!host);
 	WARN_ON(!host->claimed);
 
-	mmc_attach_bus(host, &mmc_ops);
+	mmc_attach_bus_ops(host);
 
 	/*
 	 * We need to get OCR a different way for SPI.
diff --git a/drivers/mmc/core/mmc_ops.c b/drivers/mmc/core/mmc_ops.c
index 34ce270..d2cb5c6 100644
--- a/drivers/mmc/core/mmc_ops.c
+++ b/drivers/mmc/core/mmc_ops.c
@@ -57,6 +57,42 @@
 	return _mmc_select_card(host, NULL);
 }
 
+int mmc_card_sleepawake(struct mmc_host *host, int sleep)
+{
+	struct mmc_command cmd;
+	struct mmc_card *card = host->card;
+	int err;
+
+	if (sleep)
+		mmc_deselect_cards(host);
+
+	memset(&cmd, 0, sizeof(struct mmc_command));
+
+	cmd.opcode = MMC_SLEEP_AWAKE;
+	cmd.arg = card->rca << 16;
+	if (sleep)
+		cmd.arg |= 1 << 15;
+
+	cmd.flags = MMC_RSP_R1B | MMC_CMD_AC;
+	err = mmc_wait_for_cmd(host, &cmd, 0);
+	if (err)
+		return err;
+
+	/*
+	 * If the host does not wait while the card signals busy, then we will
+	 * will have to wait the sleep/awake timeout.  Note, we cannot use the
+	 * SEND_STATUS command to poll the status because that command (and most
+	 * others) is invalid while the card sleeps.
+	 */
+	if (!(host->caps & MMC_CAP_WAIT_WHILE_BUSY))
+		mmc_delay(DIV_ROUND_UP(card->ext_csd.sa_timeout, 10000));
+
+	if (!sleep)
+		err = mmc_select_card(card);
+
+	return err;
+}
+
 int mmc_go_idle(struct mmc_host *host)
 {
 	int err;
@@ -354,6 +390,7 @@
 {
 	int err;
 	struct mmc_command cmd;
+	u32 status;
 
 	BUG_ON(!card);
 	BUG_ON(!card->host);
@@ -371,6 +408,28 @@
 	if (err)
 		return err;
 
+	/* Must check status to be sure of no errors */
+	do {
+		err = mmc_send_status(card, &status);
+		if (err)
+			return err;
+		if (card->host->caps & MMC_CAP_WAIT_WHILE_BUSY)
+			break;
+		if (mmc_host_is_spi(card->host))
+			break;
+	} while (R1_CURRENT_STATE(status) == 7);
+
+	if (mmc_host_is_spi(card->host)) {
+		if (status & R1_SPI_ILLEGAL_COMMAND)
+			return -EBADMSG;
+	} else {
+		if (status & 0xFDFFA000)
+			printk(KERN_WARNING "%s: unexpected status %#x after "
+			       "switch", mmc_hostname(card->host), status);
+		if (status & R1_SWITCH_ERROR)
+			return -EBADMSG;
+	}
+
 	return 0;
 }
 
diff --git a/drivers/mmc/core/mmc_ops.h b/drivers/mmc/core/mmc_ops.h
index 17854bf..653eb8e 100644
--- a/drivers/mmc/core/mmc_ops.h
+++ b/drivers/mmc/core/mmc_ops.h
@@ -25,6 +25,7 @@
 int mmc_send_cid(struct mmc_host *host, u32 *cid);
 int mmc_spi_read_ocr(struct mmc_host *host, int highcap, u32 *ocrp);
 int mmc_spi_set_crc(struct mmc_host *host, int use_crc);
+int mmc_card_sleepawake(struct mmc_host *host, int sleep);
 
 #endif
 
diff --git a/drivers/mmc/core/sd.c b/drivers/mmc/core/sd.c
index 7ad646f..10b2a4d 100644
--- a/drivers/mmc/core/sd.c
+++ b/drivers/mmc/core/sd.c
@@ -210,11 +210,11 @@
 
 	err = mmc_sd_switch(card, 0, 0, 1, status);
 	if (err) {
-		/*
-		 * We all hosts that cannot perform the command
-		 * to fail more gracefully
-		 */
-		if (err != -EINVAL)
+		/* If the host or the card can't do the switch,
+		 * fail more gracefully. */
+		if ((err != -EINVAL)
+		 && (err != -ENOSYS)
+		 && (err != -EFAULT))
 			goto out;
 
 		printk(KERN_WARNING "%s: problem reading switch "
@@ -561,12 +561,10 @@
 	}
 }
 
-#ifdef CONFIG_MMC_UNSAFE_RESUME
-
 /*
  * Suspend callback from host.
  */
-static void mmc_sd_suspend(struct mmc_host *host)
+static int mmc_sd_suspend(struct mmc_host *host)
 {
 	BUG_ON(!host);
 	BUG_ON(!host->card);
@@ -576,6 +574,8 @@
 		mmc_deselect_cards(host);
 	host->card->state &= ~MMC_STATE_HIGHSPEED;
 	mmc_release_host(host);
+
+	return 0;
 }
 
 /*
@@ -584,7 +584,7 @@
  * This function tries to determine if the same card is still present
  * and, if so, restore all state to it.
  */
-static void mmc_sd_resume(struct mmc_host *host)
+static int mmc_sd_resume(struct mmc_host *host)
 {
 	int err;
 
@@ -595,30 +595,63 @@
 	err = mmc_sd_init_card(host, host->ocr, host->card);
 	mmc_release_host(host);
 
-	if (err) {
-		mmc_sd_remove(host);
-
-		mmc_claim_host(host);
-		mmc_detach_bus(host);
-		mmc_release_host(host);
-	}
-
+	return err;
 }
 
-#else
+static void mmc_sd_power_restore(struct mmc_host *host)
+{
+	host->card->state &= ~MMC_STATE_HIGHSPEED;
+	mmc_claim_host(host);
+	mmc_sd_init_card(host, host->ocr, host->card);
+	mmc_release_host(host);
+}
 
-#define mmc_sd_suspend NULL
-#define mmc_sd_resume NULL
-
-#endif
+#ifdef CONFIG_MMC_UNSAFE_RESUME
 
 static const struct mmc_bus_ops mmc_sd_ops = {
 	.remove = mmc_sd_remove,
 	.detect = mmc_sd_detect,
 	.suspend = mmc_sd_suspend,
 	.resume = mmc_sd_resume,
+	.power_restore = mmc_sd_power_restore,
 };
 
+static void mmc_sd_attach_bus_ops(struct mmc_host *host)
+{
+	mmc_attach_bus(host, &mmc_sd_ops);
+}
+
+#else
+
+static const struct mmc_bus_ops mmc_sd_ops = {
+	.remove = mmc_sd_remove,
+	.detect = mmc_sd_detect,
+	.suspend = NULL,
+	.resume = NULL,
+	.power_restore = mmc_sd_power_restore,
+};
+
+static const struct mmc_bus_ops mmc_sd_ops_unsafe = {
+	.remove = mmc_sd_remove,
+	.detect = mmc_sd_detect,
+	.suspend = mmc_sd_suspend,
+	.resume = mmc_sd_resume,
+	.power_restore = mmc_sd_power_restore,
+};
+
+static void mmc_sd_attach_bus_ops(struct mmc_host *host)
+{
+	const struct mmc_bus_ops *bus_ops;
+
+	if (host->caps & MMC_CAP_NONREMOVABLE)
+		bus_ops = &mmc_sd_ops_unsafe;
+	else
+		bus_ops = &mmc_sd_ops;
+	mmc_attach_bus(host, bus_ops);
+}
+
+#endif
+
 /*
  * Starting point for SD card init.
  */
@@ -629,7 +662,7 @@
 	BUG_ON(!host);
 	WARN_ON(!host->claimed);
 
-	mmc_attach_bus(host, &mmc_sd_ops);
+	mmc_sd_attach_bus_ops(host);
 
 	/*
 	 * We need to get OCR a different way for SPI.
diff --git a/drivers/mmc/core/sdio.c b/drivers/mmc/core/sdio.c
index fb99ccf..cdb845b 100644
--- a/drivers/mmc/core/sdio.c
+++ b/drivers/mmc/core/sdio.c
@@ -165,6 +165,29 @@
 }
 
 /*
+ * If desired, disconnect the pull-up resistor on CD/DAT[3] (pin 1)
+ * of the card. This may be required on certain setups of boards,
+ * controllers and embedded sdio device which do not need the card's
+ * pull-up. As a result, card detection is disabled and power is saved.
+ */
+static int sdio_disable_cd(struct mmc_card *card)
+{
+	int ret;
+	u8 ctrl;
+
+	if (!card->cccr.disable_cd)
+		return 0;
+
+	ret = mmc_io_rw_direct(card, 0, 0, SDIO_CCCR_IF, 0, &ctrl);
+	if (ret)
+		return ret;
+
+	ctrl |= SDIO_BUS_CD_DISABLE;
+
+	return mmc_io_rw_direct(card, 1, 0, SDIO_CCCR_IF, ctrl, NULL);
+}
+
+/*
  * Test if the card supports high-speed mode and, if so, switch to it.
  */
 static int sdio_enable_hs(struct mmc_card *card)
@@ -195,6 +218,135 @@
 }
 
 /*
+ * Handle the detection and initialisation of a card.
+ *
+ * In the case of a resume, "oldcard" will contain the card
+ * we're trying to reinitialise.
+ */
+static int mmc_sdio_init_card(struct mmc_host *host, u32 ocr,
+			      struct mmc_card *oldcard)
+{
+	struct mmc_card *card;
+	int err;
+
+	BUG_ON(!host);
+	WARN_ON(!host->claimed);
+
+	/*
+	 * Inform the card of the voltage
+	 */
+	err = mmc_send_io_op_cond(host, host->ocr, &ocr);
+	if (err)
+		goto err;
+
+	/*
+	 * For SPI, enable CRC as appropriate.
+	 */
+	if (mmc_host_is_spi(host)) {
+		err = mmc_spi_set_crc(host, use_spi_crc);
+		if (err)
+			goto err;
+	}
+
+	/*
+	 * Allocate card structure.
+	 */
+	card = mmc_alloc_card(host, NULL);
+	if (IS_ERR(card)) {
+		err = PTR_ERR(card);
+		goto err;
+	}
+
+	card->type = MMC_TYPE_SDIO;
+
+	/*
+	 * For native busses:  set card RCA and quit open drain mode.
+	 */
+	if (!mmc_host_is_spi(host)) {
+		err = mmc_send_relative_addr(host, &card->rca);
+		if (err)
+			goto remove;
+
+		mmc_set_bus_mode(host, MMC_BUSMODE_PUSHPULL);
+	}
+
+	/*
+	 * Select card, as all following commands rely on that.
+	 */
+	if (!mmc_host_is_spi(host)) {
+		err = mmc_select_card(card);
+		if (err)
+			goto remove;
+	}
+
+	/*
+	 * Read the common registers.
+	 */
+	err = sdio_read_cccr(card);
+	if (err)
+		goto remove;
+
+	/*
+	 * Read the common CIS tuples.
+	 */
+	err = sdio_read_common_cis(card);
+	if (err)
+		goto remove;
+
+	if (oldcard) {
+		int same = (card->cis.vendor == oldcard->cis.vendor &&
+			    card->cis.device == oldcard->cis.device);
+		mmc_remove_card(card);
+		if (!same) {
+			err = -ENOENT;
+			goto err;
+		}
+		card = oldcard;
+		return 0;
+	}
+
+	/*
+	 * Switch to high-speed (if supported).
+	 */
+	err = sdio_enable_hs(card);
+	if (err)
+		goto remove;
+
+	/*
+	 * Change to the card's maximum speed.
+	 */
+	if (mmc_card_highspeed(card)) {
+		/*
+		 * The SDIO specification doesn't mention how
+		 * the CIS transfer speed register relates to
+		 * high-speed, but it seems that 50 MHz is
+		 * mandatory.
+		 */
+		mmc_set_clock(host, 50000000);
+	} else {
+		mmc_set_clock(host, card->cis.max_dtr);
+	}
+
+	/*
+	 * Switch to wider bus (if supported).
+	 */
+	err = sdio_enable_wide(card);
+	if (err)
+		goto remove;
+
+	if (!oldcard)
+		host->card = card;
+	return 0;
+
+remove:
+	if (!oldcard)
+		mmc_remove_card(card);
+
+err:
+	return err;
+}
+
+/*
  * Host is being removed. Free up the current card.
  */
 static void mmc_sdio_remove(struct mmc_host *host)
@@ -243,10 +395,77 @@
 	}
 }
 
+/*
+ * SDIO suspend.  We need to suspend all functions separately.
+ * Therefore all registered functions must have drivers with suspend
+ * and resume methods.  Failing that we simply remove the whole card.
+ */
+static int mmc_sdio_suspend(struct mmc_host *host)
+{
+	int i, err = 0;
+
+	for (i = 0; i < host->card->sdio_funcs; i++) {
+		struct sdio_func *func = host->card->sdio_func[i];
+		if (func && sdio_func_present(func) && func->dev.driver) {
+			const struct dev_pm_ops *pmops = func->dev.driver->pm;
+			if (!pmops || !pmops->suspend || !pmops->resume) {
+				/* force removal of entire card in that case */
+				err = -ENOSYS;
+			} else
+				err = pmops->suspend(&func->dev);
+			if (err)
+				break;
+		}
+	}
+	while (err && --i >= 0) {
+		struct sdio_func *func = host->card->sdio_func[i];
+		if (func && sdio_func_present(func) && func->dev.driver) {
+			const struct dev_pm_ops *pmops = func->dev.driver->pm;
+			pmops->resume(&func->dev);
+		}
+	}
+
+	return err;
+}
+
+static int mmc_sdio_resume(struct mmc_host *host)
+{
+	int i, err;
+
+	BUG_ON(!host);
+	BUG_ON(!host->card);
+
+	/* Basic card reinitialization. */
+	mmc_claim_host(host);
+	err = mmc_sdio_init_card(host, host->ocr, host->card);
+	mmc_release_host(host);
+
+	/*
+	 * If the card looked to be the same as before suspending, then
+	 * we proceed to resume all card functions.  If one of them returns
+	 * an error then we simply return that error to the core and the
+	 * card will be redetected as new.  It is the responsibility of
+	 * the function driver to perform further tests with the extra
+	 * knowledge it has of the card to confirm the card is indeed the
+	 * same as before suspending (same MAC address for network cards,
+	 * etc.) and return an error otherwise.
+	 */
+	for (i = 0; !err && i < host->card->sdio_funcs; i++) {
+		struct sdio_func *func = host->card->sdio_func[i];
+		if (func && sdio_func_present(func) && func->dev.driver) {
+			const struct dev_pm_ops *pmops = func->dev.driver->pm;
+			err = pmops->resume(&func->dev);
+		}
+	}
+
+	return err;
+}
 
 static const struct mmc_bus_ops mmc_sdio_ops = {
 	.remove = mmc_sdio_remove,
 	.detect = mmc_sdio_detect,
+	.suspend = mmc_sdio_suspend,
+	.resume = mmc_sdio_resume,
 };
 
 
@@ -275,13 +494,6 @@
 		ocr &= ~0x7F;
 	}
 
-	if (ocr & MMC_VDD_165_195) {
-		printk(KERN_WARNING "%s: SDIO card claims to support the "
-		       "incompletely defined 'low voltage range'. This "
-		       "will be ignored.\n", mmc_hostname(host));
-		ocr &= ~MMC_VDD_165_195;
-	}
-
 	host->ocr = mmc_select_voltage(host, ocr);
 
 	/*
@@ -293,101 +505,23 @@
 	}
 
 	/*
-	 * Inform the card of the voltage
+	 * Detect and init the card.
 	 */
-	err = mmc_send_io_op_cond(host, host->ocr, &ocr);
+	err = mmc_sdio_init_card(host, host->ocr, NULL);
 	if (err)
 		goto err;
-
-	/*
-	 * For SPI, enable CRC as appropriate.
-	 */
-	if (mmc_host_is_spi(host)) {
-		err = mmc_spi_set_crc(host, use_spi_crc);
-		if (err)
-			goto err;
-	}
+	card = host->card;
 
 	/*
 	 * The number of functions on the card is encoded inside
 	 * the ocr.
 	 */
-	funcs = (ocr & 0x70000000) >> 28;
+	card->sdio_funcs = funcs = (ocr & 0x70000000) >> 28;
 
 	/*
-	 * Allocate card structure.
+	 * If needed, disconnect card detection pull-up resistor.
 	 */
-	card = mmc_alloc_card(host, NULL);
-	if (IS_ERR(card)) {
-		err = PTR_ERR(card);
-		goto err;
-	}
-
-	card->type = MMC_TYPE_SDIO;
-	card->sdio_funcs = funcs;
-
-	host->card = card;
-
-	/*
-	 * For native busses:  set card RCA and quit open drain mode.
-	 */
-	if (!mmc_host_is_spi(host)) {
-		err = mmc_send_relative_addr(host, &card->rca);
-		if (err)
-			goto remove;
-
-		mmc_set_bus_mode(host, MMC_BUSMODE_PUSHPULL);
-	}
-
-	/*
-	 * Select card, as all following commands rely on that.
-	 */
-	if (!mmc_host_is_spi(host)) {
-		err = mmc_select_card(card);
-		if (err)
-			goto remove;
-	}
-
-	/*
-	 * Read the common registers.
-	 */
-	err = sdio_read_cccr(card);
-	if (err)
-		goto remove;
-
-	/*
-	 * Read the common CIS tuples.
-	 */
-	err = sdio_read_common_cis(card);
-	if (err)
-		goto remove;
-
-	/*
-	 * Switch to high-speed (if supported).
-	 */
-	err = sdio_enable_hs(card);
-	if (err)
-		goto remove;
-
-	/*
-	 * Change to the card's maximum speed.
-	 */
-	if (mmc_card_highspeed(card)) {
-		/*
-		 * The SDIO specification doesn't mention how
-		 * the CIS transfer speed register relates to
-		 * high-speed, but it seems that 50 MHz is
-		 * mandatory.
-		 */
-		mmc_set_clock(host, 50000000);
-	} else {
-		mmc_set_clock(host, card->cis.max_dtr);
-	}
-
-	/*
-	 * Switch to wider bus (if supported).
-	 */
-	err = sdio_enable_wide(card);
+	err = sdio_disable_cd(card);
 	if (err)
 		goto remove;
 
diff --git a/drivers/mmc/core/sdio_bus.c b/drivers/mmc/core/sdio_bus.c
index 46284b5..d37464e 100644
--- a/drivers/mmc/core/sdio_bus.c
+++ b/drivers/mmc/core/sdio_bus.c
@@ -20,9 +20,6 @@
 #include "sdio_cis.h"
 #include "sdio_bus.h"
 
-#define dev_to_sdio_func(d)	container_of(d, struct sdio_func, dev)
-#define to_sdio_driver(d)      container_of(d, struct sdio_driver, drv)
-
 /* show configuration fields */
 #define sdio_config_attr(field, format_string)				\
 static ssize_t								\
diff --git a/drivers/mmc/core/sdio_cis.c b/drivers/mmc/core/sdio_cis.c
index 963f293..6636354 100644
--- a/drivers/mmc/core/sdio_cis.c
+++ b/drivers/mmc/core/sdio_cis.c
@@ -40,7 +40,7 @@
 			nr_strings++;
 	}
 
-	if (buf[i-1] != '\0') {
+	if (nr_strings < 4) {
 		printk(KERN_WARNING "SDIO: ignoring broken CISTPL_VERS_1\n");
 		return 0;
 	}
diff --git a/drivers/mmc/core/sdio_io.c b/drivers/mmc/core/sdio_io.c
index f61fc2d..f9aa8a7 100644
--- a/drivers/mmc/core/sdio_io.c
+++ b/drivers/mmc/core/sdio_io.c
@@ -624,7 +624,7 @@
 
 	BUG_ON(!func);
 
-	if (addr < 0xF0 || addr > 0xFF) {
+	if ((addr < 0xF0 || addr > 0xFF) && (!mmc_card_lenient_fn0(func->card))) {
 		if (err_ret)
 			*err_ret = -EINVAL;
 		return;
diff --git a/drivers/mmc/host/Kconfig b/drivers/mmc/host/Kconfig
index 891ef18..7cb057f 100644
--- a/drivers/mmc/host/Kconfig
+++ b/drivers/mmc/host/Kconfig
@@ -132,11 +132,11 @@
 
 config MMC_OMAP_HS
 	tristate "TI OMAP High Speed Multimedia Card Interface support"
-	depends on ARCH_OMAP2430 || ARCH_OMAP3
+	depends on ARCH_OMAP2430 || ARCH_OMAP3 || ARCH_OMAP4
 	help
 	  This selects the TI OMAP High Speed Multimedia card Interface.
-	  If you have an OMAP2430 or OMAP3 board with a Multimedia Card slot,
-	  say Y or M here.
+	  If you have an OMAP2430 or OMAP3 board or OMAP4 board with a
+	  Multimedia Card slot, say Y or M here.
 
 	  If unsure, say N.
 
@@ -160,6 +160,12 @@
 
 	  If unsure, say N.
 
+choice
+	prompt "Atmel SD/MMC Driver"
+	default MMC_ATMELMCI if AVR32
+	help
+	  Choose which driver to use for the Atmel MCI Silicon
+
 config MMC_AT91
 	tristate "AT91 SD/MMC Card Interface support"
 	depends on ARCH_AT91
@@ -170,17 +176,19 @@
 
 config MMC_ATMELMCI
 	tristate "Atmel Multimedia Card Interface support"
-	depends on AVR32
+	depends on AVR32 || ARCH_AT91
 	help
 	  This selects the Atmel Multimedia Card Interface driver. If
-	  you have an AT32 (AVR32) platform with a Multimedia Card
-	  slot, say Y or M here.
+	  you have an AT32 (AVR32) or AT91 platform with a Multimedia
+	  Card slot, say Y or M here.
 
 	  If unsure, say N.
 
+endchoice
+
 config MMC_ATMELMCI_DMA
 	bool "Atmel MCI DMA support (EXPERIMENTAL)"
-	depends on MMC_ATMELMCI && DMA_ENGINE && EXPERIMENTAL
+	depends on MMC_ATMELMCI && AVR32 && DMA_ENGINE && EXPERIMENTAL
 	help
 	  Say Y here to have the Atmel MCI driver use a DMA engine to
 	  do data transfers and thus increase the throughput and
@@ -199,6 +207,13 @@
 
 	  If unsure, say N.
 
+config MMC_MSM7X00A
+	tristate "Qualcomm MSM 7X00A SDCC Controller Support"
+	depends on MMC && ARCH_MSM
+	help
+	  This provides support for the SD/MMC cell found in the
+          MSM 7X00A controllers from Qualcomm.
+
 config MMC_MXC
 	tristate "Freescale i.MX2/3 Multimedia Card Interface support"
 	depends on ARCH_MXC
diff --git a/drivers/mmc/host/Makefile b/drivers/mmc/host/Makefile
index cf153f6..abcb040 100644
--- a/drivers/mmc/host/Makefile
+++ b/drivers/mmc/host/Makefile
@@ -23,6 +23,7 @@
 obj-$(CONFIG_MMC_AT91)		+= at91_mci.o
 obj-$(CONFIG_MMC_ATMELMCI)	+= atmel-mci.o
 obj-$(CONFIG_MMC_TIFM_SD)	+= tifm_sd.o
+obj-$(CONFIG_MMC_MSM7X00A)	+= msm_sdcc.o
 obj-$(CONFIG_MMC_MVSDIO)	+= mvsdio.o
 obj-$(CONFIG_MMC_SPI)		+= mmc_spi.o
 ifeq ($(CONFIG_OF),y)
diff --git a/drivers/mmc/host/atmel-mci.c b/drivers/mmc/host/atmel-mci.c
index 7b603e4..065fa81 100644
--- a/drivers/mmc/host/atmel-mci.c
+++ b/drivers/mmc/host/atmel-mci.c
@@ -30,6 +30,7 @@
 #include <asm/io.h>
 #include <asm/unaligned.h>
 
+#include <mach/cpu.h>
 #include <mach/board.h>
 
 #include "atmel-mci-regs.h"
@@ -210,6 +211,18 @@
 	set_bit(event, &host->pending_events)
 
 /*
+ * Enable or disable features/registers based on
+ * whether the processor supports them
+ */
+static bool mci_has_rwproof(void)
+{
+	if (cpu_is_at91sam9261() || cpu_is_at91rm9200())
+		return false;
+	else
+		return true;
+}
+
+/*
  * The debugfs stuff below is mostly optimized away when
  * CONFIG_DEBUG_FS is not set.
  */
@@ -276,8 +289,13 @@
 		[3]	= "BLKE",
 		[4]	= "DTIP",
 		[5]	= "NOTBUSY",
+		[6]	= "ENDRX",
+		[7]	= "ENDTX",
 		[8]	= "SDIOIRQA",
 		[9]	= "SDIOIRQB",
+		[12]	= "SDIOWAIT",
+		[14]	= "RXBUFF",
+		[15]	= "TXBUFE",
 		[16]	= "RINDE",
 		[17]	= "RDIRE",
 		[18]	= "RCRCE",
@@ -285,6 +303,11 @@
 		[20]	= "RTOE",
 		[21]	= "DCRCE",
 		[22]	= "DTOE",
+		[23]	= "CSTOE",
+		[24]	= "BLKOVRE",
+		[25]	= "DMADONE",
+		[26]	= "FIFOEMPTY",
+		[27]	= "XFRDONE",
 		[30]	= "OVRE",
 		[31]	= "UNRE",
 	};
@@ -849,13 +872,15 @@
 			clkdiv = 255;
 		}
 
+		host->mode_reg = MCI_MR_CLKDIV(clkdiv);
+
 		/*
 		 * WRPROOF and RDPROOF prevent overruns/underruns by
 		 * stopping the clock when the FIFO is full/empty.
 		 * This state is not expected to last for long.
 		 */
-		host->mode_reg = MCI_MR_CLKDIV(clkdiv) | MCI_MR_WRPROOF
-					| MCI_MR_RDPROOF;
+		if (mci_has_rwproof())
+			host->mode_reg |= (MCI_MR_WRPROOF | MCI_MR_RDPROOF);
 
 		if (list_empty(&host->queue))
 			mci_writel(host, MR, host->mode_reg);
@@ -1648,8 +1673,10 @@
 			nr_slots++;
 	}
 
-	if (!nr_slots)
+	if (!nr_slots) {
+		dev_err(&pdev->dev, "init failed: no slot defined\n");
 		goto err_init_slot;
+	}
 
 	dev_info(&pdev->dev,
 			"Atmel MCI controller at 0x%08lx irq %d, %u slots\n",
diff --git a/drivers/mmc/host/mmc_spi.c b/drivers/mmc/host/mmc_spi.c
index a461017..d55fe4f 100644
--- a/drivers/mmc/host/mmc_spi.c
+++ b/drivers/mmc/host/mmc_spi.c
@@ -1562,3 +1562,4 @@
 		"Hans-Peter Nilsson, Jan Nikitenko");
 MODULE_DESCRIPTION("SPI SD/MMC host driver");
 MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:mmc_spi");
diff --git a/drivers/mmc/host/msm_sdcc.c b/drivers/mmc/host/msm_sdcc.c
new file mode 100644
index 0000000..dba4600
--- /dev/null
+++ b/drivers/mmc/host/msm_sdcc.c
@@ -0,0 +1,1287 @@
+/*
+ *  linux/drivers/mmc/host/msm_sdcc.c - Qualcomm MSM 7X00A SDCC Driver
+ *
+ *  Copyright (C) 2007 Google Inc,
+ *  Copyright (C) 2003 Deep Blue Solutions, Ltd, All Rights Reserved.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * Based on mmci.c
+ *
+ * Author: San Mehat (san@android.com)
+ *
+ */
+
+#include <linux/module.h>
+#include <linux/moduleparam.h>
+#include <linux/init.h>
+#include <linux/ioport.h>
+#include <linux/device.h>
+#include <linux/interrupt.h>
+#include <linux/delay.h>
+#include <linux/err.h>
+#include <linux/highmem.h>
+#include <linux/log2.h>
+#include <linux/mmc/host.h>
+#include <linux/mmc/card.h>
+#include <linux/clk.h>
+#include <linux/scatterlist.h>
+#include <linux/platform_device.h>
+#include <linux/dma-mapping.h>
+#include <linux/debugfs.h>
+#include <linux/io.h>
+#include <linux/memory.h>
+
+#include <asm/cacheflush.h>
+#include <asm/div64.h>
+#include <asm/sizes.h>
+
+#include <asm/mach/mmc.h>
+#include <mach/msm_iomap.h>
+#include <mach/dma.h>
+#include <mach/htc_pwrsink.h>
+
+#include "msm_sdcc.h"
+
+#define DRIVER_NAME "msm-sdcc"
+
+static unsigned int msmsdcc_fmin = 144000;
+static unsigned int msmsdcc_fmax = 50000000;
+static unsigned int msmsdcc_4bit = 1;
+static unsigned int msmsdcc_pwrsave = 1;
+static unsigned int msmsdcc_piopoll = 1;
+static unsigned int msmsdcc_sdioirq;
+
+#define PIO_SPINMAX 30
+#define CMD_SPINMAX 20
+
+static void
+msmsdcc_start_command(struct msmsdcc_host *host, struct mmc_command *cmd,
+		      u32 c);
+
+static void
+msmsdcc_request_end(struct msmsdcc_host *host, struct mmc_request *mrq)
+{
+	writel(0, host->base + MMCICOMMAND);
+
+	BUG_ON(host->curr.data);
+
+	host->curr.mrq = NULL;
+	host->curr.cmd = NULL;
+
+	if (mrq->data)
+		mrq->data->bytes_xfered = host->curr.data_xfered;
+	if (mrq->cmd->error == -ETIMEDOUT)
+		mdelay(5);
+
+	/*
+	 * Need to drop the host lock here; mmc_request_done may call
+	 * back into the driver...
+	 */
+	spin_unlock(&host->lock);
+	mmc_request_done(host->mmc, mrq);
+	spin_lock(&host->lock);
+}
+
+static void
+msmsdcc_stop_data(struct msmsdcc_host *host)
+{
+	writel(0, host->base + MMCIDATACTRL);
+	host->curr.data = NULL;
+	host->curr.got_dataend = host->curr.got_datablkend = 0;
+}
+
+uint32_t msmsdcc_fifo_addr(struct msmsdcc_host *host)
+{
+	switch (host->pdev_id) {
+	case 1:
+		return MSM_SDC1_PHYS + MMCIFIFO;
+	case 2:
+		return MSM_SDC2_PHYS + MMCIFIFO;
+	case 3:
+		return MSM_SDC3_PHYS + MMCIFIFO;
+	case 4:
+		return MSM_SDC4_PHYS + MMCIFIFO;
+	}
+	BUG();
+	return 0;
+}
+
+static void
+msmsdcc_dma_complete_func(struct msm_dmov_cmd *cmd,
+			  unsigned int result,
+			  struct msm_dmov_errdata *err)
+{
+	struct msmsdcc_dma_data	*dma_data =
+		container_of(cmd, struct msmsdcc_dma_data, hdr);
+	struct msmsdcc_host	*host = dma_data->host;
+	unsigned long		flags;
+	struct mmc_request	*mrq;
+
+	spin_lock_irqsave(&host->lock, flags);
+	mrq = host->curr.mrq;
+	BUG_ON(!mrq);
+
+	if (!(result & DMOV_RSLT_VALID)) {
+		pr_err("msmsdcc: Invalid DataMover result\n");
+		goto out;
+	}
+
+	if (result & DMOV_RSLT_DONE) {
+		host->curr.data_xfered = host->curr.xfer_size;
+	} else {
+		/* Error or flush  */
+		if (result & DMOV_RSLT_ERROR)
+			pr_err("%s: DMA error (0x%.8x)\n",
+			       mmc_hostname(host->mmc), result);
+		if (result & DMOV_RSLT_FLUSH)
+			pr_err("%s: DMA channel flushed (0x%.8x)\n",
+			       mmc_hostname(host->mmc), result);
+		if (err)
+			pr_err("Flush data: %.8x %.8x %.8x %.8x %.8x %.8x\n",
+			       err->flush[0], err->flush[1], err->flush[2],
+			       err->flush[3], err->flush[4], err->flush[5]);
+		if (!mrq->data->error)
+			mrq->data->error = -EIO;
+	}
+	host->dma.busy = 0;
+	dma_unmap_sg(mmc_dev(host->mmc), host->dma.sg, host->dma.num_ents,
+		     host->dma.dir);
+
+	if (host->curr.user_pages) {
+		struct scatterlist *sg = host->dma.sg;
+		int i;
+
+		for (i = 0; i < host->dma.num_ents; i++)
+			flush_dcache_page(sg_page(sg++));
+	}
+
+	host->dma.sg = NULL;
+
+	if ((host->curr.got_dataend && host->curr.got_datablkend)
+	     || mrq->data->error) {
+
+		/*
+		 * If we've already gotten our DATAEND / DATABLKEND
+		 * for this request, then complete it through here.
+		 */
+		msmsdcc_stop_data(host);
+
+		if (!mrq->data->error)
+			host->curr.data_xfered = host->curr.xfer_size;
+		if (!mrq->data->stop || mrq->cmd->error) {
+			writel(0, host->base + MMCICOMMAND);
+			host->curr.mrq = NULL;
+			host->curr.cmd = NULL;
+			mrq->data->bytes_xfered = host->curr.data_xfered;
+
+			spin_unlock_irqrestore(&host->lock, flags);
+			mmc_request_done(host->mmc, mrq);
+			return;
+		} else
+			msmsdcc_start_command(host, mrq->data->stop, 0);
+	}
+
+out:
+	spin_unlock_irqrestore(&host->lock, flags);
+	return;
+}
+
+static int validate_dma(struct msmsdcc_host *host, struct mmc_data *data)
+{
+	if (host->dma.channel == -1)
+		return -ENOENT;
+
+	if ((data->blksz * data->blocks) < MCI_FIFOSIZE)
+		return -EINVAL;
+	if ((data->blksz * data->blocks) % MCI_FIFOSIZE)
+		return -EINVAL;
+	return 0;
+}
+
+static int msmsdcc_config_dma(struct msmsdcc_host *host, struct mmc_data *data)
+{
+	struct msmsdcc_nc_dmadata *nc;
+	dmov_box *box;
+	uint32_t rows;
+	uint32_t crci;
+	unsigned int n;
+	int i, rc;
+	struct scatterlist *sg = data->sg;
+
+	rc = validate_dma(host, data);
+	if (rc)
+		return rc;
+
+	host->dma.sg = data->sg;
+	host->dma.num_ents = data->sg_len;
+
+	nc = host->dma.nc;
+
+	switch (host->pdev_id) {
+	case 1:
+		crci = MSMSDCC_CRCI_SDC1;
+		break;
+	case 2:
+		crci = MSMSDCC_CRCI_SDC2;
+		break;
+	case 3:
+		crci = MSMSDCC_CRCI_SDC3;
+		break;
+	case 4:
+		crci = MSMSDCC_CRCI_SDC4;
+		break;
+	default:
+		host->dma.sg = NULL;
+		host->dma.num_ents = 0;
+		return -ENOENT;
+	}
+
+	if (data->flags & MMC_DATA_READ)
+		host->dma.dir = DMA_FROM_DEVICE;
+	else
+		host->dma.dir = DMA_TO_DEVICE;
+
+	host->curr.user_pages = 0;
+
+	n = dma_map_sg(mmc_dev(host->mmc), host->dma.sg,
+		       host->dma.num_ents, host->dma.dir);
+
+	if (n != host->dma.num_ents) {
+		pr_err("%s: Unable to map in all sg elements\n",
+		       mmc_hostname(host->mmc));
+		host->dma.sg = NULL;
+		host->dma.num_ents = 0;
+		return -ENOMEM;
+	}
+
+	box = &nc->cmd[0];
+	for (i = 0; i < host->dma.num_ents; i++) {
+		box->cmd = CMD_MODE_BOX;
+
+		if (i == (host->dma.num_ents - 1))
+			box->cmd |= CMD_LC;
+		rows = (sg_dma_len(sg) % MCI_FIFOSIZE) ?
+			(sg_dma_len(sg) / MCI_FIFOSIZE) + 1 :
+			(sg_dma_len(sg) / MCI_FIFOSIZE) ;
+
+		if (data->flags & MMC_DATA_READ) {
+			box->src_row_addr = msmsdcc_fifo_addr(host);
+			box->dst_row_addr = sg_dma_address(sg);
+
+			box->src_dst_len = (MCI_FIFOSIZE << 16) |
+					   (MCI_FIFOSIZE);
+			box->row_offset = MCI_FIFOSIZE;
+
+			box->num_rows = rows * ((1 << 16) + 1);
+			box->cmd |= CMD_SRC_CRCI(crci);
+		} else {
+			box->src_row_addr = sg_dma_address(sg);
+			box->dst_row_addr = msmsdcc_fifo_addr(host);
+
+			box->src_dst_len = (MCI_FIFOSIZE << 16) |
+					   (MCI_FIFOSIZE);
+			box->row_offset = (MCI_FIFOSIZE << 16);
+
+			box->num_rows = rows * ((1 << 16) + 1);
+			box->cmd |= CMD_DST_CRCI(crci);
+		}
+		box++;
+		sg++;
+	}
+
+	/* location of command block must be 64 bit aligned */
+	BUG_ON(host->dma.cmd_busaddr & 0x07);
+
+	nc->cmdptr = (host->dma.cmd_busaddr >> 3) | CMD_PTR_LP;
+	host->dma.hdr.cmdptr = DMOV_CMD_PTR_LIST |
+			       DMOV_CMD_ADDR(host->dma.cmdptr_busaddr);
+	host->dma.hdr.complete_func = msmsdcc_dma_complete_func;
+
+	return 0;
+}
+
+static void
+msmsdcc_start_data(struct msmsdcc_host *host, struct mmc_data *data)
+{
+	unsigned int datactrl, timeout;
+	unsigned long long clks;
+	void __iomem *base = host->base;
+	unsigned int pio_irqmask = 0;
+
+	host->curr.data = data;
+	host->curr.xfer_size = data->blksz * data->blocks;
+	host->curr.xfer_remain = host->curr.xfer_size;
+	host->curr.data_xfered = 0;
+	host->curr.got_dataend = 0;
+	host->curr.got_datablkend = 0;
+
+	memset(&host->pio, 0, sizeof(host->pio));
+
+	clks = (unsigned long long)data->timeout_ns * host->clk_rate;
+	do_div(clks, NSEC_PER_SEC);
+	timeout = data->timeout_clks + (unsigned int)clks;
+	writel(timeout, base + MMCIDATATIMER);
+
+	writel(host->curr.xfer_size, base + MMCIDATALENGTH);
+
+	datactrl = MCI_DPSM_ENABLE | (data->blksz << 4);
+
+	if (!msmsdcc_config_dma(host, data))
+		datactrl |= MCI_DPSM_DMAENABLE;
+	else {
+		host->pio.sg = data->sg;
+		host->pio.sg_len = data->sg_len;
+		host->pio.sg_off = 0;
+
+		if (data->flags & MMC_DATA_READ) {
+			pio_irqmask = MCI_RXFIFOHALFFULLMASK;
+			if (host->curr.xfer_remain < MCI_FIFOSIZE)
+				pio_irqmask |= MCI_RXDATAAVLBLMASK;
+		} else
+			pio_irqmask = MCI_TXFIFOHALFEMPTYMASK;
+	}
+
+	if (data->flags & MMC_DATA_READ)
+		datactrl |= MCI_DPSM_DIRECTION;
+
+	writel(pio_irqmask, base + MMCIMASK1);
+	writel(datactrl, base + MMCIDATACTRL);
+
+	if (datactrl & MCI_DPSM_DMAENABLE) {
+		host->dma.busy = 1;
+		msm_dmov_enqueue_cmd(host->dma.channel, &host->dma.hdr);
+	}
+}
+
+static void
+msmsdcc_start_command(struct msmsdcc_host *host, struct mmc_command *cmd, u32 c)
+{
+	void __iomem *base = host->base;
+
+	if (readl(base + MMCICOMMAND) & MCI_CPSM_ENABLE) {
+		writel(0, base + MMCICOMMAND);
+		udelay(2 + ((5 * 1000000) / host->clk_rate));
+	}
+
+	c |= cmd->opcode | MCI_CPSM_ENABLE;
+
+	if (cmd->flags & MMC_RSP_PRESENT) {
+		if (cmd->flags & MMC_RSP_136)
+			c |= MCI_CPSM_LONGRSP;
+		c |= MCI_CPSM_RESPONSE;
+	}
+
+	if (cmd->opcode == 17 || cmd->opcode == 18 ||
+	    cmd->opcode == 24 || cmd->opcode == 25 ||
+	    cmd->opcode == 53)
+		c |= MCI_CSPM_DATCMD;
+
+	if (cmd == cmd->mrq->stop)
+		c |= MCI_CSPM_MCIABORT;
+
+	host->curr.cmd = cmd;
+
+	host->stats.cmds++;
+
+	writel(cmd->arg, base + MMCIARGUMENT);
+	writel(c, base + MMCICOMMAND);
+}
+
+static void
+msmsdcc_data_err(struct msmsdcc_host *host, struct mmc_data *data,
+		 unsigned int status)
+{
+	if (status & MCI_DATACRCFAIL) {
+		pr_err("%s: Data CRC error\n", mmc_hostname(host->mmc));
+		pr_err("%s: opcode 0x%.8x\n", __func__,
+		       data->mrq->cmd->opcode);
+		pr_err("%s: blksz %d, blocks %d\n", __func__,
+		       data->blksz, data->blocks);
+		data->error = -EILSEQ;
+	} else if (status & MCI_DATATIMEOUT) {
+		pr_err("%s: Data timeout\n", mmc_hostname(host->mmc));
+		data->error = -ETIMEDOUT;
+	} else if (status & MCI_RXOVERRUN) {
+		pr_err("%s: RX overrun\n", mmc_hostname(host->mmc));
+		data->error = -EIO;
+	} else if (status & MCI_TXUNDERRUN) {
+		pr_err("%s: TX underrun\n", mmc_hostname(host->mmc));
+		data->error = -EIO;
+	} else {
+		pr_err("%s: Unknown error (0x%.8x)\n",
+		       mmc_hostname(host->mmc), status);
+		data->error = -EIO;
+	}
+}
+
+
+static int
+msmsdcc_pio_read(struct msmsdcc_host *host, char *buffer, unsigned int remain)
+{
+	void __iomem	*base = host->base;
+	uint32_t	*ptr = (uint32_t *) buffer;
+	int		count = 0;
+
+	while (readl(base + MMCISTATUS) & MCI_RXDATAAVLBL) {
+
+		*ptr = readl(base + MMCIFIFO + (count % MCI_FIFOSIZE));
+		ptr++;
+		count += sizeof(uint32_t);
+
+		remain -=  sizeof(uint32_t);
+		if (remain == 0)
+			break;
+	}
+	return count;
+}
+
+static int
+msmsdcc_pio_write(struct msmsdcc_host *host, char *buffer,
+		  unsigned int remain, u32 status)
+{
+	void __iomem *base = host->base;
+	char *ptr = buffer;
+
+	do {
+		unsigned int count, maxcnt;
+
+		maxcnt = status & MCI_TXFIFOEMPTY ? MCI_FIFOSIZE :
+						    MCI_FIFOHALFSIZE;
+		count = min(remain, maxcnt);
+
+		writesl(base + MMCIFIFO, ptr, count >> 2);
+		ptr += count;
+		remain -= count;
+
+		if (remain == 0)
+			break;
+
+		status = readl(base + MMCISTATUS);
+	} while (status & MCI_TXFIFOHALFEMPTY);
+
+	return ptr - buffer;
+}
+
+static int
+msmsdcc_spin_on_status(struct msmsdcc_host *host, uint32_t mask, int maxspin)
+{
+	while (maxspin) {
+		if ((readl(host->base + MMCISTATUS) & mask))
+			return 0;
+		udelay(1);
+		--maxspin;
+	}
+	return -ETIMEDOUT;
+}
+
+static int
+msmsdcc_pio_irq(int irq, void *dev_id)
+{
+	struct msmsdcc_host	*host = dev_id;
+	void __iomem		*base = host->base;
+	uint32_t		status;
+
+	status = readl(base + MMCISTATUS);
+
+	do {
+		unsigned long flags;
+		unsigned int remain, len;
+		char *buffer;
+
+		if (!(status & (MCI_TXFIFOHALFEMPTY | MCI_RXDATAAVLBL))) {
+			if (host->curr.xfer_remain == 0 || !msmsdcc_piopoll)
+				break;
+
+			if (msmsdcc_spin_on_status(host,
+						   (MCI_TXFIFOHALFEMPTY |
+						   MCI_RXDATAAVLBL),
+						   PIO_SPINMAX)) {
+				break;
+			}
+		}
+
+		/* Map the current scatter buffer */
+		local_irq_save(flags);
+		buffer = kmap_atomic(sg_page(host->pio.sg),
+				     KM_BIO_SRC_IRQ) + host->pio.sg->offset;
+		buffer += host->pio.sg_off;
+		remain = host->pio.sg->length - host->pio.sg_off;
+		len = 0;
+		if (status & MCI_RXACTIVE)
+			len = msmsdcc_pio_read(host, buffer, remain);
+		if (status & MCI_TXACTIVE)
+			len = msmsdcc_pio_write(host, buffer, remain, status);
+
+		/* Unmap the buffer */
+		kunmap_atomic(buffer, KM_BIO_SRC_IRQ);
+		local_irq_restore(flags);
+
+		host->pio.sg_off += len;
+		host->curr.xfer_remain -= len;
+		host->curr.data_xfered += len;
+		remain -= len;
+
+		if (remain == 0) {
+			/* This sg page is full - do some housekeeping */
+			if (status & MCI_RXACTIVE && host->curr.user_pages)
+				flush_dcache_page(sg_page(host->pio.sg));
+
+			if (!--host->pio.sg_len) {
+				memset(&host->pio, 0, sizeof(host->pio));
+				break;
+			}
+
+			/* Advance to next sg */
+			host->pio.sg++;
+			host->pio.sg_off = 0;
+		}
+
+		status = readl(base + MMCISTATUS);
+	} while (1);
+
+	if (status & MCI_RXACTIVE && host->curr.xfer_remain < MCI_FIFOSIZE)
+		writel(MCI_RXDATAAVLBLMASK, base + MMCIMASK1);
+
+	if (!host->curr.xfer_remain)
+		writel(0, base + MMCIMASK1);
+
+	return IRQ_HANDLED;
+}
+
+static void msmsdcc_do_cmdirq(struct msmsdcc_host *host, uint32_t status)
+{
+	struct mmc_command *cmd = host->curr.cmd;
+	void __iomem	   *base = host->base;
+
+	host->curr.cmd = NULL;
+	cmd->resp[0] = readl(base + MMCIRESPONSE0);
+	cmd->resp[1] = readl(base + MMCIRESPONSE1);
+	cmd->resp[2] = readl(base + MMCIRESPONSE2);
+	cmd->resp[3] = readl(base + MMCIRESPONSE3);
+
+	del_timer(&host->command_timer);
+	if (status & MCI_CMDTIMEOUT) {
+		cmd->error = -ETIMEDOUT;
+	} else if (status & MCI_CMDCRCFAIL &&
+		   cmd->flags & MMC_RSP_CRC) {
+		pr_err("%s: Command CRC error\n", mmc_hostname(host->mmc));
+		cmd->error = -EILSEQ;
+	}
+
+	if (!cmd->data || cmd->error) {
+		if (host->curr.data && host->dma.sg)
+			msm_dmov_stop_cmd(host->dma.channel,
+					  &host->dma.hdr, 0);
+		else if (host->curr.data) { /* Non DMA */
+			msmsdcc_stop_data(host);
+			msmsdcc_request_end(host, cmd->mrq);
+		} else /* host->data == NULL */
+			msmsdcc_request_end(host, cmd->mrq);
+	} else if (!(cmd->data->flags & MMC_DATA_READ))
+		msmsdcc_start_data(host, cmd->data);
+}
+
+static void
+msmsdcc_handle_irq_data(struct msmsdcc_host *host, u32 status,
+			void __iomem *base)
+{
+	struct mmc_data *data = host->curr.data;
+
+	if (!data)
+		return;
+
+	/* Check for data errors */
+	if (status & (MCI_DATACRCFAIL | MCI_DATATIMEOUT |
+		      MCI_TXUNDERRUN | MCI_RXOVERRUN)) {
+		msmsdcc_data_err(host, data, status);
+		host->curr.data_xfered = 0;
+		if (host->dma.sg)
+			msm_dmov_stop_cmd(host->dma.channel,
+					  &host->dma.hdr, 0);
+		else {
+			msmsdcc_stop_data(host);
+			if (!data->stop)
+				msmsdcc_request_end(host, data->mrq);
+			else
+				msmsdcc_start_command(host, data->stop, 0);
+		}
+	}
+
+	/* Check for data done */
+	if (!host->curr.got_dataend && (status & MCI_DATAEND))
+		host->curr.got_dataend = 1;
+
+	if (!host->curr.got_datablkend && (status & MCI_DATABLOCKEND))
+		host->curr.got_datablkend = 1;
+
+	/*
+	 * If DMA is still in progress, we complete via the completion handler
+	 */
+	if (host->curr.got_dataend && host->curr.got_datablkend &&
+	    !host->dma.busy) {
+		/*
+		 * There appears to be an issue in the controller where
+		 * if you request a small block transfer (< fifo size),
+		 * you may get your DATAEND/DATABLKEND irq without the
+		 * PIO data irq.
+		 *
+		 * Check to see if there is still data to be read,
+		 * and simulate a PIO irq.
+		 */
+		if (readl(base + MMCISTATUS) & MCI_RXDATAAVLBL)
+			msmsdcc_pio_irq(1, host);
+
+		msmsdcc_stop_data(host);
+		if (!data->error)
+			host->curr.data_xfered = host->curr.xfer_size;
+
+		if (!data->stop)
+			msmsdcc_request_end(host, data->mrq);
+		else
+			msmsdcc_start_command(host, data->stop, 0);
+	}
+}
+
+static irqreturn_t
+msmsdcc_irq(int irq, void *dev_id)
+{
+	struct msmsdcc_host	*host = dev_id;
+	void __iomem		*base = host->base;
+	u32			status;
+	int			ret = 0;
+	int			cardint = 0;
+
+	spin_lock(&host->lock);
+
+	do {
+		status = readl(base + MMCISTATUS);
+
+		status &= (readl(base + MMCIMASK0) | MCI_DATABLOCKENDMASK);
+		writel(status, base + MMCICLEAR);
+
+		msmsdcc_handle_irq_data(host, status, base);
+
+		if (status & (MCI_CMDSENT | MCI_CMDRESPEND | MCI_CMDCRCFAIL |
+			      MCI_CMDTIMEOUT) && host->curr.cmd) {
+			msmsdcc_do_cmdirq(host, status);
+		}
+
+		if (status & MCI_SDIOINTOPER) {
+			cardint = 1;
+			status &= ~MCI_SDIOINTOPER;
+		}
+		ret = 1;
+	} while (status);
+
+	spin_unlock(&host->lock);
+
+	/*
+	 * We have to delay handling the card interrupt as it calls
+	 * back into the driver.
+	 */
+	if (cardint)
+		mmc_signal_sdio_irq(host->mmc);
+
+	return IRQ_RETVAL(ret);
+}
+
+static void
+msmsdcc_request(struct mmc_host *mmc, struct mmc_request *mrq)
+{
+	struct msmsdcc_host *host = mmc_priv(mmc);
+	unsigned long flags;
+
+	WARN_ON(host->curr.mrq != NULL);
+	WARN_ON(host->pwr == 0);
+
+	spin_lock_irqsave(&host->lock, flags);
+
+	host->stats.reqs++;
+
+	if (host->eject) {
+		if (mrq->data && !(mrq->data->flags & MMC_DATA_READ)) {
+			mrq->cmd->error = 0;
+			mrq->data->bytes_xfered = mrq->data->blksz *
+						  mrq->data->blocks;
+		} else
+			mrq->cmd->error = -ENOMEDIUM;
+
+		spin_unlock_irqrestore(&host->lock, flags);
+		mmc_request_done(mmc, mrq);
+		return;
+	}
+
+	host->curr.mrq = mrq;
+
+	if (mrq->data && mrq->data->flags & MMC_DATA_READ)
+		msmsdcc_start_data(host, mrq->data);
+
+	msmsdcc_start_command(host, mrq->cmd, 0);
+
+	if (host->cmdpoll && !msmsdcc_spin_on_status(host,
+				MCI_CMDRESPEND|MCI_CMDCRCFAIL|MCI_CMDTIMEOUT,
+				CMD_SPINMAX)) {
+		uint32_t status = readl(host->base + MMCISTATUS);
+		msmsdcc_do_cmdirq(host, status);
+		writel(MCI_CMDRESPEND | MCI_CMDCRCFAIL | MCI_CMDTIMEOUT,
+		       host->base + MMCICLEAR);
+		host->stats.cmdpoll_hits++;
+	} else {
+		host->stats.cmdpoll_misses++;
+		mod_timer(&host->command_timer, jiffies + HZ);
+	}
+	spin_unlock_irqrestore(&host->lock, flags);
+}
+
+static void
+msmsdcc_set_ios(struct mmc_host *mmc, struct mmc_ios *ios)
+{
+	struct msmsdcc_host *host = mmc_priv(mmc);
+	u32 clk = 0, pwr = 0;
+	int rc;
+
+	if (ios->clock) {
+
+		if (!host->clks_on) {
+			clk_enable(host->pclk);
+			clk_enable(host->clk);
+			host->clks_on = 1;
+		}
+		if (ios->clock != host->clk_rate) {
+			rc = clk_set_rate(host->clk, ios->clock);
+			if (rc < 0)
+				pr_err("%s: Error setting clock rate (%d)\n",
+				       mmc_hostname(host->mmc), rc);
+			else
+				host->clk_rate = ios->clock;
+		}
+		clk |= MCI_CLK_ENABLE;
+	}
+
+	if (ios->bus_width == MMC_BUS_WIDTH_4)
+		clk |= (2 << 10); /* Set WIDEBUS */
+
+	if (ios->clock > 400000 && msmsdcc_pwrsave)
+		clk |= (1 << 9); /* PWRSAVE */
+
+	clk |= (1 << 12); /* FLOW_ENA */
+	clk |= (1 << 15); /* feedback clock */
+
+	if (host->plat->translate_vdd)
+		pwr |= host->plat->translate_vdd(mmc_dev(mmc), ios->vdd);
+
+	switch (ios->power_mode) {
+	case MMC_POWER_OFF:
+		htc_pwrsink_set(PWRSINK_SDCARD, 0);
+		break;
+	case MMC_POWER_UP:
+		pwr |= MCI_PWR_UP;
+		break;
+	case MMC_POWER_ON:
+		htc_pwrsink_set(PWRSINK_SDCARD, 100);
+		pwr |= MCI_PWR_ON;
+		break;
+	}
+
+	if (ios->bus_mode == MMC_BUSMODE_OPENDRAIN)
+		pwr |= MCI_OD;
+
+	writel(clk, host->base + MMCICLOCK);
+
+	if (host->pwr != pwr) {
+		host->pwr = pwr;
+		writel(pwr, host->base + MMCIPOWER);
+	}
+
+	if (!(clk & MCI_CLK_ENABLE) && host->clks_on) {
+		clk_disable(host->clk);
+		clk_disable(host->pclk);
+		host->clks_on = 0;
+	}
+}
+
+static void msmsdcc_enable_sdio_irq(struct mmc_host *mmc, int enable)
+{
+	struct msmsdcc_host *host = mmc_priv(mmc);
+	unsigned long flags;
+	u32 status;
+
+	spin_lock_irqsave(&host->lock, flags);
+	if (msmsdcc_sdioirq == 1) {
+		status = readl(host->base + MMCIMASK0);
+		if (enable)
+			status |= MCI_SDIOINTOPERMASK;
+		else
+			status &= ~MCI_SDIOINTOPERMASK;
+		host->saved_irq0mask = status;
+		writel(status, host->base + MMCIMASK0);
+	}
+	spin_unlock_irqrestore(&host->lock, flags);
+}
+
+static const struct mmc_host_ops msmsdcc_ops = {
+	.request	= msmsdcc_request,
+	.set_ios	= msmsdcc_set_ios,
+	.enable_sdio_irq = msmsdcc_enable_sdio_irq,
+};
+
+static void
+msmsdcc_check_status(unsigned long data)
+{
+	struct msmsdcc_host *host = (struct msmsdcc_host *)data;
+	unsigned int status;
+
+	if (!host->plat->status) {
+		mmc_detect_change(host->mmc, 0);
+		goto out;
+	}
+
+	status = host->plat->status(mmc_dev(host->mmc));
+	host->eject = !status;
+	if (status ^ host->oldstat) {
+		pr_info("%s: Slot status change detected (%d -> %d)\n",
+			mmc_hostname(host->mmc), host->oldstat, status);
+		if (status)
+			mmc_detect_change(host->mmc, (5 * HZ) / 2);
+		else
+			mmc_detect_change(host->mmc, 0);
+	}
+
+	host->oldstat = status;
+
+out:
+	if (host->timer.function)
+		mod_timer(&host->timer, jiffies + HZ);
+}
+
+static irqreturn_t
+msmsdcc_platform_status_irq(int irq, void *dev_id)
+{
+	struct msmsdcc_host *host = dev_id;
+
+	printk(KERN_DEBUG "%s: %d\n", __func__, irq);
+	msmsdcc_check_status((unsigned long) host);
+	return IRQ_HANDLED;
+}
+
+static void
+msmsdcc_status_notify_cb(int card_present, void *dev_id)
+{
+	struct msmsdcc_host *host = dev_id;
+
+	printk(KERN_DEBUG "%s: card_present %d\n", mmc_hostname(host->mmc),
+	       card_present);
+	msmsdcc_check_status((unsigned long) host);
+}
+
+/*
+ * called when a command expires.
+ * Dump some debugging, and then error
+ * out the transaction.
+ */
+static void
+msmsdcc_command_expired(unsigned long _data)
+{
+	struct msmsdcc_host	*host = (struct msmsdcc_host *) _data;
+	struct mmc_request	*mrq;
+	unsigned long		flags;
+
+	spin_lock_irqsave(&host->lock, flags);
+	mrq = host->curr.mrq;
+
+	if (!mrq) {
+		pr_info("%s: Command expiry misfire\n",
+			mmc_hostname(host->mmc));
+		spin_unlock_irqrestore(&host->lock, flags);
+		return;
+	}
+
+	pr_err("%s: Command timeout (%p %p %p %p)\n",
+	       mmc_hostname(host->mmc), mrq, mrq->cmd,
+	       mrq->data, host->dma.sg);
+
+	mrq->cmd->error = -ETIMEDOUT;
+	msmsdcc_stop_data(host);
+
+	writel(0, host->base + MMCICOMMAND);
+
+	host->curr.mrq = NULL;
+	host->curr.cmd = NULL;
+
+	spin_unlock_irqrestore(&host->lock, flags);
+	mmc_request_done(host->mmc, mrq);
+}
+
+static int
+msmsdcc_init_dma(struct msmsdcc_host *host)
+{
+	memset(&host->dma, 0, sizeof(struct msmsdcc_dma_data));
+	host->dma.host = host;
+	host->dma.channel = -1;
+
+	if (!host->dmares)
+		return -ENODEV;
+
+	host->dma.nc = dma_alloc_coherent(NULL,
+					  sizeof(struct msmsdcc_nc_dmadata),
+					  &host->dma.nc_busaddr,
+					  GFP_KERNEL);
+	if (host->dma.nc == NULL) {
+		pr_err("Unable to allocate DMA buffer\n");
+		return -ENOMEM;
+	}
+	memset(host->dma.nc, 0x00, sizeof(struct msmsdcc_nc_dmadata));
+	host->dma.cmd_busaddr = host->dma.nc_busaddr;
+	host->dma.cmdptr_busaddr = host->dma.nc_busaddr +
+				offsetof(struct msmsdcc_nc_dmadata, cmdptr);
+	host->dma.channel = host->dmares->start;
+
+	return 0;
+}
+
+#ifdef CONFIG_MMC_MSM7X00A_RESUME_IN_WQ
+static void
+do_resume_work(struct work_struct *work)
+{
+	struct msmsdcc_host *host =
+		container_of(work, struct msmsdcc_host, resume_task);
+	struct mmc_host	*mmc = host->mmc;
+
+	if (mmc) {
+		mmc_resume_host(mmc);
+		if (host->stat_irq)
+			enable_irq(host->stat_irq);
+	}
+}
+#endif
+
+static int
+msmsdcc_probe(struct platform_device *pdev)
+{
+	struct mmc_platform_data *plat = pdev->dev.platform_data;
+	struct msmsdcc_host *host;
+	struct mmc_host *mmc;
+	struct resource *cmd_irqres = NULL;
+	struct resource *pio_irqres = NULL;
+	struct resource *stat_irqres = NULL;
+	struct resource *memres = NULL;
+	struct resource *dmares = NULL;
+	int ret;
+
+	/* must have platform data */
+	if (!plat) {
+		pr_err("%s: Platform data not available\n", __func__);
+		ret = -EINVAL;
+		goto out;
+	}
+
+	if (pdev->id < 1 || pdev->id > 4)
+		return -EINVAL;
+
+	if (pdev->resource == NULL || pdev->num_resources < 2) {
+		pr_err("%s: Invalid resource\n", __func__);
+		return -ENXIO;
+	}
+
+	memres = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+	dmares = platform_get_resource(pdev, IORESOURCE_DMA, 0);
+	cmd_irqres = platform_get_resource_byname(pdev, IORESOURCE_IRQ,
+						  "cmd_irq");
+	pio_irqres = platform_get_resource_byname(pdev, IORESOURCE_IRQ,
+						  "pio_irq");
+	stat_irqres = platform_get_resource_byname(pdev, IORESOURCE_IRQ,
+						   "status_irq");
+
+	if (!cmd_irqres || !pio_irqres || !memres) {
+		pr_err("%s: Invalid resource\n", __func__);
+		return -ENXIO;
+	}
+
+	/*
+	 * Setup our host structure
+	 */
+
+	mmc = mmc_alloc_host(sizeof(struct msmsdcc_host), &pdev->dev);
+	if (!mmc) {
+		ret = -ENOMEM;
+		goto out;
+	}
+
+	host = mmc_priv(mmc);
+	host->pdev_id = pdev->id;
+	host->plat = plat;
+	host->mmc = mmc;
+
+	host->cmdpoll = 1;
+
+	host->base = ioremap(memres->start, PAGE_SIZE);
+	if (!host->base) {
+		ret = -ENOMEM;
+		goto out;
+	}
+
+	host->cmd_irqres = cmd_irqres;
+	host->pio_irqres = pio_irqres;
+	host->memres = memres;
+	host->dmares = dmares;
+	spin_lock_init(&host->lock);
+
+	/*
+	 * Setup DMA
+	 */
+	msmsdcc_init_dma(host);
+
+	/*
+	 * Setup main peripheral bus clock
+	 */
+	host->pclk = clk_get(&pdev->dev, "sdc_pclk");
+	if (IS_ERR(host->pclk)) {
+		ret = PTR_ERR(host->pclk);
+		goto host_free;
+	}
+
+	ret = clk_enable(host->pclk);
+	if (ret)
+		goto pclk_put;
+
+	host->pclk_rate = clk_get_rate(host->pclk);
+
+	/*
+	 * Setup SDC MMC clock
+	 */
+	host->clk = clk_get(&pdev->dev, "sdc_clk");
+	if (IS_ERR(host->clk)) {
+		ret = PTR_ERR(host->clk);
+		goto pclk_disable;
+	}
+
+	ret = clk_enable(host->clk);
+	if (ret)
+		goto clk_put;
+
+	ret = clk_set_rate(host->clk, msmsdcc_fmin);
+	if (ret) {
+		pr_err("%s: Clock rate set failed (%d)\n", __func__, ret);
+		goto clk_disable;
+	}
+
+	host->clk_rate = clk_get_rate(host->clk);
+
+	host->clks_on = 1;
+
+	/*
+	 * Setup MMC host structure
+	 */
+	mmc->ops = &msmsdcc_ops;
+	mmc->f_min = msmsdcc_fmin;
+	mmc->f_max = msmsdcc_fmax;
+	mmc->ocr_avail = plat->ocr_mask;
+
+	if (msmsdcc_4bit)
+		mmc->caps |= MMC_CAP_4_BIT_DATA;
+	if (msmsdcc_sdioirq)
+		mmc->caps |= MMC_CAP_SDIO_IRQ;
+	mmc->caps |= MMC_CAP_MMC_HIGHSPEED | MMC_CAP_SD_HIGHSPEED;
+
+	mmc->max_phys_segs = NR_SG;
+	mmc->max_hw_segs = NR_SG;
+	mmc->max_blk_size = 4096;	/* MCI_DATA_CTL BLOCKSIZE up to 4096 */
+	mmc->max_blk_count = 65536;
+
+	mmc->max_req_size = 33554432;	/* MCI_DATA_LENGTH is 25 bits */
+	mmc->max_seg_size = mmc->max_req_size;
+
+	writel(0, host->base + MMCIMASK0);
+	writel(0x5e007ff, host->base + MMCICLEAR); /* Add: 1 << 25 */
+
+	writel(MCI_IRQENABLE, host->base + MMCIMASK0);
+	host->saved_irq0mask = MCI_IRQENABLE;
+
+	/*
+	 * Setup card detect change
+	 */
+
+	memset(&host->timer, 0, sizeof(host->timer));
+
+	if (stat_irqres && !(stat_irqres->flags & IORESOURCE_DISABLED)) {
+		unsigned long irqflags = IRQF_SHARED |
+			(stat_irqres->flags & IRQF_TRIGGER_MASK);
+
+		host->stat_irq = stat_irqres->start;
+		ret = request_irq(host->stat_irq,
+				  msmsdcc_platform_status_irq,
+				  irqflags,
+				  DRIVER_NAME " (slot)",
+				  host);
+		if (ret) {
+			pr_err("%s: Unable to get slot IRQ %d (%d)\n",
+			       mmc_hostname(mmc), host->stat_irq, ret);
+			goto clk_disable;
+		}
+	} else if (plat->register_status_notify) {
+		plat->register_status_notify(msmsdcc_status_notify_cb, host);
+	} else if (!plat->status)
+		pr_err("%s: No card detect facilities available\n",
+		       mmc_hostname(mmc));
+	else {
+		init_timer(&host->timer);
+		host->timer.data = (unsigned long)host;
+		host->timer.function = msmsdcc_check_status;
+		host->timer.expires = jiffies + HZ;
+		add_timer(&host->timer);
+	}
+
+	if (plat->status) {
+		host->oldstat = host->plat->status(mmc_dev(host->mmc));
+		host->eject = !host->oldstat;
+	}
+
+	/*
+	 * Setup a command timer. We currently need this due to
+	 * some 'strange' timeout / error handling situations.
+	 */
+	init_timer(&host->command_timer);
+	host->command_timer.data = (unsigned long) host;
+	host->command_timer.function = msmsdcc_command_expired;
+
+	ret = request_irq(cmd_irqres->start, msmsdcc_irq, IRQF_SHARED,
+			  DRIVER_NAME " (cmd)", host);
+	if (ret)
+		goto stat_irq_free;
+
+	ret = request_irq(pio_irqres->start, msmsdcc_pio_irq, IRQF_SHARED,
+			  DRIVER_NAME " (pio)", host);
+	if (ret)
+		goto cmd_irq_free;
+
+	mmc_set_drvdata(pdev, mmc);
+	mmc_add_host(mmc);
+
+	pr_info("%s: Qualcomm MSM SDCC at 0x%016llx irq %d,%d dma %d\n",
+		mmc_hostname(mmc), (unsigned long long)memres->start,
+		(unsigned int) cmd_irqres->start,
+		(unsigned int) host->stat_irq, host->dma.channel);
+	pr_info("%s: 4 bit data mode %s\n", mmc_hostname(mmc),
+		(mmc->caps & MMC_CAP_4_BIT_DATA ? "enabled" : "disabled"));
+	pr_info("%s: MMC clock %u -> %u Hz, PCLK %u Hz\n",
+		mmc_hostname(mmc), msmsdcc_fmin, msmsdcc_fmax, host->pclk_rate);
+	pr_info("%s: Slot eject status = %d\n", mmc_hostname(mmc), host->eject);
+	pr_info("%s: Power save feature enable = %d\n",
+		mmc_hostname(mmc), msmsdcc_pwrsave);
+
+	if (host->dma.channel != -1) {
+		pr_info("%s: DM non-cached buffer at %p, dma_addr 0x%.8x\n",
+			mmc_hostname(mmc), host->dma.nc, host->dma.nc_busaddr);
+		pr_info("%s: DM cmd busaddr 0x%.8x, cmdptr busaddr 0x%.8x\n",
+			mmc_hostname(mmc), host->dma.cmd_busaddr,
+			host->dma.cmdptr_busaddr);
+	} else
+		pr_info("%s: PIO transfer enabled\n", mmc_hostname(mmc));
+	if (host->timer.function)
+		pr_info("%s: Polling status mode enabled\n", mmc_hostname(mmc));
+
+	return 0;
+ cmd_irq_free:
+	free_irq(cmd_irqres->start, host);
+ stat_irq_free:
+	if (host->stat_irq)
+		free_irq(host->stat_irq, host);
+ clk_disable:
+	clk_disable(host->clk);
+ clk_put:
+	clk_put(host->clk);
+ pclk_disable:
+	clk_disable(host->pclk);
+ pclk_put:
+	clk_put(host->pclk);
+ host_free:
+	mmc_free_host(mmc);
+ out:
+	return ret;
+}
+
+static int
+msmsdcc_suspend(struct platform_device *dev, pm_message_t state)
+{
+	struct mmc_host *mmc = mmc_get_drvdata(dev);
+	int rc = 0;
+
+	if (mmc) {
+		struct msmsdcc_host *host = mmc_priv(mmc);
+
+		if (host->stat_irq)
+			disable_irq(host->stat_irq);
+
+		if (mmc->card && mmc->card->type != MMC_TYPE_SDIO)
+			rc = mmc_suspend_host(mmc, state);
+		if (!rc) {
+			writel(0, host->base + MMCIMASK0);
+
+			if (host->clks_on) {
+				clk_disable(host->clk);
+				clk_disable(host->pclk);
+				host->clks_on = 0;
+			}
+		}
+	}
+	return rc;
+}
+
+static int
+msmsdcc_resume(struct platform_device *dev)
+{
+	struct mmc_host *mmc = mmc_get_drvdata(dev);
+	unsigned long flags;
+
+	if (mmc) {
+		struct msmsdcc_host *host = mmc_priv(mmc);
+
+		spin_lock_irqsave(&host->lock, flags);
+
+		if (!host->clks_on) {
+			clk_enable(host->pclk);
+			clk_enable(host->clk);
+			host->clks_on = 1;
+		}
+
+		writel(host->saved_irq0mask, host->base + MMCIMASK0);
+
+		spin_unlock_irqrestore(&host->lock, flags);
+
+		if (mmc->card && mmc->card->type != MMC_TYPE_SDIO)
+			mmc_resume_host(mmc);
+			if (host->stat_irq)
+				enable_irq(host->stat_irq);
+		else if (host->stat_irq)
+			enable_irq(host->stat_irq);
+	}
+	return 0;
+}
+
+static struct platform_driver msmsdcc_driver = {
+	.probe		= msmsdcc_probe,
+	.suspend	= msmsdcc_suspend,
+	.resume		= msmsdcc_resume,
+	.driver		= {
+		.name	= "msm_sdcc",
+	},
+};
+
+static int __init msmsdcc_init(void)
+{
+	return platform_driver_register(&msmsdcc_driver);
+}
+
+static void __exit msmsdcc_exit(void)
+{
+	platform_driver_unregister(&msmsdcc_driver);
+}
+
+module_init(msmsdcc_init);
+module_exit(msmsdcc_exit);
+
+MODULE_DESCRIPTION("Qualcomm MSM 7X00A Multimedia Card Interface driver");
+MODULE_LICENSE("GPL");
diff --git a/drivers/mmc/host/msm_sdcc.h b/drivers/mmc/host/msm_sdcc.h
new file mode 100644
index 0000000..8c84484
--- /dev/null
+++ b/drivers/mmc/host/msm_sdcc.h
@@ -0,0 +1,238 @@
+/*
+ *  linux/drivers/mmc/host/msmsdcc.h - QCT MSM7K SDC Controller
+ *
+ *  Copyright (C) 2008 Google, All Rights Reserved.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * - Based on mmci.h
+ */
+
+#ifndef _MSM_SDCC_H
+#define _MSM_SDCC_H
+
+#define MSMSDCC_CRCI_SDC1	6
+#define MSMSDCC_CRCI_SDC2	7
+#define MSMSDCC_CRCI_SDC3	12
+#define MSMSDCC_CRCI_SDC4	13
+
+#define MMCIPOWER		0x000
+#define MCI_PWR_OFF		0x00
+#define MCI_PWR_UP		0x02
+#define MCI_PWR_ON		0x03
+#define MCI_OD			(1 << 6)
+
+#define MMCICLOCK		0x004
+#define MCI_CLK_ENABLE		(1 << 8)
+#define MCI_CLK_PWRSAVE		(1 << 9)
+#define MCI_CLK_WIDEBUS		(1 << 10)
+#define MCI_CLK_FLOWENA		(1 << 12)
+#define MCI_CLK_INVERTOUT	(1 << 13)
+#define MCI_CLK_SELECTIN	(1 << 14)
+
+#define MMCIARGUMENT		0x008
+#define MMCICOMMAND		0x00c
+#define MCI_CPSM_RESPONSE	(1 << 6)
+#define MCI_CPSM_LONGRSP	(1 << 7)
+#define MCI_CPSM_INTERRUPT	(1 << 8)
+#define MCI_CPSM_PENDING	(1 << 9)
+#define MCI_CPSM_ENABLE		(1 << 10)
+#define MCI_CPSM_PROGENA	(1 << 11)
+#define MCI_CSPM_DATCMD		(1 << 12)
+#define MCI_CSPM_MCIABORT	(1 << 13)
+#define MCI_CSPM_CCSENABLE	(1 << 14)
+#define MCI_CSPM_CCSDISABLE	(1 << 15)
+
+
+#define MMCIRESPCMD		0x010
+#define MMCIRESPONSE0		0x014
+#define MMCIRESPONSE1		0x018
+#define MMCIRESPONSE2		0x01c
+#define MMCIRESPONSE3		0x020
+#define MMCIDATATIMER		0x024
+#define MMCIDATALENGTH		0x028
+
+#define MMCIDATACTRL		0x02c
+#define MCI_DPSM_ENABLE		(1 << 0)
+#define MCI_DPSM_DIRECTION	(1 << 1)
+#define MCI_DPSM_MODE		(1 << 2)
+#define MCI_DPSM_DMAENABLE	(1 << 3)
+
+#define MMCIDATACNT		0x030
+#define MMCISTATUS		0x034
+#define MCI_CMDCRCFAIL		(1 << 0)
+#define MCI_DATACRCFAIL		(1 << 1)
+#define MCI_CMDTIMEOUT		(1 << 2)
+#define MCI_DATATIMEOUT		(1 << 3)
+#define MCI_TXUNDERRUN		(1 << 4)
+#define MCI_RXOVERRUN		(1 << 5)
+#define MCI_CMDRESPEND		(1 << 6)
+#define MCI_CMDSENT		(1 << 7)
+#define MCI_DATAEND		(1 << 8)
+#define MCI_DATABLOCKEND	(1 << 10)
+#define MCI_CMDACTIVE		(1 << 11)
+#define MCI_TXACTIVE		(1 << 12)
+#define MCI_RXACTIVE		(1 << 13)
+#define MCI_TXFIFOHALFEMPTY	(1 << 14)
+#define MCI_RXFIFOHALFFULL	(1 << 15)
+#define MCI_TXFIFOFULL		(1 << 16)
+#define MCI_RXFIFOFULL		(1 << 17)
+#define MCI_TXFIFOEMPTY		(1 << 18)
+#define MCI_RXFIFOEMPTY		(1 << 19)
+#define MCI_TXDATAAVLBL		(1 << 20)
+#define MCI_RXDATAAVLBL		(1 << 21)
+#define MCI_SDIOINTR		(1 << 22)
+#define MCI_PROGDONE		(1 << 23)
+#define MCI_ATACMDCOMPL		(1 << 24)
+#define MCI_SDIOINTOPER		(1 << 25)
+#define MCI_CCSTIMEOUT		(1 << 26)
+
+#define MMCICLEAR		0x038
+#define MCI_CMDCRCFAILCLR	(1 << 0)
+#define MCI_DATACRCFAILCLR	(1 << 1)
+#define MCI_CMDTIMEOUTCLR	(1 << 2)
+#define MCI_DATATIMEOUTCLR	(1 << 3)
+#define MCI_TXUNDERRUNCLR	(1 << 4)
+#define MCI_RXOVERRUNCLR	(1 << 5)
+#define MCI_CMDRESPENDCLR	(1 << 6)
+#define MCI_CMDSENTCLR		(1 << 7)
+#define MCI_DATAENDCLR		(1 << 8)
+#define MCI_DATABLOCKENDCLR	(1 << 10)
+
+#define MMCIMASK0		0x03c
+#define MCI_CMDCRCFAILMASK	(1 << 0)
+#define MCI_DATACRCFAILMASK	(1 << 1)
+#define MCI_CMDTIMEOUTMASK	(1 << 2)
+#define MCI_DATATIMEOUTMASK	(1 << 3)
+#define MCI_TXUNDERRUNMASK	(1 << 4)
+#define MCI_RXOVERRUNMASK	(1 << 5)
+#define MCI_CMDRESPENDMASK	(1 << 6)
+#define MCI_CMDSENTMASK		(1 << 7)
+#define MCI_DATAENDMASK		(1 << 8)
+#define MCI_DATABLOCKENDMASK	(1 << 10)
+#define MCI_CMDACTIVEMASK	(1 << 11)
+#define MCI_TXACTIVEMASK	(1 << 12)
+#define MCI_RXACTIVEMASK	(1 << 13)
+#define MCI_TXFIFOHALFEMPTYMASK	(1 << 14)
+#define MCI_RXFIFOHALFFULLMASK	(1 << 15)
+#define MCI_TXFIFOFULLMASK	(1 << 16)
+#define MCI_RXFIFOFULLMASK	(1 << 17)
+#define MCI_TXFIFOEMPTYMASK	(1 << 18)
+#define MCI_RXFIFOEMPTYMASK	(1 << 19)
+#define MCI_TXDATAAVLBLMASK	(1 << 20)
+#define MCI_RXDATAAVLBLMASK	(1 << 21)
+#define MCI_SDIOINTMASK		(1 << 22)
+#define MCI_PROGDONEMASK	(1 << 23)
+#define MCI_ATACMDCOMPLMASK	(1 << 24)
+#define MCI_SDIOINTOPERMASK	(1 << 25)
+#define MCI_CCSTIMEOUTMASK	(1 << 26)
+
+#define MMCIMASK1		0x040
+#define MMCIFIFOCNT		0x044
+#define MCICCSTIMER		0x058
+
+#define MMCIFIFO		0x080 /* to 0x0bc */
+
+#define MCI_IRQENABLE	\
+	(MCI_CMDCRCFAILMASK|MCI_DATACRCFAILMASK|MCI_CMDTIMEOUTMASK|	\
+	MCI_DATATIMEOUTMASK|MCI_TXUNDERRUNMASK|MCI_RXOVERRUNMASK|	\
+	MCI_CMDRESPENDMASK|MCI_CMDSENTMASK|MCI_DATAENDMASK)
+
+/*
+ * The size of the FIFO in bytes.
+ */
+#define MCI_FIFOSIZE	(16*4)
+
+#define MCI_FIFOHALFSIZE (MCI_FIFOSIZE / 2)
+
+#define NR_SG		32
+
+struct clk;
+
+struct msmsdcc_nc_dmadata {
+	dmov_box	cmd[NR_SG];
+	uint32_t	cmdptr;
+};
+
+struct msmsdcc_dma_data {
+	struct msmsdcc_nc_dmadata	*nc;
+	dma_addr_t			nc_busaddr;
+	dma_addr_t			cmd_busaddr;
+	dma_addr_t			cmdptr_busaddr;
+
+	struct msm_dmov_cmd		hdr;
+	enum dma_data_direction		dir;
+
+	struct scatterlist		*sg;
+	int				num_ents;
+
+	int				channel;
+	struct msmsdcc_host		*host;
+	int				busy; /* Set if DM is busy */
+};
+
+struct msmsdcc_pio_data {
+	struct scatterlist	*sg;
+	unsigned int		sg_len;
+	unsigned int		sg_off;
+};
+
+struct msmsdcc_curr_req {
+	struct mmc_request	*mrq;
+	struct mmc_command	*cmd;
+	struct mmc_data		*data;
+	unsigned int		xfer_size;	/* Total data size */
+	unsigned int		xfer_remain;	/* Bytes remaining to send */
+	unsigned int		data_xfered;	/* Bytes acked by BLKEND irq */
+	int			got_dataend;
+	int			got_datablkend;
+	int			user_pages;
+};
+
+struct msmsdcc_stats {
+	unsigned int reqs;
+	unsigned int cmds;
+	unsigned int cmdpoll_hits;
+	unsigned int cmdpoll_misses;
+};
+
+struct msmsdcc_host {
+	struct resource		*cmd_irqres;
+	struct resource		*pio_irqres;
+	struct resource		*memres;
+	struct resource		*dmares;
+	void __iomem		*base;
+	int			pdev_id;
+	unsigned int		stat_irq;
+
+	struct msmsdcc_curr_req	curr;
+
+	struct mmc_host		*mmc;
+	struct clk		*clk;		/* main MMC bus clock */
+	struct clk		*pclk;		/* SDCC peripheral bus clock */
+	unsigned int		clks_on;	/* set if clocks are enabled */
+	struct timer_list	command_timer;
+
+	unsigned int		eject;		/* eject state */
+
+	spinlock_t		lock;
+
+	unsigned int		clk_rate;	/* Current clock rate */
+	unsigned int		pclk_rate;
+
+	u32			pwr;
+	u32			saved_irq0mask;	/* MMCIMASK0 reg value */
+	struct mmc_platform_data *plat;
+
+	struct timer_list	timer;
+	unsigned int		oldstat;
+
+	struct msmsdcc_dma_data	dma;
+	struct msmsdcc_pio_data	pio;
+	int			cmdpoll;
+	struct msmsdcc_stats	stats;
+};
+
+#endif
diff --git a/drivers/mmc/host/omap_hsmmc.c b/drivers/mmc/host/omap_hsmmc.c
index 1cf9cfb..4487cc0 100644
--- a/drivers/mmc/host/omap_hsmmc.c
+++ b/drivers/mmc/host/omap_hsmmc.c
@@ -17,6 +17,8 @@
 
 #include <linux/module.h>
 #include <linux/init.h>
+#include <linux/debugfs.h>
+#include <linux/seq_file.h>
 #include <linux/interrupt.h>
 #include <linux/delay.h>
 #include <linux/dma-mapping.h>
@@ -25,6 +27,7 @@
 #include <linux/timer.h>
 #include <linux/clk.h>
 #include <linux/mmc/host.h>
+#include <linux/mmc/core.h>
 #include <linux/io.h>
 #include <linux/semaphore.h>
 #include <mach/dma.h>
@@ -35,6 +38,7 @@
 
 /* OMAP HSMMC Host Controller Registers */
 #define OMAP_HSMMC_SYSCONFIG	0x0010
+#define OMAP_HSMMC_SYSSTATUS	0x0014
 #define OMAP_HSMMC_CON		0x002C
 #define OMAP_HSMMC_BLK		0x0104
 #define OMAP_HSMMC_ARG		0x0108
@@ -70,6 +74,8 @@
 #define DTO_MASK		0x000F0000
 #define DTO_SHIFT		16
 #define INT_EN_MASK		0x307F0033
+#define BWR_ENABLE		(1 << 4)
+#define BRR_ENABLE		(1 << 5)
 #define INIT_STREAM		(1 << 1)
 #define DP_SELECT		(1 << 21)
 #define DDIR			(1 << 4)
@@ -92,6 +98,8 @@
 #define DUAL_VOLT_OCR_BIT	7
 #define SRC			(1 << 25)
 #define SRD			(1 << 26)
+#define SOFTRESET		(1 << 1)
+#define RESETDONE		(1 << 0)
 
 /*
  * FIXME: Most likely all the data using these _DEVID defines should come
@@ -101,11 +109,18 @@
 #define OMAP_MMC1_DEVID		0
 #define OMAP_MMC2_DEVID		1
 #define OMAP_MMC3_DEVID		2
+#define OMAP_MMC4_DEVID		3
+#define OMAP_MMC5_DEVID		4
 
 #define MMC_TIMEOUT_MS		20
 #define OMAP_MMC_MASTER_CLOCK	96000000
 #define DRIVER_NAME		"mmci-omap-hs"
 
+/* Timeouts for entering power saving states on inactivity, msec */
+#define OMAP_MMC_DISABLED_TIMEOUT	100
+#define OMAP_MMC_SLEEP_TIMEOUT		1000
+#define OMAP_MMC_OFF_TIMEOUT		8000
+
 /*
  * One controller can have multiple slots, like on some omap boards using
  * omap.c controller driver. Luckily this is not currently done on any known
@@ -122,7 +137,7 @@
 #define OMAP_HSMMC_WRITE(base, reg, val) \
 	__raw_writel((val), (base) + OMAP_HSMMC_##reg)
 
-struct mmc_omap_host {
+struct omap_hsmmc_host {
 	struct	device		*dev;
 	struct	mmc_host	*mmc;
 	struct	mmc_request	*mrq;
@@ -135,27 +150,35 @@
 	struct	work_struct	mmc_carddetect_work;
 	void	__iomem		*base;
 	resource_size_t		mapbase;
+	spinlock_t		irq_lock; /* Prevent races with irq handler */
+	unsigned long		flags;
 	unsigned int		id;
 	unsigned int		dma_len;
 	unsigned int		dma_sg_idx;
 	unsigned char		bus_mode;
+	unsigned char		power_mode;
 	u32			*buffer;
 	u32			bytesleft;
 	int			suspended;
 	int			irq;
-	int			carddetect;
 	int			use_dma, dma_ch;
 	int			dma_line_tx, dma_line_rx;
 	int			slot_id;
-	int			dbclk_enabled;
+	int			got_dbclk;
 	int			response_busy;
+	int			context_loss;
+	int			dpm_state;
+	int			vdd;
+	int			protect_card;
+	int			reqs_blocked;
+
 	struct	omap_mmc_platform_data	*pdata;
 };
 
 /*
  * Stop clock to the card
  */
-static void omap_mmc_stop_clock(struct mmc_omap_host *host)
+static void omap_hsmmc_stop_clock(struct omap_hsmmc_host *host)
 {
 	OMAP_HSMMC_WRITE(host->base, SYSCTL,
 		OMAP_HSMMC_READ(host->base, SYSCTL) & ~CEN);
@@ -163,15 +186,178 @@
 		dev_dbg(mmc_dev(host->mmc), "MMC Clock is not stoped\n");
 }
 
+#ifdef CONFIG_PM
+
+/*
+ * Restore the MMC host context, if it was lost as result of a
+ * power state change.
+ */
+static int omap_hsmmc_context_restore(struct omap_hsmmc_host *host)
+{
+	struct mmc_ios *ios = &host->mmc->ios;
+	struct omap_mmc_platform_data *pdata = host->pdata;
+	int context_loss = 0;
+	u32 hctl, capa, con;
+	u16 dsor = 0;
+	unsigned long timeout;
+
+	if (pdata->get_context_loss_count) {
+		context_loss = pdata->get_context_loss_count(host->dev);
+		if (context_loss < 0)
+			return 1;
+	}
+
+	dev_dbg(mmc_dev(host->mmc), "context was %slost\n",
+		context_loss == host->context_loss ? "not " : "");
+	if (host->context_loss == context_loss)
+		return 1;
+
+	/* Wait for hardware reset */
+	timeout = jiffies + msecs_to_jiffies(MMC_TIMEOUT_MS);
+	while ((OMAP_HSMMC_READ(host->base, SYSSTATUS) & RESETDONE) != RESETDONE
+		&& time_before(jiffies, timeout))
+		;
+
+	/* Do software reset */
+	OMAP_HSMMC_WRITE(host->base, SYSCONFIG, SOFTRESET);
+	timeout = jiffies + msecs_to_jiffies(MMC_TIMEOUT_MS);
+	while ((OMAP_HSMMC_READ(host->base, SYSSTATUS) & RESETDONE) != RESETDONE
+		&& time_before(jiffies, timeout))
+		;
+
+	OMAP_HSMMC_WRITE(host->base, SYSCONFIG,
+			OMAP_HSMMC_READ(host->base, SYSCONFIG) | AUTOIDLE);
+
+	if (host->id == OMAP_MMC1_DEVID) {
+		if (host->power_mode != MMC_POWER_OFF &&
+		    (1 << ios->vdd) <= MMC_VDD_23_24)
+			hctl = SDVS18;
+		else
+			hctl = SDVS30;
+		capa = VS30 | VS18;
+	} else {
+		hctl = SDVS18;
+		capa = VS18;
+	}
+
+	OMAP_HSMMC_WRITE(host->base, HCTL,
+			OMAP_HSMMC_READ(host->base, HCTL) | hctl);
+
+	OMAP_HSMMC_WRITE(host->base, CAPA,
+			OMAP_HSMMC_READ(host->base, CAPA) | capa);
+
+	OMAP_HSMMC_WRITE(host->base, HCTL,
+			OMAP_HSMMC_READ(host->base, HCTL) | SDBP);
+
+	timeout = jiffies + msecs_to_jiffies(MMC_TIMEOUT_MS);
+	while ((OMAP_HSMMC_READ(host->base, HCTL) & SDBP) != SDBP
+		&& time_before(jiffies, timeout))
+		;
+
+	OMAP_HSMMC_WRITE(host->base, STAT, STAT_CLEAR);
+	OMAP_HSMMC_WRITE(host->base, ISE, INT_EN_MASK);
+	OMAP_HSMMC_WRITE(host->base, IE, INT_EN_MASK);
+
+	/* Do not initialize card-specific things if the power is off */
+	if (host->power_mode == MMC_POWER_OFF)
+		goto out;
+
+	con = OMAP_HSMMC_READ(host->base, CON);
+	switch (ios->bus_width) {
+	case MMC_BUS_WIDTH_8:
+		OMAP_HSMMC_WRITE(host->base, CON, con | DW8);
+		break;
+	case MMC_BUS_WIDTH_4:
+		OMAP_HSMMC_WRITE(host->base, CON, con & ~DW8);
+		OMAP_HSMMC_WRITE(host->base, HCTL,
+			OMAP_HSMMC_READ(host->base, HCTL) | FOUR_BIT);
+		break;
+	case MMC_BUS_WIDTH_1:
+		OMAP_HSMMC_WRITE(host->base, CON, con & ~DW8);
+		OMAP_HSMMC_WRITE(host->base, HCTL,
+			OMAP_HSMMC_READ(host->base, HCTL) & ~FOUR_BIT);
+		break;
+	}
+
+	if (ios->clock) {
+		dsor = OMAP_MMC_MASTER_CLOCK / ios->clock;
+		if (dsor < 1)
+			dsor = 1;
+
+		if (OMAP_MMC_MASTER_CLOCK / dsor > ios->clock)
+			dsor++;
+
+		if (dsor > 250)
+			dsor = 250;
+	}
+
+	OMAP_HSMMC_WRITE(host->base, SYSCTL,
+		OMAP_HSMMC_READ(host->base, SYSCTL) & ~CEN);
+	OMAP_HSMMC_WRITE(host->base, SYSCTL, (dsor << 6) | (DTO << 16));
+	OMAP_HSMMC_WRITE(host->base, SYSCTL,
+		OMAP_HSMMC_READ(host->base, SYSCTL) | ICE);
+
+	timeout = jiffies + msecs_to_jiffies(MMC_TIMEOUT_MS);
+	while ((OMAP_HSMMC_READ(host->base, SYSCTL) & ICS) != ICS
+		&& time_before(jiffies, timeout))
+		;
+
+	OMAP_HSMMC_WRITE(host->base, SYSCTL,
+		OMAP_HSMMC_READ(host->base, SYSCTL) | CEN);
+
+	con = OMAP_HSMMC_READ(host->base, CON);
+	if (ios->bus_mode == MMC_BUSMODE_OPENDRAIN)
+		OMAP_HSMMC_WRITE(host->base, CON, con | OD);
+	else
+		OMAP_HSMMC_WRITE(host->base, CON, con & ~OD);
+out:
+	host->context_loss = context_loss;
+
+	dev_dbg(mmc_dev(host->mmc), "context is restored\n");
+	return 0;
+}
+
+/*
+ * Save the MMC host context (store the number of power state changes so far).
+ */
+static void omap_hsmmc_context_save(struct omap_hsmmc_host *host)
+{
+	struct omap_mmc_platform_data *pdata = host->pdata;
+	int context_loss;
+
+	if (pdata->get_context_loss_count) {
+		context_loss = pdata->get_context_loss_count(host->dev);
+		if (context_loss < 0)
+			return;
+		host->context_loss = context_loss;
+	}
+}
+
+#else
+
+static int omap_hsmmc_context_restore(struct omap_hsmmc_host *host)
+{
+	return 0;
+}
+
+static void omap_hsmmc_context_save(struct omap_hsmmc_host *host)
+{
+}
+
+#endif
+
 /*
  * Send init stream sequence to card
  * before sending IDLE command
  */
-static void send_init_stream(struct mmc_omap_host *host)
+static void send_init_stream(struct omap_hsmmc_host *host)
 {
 	int reg = 0;
 	unsigned long timeout;
 
+	if (host->protect_card)
+		return;
+
 	disable_irq(host->irq);
 	OMAP_HSMMC_WRITE(host->base, CON,
 		OMAP_HSMMC_READ(host->base, CON) | INIT_STREAM);
@@ -183,51 +369,53 @@
 
 	OMAP_HSMMC_WRITE(host->base, CON,
 		OMAP_HSMMC_READ(host->base, CON) & ~INIT_STREAM);
+
+	OMAP_HSMMC_WRITE(host->base, STAT, STAT_CLEAR);
+	OMAP_HSMMC_READ(host->base, STAT);
+
 	enable_irq(host->irq);
 }
 
 static inline
-int mmc_omap_cover_is_closed(struct mmc_omap_host *host)
+int omap_hsmmc_cover_is_closed(struct omap_hsmmc_host *host)
 {
 	int r = 1;
 
-	if (host->pdata->slots[host->slot_id].get_cover_state)
-		r = host->pdata->slots[host->slot_id].get_cover_state(host->dev,
-			host->slot_id);
+	if (mmc_slot(host).get_cover_state)
+		r = mmc_slot(host).get_cover_state(host->dev, host->slot_id);
 	return r;
 }
 
 static ssize_t
-mmc_omap_show_cover_switch(struct device *dev, struct device_attribute *attr,
+omap_hsmmc_show_cover_switch(struct device *dev, struct device_attribute *attr,
 			   char *buf)
 {
 	struct mmc_host *mmc = container_of(dev, struct mmc_host, class_dev);
-	struct mmc_omap_host *host = mmc_priv(mmc);
+	struct omap_hsmmc_host *host = mmc_priv(mmc);
 
-	return sprintf(buf, "%s\n", mmc_omap_cover_is_closed(host) ? "closed" :
-		       "open");
+	return sprintf(buf, "%s\n",
+			omap_hsmmc_cover_is_closed(host) ? "closed" : "open");
 }
 
-static DEVICE_ATTR(cover_switch, S_IRUGO, mmc_omap_show_cover_switch, NULL);
+static DEVICE_ATTR(cover_switch, S_IRUGO, omap_hsmmc_show_cover_switch, NULL);
 
 static ssize_t
-mmc_omap_show_slot_name(struct device *dev, struct device_attribute *attr,
+omap_hsmmc_show_slot_name(struct device *dev, struct device_attribute *attr,
 			char *buf)
 {
 	struct mmc_host *mmc = container_of(dev, struct mmc_host, class_dev);
-	struct mmc_omap_host *host = mmc_priv(mmc);
-	struct omap_mmc_slot_data slot = host->pdata->slots[host->slot_id];
+	struct omap_hsmmc_host *host = mmc_priv(mmc);
 
-	return sprintf(buf, "%s\n", slot.name);
+	return sprintf(buf, "%s\n", mmc_slot(host).name);
 }
 
-static DEVICE_ATTR(slot_name, S_IRUGO, mmc_omap_show_slot_name, NULL);
+static DEVICE_ATTR(slot_name, S_IRUGO, omap_hsmmc_show_slot_name, NULL);
 
 /*
  * Configure the response type and send the cmd.
  */
 static void
-mmc_omap_start_command(struct mmc_omap_host *host, struct mmc_command *cmd,
+omap_hsmmc_start_command(struct omap_hsmmc_host *host, struct mmc_command *cmd,
 	struct mmc_data *data)
 {
 	int cmdreg = 0, resptype = 0, cmdtype = 0;
@@ -241,7 +429,12 @@
 	 */
 	OMAP_HSMMC_WRITE(host->base, STAT, STAT_CLEAR);
 	OMAP_HSMMC_WRITE(host->base, ISE, INT_EN_MASK);
-	OMAP_HSMMC_WRITE(host->base, IE, INT_EN_MASK);
+
+	if (host->use_dma)
+		OMAP_HSMMC_WRITE(host->base, IE,
+				 INT_EN_MASK & ~(BRR_ENABLE | BWR_ENABLE));
+	else
+		OMAP_HSMMC_WRITE(host->base, IE, INT_EN_MASK);
 
 	host->response_busy = 0;
 	if (cmd->flags & MMC_RSP_PRESENT) {
@@ -275,12 +468,20 @@
 	if (host->use_dma)
 		cmdreg |= DMA_EN;
 
+	/*
+	 * In an interrupt context (i.e. STOP command), the spinlock is unlocked
+	 * by the interrupt handler, otherwise (i.e. for a new request) it is
+	 * unlocked here.
+	 */
+	if (!in_interrupt())
+		spin_unlock_irqrestore(&host->irq_lock, host->flags);
+
 	OMAP_HSMMC_WRITE(host->base, ARG, cmd->arg);
 	OMAP_HSMMC_WRITE(host->base, CMD, cmdreg);
 }
 
 static int
-mmc_omap_get_dma_dir(struct mmc_omap_host *host, struct mmc_data *data)
+omap_hsmmc_get_dma_dir(struct omap_hsmmc_host *host, struct mmc_data *data)
 {
 	if (data->flags & MMC_DATA_WRITE)
 		return DMA_TO_DEVICE;
@@ -292,11 +493,18 @@
  * Notify the transfer complete to MMC core
  */
 static void
-mmc_omap_xfer_done(struct mmc_omap_host *host, struct mmc_data *data)
+omap_hsmmc_xfer_done(struct omap_hsmmc_host *host, struct mmc_data *data)
 {
 	if (!data) {
 		struct mmc_request *mrq = host->mrq;
 
+		/* TC before CC from CMD6 - don't know why, but it happens */
+		if (host->cmd && host->cmd->opcode == 6 &&
+		    host->response_busy) {
+			host->response_busy = 0;
+			return;
+		}
+
 		host->mrq = NULL;
 		mmc_request_done(host->mmc, mrq);
 		return;
@@ -306,7 +514,7 @@
 
 	if (host->use_dma && host->dma_ch != -1)
 		dma_unmap_sg(mmc_dev(host->mmc), data->sg, host->dma_len,
-			mmc_omap_get_dma_dir(host, data));
+			omap_hsmmc_get_dma_dir(host, data));
 
 	if (!data->error)
 		data->bytes_xfered += data->blocks * (data->blksz);
@@ -318,14 +526,14 @@
 		mmc_request_done(host->mmc, data->mrq);
 		return;
 	}
-	mmc_omap_start_command(host, data->stop, NULL);
+	omap_hsmmc_start_command(host, data->stop, NULL);
 }
 
 /*
  * Notify the core about command completion
  */
 static void
-mmc_omap_cmd_done(struct mmc_omap_host *host, struct mmc_command *cmd)
+omap_hsmmc_cmd_done(struct omap_hsmmc_host *host, struct mmc_command *cmd)
 {
 	host->cmd = NULL;
 
@@ -350,13 +558,13 @@
 /*
  * DMA clean up for command errors
  */
-static void mmc_dma_cleanup(struct mmc_omap_host *host, int errno)
+static void omap_hsmmc_dma_cleanup(struct omap_hsmmc_host *host, int errno)
 {
 	host->data->error = errno;
 
 	if (host->use_dma && host->dma_ch != -1) {
 		dma_unmap_sg(mmc_dev(host->mmc), host->data->sg, host->dma_len,
-			mmc_omap_get_dma_dir(host, host->data));
+			omap_hsmmc_get_dma_dir(host, host->data));
 		omap_free_dma(host->dma_ch);
 		host->dma_ch = -1;
 		up(&host->sem);
@@ -368,10 +576,10 @@
  * Readable error output
  */
 #ifdef CONFIG_MMC_DEBUG
-static void mmc_omap_report_irq(struct mmc_omap_host *host, u32 status)
+static void omap_hsmmc_report_irq(struct omap_hsmmc_host *host, u32 status)
 {
 	/* --- means reserved bit without definition at documentation */
-	static const char *mmc_omap_status_bits[] = {
+	static const char *omap_hsmmc_status_bits[] = {
 		"CC", "TC", "BGE", "---", "BWR", "BRR", "---", "---", "CIRQ",
 		"OBI", "---", "---", "---", "---", "---", "ERRI", "CTO", "CCRC",
 		"CEB", "CIE", "DTO", "DCRC", "DEB", "---", "ACE", "---",
@@ -384,9 +592,9 @@
 	len = sprintf(buf, "MMC IRQ 0x%x :", status);
 	buf += len;
 
-	for (i = 0; i < ARRAY_SIZE(mmc_omap_status_bits); i++)
+	for (i = 0; i < ARRAY_SIZE(omap_hsmmc_status_bits); i++)
 		if (status & (1 << i)) {
-			len = sprintf(buf, " %s", mmc_omap_status_bits[i]);
+			len = sprintf(buf, " %s", omap_hsmmc_status_bits[i]);
 			buf += len;
 		}
 
@@ -401,8 +609,8 @@
  *  SRC or SRD bit of SYSCTL register
  * Can be called from interrupt context
  */
-static inline void mmc_omap_reset_controller_fsm(struct mmc_omap_host *host,
-		unsigned long bit)
+static inline void omap_hsmmc_reset_controller_fsm(struct omap_hsmmc_host *host,
+						   unsigned long bit)
 {
 	unsigned long i = 0;
 	unsigned long limit = (loops_per_jiffy *
@@ -424,17 +632,20 @@
 /*
  * MMC controller IRQ handler
  */
-static irqreturn_t mmc_omap_irq(int irq, void *dev_id)
+static irqreturn_t omap_hsmmc_irq(int irq, void *dev_id)
 {
-	struct mmc_omap_host *host = dev_id;
+	struct omap_hsmmc_host *host = dev_id;
 	struct mmc_data *data;
 	int end_cmd = 0, end_trans = 0, status;
 
+	spin_lock(&host->irq_lock);
+
 	if (host->mrq == NULL) {
 		OMAP_HSMMC_WRITE(host->base, STAT,
 			OMAP_HSMMC_READ(host->base, STAT));
 		/* Flush posted write */
 		OMAP_HSMMC_READ(host->base, STAT);
+		spin_unlock(&host->irq_lock);
 		return IRQ_HANDLED;
 	}
 
@@ -444,13 +655,14 @@
 
 	if (status & ERR) {
 #ifdef CONFIG_MMC_DEBUG
-		mmc_omap_report_irq(host, status);
+		omap_hsmmc_report_irq(host, status);
 #endif
 		if ((status & CMD_TIMEOUT) ||
 			(status & CMD_CRC)) {
 			if (host->cmd) {
 				if (status & CMD_TIMEOUT) {
-					mmc_omap_reset_controller_fsm(host, SRC);
+					omap_hsmmc_reset_controller_fsm(host,
+									SRC);
 					host->cmd->error = -ETIMEDOUT;
 				} else {
 					host->cmd->error = -EILSEQ;
@@ -459,9 +671,10 @@
 			}
 			if (host->data || host->response_busy) {
 				if (host->data)
-					mmc_dma_cleanup(host, -ETIMEDOUT);
+					omap_hsmmc_dma_cleanup(host,
+								-ETIMEDOUT);
 				host->response_busy = 0;
-				mmc_omap_reset_controller_fsm(host, SRD);
+				omap_hsmmc_reset_controller_fsm(host, SRD);
 			}
 		}
 		if ((status & DATA_TIMEOUT) ||
@@ -471,11 +684,11 @@
 						-ETIMEDOUT : -EILSEQ;
 
 				if (host->data)
-					mmc_dma_cleanup(host, err);
+					omap_hsmmc_dma_cleanup(host, err);
 				else
 					host->mrq->cmd->error = err;
 				host->response_busy = 0;
-				mmc_omap_reset_controller_fsm(host, SRD);
+				omap_hsmmc_reset_controller_fsm(host, SRD);
 				end_trans = 1;
 			}
 		}
@@ -494,14 +707,16 @@
 	OMAP_HSMMC_READ(host->base, STAT);
 
 	if (end_cmd || ((status & CC) && host->cmd))
-		mmc_omap_cmd_done(host, host->cmd);
-	if (end_trans || (status & TC))
-		mmc_omap_xfer_done(host, data);
+		omap_hsmmc_cmd_done(host, host->cmd);
+	if ((end_trans || (status & TC)) && host->mrq)
+		omap_hsmmc_xfer_done(host, data);
+
+	spin_unlock(&host->irq_lock);
 
 	return IRQ_HANDLED;
 }
 
-static void set_sd_bus_power(struct mmc_omap_host *host)
+static void set_sd_bus_power(struct omap_hsmmc_host *host)
 {
 	unsigned long i;
 
@@ -521,7 +736,7 @@
  * The MMC2 transceiver controls are used instead of DAT4..DAT7.
  * Some chips, like eMMC ones, use internal transceivers.
  */
-static int omap_mmc_switch_opcond(struct mmc_omap_host *host, int vdd)
+static int omap_hsmmc_switch_opcond(struct omap_hsmmc_host *host, int vdd)
 {
 	u32 reg_val = 0;
 	int ret;
@@ -529,22 +744,24 @@
 	/* Disable the clocks */
 	clk_disable(host->fclk);
 	clk_disable(host->iclk);
-	clk_disable(host->dbclk);
+	if (host->got_dbclk)
+		clk_disable(host->dbclk);
 
 	/* Turn the power off */
 	ret = mmc_slot(host).set_power(host->dev, host->slot_id, 0, 0);
-	if (ret != 0)
-		goto err;
 
 	/* Turn the power ON with given VDD 1.8 or 3.0v */
-	ret = mmc_slot(host).set_power(host->dev, host->slot_id, 1, vdd);
+	if (!ret)
+		ret = mmc_slot(host).set_power(host->dev, host->slot_id, 1,
+					       vdd);
+	clk_enable(host->iclk);
+	clk_enable(host->fclk);
+	if (host->got_dbclk)
+		clk_enable(host->dbclk);
+
 	if (ret != 0)
 		goto err;
 
-	clk_enable(host->fclk);
-	clk_enable(host->iclk);
-	clk_enable(host->dbclk);
-
 	OMAP_HSMMC_WRITE(host->base, HCTL,
 		OMAP_HSMMC_READ(host->base, HCTL) & SDVSCLR);
 	reg_val = OMAP_HSMMC_READ(host->base, HCTL);
@@ -552,7 +769,7 @@
 	/*
 	 * If a MMC dual voltage card is detected, the set_ios fn calls
 	 * this fn with VDD bit set for 1.8V. Upon card removal from the
-	 * slot, omap_mmc_set_ios sets the VDD back to 3V on MMC_POWER_OFF.
+	 * slot, omap_hsmmc_set_ios sets the VDD back to 3V on MMC_POWER_OFF.
 	 *
 	 * Cope with a bit of slop in the range ... per data sheets:
 	 *  - "1.8V" for vdds_mmc1/vdds_mmc1a can be up to 2.45V max,
@@ -578,25 +795,59 @@
 	return ret;
 }
 
+/* Protect the card while the cover is open */
+static void omap_hsmmc_protect_card(struct omap_hsmmc_host *host)
+{
+	if (!mmc_slot(host).get_cover_state)
+		return;
+
+	host->reqs_blocked = 0;
+	if (mmc_slot(host).get_cover_state(host->dev, host->slot_id)) {
+		if (host->protect_card) {
+			printk(KERN_INFO "%s: cover is closed, "
+					 "card is now accessible\n",
+					 mmc_hostname(host->mmc));
+			host->protect_card = 0;
+		}
+	} else {
+		if (!host->protect_card) {
+			printk(KERN_INFO "%s: cover is open, "
+					 "card is now inaccessible\n",
+					 mmc_hostname(host->mmc));
+			host->protect_card = 1;
+		}
+	}
+}
+
 /*
  * Work Item to notify the core about card insertion/removal
  */
-static void mmc_omap_detect(struct work_struct *work)
+static void omap_hsmmc_detect(struct work_struct *work)
 {
-	struct mmc_omap_host *host = container_of(work, struct mmc_omap_host,
-						mmc_carddetect_work);
+	struct omap_hsmmc_host *host =
+		container_of(work, struct omap_hsmmc_host, mmc_carddetect_work);
 	struct omap_mmc_slot_data *slot = &mmc_slot(host);
+	int carddetect;
 
-	if (mmc_slot(host).card_detect)
-		host->carddetect = slot->card_detect(slot->card_detect_irq);
-	else
-		host->carddetect = -ENOSYS;
+	if (host->suspended)
+		return;
 
 	sysfs_notify(&host->mmc->class_dev.kobj, NULL, "cover_switch");
-	if (host->carddetect) {
+
+	if (slot->card_detect)
+		carddetect = slot->card_detect(slot->card_detect_irq);
+	else {
+		omap_hsmmc_protect_card(host);
+		carddetect = -ENOSYS;
+	}
+
+	if (carddetect) {
 		mmc_detect_change(host->mmc, (HZ * 200) / 1000);
 	} else {
-		mmc_omap_reset_controller_fsm(host, SRD);
+		mmc_host_enable(host->mmc);
+		omap_hsmmc_reset_controller_fsm(host, SRD);
+		mmc_host_lazy_disable(host->mmc);
+
 		mmc_detect_change(host->mmc, (HZ * 50) / 1000);
 	}
 }
@@ -604,16 +855,18 @@
 /*
  * ISR for handling card insertion and removal
  */
-static irqreturn_t omap_mmc_cd_handler(int irq, void *dev_id)
+static irqreturn_t omap_hsmmc_cd_handler(int irq, void *dev_id)
 {
-	struct mmc_omap_host *host = (struct mmc_omap_host *)dev_id;
+	struct omap_hsmmc_host *host = (struct omap_hsmmc_host *)dev_id;
 
+	if (host->suspended)
+		return IRQ_HANDLED;
 	schedule_work(&host->mmc_carddetect_work);
 
 	return IRQ_HANDLED;
 }
 
-static int mmc_omap_get_dma_sync_dev(struct mmc_omap_host *host,
+static int omap_hsmmc_get_dma_sync_dev(struct omap_hsmmc_host *host,
 				     struct mmc_data *data)
 {
 	int sync_dev;
@@ -625,7 +878,7 @@
 	return sync_dev;
 }
 
-static void mmc_omap_config_dma_params(struct mmc_omap_host *host,
+static void omap_hsmmc_config_dma_params(struct omap_hsmmc_host *host,
 				       struct mmc_data *data,
 				       struct scatterlist *sgl)
 {
@@ -639,7 +892,7 @@
 			sg_dma_address(sgl), 0, 0);
 	} else {
 		omap_set_dma_src_params(dma_ch, 0, OMAP_DMA_AMODE_CONSTANT,
-					(host->mapbase + OMAP_HSMMC_DATA), 0, 0);
+			(host->mapbase + OMAP_HSMMC_DATA), 0, 0);
 		omap_set_dma_dest_params(dma_ch, 0, OMAP_DMA_AMODE_POST_INC,
 			sg_dma_address(sgl), 0, 0);
 	}
@@ -649,7 +902,7 @@
 
 	omap_set_dma_transfer_params(dma_ch, OMAP_DMA_DATA_TYPE_S32,
 			blksz / 4, nblk, OMAP_DMA_SYNC_FRAME,
-			mmc_omap_get_dma_sync_dev(host, data),
+			omap_hsmmc_get_dma_sync_dev(host, data),
 			!(data->flags & MMC_DATA_WRITE));
 
 	omap_start_dma(dma_ch);
@@ -658,9 +911,9 @@
 /*
  * DMA call back function
  */
-static void mmc_omap_dma_cb(int lch, u16 ch_status, void *data)
+static void omap_hsmmc_dma_cb(int lch, u16 ch_status, void *data)
 {
-	struct mmc_omap_host *host = data;
+	struct omap_hsmmc_host *host = data;
 
 	if (ch_status & OMAP2_DMA_MISALIGNED_ERR_IRQ)
 		dev_dbg(mmc_dev(host->mmc), "MISALIGNED_ADRS_ERR\n");
@@ -671,7 +924,7 @@
 	host->dma_sg_idx++;
 	if (host->dma_sg_idx < host->dma_len) {
 		/* Fire up the next transfer. */
-		mmc_omap_config_dma_params(host, host->data,
+		omap_hsmmc_config_dma_params(host, host->data,
 					   host->data->sg + host->dma_sg_idx);
 		return;
 	}
@@ -688,14 +941,14 @@
 /*
  * Routine to configure and start DMA for the MMC card
  */
-static int
-mmc_omap_start_dma_transfer(struct mmc_omap_host *host, struct mmc_request *req)
+static int omap_hsmmc_start_dma_transfer(struct omap_hsmmc_host *host,
+					struct mmc_request *req)
 {
 	int dma_ch = 0, ret = 0, err = 1, i;
 	struct mmc_data *data = req->data;
 
 	/* Sanity check: all the SG entries must be aligned by block size. */
-	for (i = 0; i < host->dma_len; i++) {
+	for (i = 0; i < data->sg_len; i++) {
 		struct scatterlist *sgl;
 
 		sgl = data->sg + i;
@@ -726,8 +979,8 @@
 			return err;
 	}
 
-	ret = omap_request_dma(mmc_omap_get_dma_sync_dev(host, data), "MMC/SD",
-			       mmc_omap_dma_cb,host, &dma_ch);
+	ret = omap_request_dma(omap_hsmmc_get_dma_sync_dev(host, data),
+			       "MMC/SD", omap_hsmmc_dma_cb, host, &dma_ch);
 	if (ret != 0) {
 		dev_err(mmc_dev(host->mmc),
 			"%s: omap_request_dma() failed with %d\n",
@@ -736,17 +989,18 @@
 	}
 
 	host->dma_len = dma_map_sg(mmc_dev(host->mmc), data->sg,
-			data->sg_len, mmc_omap_get_dma_dir(host, data));
+			data->sg_len, omap_hsmmc_get_dma_dir(host, data));
 	host->dma_ch = dma_ch;
 	host->dma_sg_idx = 0;
 
-	mmc_omap_config_dma_params(host, data, data->sg);
+	omap_hsmmc_config_dma_params(host, data, data->sg);
 
 	return 0;
 }
 
-static void set_data_timeout(struct mmc_omap_host *host,
-			     struct mmc_request *req)
+static void set_data_timeout(struct omap_hsmmc_host *host,
+			     unsigned int timeout_ns,
+			     unsigned int timeout_clks)
 {
 	unsigned int timeout, cycle_ns;
 	uint32_t reg, clkd, dto = 0;
@@ -757,8 +1011,8 @@
 		clkd = 1;
 
 	cycle_ns = 1000000000 / (clk_get_rate(host->fclk) / clkd);
-	timeout = req->data->timeout_ns / cycle_ns;
-	timeout += req->data->timeout_clks;
+	timeout = timeout_ns / cycle_ns;
+	timeout += timeout_clks;
 	if (timeout) {
 		while ((timeout & 0x80000000) == 0) {
 			dto += 1;
@@ -785,22 +1039,28 @@
  * Configure block length for MMC/SD cards and initiate the transfer.
  */
 static int
-mmc_omap_prepare_data(struct mmc_omap_host *host, struct mmc_request *req)
+omap_hsmmc_prepare_data(struct omap_hsmmc_host *host, struct mmc_request *req)
 {
 	int ret;
 	host->data = req->data;
 
 	if (req->data == NULL) {
 		OMAP_HSMMC_WRITE(host->base, BLK, 0);
+		/*
+		 * Set an arbitrary 100ms data timeout for commands with
+		 * busy signal.
+		 */
+		if (req->cmd->flags & MMC_RSP_BUSY)
+			set_data_timeout(host, 100000000U, 0);
 		return 0;
 	}
 
 	OMAP_HSMMC_WRITE(host->base, BLK, (req->data->blksz)
 					| (req->data->blocks << 16));
-	set_data_timeout(host, req);
+	set_data_timeout(host, req->data->timeout_ns, req->data->timeout_clks);
 
 	if (host->use_dma) {
-		ret = mmc_omap_start_dma_transfer(host, req);
+		ret = omap_hsmmc_start_dma_transfer(host, req);
 		if (ret != 0) {
 			dev_dbg(mmc_dev(host->mmc), "MMC start dma failure\n");
 			return ret;
@@ -812,35 +1072,92 @@
 /*
  * Request function. for read/write operation
  */
-static void omap_mmc_request(struct mmc_host *mmc, struct mmc_request *req)
+static void omap_hsmmc_request(struct mmc_host *mmc, struct mmc_request *req)
 {
-	struct mmc_omap_host *host = mmc_priv(mmc);
+	struct omap_hsmmc_host *host = mmc_priv(mmc);
+	int err;
 
+	/*
+	 * Prevent races with the interrupt handler because of unexpected
+	 * interrupts, but not if we are already in interrupt context i.e.
+	 * retries.
+	 */
+	if (!in_interrupt()) {
+		spin_lock_irqsave(&host->irq_lock, host->flags);
+		/*
+		 * Protect the card from I/O if there is a possibility
+		 * it can be removed.
+		 */
+		if (host->protect_card) {
+			if (host->reqs_blocked < 3) {
+				/*
+				 * Ensure the controller is left in a consistent
+				 * state by resetting the command and data state
+				 * machines.
+				 */
+				omap_hsmmc_reset_controller_fsm(host, SRD);
+				omap_hsmmc_reset_controller_fsm(host, SRC);
+				host->reqs_blocked += 1;
+			}
+			req->cmd->error = -EBADF;
+			if (req->data)
+				req->data->error = -EBADF;
+			spin_unlock_irqrestore(&host->irq_lock, host->flags);
+			mmc_request_done(mmc, req);
+			return;
+		} else if (host->reqs_blocked)
+			host->reqs_blocked = 0;
+	}
 	WARN_ON(host->mrq != NULL);
 	host->mrq = req;
-	mmc_omap_prepare_data(host, req);
-	mmc_omap_start_command(host, req->cmd, req->data);
+	err = omap_hsmmc_prepare_data(host, req);
+	if (err) {
+		req->cmd->error = err;
+		if (req->data)
+			req->data->error = err;
+		host->mrq = NULL;
+		if (!in_interrupt())
+			spin_unlock_irqrestore(&host->irq_lock, host->flags);
+		mmc_request_done(mmc, req);
+		return;
+	}
+
+	omap_hsmmc_start_command(host, req->cmd, req->data);
 }
 
-
 /* Routine to configure clock values. Exposed API to core */
-static void omap_mmc_set_ios(struct mmc_host *mmc, struct mmc_ios *ios)
+static void omap_hsmmc_set_ios(struct mmc_host *mmc, struct mmc_ios *ios)
 {
-	struct mmc_omap_host *host = mmc_priv(mmc);
+	struct omap_hsmmc_host *host = mmc_priv(mmc);
 	u16 dsor = 0;
 	unsigned long regval;
 	unsigned long timeout;
 	u32 con;
+	int do_send_init_stream = 0;
 
-	switch (ios->power_mode) {
-	case MMC_POWER_OFF:
-		mmc_slot(host).set_power(host->dev, host->slot_id, 0, 0);
-		break;
-	case MMC_POWER_UP:
-		mmc_slot(host).set_power(host->dev, host->slot_id, 1, ios->vdd);
-		break;
+	mmc_host_enable(host->mmc);
+
+	if (ios->power_mode != host->power_mode) {
+		switch (ios->power_mode) {
+		case MMC_POWER_OFF:
+			mmc_slot(host).set_power(host->dev, host->slot_id,
+						 0, 0);
+			host->vdd = 0;
+			break;
+		case MMC_POWER_UP:
+			mmc_slot(host).set_power(host->dev, host->slot_id,
+						 1, ios->vdd);
+			host->vdd = ios->vdd;
+			break;
+		case MMC_POWER_ON:
+			do_send_init_stream = 1;
+			break;
+		}
+		host->power_mode = ios->power_mode;
 	}
 
+	/* FIXME: set registers based only on changes to ios */
+
 	con = OMAP_HSMMC_READ(host->base, CON);
 	switch (mmc->ios.bus_width) {
 	case MMC_BUS_WIDTH_8:
@@ -870,8 +1187,8 @@
 				 * MMC_POWER_UP upon recalculating the voltage.
 				 * vdd 1.8v.
 				 */
-				if (omap_mmc_switch_opcond(host, ios->vdd) != 0)
-					dev_dbg(mmc_dev(host->mmc),
+			if (omap_hsmmc_switch_opcond(host, ios->vdd) != 0)
+				dev_dbg(mmc_dev(host->mmc),
 						"Switch operation failed\n");
 		}
 	}
@@ -887,7 +1204,7 @@
 		if (dsor > 250)
 			dsor = 250;
 	}
-	omap_mmc_stop_clock(host);
+	omap_hsmmc_stop_clock(host);
 	regval = OMAP_HSMMC_READ(host->base, SYSCTL);
 	regval = regval & ~(CLKD_MASK);
 	regval = regval | (dsor << 6) | (DTO << 16);
@@ -897,42 +1214,47 @@
 
 	/* Wait till the ICS bit is set */
 	timeout = jiffies + msecs_to_jiffies(MMC_TIMEOUT_MS);
-	while ((OMAP_HSMMC_READ(host->base, SYSCTL) & ICS) != 0x2
+	while ((OMAP_HSMMC_READ(host->base, SYSCTL) & ICS) != ICS
 		&& time_before(jiffies, timeout))
 		msleep(1);
 
 	OMAP_HSMMC_WRITE(host->base, SYSCTL,
 		OMAP_HSMMC_READ(host->base, SYSCTL) | CEN);
 
-	if (ios->power_mode == MMC_POWER_ON)
+	if (do_send_init_stream)
 		send_init_stream(host);
 
+	con = OMAP_HSMMC_READ(host->base, CON);
 	if (ios->bus_mode == MMC_BUSMODE_OPENDRAIN)
-		OMAP_HSMMC_WRITE(host->base, CON,
-				OMAP_HSMMC_READ(host->base, CON) | OD);
+		OMAP_HSMMC_WRITE(host->base, CON, con | OD);
+	else
+		OMAP_HSMMC_WRITE(host->base, CON, con & ~OD);
+
+	if (host->power_mode == MMC_POWER_OFF)
+		mmc_host_disable(host->mmc);
+	else
+		mmc_host_lazy_disable(host->mmc);
 }
 
 static int omap_hsmmc_get_cd(struct mmc_host *mmc)
 {
-	struct mmc_omap_host *host = mmc_priv(mmc);
-	struct omap_mmc_platform_data *pdata = host->pdata;
+	struct omap_hsmmc_host *host = mmc_priv(mmc);
 
-	if (!pdata->slots[0].card_detect)
+	if (!mmc_slot(host).card_detect)
 		return -ENOSYS;
-	return pdata->slots[0].card_detect(pdata->slots[0].card_detect_irq);
+	return mmc_slot(host).card_detect(mmc_slot(host).card_detect_irq);
 }
 
 static int omap_hsmmc_get_ro(struct mmc_host *mmc)
 {
-	struct mmc_omap_host *host = mmc_priv(mmc);
-	struct omap_mmc_platform_data *pdata = host->pdata;
+	struct omap_hsmmc_host *host = mmc_priv(mmc);
 
-	if (!pdata->slots[0].get_ro)
+	if (!mmc_slot(host).get_ro)
 		return -ENOSYS;
-	return pdata->slots[0].get_ro(host->dev, 0);
+	return mmc_slot(host).get_ro(host->dev, 0);
 }
 
-static void omap_hsmmc_init(struct mmc_omap_host *host)
+static void omap_hsmmc_conf_bus_power(struct omap_hsmmc_host *host)
 {
 	u32 hctl, capa, value;
 
@@ -959,19 +1281,340 @@
 	set_sd_bus_power(host);
 }
 
-static struct mmc_host_ops mmc_omap_ops = {
-	.request = omap_mmc_request,
-	.set_ios = omap_mmc_set_ios,
+/*
+ * Dynamic power saving handling, FSM:
+ *   ENABLED -> DISABLED -> CARDSLEEP / REGSLEEP -> OFF
+ *     ^___________|          |                      |
+ *     |______________________|______________________|
+ *
+ * ENABLED:   mmc host is fully functional
+ * DISABLED:  fclk is off
+ * CARDSLEEP: fclk is off, card is asleep, voltage regulator is asleep
+ * REGSLEEP:  fclk is off, voltage regulator is asleep
+ * OFF:       fclk is off, voltage regulator is off
+ *
+ * Transition handlers return the timeout for the next state transition
+ * or negative error.
+ */
+
+enum {ENABLED = 0, DISABLED, CARDSLEEP, REGSLEEP, OFF};
+
+/* Handler for [ENABLED -> DISABLED] transition */
+static int omap_hsmmc_enabled_to_disabled(struct omap_hsmmc_host *host)
+{
+	omap_hsmmc_context_save(host);
+	clk_disable(host->fclk);
+	host->dpm_state = DISABLED;
+
+	dev_dbg(mmc_dev(host->mmc), "ENABLED -> DISABLED\n");
+
+	if (host->power_mode == MMC_POWER_OFF)
+		return 0;
+
+	return msecs_to_jiffies(OMAP_MMC_SLEEP_TIMEOUT);
+}
+
+/* Handler for [DISABLED -> REGSLEEP / CARDSLEEP] transition */
+static int omap_hsmmc_disabled_to_sleep(struct omap_hsmmc_host *host)
+{
+	int err, new_state;
+
+	if (!mmc_try_claim_host(host->mmc))
+		return 0;
+
+	clk_enable(host->fclk);
+	omap_hsmmc_context_restore(host);
+	if (mmc_card_can_sleep(host->mmc)) {
+		err = mmc_card_sleep(host->mmc);
+		if (err < 0) {
+			clk_disable(host->fclk);
+			mmc_release_host(host->mmc);
+			return err;
+		}
+		new_state = CARDSLEEP;
+	} else {
+		new_state = REGSLEEP;
+	}
+	if (mmc_slot(host).set_sleep)
+		mmc_slot(host).set_sleep(host->dev, host->slot_id, 1, 0,
+					 new_state == CARDSLEEP);
+	/* FIXME: turn off bus power and perhaps interrupts too */
+	clk_disable(host->fclk);
+	host->dpm_state = new_state;
+
+	mmc_release_host(host->mmc);
+
+	dev_dbg(mmc_dev(host->mmc), "DISABLED -> %s\n",
+		host->dpm_state == CARDSLEEP ? "CARDSLEEP" : "REGSLEEP");
+
+	if ((host->mmc->caps & MMC_CAP_NONREMOVABLE) ||
+	    mmc_slot(host).card_detect ||
+	    (mmc_slot(host).get_cover_state &&
+	     mmc_slot(host).get_cover_state(host->dev, host->slot_id)))
+		return msecs_to_jiffies(OMAP_MMC_OFF_TIMEOUT);
+
+	return 0;
+}
+
+/* Handler for [REGSLEEP / CARDSLEEP -> OFF] transition */
+static int omap_hsmmc_sleep_to_off(struct omap_hsmmc_host *host)
+{
+	if (!mmc_try_claim_host(host->mmc))
+		return 0;
+
+	if (!((host->mmc->caps & MMC_CAP_NONREMOVABLE) ||
+	      mmc_slot(host).card_detect ||
+	      (mmc_slot(host).get_cover_state &&
+	       mmc_slot(host).get_cover_state(host->dev, host->slot_id)))) {
+		mmc_release_host(host->mmc);
+		return 0;
+	}
+
+	mmc_slot(host).set_power(host->dev, host->slot_id, 0, 0);
+	host->vdd = 0;
+	host->power_mode = MMC_POWER_OFF;
+
+	dev_dbg(mmc_dev(host->mmc), "%s -> OFF\n",
+		host->dpm_state == CARDSLEEP ? "CARDSLEEP" : "REGSLEEP");
+
+	host->dpm_state = OFF;
+
+	mmc_release_host(host->mmc);
+
+	return 0;
+}
+
+/* Handler for [DISABLED -> ENABLED] transition */
+static int omap_hsmmc_disabled_to_enabled(struct omap_hsmmc_host *host)
+{
+	int err;
+
+	err = clk_enable(host->fclk);
+	if (err < 0)
+		return err;
+
+	omap_hsmmc_context_restore(host);
+	host->dpm_state = ENABLED;
+
+	dev_dbg(mmc_dev(host->mmc), "DISABLED -> ENABLED\n");
+
+	return 0;
+}
+
+/* Handler for [SLEEP -> ENABLED] transition */
+static int omap_hsmmc_sleep_to_enabled(struct omap_hsmmc_host *host)
+{
+	if (!mmc_try_claim_host(host->mmc))
+		return 0;
+
+	clk_enable(host->fclk);
+	omap_hsmmc_context_restore(host);
+	if (mmc_slot(host).set_sleep)
+		mmc_slot(host).set_sleep(host->dev, host->slot_id, 0,
+			 host->vdd, host->dpm_state == CARDSLEEP);
+	if (mmc_card_can_sleep(host->mmc))
+		mmc_card_awake(host->mmc);
+
+	dev_dbg(mmc_dev(host->mmc), "%s -> ENABLED\n",
+		host->dpm_state == CARDSLEEP ? "CARDSLEEP" : "REGSLEEP");
+
+	host->dpm_state = ENABLED;
+
+	mmc_release_host(host->mmc);
+
+	return 0;
+}
+
+/* Handler for [OFF -> ENABLED] transition */
+static int omap_hsmmc_off_to_enabled(struct omap_hsmmc_host *host)
+{
+	clk_enable(host->fclk);
+
+	omap_hsmmc_context_restore(host);
+	omap_hsmmc_conf_bus_power(host);
+	mmc_power_restore_host(host->mmc);
+
+	host->dpm_state = ENABLED;
+
+	dev_dbg(mmc_dev(host->mmc), "OFF -> ENABLED\n");
+
+	return 0;
+}
+
+/*
+ * Bring MMC host to ENABLED from any other PM state.
+ */
+static int omap_hsmmc_enable(struct mmc_host *mmc)
+{
+	struct omap_hsmmc_host *host = mmc_priv(mmc);
+
+	switch (host->dpm_state) {
+	case DISABLED:
+		return omap_hsmmc_disabled_to_enabled(host);
+	case CARDSLEEP:
+	case REGSLEEP:
+		return omap_hsmmc_sleep_to_enabled(host);
+	case OFF:
+		return omap_hsmmc_off_to_enabled(host);
+	default:
+		dev_dbg(mmc_dev(host->mmc), "UNKNOWN state\n");
+		return -EINVAL;
+	}
+}
+
+/*
+ * Bring MMC host in PM state (one level deeper).
+ */
+static int omap_hsmmc_disable(struct mmc_host *mmc, int lazy)
+{
+	struct omap_hsmmc_host *host = mmc_priv(mmc);
+
+	switch (host->dpm_state) {
+	case ENABLED: {
+		int delay;
+
+		delay = omap_hsmmc_enabled_to_disabled(host);
+		if (lazy || delay < 0)
+			return delay;
+		return 0;
+	}
+	case DISABLED:
+		return omap_hsmmc_disabled_to_sleep(host);
+	case CARDSLEEP:
+	case REGSLEEP:
+		return omap_hsmmc_sleep_to_off(host);
+	default:
+		dev_dbg(mmc_dev(host->mmc), "UNKNOWN state\n");
+		return -EINVAL;
+	}
+}
+
+static int omap_hsmmc_enable_fclk(struct mmc_host *mmc)
+{
+	struct omap_hsmmc_host *host = mmc_priv(mmc);
+	int err;
+
+	err = clk_enable(host->fclk);
+	if (err)
+		return err;
+	dev_dbg(mmc_dev(host->mmc), "mmc_fclk: enabled\n");
+	omap_hsmmc_context_restore(host);
+	return 0;
+}
+
+static int omap_hsmmc_disable_fclk(struct mmc_host *mmc, int lazy)
+{
+	struct omap_hsmmc_host *host = mmc_priv(mmc);
+
+	omap_hsmmc_context_save(host);
+	clk_disable(host->fclk);
+	dev_dbg(mmc_dev(host->mmc), "mmc_fclk: disabled\n");
+	return 0;
+}
+
+static const struct mmc_host_ops omap_hsmmc_ops = {
+	.enable = omap_hsmmc_enable_fclk,
+	.disable = omap_hsmmc_disable_fclk,
+	.request = omap_hsmmc_request,
+	.set_ios = omap_hsmmc_set_ios,
 	.get_cd = omap_hsmmc_get_cd,
 	.get_ro = omap_hsmmc_get_ro,
 	/* NYET -- enable_sdio_irq */
 };
 
-static int __init omap_mmc_probe(struct platform_device *pdev)
+static const struct mmc_host_ops omap_hsmmc_ps_ops = {
+	.enable = omap_hsmmc_enable,
+	.disable = omap_hsmmc_disable,
+	.request = omap_hsmmc_request,
+	.set_ios = omap_hsmmc_set_ios,
+	.get_cd = omap_hsmmc_get_cd,
+	.get_ro = omap_hsmmc_get_ro,
+	/* NYET -- enable_sdio_irq */
+};
+
+#ifdef CONFIG_DEBUG_FS
+
+static int omap_hsmmc_regs_show(struct seq_file *s, void *data)
+{
+	struct mmc_host *mmc = s->private;
+	struct omap_hsmmc_host *host = mmc_priv(mmc);
+	int context_loss = 0;
+
+	if (host->pdata->get_context_loss_count)
+		context_loss = host->pdata->get_context_loss_count(host->dev);
+
+	seq_printf(s, "mmc%d:\n"
+			" enabled:\t%d\n"
+			" dpm_state:\t%d\n"
+			" nesting_cnt:\t%d\n"
+			" ctx_loss:\t%d:%d\n"
+			"\nregs:\n",
+			mmc->index, mmc->enabled ? 1 : 0,
+			host->dpm_state, mmc->nesting_cnt,
+			host->context_loss, context_loss);
+
+	if (host->suspended || host->dpm_state == OFF) {
+		seq_printf(s, "host suspended, can't read registers\n");
+		return 0;
+	}
+
+	if (clk_enable(host->fclk) != 0) {
+		seq_printf(s, "can't read the regs\n");
+		return 0;
+	}
+
+	seq_printf(s, "SYSCONFIG:\t0x%08x\n",
+			OMAP_HSMMC_READ(host->base, SYSCONFIG));
+	seq_printf(s, "CON:\t\t0x%08x\n",
+			OMAP_HSMMC_READ(host->base, CON));
+	seq_printf(s, "HCTL:\t\t0x%08x\n",
+			OMAP_HSMMC_READ(host->base, HCTL));
+	seq_printf(s, "SYSCTL:\t\t0x%08x\n",
+			OMAP_HSMMC_READ(host->base, SYSCTL));
+	seq_printf(s, "IE:\t\t0x%08x\n",
+			OMAP_HSMMC_READ(host->base, IE));
+	seq_printf(s, "ISE:\t\t0x%08x\n",
+			OMAP_HSMMC_READ(host->base, ISE));
+	seq_printf(s, "CAPA:\t\t0x%08x\n",
+			OMAP_HSMMC_READ(host->base, CAPA));
+
+	clk_disable(host->fclk);
+
+	return 0;
+}
+
+static int omap_hsmmc_regs_open(struct inode *inode, struct file *file)
+{
+	return single_open(file, omap_hsmmc_regs_show, inode->i_private);
+}
+
+static const struct file_operations mmc_regs_fops = {
+	.open           = omap_hsmmc_regs_open,
+	.read           = seq_read,
+	.llseek         = seq_lseek,
+	.release        = single_release,
+};
+
+static void omap_hsmmc_debugfs(struct mmc_host *mmc)
+{
+	if (mmc->debugfs_root)
+		debugfs_create_file("regs", S_IRUSR, mmc->debugfs_root,
+			mmc, &mmc_regs_fops);
+}
+
+#else
+
+static void omap_hsmmc_debugfs(struct mmc_host *mmc)
+{
+}
+
+#endif
+
+static int __init omap_hsmmc_probe(struct platform_device *pdev)
 {
 	struct omap_mmc_platform_data *pdata = pdev->dev.platform_data;
 	struct mmc_host *mmc;
-	struct mmc_omap_host *host = NULL;
+	struct omap_hsmmc_host *host = NULL;
 	struct resource *res;
 	int ret = 0, irq;
 
@@ -995,7 +1638,7 @@
 	if (res == NULL)
 		return -EBUSY;
 
-	mmc = mmc_alloc_host(sizeof(struct mmc_omap_host), &pdev->dev);
+	mmc = mmc_alloc_host(sizeof(struct omap_hsmmc_host), &pdev->dev);
 	if (!mmc) {
 		ret = -ENOMEM;
 		goto err;
@@ -1013,15 +1656,21 @@
 	host->slot_id	= 0;
 	host->mapbase	= res->start;
 	host->base	= ioremap(host->mapbase, SZ_4K);
+	host->power_mode = -1;
 
 	platform_set_drvdata(pdev, host);
-	INIT_WORK(&host->mmc_carddetect_work, mmc_omap_detect);
+	INIT_WORK(&host->mmc_carddetect_work, omap_hsmmc_detect);
 
-	mmc->ops	= &mmc_omap_ops;
+	if (mmc_slot(host).power_saving)
+		mmc->ops	= &omap_hsmmc_ps_ops;
+	else
+		mmc->ops	= &omap_hsmmc_ops;
+
 	mmc->f_min	= 400000;
 	mmc->f_max	= 52000000;
 
 	sema_init(&host->sem, 1);
+	spin_lock_init(&host->irq_lock);
 
 	host->iclk = clk_get(&pdev->dev, "ick");
 	if (IS_ERR(host->iclk)) {
@@ -1037,31 +1686,42 @@
 		goto err1;
 	}
 
-	if (clk_enable(host->fclk) != 0) {
+	omap_hsmmc_context_save(host);
+
+	mmc->caps |= MMC_CAP_DISABLE;
+	mmc_set_disable_delay(mmc, OMAP_MMC_DISABLED_TIMEOUT);
+	/* we start off in DISABLED state */
+	host->dpm_state = DISABLED;
+
+	if (mmc_host_enable(host->mmc) != 0) {
 		clk_put(host->iclk);
 		clk_put(host->fclk);
 		goto err1;
 	}
 
 	if (clk_enable(host->iclk) != 0) {
-		clk_disable(host->fclk);
+		mmc_host_disable(host->mmc);
 		clk_put(host->iclk);
 		clk_put(host->fclk);
 		goto err1;
 	}
 
-	host->dbclk = clk_get(&pdev->dev, "mmchsdb_fck");
-	/*
-	 * MMC can still work without debounce clock.
-	 */
-	if (IS_ERR(host->dbclk))
-		dev_warn(mmc_dev(host->mmc), "Failed to get debounce clock\n");
-	else
-		if (clk_enable(host->dbclk) != 0)
-			dev_dbg(mmc_dev(host->mmc), "Enabling debounce"
-							" clk failed\n");
+	if (cpu_is_omap2430()) {
+		host->dbclk = clk_get(&pdev->dev, "mmchsdb_fck");
+		/*
+		 * MMC can still work without debounce clock.
+		 */
+		if (IS_ERR(host->dbclk))
+			dev_warn(mmc_dev(host->mmc),
+				"Failed to get debounce clock\n");
 		else
-			host->dbclk_enabled = 1;
+			host->got_dbclk = 1;
+
+		if (host->got_dbclk)
+			if (clk_enable(host->dbclk) != 0)
+				dev_dbg(mmc_dev(host->mmc), "Enabling debounce"
+							" clk failed\n");
+	}
 
 	/* Since we do only SG emulation, we can have as many segs
 	 * as we want. */
@@ -1073,14 +1733,18 @@
 	mmc->max_req_size = mmc->max_blk_size * mmc->max_blk_count;
 	mmc->max_seg_size = mmc->max_req_size;
 
-	mmc->caps |= MMC_CAP_MMC_HIGHSPEED | MMC_CAP_SD_HIGHSPEED;
+	mmc->caps |= MMC_CAP_MMC_HIGHSPEED | MMC_CAP_SD_HIGHSPEED |
+		     MMC_CAP_WAIT_WHILE_BUSY;
 
-	if (pdata->slots[host->slot_id].wires >= 8)
+	if (mmc_slot(host).wires >= 8)
 		mmc->caps |= MMC_CAP_8_BIT_DATA;
-	else if (pdata->slots[host->slot_id].wires >= 4)
+	else if (mmc_slot(host).wires >= 4)
 		mmc->caps |= MMC_CAP_4_BIT_DATA;
 
-	omap_hsmmc_init(host);
+	if (mmc_slot(host).nonremovable)
+		mmc->caps |= MMC_CAP_NONREMOVABLE;
+
+	omap_hsmmc_conf_bus_power(host);
 
 	/* Select DMA lines */
 	switch (host->id) {
@@ -1096,13 +1760,21 @@
 		host->dma_line_tx = OMAP34XX_DMA_MMC3_TX;
 		host->dma_line_rx = OMAP34XX_DMA_MMC3_RX;
 		break;
+	case OMAP_MMC4_DEVID:
+		host->dma_line_tx = OMAP44XX_DMA_MMC4_TX;
+		host->dma_line_rx = OMAP44XX_DMA_MMC4_RX;
+		break;
+	case OMAP_MMC5_DEVID:
+		host->dma_line_tx = OMAP44XX_DMA_MMC5_TX;
+		host->dma_line_rx = OMAP44XX_DMA_MMC5_RX;
+		break;
 	default:
 		dev_err(mmc_dev(host->mmc), "Invalid MMC id\n");
 		goto err_irq;
 	}
 
 	/* Request IRQ for MMC operations */
-	ret = request_irq(host->irq, mmc_omap_irq, IRQF_DISABLED,
+	ret = request_irq(host->irq, omap_hsmmc_irq, IRQF_DISABLED,
 			mmc_hostname(mmc), host);
 	if (ret) {
 		dev_dbg(mmc_dev(host->mmc), "Unable to grab HSMMC IRQ\n");
@@ -1112,7 +1784,8 @@
 	/* initialize power supplies, gpios, etc */
 	if (pdata->init != NULL) {
 		if (pdata->init(&pdev->dev) != 0) {
-			dev_dbg(mmc_dev(host->mmc), "late init error\n");
+			dev_dbg(mmc_dev(host->mmc),
+				"Unable to configure MMC IRQs\n");
 			goto err_irq_cd_init;
 		}
 	}
@@ -1121,7 +1794,7 @@
 	/* Request IRQ for card detect */
 	if ((mmc_slot(host).card_detect_irq)) {
 		ret = request_irq(mmc_slot(host).card_detect_irq,
-				  omap_mmc_cd_handler,
+				  omap_hsmmc_cd_handler,
 				  IRQF_TRIGGER_RISING | IRQF_TRIGGER_FALLING
 					  | IRQF_DISABLED,
 				  mmc_hostname(mmc), host);
@@ -1135,21 +1808,26 @@
 	OMAP_HSMMC_WRITE(host->base, ISE, INT_EN_MASK);
 	OMAP_HSMMC_WRITE(host->base, IE, INT_EN_MASK);
 
+	mmc_host_lazy_disable(host->mmc);
+
+	omap_hsmmc_protect_card(host);
+
 	mmc_add_host(mmc);
 
-	if (host->pdata->slots[host->slot_id].name != NULL) {
+	if (mmc_slot(host).name != NULL) {
 		ret = device_create_file(&mmc->class_dev, &dev_attr_slot_name);
 		if (ret < 0)
 			goto err_slot_name;
 	}
-	if (mmc_slot(host).card_detect_irq &&
-	    host->pdata->slots[host->slot_id].get_cover_state) {
+	if (mmc_slot(host).card_detect_irq && mmc_slot(host).get_cover_state) {
 		ret = device_create_file(&mmc->class_dev,
 					&dev_attr_cover_switch);
 		if (ret < 0)
 			goto err_cover_switch;
 	}
 
+	omap_hsmmc_debugfs(mmc);
+
 	return 0;
 
 err_cover_switch:
@@ -1161,11 +1839,11 @@
 err_irq_cd_init:
 	free_irq(host->irq, host);
 err_irq:
-	clk_disable(host->fclk);
+	mmc_host_disable(host->mmc);
 	clk_disable(host->iclk);
 	clk_put(host->fclk);
 	clk_put(host->iclk);
-	if (host->dbclk_enabled) {
+	if (host->got_dbclk) {
 		clk_disable(host->dbclk);
 		clk_put(host->dbclk);
 	}
@@ -1180,12 +1858,13 @@
 	return ret;
 }
 
-static int omap_mmc_remove(struct platform_device *pdev)
+static int omap_hsmmc_remove(struct platform_device *pdev)
 {
-	struct mmc_omap_host *host = platform_get_drvdata(pdev);
+	struct omap_hsmmc_host *host = platform_get_drvdata(pdev);
 	struct resource *res;
 
 	if (host) {
+		mmc_host_enable(host->mmc);
 		mmc_remove_host(host->mmc);
 		if (host->pdata->cleanup)
 			host->pdata->cleanup(&pdev->dev);
@@ -1194,11 +1873,11 @@
 			free_irq(mmc_slot(host).card_detect_irq, host);
 		flush_scheduled_work();
 
-		clk_disable(host->fclk);
+		mmc_host_disable(host->mmc);
 		clk_disable(host->iclk);
 		clk_put(host->fclk);
 		clk_put(host->iclk);
-		if (host->dbclk_enabled) {
+		if (host->got_dbclk) {
 			clk_disable(host->dbclk);
 			clk_put(host->dbclk);
 		}
@@ -1216,36 +1895,51 @@
 }
 
 #ifdef CONFIG_PM
-static int omap_mmc_suspend(struct platform_device *pdev, pm_message_t state)
+static int omap_hsmmc_suspend(struct platform_device *pdev, pm_message_t state)
 {
 	int ret = 0;
-	struct mmc_omap_host *host = platform_get_drvdata(pdev);
+	struct omap_hsmmc_host *host = platform_get_drvdata(pdev);
 
 	if (host && host->suspended)
 		return 0;
 
 	if (host) {
+		host->suspended = 1;
+		if (host->pdata->suspend) {
+			ret = host->pdata->suspend(&pdev->dev,
+							host->slot_id);
+			if (ret) {
+				dev_dbg(mmc_dev(host->mmc),
+					"Unable to handle MMC board"
+					" level suspend\n");
+				host->suspended = 0;
+				return ret;
+			}
+		}
+		cancel_work_sync(&host->mmc_carddetect_work);
+		mmc_host_enable(host->mmc);
 		ret = mmc_suspend_host(host->mmc, state);
 		if (ret == 0) {
-			host->suspended = 1;
-
 			OMAP_HSMMC_WRITE(host->base, ISE, 0);
 			OMAP_HSMMC_WRITE(host->base, IE, 0);
 
-			if (host->pdata->suspend) {
-				ret = host->pdata->suspend(&pdev->dev,
-								host->slot_id);
-				if (ret)
-					dev_dbg(mmc_dev(host->mmc),
-						"Unable to handle MMC board"
-						" level suspend\n");
-			}
 
 			OMAP_HSMMC_WRITE(host->base, HCTL,
-					 OMAP_HSMMC_READ(host->base, HCTL) & ~SDBP);
-			clk_disable(host->fclk);
+				OMAP_HSMMC_READ(host->base, HCTL) & ~SDBP);
+			mmc_host_disable(host->mmc);
 			clk_disable(host->iclk);
-			clk_disable(host->dbclk);
+			if (host->got_dbclk)
+				clk_disable(host->dbclk);
+		} else {
+			host->suspended = 0;
+			if (host->pdata->resume) {
+				ret = host->pdata->resume(&pdev->dev,
+							  host->slot_id);
+				if (ret)
+					dev_dbg(mmc_dev(host->mmc),
+						"Unmask interrupt failed\n");
+			}
+			mmc_host_disable(host->mmc);
 		}
 
 	}
@@ -1253,32 +1947,28 @@
 }
 
 /* Routine to resume the MMC device */
-static int omap_mmc_resume(struct platform_device *pdev)
+static int omap_hsmmc_resume(struct platform_device *pdev)
 {
 	int ret = 0;
-	struct mmc_omap_host *host = platform_get_drvdata(pdev);
+	struct omap_hsmmc_host *host = platform_get_drvdata(pdev);
 
 	if (host && !host->suspended)
 		return 0;
 
 	if (host) {
-
-		ret = clk_enable(host->fclk);
+		ret = clk_enable(host->iclk);
 		if (ret)
 			goto clk_en_err;
 
-		ret = clk_enable(host->iclk);
-		if (ret) {
-			clk_disable(host->fclk);
-			clk_put(host->fclk);
+		if (mmc_host_enable(host->mmc) != 0) {
+			clk_disable(host->iclk);
 			goto clk_en_err;
 		}
 
-		if (clk_enable(host->dbclk) != 0)
-			dev_dbg(mmc_dev(host->mmc),
-					"Enabling debounce clk failed\n");
+		if (host->got_dbclk)
+			clk_enable(host->dbclk);
 
-		omap_hsmmc_init(host);
+		omap_hsmmc_conf_bus_power(host);
 
 		if (host->pdata->resume) {
 			ret = host->pdata->resume(&pdev->dev, host->slot_id);
@@ -1287,10 +1977,14 @@
 					"Unmask interrupt failed\n");
 		}
 
+		omap_hsmmc_protect_card(host);
+
 		/* Notify the core to resume the host */
 		ret = mmc_resume_host(host->mmc);
 		if (ret == 0)
 			host->suspended = 0;
+
+		mmc_host_lazy_disable(host->mmc);
 	}
 
 	return ret;
@@ -1302,35 +1996,34 @@
 }
 
 #else
-#define omap_mmc_suspend	NULL
-#define omap_mmc_resume		NULL
+#define omap_hsmmc_suspend	NULL
+#define omap_hsmmc_resume		NULL
 #endif
 
-static struct platform_driver omap_mmc_driver = {
-	.probe		= omap_mmc_probe,
-	.remove		= omap_mmc_remove,
-	.suspend	= omap_mmc_suspend,
-	.resume		= omap_mmc_resume,
+static struct platform_driver omap_hsmmc_driver = {
+	.remove		= omap_hsmmc_remove,
+	.suspend	= omap_hsmmc_suspend,
+	.resume		= omap_hsmmc_resume,
 	.driver		= {
 		.name = DRIVER_NAME,
 		.owner = THIS_MODULE,
 	},
 };
 
-static int __init omap_mmc_init(void)
+static int __init omap_hsmmc_init(void)
 {
 	/* Register the MMC driver */
-	return platform_driver_register(&omap_mmc_driver);
+	return platform_driver_register(&omap_hsmmc_driver);
 }
 
-static void __exit omap_mmc_cleanup(void)
+static void __exit omap_hsmmc_cleanup(void)
 {
 	/* Unregister MMC driver */
-	platform_driver_unregister(&omap_mmc_driver);
+	platform_driver_unregister(&omap_hsmmc_driver);
 }
 
-module_init(omap_mmc_init);
-module_exit(omap_mmc_cleanup);
+module_init(omap_hsmmc_init);
+module_exit(omap_hsmmc_cleanup);
 
 MODULE_DESCRIPTION("OMAP High Speed Multimedia Card driver");
 MODULE_LICENSE("GPL");
diff --git a/drivers/mmc/host/sdhci-of.c b/drivers/mmc/host/sdhci-of.c
index 1e8aa590..01ab916 100644
--- a/drivers/mmc/host/sdhci-of.c
+++ b/drivers/mmc/host/sdhci-of.c
@@ -21,6 +21,7 @@
 #include <linux/of.h>
 #include <linux/of_platform.h>
 #include <linux/mmc/host.h>
+#include <asm/machdep.h>
 #include "sdhci.h"
 
 struct sdhci_of_data {
@@ -48,6 +49,8 @@
 #define ESDHC_CLOCK_HCKEN	0x00000002
 #define ESDHC_CLOCK_IPGEN	0x00000001
 
+#define ESDHC_HOST_CONTROL_RES	0x05
+
 static u32 esdhc_readl(struct sdhci_host *host, int reg)
 {
 	return in_be32(host->ioaddr + reg);
@@ -109,13 +112,17 @@
 	int base = reg & ~0x3;
 	int shift = (reg & 0x3) * 8;
 
+	/* Prevent SDHCI core from writing reserved bits (e.g. HISPD). */
+	if (reg == SDHCI_HOST_CONTROL)
+		val &= ~ESDHC_HOST_CONTROL_RES;
+
 	clrsetbits_be32(host->ioaddr + base , 0xff << shift, val << shift);
 }
 
 static void esdhc_set_clock(struct sdhci_host *host, unsigned int clock)
 {
-	int div;
 	int pre_div = 2;
+	int div = 1;
 
 	clrbits32(host->ioaddr + ESDHC_SYSTEM_CONTROL, ESDHC_CLOCK_IPGEN |
 		  ESDHC_CLOCK_HCKEN | ESDHC_CLOCK_PEREN | ESDHC_CLOCK_MASK);
@@ -123,19 +130,17 @@
 	if (clock == 0)
 		goto out;
 
-	if (host->max_clk / 16 > clock) {
-		for (; pre_div < 256; pre_div *= 2) {
-			if (host->max_clk / pre_div < clock * 16)
-				break;
-		}
-	}
+	while (host->max_clk / pre_div / 16 > clock && pre_div < 256)
+		pre_div *= 2;
 
-	for (div = 1; div <= 16; div++) {
-		if (host->max_clk / (div * pre_div) <= clock)
-			break;
-	}
+	while (host->max_clk / pre_div / div > clock && div < 16)
+		div++;
+
+	dev_dbg(mmc_dev(host->mmc), "desired SD clock: %d, actual: %d\n",
+		clock, host->max_clk / pre_div / div);
 
 	pre_div >>= 1;
+	div--;
 
 	setbits32(host->ioaddr + ESDHC_SYSTEM_CONTROL, ESDHC_CLOCK_IPGEN |
 		  ESDHC_CLOCK_HCKEN | ESDHC_CLOCK_PEREN |
@@ -165,19 +170,12 @@
 	return of_host->clock / 256 / 16;
 }
 
-static unsigned int esdhc_get_timeout_clock(struct sdhci_host *host)
-{
-	struct sdhci_of_host *of_host = sdhci_priv(host);
-
-	return of_host->clock / 1000;
-}
-
 static struct sdhci_of_data sdhci_esdhc = {
 	.quirks = SDHCI_QUIRK_FORCE_BLK_SZ_2048 |
 		  SDHCI_QUIRK_BROKEN_CARD_DETECTION |
-		  SDHCI_QUIRK_INVERTED_WRITE_PROTECT |
 		  SDHCI_QUIRK_NO_BUSY_IRQ |
 		  SDHCI_QUIRK_NONSTANDARD_CLOCK |
+		  SDHCI_QUIRK_DATA_TIMEOUT_USES_SDCLK |
 		  SDHCI_QUIRK_PIO_NEEDS_DELAY |
 		  SDHCI_QUIRK_RESTORE_IRQS_AFTER_RESET |
 		  SDHCI_QUIRK_NO_CARD_NO_RESET,
@@ -192,7 +190,6 @@
 		.enable_dma = esdhc_enable_dma,
 		.get_max_clock = esdhc_get_max_clock,
 		.get_min_clock = esdhc_get_min_clock,
-		.get_timeout_clock = esdhc_get_timeout_clock,
 	},
 };
 
@@ -219,6 +216,15 @@
 
 #endif
 
+static bool __devinit sdhci_of_wp_inverted(struct device_node *np)
+{
+	if (of_get_property(np, "sdhci,wp-inverted", NULL))
+		return true;
+
+	/* Old device trees don't have the wp-inverted property. */
+	return machine_is(mpc837x_rdb) || machine_is(mpc837x_mds);
+}
+
 static int __devinit sdhci_of_probe(struct of_device *ofdev,
 				 const struct of_device_id *match)
 {
@@ -261,6 +267,9 @@
 	if (of_get_property(np, "sdhci,1-bit-only", NULL))
 		host->quirks |= SDHCI_QUIRK_FORCE_1_BIT_DATA;
 
+	if (sdhci_of_wp_inverted(np))
+		host->quirks |= SDHCI_QUIRK_INVERTED_WRITE_PROTECT;
+
 	clk = of_get_property(np, "clock-frequency", &size);
 	if (clk && size == sizeof(*clk) && *clk)
 		of_host->clock = *clk;
diff --git a/drivers/mmc/host/sdhci-pci.c b/drivers/mmc/host/sdhci-pci.c
index 2f15cc1..e035664 100644
--- a/drivers/mmc/host/sdhci-pci.c
+++ b/drivers/mmc/host/sdhci-pci.c
@@ -83,7 +83,8 @@
 	if (chip->pdev->subsystem_vendor == PCI_VENDOR_ID_IBM)
 		chip->quirks |= SDHCI_QUIRK_CLOCK_BEFORE_RESET;
 
-	if (chip->pdev->subsystem_vendor == PCI_VENDOR_ID_SAMSUNG)
+	if (chip->pdev->subsystem_vendor == PCI_VENDOR_ID_SAMSUNG ||
+	    chip->pdev->subsystem_vendor == PCI_VENDOR_ID_SONY)
 		chip->quirks |= SDHCI_QUIRK_NO_CARD_NO_RESET;
 
 	return 0;
@@ -395,7 +396,7 @@
 
 	if (((pdev->class & 0xFFFF00) == (PCI_CLASS_SYSTEM_SDHCI << 8)) &&
 		((pdev->class & 0x0000FF) != PCI_SDHCI_IFDMA) &&
-		(host->flags & SDHCI_USE_DMA)) {
+		(host->flags & SDHCI_USE_SDMA)) {
 		dev_warn(&pdev->dev, "Will use DMA mode even though HW "
 			"doesn't fully claim to support it.\n");
 	}
diff --git a/drivers/mmc/host/sdhci.c b/drivers/mmc/host/sdhci.c
index fc96f8c..c279fbc 100644
--- a/drivers/mmc/host/sdhci.c
+++ b/drivers/mmc/host/sdhci.c
@@ -591,6 +591,9 @@
 	target_timeout = data->timeout_ns / 1000 +
 		data->timeout_clks / host->clock;
 
+	if (host->quirks & SDHCI_QUIRK_DATA_TIMEOUT_USES_SDCLK)
+		host->timeout_clk = host->clock / 1000;
+
 	/*
 	 * Figure out needed cycles.
 	 * We do this in steps in order to fit inside a 32 bit int.
@@ -652,7 +655,7 @@
 	count = sdhci_calc_timeout(host, data);
 	sdhci_writeb(host, count, SDHCI_TIMEOUT_CONTROL);
 
-	if (host->flags & SDHCI_USE_DMA)
+	if (host->flags & (SDHCI_USE_SDMA | SDHCI_USE_ADMA))
 		host->flags |= SDHCI_REQ_USE_DMA;
 
 	/*
@@ -991,8 +994,8 @@
 	clk |= SDHCI_CLOCK_INT_EN;
 	sdhci_writew(host, clk, SDHCI_CLOCK_CONTROL);
 
-	/* Wait max 10 ms */
-	timeout = 10;
+	/* Wait max 20 ms */
+	timeout = 20;
 	while (!((clk = sdhci_readw(host, SDHCI_CLOCK_CONTROL))
 		& SDHCI_CLOCK_INT_STABLE)) {
 		if (timeout == 0) {
@@ -1597,7 +1600,7 @@
 {
 	int ret;
 
-	if (host->flags & SDHCI_USE_DMA) {
+	if (host->flags & (SDHCI_USE_SDMA | SDHCI_USE_ADMA)) {
 		if (host->ops->enable_dma)
 			host->ops->enable_dma(host);
 	}
@@ -1678,23 +1681,20 @@
 	caps = sdhci_readl(host, SDHCI_CAPABILITIES);
 
 	if (host->quirks & SDHCI_QUIRK_FORCE_DMA)
-		host->flags |= SDHCI_USE_DMA;
-	else if (!(caps & SDHCI_CAN_DO_DMA))
-		DBG("Controller doesn't have DMA capability\n");
+		host->flags |= SDHCI_USE_SDMA;
+	else if (!(caps & SDHCI_CAN_DO_SDMA))
+		DBG("Controller doesn't have SDMA capability\n");
 	else
-		host->flags |= SDHCI_USE_DMA;
+		host->flags |= SDHCI_USE_SDMA;
 
 	if ((host->quirks & SDHCI_QUIRK_BROKEN_DMA) &&
-		(host->flags & SDHCI_USE_DMA)) {
+		(host->flags & SDHCI_USE_SDMA)) {
 		DBG("Disabling DMA as it is marked broken\n");
-		host->flags &= ~SDHCI_USE_DMA;
+		host->flags &= ~SDHCI_USE_SDMA;
 	}
 
-	if (host->flags & SDHCI_USE_DMA) {
-		if ((host->version >= SDHCI_SPEC_200) &&
-				(caps & SDHCI_CAN_DO_ADMA2))
-			host->flags |= SDHCI_USE_ADMA;
-	}
+	if ((host->version >= SDHCI_SPEC_200) && (caps & SDHCI_CAN_DO_ADMA2))
+		host->flags |= SDHCI_USE_ADMA;
 
 	if ((host->quirks & SDHCI_QUIRK_BROKEN_ADMA) &&
 		(host->flags & SDHCI_USE_ADMA)) {
@@ -1702,13 +1702,14 @@
 		host->flags &= ~SDHCI_USE_ADMA;
 	}
 
-	if (host->flags & SDHCI_USE_DMA) {
+	if (host->flags & (SDHCI_USE_SDMA | SDHCI_USE_ADMA)) {
 		if (host->ops->enable_dma) {
 			if (host->ops->enable_dma(host)) {
 				printk(KERN_WARNING "%s: No suitable DMA "
 					"available. Falling back to PIO.\n",
 					mmc_hostname(mmc));
-				host->flags &= ~(SDHCI_USE_DMA | SDHCI_USE_ADMA);
+				host->flags &=
+					~(SDHCI_USE_SDMA | SDHCI_USE_ADMA);
 			}
 		}
 	}
@@ -1736,7 +1737,7 @@
 	 * mask, but PIO does not need the hw shim so we set a new
 	 * mask here in that case.
 	 */
-	if (!(host->flags & SDHCI_USE_DMA)) {
+	if (!(host->flags & (SDHCI_USE_SDMA | SDHCI_USE_ADMA))) {
 		host->dma_mask = DMA_BIT_MASK(64);
 		mmc_dev(host->mmc)->dma_mask = &host->dma_mask;
 	}
@@ -1757,13 +1758,15 @@
 	host->timeout_clk =
 		(caps & SDHCI_TIMEOUT_CLK_MASK) >> SDHCI_TIMEOUT_CLK_SHIFT;
 	if (host->timeout_clk == 0) {
-		if (!host->ops->get_timeout_clock) {
+		if (host->ops->get_timeout_clock) {
+			host->timeout_clk = host->ops->get_timeout_clock(host);
+		} else if (!(host->quirks &
+				SDHCI_QUIRK_DATA_TIMEOUT_USES_SDCLK)) {
 			printk(KERN_ERR
 			       "%s: Hardware doesn't specify timeout clock "
 			       "frequency.\n", mmc_hostname(mmc));
 			return -ENODEV;
 		}
-		host->timeout_clk = host->ops->get_timeout_clock(host);
 	}
 	if (caps & SDHCI_TIMEOUT_CLK_UNIT)
 		host->timeout_clk *= 1000;
@@ -1772,7 +1775,8 @@
 	 * Set host parameters.
 	 */
 	mmc->ops = &sdhci_ops;
-	if (host->ops->get_min_clock)
+	if (host->quirks & SDHCI_QUIRK_NONSTANDARD_CLOCK &&
+			host->ops->set_clock && host->ops->get_min_clock)
 		mmc->f_min = host->ops->get_min_clock(host);
 	else
 		mmc->f_min = host->max_clk / 256;
@@ -1810,7 +1814,7 @@
 	 */
 	if (host->flags & SDHCI_USE_ADMA)
 		mmc->max_hw_segs = 128;
-	else if (host->flags & SDHCI_USE_DMA)
+	else if (host->flags & SDHCI_USE_SDMA)
 		mmc->max_hw_segs = 1;
 	else /* PIO */
 		mmc->max_hw_segs = 128;
@@ -1893,10 +1897,10 @@
 
 	mmc_add_host(mmc);
 
-	printk(KERN_INFO "%s: SDHCI controller on %s [%s] using %s%s\n",
+	printk(KERN_INFO "%s: SDHCI controller on %s [%s] using %s\n",
 		mmc_hostname(mmc), host->hw_name, dev_name(mmc_dev(mmc)),
-		(host->flags & SDHCI_USE_ADMA)?"A":"",
-		(host->flags & SDHCI_USE_DMA)?"DMA":"PIO");
+		(host->flags & SDHCI_USE_ADMA) ? "ADMA" :
+		(host->flags & SDHCI_USE_SDMA) ? "DMA" : "PIO");
 
 	sdhci_enable_card_detection(host);
 
diff --git a/drivers/mmc/host/sdhci.h b/drivers/mmc/host/sdhci.h
index c77e9ff..ce5f1d7 100644
--- a/drivers/mmc/host/sdhci.h
+++ b/drivers/mmc/host/sdhci.h
@@ -143,7 +143,7 @@
 #define  SDHCI_CAN_DO_ADMA2	0x00080000
 #define  SDHCI_CAN_DO_ADMA1	0x00100000
 #define  SDHCI_CAN_DO_HISPD	0x00200000
-#define  SDHCI_CAN_DO_DMA	0x00400000
+#define  SDHCI_CAN_DO_SDMA	0x00400000
 #define  SDHCI_CAN_VDD_330	0x01000000
 #define  SDHCI_CAN_VDD_300	0x02000000
 #define  SDHCI_CAN_VDD_180	0x04000000
@@ -232,6 +232,8 @@
 #define SDHCI_QUIRK_FORCE_1_BIT_DATA			(1<<22)
 /* Controller needs 10ms delay between applying power and clock */
 #define SDHCI_QUIRK_DELAY_AFTER_POWER			(1<<23)
+/* Controller uses SDCLK instead of TMCLK for data timeouts */
+#define SDHCI_QUIRK_DATA_TIMEOUT_USES_SDCLK		(1<<24)
 
 	int			irq;		/* Device IRQ */
 	void __iomem *		ioaddr;		/* Mapped address */
@@ -250,7 +252,7 @@
 	spinlock_t		lock;		/* Mutex */
 
 	int			flags;		/* Host attributes */
-#define SDHCI_USE_DMA		(1<<0)		/* Host is DMA capable */
+#define SDHCI_USE_SDMA		(1<<0)		/* Host is SDMA capable */
 #define SDHCI_USE_ADMA		(1<<1)		/* Host is ADMA capable */
 #define SDHCI_REQ_USE_DMA	(1<<2)		/* Use DMA for this req. */
 #define SDHCI_DEVICE_DEAD	(1<<3)		/* Device unresponsive */
diff --git a/drivers/mtd/devices/mtd_dataflash.c b/drivers/mtd/devices/mtd_dataflash.c
index 43976aa..211c27ac 100644
--- a/drivers/mtd/devices/mtd_dataflash.c
+++ b/drivers/mtd/devices/mtd_dataflash.c
@@ -966,3 +966,4 @@
 MODULE_LICENSE("GPL");
 MODULE_AUTHOR("Andrew Victor, David Brownell");
 MODULE_DESCRIPTION("MTD DataFlash driver");
+MODULE_ALIAS("spi:mtd_dataflash");
diff --git a/drivers/net/ehea/ehea_qmr.c b/drivers/net/ehea/ehea_qmr.c
index 3747457f5..bc7c5b7 100644
--- a/drivers/net/ehea/ehea_qmr.c
+++ b/drivers/net/ehea/ehea_qmr.c
@@ -751,7 +751,7 @@
 
 	mutex_lock(&ehea_busmap_mutex);
 	ehea_mr_len = 0;
-	ret = walk_memory_resource(0, 1ULL << MAX_PHYSMEM_BITS, NULL,
+	ret = walk_system_ram_range(0, 1ULL << MAX_PHYSMEM_BITS, NULL,
 				   ehea_create_busmap_callback);
 	mutex_unlock(&ehea_busmap_mutex);
 	return ret;
diff --git a/drivers/net/enc28j60.c b/drivers/net/enc28j60.c
index 117fc6c..66813c9 100644
--- a/drivers/net/enc28j60.c
+++ b/drivers/net/enc28j60.c
@@ -1666,3 +1666,4 @@
 MODULE_LICENSE("GPL");
 module_param_named(debug, debug.msg_enable, int, 0);
 MODULE_PARM_DESC(debug, "Debug verbosity level (0=none, ..., ffff=all)");
+MODULE_ALIAS("spi:" DRV_NAME);
diff --git a/drivers/net/ks8851.c b/drivers/net/ks8851.c
index 547ac7c..2378358 100644
--- a/drivers/net/ks8851.c
+++ b/drivers/net/ks8851.c
@@ -1321,3 +1321,4 @@
 
 module_param_named(message, msg_enable, int, 0);
 MODULE_PARM_DESC(message, "Message verbosity level (0=none, 31=all)");
+MODULE_ALIAS("spi:ks8851");
diff --git a/drivers/net/niu.c b/drivers/net/niu.c
index 76cc261..f9364d0 100644
--- a/drivers/net/niu.c
+++ b/drivers/net/niu.c
@@ -5615,7 +5615,7 @@
 	/* The XMAC_MIN register only accepts values for TX min which
 	 * have the low 3 bits cleared.
 	 */
-	BUILD_BUG_ON(min & 0x7);
+	BUG_ON(min & 0x7);
 
 	if (np->flags & NIU_FLAGS_XMAC)
 		niu_init_tx_xmac(np, min, max);
diff --git a/drivers/net/wireless/libertas/if_spi.c b/drivers/net/wireless/libertas/if_spi.c
index 446e327..cb8be8d 100644
--- a/drivers/net/wireless/libertas/if_spi.c
+++ b/drivers/net/wireless/libertas/if_spi.c
@@ -1222,3 +1222,4 @@
 MODULE_AUTHOR("Andrey Yurovsky <andrey@cozybit.com>, "
 	      "Colin McCabe <colin@cozybit.com>");
 MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:libertas_spi");
diff --git a/drivers/net/wireless/p54/p54spi.c b/drivers/net/wireless/p54/p54spi.c
index 05458d9..afd26bf 100644
--- a/drivers/net/wireless/p54/p54spi.c
+++ b/drivers/net/wireless/p54/p54spi.c
@@ -731,3 +731,4 @@
 
 MODULE_LICENSE("GPL");
 MODULE_AUTHOR("Christian Lamparter <chunkeey@web.de>");
+MODULE_ALIAS("spi:cx3110x");
diff --git a/drivers/net/wireless/wl12xx/wl1251_main.c b/drivers/net/wireless/wl12xx/wl1251_main.c
index 5809ef5..1103256 100644
--- a/drivers/net/wireless/wl12xx/wl1251_main.c
+++ b/drivers/net/wireless/wl12xx/wl1251_main.c
@@ -1426,3 +1426,4 @@
 MODULE_DESCRIPTION("TI wl1251 Wireles LAN Driver Core");
 MODULE_LICENSE("GPL");
 MODULE_AUTHOR("Kalle Valo <kalle.valo@nokia.com>");
+MODULE_ALIAS("spi:wl12xx");
diff --git a/drivers/of/base.c b/drivers/of/base.c
index 69f85c0..ddf224d 100644
--- a/drivers/of/base.c
+++ b/drivers/of/base.c
@@ -447,7 +447,6 @@
 static struct of_modalias_table of_modalias_table[] = {
 	{ "fsl,mcu-mpc8349emitx", "mcu-mpc8349emitx" },
 	{ "mmc-spi-slot", "mmc_spi" },
-	{ "stm,m25p40", "m25p80" },
 };
 
 /**
diff --git a/drivers/rtc/Kconfig b/drivers/rtc/Kconfig
index 73771b0..3c20dae 100644
--- a/drivers/rtc/Kconfig
+++ b/drivers/rtc/Kconfig
@@ -378,6 +378,15 @@
 	  This driver can also be built as a module. If so, the module
 	  will be called rtc-ds3234.
 
+config RTC_DRV_PCF2123
+	tristate "NXP PCF2123"
+	help
+	  If you say yes here you get support for the NXP PCF2123
+	  RTC chip.
+
+	  This driver can also be built as a module. If so, the module
+	  will be called rtc-pcf2123.
+
 endif # SPI_MASTER
 
 comment "Platform RTC drivers"
@@ -500,6 +509,17 @@
 	  This driver can also be built as a module, if so, the module
 	  will be called "rtc-m48t59".
 
+config RTC_MXC
+	tristate "Freescale MXC Real Time Clock"
+	depends on ARCH_MXC
+	depends on RTC_CLASS
+	help
+	   If you say yes here you get support for the Freescale MXC
+	   RTC module.
+
+	   This driver can also be built as a module, if so, the module
+	   will be called "rtc-mxc".
+
 config RTC_DRV_BQ4802
 	tristate "TI BQ4802"
 	help
@@ -778,4 +798,33 @@
 	  This driver can also be built as a module. If so, the module
 	  will be called rtc-ps3.
 
+config RTC_DRV_COH901331
+	tristate "ST-Ericsson COH 901 331 RTC"
+	depends on ARCH_U300
+	help
+	  If you say Y here you will get access to ST-Ericsson
+	  COH 901 331 RTC clock found in some ST-Ericsson Mobile
+	  Platforms.
+
+	  This driver can also be built as a module. If so, the module
+	  will be called "rtc-coh901331".
+
+
+config RTC_DRV_STMP
+	tristate "Freescale STMP3xxx RTC"
+	depends on ARCH_STMP3XXX
+	help
+	  If you say yes here you will get support for the onboard
+	  STMP3xxx RTC.
+
+	  This driver can also be built as a module. If so, the module
+	  will be called rtc-stmp3xxx.
+
+config RTC_DRV_PCAP
+	tristate "PCAP RTC"
+	depends on EZX_PCAP
+	help
+	  If you say Y here you will get support for the RTC found on
+	  the PCAP2 ASIC used on some Motorola phones.
+
 endif # RTC_CLASS
diff --git a/drivers/rtc/Makefile b/drivers/rtc/Makefile
index 5e152ff..aa3fbd5 100644
--- a/drivers/rtc/Makefile
+++ b/drivers/rtc/Makefile
@@ -23,7 +23,9 @@
 obj-$(CONFIG_RTC_DRV_AT91SAM9)	+= rtc-at91sam9.o
 obj-$(CONFIG_RTC_DRV_AU1XXX)	+= rtc-au1xxx.o
 obj-$(CONFIG_RTC_DRV_BFIN)	+= rtc-bfin.o
+obj-$(CONFIG_RTC_DRV_BQ4802)	+= rtc-bq4802.o
 obj-$(CONFIG_RTC_DRV_CMOS)	+= rtc-cmos.o
+obj-$(CONFIG_RTC_DRV_COH901331)	+= rtc-coh901331.o
 obj-$(CONFIG_RTC_DRV_DM355EVM)	+= rtc-dm355evm.o
 obj-$(CONFIG_RTC_DRV_DS1216)	+= rtc-ds1216.o
 obj-$(CONFIG_RTC_DRV_DS1286)	+= rtc-ds1286.o
@@ -40,24 +42,26 @@
 obj-$(CONFIG_RTC_DRV_EFI)	+= rtc-efi.o
 obj-$(CONFIG_RTC_DRV_EP93XX)	+= rtc-ep93xx.o
 obj-$(CONFIG_RTC_DRV_FM3130)	+= rtc-fm3130.o
+obj-$(CONFIG_RTC_DRV_GENERIC)	+= rtc-generic.o
 obj-$(CONFIG_RTC_DRV_ISL1208)	+= rtc-isl1208.o
 obj-$(CONFIG_RTC_DRV_M41T80)	+= rtc-m41t80.o
 obj-$(CONFIG_RTC_DRV_M41T94)	+= rtc-m41t94.o
 obj-$(CONFIG_RTC_DRV_M48T35)	+= rtc-m48t35.o
 obj-$(CONFIG_RTC_DRV_M48T59)	+= rtc-m48t59.o
 obj-$(CONFIG_RTC_DRV_M48T86)	+= rtc-m48t86.o
-obj-$(CONFIG_RTC_DRV_BQ4802)	+= rtc-bq4802.o
-obj-$(CONFIG_RTC_DRV_SUN4V)	+= rtc-sun4v.o
-obj-$(CONFIG_RTC_DRV_STARFIRE)	+= rtc-starfire.o
+obj-$(CONFIG_RTC_MXC)		+= rtc-mxc.o
 obj-$(CONFIG_RTC_DRV_MAX6900)	+= rtc-max6900.o
 obj-$(CONFIG_RTC_DRV_MAX6902)	+= rtc-max6902.o
 obj-$(CONFIG_RTC_DRV_MV)	+= rtc-mv.o
 obj-$(CONFIG_RTC_DRV_OMAP)	+= rtc-omap.o
+obj-$(CONFIG_RTC_DRV_PCAP)	+= rtc-pcap.o
 obj-$(CONFIG_RTC_DRV_PCF8563)	+= rtc-pcf8563.o
 obj-$(CONFIG_RTC_DRV_PCF8583)	+= rtc-pcf8583.o
+obj-$(CONFIG_RTC_DRV_PCF2123)	+= rtc-pcf2123.o
+obj-$(CONFIG_RTC_DRV_PCF50633)	+= rtc-pcf50633.o
 obj-$(CONFIG_RTC_DRV_PL030)	+= rtc-pl030.o
 obj-$(CONFIG_RTC_DRV_PL031)	+= rtc-pl031.o
-obj-$(CONFIG_RTC_DRV_GENERIC)	+= rtc-generic.o
+obj-$(CONFIG_RTC_DRV_PS3)	+= rtc-ps3.o
 obj-$(CONFIG_RTC_DRV_PXA)	+= rtc-pxa.o
 obj-$(CONFIG_RTC_DRV_R9701)	+= rtc-r9701.o
 obj-$(CONFIG_RTC_DRV_RS5C313)	+= rtc-rs5c313.o
@@ -69,7 +73,10 @@
 obj-$(CONFIG_RTC_DRV_S3C)	+= rtc-s3c.o
 obj-$(CONFIG_RTC_DRV_SA1100)	+= rtc-sa1100.o
 obj-$(CONFIG_RTC_DRV_SH)	+= rtc-sh.o
+obj-$(CONFIG_RTC_DRV_STARFIRE)	+= rtc-starfire.o
 obj-$(CONFIG_RTC_DRV_STK17TA8)	+= rtc-stk17ta8.o
+obj-$(CONFIG_RTC_DRV_STMP)	+= rtc-stmp3xxx.o
+obj-$(CONFIG_RTC_DRV_SUN4V)	+= rtc-sun4v.o
 obj-$(CONFIG_RTC_DRV_TEST)	+= rtc-test.o
 obj-$(CONFIG_RTC_DRV_TWL4030)	+= rtc-twl4030.o
 obj-$(CONFIG_RTC_DRV_TX4939)	+= rtc-tx4939.o
@@ -78,5 +85,3 @@
 obj-$(CONFIG_RTC_DRV_WM831X)	+= rtc-wm831x.o
 obj-$(CONFIG_RTC_DRV_WM8350)	+= rtc-wm8350.o
 obj-$(CONFIG_RTC_DRV_X1205)	+= rtc-x1205.o
-obj-$(CONFIG_RTC_DRV_PCF50633)	+= rtc-pcf50633.o
-obj-$(CONFIG_RTC_DRV_PS3)	+= rtc-ps3.o
diff --git a/drivers/rtc/rtc-at91rm9200.c b/drivers/rtc/rtc-at91rm9200.c
index b5bf937..bc8bbca 100644
--- a/drivers/rtc/rtc-at91rm9200.c
+++ b/drivers/rtc/rtc-at91rm9200.c
@@ -289,7 +289,7 @@
 					AT91_RTC_CALEV);
 
 	ret = request_irq(AT91_ID_SYS, at91_rtc_interrupt,
-				IRQF_DISABLED | IRQF_SHARED,
+				IRQF_SHARED,
 				"at91_rtc", pdev);
 	if (ret) {
 		printk(KERN_ERR "at91_rtc: IRQ %d already in use.\n",
@@ -340,7 +340,7 @@
 
 static u32 at91_rtc_imr;
 
-static int at91_rtc_suspend(struct platform_device *pdev, pm_message_t state)
+static int at91_rtc_suspend(struct device *dev)
 {
 	/* this IRQ is shared with DBGU and other hardware which isn't
 	 * necessarily doing PM like we are...
@@ -348,7 +348,7 @@
 	at91_rtc_imr = at91_sys_read(AT91_RTC_IMR)
 			& (AT91_RTC_ALARM|AT91_RTC_SECEV);
 	if (at91_rtc_imr) {
-		if (device_may_wakeup(&pdev->dev))
+		if (device_may_wakeup(dev))
 			enable_irq_wake(AT91_ID_SYS);
 		else
 			at91_sys_write(AT91_RTC_IDR, at91_rtc_imr);
@@ -356,28 +356,34 @@
 	return 0;
 }
 
-static int at91_rtc_resume(struct platform_device *pdev)
+static int at91_rtc_resume(struct device *dev)
 {
 	if (at91_rtc_imr) {
-		if (device_may_wakeup(&pdev->dev))
+		if (device_may_wakeup(dev))
 			disable_irq_wake(AT91_ID_SYS);
 		else
 			at91_sys_write(AT91_RTC_IER, at91_rtc_imr);
 	}
 	return 0;
 }
+
+static const struct dev_pm_ops at91_rtc_pm = {
+	.suspend =	at91_rtc_suspend,
+	.resume =	at91_rtc_resume,
+};
+
+#define at91_rtc_pm_ptr	&at91_rtc_pm
+
 #else
-#define at91_rtc_suspend NULL
-#define at91_rtc_resume  NULL
+#define at91_rtc_pm_ptr	NULL
 #endif
 
 static struct platform_driver at91_rtc_driver = {
 	.remove		= __exit_p(at91_rtc_remove),
-	.suspend	= at91_rtc_suspend,
-	.resume		= at91_rtc_resume,
 	.driver		= {
 		.name	= "at91_rtc",
 		.owner	= THIS_MODULE,
+		.pm	= at91_rtc_pm_ptr,
 	},
 };
 
diff --git a/drivers/rtc/rtc-bfin.c b/drivers/rtc/rtc-bfin.c
index a118eb0..b11485b 100644
--- a/drivers/rtc/rtc-bfin.c
+++ b/drivers/rtc/rtc-bfin.c
@@ -383,7 +383,7 @@
 	}
 
 	/* Grab the IRQ and init the hardware */
-	ret = request_irq(IRQ_RTC, bfin_rtc_interrupt, IRQF_SHARED, pdev->name, dev);
+	ret = request_irq(IRQ_RTC, bfin_rtc_interrupt, 0, pdev->name, dev);
 	if (unlikely(ret))
 		goto err_reg;
 	/* sometimes the bootloader touched things, but the write complete was not
diff --git a/drivers/rtc/rtc-coh901331.c b/drivers/rtc/rtc-coh901331.c
new file mode 100644
index 0000000..7fe1fa2
--- /dev/null
+++ b/drivers/rtc/rtc-coh901331.c
@@ -0,0 +1,311 @@
+/*
+ * Copyright (C) 2007-2009 ST-Ericsson AB
+ * License terms: GNU General Public License (GPL) version 2
+ * Real Time Clock interface for ST-Ericsson AB COH 901 331 RTC.
+ * Author: Linus Walleij <linus.walleij@stericsson.com>
+ * Based on rtc-pl031.c by Deepak Saxena <dsaxena@plexity.net>
+ * Copyright 2006 (c) MontaVista Software, Inc.
+ */
+#include <linux/init.h>
+#include <linux/module.h>
+#include <linux/rtc.h>
+#include <linux/clk.h>
+#include <linux/interrupt.h>
+#include <linux/pm.h>
+#include <linux/platform_device.h>
+#include <linux/io.h>
+
+/*
+ * Registers in the COH 901 331
+ */
+/* Alarm value 32bit (R/W) */
+#define COH901331_ALARM		0x00U
+/* Used to set current time 32bit (R/W) */
+#define COH901331_SET_TIME	0x04U
+/* Indication if current time is valid 32bit (R/-) */
+#define COH901331_VALID		0x08U
+/* Read the current time 32bit (R/-) */
+#define COH901331_CUR_TIME	0x0cU
+/* Event register for the "alarm" interrupt */
+#define COH901331_IRQ_EVENT	0x10U
+/* Mask register for the "alarm" interrupt */
+#define COH901331_IRQ_MASK	0x14U
+/* Force register for the "alarm" interrupt */
+#define COH901331_IRQ_FORCE	0x18U
+
+/*
+ * Reference to RTC block clock
+ * Notice that the frequent clk_enable()/clk_disable() on this
+ * clock is mainly to be able to turn on/off other clocks in the
+ * hierarchy as needed, the RTC clock is always on anyway.
+ */
+struct coh901331_port {
+	struct rtc_device *rtc;
+	struct clk *clk;
+	u32 phybase;
+	u32 physize;
+	void __iomem *virtbase;
+	int irq;
+#ifdef CONFIG_PM
+	u32 irqmaskstore;
+#endif
+};
+
+static irqreturn_t coh901331_interrupt(int irq, void *data)
+{
+	struct coh901331_port *rtap = data;
+
+	clk_enable(rtap->clk);
+	/* Ack IRQ */
+	writel(1, rtap->virtbase + COH901331_IRQ_EVENT);
+	clk_disable(rtap->clk);
+	/* Set alarm flag */
+	rtc_update_irq(rtap->rtc, 1, RTC_AF);
+
+	return IRQ_HANDLED;
+}
+
+static int coh901331_read_time(struct device *dev, struct rtc_time *tm)
+{
+	struct coh901331_port *rtap = dev_get_drvdata(dev);
+
+	clk_enable(rtap->clk);
+	/* Check if the time is valid */
+	if (readl(rtap->virtbase + COH901331_VALID)) {
+		rtc_time_to_tm(readl(rtap->virtbase + COH901331_CUR_TIME), tm);
+		clk_disable(rtap->clk);
+		return rtc_valid_tm(tm);
+	}
+	clk_disable(rtap->clk);
+	return -EINVAL;
+}
+
+static int coh901331_set_mmss(struct device *dev, unsigned long secs)
+{
+	struct coh901331_port *rtap = dev_get_drvdata(dev);
+
+	clk_enable(rtap->clk);
+	writel(secs, rtap->virtbase + COH901331_SET_TIME);
+	clk_disable(rtap->clk);
+
+	return 0;
+}
+
+static int coh901331_read_alarm(struct device *dev, struct rtc_wkalrm *alarm)
+{
+	struct coh901331_port *rtap = dev_get_drvdata(dev);
+
+	clk_enable(rtap->clk);
+	rtc_time_to_tm(readl(rtap->virtbase + COH901331_ALARM), &alarm->time);
+	alarm->pending = readl(rtap->virtbase + COH901331_IRQ_EVENT) & 1U;
+	alarm->enabled = readl(rtap->virtbase + COH901331_IRQ_MASK) & 1U;
+	clk_disable(rtap->clk);
+
+	return 0;
+}
+
+static int coh901331_set_alarm(struct device *dev, struct rtc_wkalrm *alarm)
+{
+	struct coh901331_port *rtap = dev_get_drvdata(dev);
+	unsigned long time;
+
+	rtc_tm_to_time(&alarm->time, &time);
+	clk_enable(rtap->clk);
+	writel(time, rtap->virtbase + COH901331_ALARM);
+	writel(alarm->enabled, rtap->virtbase + COH901331_IRQ_MASK);
+	clk_disable(rtap->clk);
+
+	return 0;
+}
+
+static int coh901331_alarm_irq_enable(struct device *dev, unsigned int enabled)
+{
+	struct coh901331_port *rtap = dev_get_drvdata(dev);
+
+	clk_enable(rtap->clk);
+	if (enabled)
+		writel(1, rtap->virtbase + COH901331_IRQ_MASK);
+	else
+		writel(0, rtap->virtbase + COH901331_IRQ_MASK);
+	clk_disable(rtap->clk);
+}
+
+static struct rtc_class_ops coh901331_ops = {
+	.read_time = coh901331_read_time,
+	.set_mmss = coh901331_set_mmss,
+	.read_alarm = coh901331_read_alarm,
+	.set_alarm = coh901331_set_alarm,
+	.alarm_irq_enable = coh901331_alarm_irq_enable,
+};
+
+static int __exit coh901331_remove(struct platform_device *pdev)
+{
+	struct coh901331_port *rtap = dev_get_drvdata(&pdev->dev);
+
+	if (rtap) {
+		free_irq(rtap->irq, rtap);
+		rtc_device_unregister(rtap->rtc);
+		clk_put(rtap->clk);
+		iounmap(rtap->virtbase);
+		release_mem_region(rtap->phybase, rtap->physize);
+		platform_set_drvdata(pdev, NULL);
+		kfree(rtap);
+	}
+
+	return 0;
+}
+
+
+static int __init coh901331_probe(struct platform_device *pdev)
+{
+	int ret;
+	struct coh901331_port *rtap;
+	struct resource *res;
+
+	rtap = kzalloc(sizeof(struct coh901331_port), GFP_KERNEL);
+	if (!rtap)
+		return -ENOMEM;
+
+	res = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+	if (!res) {
+		ret = -ENOENT;
+		goto out_no_resource;
+	}
+	rtap->phybase = res->start;
+	rtap->physize = resource_size(res);
+
+	if (request_mem_region(rtap->phybase, rtap->physize,
+			       "rtc-coh901331") == NULL) {
+		ret = -EBUSY;
+		goto out_no_memregion;
+	}
+
+	rtap->virtbase = ioremap(rtap->phybase, rtap->physize);
+	if (!rtap->virtbase) {
+		ret = -ENOMEM;
+		goto out_no_remap;
+	}
+
+	rtap->irq = platform_get_irq(pdev, 0);
+	if (request_irq(rtap->irq, coh901331_interrupt, IRQF_DISABLED,
+			"RTC COH 901 331 Alarm", rtap)) {
+		ret = -EIO;
+		goto out_no_irq;
+	}
+
+	rtap->clk = clk_get(&pdev->dev, NULL);
+	if (IS_ERR(rtap->clk)) {
+		ret = PTR_ERR(rtap->clk);
+		dev_err(&pdev->dev, "could not get clock\n");
+		goto out_no_clk;
+	}
+
+	/* We enable/disable the clock only to assure it works */
+	ret = clk_enable(rtap->clk);
+	if (ret) {
+		dev_err(&pdev->dev, "could not enable clock\n");
+		goto out_no_clk_enable;
+	}
+	clk_disable(rtap->clk);
+
+	rtap->rtc = rtc_device_register("coh901331", &pdev->dev, &coh901331_ops,
+					 THIS_MODULE);
+	if (IS_ERR(rtap->rtc)) {
+		ret = PTR_ERR(rtap->rtc);
+		goto out_no_rtc;
+	}
+
+	platform_set_drvdata(pdev, rtap);
+
+	return 0;
+
+ out_no_rtc:
+ out_no_clk_enable:
+	clk_put(rtap->clk);
+ out_no_clk:
+	free_irq(rtap->irq, rtap);
+ out_no_irq:
+	iounmap(rtap->virtbase);
+ out_no_remap:
+	platform_set_drvdata(pdev, NULL);
+ out_no_memregion:
+	release_mem_region(rtap->phybase, SZ_4K);
+ out_no_resource:
+	kfree(rtap);
+	return ret;
+}
+
+#ifdef CONFIG_PM
+static int coh901331_suspend(struct platform_device *pdev, pm_message_t state)
+{
+	struct coh901331_port *rtap = dev_get_drvdata(&pdev->dev);
+
+	/*
+	 * If this RTC alarm will be used for waking the system up,
+	 * don't disable it of course. Else we just disable the alarm
+	 * and await suspension.
+	 */
+	if (device_may_wakeup(&pdev->dev)) {
+		enable_irq_wake(rtap->irq);
+	} else {
+		clk_enable(rtap->clk);
+		rtap->irqmaskstore = readl(rtap->virtbase + COH901331_IRQ_MASK);
+		writel(0, rtap->virtbase + COH901331_IRQ_MASK);
+		clk_disable(rtap->clk);
+	}
+	return 0;
+}
+
+static int coh901331_resume(struct platform_device *pdev)
+{
+	struct coh901331_port *rtap = dev_get_drvdata(&pdev->dev);
+
+	if (device_may_wakeup(&pdev->dev))
+		disable_irq_wake(rtap->irq);
+	else
+		clk_enable(rtap->clk);
+		writel(rtap->irqmaskstore, rtap->virtbase + COH901331_IRQ_MASK);
+		clk_disable(rtap->clk);
+	return 0;
+}
+#else
+#define coh901331_suspend NULL
+#define coh901331_resume NULL
+#endif
+
+static void coh901331_shutdown(struct platform_device *pdev)
+{
+	struct coh901331_port *rtap = dev_get_drvdata(&pdev->dev);
+
+	clk_enable(rtap->clk);
+	writel(0, rtap->virtbase + COH901331_IRQ_MASK);
+	clk_disable(rtap->clk);
+}
+
+static struct platform_driver coh901331_driver = {
+	.driver = {
+		.name = "rtc-coh901331",
+		.owner = THIS_MODULE,
+	},
+	.remove = __exit_p(coh901331_remove),
+	.suspend = coh901331_suspend,
+	.resume = coh901331_resume,
+	.shutdown = coh901331_shutdown,
+};
+
+static int __init coh901331_init(void)
+{
+	return platform_driver_probe(&coh901331_driver, coh901331_probe);
+}
+
+static void __exit coh901331_exit(void)
+{
+	platform_driver_unregister(&coh901331_driver);
+}
+
+module_init(coh901331_init);
+module_exit(coh901331_exit);
+
+MODULE_AUTHOR("Linus Walleij <linus.walleij@stericsson.com>");
+MODULE_DESCRIPTION("ST-Ericsson AB COH 901 331 RTC Driver");
+MODULE_LICENSE("GPL");
diff --git a/drivers/rtc/rtc-ds1305.c b/drivers/rtc/rtc-ds1305.c
index 8f410e5..2736b11 100644
--- a/drivers/rtc/rtc-ds1305.c
+++ b/drivers/rtc/rtc-ds1305.c
@@ -841,3 +841,4 @@
 
 MODULE_DESCRIPTION("RTC driver for DS1305 and DS1306 chips");
 MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:rtc-ds1305");
diff --git a/drivers/rtc/rtc-ds1307.c b/drivers/rtc/rtc-ds1307.c
index 47a93c0..eb99ee4 100644
--- a/drivers/rtc/rtc-ds1307.c
+++ b/drivers/rtc/rtc-ds1307.c
@@ -896,8 +896,7 @@
 	return 0;
 
 exit_irq:
-	if (ds1307->rtc)
-		rtc_device_unregister(ds1307->rtc);
+	rtc_device_unregister(ds1307->rtc);
 exit_free:
 	kfree(ds1307);
 	return err;
diff --git a/drivers/rtc/rtc-ds1390.c b/drivers/rtc/rtc-ds1390.c
index e01b955..cdb7050 100644
--- a/drivers/rtc/rtc-ds1390.c
+++ b/drivers/rtc/rtc-ds1390.c
@@ -189,3 +189,4 @@
 MODULE_DESCRIPTION("Dallas/Maxim DS1390/93/94 SPI RTC driver");
 MODULE_AUTHOR("Mark Jackson <mpfj@mimc.co.uk>");
 MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:rtc-ds1390");
diff --git a/drivers/rtc/rtc-ds3234.c b/drivers/rtc/rtc-ds3234.c
index c51589e..a774ca3 100644
--- a/drivers/rtc/rtc-ds3234.c
+++ b/drivers/rtc/rtc-ds3234.c
@@ -188,3 +188,4 @@
 MODULE_DESCRIPTION("DS3234 SPI RTC driver");
 MODULE_AUTHOR("Dennis Aberilla <denzzzhome@yahoo.com>");
 MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:ds3234");
diff --git a/drivers/rtc/rtc-ep93xx.c b/drivers/rtc/rtc-ep93xx.c
index 551332e..9da02d1 100644
--- a/drivers/rtc/rtc-ep93xx.c
+++ b/drivers/rtc/rtc-ep93xx.c
@@ -128,12 +128,16 @@
 		return -ENOMEM;
 
 	res = platform_get_resource(pdev, IORESOURCE_MEM, 0);
-	if (res == NULL)
-		return -ENXIO;
+	if (res == NULL) {
+		err = -ENXIO;
+		goto fail_free;
+	}
 
 	res = request_mem_region(res->start, resource_size(res), pdev->name);
-	if (res == NULL)
-		return -EBUSY;
+	if (res == NULL) {
+		err = -EBUSY;
+		goto fail_free;
+	}
 
 	ep93xx_rtc->mmio_base = ioremap(res->start, resource_size(res));
 	if (ep93xx_rtc->mmio_base == NULL) {
@@ -169,6 +173,8 @@
 		pdev->dev.platform_data = NULL;
 	}
 	release_mem_region(res->start, resource_size(res));
+fail_free:
+	kfree(ep93xx_rtc);
 	return err;
 }
 
diff --git a/drivers/rtc/rtc-m41t94.c b/drivers/rtc/rtc-m41t94.c
index c3a18c5..c8c97a41 100644
--- a/drivers/rtc/rtc-m41t94.c
+++ b/drivers/rtc/rtc-m41t94.c
@@ -171,3 +171,4 @@
 MODULE_AUTHOR("Kim B. Heino <Kim.Heino@bluegiga.com>");
 MODULE_DESCRIPTION("Driver for ST M41T94 SPI RTC");
 MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:rtc-m41t94");
diff --git a/drivers/rtc/rtc-max6902.c b/drivers/rtc/rtc-max6902.c
index 36a8ea9..657403e 100644
--- a/drivers/rtc/rtc-max6902.c
+++ b/drivers/rtc/rtc-max6902.c
@@ -175,3 +175,4 @@
 MODULE_DESCRIPTION ("max6902 spi RTC driver");
 MODULE_AUTHOR ("Raphael Assenat");
 MODULE_LICENSE ("GPL");
+MODULE_ALIAS("spi:rtc-max6902");
diff --git a/drivers/rtc/rtc-mxc.c b/drivers/rtc/rtc-mxc.c
new file mode 100644
index 0000000..6bd5072
--- /dev/null
+++ b/drivers/rtc/rtc-mxc.c
@@ -0,0 +1,507 @@
+/*
+ * Copyright 2004-2008 Freescale Semiconductor, Inc. All Rights Reserved.
+ *
+ * The code contained herein is licensed under the GNU General Public
+ * License. You may obtain a copy of the GNU General Public License
+ * Version 2 or later at the following locations:
+ *
+ * http://www.opensource.org/licenses/gpl-license.html
+ * http://www.gnu.org/copyleft/gpl.html
+ */
+
+#include <linux/io.h>
+#include <linux/rtc.h>
+#include <linux/module.h>
+#include <linux/interrupt.h>
+#include <linux/platform_device.h>
+#include <linux/clk.h>
+
+#include <mach/hardware.h>
+
+#define RTC_INPUT_CLK_32768HZ	(0x00 << 5)
+#define RTC_INPUT_CLK_32000HZ	(0x01 << 5)
+#define RTC_INPUT_CLK_38400HZ	(0x02 << 5)
+
+#define RTC_SW_BIT      (1 << 0)
+#define RTC_ALM_BIT     (1 << 2)
+#define RTC_1HZ_BIT     (1 << 4)
+#define RTC_2HZ_BIT     (1 << 7)
+#define RTC_SAM0_BIT    (1 << 8)
+#define RTC_SAM1_BIT    (1 << 9)
+#define RTC_SAM2_BIT    (1 << 10)
+#define RTC_SAM3_BIT    (1 << 11)
+#define RTC_SAM4_BIT    (1 << 12)
+#define RTC_SAM5_BIT    (1 << 13)
+#define RTC_SAM6_BIT    (1 << 14)
+#define RTC_SAM7_BIT    (1 << 15)
+#define PIT_ALL_ON      (RTC_2HZ_BIT | RTC_SAM0_BIT | RTC_SAM1_BIT | \
+			 RTC_SAM2_BIT | RTC_SAM3_BIT | RTC_SAM4_BIT | \
+			 RTC_SAM5_BIT | RTC_SAM6_BIT | RTC_SAM7_BIT)
+
+#define RTC_ENABLE_BIT  (1 << 7)
+
+#define MAX_PIE_NUM     9
+#define MAX_PIE_FREQ    512
+static const u32 PIE_BIT_DEF[MAX_PIE_NUM][2] = {
+	{ 2,		RTC_2HZ_BIT },
+	{ 4,		RTC_SAM0_BIT },
+	{ 8,		RTC_SAM1_BIT },
+	{ 16,		RTC_SAM2_BIT },
+	{ 32,		RTC_SAM3_BIT },
+	{ 64,		RTC_SAM4_BIT },
+	{ 128,		RTC_SAM5_BIT },
+	{ 256,		RTC_SAM6_BIT },
+	{ MAX_PIE_FREQ,	RTC_SAM7_BIT },
+};
+
+/* Those are the bits from a classic RTC we want to mimic */
+#define RTC_IRQF	0x80	/* any of the following 3 is active */
+#define RTC_PF		0x40	/* Periodic interrupt */
+#define RTC_AF		0x20	/* Alarm interrupt */
+#define RTC_UF		0x10	/* Update interrupt for 1Hz RTC */
+
+#define MXC_RTC_TIME	0
+#define MXC_RTC_ALARM	1
+
+#define RTC_HOURMIN	0x00	/*  32bit rtc hour/min counter reg */
+#define RTC_SECOND	0x04	/*  32bit rtc seconds counter reg */
+#define RTC_ALRM_HM	0x08	/*  32bit rtc alarm hour/min reg */
+#define RTC_ALRM_SEC	0x0C	/*  32bit rtc alarm seconds reg */
+#define RTC_RTCCTL	0x10	/*  32bit rtc control reg */
+#define RTC_RTCISR	0x14	/*  32bit rtc interrupt status reg */
+#define RTC_RTCIENR	0x18	/*  32bit rtc interrupt enable reg */
+#define RTC_STPWCH	0x1C	/*  32bit rtc stopwatch min reg */
+#define RTC_DAYR	0x20	/*  32bit rtc days counter reg */
+#define RTC_DAYALARM	0x24	/*  32bit rtc day alarm reg */
+#define RTC_TEST1	0x28	/*  32bit rtc test reg 1 */
+#define RTC_TEST2	0x2C	/*  32bit rtc test reg 2 */
+#define RTC_TEST3	0x30	/*  32bit rtc test reg 3 */
+
+struct rtc_plat_data {
+	struct rtc_device *rtc;
+	void __iomem *ioaddr;
+	int irq;
+	struct clk *clk;
+	unsigned int irqen;
+	int alrm_sec;
+	int alrm_min;
+	int alrm_hour;
+	int alrm_mday;
+	struct timespec mxc_rtc_delta;
+	struct rtc_time g_rtc_alarm;
+};
+
+/*
+ * This function is used to obtain the RTC time or the alarm value in
+ * second.
+ */
+static u32 get_alarm_or_time(struct device *dev, int time_alarm)
+{
+	struct platform_device *pdev = to_platform_device(dev);
+	struct rtc_plat_data *pdata = platform_get_drvdata(pdev);
+	void __iomem *ioaddr = pdata->ioaddr;
+	u32 day = 0, hr = 0, min = 0, sec = 0, hr_min = 0;
+
+	switch (time_alarm) {
+	case MXC_RTC_TIME:
+		day = readw(ioaddr + RTC_DAYR);
+		hr_min = readw(ioaddr + RTC_HOURMIN);
+		sec = readw(ioaddr + RTC_SECOND);
+		break;
+	case MXC_RTC_ALARM:
+		day = readw(ioaddr + RTC_DAYALARM);
+		hr_min = readw(ioaddr + RTC_ALRM_HM) & 0xffff;
+		sec = readw(ioaddr + RTC_ALRM_SEC);
+		break;
+	}
+
+	hr = hr_min >> 8;
+	min = hr_min & 0xff;
+
+	return (((day * 24 + hr) * 60) + min) * 60 + sec;
+}
+
+/*
+ * This function sets the RTC alarm value or the time value.
+ */
+static void set_alarm_or_time(struct device *dev, int time_alarm, u32 time)
+{
+	u32 day, hr, min, sec, temp;
+	struct platform_device *pdev = to_platform_device(dev);
+	struct rtc_plat_data *pdata = platform_get_drvdata(pdev);
+	void __iomem *ioaddr = pdata->ioaddr;
+
+	day = time / 86400;
+	time -= day * 86400;
+
+	/* time is within a day now */
+	hr = time / 3600;
+	time -= hr * 3600;
+
+	/* time is within an hour now */
+	min = time / 60;
+	sec = time - min * 60;
+
+	temp = (hr << 8) + min;
+
+	switch (time_alarm) {
+	case MXC_RTC_TIME:
+		writew(day, ioaddr + RTC_DAYR);
+		writew(sec, ioaddr + RTC_SECOND);
+		writew(temp, ioaddr + RTC_HOURMIN);
+		break;
+	case MXC_RTC_ALARM:
+		writew(day, ioaddr + RTC_DAYALARM);
+		writew(sec, ioaddr + RTC_ALRM_SEC);
+		writew(temp, ioaddr + RTC_ALRM_HM);
+		break;
+	}
+}
+
+/*
+ * This function updates the RTC alarm registers and then clears all the
+ * interrupt status bits.
+ */
+static int rtc_update_alarm(struct device *dev, struct rtc_time *alrm)
+{
+	struct rtc_time alarm_tm, now_tm;
+	unsigned long now, time;
+	int ret;
+	struct platform_device *pdev = to_platform_device(dev);
+	struct rtc_plat_data *pdata = platform_get_drvdata(pdev);
+	void __iomem *ioaddr = pdata->ioaddr;
+
+	now = get_alarm_or_time(dev, MXC_RTC_TIME);
+	rtc_time_to_tm(now, &now_tm);
+	alarm_tm.tm_year = now_tm.tm_year;
+	alarm_tm.tm_mon = now_tm.tm_mon;
+	alarm_tm.tm_mday = now_tm.tm_mday;
+	alarm_tm.tm_hour = alrm->tm_hour;
+	alarm_tm.tm_min = alrm->tm_min;
+	alarm_tm.tm_sec = alrm->tm_sec;
+	rtc_tm_to_time(&now_tm, &now);
+	rtc_tm_to_time(&alarm_tm, &time);
+
+	if (time < now) {
+		time += 60 * 60 * 24;
+		rtc_time_to_tm(time, &alarm_tm);
+	}
+
+	ret = rtc_tm_to_time(&alarm_tm, &time);
+
+	/* clear all the interrupt status bits */
+	writew(readw(ioaddr + RTC_RTCISR), ioaddr + RTC_RTCISR);
+	set_alarm_or_time(dev, MXC_RTC_ALARM, time);
+
+	return ret;
+}
+
+/* This function is the RTC interrupt service routine. */
+static irqreturn_t mxc_rtc_interrupt(int irq, void *dev_id)
+{
+	struct platform_device *pdev = dev_id;
+	struct rtc_plat_data *pdata = platform_get_drvdata(pdev);
+	void __iomem *ioaddr = pdata->ioaddr;
+	u32 status;
+	u32 events = 0;
+
+	spin_lock_irq(&pdata->rtc->irq_lock);
+	status = readw(ioaddr + RTC_RTCISR) & readw(ioaddr + RTC_RTCIENR);
+	/* clear interrupt sources */
+	writew(status, ioaddr + RTC_RTCISR);
+
+	/* clear alarm interrupt if it has occurred */
+	if (status & RTC_ALM_BIT)
+		status &= ~RTC_ALM_BIT;
+
+	/* update irq data & counter */
+	if (status & RTC_ALM_BIT)
+		events |= (RTC_AF | RTC_IRQF);
+
+	if (status & RTC_1HZ_BIT)
+		events |= (RTC_UF | RTC_IRQF);
+
+	if (status & PIT_ALL_ON)
+		events |= (RTC_PF | RTC_IRQF);
+
+	if ((status & RTC_ALM_BIT) && rtc_valid_tm(&pdata->g_rtc_alarm))
+		rtc_update_alarm(&pdev->dev, &pdata->g_rtc_alarm);
+
+	rtc_update_irq(pdata->rtc, 1, events);
+	spin_unlock_irq(&pdata->rtc->irq_lock);
+
+	return IRQ_HANDLED;
+}
+
+/*
+ * Clear all interrupts and release the IRQ
+ */
+static void mxc_rtc_release(struct device *dev)
+{
+	struct platform_device *pdev = to_platform_device(dev);
+	struct rtc_plat_data *pdata = platform_get_drvdata(pdev);
+	void __iomem *ioaddr = pdata->ioaddr;
+
+	spin_lock_irq(&pdata->rtc->irq_lock);
+
+	/* Disable all rtc interrupts */
+	writew(0, ioaddr + RTC_RTCIENR);
+
+	/* Clear all interrupt status */
+	writew(0xffffffff, ioaddr + RTC_RTCISR);
+
+	spin_unlock_irq(&pdata->rtc->irq_lock);
+}
+
+static void mxc_rtc_irq_enable(struct device *dev, unsigned int bit,
+				unsigned int enabled)
+{
+	struct platform_device *pdev = to_platform_device(dev);
+	struct rtc_plat_data *pdata = platform_get_drvdata(pdev);
+	void __iomem *ioaddr = pdata->ioaddr;
+	u32 reg;
+
+	spin_lock_irq(&pdata->rtc->irq_lock);
+	reg = readw(ioaddr + RTC_RTCIENR);
+
+	if (enabled)
+		reg |= bit;
+	else
+		reg &= ~bit;
+
+	writew(reg, ioaddr + RTC_RTCIENR);
+	spin_unlock_irq(&pdata->rtc->irq_lock);
+}
+
+static int mxc_rtc_alarm_irq_enable(struct device *dev, unsigned int enabled)
+{
+	mxc_rtc_irq_enable(dev, RTC_ALM_BIT, enabled);
+	return 0;
+}
+
+static int mxc_rtc_update_irq_enable(struct device *dev, unsigned int enabled)
+{
+	mxc_rtc_irq_enable(dev, RTC_1HZ_BIT, enabled);
+	return 0;
+}
+
+/*
+ * This function reads the current RTC time into tm in Gregorian date.
+ */
+static int mxc_rtc_read_time(struct device *dev, struct rtc_time *tm)
+{
+	u32 val;
+
+	/* Avoid roll-over from reading the different registers */
+	do {
+		val = get_alarm_or_time(dev, MXC_RTC_TIME);
+	} while (val != get_alarm_or_time(dev, MXC_RTC_TIME));
+
+	rtc_time_to_tm(val, tm);
+
+	return 0;
+}
+
+/*
+ * This function sets the internal RTC time based on tm in Gregorian date.
+ */
+static int mxc_rtc_set_mmss(struct device *dev, unsigned long time)
+{
+	/* Avoid roll-over from reading the different registers */
+	do {
+		set_alarm_or_time(dev, MXC_RTC_TIME, time);
+	} while (time != get_alarm_or_time(dev, MXC_RTC_TIME));
+
+	return 0;
+}
+
+/*
+ * This function reads the current alarm value into the passed in 'alrm'
+ * argument. It updates the alrm's pending field value based on the whether
+ * an alarm interrupt occurs or not.
+ */
+static int mxc_rtc_read_alarm(struct device *dev, struct rtc_wkalrm *alrm)
+{
+	struct platform_device *pdev = to_platform_device(dev);
+	struct rtc_plat_data *pdata = platform_get_drvdata(pdev);
+	void __iomem *ioaddr = pdata->ioaddr;
+
+	rtc_time_to_tm(get_alarm_or_time(dev, MXC_RTC_ALARM), &alrm->time);
+	alrm->pending = ((readw(ioaddr + RTC_RTCISR) & RTC_ALM_BIT)) ? 1 : 0;
+
+	return 0;
+}
+
+/*
+ * This function sets the RTC alarm based on passed in alrm.
+ */
+static int mxc_rtc_set_alarm(struct device *dev, struct rtc_wkalrm *alrm)
+{
+	struct platform_device *pdev = to_platform_device(dev);
+	struct rtc_plat_data *pdata = platform_get_drvdata(pdev);
+	int ret;
+
+	if (rtc_valid_tm(&alrm->time)) {
+		if (alrm->time.tm_sec > 59 ||
+		    alrm->time.tm_hour > 23 ||
+		    alrm->time.tm_min > 59)
+			return -EINVAL;
+
+		ret = rtc_update_alarm(dev, &alrm->time);
+	} else {
+		ret = rtc_valid_tm(&alrm->time);
+		if (ret)
+			return ret;
+
+		ret = rtc_update_alarm(dev, &alrm->time);
+	}
+
+	if (ret)
+		return ret;
+
+	memcpy(&pdata->g_rtc_alarm, &alrm->time, sizeof(struct rtc_time));
+	mxc_rtc_irq_enable(dev, RTC_ALM_BIT, alrm->enabled);
+
+	return 0;
+}
+
+/* RTC layer */
+static struct rtc_class_ops mxc_rtc_ops = {
+	.release		= mxc_rtc_release,
+	.read_time		= mxc_rtc_read_time,
+	.set_mmss		= mxc_rtc_set_mmss,
+	.read_alarm		= mxc_rtc_read_alarm,
+	.set_alarm		= mxc_rtc_set_alarm,
+	.alarm_irq_enable	= mxc_rtc_alarm_irq_enable,
+	.update_irq_enable	= mxc_rtc_update_irq_enable,
+};
+
+static int __init mxc_rtc_probe(struct platform_device *pdev)
+{
+	struct clk *clk;
+	struct resource *res;
+	struct rtc_device *rtc;
+	struct rtc_plat_data *pdata = NULL;
+	u32 reg;
+	int ret, rate;
+
+	res = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+	if (!res)
+		return -ENODEV;
+
+	pdata = kzalloc(sizeof(*pdata), GFP_KERNEL);
+	if (!pdata)
+		return -ENOMEM;
+
+	pdata->ioaddr = ioremap(res->start, resource_size(res));
+
+	clk = clk_get(&pdev->dev, "ckil");
+	if (IS_ERR(clk))
+		return PTR_ERR(clk);
+
+	rate = clk_get_rate(clk);
+	clk_put(clk);
+
+	if (rate == 32768)
+		reg = RTC_INPUT_CLK_32768HZ;
+	else if (rate == 32000)
+		reg = RTC_INPUT_CLK_32000HZ;
+	else if (rate == 38400)
+		reg = RTC_INPUT_CLK_38400HZ;
+	else {
+		dev_err(&pdev->dev, "rtc clock is not valid (%lu)\n",
+			clk_get_rate(clk));
+		ret = -EINVAL;
+		goto exit_free_pdata;
+	}
+
+	reg |= RTC_ENABLE_BIT;
+	writew(reg, (pdata->ioaddr + RTC_RTCCTL));
+	if (((readw(pdata->ioaddr + RTC_RTCCTL)) & RTC_ENABLE_BIT) == 0) {
+		dev_err(&pdev->dev, "hardware module can't be enabled!\n");
+		ret = -EIO;
+		goto exit_free_pdata;
+	}
+
+	pdata->clk = clk_get(&pdev->dev, "rtc");
+	if (IS_ERR(pdata->clk)) {
+		dev_err(&pdev->dev, "unable to get clock!\n");
+		ret = PTR_ERR(pdata->clk);
+		goto exit_free_pdata;
+	}
+
+	clk_enable(pdata->clk);
+
+	rtc = rtc_device_register(pdev->name, &pdev->dev, &mxc_rtc_ops,
+				  THIS_MODULE);
+	if (IS_ERR(rtc)) {
+		ret = PTR_ERR(rtc);
+		goto exit_put_clk;
+	}
+
+	pdata->rtc = rtc;
+	platform_set_drvdata(pdev, pdata);
+
+	/* Configure and enable the RTC */
+	pdata->irq = platform_get_irq(pdev, 0);
+
+	if (pdata->irq >= 0 &&
+	    request_irq(pdata->irq, mxc_rtc_interrupt, IRQF_SHARED,
+			pdev->name, pdev) < 0) {
+		dev_warn(&pdev->dev, "interrupt not available.\n");
+		pdata->irq = -1;
+	}
+
+	return 0;
+
+exit_put_clk:
+	clk_put(pdata->clk);
+
+exit_free_pdata:
+	kfree(pdata);
+
+	return ret;
+}
+
+static int __exit mxc_rtc_remove(struct platform_device *pdev)
+{
+	struct rtc_plat_data *pdata = platform_get_drvdata(pdev);
+
+	rtc_device_unregister(pdata->rtc);
+
+	if (pdata->irq >= 0)
+		free_irq(pdata->irq, pdev);
+
+	clk_disable(pdata->clk);
+	clk_put(pdata->clk);
+	kfree(pdata);
+	platform_set_drvdata(pdev, NULL);
+
+	return 0;
+}
+
+static struct platform_driver mxc_rtc_driver = {
+	.driver = {
+		   .name	= "mxc_rtc",
+		   .owner	= THIS_MODULE,
+	},
+	.remove		= __exit_p(mxc_rtc_remove),
+};
+
+static int __init mxc_rtc_init(void)
+{
+	return platform_driver_probe(&mxc_rtc_driver, mxc_rtc_probe);
+}
+
+static void __exit mxc_rtc_exit(void)
+{
+	platform_driver_unregister(&mxc_rtc_driver);
+}
+
+module_init(mxc_rtc_init);
+module_exit(mxc_rtc_exit);
+
+MODULE_AUTHOR("Daniel Mack <daniel@caiaq.de>");
+MODULE_DESCRIPTION("RTC driver for Freescale MXC");
+MODULE_LICENSE("GPL");
+
diff --git a/drivers/rtc/rtc-pcap.c b/drivers/rtc/rtc-pcap.c
new file mode 100644
index 0000000..a99c289
--- /dev/null
+++ b/drivers/rtc/rtc-pcap.c
@@ -0,0 +1,224 @@
+/*
+ *  pcap rtc code for Motorola EZX phones
+ *
+ *  Copyright (c) 2008 guiming zhuo <gmzhuo@gmail.com>
+ *  Copyright (c) 2009 Daniel Ribeiro <drwyrm@gmail.com>
+ *
+ *  Based on Motorola's rtc.c Copyright (c) 2003-2005 Motorola
+ *
+ *  This program is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License version 2 as
+ *  published by the Free Software Foundation.
+ *
+ */
+
+#include <linux/kernel.h>
+#include <linux/module.h>
+#include <linux/init.h>
+#include <linux/mfd/ezx-pcap.h>
+#include <linux/rtc.h>
+#include <linux/platform_device.h>
+
+struct pcap_rtc {
+	struct pcap_chip *pcap;
+	struct rtc_device *rtc;
+};
+
+static irqreturn_t pcap_rtc_irq(int irq, void *_pcap_rtc)
+{
+	struct pcap_rtc *pcap_rtc = _pcap_rtc;
+	unsigned long rtc_events;
+
+	if (irq == pcap_to_irq(pcap_rtc->pcap, PCAP_IRQ_1HZ))
+		rtc_events = RTC_IRQF | RTC_UF;
+	else if (irq == pcap_to_irq(pcap_rtc->pcap, PCAP_IRQ_TODA))
+		rtc_events = RTC_IRQF | RTC_AF;
+	else
+		rtc_events = 0;
+
+	rtc_update_irq(pcap_rtc->rtc, 1, rtc_events);
+	return IRQ_HANDLED;
+}
+
+static int pcap_rtc_read_alarm(struct device *dev, struct rtc_wkalrm *alrm)
+{
+	struct platform_device *pdev = to_platform_device(dev);
+	struct pcap_rtc *pcap_rtc = platform_get_drvdata(pdev);
+	struct rtc_time *tm = &alrm->time;
+	unsigned long secs;
+	u32 tod;	/* time of day, seconds since midnight */
+	u32 days;	/* days since 1/1/1970 */
+
+	ezx_pcap_read(pcap_rtc->pcap, PCAP_REG_RTC_TODA, &tod);
+	secs = tod & PCAP_RTC_TOD_MASK;
+
+	ezx_pcap_read(pcap_rtc->pcap, PCAP_REG_RTC_DAYA, &days);
+	secs += (days & PCAP_RTC_DAY_MASK) * SEC_PER_DAY;
+
+	rtc_time_to_tm(secs, tm);
+
+	return 0;
+}
+
+static int pcap_rtc_set_alarm(struct device *dev, struct rtc_wkalrm *alrm)
+{
+	struct platform_device *pdev = to_platform_device(dev);
+	struct pcap_rtc *pcap_rtc = platform_get_drvdata(pdev);
+	struct rtc_time *tm = &alrm->time;
+	unsigned long secs;
+	u32 tod, days;
+
+	rtc_tm_to_time(tm, &secs);
+
+	tod = secs % SEC_PER_DAY;
+	ezx_pcap_write(pcap_rtc->pcap, PCAP_REG_RTC_TODA, tod);
+
+	days = secs / SEC_PER_DAY;
+	ezx_pcap_write(pcap_rtc->pcap, PCAP_REG_RTC_DAYA, days);
+
+	return 0;
+}
+
+static int pcap_rtc_read_time(struct device *dev, struct rtc_time *tm)
+{
+	struct platform_device *pdev = to_platform_device(dev);
+	struct pcap_rtc *pcap_rtc = platform_get_drvdata(pdev);
+	unsigned long secs;
+	u32 tod, days;
+
+	ezx_pcap_read(pcap_rtc->pcap, PCAP_REG_RTC_TOD, &tod);
+	secs = tod & PCAP_RTC_TOD_MASK;
+
+	ezx_pcap_read(pcap_rtc->pcap, PCAP_REG_RTC_DAY, &days);
+	secs += (days & PCAP_RTC_DAY_MASK) * SEC_PER_DAY;
+
+	rtc_time_to_tm(secs, tm);
+
+	return rtc_valid_tm(tm);
+}
+
+static int pcap_rtc_set_mmss(struct device *dev, unsigned long secs)
+{
+	struct platform_device *pdev = to_platform_device(dev);
+	struct pcap_rtc *pcap_rtc = platform_get_drvdata(pdev);
+	u32 tod, days;
+
+	tod = secs % SEC_PER_DAY;
+	ezx_pcap_write(pcap_rtc->pcap, PCAP_REG_RTC_TOD, tod);
+
+	days = secs / SEC_PER_DAY;
+	ezx_pcap_write(pcap_rtc->pcap, PCAP_REG_RTC_DAY, days);
+
+	return 0;
+}
+
+static int pcap_rtc_irq_enable(struct device *dev, int pirq, unsigned int en)
+{
+	struct platform_device *pdev = to_platform_device(dev);
+	struct pcap_rtc *pcap_rtc = platform_get_drvdata(pdev);
+
+	if (en)
+		enable_irq(pcap_to_irq(pcap_rtc->pcap, pirq));
+	else
+		disable_irq(pcap_to_irq(pcap_rtc->pcap, pirq));
+
+	return 0;
+}
+
+static int pcap_rtc_alarm_irq_enable(struct device *dev, unsigned int en)
+{
+	return pcap_rtc_irq_enable(dev, PCAP_IRQ_TODA, en);
+}
+
+static int pcap_rtc_update_irq_enable(struct device *dev, unsigned int en)
+{
+	return pcap_rtc_irq_enable(dev, PCAP_IRQ_1HZ, en);
+}
+
+static const struct rtc_class_ops pcap_rtc_ops = {
+	.read_time = pcap_rtc_read_time,
+	.read_alarm = pcap_rtc_read_alarm,
+	.set_alarm = pcap_rtc_set_alarm,
+	.set_mmss = pcap_rtc_set_mmss,
+	.alarm_irq_enable = pcap_rtc_alarm_irq_enable,
+	.update_irq_enable = pcap_rtc_update_irq_enable,
+};
+
+static int __devinit pcap_rtc_probe(struct platform_device *pdev)
+{
+	struct pcap_rtc *pcap_rtc;
+	int timer_irq, alarm_irq;
+	int err = -ENOMEM;
+
+	pcap_rtc = kmalloc(sizeof(struct pcap_rtc), GFP_KERNEL);
+	if (!pcap_rtc)
+		return err;
+
+	pcap_rtc->pcap = dev_get_drvdata(pdev->dev.parent);
+
+	pcap_rtc->rtc = rtc_device_register("pcap", &pdev->dev,
+				  &pcap_rtc_ops, THIS_MODULE);
+	if (IS_ERR(pcap_rtc->rtc)) {
+		err = PTR_ERR(pcap_rtc->rtc);
+		goto fail_rtc;
+	}
+
+	platform_set_drvdata(pdev, pcap_rtc);
+
+	timer_irq = pcap_to_irq(pcap_rtc->pcap, PCAP_IRQ_1HZ);
+	alarm_irq = pcap_to_irq(pcap_rtc->pcap, PCAP_IRQ_TODA);
+
+	err = request_irq(timer_irq, pcap_rtc_irq, 0, "RTC Timer", pcap_rtc);
+	if (err)
+		goto fail_timer;
+
+	err = request_irq(alarm_irq, pcap_rtc_irq, 0, "RTC Alarm", pcap_rtc);
+	if (err)
+		goto fail_alarm;
+
+	return 0;
+fail_alarm:
+	free_irq(timer_irq, pcap_rtc);
+fail_timer:
+	rtc_device_unregister(pcap_rtc->rtc);
+fail_rtc:
+	kfree(pcap_rtc);
+	return err;
+}
+
+static int __devexit pcap_rtc_remove(struct platform_device *pdev)
+{
+	struct pcap_rtc *pcap_rtc = platform_get_drvdata(pdev);
+
+	free_irq(pcap_to_irq(pcap_rtc->pcap, PCAP_IRQ_1HZ), pcap_rtc);
+	free_irq(pcap_to_irq(pcap_rtc->pcap, PCAP_IRQ_TODA), pcap_rtc);
+	rtc_device_unregister(pcap_rtc->rtc);
+	kfree(pcap_rtc);
+
+	return 0;
+}
+
+static struct platform_driver pcap_rtc_driver = {
+	.remove = __devexit_p(pcap_rtc_remove),
+	.driver = {
+		.name  = "pcap-rtc",
+		.owner = THIS_MODULE,
+	},
+};
+
+static int __init rtc_pcap_init(void)
+{
+	return platform_driver_probe(&pcap_rtc_driver, pcap_rtc_probe);
+}
+
+static void __exit rtc_pcap_exit(void)
+{
+	platform_driver_unregister(&pcap_rtc_driver);
+}
+
+module_init(rtc_pcap_init);
+module_exit(rtc_pcap_exit);
+
+MODULE_DESCRIPTION("Motorola pcap rtc driver");
+MODULE_AUTHOR("guiming zhuo <gmzhuo@gmail.com>");
+MODULE_LICENSE("GPL");
diff --git a/drivers/rtc/rtc-pcf2123.c b/drivers/rtc/rtc-pcf2123.c
new file mode 100644
index 0000000..e75df9d
--- /dev/null
+++ b/drivers/rtc/rtc-pcf2123.c
@@ -0,0 +1,364 @@
+/*
+ * An SPI driver for the Philips PCF2123 RTC
+ * Copyright 2009 Cyber Switching, Inc.
+ *
+ * Author: Chris Verges <chrisv@cyberswitching.com>
+ * Maintainers: http://www.cyberswitching.com
+ *
+ * based on the RS5C348 driver in this same directory.
+ *
+ * Thanks to Christian Pellegrin <chripell@fsfe.org> for
+ * the sysfs contributions to this driver.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * Please note that the CS is active high, so platform data
+ * should look something like:
+ *
+ * static struct spi_board_info ek_spi_devices[] = {
+ * 	...
+ * 	{
+ * 		.modalias		= "rtc-pcf2123",
+ * 		.chip_select		= 1,
+ * 		.controller_data	= (void *)AT91_PIN_PA10,
+ *		.max_speed_hz		= 1000 * 1000,
+ *		.mode			= SPI_CS_HIGH,
+ *		.bus_num		= 0,
+ *	},
+ *	...
+ *};
+ *
+ */
+
+#include <linux/bcd.h>
+#include <linux/delay.h>
+#include <linux/device.h>
+#include <linux/errno.h>
+#include <linux/init.h>
+#include <linux/kernel.h>
+#include <linux/string.h>
+#include <linux/rtc.h>
+#include <linux/spi/spi.h>
+
+#define DRV_VERSION "0.6"
+
+#define PCF2123_REG_CTRL1	(0x00)	/* Control Register 1 */
+#define PCF2123_REG_CTRL2	(0x01)	/* Control Register 2 */
+#define PCF2123_REG_SC		(0x02)	/* datetime */
+#define PCF2123_REG_MN		(0x03)
+#define PCF2123_REG_HR		(0x04)
+#define PCF2123_REG_DM		(0x05)
+#define PCF2123_REG_DW		(0x06)
+#define PCF2123_REG_MO		(0x07)
+#define PCF2123_REG_YR		(0x08)
+
+#define PCF2123_SUBADDR		(1 << 4)
+#define PCF2123_WRITE		((0 << 7) | PCF2123_SUBADDR)
+#define PCF2123_READ		((1 << 7) | PCF2123_SUBADDR)
+
+static struct spi_driver pcf2123_driver;
+
+struct pcf2123_sysfs_reg {
+	struct device_attribute attr;
+	char name[2];
+};
+
+struct pcf2123_plat_data {
+	struct rtc_device *rtc;
+	struct pcf2123_sysfs_reg regs[16];
+};
+
+/*
+ * Causes a 30 nanosecond delay to ensure that the PCF2123 chip select
+ * is released properly after an SPI write.  This function should be
+ * called after EVERY read/write call over SPI.
+ */
+static inline void pcf2123_delay_trec(void)
+{
+	ndelay(30);
+}
+
+static ssize_t pcf2123_show(struct device *dev, struct device_attribute *attr,
+			    char *buffer)
+{
+	struct spi_device *spi = to_spi_device(dev);
+	struct pcf2123_sysfs_reg *r;
+	u8 txbuf[1], rxbuf[1];
+	unsigned long reg;
+	int ret;
+
+	r = container_of(attr, struct pcf2123_sysfs_reg, attr);
+
+	if (strict_strtoul(r->name, 16, &reg))
+		return -EINVAL;
+
+	txbuf[0] = PCF2123_READ | reg;
+	ret = spi_write_then_read(spi, txbuf, 1, rxbuf, 1);
+	if (ret < 0)
+		return -EIO;
+	pcf2123_delay_trec();
+	return sprintf(buffer, "0x%x\n", rxbuf[0]);
+}
+
+static ssize_t pcf2123_store(struct device *dev, struct device_attribute *attr,
+			     const char *buffer, size_t count) {
+	struct spi_device *spi = to_spi_device(dev);
+	struct pcf2123_sysfs_reg *r;
+	u8 txbuf[2];
+	unsigned long reg;
+	unsigned long val;
+
+	int ret;
+
+	r = container_of(attr, struct pcf2123_sysfs_reg, attr);
+
+	if (strict_strtoul(r->name, 16, &reg)
+		|| strict_strtoul(buffer, 10, &val))
+		return -EINVAL;
+
+	txbuf[0] = PCF2123_WRITE | reg;
+	txbuf[1] = val;
+	ret = spi_write(spi, txbuf, sizeof(txbuf));
+	if (ret < 0)
+		return -EIO;
+	pcf2123_delay_trec();
+	return count;
+}
+
+static int pcf2123_rtc_read_time(struct device *dev, struct rtc_time *tm)
+{
+	struct spi_device *spi = to_spi_device(dev);
+	u8 txbuf[1], rxbuf[7];
+	int ret;
+
+	txbuf[0] = PCF2123_READ | PCF2123_REG_SC;
+	ret = spi_write_then_read(spi, txbuf, sizeof(txbuf),
+			rxbuf, sizeof(rxbuf));
+	if (ret < 0)
+		return ret;
+	pcf2123_delay_trec();
+
+	tm->tm_sec = bcd2bin(rxbuf[0] & 0x7F);
+	tm->tm_min = bcd2bin(rxbuf[1] & 0x7F);
+	tm->tm_hour = bcd2bin(rxbuf[2] & 0x3F); /* rtc hr 0-23 */
+	tm->tm_mday = bcd2bin(rxbuf[3] & 0x3F);
+	tm->tm_wday = rxbuf[4] & 0x07;
+	tm->tm_mon = bcd2bin(rxbuf[5] & 0x1F) - 1; /* rtc mn 1-12 */
+	tm->tm_year = bcd2bin(rxbuf[6]);
+	if (tm->tm_year < 70)
+		tm->tm_year += 100;	/* assume we are in 1970...2069 */
+
+	dev_dbg(dev, "%s: tm is secs=%d, mins=%d, hours=%d, "
+			"mday=%d, mon=%d, year=%d, wday=%d\n",
+			__func__,
+			tm->tm_sec, tm->tm_min, tm->tm_hour,
+			tm->tm_mday, tm->tm_mon, tm->tm_year, tm->tm_wday);
+
+	/* the clock can give out invalid datetime, but we cannot return
+	 * -EINVAL otherwise hwclock will refuse to set the time on bootup.
+	 */
+	if (rtc_valid_tm(tm) < 0)
+		dev_err(dev, "retrieved date/time is not valid.\n");
+
+	return 0;
+}
+
+static int pcf2123_rtc_set_time(struct device *dev, struct rtc_time *tm)
+{
+	struct spi_device *spi = to_spi_device(dev);
+	u8 txbuf[8];
+	int ret;
+
+	dev_dbg(dev, "%s: tm is secs=%d, mins=%d, hours=%d, "
+			"mday=%d, mon=%d, year=%d, wday=%d\n",
+			__func__,
+			tm->tm_sec, tm->tm_min, tm->tm_hour,
+			tm->tm_mday, tm->tm_mon, tm->tm_year, tm->tm_wday);
+
+	/* Stop the counter first */
+	txbuf[0] = PCF2123_WRITE | PCF2123_REG_CTRL1;
+	txbuf[1] = 0x20;
+	ret = spi_write(spi, txbuf, 2);
+	if (ret < 0)
+		return ret;
+	pcf2123_delay_trec();
+
+	/* Set the new time */
+	txbuf[0] = PCF2123_WRITE | PCF2123_REG_SC;
+	txbuf[1] = bin2bcd(tm->tm_sec & 0x7F);
+	txbuf[2] = bin2bcd(tm->tm_min & 0x7F);
+	txbuf[3] = bin2bcd(tm->tm_hour & 0x3F);
+	txbuf[4] = bin2bcd(tm->tm_mday & 0x3F);
+	txbuf[5] = tm->tm_wday & 0x07;
+	txbuf[6] = bin2bcd((tm->tm_mon + 1) & 0x1F); /* rtc mn 1-12 */
+	txbuf[7] = bin2bcd(tm->tm_year < 100 ? tm->tm_year : tm->tm_year - 100);
+
+	ret = spi_write(spi, txbuf, sizeof(txbuf));
+	if (ret < 0)
+		return ret;
+	pcf2123_delay_trec();
+
+	/* Start the counter */
+	txbuf[0] = PCF2123_WRITE | PCF2123_REG_CTRL1;
+	txbuf[1] = 0x00;
+	ret = spi_write(spi, txbuf, 2);
+	if (ret < 0)
+		return ret;
+	pcf2123_delay_trec();
+
+	return 0;
+}
+
+static const struct rtc_class_ops pcf2123_rtc_ops = {
+	.read_time	= pcf2123_rtc_read_time,
+	.set_time	= pcf2123_rtc_set_time,
+};
+
+static int __devinit pcf2123_probe(struct spi_device *spi)
+{
+	struct rtc_device *rtc;
+	struct pcf2123_plat_data *pdata;
+	u8 txbuf[2], rxbuf[2];
+	int ret, i;
+
+	pdata = kzalloc(sizeof(struct pcf2123_plat_data), GFP_KERNEL);
+	if (!pdata)
+		return -ENOMEM;
+	spi->dev.platform_data = pdata;
+
+	/* Send a software reset command */
+	txbuf[0] = PCF2123_WRITE | PCF2123_REG_CTRL1;
+	txbuf[1] = 0x58;
+	dev_dbg(&spi->dev, "resetting RTC (0x%02X 0x%02X)\n",
+			txbuf[0], txbuf[1]);
+	ret = spi_write(spi, txbuf, 2 * sizeof(u8));
+	if (ret < 0)
+		goto kfree_exit;
+	pcf2123_delay_trec();
+
+	/* Stop the counter */
+	txbuf[0] = PCF2123_WRITE | PCF2123_REG_CTRL1;
+	txbuf[1] = 0x20;
+	dev_dbg(&spi->dev, "stopping RTC (0x%02X 0x%02X)\n",
+			txbuf[0], txbuf[1]);
+	ret = spi_write(spi, txbuf, 2 * sizeof(u8));
+	if (ret < 0)
+		goto kfree_exit;
+	pcf2123_delay_trec();
+
+	/* See if the counter was actually stopped */
+	txbuf[0] = PCF2123_READ | PCF2123_REG_CTRL1;
+	dev_dbg(&spi->dev, "checking for presence of RTC (0x%02X)\n",
+			txbuf[0]);
+	ret = spi_write_then_read(spi, txbuf, 1 * sizeof(u8),
+					rxbuf, 2 * sizeof(u8));
+	dev_dbg(&spi->dev, "received data from RTC (0x%02X 0x%02X)\n",
+			rxbuf[0], rxbuf[1]);
+	if (ret < 0)
+		goto kfree_exit;
+	pcf2123_delay_trec();
+
+	if (!(rxbuf[0] & 0x20)) {
+		dev_err(&spi->dev, "chip not found\n");
+		goto kfree_exit;
+	}
+
+	dev_info(&spi->dev, "chip found, driver version " DRV_VERSION "\n");
+	dev_info(&spi->dev, "spiclk %u KHz.\n",
+			(spi->max_speed_hz + 500) / 1000);
+
+	/* Start the counter */
+	txbuf[0] = PCF2123_WRITE | PCF2123_REG_CTRL1;
+	txbuf[1] = 0x00;
+	ret = spi_write(spi, txbuf, sizeof(txbuf));
+	if (ret < 0)
+		goto kfree_exit;
+	pcf2123_delay_trec();
+
+	/* Finalize the initialization */
+	rtc = rtc_device_register(pcf2123_driver.driver.name, &spi->dev,
+			&pcf2123_rtc_ops, THIS_MODULE);
+
+	if (IS_ERR(rtc)) {
+		dev_err(&spi->dev, "failed to register.\n");
+		ret = PTR_ERR(rtc);
+		goto kfree_exit;
+	}
+
+	pdata->rtc = rtc;
+
+	for (i = 0; i < 16; i++) {
+		sprintf(pdata->regs[i].name, "%1x", i);
+		pdata->regs[i].attr.attr.mode = S_IRUGO | S_IWUSR;
+		pdata->regs[i].attr.attr.name = pdata->regs[i].name;
+		pdata->regs[i].attr.show = pcf2123_show;
+		pdata->regs[i].attr.store = pcf2123_store;
+		ret = device_create_file(&spi->dev, &pdata->regs[i].attr);
+		if (ret) {
+			dev_err(&spi->dev, "Unable to create sysfs %s\n",
+				pdata->regs[i].name);
+			goto sysfs_exit;
+		}
+	}
+
+	return 0;
+
+sysfs_exit:
+	for (i--; i >= 0; i--)
+		device_remove_file(&spi->dev, &pdata->regs[i].attr);
+
+kfree_exit:
+	kfree(pdata);
+	spi->dev.platform_data = NULL;
+	return ret;
+}
+
+static int pcf2123_remove(struct spi_device *spi)
+{
+	struct pcf2123_plat_data *pdata = spi->dev.platform_data;
+	int i;
+
+	if (pdata) {
+		struct rtc_device *rtc = pdata->rtc;
+
+		if (rtc)
+			rtc_device_unregister(rtc);
+		for (i = 0; i < 16; i++)
+			if (pdata->regs[i].name[0])
+				device_remove_file(&spi->dev,
+						   &pdata->regs[i].attr);
+		kfree(pdata);
+	}
+
+	return 0;
+}
+
+static struct spi_driver pcf2123_driver = {
+	.driver	= {
+			.name	= "rtc-pcf2123",
+			.bus	= &spi_bus_type,
+			.owner	= THIS_MODULE,
+	},
+	.probe	= pcf2123_probe,
+	.remove	= __devexit_p(pcf2123_remove),
+};
+
+static int __init pcf2123_init(void)
+{
+	return spi_register_driver(&pcf2123_driver);
+}
+
+static void __exit pcf2123_exit(void)
+{
+	spi_unregister_driver(&pcf2123_driver);
+}
+
+MODULE_AUTHOR("Chris Verges <chrisv@cyberswitching.com>");
+MODULE_DESCRIPTION("NXP PCF2123 RTC driver");
+MODULE_LICENSE("GPL");
+MODULE_VERSION(DRV_VERSION);
+
+module_init(pcf2123_init);
+module_exit(pcf2123_exit);
diff --git a/drivers/rtc/rtc-r9701.c b/drivers/rtc/rtc-r9701.c
index 42028f2..9beba49c 100644
--- a/drivers/rtc/rtc-r9701.c
+++ b/drivers/rtc/rtc-r9701.c
@@ -174,3 +174,4 @@
 MODULE_DESCRIPTION("r9701 spi RTC driver");
 MODULE_AUTHOR("Magnus Damm <damm@opensource.se>");
 MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:rtc-r9701");
diff --git a/drivers/rtc/rtc-rs5c348.c b/drivers/rtc/rtc-rs5c348.c
index dd1e2bc..2099037 100644
--- a/drivers/rtc/rtc-rs5c348.c
+++ b/drivers/rtc/rtc-rs5c348.c
@@ -251,3 +251,4 @@
 MODULE_DESCRIPTION("Ricoh RS5C348 RTC driver");
 MODULE_LICENSE("GPL");
 MODULE_VERSION(DRV_VERSION);
+MODULE_ALIAS("spi:rtc-rs5c348");
diff --git a/drivers/rtc/rtc-stmp3xxx.c b/drivers/rtc/rtc-stmp3xxx.c
new file mode 100644
index 0000000..d7ce1a5
--- /dev/null
+++ b/drivers/rtc/rtc-stmp3xxx.c
@@ -0,0 +1,304 @@
+/*
+ * Freescale STMP37XX/STMP378X Real Time Clock driver
+ *
+ * Copyright (c) 2007 Sigmatel, Inc.
+ * Peter Hartley, <peter.hartley@sigmatel.com>
+ *
+ * Copyright 2008 Freescale Semiconductor, Inc. All Rights Reserved.
+ * Copyright 2008 Embedded Alley Solutions, Inc All Rights Reserved.
+ */
+
+/*
+ * The code contained herein is licensed under the GNU General Public
+ * License. You may obtain a copy of the GNU General Public License
+ * Version 2 or later at the following locations:
+ *
+ * http://www.opensource.org/licenses/gpl-license.html
+ * http://www.gnu.org/copyleft/gpl.html
+ */
+#include <linux/kernel.h>
+#include <linux/module.h>
+#include <linux/init.h>
+#include <linux/platform_device.h>
+#include <linux/interrupt.h>
+#include <linux/rtc.h>
+
+#include <mach/platform.h>
+#include <mach/stmp3xxx.h>
+#include <mach/regs-rtc.h>
+
+struct stmp3xxx_rtc_data {
+	struct rtc_device *rtc;
+	unsigned irq_count;
+	void __iomem *io;
+	int irq_alarm, irq_1msec;
+};
+
+static void stmp3xxx_wait_time(struct stmp3xxx_rtc_data *rtc_data)
+{
+	/*
+	 * The datasheet doesn't say which way round the
+	 * NEW_REGS/STALE_REGS bitfields go. In fact it's 0x1=P0,
+	 * 0x2=P1, .., 0x20=P5, 0x40=ALARM, 0x80=SECONDS
+	 */
+	while (__raw_readl(rtc_data->io + HW_RTC_STAT) &
+			BF(0x80, RTC_STAT_STALE_REGS))
+		cpu_relax();
+}
+
+/* Time read/write */
+static int stmp3xxx_rtc_gettime(struct device *dev, struct rtc_time *rtc_tm)
+{
+	struct stmp3xxx_rtc_data *rtc_data = dev_get_drvdata(dev);
+
+	stmp3xxx_wait_time(rtc_data);
+	rtc_time_to_tm(__raw_readl(rtc_data->io + HW_RTC_SECONDS), rtc_tm);
+	return 0;
+}
+
+static int stmp3xxx_rtc_set_mmss(struct device *dev, unsigned long t)
+{
+	struct stmp3xxx_rtc_data *rtc_data = dev_get_drvdata(dev);
+
+	__raw_writel(t, rtc_data->io + HW_RTC_SECONDS);
+	stmp3xxx_wait_time(rtc_data);
+	return 0;
+}
+
+/* interrupt(s) handler */
+static irqreturn_t stmp3xxx_rtc_interrupt(int irq, void *dev_id)
+{
+	struct stmp3xxx_rtc_data *rtc_data = dev_get_drvdata(dev_id);
+	u32 status;
+	u32 events = 0;
+
+	status = __raw_readl(rtc_data->io + HW_RTC_CTRL) &
+			(BM_RTC_CTRL_ALARM_IRQ | BM_RTC_CTRL_ONEMSEC_IRQ);
+
+	if (status & BM_RTC_CTRL_ALARM_IRQ) {
+		stmp3xxx_clearl(BM_RTC_CTRL_ALARM_IRQ,
+				rtc_data->io + HW_RTC_CTRL);
+		events |= RTC_AF | RTC_IRQF;
+	}
+
+	if (status & BM_RTC_CTRL_ONEMSEC_IRQ) {
+		stmp3xxx_clearl(BM_RTC_CTRL_ONEMSEC_IRQ,
+				rtc_data->io + HW_RTC_CTRL);
+		if (++rtc_data->irq_count % 1000 == 0) {
+			events |= RTC_UF | RTC_IRQF;
+			rtc_data->irq_count = 0;
+		}
+	}
+
+	if (events)
+		rtc_update_irq(rtc_data->rtc, 1, events);
+
+	return IRQ_HANDLED;
+}
+
+static int stmp3xxx_alarm_irq_enable(struct device *dev, unsigned int enabled)
+{
+	struct stmp3xxx_rtc_data *rtc_data = dev_get_drvdata(dev);
+	void __iomem *p = rtc_data->io + HW_RTC_PERSISTENT0,
+		     *ctl = rtc_data->io + HW_RTC_CTRL;
+
+	if (enabled) {
+		stmp3xxx_setl(BM_RTC_PERSISTENT0_ALARM_EN |
+			      BM_RTC_PERSISTENT0_ALARM_WAKE_EN, p);
+		stmp3xxx_setl(BM_RTC_CTRL_ALARM_IRQ_EN, ctl);
+	} else {
+		stmp3xxx_clearl(BM_RTC_PERSISTENT0_ALARM_EN |
+			      BM_RTC_PERSISTENT0_ALARM_WAKE_EN, p);
+		stmp3xxx_clearl(BM_RTC_CTRL_ALARM_IRQ_EN, ctl);
+	}
+	return 0;
+}
+
+static int stmp3xxx_update_irq_enable(struct device *dev, unsigned int enabled)
+{
+	struct stmp3xxx_rtc_data *rtc_data = dev_get_drvdata(dev);
+
+	if (enabled)
+		stmp3xxx_setl(BM_RTC_CTRL_ONEMSEC_IRQ_EN,
+				rtc_data->io + HW_RTC_CTRL);
+	else
+		stmp3xxx_clearl(BM_RTC_CTRL_ONEMSEC_IRQ_EN,
+				rtc_data->io + HW_RTC_CTRL);
+	return 0;
+}
+
+static int stmp3xxx_rtc_read_alarm(struct device *dev, struct rtc_wkalrm *alm)
+{
+	struct stmp3xxx_rtc_data *rtc_data = dev_get_drvdata(dev);
+
+	rtc_time_to_tm(__raw_readl(rtc_data->io + HW_RTC_ALARM), &alm->time);
+	return 0;
+}
+
+static int stmp3xxx_rtc_set_alarm(struct device *dev, struct rtc_wkalrm *alm)
+{
+	unsigned long t;
+	struct stmp3xxx_rtc_data *rtc_data = dev_get_drvdata(dev);
+
+	rtc_tm_to_time(&alm->time, &t);
+	__raw_writel(t, rtc_data->io + HW_RTC_ALARM);
+	return 0;
+}
+
+static struct rtc_class_ops stmp3xxx_rtc_ops = {
+	.alarm_irq_enable =
+			  stmp3xxx_alarm_irq_enable,
+	.update_irq_enable =
+			  stmp3xxx_update_irq_enable,
+	.read_time	= stmp3xxx_rtc_gettime,
+	.set_mmss	= stmp3xxx_rtc_set_mmss,
+	.read_alarm	= stmp3xxx_rtc_read_alarm,
+	.set_alarm	= stmp3xxx_rtc_set_alarm,
+};
+
+static int stmp3xxx_rtc_remove(struct platform_device *pdev)
+{
+	struct stmp3xxx_rtc_data *rtc_data = platform_get_drvdata(pdev);
+
+	if (!rtc_data)
+		return 0;
+
+	stmp3xxx_clearl(BM_RTC_CTRL_ONEMSEC_IRQ_EN | BM_RTC_CTRL_ALARM_IRQ_EN,
+			rtc_data->io + HW_RTC_CTRL);
+	free_irq(rtc_data->irq_alarm, &pdev->dev);
+	free_irq(rtc_data->irq_1msec, &pdev->dev);
+	rtc_device_unregister(rtc_data->rtc);
+	iounmap(rtc_data->io);
+	kfree(rtc_data);
+
+	return 0;
+}
+
+static int stmp3xxx_rtc_probe(struct platform_device *pdev)
+{
+	struct stmp3xxx_rtc_data *rtc_data;
+	struct resource *r;
+	int err;
+
+	rtc_data = kzalloc(sizeof *rtc_data, GFP_KERNEL);
+	if (!rtc_data)
+		return -ENOMEM;
+
+	r = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+	if (!r) {
+		dev_err(&pdev->dev, "failed to get resource\n");
+		err = -ENXIO;
+		goto out_free;
+	}
+
+	rtc_data->io = ioremap(r->start, resource_size(r));
+	if (!rtc_data->io) {
+		dev_err(&pdev->dev, "ioremap failed\n");
+		err = -EIO;
+		goto out_free;
+	}
+
+	rtc_data->irq_alarm = platform_get_irq(pdev, 0);
+	rtc_data->irq_1msec = platform_get_irq(pdev, 1);
+
+	if (!(__raw_readl(HW_RTC_STAT + rtc_data->io) &
+			BM_RTC_STAT_RTC_PRESENT)) {
+		dev_err(&pdev->dev, "no device onboard\n");
+		err = -ENODEV;
+		goto out_remap;
+	}
+
+	stmp3xxx_reset_block(rtc_data->io, true);
+	stmp3xxx_clearl(BM_RTC_PERSISTENT0_ALARM_EN |
+			BM_RTC_PERSISTENT0_ALARM_WAKE_EN |
+			BM_RTC_PERSISTENT0_ALARM_WAKE,
+			rtc_data->io + HW_RTC_PERSISTENT0);
+	rtc_data->rtc = rtc_device_register(pdev->name, &pdev->dev,
+				&stmp3xxx_rtc_ops, THIS_MODULE);
+	if (IS_ERR(rtc_data->rtc)) {
+		err = PTR_ERR(rtc_data->rtc);
+		goto out_remap;
+	}
+
+	rtc_data->irq_count = 0;
+	err = request_irq(rtc_data->irq_alarm, stmp3xxx_rtc_interrupt,
+			IRQF_DISABLED, "RTC alarm", &pdev->dev);
+	if (err) {
+		dev_err(&pdev->dev, "Cannot claim IRQ%d\n",
+			rtc_data->irq_alarm);
+		goto out_irq_alarm;
+	}
+	err = request_irq(rtc_data->irq_1msec, stmp3xxx_rtc_interrupt,
+			IRQF_DISABLED, "RTC tick", &pdev->dev);
+	if (err) {
+		dev_err(&pdev->dev, "Cannot claim IRQ%d\n",
+			rtc_data->irq_1msec);
+		goto out_irq1;
+	}
+
+	platform_set_drvdata(pdev, rtc_data);
+
+	return 0;
+
+out_irq1:
+	free_irq(rtc_data->irq_alarm, &pdev->dev);
+out_irq_alarm:
+	stmp3xxx_clearl(BM_RTC_CTRL_ONEMSEC_IRQ_EN | BM_RTC_CTRL_ALARM_IRQ_EN,
+			rtc_data->io + HW_RTC_CTRL);
+	rtc_device_unregister(rtc_data->rtc);
+out_remap:
+	iounmap(rtc_data->io);
+out_free:
+	kfree(rtc_data);
+	return err;
+}
+
+#ifdef CONFIG_PM
+static int stmp3xxx_rtc_suspend(struct platform_device *dev, pm_message_t state)
+{
+	return 0;
+}
+
+static int stmp3xxx_rtc_resume(struct platform_device *dev)
+{
+	struct stmp3xxx_rtc_data *rtc_data = platform_get_drvdata(dev);
+
+	stmp3xxx_reset_block(rtc_data->io, true);
+	stmp3xxx_clearl(BM_RTC_PERSISTENT0_ALARM_EN |
+			BM_RTC_PERSISTENT0_ALARM_WAKE_EN |
+			BM_RTC_PERSISTENT0_ALARM_WAKE,
+			rtc_data->io + HW_RTC_PERSISTENT0);
+	return 0;
+}
+#else
+#define stmp3xxx_rtc_suspend	NULL
+#define stmp3xxx_rtc_resume	NULL
+#endif
+
+static struct platform_driver stmp3xxx_rtcdrv = {
+	.probe		= stmp3xxx_rtc_probe,
+	.remove		= stmp3xxx_rtc_remove,
+	.suspend	= stmp3xxx_rtc_suspend,
+	.resume		= stmp3xxx_rtc_resume,
+	.driver		= {
+		.name	= "stmp3xxx-rtc",
+		.owner	= THIS_MODULE,
+	},
+};
+
+static int __init stmp3xxx_rtc_init(void)
+{
+	return platform_driver_register(&stmp3xxx_rtcdrv);
+}
+
+static void __exit stmp3xxx_rtc_exit(void)
+{
+	platform_driver_unregister(&stmp3xxx_rtcdrv);
+}
+
+module_init(stmp3xxx_rtc_init);
+module_exit(stmp3xxx_rtc_exit);
+
+MODULE_DESCRIPTION("STMP3xxx RTC Driver");
+MODULE_AUTHOR("dmitry pervushin <dpervushin@embeddedalley.com>");
+MODULE_LICENSE("GPL");
diff --git a/drivers/rtc/rtc-sysfs.c b/drivers/rtc/rtc-sysfs.c
index 2531ce4..7dd23a6f 100644
--- a/drivers/rtc/rtc-sysfs.c
+++ b/drivers/rtc/rtc-sysfs.c
@@ -102,6 +102,19 @@
 	return n;
 }
 
+static ssize_t
+rtc_sysfs_show_hctosys(struct device *dev, struct device_attribute *attr,
+		char *buf)
+{
+#ifdef CONFIG_RTC_HCTOSYS_DEVICE
+	if (strcmp(dev_name(&to_rtc_device(dev)->dev),
+		   CONFIG_RTC_HCTOSYS_DEVICE) == 0)
+		return sprintf(buf, "1\n");
+	else
+#endif
+		return sprintf(buf, "0\n");
+}
+
 static struct device_attribute rtc_attrs[] = {
 	__ATTR(name, S_IRUGO, rtc_sysfs_show_name, NULL),
 	__ATTR(date, S_IRUGO, rtc_sysfs_show_date, NULL),
@@ -109,6 +122,7 @@
 	__ATTR(since_epoch, S_IRUGO, rtc_sysfs_show_since_epoch, NULL),
 	__ATTR(max_user_freq, S_IRUGO | S_IWUSR, rtc_sysfs_show_max_user_freq,
 			rtc_sysfs_set_max_user_freq),
+	__ATTR(hctosys, S_IRUGO, rtc_sysfs_show_hctosys, NULL),
 	{ },
 };
 
diff --git a/drivers/scsi/sg.c b/drivers/scsi/sg.c
index 4968c4c..848b594 100644
--- a/drivers/scsi/sg.c
+++ b/drivers/scsi/sg.c
@@ -2233,7 +2233,7 @@
 	.open = sg_proc_open_dev,
 	.release = seq_release,
 };
-static struct seq_operations dev_seq_ops = {
+static const struct seq_operations dev_seq_ops = {
 	.start = dev_seq_start,
 	.next  = dev_seq_next,
 	.stop  = dev_seq_stop,
@@ -2246,7 +2246,7 @@
 	.open = sg_proc_open_devstrs,
 	.release = seq_release,
 };
-static struct seq_operations devstrs_seq_ops = {
+static const struct seq_operations devstrs_seq_ops = {
 	.start = dev_seq_start,
 	.next  = dev_seq_next,
 	.stop  = dev_seq_stop,
@@ -2259,7 +2259,7 @@
 	.open = sg_proc_open_debug,
 	.release = seq_release,
 };
-static struct seq_operations debug_seq_ops = {
+static const struct seq_operations debug_seq_ops = {
 	.start = dev_seq_start,
 	.next  = dev_seq_next,
 	.stop  = dev_seq_stop,
diff --git a/drivers/serial/max3100.c b/drivers/serial/max3100.c
index 75ab006..3c30c56 100644
--- a/drivers/serial/max3100.c
+++ b/drivers/serial/max3100.c
@@ -925,3 +925,4 @@
 MODULE_DESCRIPTION("MAX3100 driver");
 MODULE_AUTHOR("Christian Pellegrin <chripell@evolware.org>");
 MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:max3100");
diff --git a/drivers/spi/Kconfig b/drivers/spi/Kconfig
index 2c733c2..4b6f7cb 100644
--- a/drivers/spi/Kconfig
+++ b/drivers/spi/Kconfig
@@ -117,10 +117,11 @@
 	  speed with a custom version of this driver; see the source code.
 
 config SPI_IMX
-	tristate "Freescale iMX SPI controller"
-	depends on ARCH_MX1 && EXPERIMENTAL
+	tristate "Freescale i.MX SPI controllers"
+	depends on ARCH_MXC
+	select SPI_BITBANG
 	help
-	  This enables using the Freescale iMX SPI controller in master
+	  This enables using the Freescale i.MX SPI controllers in master
 	  mode.
 
 config SPI_LM70_LLP
@@ -173,11 +174,21 @@
 	tristate "ARM AMBA PL022 SSP controller (EXPERIMENTAL)"
 	depends on ARM_AMBA && EXPERIMENTAL
 	default y if MACH_U300
+	default y if ARCH_REALVIEW
+	default y if INTEGRATOR_IMPD1
+	default y if ARCH_VERSATILE
 	help
 	  This selects the ARM(R) AMBA(R) PrimeCell PL022 SSP
 	  controller. If you have an embedded system with an AMBA(R)
 	  bus and a PL022 controller, say Y or M here.
 
+config SPI_PPC4xx
+	tristate "PPC4xx SPI Controller"
+	depends on PPC32 && 4xx && SPI_MASTER
+	select SPI_BITBANG
+	help
+	  This selects a driver for the PPC4xx SPI Controller.
+
 config SPI_PXA2XX
 	tristate "PXA2xx SSP SPI master"
 	depends on ARCH_PXA && EXPERIMENTAL
@@ -211,6 +222,12 @@
 	help
 	  SPI driver for SuperH SCI blocks.
 
+config SPI_STMP3XXX
+	tristate "Freescale STMP37xx/378x SPI/SSP controller"
+	depends on ARCH_STMP3XXX && SPI_MASTER
+	help
+	  SPI driver for Freescale STMP37xx/378x SoC SSP interface
+
 config SPI_TXX9
 	tristate "Toshiba TXx9 SPI controller"
 	depends on GENERIC_GPIO && CPU_TX49XX
diff --git a/drivers/spi/Makefile b/drivers/spi/Makefile
index 3de408d..6d7a3f8 100644
--- a/drivers/spi/Makefile
+++ b/drivers/spi/Makefile
@@ -17,7 +17,7 @@
 obj-$(CONFIG_SPI_AU1550)		+= au1550_spi.o
 obj-$(CONFIG_SPI_BUTTERFLY)		+= spi_butterfly.o
 obj-$(CONFIG_SPI_GPIO)			+= spi_gpio.o
-obj-$(CONFIG_SPI_IMX)			+= spi_imx.o
+obj-$(CONFIG_SPI_IMX)			+= mxc_spi.o
 obj-$(CONFIG_SPI_LM70_LLP)		+= spi_lm70llp.o
 obj-$(CONFIG_SPI_PXA2XX)		+= pxa2xx_spi.o
 obj-$(CONFIG_SPI_OMAP_UWIRE)		+= omap_uwire.o
@@ -26,11 +26,13 @@
 obj-$(CONFIG_SPI_PL022)			+= amba-pl022.o
 obj-$(CONFIG_SPI_MPC52xx_PSC)		+= mpc52xx_psc_spi.o
 obj-$(CONFIG_SPI_MPC8xxx)		+= spi_mpc8xxx.o
+obj-$(CONFIG_SPI_PPC4xx)		+= spi_ppc4xx.o
 obj-$(CONFIG_SPI_S3C24XX_GPIO)		+= spi_s3c24xx_gpio.o
 obj-$(CONFIG_SPI_S3C24XX)		+= spi_s3c24xx.o
 obj-$(CONFIG_SPI_TXX9)			+= spi_txx9.o
 obj-$(CONFIG_SPI_XILINX)		+= xilinx_spi.o
 obj-$(CONFIG_SPI_SH_SCI)		+= spi_sh_sci.o
+obj-$(CONFIG_SPI_STMP3XXX)		+= spi_stmp.o
 # 	... add above this line ...
 
 # SPI protocol drivers (device/link on bus)
diff --git a/drivers/spi/mxc_spi.c b/drivers/spi/mxc_spi.c
new file mode 100644
index 0000000..b144723
--- /dev/null
+++ b/drivers/spi/mxc_spi.c
@@ -0,0 +1,685 @@
+/*
+ * Copyright 2004-2007 Freescale Semiconductor, Inc. All Rights Reserved.
+ * Copyright (C) 2008 Juergen Beisert
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License
+ * as published by the Free Software Foundation; either version 2
+ * of the License, or (at your option) any later version.
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the
+ * Free Software Foundation
+ * 51 Franklin Street, Fifth Floor
+ * Boston, MA  02110-1301, USA.
+ */
+
+#include <linux/clk.h>
+#include <linux/completion.h>
+#include <linux/delay.h>
+#include <linux/err.h>
+#include <linux/gpio.h>
+#include <linux/init.h>
+#include <linux/interrupt.h>
+#include <linux/io.h>
+#include <linux/irq.h>
+#include <linux/kernel.h>
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/spi/spi.h>
+#include <linux/spi/spi_bitbang.h>
+#include <linux/types.h>
+
+#include <mach/spi.h>
+
+#define DRIVER_NAME "spi_imx"
+
+#define MXC_CSPIRXDATA		0x00
+#define MXC_CSPITXDATA		0x04
+#define MXC_CSPICTRL		0x08
+#define MXC_CSPIINT		0x0c
+#define MXC_RESET		0x1c
+
+/* generic defines to abstract from the different register layouts */
+#define MXC_INT_RR	(1 << 0) /* Receive data ready interrupt */
+#define MXC_INT_TE	(1 << 1) /* Transmit FIFO empty interrupt */
+
+struct mxc_spi_config {
+	unsigned int speed_hz;
+	unsigned int bpw;
+	unsigned int mode;
+	int cs;
+};
+
+struct mxc_spi_data {
+	struct spi_bitbang bitbang;
+
+	struct completion xfer_done;
+	void *base;
+	int irq;
+	struct clk *clk;
+	unsigned long spi_clk;
+	int *chipselect;
+
+	unsigned int count;
+	void (*tx)(struct mxc_spi_data *);
+	void (*rx)(struct mxc_spi_data *);
+	void *rx_buf;
+	const void *tx_buf;
+	unsigned int txfifo; /* number of words pushed in tx FIFO */
+
+	/* SoC specific functions */
+	void (*intctrl)(struct mxc_spi_data *, int);
+	int (*config)(struct mxc_spi_data *, struct mxc_spi_config *);
+	void (*trigger)(struct mxc_spi_data *);
+	int (*rx_available)(struct mxc_spi_data *);
+};
+
+#define MXC_SPI_BUF_RX(type)						\
+static void mxc_spi_buf_rx_##type(struct mxc_spi_data *mxc_spi)		\
+{									\
+	unsigned int val = readl(mxc_spi->base + MXC_CSPIRXDATA);	\
+									\
+	if (mxc_spi->rx_buf) {						\
+		*(type *)mxc_spi->rx_buf = val;				\
+		mxc_spi->rx_buf += sizeof(type);			\
+	}								\
+}
+
+#define MXC_SPI_BUF_TX(type)						\
+static void mxc_spi_buf_tx_##type(struct mxc_spi_data *mxc_spi)		\
+{									\
+	type val = 0;							\
+									\
+	if (mxc_spi->tx_buf) {						\
+		val = *(type *)mxc_spi->tx_buf;				\
+		mxc_spi->tx_buf += sizeof(type);			\
+	}								\
+									\
+	mxc_spi->count -= sizeof(type);					\
+									\
+	writel(val, mxc_spi->base + MXC_CSPITXDATA);			\
+}
+
+MXC_SPI_BUF_RX(u8)
+MXC_SPI_BUF_TX(u8)
+MXC_SPI_BUF_RX(u16)
+MXC_SPI_BUF_TX(u16)
+MXC_SPI_BUF_RX(u32)
+MXC_SPI_BUF_TX(u32)
+
+/* First entry is reserved, second entry is valid only if SDHC_SPIEN is set
+ * (which is currently not the case in this driver)
+ */
+static int mxc_clkdivs[] = {0, 3, 4, 6, 8, 12, 16, 24, 32, 48, 64, 96, 128, 192,
+	256, 384, 512, 768, 1024};
+
+/* MX21, MX27 */
+static unsigned int mxc_spi_clkdiv_1(unsigned int fin,
+		unsigned int fspi)
+{
+	int i, max;
+
+	if (cpu_is_mx21())
+		max = 18;
+	else
+		max = 16;
+
+	for (i = 2; i < max; i++)
+		if (fspi * mxc_clkdivs[i] >= fin)
+			return i;
+
+	return max;
+}
+
+/* MX1, MX31, MX35 */
+static unsigned int mxc_spi_clkdiv_2(unsigned int fin,
+		unsigned int fspi)
+{
+	int i, div = 4;
+
+	for (i = 0; i < 7; i++) {
+		if (fspi * div >= fin)
+			return i;
+		div <<= 1;
+	}
+
+	return 7;
+}
+
+#define MX31_INTREG_TEEN	(1 << 0)
+#define MX31_INTREG_RREN	(1 << 3)
+
+#define MX31_CSPICTRL_ENABLE	(1 << 0)
+#define MX31_CSPICTRL_MASTER	(1 << 1)
+#define MX31_CSPICTRL_XCH	(1 << 2)
+#define MX31_CSPICTRL_POL	(1 << 4)
+#define MX31_CSPICTRL_PHA	(1 << 5)
+#define MX31_CSPICTRL_SSCTL	(1 << 6)
+#define MX31_CSPICTRL_SSPOL	(1 << 7)
+#define MX31_CSPICTRL_BC_SHIFT	8
+#define MX35_CSPICTRL_BL_SHIFT	20
+#define MX31_CSPICTRL_CS_SHIFT	24
+#define MX35_CSPICTRL_CS_SHIFT	12
+#define MX31_CSPICTRL_DR_SHIFT	16
+
+#define MX31_CSPISTATUS		0x14
+#define MX31_STATUS_RR		(1 << 3)
+
+/* These functions also work for the i.MX35, but be aware that
+ * the i.MX35 has a slightly different register layout for bits
+ * we do not use here.
+ */
+static void mx31_intctrl(struct mxc_spi_data *mxc_spi, int enable)
+{
+	unsigned int val = 0;
+
+	if (enable & MXC_INT_TE)
+		val |= MX31_INTREG_TEEN;
+	if (enable & MXC_INT_RR)
+		val |= MX31_INTREG_RREN;
+
+	writel(val, mxc_spi->base + MXC_CSPIINT);
+}
+
+static void mx31_trigger(struct mxc_spi_data *mxc_spi)
+{
+	unsigned int reg;
+
+	reg = readl(mxc_spi->base + MXC_CSPICTRL);
+	reg |= MX31_CSPICTRL_XCH;
+	writel(reg, mxc_spi->base + MXC_CSPICTRL);
+}
+
+static int mx31_config(struct mxc_spi_data *mxc_spi,
+		struct mxc_spi_config *config)
+{
+	unsigned int reg = MX31_CSPICTRL_ENABLE | MX31_CSPICTRL_MASTER;
+
+	reg |= mxc_spi_clkdiv_2(mxc_spi->spi_clk, config->speed_hz) <<
+		MX31_CSPICTRL_DR_SHIFT;
+
+	if (cpu_is_mx31())
+		reg |= (config->bpw - 1) << MX31_CSPICTRL_BC_SHIFT;
+	else if (cpu_is_mx35()) {
+		reg |= (config->bpw - 1) << MX35_CSPICTRL_BL_SHIFT;
+		reg |= MX31_CSPICTRL_SSCTL;
+	}
+
+	if (config->mode & SPI_CPHA)
+		reg |= MX31_CSPICTRL_PHA;
+	if (config->mode & SPI_CPOL)
+		reg |= MX31_CSPICTRL_POL;
+	if (config->mode & SPI_CS_HIGH)
+		reg |= MX31_CSPICTRL_SSPOL;
+	if (config->cs < 0) {
+		if (cpu_is_mx31())
+			reg |= (config->cs + 32) << MX31_CSPICTRL_CS_SHIFT;
+		else if (cpu_is_mx35())
+			reg |= (config->cs + 32) << MX35_CSPICTRL_CS_SHIFT;
+	}
+
+	writel(reg, mxc_spi->base + MXC_CSPICTRL);
+
+	return 0;
+}
+
+static int mx31_rx_available(struct mxc_spi_data *mxc_spi)
+{
+	return readl(mxc_spi->base + MX31_CSPISTATUS) & MX31_STATUS_RR;
+}
+
+#define MX27_INTREG_RR		(1 << 4)
+#define MX27_INTREG_TEEN	(1 << 9)
+#define MX27_INTREG_RREN	(1 << 13)
+
+#define MX27_CSPICTRL_POL	(1 << 5)
+#define MX27_CSPICTRL_PHA	(1 << 6)
+#define MX27_CSPICTRL_SSPOL	(1 << 8)
+#define MX27_CSPICTRL_XCH	(1 << 9)
+#define MX27_CSPICTRL_ENABLE	(1 << 10)
+#define MX27_CSPICTRL_MASTER	(1 << 11)
+#define MX27_CSPICTRL_DR_SHIFT	14
+#define MX27_CSPICTRL_CS_SHIFT	19
+
+static void mx27_intctrl(struct mxc_spi_data *mxc_spi, int enable)
+{
+	unsigned int val = 0;
+
+	if (enable & MXC_INT_TE)
+		val |= MX27_INTREG_TEEN;
+	if (enable & MXC_INT_RR)
+		val |= MX27_INTREG_RREN;
+
+	writel(val, mxc_spi->base + MXC_CSPIINT);
+}
+
+static void mx27_trigger(struct mxc_spi_data *mxc_spi)
+{
+	unsigned int reg;
+
+	reg = readl(mxc_spi->base + MXC_CSPICTRL);
+	reg |= MX27_CSPICTRL_XCH;
+	writel(reg, mxc_spi->base + MXC_CSPICTRL);
+}
+
+static int mx27_config(struct mxc_spi_data *mxc_spi,
+		struct mxc_spi_config *config)
+{
+	unsigned int reg = MX27_CSPICTRL_ENABLE | MX27_CSPICTRL_MASTER;
+
+	reg |= mxc_spi_clkdiv_1(mxc_spi->spi_clk, config->speed_hz) <<
+		MX27_CSPICTRL_DR_SHIFT;
+	reg |= config->bpw - 1;
+
+	if (config->mode & SPI_CPHA)
+		reg |= MX27_CSPICTRL_PHA;
+	if (config->mode & SPI_CPOL)
+		reg |= MX27_CSPICTRL_POL;
+	if (config->mode & SPI_CS_HIGH)
+		reg |= MX27_CSPICTRL_SSPOL;
+	if (config->cs < 0)
+		reg |= (config->cs + 32) << MX27_CSPICTRL_CS_SHIFT;
+
+	writel(reg, mxc_spi->base + MXC_CSPICTRL);
+
+	return 0;
+}
+
+static int mx27_rx_available(struct mxc_spi_data *mxc_spi)
+{
+	return readl(mxc_spi->base + MXC_CSPIINT) & MX27_INTREG_RR;
+}
+
+#define MX1_INTREG_RR		(1 << 3)
+#define MX1_INTREG_TEEN		(1 << 8)
+#define MX1_INTREG_RREN		(1 << 11)
+
+#define MX1_CSPICTRL_POL	(1 << 4)
+#define MX1_CSPICTRL_PHA	(1 << 5)
+#define MX1_CSPICTRL_XCH	(1 << 8)
+#define MX1_CSPICTRL_ENABLE	(1 << 9)
+#define MX1_CSPICTRL_MASTER	(1 << 10)
+#define MX1_CSPICTRL_DR_SHIFT	13
+
+static void mx1_intctrl(struct mxc_spi_data *mxc_spi, int enable)
+{
+	unsigned int val = 0;
+
+	if (enable & MXC_INT_TE)
+		val |= MX1_INTREG_TEEN;
+	if (enable & MXC_INT_RR)
+		val |= MX1_INTREG_RREN;
+
+	writel(val, mxc_spi->base + MXC_CSPIINT);
+}
+
+static void mx1_trigger(struct mxc_spi_data *mxc_spi)
+{
+	unsigned int reg;
+
+	reg = readl(mxc_spi->base + MXC_CSPICTRL);
+	reg |= MX1_CSPICTRL_XCH;
+	writel(reg, mxc_spi->base + MXC_CSPICTRL);
+}
+
+static int mx1_config(struct mxc_spi_data *mxc_spi,
+		struct mxc_spi_config *config)
+{
+	unsigned int reg = MX1_CSPICTRL_ENABLE | MX1_CSPICTRL_MASTER;
+
+	reg |= mxc_spi_clkdiv_2(mxc_spi->spi_clk, config->speed_hz) <<
+		MX1_CSPICTRL_DR_SHIFT;
+	reg |= config->bpw - 1;
+
+	if (config->mode & SPI_CPHA)
+		reg |= MX1_CSPICTRL_PHA;
+	if (config->mode & SPI_CPOL)
+		reg |= MX1_CSPICTRL_POL;
+
+	writel(reg, mxc_spi->base + MXC_CSPICTRL);
+
+	return 0;
+}
+
+static int mx1_rx_available(struct mxc_spi_data *mxc_spi)
+{
+	return readl(mxc_spi->base + MXC_CSPIINT) & MX1_INTREG_RR;
+}
+
+static void mxc_spi_chipselect(struct spi_device *spi, int is_active)
+{
+	struct mxc_spi_data *mxc_spi = spi_master_get_devdata(spi->master);
+	unsigned int cs = 0;
+	int gpio = mxc_spi->chipselect[spi->chip_select];
+	struct mxc_spi_config config;
+
+	if (spi->mode & SPI_CS_HIGH)
+		cs = 1;
+
+	if (is_active == BITBANG_CS_INACTIVE) {
+		if (gpio >= 0)
+			gpio_set_value(gpio, !cs);
+		return;
+	}
+
+	config.bpw = spi->bits_per_word;
+	config.speed_hz = spi->max_speed_hz;
+	config.mode = spi->mode;
+	config.cs = mxc_spi->chipselect[spi->chip_select];
+
+	mxc_spi->config(mxc_spi, &config);
+
+	/* Initialize the functions for transfer */
+	if (config.bpw <= 8) {
+		mxc_spi->rx = mxc_spi_buf_rx_u8;
+		mxc_spi->tx = mxc_spi_buf_tx_u8;
+	} else if (config.bpw <= 16) {
+		mxc_spi->rx = mxc_spi_buf_rx_u16;
+		mxc_spi->tx = mxc_spi_buf_tx_u16;
+	} else if (config.bpw <= 32) {
+		mxc_spi->rx = mxc_spi_buf_rx_u32;
+		mxc_spi->tx = mxc_spi_buf_tx_u32;
+	} else
+		BUG();
+
+	if (gpio >= 0)
+		gpio_set_value(gpio, cs);
+
+	return;
+}
+
+static void mxc_spi_push(struct mxc_spi_data *mxc_spi)
+{
+	while (mxc_spi->txfifo < 8) {
+		if (!mxc_spi->count)
+			break;
+		mxc_spi->tx(mxc_spi);
+		mxc_spi->txfifo++;
+	}
+
+	mxc_spi->trigger(mxc_spi);
+}
+
+static irqreturn_t mxc_spi_isr(int irq, void *dev_id)
+{
+	struct mxc_spi_data *mxc_spi = dev_id;
+
+	while (mxc_spi->rx_available(mxc_spi)) {
+		mxc_spi->rx(mxc_spi);
+		mxc_spi->txfifo--;
+	}
+
+	if (mxc_spi->count) {
+		mxc_spi_push(mxc_spi);
+		return IRQ_HANDLED;
+	}
+
+	if (mxc_spi->txfifo) {
+		/* No data left to push, but still waiting for rx data,
+		 * enable receive data available interrupt.
+		 */
+		mxc_spi->intctrl(mxc_spi, MXC_INT_RR);
+		return IRQ_HANDLED;
+	}
+
+	mxc_spi->intctrl(mxc_spi, 0);
+	complete(&mxc_spi->xfer_done);
+
+	return IRQ_HANDLED;
+}
+
+static int mxc_spi_setupxfer(struct spi_device *spi,
+				 struct spi_transfer *t)
+{
+	struct mxc_spi_data *mxc_spi = spi_master_get_devdata(spi->master);
+	struct mxc_spi_config config;
+
+	config.bpw = t ? t->bits_per_word : spi->bits_per_word;
+	config.speed_hz  = t ? t->speed_hz : spi->max_speed_hz;
+	config.mode = spi->mode;
+
+	mxc_spi->config(mxc_spi, &config);
+
+	return 0;
+}
+
+static int mxc_spi_transfer(struct spi_device *spi,
+				struct spi_transfer *transfer)
+{
+	struct mxc_spi_data *mxc_spi = spi_master_get_devdata(spi->master);
+
+	mxc_spi->tx_buf = transfer->tx_buf;
+	mxc_spi->rx_buf = transfer->rx_buf;
+	mxc_spi->count = transfer->len;
+	mxc_spi->txfifo = 0;
+
+	init_completion(&mxc_spi->xfer_done);
+
+	mxc_spi_push(mxc_spi);
+
+	mxc_spi->intctrl(mxc_spi, MXC_INT_TE);
+
+	wait_for_completion(&mxc_spi->xfer_done);
+
+	return transfer->len;
+}
+
+static int mxc_spi_setup(struct spi_device *spi)
+{
+	if (!spi->bits_per_word)
+		spi->bits_per_word = 8;
+
+	pr_debug("%s: mode %d, %u bpw, %d hz\n", __func__,
+		 spi->mode, spi->bits_per_word, spi->max_speed_hz);
+
+	mxc_spi_chipselect(spi, BITBANG_CS_INACTIVE);
+
+	return 0;
+}
+
+static void mxc_spi_cleanup(struct spi_device *spi)
+{
+}
+
+static int __init mxc_spi_probe(struct platform_device *pdev)
+{
+	struct spi_imx_master *mxc_platform_info;
+	struct spi_master *master;
+	struct mxc_spi_data *mxc_spi;
+	struct resource *res;
+	int i, ret;
+
+	mxc_platform_info = (struct spi_imx_master *)pdev->dev.platform_data;
+	if (!mxc_platform_info) {
+		dev_err(&pdev->dev, "can't get the platform data\n");
+		return -EINVAL;
+	}
+
+	master = spi_alloc_master(&pdev->dev, sizeof(struct mxc_spi_data));
+	if (!master)
+		return -ENOMEM;
+
+	platform_set_drvdata(pdev, master);
+
+	master->bus_num = pdev->id;
+	master->num_chipselect = mxc_platform_info->num_chipselect;
+
+	mxc_spi = spi_master_get_devdata(master);
+	mxc_spi->bitbang.master = spi_master_get(master);
+	mxc_spi->chipselect = mxc_platform_info->chipselect;
+
+	for (i = 0; i < master->num_chipselect; i++) {
+		if (mxc_spi->chipselect[i] < 0)
+			continue;
+		ret = gpio_request(mxc_spi->chipselect[i], DRIVER_NAME);
+		if (ret) {
+			i--;
+			while (i > 0)
+				if (mxc_spi->chipselect[i] >= 0)
+					gpio_free(mxc_spi->chipselect[i--]);
+			dev_err(&pdev->dev, "can't get cs gpios");
+			goto out_master_put;
+		}
+		gpio_direction_output(mxc_spi->chipselect[i], 1);
+	}
+
+	mxc_spi->bitbang.chipselect = mxc_spi_chipselect;
+	mxc_spi->bitbang.setup_transfer = mxc_spi_setupxfer;
+	mxc_spi->bitbang.txrx_bufs = mxc_spi_transfer;
+	mxc_spi->bitbang.master->setup = mxc_spi_setup;
+	mxc_spi->bitbang.master->cleanup = mxc_spi_cleanup;
+
+	init_completion(&mxc_spi->xfer_done);
+
+	res = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+	if (!res) {
+		dev_err(&pdev->dev, "can't get platform resource\n");
+		ret = -ENOMEM;
+		goto out_gpio_free;
+	}
+
+	if (!request_mem_region(res->start, resource_size(res), pdev->name)) {
+		dev_err(&pdev->dev, "request_mem_region failed\n");
+		ret = -EBUSY;
+		goto out_gpio_free;
+	}
+
+	mxc_spi->base = ioremap(res->start, resource_size(res));
+	if (!mxc_spi->base) {
+		ret = -EINVAL;
+		goto out_release_mem;
+	}
+
+	mxc_spi->irq = platform_get_irq(pdev, 0);
+	if (!mxc_spi->irq) {
+		ret = -EINVAL;
+		goto out_iounmap;
+	}
+
+	ret = request_irq(mxc_spi->irq, mxc_spi_isr, 0, DRIVER_NAME, mxc_spi);
+	if (ret) {
+		dev_err(&pdev->dev, "can't get irq%d: %d\n", mxc_spi->irq, ret);
+		goto out_iounmap;
+	}
+
+	if (cpu_is_mx31() || cpu_is_mx35()) {
+		mxc_spi->intctrl = mx31_intctrl;
+		mxc_spi->config = mx31_config;
+		mxc_spi->trigger = mx31_trigger;
+		mxc_spi->rx_available = mx31_rx_available;
+	} else  if (cpu_is_mx27() || cpu_is_mx21()) {
+		mxc_spi->intctrl = mx27_intctrl;
+		mxc_spi->config = mx27_config;
+		mxc_spi->trigger = mx27_trigger;
+		mxc_spi->rx_available = mx27_rx_available;
+	} else if (cpu_is_mx1()) {
+		mxc_spi->intctrl = mx1_intctrl;
+		mxc_spi->config = mx1_config;
+		mxc_spi->trigger = mx1_trigger;
+		mxc_spi->rx_available = mx1_rx_available;
+	} else
+		BUG();
+
+	mxc_spi->clk = clk_get(&pdev->dev, NULL);
+	if (IS_ERR(mxc_spi->clk)) {
+		dev_err(&pdev->dev, "unable to get clock\n");
+		ret = PTR_ERR(mxc_spi->clk);
+		goto out_free_irq;
+	}
+
+	clk_enable(mxc_spi->clk);
+	mxc_spi->spi_clk = clk_get_rate(mxc_spi->clk);
+
+	if (!cpu_is_mx31() || !cpu_is_mx35())
+		writel(1, mxc_spi->base + MXC_RESET);
+
+	mxc_spi->intctrl(mxc_spi, 0);
+
+	ret = spi_bitbang_start(&mxc_spi->bitbang);
+	if (ret) {
+		dev_err(&pdev->dev, "bitbang start failed with %d\n", ret);
+		goto out_clk_put;
+	}
+
+	dev_info(&pdev->dev, "probed\n");
+
+	return ret;
+
+out_clk_put:
+	clk_disable(mxc_spi->clk);
+	clk_put(mxc_spi->clk);
+out_free_irq:
+	free_irq(mxc_spi->irq, mxc_spi);
+out_iounmap:
+	iounmap(mxc_spi->base);
+out_release_mem:
+	release_mem_region(res->start, resource_size(res));
+out_gpio_free:
+	for (i = 0; i < master->num_chipselect; i++)
+		if (mxc_spi->chipselect[i] >= 0)
+			gpio_free(mxc_spi->chipselect[i]);
+out_master_put:
+	spi_master_put(master);
+	kfree(master);
+	platform_set_drvdata(pdev, NULL);
+	return ret;
+}
+
+static int __exit mxc_spi_remove(struct platform_device *pdev)
+{
+	struct spi_master *master = platform_get_drvdata(pdev);
+	struct resource *res = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+	struct mxc_spi_data *mxc_spi = spi_master_get_devdata(master);
+	int i;
+
+	spi_bitbang_stop(&mxc_spi->bitbang);
+
+	writel(0, mxc_spi->base + MXC_CSPICTRL);
+	clk_disable(mxc_spi->clk);
+	clk_put(mxc_spi->clk);
+	free_irq(mxc_spi->irq, mxc_spi);
+	iounmap(mxc_spi->base);
+
+	for (i = 0; i < master->num_chipselect; i++)
+		if (mxc_spi->chipselect[i] >= 0)
+			gpio_free(mxc_spi->chipselect[i]);
+
+	spi_master_put(master);
+
+	release_mem_region(res->start, resource_size(res));
+
+	platform_set_drvdata(pdev, NULL);
+
+	return 0;
+}
+
+static struct platform_driver mxc_spi_driver = {
+	.driver = {
+		   .name = DRIVER_NAME,
+		   .owner = THIS_MODULE,
+		   },
+	.probe = mxc_spi_probe,
+	.remove = __exit_p(mxc_spi_remove),
+};
+
+static int __init mxc_spi_init(void)
+{
+	return platform_driver_register(&mxc_spi_driver);
+}
+
+static void __exit mxc_spi_exit(void)
+{
+	platform_driver_unregister(&mxc_spi_driver);
+}
+
+module_init(mxc_spi_init);
+module_exit(mxc_spi_exit);
+
+MODULE_DESCRIPTION("SPI Master Controller driver");
+MODULE_AUTHOR("Sascha Hauer, Pengutronix");
+MODULE_LICENSE("GPL");
diff --git a/drivers/spi/omap2_mcspi.c b/drivers/spi/omap2_mcspi.c
index 9b80ad36..ba1a872 100644
--- a/drivers/spi/omap2_mcspi.c
+++ b/drivers/spi/omap2_mcspi.c
@@ -41,6 +41,9 @@
 
 #define OMAP2_MCSPI_MAX_FREQ		48000000
 
+/* OMAP2 has 3 SPI controllers, while OMAP3 has 4 */
+#define OMAP2_MCSPI_MAX_CTRL 		4
+
 #define OMAP2_MCSPI_REVISION		0x00
 #define OMAP2_MCSPI_SYSCONFIG		0x10
 #define OMAP2_MCSPI_SYSSTATUS		0x14
@@ -59,40 +62,40 @@
 
 /* per-register bitmasks: */
 
-#define OMAP2_MCSPI_SYSCONFIG_SMARTIDLE	(2 << 3)
-#define OMAP2_MCSPI_SYSCONFIG_ENAWAKEUP	(1 << 2)
-#define OMAP2_MCSPI_SYSCONFIG_AUTOIDLE	(1 << 0)
-#define OMAP2_MCSPI_SYSCONFIG_SOFTRESET	(1 << 1)
+#define OMAP2_MCSPI_SYSCONFIG_SMARTIDLE	BIT(4)
+#define OMAP2_MCSPI_SYSCONFIG_ENAWAKEUP	BIT(2)
+#define OMAP2_MCSPI_SYSCONFIG_AUTOIDLE	BIT(0)
+#define OMAP2_MCSPI_SYSCONFIG_SOFTRESET	BIT(1)
 
-#define OMAP2_MCSPI_SYSSTATUS_RESETDONE	(1 << 0)
+#define OMAP2_MCSPI_SYSSTATUS_RESETDONE	BIT(0)
 
-#define OMAP2_MCSPI_MODULCTRL_SINGLE	(1 << 0)
-#define OMAP2_MCSPI_MODULCTRL_MS	(1 << 2)
-#define OMAP2_MCSPI_MODULCTRL_STEST	(1 << 3)
+#define OMAP2_MCSPI_MODULCTRL_SINGLE	BIT(0)
+#define OMAP2_MCSPI_MODULCTRL_MS	BIT(2)
+#define OMAP2_MCSPI_MODULCTRL_STEST	BIT(3)
 
-#define OMAP2_MCSPI_CHCONF_PHA		(1 << 0)
-#define OMAP2_MCSPI_CHCONF_POL		(1 << 1)
+#define OMAP2_MCSPI_CHCONF_PHA		BIT(0)
+#define OMAP2_MCSPI_CHCONF_POL		BIT(1)
 #define OMAP2_MCSPI_CHCONF_CLKD_MASK	(0x0f << 2)
-#define OMAP2_MCSPI_CHCONF_EPOL		(1 << 6)
+#define OMAP2_MCSPI_CHCONF_EPOL		BIT(6)
 #define OMAP2_MCSPI_CHCONF_WL_MASK	(0x1f << 7)
-#define OMAP2_MCSPI_CHCONF_TRM_RX_ONLY	(0x01 << 12)
-#define OMAP2_MCSPI_CHCONF_TRM_TX_ONLY	(0x02 << 12)
+#define OMAP2_MCSPI_CHCONF_TRM_RX_ONLY	BIT(12)
+#define OMAP2_MCSPI_CHCONF_TRM_TX_ONLY	BIT(13)
 #define OMAP2_MCSPI_CHCONF_TRM_MASK	(0x03 << 12)
-#define OMAP2_MCSPI_CHCONF_DMAW		(1 << 14)
-#define OMAP2_MCSPI_CHCONF_DMAR		(1 << 15)
-#define OMAP2_MCSPI_CHCONF_DPE0		(1 << 16)
-#define OMAP2_MCSPI_CHCONF_DPE1		(1 << 17)
-#define OMAP2_MCSPI_CHCONF_IS		(1 << 18)
-#define OMAP2_MCSPI_CHCONF_TURBO	(1 << 19)
-#define OMAP2_MCSPI_CHCONF_FORCE	(1 << 20)
+#define OMAP2_MCSPI_CHCONF_DMAW		BIT(14)
+#define OMAP2_MCSPI_CHCONF_DMAR		BIT(15)
+#define OMAP2_MCSPI_CHCONF_DPE0		BIT(16)
+#define OMAP2_MCSPI_CHCONF_DPE1		BIT(17)
+#define OMAP2_MCSPI_CHCONF_IS		BIT(18)
+#define OMAP2_MCSPI_CHCONF_TURBO	BIT(19)
+#define OMAP2_MCSPI_CHCONF_FORCE	BIT(20)
 
-#define OMAP2_MCSPI_CHSTAT_RXS		(1 << 0)
-#define OMAP2_MCSPI_CHSTAT_TXS		(1 << 1)
-#define OMAP2_MCSPI_CHSTAT_EOT		(1 << 2)
+#define OMAP2_MCSPI_CHSTAT_RXS		BIT(0)
+#define OMAP2_MCSPI_CHSTAT_TXS		BIT(1)
+#define OMAP2_MCSPI_CHSTAT_EOT		BIT(2)
 
-#define OMAP2_MCSPI_CHCTRL_EN		(1 << 0)
+#define OMAP2_MCSPI_CHCTRL_EN		BIT(0)
 
-#define OMAP2_MCSPI_WAKEUPENABLE_WKEN	(1 << 0)
+#define OMAP2_MCSPI_WAKEUPENABLE_WKEN	BIT(0)
 
 /* We have 2 DMA channels per CS, one for RX and one for TX */
 struct omap2_mcspi_dma {
@@ -131,8 +134,23 @@
 	void __iomem		*base;
 	unsigned long		phys;
 	int			word_len;
+	struct list_head	node;
+	/* Context save and restore shadow register */
+	u32			chconf0;
 };
 
+/* used for context save and restore, structure members to be updated whenever
+ * corresponding registers are modified.
+ */
+struct omap2_mcspi_regs {
+	u32 sysconfig;
+	u32 modulctrl;
+	u32 wakeupenable;
+	struct list_head cs;
+};
+
+static struct omap2_mcspi_regs omap2_mcspi_ctx[OMAP2_MCSPI_MAX_CTRL];
+
 static struct workqueue_struct *omap2_mcspi_wq;
 
 #define MOD_REG_BIT(val, mask, set) do { \
@@ -172,12 +190,27 @@
 	return __raw_readl(cs->base + idx);
 }
 
+static inline u32 mcspi_cached_chconf0(const struct spi_device *spi)
+{
+	struct omap2_mcspi_cs *cs = spi->controller_state;
+
+	return cs->chconf0;
+}
+
+static inline void mcspi_write_chconf0(const struct spi_device *spi, u32 val)
+{
+	struct omap2_mcspi_cs *cs = spi->controller_state;
+
+	cs->chconf0 = val;
+	mcspi_write_cs_reg(spi, OMAP2_MCSPI_CHCONF0, val);
+}
+
 static void omap2_mcspi_set_dma_req(const struct spi_device *spi,
 		int is_read, int enable)
 {
 	u32 l, rw;
 
-	l = mcspi_read_cs_reg(spi, OMAP2_MCSPI_CHCONF0);
+	l = mcspi_cached_chconf0(spi);
 
 	if (is_read) /* 1 is read, 0 write */
 		rw = OMAP2_MCSPI_CHCONF_DMAR;
@@ -185,7 +218,7 @@
 		rw = OMAP2_MCSPI_CHCONF_DMAW;
 
 	MOD_REG_BIT(l, rw, enable);
-	mcspi_write_cs_reg(spi, OMAP2_MCSPI_CHCONF0, l);
+	mcspi_write_chconf0(spi, l);
 }
 
 static void omap2_mcspi_set_enable(const struct spi_device *spi, int enable)
@@ -200,9 +233,9 @@
 {
 	u32 l;
 
-	l = mcspi_read_cs_reg(spi, OMAP2_MCSPI_CHCONF0);
+	l = mcspi_cached_chconf0(spi);
 	MOD_REG_BIT(l, OMAP2_MCSPI_CHCONF_FORCE, cs_active);
-	mcspi_write_cs_reg(spi, OMAP2_MCSPI_CHCONF0, l);
+	mcspi_write_chconf0(spi, l);
 }
 
 static void omap2_mcspi_set_master_mode(struct spi_master *master)
@@ -217,6 +250,46 @@
 	MOD_REG_BIT(l, OMAP2_MCSPI_MODULCTRL_MS, 0);
 	MOD_REG_BIT(l, OMAP2_MCSPI_MODULCTRL_SINGLE, 1);
 	mcspi_write_reg(master, OMAP2_MCSPI_MODULCTRL, l);
+
+	omap2_mcspi_ctx[master->bus_num - 1].modulctrl = l;
+}
+
+static void omap2_mcspi_restore_ctx(struct omap2_mcspi *mcspi)
+{
+	struct spi_master *spi_cntrl;
+	struct omap2_mcspi_cs *cs;
+	spi_cntrl = mcspi->master;
+
+	/* McSPI: context restore */
+	mcspi_write_reg(spi_cntrl, OMAP2_MCSPI_MODULCTRL,
+			omap2_mcspi_ctx[spi_cntrl->bus_num - 1].modulctrl);
+
+	mcspi_write_reg(spi_cntrl, OMAP2_MCSPI_SYSCONFIG,
+			omap2_mcspi_ctx[spi_cntrl->bus_num - 1].sysconfig);
+
+	mcspi_write_reg(spi_cntrl, OMAP2_MCSPI_WAKEUPENABLE,
+			omap2_mcspi_ctx[spi_cntrl->bus_num - 1].wakeupenable);
+
+	list_for_each_entry(cs, &omap2_mcspi_ctx[spi_cntrl->bus_num - 1].cs,
+			node)
+		__raw_writel(cs->chconf0, cs->base + OMAP2_MCSPI_CHCONF0);
+}
+static void omap2_mcspi_disable_clocks(struct omap2_mcspi *mcspi)
+{
+	clk_disable(mcspi->ick);
+	clk_disable(mcspi->fck);
+}
+
+static int omap2_mcspi_enable_clocks(struct omap2_mcspi *mcspi)
+{
+	if (clk_enable(mcspi->ick))
+		return -ENODEV;
+	if (clk_enable(mcspi->fck))
+		return -ENODEV;
+
+	omap2_mcspi_restore_ctx(mcspi);
+
+	return 0;
 }
 
 static unsigned
@@ -357,7 +430,7 @@
 	c = count;
 	word_len = cs->word_len;
 
-	l = mcspi_read_cs_reg(spi, OMAP2_MCSPI_CHCONF0);
+	l = mcspi_cached_chconf0(spi);
 	l &= ~OMAP2_MCSPI_CHCONF_TRM_MASK;
 
 	/* We store the pre-calculated register addresses on stack to speed
@@ -397,8 +470,7 @@
 				 * more word i/o: switch to rx+tx
 				 */
 				if (c == 0 && tx == NULL)
-					mcspi_write_cs_reg(spi,
-							OMAP2_MCSPI_CHCONF0, l);
+					mcspi_write_chconf0(spi, l);
 				*rx++ = __raw_readl(rx_reg);
 #ifdef VERBOSE
 				dev_dbg(&spi->dev, "read-%d %02x\n",
@@ -436,8 +508,7 @@
 				 * more word i/o: switch to rx+tx
 				 */
 				if (c == 0 && tx == NULL)
-					mcspi_write_cs_reg(spi,
-							OMAP2_MCSPI_CHCONF0, l);
+					mcspi_write_chconf0(spi, l);
 				*rx++ = __raw_readl(rx_reg);
 #ifdef VERBOSE
 				dev_dbg(&spi->dev, "read-%d %04x\n",
@@ -475,8 +546,7 @@
 				 * more word i/o: switch to rx+tx
 				 */
 				if (c == 0 && tx == NULL)
-					mcspi_write_cs_reg(spi,
-							OMAP2_MCSPI_CHCONF0, l);
+					mcspi_write_chconf0(spi, l);
 				*rx++ = __raw_readl(rx_reg);
 #ifdef VERBOSE
 				dev_dbg(&spi->dev, "read-%d %04x\n",
@@ -505,10 +575,12 @@
 {
 	struct omap2_mcspi_cs *cs = spi->controller_state;
 	struct omap2_mcspi *mcspi;
+	struct spi_master *spi_cntrl;
 	u32 l = 0, div = 0;
 	u8 word_len = spi->bits_per_word;
 
 	mcspi = spi_master_get_devdata(spi->master);
+	spi_cntrl = mcspi->master;
 
 	if (t != NULL && t->bits_per_word)
 		word_len = t->bits_per_word;
@@ -522,7 +594,7 @@
 	} else
 		div = 15;
 
-	l = mcspi_read_cs_reg(spi, OMAP2_MCSPI_CHCONF0);
+	l = mcspi_cached_chconf0(spi);
 
 	/* standard 4-wire master mode:  SCK, MOSI/out, MISO/in, nCS
 	 * REVISIT: this controller could support SPI_3WIRE mode.
@@ -554,7 +626,7 @@
 	else
 		l &= ~OMAP2_MCSPI_CHCONF_PHA;
 
-	mcspi_write_cs_reg(spi, OMAP2_MCSPI_CHCONF0, l);
+	mcspi_write_chconf0(spi, l);
 
 	dev_dbg(&spi->dev, "setup: speed %d, sample %s edge, clk %s\n",
 			OMAP2_MCSPI_MAX_FREQ / (1 << div),
@@ -647,7 +719,11 @@
 			return -ENOMEM;
 		cs->base = mcspi->base + spi->chip_select * 0x14;
 		cs->phys = mcspi->phys + spi->chip_select * 0x14;
+		cs->chconf0 = 0;
 		spi->controller_state = cs;
+		/* Link this to context save list */
+		list_add_tail(&cs->node,
+			&omap2_mcspi_ctx[mcspi->master->bus_num - 1].cs);
 	}
 
 	if (mcspi_dma->dma_rx_channel == -1
@@ -657,11 +733,11 @@
 			return ret;
 	}
 
-	clk_enable(mcspi->ick);
-	clk_enable(mcspi->fck);
+	if (omap2_mcspi_enable_clocks(mcspi))
+		return -ENODEV;
+
 	ret = omap2_mcspi_setup_transfer(spi, NULL);
-	clk_disable(mcspi->fck);
-	clk_disable(mcspi->ick);
+	omap2_mcspi_disable_clocks(mcspi);
 
 	return ret;
 }
@@ -670,10 +746,15 @@
 {
 	struct omap2_mcspi	*mcspi;
 	struct omap2_mcspi_dma	*mcspi_dma;
+	struct omap2_mcspi_cs	*cs;
 
 	mcspi = spi_master_get_devdata(spi->master);
 	mcspi_dma = &mcspi->dma_channels[spi->chip_select];
 
+	/* Unlink controller state from context save list */
+	cs = spi->controller_state;
+	list_del(&cs->node);
+
 	kfree(spi->controller_state);
 
 	if (mcspi_dma->dma_rx_channel != -1) {
@@ -693,8 +774,8 @@
 	mcspi = container_of(work, struct omap2_mcspi, work);
 	spin_lock_irq(&mcspi->lock);
 
-	clk_enable(mcspi->ick);
-	clk_enable(mcspi->fck);
+	if (omap2_mcspi_enable_clocks(mcspi))
+		goto out;
 
 	/* We only enable one channel at a time -- the one whose message is
 	 * at the head of the queue -- although this controller would gladly
@@ -741,13 +822,13 @@
 				cs_active = 1;
 			}
 
-			chconf = mcspi_read_cs_reg(spi, OMAP2_MCSPI_CHCONF0);
+			chconf = mcspi_cached_chconf0(spi);
 			chconf &= ~OMAP2_MCSPI_CHCONF_TRM_MASK;
 			if (t->tx_buf == NULL)
 				chconf |= OMAP2_MCSPI_CHCONF_TRM_RX_ONLY;
 			else if (t->rx_buf == NULL)
 				chconf |= OMAP2_MCSPI_CHCONF_TRM_TX_ONLY;
-			mcspi_write_cs_reg(spi, OMAP2_MCSPI_CHCONF0, chconf);
+			mcspi_write_chconf0(spi, chconf);
 
 			if (t->len) {
 				unsigned	count;
@@ -796,9 +877,9 @@
 		spin_lock_irq(&mcspi->lock);
 	}
 
-	clk_disable(mcspi->fck);
-	clk_disable(mcspi->ick);
+	omap2_mcspi_disable_clocks(mcspi);
 
+out:
 	spin_unlock_irq(&mcspi->lock);
 }
 
@@ -885,8 +966,8 @@
 	struct spi_master	*master = mcspi->master;
 	u32			tmp;
 
-	clk_enable(mcspi->ick);
-	clk_enable(mcspi->fck);
+	if (omap2_mcspi_enable_clocks(mcspi))
+		return -1;
 
 	mcspi_write_reg(master, OMAP2_MCSPI_SYSCONFIG,
 			OMAP2_MCSPI_SYSCONFIG_SOFTRESET);
@@ -894,18 +975,18 @@
 		tmp = mcspi_read_reg(master, OMAP2_MCSPI_SYSSTATUS);
 	} while (!(tmp & OMAP2_MCSPI_SYSSTATUS_RESETDONE));
 
-	mcspi_write_reg(master, OMAP2_MCSPI_SYSCONFIG,
-			OMAP2_MCSPI_SYSCONFIG_AUTOIDLE |
-			OMAP2_MCSPI_SYSCONFIG_ENAWAKEUP |
-			OMAP2_MCSPI_SYSCONFIG_SMARTIDLE);
+	tmp = OMAP2_MCSPI_SYSCONFIG_AUTOIDLE |
+		OMAP2_MCSPI_SYSCONFIG_ENAWAKEUP |
+		OMAP2_MCSPI_SYSCONFIG_SMARTIDLE;
+	mcspi_write_reg(master, OMAP2_MCSPI_SYSCONFIG, tmp);
+	omap2_mcspi_ctx[master->bus_num - 1].sysconfig = tmp;
 
-	mcspi_write_reg(master, OMAP2_MCSPI_WAKEUPENABLE,
-			OMAP2_MCSPI_WAKEUPENABLE_WKEN);
+	tmp = OMAP2_MCSPI_WAKEUPENABLE_WKEN;
+	mcspi_write_reg(master, OMAP2_MCSPI_WAKEUPENABLE, tmp);
+	omap2_mcspi_ctx[master->bus_num - 1].wakeupenable = tmp;
 
 	omap2_mcspi_set_master_mode(master);
-
-	clk_disable(mcspi->fck);
-	clk_disable(mcspi->ick);
+	omap2_mcspi_disable_clocks(mcspi);
 	return 0;
 }
 
@@ -933,7 +1014,8 @@
 	OMAP24XX_DMA_SPI2_TX1,
 };
 
-#if defined(CONFIG_ARCH_OMAP2430) || defined(CONFIG_ARCH_OMAP34XX)
+#if defined(CONFIG_ARCH_OMAP2430) || defined(CONFIG_ARCH_OMAP34XX) \
+	|| defined(CONFIG_ARCH_OMAP4)
 static u8 __initdata spi3_rxdma_id[] = {
 	OMAP24XX_DMA_SPI3_RX0,
 	OMAP24XX_DMA_SPI3_RX1,
@@ -945,7 +1027,7 @@
 };
 #endif
 
-#ifdef CONFIG_ARCH_OMAP3
+#if defined(CONFIG_ARCH_OMAP3) || defined(CONFIG_ARCH_OMAP4)
 static u8 __initdata spi4_rxdma_id[] = {
 	OMAP34XX_DMA_SPI4_RX0,
 };
@@ -975,14 +1057,15 @@
 		txdma_id = spi2_txdma_id;
 		num_chipselect = 2;
 		break;
-#if defined(CONFIG_ARCH_OMAP2430) || defined(CONFIG_ARCH_OMAP3)
+#if defined(CONFIG_ARCH_OMAP2430) || defined(CONFIG_ARCH_OMAP3) \
+	|| defined(CONFIG_ARCH_OMAP4)
 	case 3:
 		rxdma_id = spi3_rxdma_id;
 		txdma_id = spi3_txdma_id;
 		num_chipselect = 2;
 		break;
 #endif
-#ifdef CONFIG_ARCH_OMAP3
+#if defined(CONFIG_ARCH_OMAP3) || defined(CONFIG_ARCH_OMAP4)
 	case 4:
 		rxdma_id = spi4_rxdma_id;
 		txdma_id = spi4_txdma_id;
@@ -1038,6 +1121,7 @@
 
 	spin_lock_init(&mcspi->lock);
 	INIT_LIST_HEAD(&mcspi->msg_queue);
+	INIT_LIST_HEAD(&omap2_mcspi_ctx[master->bus_num - 1].cs);
 
 	mcspi->ick = clk_get(&pdev->dev, "ick");
 	if (IS_ERR(mcspi->ick)) {
diff --git a/drivers/spi/pxa2xx_spi.c b/drivers/spi/pxa2xx_spi.c
index d949dbf..31dd56f 100644
--- a/drivers/spi/pxa2xx_spi.c
+++ b/drivers/spi/pxa2xx_spi.c
@@ -1729,7 +1729,7 @@
 {
 	return platform_driver_probe(&driver, pxa2xx_spi_probe);
 }
-module_init(pxa2xx_spi_init);
+subsys_initcall(pxa2xx_spi_init);
 
 static void __exit pxa2xx_spi_exit(void)
 {
diff --git a/drivers/spi/spi.c b/drivers/spi/spi.c
index 70845ccd..b76f246 100644
--- a/drivers/spi/spi.c
+++ b/drivers/spi/spi.c
@@ -23,6 +23,7 @@
 #include <linux/init.h>
 #include <linux/cache.h>
 #include <linux/mutex.h>
+#include <linux/mod_devicetable.h>
 #include <linux/spi/spi.h>
 
 
@@ -59,9 +60,32 @@
  * and the sysfs version makes coldplug work too.
  */
 
+static const struct spi_device_id *spi_match_id(const struct spi_device_id *id,
+						const struct spi_device *sdev)
+{
+	while (id->name[0]) {
+		if (!strcmp(sdev->modalias, id->name))
+			return id;
+		id++;
+	}
+	return NULL;
+}
+
+const struct spi_device_id *spi_get_device_id(const struct spi_device *sdev)
+{
+	const struct spi_driver *sdrv = to_spi_driver(sdev->dev.driver);
+
+	return spi_match_id(sdrv->id_table, sdev);
+}
+EXPORT_SYMBOL_GPL(spi_get_device_id);
+
 static int spi_match_device(struct device *dev, struct device_driver *drv)
 {
 	const struct spi_device	*spi = to_spi_device(dev);
+	const struct spi_driver	*sdrv = to_spi_driver(drv);
+
+	if (sdrv->id_table)
+		return !!spi_match_id(sdrv->id_table, spi);
 
 	return strcmp(spi->modalias, drv->name) == 0;
 }
@@ -70,7 +94,7 @@
 {
 	const struct spi_device		*spi = to_spi_device(dev);
 
-	add_uevent_var(env, "MODALIAS=%s", spi->modalias);
+	add_uevent_var(env, "MODALIAS=%s%s", SPI_MODULE_PREFIX, spi->modalias);
 	return 0;
 }
 
@@ -639,6 +663,65 @@
 }
 EXPORT_SYMBOL_GPL(spi_setup);
 
+/**
+ * spi_async - asynchronous SPI transfer
+ * @spi: device with which data will be exchanged
+ * @message: describes the data transfers, including completion callback
+ * Context: any (irqs may be blocked, etc)
+ *
+ * This call may be used in_irq and other contexts which can't sleep,
+ * as well as from task contexts which can sleep.
+ *
+ * The completion callback is invoked in a context which can't sleep.
+ * Before that invocation, the value of message->status is undefined.
+ * When the callback is issued, message->status holds either zero (to
+ * indicate complete success) or a negative error code.  After that
+ * callback returns, the driver which issued the transfer request may
+ * deallocate the associated memory; it's no longer in use by any SPI
+ * core or controller driver code.
+ *
+ * Note that although all messages to a spi_device are handled in
+ * FIFO order, messages may go to different devices in other orders.
+ * Some device might be higher priority, or have various "hard" access
+ * time requirements, for example.
+ *
+ * On detection of any fault during the transfer, processing of
+ * the entire message is aborted, and the device is deselected.
+ * Until returning from the associated message completion callback,
+ * no other spi_message queued to that device will be processed.
+ * (This rule applies equally to all the synchronous transfer calls,
+ * which are wrappers around this core asynchronous primitive.)
+ */
+int spi_async(struct spi_device *spi, struct spi_message *message)
+{
+	struct spi_master *master = spi->master;
+
+	/* Half-duplex links include original MicroWire, and ones with
+	 * only one data pin like SPI_3WIRE (switches direction) or where
+	 * either MOSI or MISO is missing.  They can also be caused by
+	 * software limitations.
+	 */
+	if ((master->flags & SPI_MASTER_HALF_DUPLEX)
+			|| (spi->mode & SPI_3WIRE)) {
+		struct spi_transfer *xfer;
+		unsigned flags = master->flags;
+
+		list_for_each_entry(xfer, &message->transfers, transfer_list) {
+			if (xfer->rx_buf && xfer->tx_buf)
+				return -EINVAL;
+			if ((flags & SPI_MASTER_NO_TX) && xfer->tx_buf)
+				return -EINVAL;
+			if ((flags & SPI_MASTER_NO_RX) && xfer->rx_buf)
+				return -EINVAL;
+		}
+	}
+
+	message->spi = spi;
+	message->status = -EINPROGRESS;
+	return master->transfer(spi, message);
+}
+EXPORT_SYMBOL_GPL(spi_async);
+
 
 /*-------------------------------------------------------------------------*/
 
diff --git a/drivers/spi/spi_imx.c b/drivers/spi/spi_imx.c
deleted file mode 100644
index c195e45..0000000
--- a/drivers/spi/spi_imx.c
+++ /dev/null
@@ -1,1770 +0,0 @@
-/*
- * drivers/spi/spi_imx.c
- *
- * Copyright (C) 2006 SWAPP
- *	Andrea Paterniani <a.paterniani@swapp-eng.it>
- *
- * Initial version inspired by:
- *	linux-2.6.17-rc3-mm1/drivers/spi/pxa2xx_spi.c
- *
- * This program is free software; you can redistribute it and/or modify
- * it under the terms of the GNU General Public License as published by
- * the Free Software Foundation; either version 2 of the License, or
- * (at your option) any later version.
- *
- * This program is distributed in the hope that it will be useful,
- * but WITHOUT ANY WARRANTY; without even the implied warranty of
- * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
- * GNU General Public License for more details.
- */
-
-#include <linux/init.h>
-#include <linux/module.h>
-#include <linux/device.h>
-#include <linux/ioport.h>
-#include <linux/errno.h>
-#include <linux/interrupt.h>
-#include <linux/platform_device.h>
-#include <linux/dma-mapping.h>
-#include <linux/spi/spi.h>
-#include <linux/workqueue.h>
-#include <linux/delay.h>
-#include <linux/clk.h>
-
-#include <asm/io.h>
-#include <asm/irq.h>
-#include <asm/delay.h>
-
-#include <mach/hardware.h>
-#include <mach/imx-dma.h>
-#include <mach/spi_imx.h>
-
-/*-------------------------------------------------------------------------*/
-/* SPI Registers offsets from peripheral base address */
-#define SPI_RXDATA		(0x00)
-#define SPI_TXDATA		(0x04)
-#define SPI_CONTROL		(0x08)
-#define SPI_INT_STATUS		(0x0C)
-#define SPI_TEST		(0x10)
-#define SPI_PERIOD		(0x14)
-#define SPI_DMA			(0x18)
-#define SPI_RESET		(0x1C)
-
-/* SPI Control Register Bit Fields & Masks */
-#define SPI_CONTROL_BITCOUNT_MASK	(0xF)		/* Bit Count Mask */
-#define SPI_CONTROL_BITCOUNT(n)		(((n) - 1) & SPI_CONTROL_BITCOUNT_MASK)
-#define SPI_CONTROL_POL			(0x1 << 4)      /* Clock Polarity Mask */
-#define SPI_CONTROL_POL_ACT_HIGH	(0x0 << 4)      /* Active high pol. (0=idle) */
-#define SPI_CONTROL_POL_ACT_LOW		(0x1 << 4)      /* Active low pol. (1=idle) */
-#define SPI_CONTROL_PHA			(0x1 << 5)      /* Clock Phase Mask */
-#define SPI_CONTROL_PHA_0		(0x0 << 5)      /* Clock Phase 0 */
-#define SPI_CONTROL_PHA_1		(0x1 << 5)      /* Clock Phase 1 */
-#define SPI_CONTROL_SSCTL		(0x1 << 6)      /* /SS Waveform Select Mask */
-#define SPI_CONTROL_SSCTL_0		(0x0 << 6)      /* Master: /SS stays low between SPI burst
-							   Slave: RXFIFO advanced by BIT_COUNT */
-#define SPI_CONTROL_SSCTL_1		(0x1 << 6)      /* Master: /SS insert pulse between SPI burst
-							   Slave: RXFIFO advanced by /SS rising edge */
-#define SPI_CONTROL_SSPOL		(0x1 << 7)      /* /SS Polarity Select Mask */
-#define SPI_CONTROL_SSPOL_ACT_LOW	(0x0 << 7)      /* /SS Active low */
-#define SPI_CONTROL_SSPOL_ACT_HIGH	(0x1 << 7)      /* /SS Active high */
-#define SPI_CONTROL_XCH			(0x1 << 8)      /* Exchange */
-#define SPI_CONTROL_SPIEN		(0x1 << 9)      /* SPI Module Enable */
-#define SPI_CONTROL_MODE		(0x1 << 10)     /* SPI Mode Select Mask */
-#define SPI_CONTROL_MODE_SLAVE		(0x0 << 10)     /* SPI Mode Slave */
-#define SPI_CONTROL_MODE_MASTER		(0x1 << 10)     /* SPI Mode Master */
-#define SPI_CONTROL_DRCTL		(0x3 << 11)     /* /SPI_RDY Control Mask */
-#define SPI_CONTROL_DRCTL_0		(0x0 << 11)     /* Ignore /SPI_RDY */
-#define SPI_CONTROL_DRCTL_1		(0x1 << 11)     /* /SPI_RDY falling edge triggers input */
-#define SPI_CONTROL_DRCTL_2		(0x2 << 11)     /* /SPI_RDY active low level triggers input */
-#define SPI_CONTROL_DATARATE		(0x7 << 13)     /* Data Rate Mask */
-#define SPI_PERCLK2_DIV_MIN		(0)		/* PERCLK2:4 */
-#define SPI_PERCLK2_DIV_MAX		(7)		/* PERCLK2:512 */
-#define SPI_CONTROL_DATARATE_MIN	(SPI_PERCLK2_DIV_MAX << 13)
-#define SPI_CONTROL_DATARATE_MAX	(SPI_PERCLK2_DIV_MIN << 13)
-#define SPI_CONTROL_DATARATE_BAD	(SPI_CONTROL_DATARATE_MIN + 1)
-
-/* SPI Interrupt/Status Register Bit Fields & Masks */
-#define SPI_STATUS_TE	(0x1 << 0)	/* TXFIFO Empty Status */
-#define SPI_STATUS_TH	(0x1 << 1)      /* TXFIFO Half Status */
-#define SPI_STATUS_TF	(0x1 << 2)      /* TXFIFO Full Status */
-#define SPI_STATUS_RR	(0x1 << 3)      /* RXFIFO Data Ready Status */
-#define SPI_STATUS_RH	(0x1 << 4)      /* RXFIFO Half Status */
-#define SPI_STATUS_RF	(0x1 << 5)      /* RXFIFO Full Status */
-#define SPI_STATUS_RO	(0x1 << 6)      /* RXFIFO Overflow */
-#define SPI_STATUS_BO	(0x1 << 7)      /* Bit Count Overflow */
-#define SPI_STATUS	(0xFF)		/* SPI Status Mask */
-#define SPI_INTEN_TE	(0x1 << 8)      /* TXFIFO Empty Interrupt Enable */
-#define SPI_INTEN_TH	(0x1 << 9)      /* TXFIFO Half Interrupt Enable */
-#define SPI_INTEN_TF	(0x1 << 10)     /* TXFIFO Full Interrupt Enable */
-#define SPI_INTEN_RE	(0x1 << 11)     /* RXFIFO Data Ready Interrupt Enable */
-#define SPI_INTEN_RH	(0x1 << 12)     /* RXFIFO Half Interrupt Enable */
-#define SPI_INTEN_RF	(0x1 << 13)     /* RXFIFO Full Interrupt Enable */
-#define SPI_INTEN_RO	(0x1 << 14)     /* RXFIFO Overflow Interrupt Enable */
-#define SPI_INTEN_BO	(0x1 << 15)     /* Bit Count Overflow Interrupt Enable */
-#define SPI_INTEN	(0xFF << 8)	/* SPI Interrupt Enable Mask */
-
-/* SPI Test Register Bit Fields & Masks */
-#define SPI_TEST_TXCNT		(0xF << 0)	/* TXFIFO Counter */
-#define SPI_TEST_RXCNT_LSB	(4)		/* RXFIFO Counter LSB */
-#define SPI_TEST_RXCNT		(0xF << 4)	/* RXFIFO Counter */
-#define SPI_TEST_SSTATUS	(0xF << 8)	/* State Machine Status */
-#define SPI_TEST_LBC		(0x1 << 14)	/* Loop Back Control */
-
-/* SPI Period Register Bit Fields & Masks */
-#define SPI_PERIOD_WAIT		(0x7FFF << 0)	/* Wait Between Transactions */
-#define SPI_PERIOD_MAX_WAIT	(0x7FFF)	/* Max Wait Between
-							Transactions */
-#define SPI_PERIOD_CSRC		(0x1 << 15)	/* Period Clock Source Mask */
-#define SPI_PERIOD_CSRC_BCLK	(0x0 << 15)	/* Period Clock Source is
-							Bit Clock */
-#define SPI_PERIOD_CSRC_32768	(0x1 << 15)	/* Period Clock Source is
-							32.768 KHz Clock */
-
-/* SPI DMA Register Bit Fields & Masks */
-#define SPI_DMA_RHDMA	(0x1 << 4)	/* RXFIFO Half Status */
-#define SPI_DMA_RFDMA	(0x1 << 5)      /* RXFIFO Full Status */
-#define SPI_DMA_TEDMA	(0x1 << 6)      /* TXFIFO Empty Status */
-#define SPI_DMA_THDMA	(0x1 << 7)      /* TXFIFO Half Status */
-#define SPI_DMA_RHDEN	(0x1 << 12)	/* RXFIFO Half DMA Request Enable */
-#define SPI_DMA_RFDEN	(0x1 << 13)     /* RXFIFO Full DMA Request Enable */
-#define SPI_DMA_TEDEN	(0x1 << 14)     /* TXFIFO Empty DMA Request Enable */
-#define SPI_DMA_THDEN	(0x1 << 15)     /* TXFIFO Half DMA Request Enable */
-
-/* SPI Soft Reset Register Bit Fields & Masks */
-#define SPI_RESET_START	(0x1)		/* Start */
-
-/* Default SPI configuration values */
-#define SPI_DEFAULT_CONTROL		\
-(					\
-	SPI_CONTROL_BITCOUNT(16) | 	\
-	SPI_CONTROL_POL_ACT_HIGH |	\
-	SPI_CONTROL_PHA_0 |		\
-	SPI_CONTROL_SPIEN |		\
-	SPI_CONTROL_SSCTL_1 |		\
-	SPI_CONTROL_MODE_MASTER |	\
-	SPI_CONTROL_DRCTL_0 |		\
-	SPI_CONTROL_DATARATE_MIN	\
-)
-#define SPI_DEFAULT_ENABLE_LOOPBACK	(0)
-#define SPI_DEFAULT_ENABLE_DMA		(0)
-#define SPI_DEFAULT_PERIOD_WAIT		(8)
-/*-------------------------------------------------------------------------*/
-
-
-/*-------------------------------------------------------------------------*/
-/* TX/RX SPI FIFO size */
-#define SPI_FIFO_DEPTH			(8)
-#define SPI_FIFO_BYTE_WIDTH		(2)
-#define SPI_FIFO_OVERFLOW_MARGIN	(2)
-
-/* DMA burst length for half full/empty request trigger */
-#define SPI_DMA_BLR			(SPI_FIFO_DEPTH * SPI_FIFO_BYTE_WIDTH / 2)
-
-/* Dummy char output to achieve reads.
-   Choosing something different from all zeroes may help pattern recogition
-   for oscilloscope analysis, but may break some drivers. */
-#define SPI_DUMMY_u8			0
-#define SPI_DUMMY_u16			((SPI_DUMMY_u8 << 8) | SPI_DUMMY_u8)
-#define SPI_DUMMY_u32			((SPI_DUMMY_u16 << 16) | SPI_DUMMY_u16)
-
-/**
- * Macro to change a u32 field:
- * @r : register to edit
- * @m : bit mask
- * @v : new value for the field correctly bit-alligned
-*/
-#define u32_EDIT(r, m, v)		r = (r & ~(m)) | (v)
-
-/* Message state */
-#define START_STATE			((void*)0)
-#define RUNNING_STATE			((void*)1)
-#define DONE_STATE			((void*)2)
-#define ERROR_STATE			((void*)-1)
-
-/* Queue state */
-#define QUEUE_RUNNING			(0)
-#define QUEUE_STOPPED			(1)
-
-#define IS_DMA_ALIGNED(x) 		(((u32)(x) & 0x03) == 0)
-#define DMA_ALIGNMENT			4
-/*-------------------------------------------------------------------------*/
-
-
-/*-------------------------------------------------------------------------*/
-/* Driver data structs */
-
-/* Context */
-struct driver_data {
-	/* Driver model hookup */
-	struct platform_device *pdev;
-
-	/* SPI framework hookup */
-	struct spi_master *master;
-
-	/* IMX hookup */
-	struct spi_imx_master *master_info;
-
-	/* Memory resources and SPI regs virtual address */
-	struct resource *ioarea;
-	void __iomem *regs;
-
-	/* SPI RX_DATA physical address */
-	dma_addr_t rd_data_phys;
-
-	/* Driver message queue */
-	struct workqueue_struct	*workqueue;
-	struct work_struct work;
-	spinlock_t lock;
-	struct list_head queue;
-	int busy;
-	int run;
-
-	/* Message Transfer pump */
-	struct tasklet_struct pump_transfers;
-
-	/* Current message, transfer and state */
-	struct spi_message *cur_msg;
-	struct spi_transfer *cur_transfer;
-	struct chip_data *cur_chip;
-
-	/* Rd / Wr buffers pointers */
-	size_t len;
-	void *tx;
-	void *tx_end;
-	void *rx;
-	void *rx_end;
-
-	u8 rd_only;
-	u8 n_bytes;
-	int cs_change;
-
-	/* Function pointers */
-	irqreturn_t (*transfer_handler)(struct driver_data *drv_data);
-	void (*cs_control)(u32 command);
-
-	/* DMA setup */
-	int rx_channel;
-	int tx_channel;
-	dma_addr_t rx_dma;
-	dma_addr_t tx_dma;
-	int rx_dma_needs_unmap;
-	int tx_dma_needs_unmap;
-	size_t tx_map_len;
-	u32 dummy_dma_buf ____cacheline_aligned;
-
-	struct clk *clk;
-};
-
-/* Runtime state */
-struct chip_data {
-	u32 control;
-	u32 period;
-	u32 test;
-
-	u8 enable_dma:1;
-	u8 bits_per_word;
-	u8 n_bytes;
-	u32 max_speed_hz;
-
-	void (*cs_control)(u32 command);
-};
-/*-------------------------------------------------------------------------*/
-
-
-static void pump_messages(struct work_struct *work);
-
-static void flush(struct driver_data *drv_data)
-{
-	void __iomem *regs = drv_data->regs;
-	u32 control;
-
-	dev_dbg(&drv_data->pdev->dev, "flush\n");
-
-	/* Wait for end of transaction */
-	do {
-		control = readl(regs + SPI_CONTROL);
-	} while (control & SPI_CONTROL_XCH);
-
-	/* Release chip select if requested, transfer delays are
-	   handled in pump_transfers */
-	if (drv_data->cs_change)
-		drv_data->cs_control(SPI_CS_DEASSERT);
-
-	/* Disable SPI to flush FIFOs */
-	writel(control & ~SPI_CONTROL_SPIEN, regs + SPI_CONTROL);
-	writel(control, regs + SPI_CONTROL);
-}
-
-static void restore_state(struct driver_data *drv_data)
-{
-	void __iomem *regs = drv_data->regs;
-	struct chip_data *chip = drv_data->cur_chip;
-
-	/* Load chip registers */
-	dev_dbg(&drv_data->pdev->dev,
-		"restore_state\n"
-		"    test    = 0x%08X\n"
-		"    control = 0x%08X\n",
-		chip->test,
-		chip->control);
-	writel(chip->test, regs + SPI_TEST);
-	writel(chip->period, regs + SPI_PERIOD);
-	writel(0, regs + SPI_INT_STATUS);
-	writel(chip->control, regs + SPI_CONTROL);
-}
-
-static void null_cs_control(u32 command)
-{
-}
-
-static inline u32 data_to_write(struct driver_data *drv_data)
-{
-	return ((u32)(drv_data->tx_end - drv_data->tx)) / drv_data->n_bytes;
-}
-
-static inline u32 data_to_read(struct driver_data *drv_data)
-{
-	return ((u32)(drv_data->rx_end - drv_data->rx)) / drv_data->n_bytes;
-}
-
-static int write(struct driver_data *drv_data)
-{
-	void __iomem *regs = drv_data->regs;
-	void *tx = drv_data->tx;
-	void *tx_end = drv_data->tx_end;
-	u8 n_bytes = drv_data->n_bytes;
-	u32 remaining_writes;
-	u32 fifo_avail_space;
-	u32 n;
-	u16 d;
-
-	/* Compute how many fifo writes to do */
-	remaining_writes = (u32)(tx_end - tx) / n_bytes;
-	fifo_avail_space = SPI_FIFO_DEPTH -
-				(readl(regs + SPI_TEST) & SPI_TEST_TXCNT);
-	if (drv_data->rx && (fifo_avail_space > SPI_FIFO_OVERFLOW_MARGIN))
-		/* Fix misunderstood receive overflow */
-		fifo_avail_space -= SPI_FIFO_OVERFLOW_MARGIN;
-	n = min(remaining_writes, fifo_avail_space);
-
-	dev_dbg(&drv_data->pdev->dev,
-		"write type %s\n"
-		"    remaining writes = %d\n"
-		"    fifo avail space = %d\n"
-		"    fifo writes      = %d\n",
-		(n_bytes == 1) ? "u8" : "u16",
-		remaining_writes,
-		fifo_avail_space,
-		n);
-
-	if (n > 0) {
-		/* Fill SPI TXFIFO */
-		if (drv_data->rd_only) {
-			tx += n * n_bytes;
-			while (n--)
-				writel(SPI_DUMMY_u16, regs + SPI_TXDATA);
-		} else {
-			if (n_bytes == 1) {
-				while (n--) {
-					d = *(u8*)tx;
-					writel(d, regs + SPI_TXDATA);
-					tx += 1;
-				}
-			} else {
-				while (n--) {
-					d = *(u16*)tx;
-					writel(d, regs + SPI_TXDATA);
-					tx += 2;
-				}
-			}
-		}
-
-		/* Trigger transfer */
-		writel(readl(regs + SPI_CONTROL) | SPI_CONTROL_XCH,
-			regs + SPI_CONTROL);
-
-		/* Update tx pointer */
-		drv_data->tx = tx;
-	}
-
-	return (tx >= tx_end);
-}
-
-static int read(struct driver_data *drv_data)
-{
-	void __iomem *regs = drv_data->regs;
-	void *rx = drv_data->rx;
-	void *rx_end = drv_data->rx_end;
-	u8 n_bytes = drv_data->n_bytes;
-	u32 remaining_reads;
-	u32 fifo_rxcnt;
-	u32 n;
-	u16 d;
-
-	/* Compute how many fifo reads to do */
-	remaining_reads = (u32)(rx_end - rx) / n_bytes;
-	fifo_rxcnt = (readl(regs + SPI_TEST) & SPI_TEST_RXCNT) >>
-			SPI_TEST_RXCNT_LSB;
-	n = min(remaining_reads, fifo_rxcnt);
-
-	dev_dbg(&drv_data->pdev->dev,
-		"read type %s\n"
-		"    remaining reads = %d\n"
-		"    fifo rx count   = %d\n"
-		"    fifo reads      = %d\n",
-		(n_bytes == 1) ? "u8" : "u16",
-		remaining_reads,
-		fifo_rxcnt,
-		n);
-
-	if (n > 0) {
-		/* Read SPI RXFIFO */
-		if (n_bytes == 1) {
-			while (n--) {
-				d = readl(regs + SPI_RXDATA);
-				*((u8*)rx) = d;
-				rx += 1;
-			}
-		} else {
-			while (n--) {
-				d = readl(regs + SPI_RXDATA);
-				*((u16*)rx) = d;
-				rx += 2;
-			}
-		}
-
-		/* Update rx pointer */
-		drv_data->rx = rx;
-	}
-
-	return (rx >= rx_end);
-}
-
-static void *next_transfer(struct driver_data *drv_data)
-{
-	struct spi_message *msg = drv_data->cur_msg;
-	struct spi_transfer *trans = drv_data->cur_transfer;
-
-	/* Move to next transfer */
-	if (trans->transfer_list.next != &msg->transfers) {
-		drv_data->cur_transfer =
-			list_entry(trans->transfer_list.next,
-					struct spi_transfer,
-					transfer_list);
-		return RUNNING_STATE;
-	}
-
-	return DONE_STATE;
-}
-
-static int map_dma_buffers(struct driver_data *drv_data)
-{
-	struct spi_message *msg;
-	struct device *dev;
-	void *buf;
-
-	drv_data->rx_dma_needs_unmap = 0;
-	drv_data->tx_dma_needs_unmap = 0;
-
-	if (!drv_data->master_info->enable_dma ||
-		!drv_data->cur_chip->enable_dma)
-			return -1;
-
-	msg = drv_data->cur_msg;
-	dev = &msg->spi->dev;
-	if (msg->is_dma_mapped) {
-		if (drv_data->tx_dma)
-			/* The caller provided at least dma and cpu virtual
-			   address for write; pump_transfers() will consider the
-			   transfer as write only if cpu rx virtual address is
-			   NULL */
-			return 0;
-
-		if (drv_data->rx_dma) {
-			/* The caller provided dma and cpu virtual address to
-			   performe read only transfer -->
-			   use drv_data->dummy_dma_buf for dummy writes to
-			   achive reads */
-			buf = &drv_data->dummy_dma_buf;
-			drv_data->tx_map_len = sizeof(drv_data->dummy_dma_buf);
-			drv_data->tx_dma = dma_map_single(dev,
-							buf,
-							drv_data->tx_map_len,
-							DMA_TO_DEVICE);
-			if (dma_mapping_error(dev, drv_data->tx_dma))
-				return -1;
-
-			drv_data->tx_dma_needs_unmap = 1;
-
-			/* Flags transfer as rd_only for pump_transfers() DMA
-			   regs programming (should be redundant) */
-			drv_data->tx = NULL;
-
-			return 0;
-		}
-	}
-
-	if (!IS_DMA_ALIGNED(drv_data->rx) || !IS_DMA_ALIGNED(drv_data->tx))
-		return -1;
-
-	if (drv_data->tx == NULL) {
-		/* Read only message --> use drv_data->dummy_dma_buf for dummy
-		   writes to achive reads */
-		buf = &drv_data->dummy_dma_buf;
-		drv_data->tx_map_len = sizeof(drv_data->dummy_dma_buf);
-	} else {
-		buf = drv_data->tx;
-		drv_data->tx_map_len = drv_data->len;
-	}
-	drv_data->tx_dma = dma_map_single(dev,
-					buf,
-					drv_data->tx_map_len,
-					DMA_TO_DEVICE);
-	if (dma_mapping_error(dev, drv_data->tx_dma))
-		return -1;
-	drv_data->tx_dma_needs_unmap = 1;
-
-	/* NULL rx means write-only transfer and no map needed
-	 * since rx DMA will not be used */
-	if (drv_data->rx) {
-		buf = drv_data->rx;
-		drv_data->rx_dma = dma_map_single(dev,
-						buf,
-						drv_data->len,
-						DMA_FROM_DEVICE);
-		if (dma_mapping_error(dev, drv_data->rx_dma)) {
-			if (drv_data->tx_dma) {
-				dma_unmap_single(dev,
-						drv_data->tx_dma,
-						drv_data->tx_map_len,
-						DMA_TO_DEVICE);
-				drv_data->tx_dma_needs_unmap = 0;
-			}
-			return -1;
-		}
-		drv_data->rx_dma_needs_unmap = 1;
-	}
-
-	return 0;
-}
-
-static void unmap_dma_buffers(struct driver_data *drv_data)
-{
-	struct spi_message *msg = drv_data->cur_msg;
-	struct device *dev = &msg->spi->dev;
-
-	if (drv_data->rx_dma_needs_unmap) {
-		dma_unmap_single(dev,
-				drv_data->rx_dma,
-				drv_data->len,
-				DMA_FROM_DEVICE);
-		drv_data->rx_dma_needs_unmap = 0;
-	}
-	if (drv_data->tx_dma_needs_unmap) {
-		dma_unmap_single(dev,
-				drv_data->tx_dma,
-				drv_data->tx_map_len,
-				DMA_TO_DEVICE);
-		drv_data->tx_dma_needs_unmap = 0;
-	}
-}
-
-/* Caller already set message->status (dma is already blocked) */
-static void giveback(struct spi_message *message, struct driver_data *drv_data)
-{
-	void __iomem *regs = drv_data->regs;
-
-	/* Bring SPI to sleep; restore_state() and pump_transfer()
-	   will do new setup */
-	writel(0, regs + SPI_INT_STATUS);
-	writel(0, regs + SPI_DMA);
-
-	/* Unconditioned deselct */
-	drv_data->cs_control(SPI_CS_DEASSERT);
-
-	message->state = NULL;
-	if (message->complete)
-		message->complete(message->context);
-
-	drv_data->cur_msg = NULL;
-	drv_data->cur_transfer = NULL;
-	drv_data->cur_chip = NULL;
-	queue_work(drv_data->workqueue, &drv_data->work);
-}
-
-static void dma_err_handler(int channel, void *data, int errcode)
-{
-	struct driver_data *drv_data = data;
-	struct spi_message *msg = drv_data->cur_msg;
-
-	dev_dbg(&drv_data->pdev->dev, "dma_err_handler\n");
-
-	/* Disable both rx and tx dma channels */
-	imx_dma_disable(drv_data->rx_channel);
-	imx_dma_disable(drv_data->tx_channel);
-	unmap_dma_buffers(drv_data);
-
-	flush(drv_data);
-
-	msg->state = ERROR_STATE;
-	tasklet_schedule(&drv_data->pump_transfers);
-}
-
-static void dma_tx_handler(int channel, void *data)
-{
-	struct driver_data *drv_data = data;
-
-	dev_dbg(&drv_data->pdev->dev, "dma_tx_handler\n");
-
-	imx_dma_disable(channel);
-
-	/* Now waits for TX FIFO empty */
-	writel(SPI_INTEN_TE, drv_data->regs + SPI_INT_STATUS);
-}
-
-static irqreturn_t dma_transfer(struct driver_data *drv_data)
-{
-	u32 status;
-	struct spi_message *msg = drv_data->cur_msg;
-	void __iomem *regs = drv_data->regs;
-
-	status = readl(regs + SPI_INT_STATUS);
-
-	if ((status & (SPI_INTEN_RO | SPI_STATUS_RO))
-			== (SPI_INTEN_RO | SPI_STATUS_RO)) {
-		writel(status & ~SPI_INTEN, regs + SPI_INT_STATUS);
-
-		imx_dma_disable(drv_data->tx_channel);
-		imx_dma_disable(drv_data->rx_channel);
-		unmap_dma_buffers(drv_data);
-
-		flush(drv_data);
-
-		dev_warn(&drv_data->pdev->dev,
-				"dma_transfer - fifo overun\n");
-
-		msg->state = ERROR_STATE;
-		tasklet_schedule(&drv_data->pump_transfers);
-
-		return IRQ_HANDLED;
-	}
-
-	if (status & SPI_STATUS_TE) {
-		writel(status & ~SPI_INTEN_TE, regs + SPI_INT_STATUS);
-
-		if (drv_data->rx) {
-			/* Wait end of transfer before read trailing data */
-			while (readl(regs + SPI_CONTROL) & SPI_CONTROL_XCH)
-				cpu_relax();
-
-			imx_dma_disable(drv_data->rx_channel);
-			unmap_dma_buffers(drv_data);
-
-			/* Release chip select if requested, transfer delays are
-			   handled in pump_transfers() */
-			if (drv_data->cs_change)
-				drv_data->cs_control(SPI_CS_DEASSERT);
-
-			/* Calculate number of trailing data and read them */
-			dev_dbg(&drv_data->pdev->dev,
-				"dma_transfer - test = 0x%08X\n",
-				readl(regs + SPI_TEST));
-			drv_data->rx = drv_data->rx_end -
-					((readl(regs + SPI_TEST) &
-					SPI_TEST_RXCNT) >>
-					SPI_TEST_RXCNT_LSB)*drv_data->n_bytes;
-			read(drv_data);
-		} else {
-			/* Write only transfer */
-			unmap_dma_buffers(drv_data);
-
-			flush(drv_data);
-		}
-
-		/* End of transfer, update total byte transfered */
-		msg->actual_length += drv_data->len;
-
-		/* Move to next transfer */
-		msg->state = next_transfer(drv_data);
-
-		/* Schedule transfer tasklet */
-		tasklet_schedule(&drv_data->pump_transfers);
-
-		return IRQ_HANDLED;
-	}
-
-	/* Opps problem detected */
-	return IRQ_NONE;
-}
-
-static irqreturn_t interrupt_wronly_transfer(struct driver_data *drv_data)
-{
-	struct spi_message *msg = drv_data->cur_msg;
-	void __iomem *regs = drv_data->regs;
-	u32 status;
-	irqreturn_t handled = IRQ_NONE;
-
-	status = readl(regs + SPI_INT_STATUS);
-
-	if (status & SPI_INTEN_TE) {
-		/* TXFIFO Empty Interrupt on the last transfered word */
-		writel(status & ~SPI_INTEN, regs + SPI_INT_STATUS);
-		dev_dbg(&drv_data->pdev->dev,
-			"interrupt_wronly_transfer - end of tx\n");
-
-		flush(drv_data);
-
-		/* Update total byte transfered */
-		msg->actual_length += drv_data->len;
-
-		/* Move to next transfer */
-		msg->state = next_transfer(drv_data);
-
-		/* Schedule transfer tasklet */
-		tasklet_schedule(&drv_data->pump_transfers);
-
-		return IRQ_HANDLED;
-	} else {
-		while (status & SPI_STATUS_TH) {
-			dev_dbg(&drv_data->pdev->dev,
-				"interrupt_wronly_transfer - status = 0x%08X\n",
-				status);
-
-			/* Pump data */
-			if (write(drv_data)) {
-				/* End of TXFIFO writes,
-				   now wait until TXFIFO is empty */
-				writel(SPI_INTEN_TE, regs + SPI_INT_STATUS);
-				return IRQ_HANDLED;
-			}
-
-			status = readl(regs + SPI_INT_STATUS);
-
-			/* We did something */
-			handled = IRQ_HANDLED;
-		}
-	}
-
-	return handled;
-}
-
-static irqreturn_t interrupt_transfer(struct driver_data *drv_data)
-{
-	struct spi_message *msg = drv_data->cur_msg;
-	void __iomem *regs = drv_data->regs;
-	u32 status, control;
-	irqreturn_t handled = IRQ_NONE;
-	unsigned long limit;
-
-	status = readl(regs + SPI_INT_STATUS);
-
-	if (status & SPI_INTEN_TE) {
-		/* TXFIFO Empty Interrupt on the last transfered word */
-		writel(status & ~SPI_INTEN, regs + SPI_INT_STATUS);
-		dev_dbg(&drv_data->pdev->dev,
-			"interrupt_transfer - end of tx\n");
-
-		if (msg->state == ERROR_STATE) {
-			/* RXFIFO overrun was detected and message aborted */
-			flush(drv_data);
-		} else {
-			/* Wait for end of transaction */
-			do {
-				control = readl(regs + SPI_CONTROL);
-			} while (control & SPI_CONTROL_XCH);
-
-			/* Release chip select if requested, transfer delays are
-			   handled in pump_transfers */
-			if (drv_data->cs_change)
-				drv_data->cs_control(SPI_CS_DEASSERT);
-
-			/* Read trailing bytes */
-			limit = loops_per_jiffy << 1;
-			while ((read(drv_data) == 0) && --limit)
-				cpu_relax();
-
-			if (limit == 0)
-				dev_err(&drv_data->pdev->dev,
-					"interrupt_transfer - "
-					"trailing byte read failed\n");
-			else
-				dev_dbg(&drv_data->pdev->dev,
-					"interrupt_transfer - end of rx\n");
-
-			/* Update total byte transfered */
-			msg->actual_length += drv_data->len;
-
-			/* Move to next transfer */
-			msg->state = next_transfer(drv_data);
-		}
-
-		/* Schedule transfer tasklet */
-		tasklet_schedule(&drv_data->pump_transfers);
-
-		return IRQ_HANDLED;
-	} else {
-		while (status & (SPI_STATUS_TH | SPI_STATUS_RO)) {
-			dev_dbg(&drv_data->pdev->dev,
-				"interrupt_transfer - status = 0x%08X\n",
-				status);
-
-			if (status & SPI_STATUS_RO) {
-				/* RXFIFO overrun, abort message end wait
-				   until TXFIFO is empty */
-				writel(SPI_INTEN_TE, regs + SPI_INT_STATUS);
-
-				dev_warn(&drv_data->pdev->dev,
-					"interrupt_transfer - fifo overun\n"
-					"    data not yet written = %d\n"
-					"    data not yet read    = %d\n",
-					data_to_write(drv_data),
-					data_to_read(drv_data));
-
-				msg->state = ERROR_STATE;
-
-				return IRQ_HANDLED;
-			}
-
-			/* Pump data */
-			read(drv_data);
-			if (write(drv_data)) {
-				/* End of TXFIFO writes,
-				   now wait until TXFIFO is empty */
-				writel(SPI_INTEN_TE, regs + SPI_INT_STATUS);
-				return IRQ_HANDLED;
-			}
-
-			status = readl(regs + SPI_INT_STATUS);
-
-			/* We did something */
-			handled = IRQ_HANDLED;
-		}
-	}
-
-	return handled;
-}
-
-static irqreturn_t spi_int(int irq, void *dev_id)
-{
-	struct driver_data *drv_data = (struct driver_data *)dev_id;
-
-	if (!drv_data->cur_msg) {
-		dev_err(&drv_data->pdev->dev,
-			"spi_int - bad message state\n");
-		/* Never fail */
-		return IRQ_HANDLED;
-	}
-
-	return drv_data->transfer_handler(drv_data);
-}
-
-static inline u32 spi_speed_hz(struct driver_data *drv_data, u32 data_rate)
-{
-	return clk_get_rate(drv_data->clk) / (4 << ((data_rate) >> 13));
-}
-
-static u32 spi_data_rate(struct driver_data *drv_data, u32 speed_hz)
-{
-	u32 div;
-	u32 quantized_hz = clk_get_rate(drv_data->clk) >> 2;
-
-	for (div = SPI_PERCLK2_DIV_MIN;
-		div <= SPI_PERCLK2_DIV_MAX;
-		div++, quantized_hz >>= 1) {
-			if (quantized_hz <= speed_hz)
-				/* Max available speed LEQ required speed */
-				return div << 13;
-	}
-	return SPI_CONTROL_DATARATE_BAD;
-}
-
-static void pump_transfers(unsigned long data)
-{
-	struct driver_data *drv_data = (struct driver_data *)data;
-	struct spi_message *message;
-	struct spi_transfer *transfer, *previous;
-	struct chip_data *chip;
-	void __iomem *regs;
-	u32 tmp, control;
-
-	dev_dbg(&drv_data->pdev->dev, "pump_transfer\n");
-
-	message = drv_data->cur_msg;
-
-	/* Handle for abort */
-	if (message->state == ERROR_STATE) {
-		message->status = -EIO;
-		giveback(message, drv_data);
-		return;
-	}
-
-	/* Handle end of message */
-	if (message->state == DONE_STATE) {
-		message->status = 0;
-		giveback(message, drv_data);
-		return;
-	}
-
-	chip = drv_data->cur_chip;
-
-	/* Delay if requested at end of transfer*/
-	transfer = drv_data->cur_transfer;
-	if (message->state == RUNNING_STATE) {
-		previous = list_entry(transfer->transfer_list.prev,
-					struct spi_transfer,
-					transfer_list);
-		if (previous->delay_usecs)
-			udelay(previous->delay_usecs);
-	} else {
-		/* START_STATE */
-		message->state = RUNNING_STATE;
-		drv_data->cs_control = chip->cs_control;
-	}
-
-	transfer = drv_data->cur_transfer;
-	drv_data->tx = (void *)transfer->tx_buf;
-	drv_data->tx_end = drv_data->tx + transfer->len;
-	drv_data->rx = transfer->rx_buf;
-	drv_data->rx_end = drv_data->rx + transfer->len;
-	drv_data->rx_dma = transfer->rx_dma;
-	drv_data->tx_dma = transfer->tx_dma;
-	drv_data->len = transfer->len;
-	drv_data->cs_change = transfer->cs_change;
-	drv_data->rd_only = (drv_data->tx == NULL);
-
-	regs = drv_data->regs;
-	control = readl(regs + SPI_CONTROL);
-
-	/* Bits per word setup */
-	tmp = transfer->bits_per_word;
-	if (tmp == 0) {
-		/* Use device setup */
-		tmp = chip->bits_per_word;
-		drv_data->n_bytes = chip->n_bytes;
-	} else
-		/* Use per-transfer setup */
-		drv_data->n_bytes = (tmp <= 8) ? 1 : 2;
-	u32_EDIT(control, SPI_CONTROL_BITCOUNT_MASK, tmp - 1);
-
-	/* Speed setup (surely valid because already checked) */
-	tmp = transfer->speed_hz;
-	if (tmp == 0)
-		tmp = chip->max_speed_hz;
-	tmp = spi_data_rate(drv_data, tmp);
-	u32_EDIT(control, SPI_CONTROL_DATARATE, tmp);
-
-	writel(control, regs + SPI_CONTROL);
-
-	/* Assert device chip-select */
-	drv_data->cs_control(SPI_CS_ASSERT);
-
-	/* DMA cannot read/write SPI FIFOs other than 16 bits at a time; hence
-	   if bits_per_word is less or equal 8 PIO transfers are performed.
-	   Moreover DMA is convinient for transfer length bigger than FIFOs
-	   byte size. */
-	if ((drv_data->n_bytes == 2) &&
-		(drv_data->len > SPI_FIFO_DEPTH*SPI_FIFO_BYTE_WIDTH) &&
-		(map_dma_buffers(drv_data) == 0)) {
-		dev_dbg(&drv_data->pdev->dev,
-			"pump dma transfer\n"
-			"    tx      = %p\n"
-			"    tx_dma  = %08X\n"
-			"    rx      = %p\n"
-			"    rx_dma  = %08X\n"
-			"    len     = %d\n",
-			drv_data->tx,
-			(unsigned int)drv_data->tx_dma,
-			drv_data->rx,
-			(unsigned int)drv_data->rx_dma,
-			drv_data->len);
-
-		/* Ensure we have the correct interrupt handler */
-		drv_data->transfer_handler = dma_transfer;
-
-		/* Trigger transfer */
-		writel(readl(regs + SPI_CONTROL) | SPI_CONTROL_XCH,
-			regs + SPI_CONTROL);
-
-		/* Setup tx DMA */
-		if (drv_data->tx)
-			/* Linear source address */
-			CCR(drv_data->tx_channel) =
-				CCR_DMOD_FIFO |
-				CCR_SMOD_LINEAR |
-				CCR_SSIZ_32 | CCR_DSIZ_16 |
-				CCR_REN;
-		else
-			/* Read only transfer -> fixed source address for
-			   dummy write to achive read */
-			CCR(drv_data->tx_channel) =
-				CCR_DMOD_FIFO |
-				CCR_SMOD_FIFO |
-				CCR_SSIZ_32 | CCR_DSIZ_16 |
-				CCR_REN;
-
-		imx_dma_setup_single(
-			drv_data->tx_channel,
-			drv_data->tx_dma,
-			drv_data->len,
-			drv_data->rd_data_phys + 4,
-			DMA_MODE_WRITE);
-
-		if (drv_data->rx) {
-			/* Setup rx DMA for linear destination address */
-			CCR(drv_data->rx_channel) =
-				CCR_DMOD_LINEAR |
-				CCR_SMOD_FIFO |
-				CCR_DSIZ_32 | CCR_SSIZ_16 |
-				CCR_REN;
-			imx_dma_setup_single(
-				drv_data->rx_channel,
-				drv_data->rx_dma,
-				drv_data->len,
-				drv_data->rd_data_phys,
-				DMA_MODE_READ);
-			imx_dma_enable(drv_data->rx_channel);
-
-			/* Enable SPI interrupt */
-			writel(SPI_INTEN_RO, regs + SPI_INT_STATUS);
-
-			/* Set SPI to request DMA service on both
-			   Rx and Tx half fifo watermark */
-			writel(SPI_DMA_RHDEN | SPI_DMA_THDEN, regs + SPI_DMA);
-		} else
-			/* Write only access -> set SPI to request DMA
-			   service on Tx half fifo watermark */
-			writel(SPI_DMA_THDEN, regs + SPI_DMA);
-
-		imx_dma_enable(drv_data->tx_channel);
-	} else {
-		dev_dbg(&drv_data->pdev->dev,
-			"pump pio transfer\n"
-			"    tx      = %p\n"
-			"    rx      = %p\n"
-			"    len     = %d\n",
-			drv_data->tx,
-			drv_data->rx,
-			drv_data->len);
-
-		/* Ensure we have the correct interrupt handler	*/
-		if (drv_data->rx)
-			drv_data->transfer_handler = interrupt_transfer;
-		else
-			drv_data->transfer_handler = interrupt_wronly_transfer;
-
-		/* Enable SPI interrupt */
-		if (drv_data->rx)
-			writel(SPI_INTEN_TH | SPI_INTEN_RO,
-				regs + SPI_INT_STATUS);
-		else
-			writel(SPI_INTEN_TH, regs + SPI_INT_STATUS);
-	}
-}
-
-static void pump_messages(struct work_struct *work)
-{
-	struct driver_data *drv_data =
-				container_of(work, struct driver_data, work);
-	unsigned long flags;
-
-	/* Lock queue and check for queue work */
-	spin_lock_irqsave(&drv_data->lock, flags);
-	if (list_empty(&drv_data->queue) || drv_data->run == QUEUE_STOPPED) {
-		drv_data->busy = 0;
-		spin_unlock_irqrestore(&drv_data->lock, flags);
-		return;
-	}
-
-	/* Make sure we are not already running a message */
-	if (drv_data->cur_msg) {
-		spin_unlock_irqrestore(&drv_data->lock, flags);
-		return;
-	}
-
-	/* Extract head of queue */
-	drv_data->cur_msg = list_entry(drv_data->queue.next,
-					struct spi_message, queue);
-	list_del_init(&drv_data->cur_msg->queue);
-	drv_data->busy = 1;
-	spin_unlock_irqrestore(&drv_data->lock, flags);
-
-	/* Initial message state */
-	drv_data->cur_msg->state = START_STATE;
-	drv_data->cur_transfer = list_entry(drv_data->cur_msg->transfers.next,
-						struct spi_transfer,
-						transfer_list);
-
-	/* Setup the SPI using the per chip configuration */
-	drv_data->cur_chip = spi_get_ctldata(drv_data->cur_msg->spi);
-	restore_state(drv_data);
-
-	/* Mark as busy and launch transfers */
-	tasklet_schedule(&drv_data->pump_transfers);
-}
-
-static int transfer(struct spi_device *spi, struct spi_message *msg)
-{
-	struct driver_data *drv_data = spi_master_get_devdata(spi->master);
-	u32 min_speed_hz, max_speed_hz, tmp;
-	struct spi_transfer *trans;
-	unsigned long flags;
-
-	msg->actual_length = 0;
-
-	/* Per transfer setup check */
-	min_speed_hz = spi_speed_hz(drv_data, SPI_CONTROL_DATARATE_MIN);
-	max_speed_hz = spi->max_speed_hz;
-	list_for_each_entry(trans, &msg->transfers, transfer_list) {
-		tmp = trans->bits_per_word;
-		if (tmp > 16) {
-			dev_err(&drv_data->pdev->dev,
-				"message rejected : "
-				"invalid transfer bits_per_word (%d bits)\n",
-				tmp);
-			goto msg_rejected;
-		}
-		tmp = trans->speed_hz;
-		if (tmp) {
-			if (tmp < min_speed_hz) {
-				dev_err(&drv_data->pdev->dev,
-					"message rejected : "
-					"device min speed (%d Hz) exceeds "
-					"required transfer speed (%d Hz)\n",
-					min_speed_hz,
-					tmp);
-				goto msg_rejected;
-			} else if (tmp > max_speed_hz) {
-				dev_err(&drv_data->pdev->dev,
-					"message rejected : "
-					"transfer speed (%d Hz) exceeds "
-					"device max speed (%d Hz)\n",
-					tmp,
-					max_speed_hz);
-				goto msg_rejected;
-			}
-		}
-	}
-
-	/* Message accepted */
-	msg->status = -EINPROGRESS;
-	msg->state = START_STATE;
-
-	spin_lock_irqsave(&drv_data->lock, flags);
-	if (drv_data->run == QUEUE_STOPPED) {
-		spin_unlock_irqrestore(&drv_data->lock, flags);
-		return -ESHUTDOWN;
-	}
-
-	list_add_tail(&msg->queue, &drv_data->queue);
-	if (drv_data->run == QUEUE_RUNNING && !drv_data->busy)
-		queue_work(drv_data->workqueue, &drv_data->work);
-
-	spin_unlock_irqrestore(&drv_data->lock, flags);
-	return 0;
-
-msg_rejected:
-	/* Message rejected and not queued */
-	msg->status = -EINVAL;
-	msg->state = ERROR_STATE;
-	if (msg->complete)
-		msg->complete(msg->context);
-	return -EINVAL;
-}
-
-/* On first setup bad values must free chip_data memory since will cause
-   spi_new_device to fail. Bad value setup from protocol driver are simply not
-   applied and notified to the calling driver. */
-static int setup(struct spi_device *spi)
-{
-	struct driver_data *drv_data = spi_master_get_devdata(spi->master);
-	struct spi_imx_chip *chip_info;
-	struct chip_data *chip;
-	int first_setup = 0;
-	u32 tmp;
-	int status = 0;
-
-	/* Get controller data */
-	chip_info = spi->controller_data;
-
-	/* Get controller_state */
-	chip = spi_get_ctldata(spi);
-	if (chip == NULL) {
-		first_setup = 1;
-
-		chip = kzalloc(sizeof(struct chip_data), GFP_KERNEL);
-		if (!chip) {
-			dev_err(&spi->dev,
-				"setup - cannot allocate controller state\n");
-			return -ENOMEM;
-		}
-		chip->control = SPI_DEFAULT_CONTROL;
-
-		if (chip_info == NULL) {
-			/* spi_board_info.controller_data not is supplied */
-			chip_info = kzalloc(sizeof(struct spi_imx_chip),
-						GFP_KERNEL);
-			if (!chip_info) {
-				dev_err(&spi->dev,
-					"setup - "
-					"cannot allocate controller data\n");
-				status = -ENOMEM;
-				goto err_first_setup;
-			}
-			/* Set controller data default value */
-			chip_info->enable_loopback =
-						SPI_DEFAULT_ENABLE_LOOPBACK;
-			chip_info->enable_dma = SPI_DEFAULT_ENABLE_DMA;
-			chip_info->ins_ss_pulse = 1;
-			chip_info->bclk_wait = SPI_DEFAULT_PERIOD_WAIT;
-			chip_info->cs_control = null_cs_control;
-		}
-	}
-
-	/* Now set controller state based on controller data */
-
-	if (first_setup) {
-		/* SPI loopback */
-		if (chip_info->enable_loopback)
-			chip->test = SPI_TEST_LBC;
-		else
-			chip->test = 0;
-
-		/* SPI dma driven */
-		chip->enable_dma = chip_info->enable_dma;
-
-		/* SPI /SS pulse between spi burst */
-		if (chip_info->ins_ss_pulse)
-			u32_EDIT(chip->control,
-				SPI_CONTROL_SSCTL, SPI_CONTROL_SSCTL_1);
-		else
-			u32_EDIT(chip->control,
-				SPI_CONTROL_SSCTL, SPI_CONTROL_SSCTL_0);
-
-		/* SPI bclk waits between each bits_per_word spi burst */
-		if (chip_info->bclk_wait > SPI_PERIOD_MAX_WAIT) {
-			dev_err(&spi->dev,
-				"setup - "
-				"bclk_wait exceeds max allowed (%d)\n",
-				SPI_PERIOD_MAX_WAIT);
-			goto err_first_setup;
-		}
-		chip->period = SPI_PERIOD_CSRC_BCLK |
-				(chip_info->bclk_wait & SPI_PERIOD_WAIT);
-	}
-
-	/* SPI mode */
-	tmp = spi->mode;
-	if (tmp & SPI_CS_HIGH) {
-		u32_EDIT(chip->control,
-				SPI_CONTROL_SSPOL, SPI_CONTROL_SSPOL_ACT_HIGH);
-	}
-	switch (tmp & SPI_MODE_3) {
-	case SPI_MODE_0:
-		tmp = 0;
-		break;
-	case SPI_MODE_1:
-		tmp = SPI_CONTROL_PHA_1;
-		break;
-	case SPI_MODE_2:
-		tmp = SPI_CONTROL_POL_ACT_LOW;
-		break;
-	default:
-		/* SPI_MODE_3 */
-		tmp = SPI_CONTROL_PHA_1 | SPI_CONTROL_POL_ACT_LOW;
-		break;
-	}
-	u32_EDIT(chip->control, SPI_CONTROL_POL | SPI_CONTROL_PHA, tmp);
-
-	/* SPI word width */
-	tmp = spi->bits_per_word;
-	if (tmp > 16) {
-		status = -EINVAL;
-		dev_err(&spi->dev,
-			"setup - "
-			"invalid bits_per_word (%d)\n",
-			tmp);
-		if (first_setup)
-			goto err_first_setup;
-		else {
-			/* Undo setup using chip as backup copy */
-			tmp = chip->bits_per_word;
-			spi->bits_per_word = tmp;
-		}
-	}
-	chip->bits_per_word = tmp;
-	u32_EDIT(chip->control, SPI_CONTROL_BITCOUNT_MASK, tmp - 1);
-	chip->n_bytes = (tmp <= 8) ? 1 : 2;
-
-	/* SPI datarate */
-	tmp = spi_data_rate(drv_data, spi->max_speed_hz);
-	if (tmp == SPI_CONTROL_DATARATE_BAD) {
-		status = -EINVAL;
-		dev_err(&spi->dev,
-			"setup - "
-			"HW min speed (%d Hz) exceeds required "
-			"max speed (%d Hz)\n",
-			spi_speed_hz(drv_data, SPI_CONTROL_DATARATE_MIN),
-			spi->max_speed_hz);
-		if (first_setup)
-			goto err_first_setup;
-		else
-			/* Undo setup using chip as backup copy */
-			spi->max_speed_hz = chip->max_speed_hz;
-	} else {
-		u32_EDIT(chip->control, SPI_CONTROL_DATARATE, tmp);
-		/* Actual rounded max_speed_hz */
-		tmp = spi_speed_hz(drv_data, tmp);
-		spi->max_speed_hz = tmp;
-		chip->max_speed_hz = tmp;
-	}
-
-	/* SPI chip-select management */
-	if (chip_info->cs_control)
-		chip->cs_control = chip_info->cs_control;
-	else
-		chip->cs_control = null_cs_control;
-
-	/* Save controller_state */
-	spi_set_ctldata(spi, chip);
-
-	/* Summary */
-	dev_dbg(&spi->dev,
-		"setup succeded\n"
-		"    loopback enable   = %s\n"
-		"    dma enable        = %s\n"
-		"    insert /ss pulse  = %s\n"
-		"    period wait       = %d\n"
-		"    mode              = %d\n"
-		"    bits per word     = %d\n"
-		"    min speed         = %d Hz\n"
-		"    rounded max speed = %d Hz\n",
-		chip->test & SPI_TEST_LBC ? "Yes" : "No",
-		chip->enable_dma ? "Yes" : "No",
-		chip->control & SPI_CONTROL_SSCTL ? "Yes" : "No",
-		chip->period & SPI_PERIOD_WAIT,
-		spi->mode,
-		spi->bits_per_word,
-		spi_speed_hz(drv_data, SPI_CONTROL_DATARATE_MIN),
-		spi->max_speed_hz);
-	return status;
-
-err_first_setup:
-	kfree(chip);
-	return status;
-}
-
-static void cleanup(struct spi_device *spi)
-{
-	kfree(spi_get_ctldata(spi));
-}
-
-static int __init init_queue(struct driver_data *drv_data)
-{
-	INIT_LIST_HEAD(&drv_data->queue);
-	spin_lock_init(&drv_data->lock);
-
-	drv_data->run = QUEUE_STOPPED;
-	drv_data->busy = 0;
-
-	tasklet_init(&drv_data->pump_transfers,
-			pump_transfers,	(unsigned long)drv_data);
-
-	INIT_WORK(&drv_data->work, pump_messages);
-	drv_data->workqueue = create_singlethread_workqueue(
-				dev_name(drv_data->master->dev.parent));
-	if (drv_data->workqueue == NULL)
-		return -EBUSY;
-
-	return 0;
-}
-
-static int start_queue(struct driver_data *drv_data)
-{
-	unsigned long flags;
-
-	spin_lock_irqsave(&drv_data->lock, flags);
-
-	if (drv_data->run == QUEUE_RUNNING || drv_data->busy) {
-		spin_unlock_irqrestore(&drv_data->lock, flags);
-		return -EBUSY;
-	}
-
-	drv_data->run = QUEUE_RUNNING;
-	drv_data->cur_msg = NULL;
-	drv_data->cur_transfer = NULL;
-	drv_data->cur_chip = NULL;
-	spin_unlock_irqrestore(&drv_data->lock, flags);
-
-	queue_work(drv_data->workqueue, &drv_data->work);
-
-	return 0;
-}
-
-static int stop_queue(struct driver_data *drv_data)
-{
-	unsigned long flags;
-	unsigned limit = 500;
-	int status = 0;
-
-	spin_lock_irqsave(&drv_data->lock, flags);
-
-	/* This is a bit lame, but is optimized for the common execution path.
-	 * A wait_queue on the drv_data->busy could be used, but then the common
-	 * execution path (pump_messages) would be required to call wake_up or
-	 * friends on every SPI message. Do this instead */
-	drv_data->run = QUEUE_STOPPED;
-	while (!list_empty(&drv_data->queue) && drv_data->busy && limit--) {
-		spin_unlock_irqrestore(&drv_data->lock, flags);
-		msleep(10);
-		spin_lock_irqsave(&drv_data->lock, flags);
-	}
-
-	if (!list_empty(&drv_data->queue) || drv_data->busy)
-		status = -EBUSY;
-
-	spin_unlock_irqrestore(&drv_data->lock, flags);
-
-	return status;
-}
-
-static int destroy_queue(struct driver_data *drv_data)
-{
-	int status;
-
-	status = stop_queue(drv_data);
-	if (status != 0)
-		return status;
-
-	if (drv_data->workqueue)
-		destroy_workqueue(drv_data->workqueue);
-
-	return 0;
-}
-
-static int __init spi_imx_probe(struct platform_device *pdev)
-{
-	struct device *dev = &pdev->dev;
-	struct spi_imx_master *platform_info;
-	struct spi_master *master;
-	struct driver_data *drv_data;
-	struct resource *res;
-	int irq, status = 0;
-
-	platform_info = dev->platform_data;
-	if (platform_info == NULL) {
-		dev_err(&pdev->dev, "probe - no platform data supplied\n");
-		status = -ENODEV;
-		goto err_no_pdata;
-	}
-
-	/* Allocate master with space for drv_data */
-	master = spi_alloc_master(dev, sizeof(struct driver_data));
-	if (!master) {
-		dev_err(&pdev->dev, "probe - cannot alloc spi_master\n");
-		status = -ENOMEM;
-		goto err_no_mem;
-	}
-	drv_data = spi_master_get_devdata(master);
-	drv_data->master = master;
-	drv_data->master_info = platform_info;
-	drv_data->pdev = pdev;
-
-	/* the spi->mode bits understood by this driver: */
-	master->mode_bits = SPI_CPOL | SPI_CPHA | SPI_CS_HIGH;
-
-	master->bus_num = pdev->id;
-	master->num_chipselect = platform_info->num_chipselect;
-	master->dma_alignment = DMA_ALIGNMENT;
-	master->cleanup = cleanup;
-	master->setup = setup;
-	master->transfer = transfer;
-
-	drv_data->dummy_dma_buf = SPI_DUMMY_u32;
-
-	drv_data->clk = clk_get(&pdev->dev, "perclk2");
-	if (IS_ERR(drv_data->clk)) {
-		dev_err(&pdev->dev, "probe - cannot get clock\n");
-		status = PTR_ERR(drv_data->clk);
-		goto err_no_clk;
-	}
-	clk_enable(drv_data->clk);
-
-	/* Find and map resources */
-	res = platform_get_resource(pdev, IORESOURCE_MEM, 0);
-	if (!res) {
-		dev_err(&pdev->dev, "probe - MEM resources not defined\n");
-		status = -ENODEV;
-		goto err_no_iores;
-	}
-	drv_data->ioarea = request_mem_region(res->start,
-						res->end - res->start + 1,
-						pdev->name);
-	if (drv_data->ioarea == NULL) {
-		dev_err(&pdev->dev, "probe - cannot reserve region\n");
-		status = -ENXIO;
-		goto err_no_iores;
-	}
-	drv_data->regs = ioremap(res->start, res->end - res->start + 1);
-	if (drv_data->regs == NULL) {
-		dev_err(&pdev->dev, "probe - cannot map IO\n");
-		status = -ENXIO;
-		goto err_no_iomap;
-	}
-	drv_data->rd_data_phys = (dma_addr_t)res->start;
-
-	/* Attach to IRQ */
-	irq = platform_get_irq(pdev, 0);
-	if (irq < 0) {
-		dev_err(&pdev->dev, "probe - IRQ resource not defined\n");
-		status = -ENODEV;
-		goto err_no_irqres;
-	}
-	status = request_irq(irq, spi_int, IRQF_DISABLED,
-			     dev_name(dev), drv_data);
-	if (status < 0) {
-		dev_err(&pdev->dev, "probe - cannot get IRQ (%d)\n", status);
-		goto err_no_irqres;
-	}
-
-	/* Setup DMA if requested */
-	drv_data->tx_channel = -1;
-	drv_data->rx_channel = -1;
-	if (platform_info->enable_dma) {
-		/* Get rx DMA channel */
-		drv_data->rx_channel = imx_dma_request_by_prio("spi_imx_rx",
-							       DMA_PRIO_HIGH);
-		if (drv_data->rx_channel < 0) {
-			dev_err(dev,
-				"probe - problem (%d) requesting rx channel\n",
-				drv_data->rx_channel);
-			goto err_no_rxdma;
-		} else
-			imx_dma_setup_handlers(drv_data->rx_channel, NULL,
-						dma_err_handler, drv_data);
-
-		/* Get tx DMA channel */
-		drv_data->tx_channel = imx_dma_request_by_prio("spi_imx_tx",
-							       DMA_PRIO_MEDIUM);
-		if (drv_data->tx_channel < 0) {
-			dev_err(dev,
-				"probe - problem (%d) requesting tx channel\n",
-				drv_data->tx_channel);
-			imx_dma_free(drv_data->rx_channel);
-			goto err_no_txdma;
-		} else
-			imx_dma_setup_handlers(drv_data->tx_channel,
-						dma_tx_handler, dma_err_handler,
-						drv_data);
-
-		/* Set request source and burst length for allocated channels */
-		switch (drv_data->pdev->id) {
-		case 1:
-			/* Using SPI1 */
-			RSSR(drv_data->rx_channel) = DMA_REQ_SPI1_R;
-			RSSR(drv_data->tx_channel) = DMA_REQ_SPI1_T;
-			break;
-		case 2:
-			/* Using SPI2 */
-			RSSR(drv_data->rx_channel) = DMA_REQ_SPI2_R;
-			RSSR(drv_data->tx_channel) = DMA_REQ_SPI2_T;
-			break;
-		default:
-			dev_err(dev, "probe - bad SPI Id\n");
-			imx_dma_free(drv_data->rx_channel);
-			imx_dma_free(drv_data->tx_channel);
-			status = -ENODEV;
-			goto err_no_devid;
-		}
-		BLR(drv_data->rx_channel) = SPI_DMA_BLR;
-		BLR(drv_data->tx_channel) = SPI_DMA_BLR;
-	}
-
-	/* Load default SPI configuration */
-	writel(SPI_RESET_START, drv_data->regs + SPI_RESET);
-	writel(0, drv_data->regs + SPI_RESET);
-	writel(SPI_DEFAULT_CONTROL, drv_data->regs + SPI_CONTROL);
-
-	/* Initial and start queue */
-	status = init_queue(drv_data);
-	if (status != 0) {
-		dev_err(&pdev->dev, "probe - problem initializing queue\n");
-		goto err_init_queue;
-	}
-	status = start_queue(drv_data);
-	if (status != 0) {
-		dev_err(&pdev->dev, "probe - problem starting queue\n");
-		goto err_start_queue;
-	}
-
-	/* Register with the SPI framework */
-	platform_set_drvdata(pdev, drv_data);
-	status = spi_register_master(master);
-	if (status != 0) {
-		dev_err(&pdev->dev, "probe - problem registering spi master\n");
-		goto err_spi_register;
-	}
-
-	dev_dbg(dev, "probe succeded\n");
-	return 0;
-
-err_init_queue:
-err_start_queue:
-err_spi_register:
-	destroy_queue(drv_data);
-
-err_no_rxdma:
-err_no_txdma:
-err_no_devid:
-	free_irq(irq, drv_data);
-
-err_no_irqres:
-	iounmap(drv_data->regs);
-
-err_no_iomap:
-	release_resource(drv_data->ioarea);
-	kfree(drv_data->ioarea);
-
-err_no_iores:
-	clk_disable(drv_data->clk);
-	clk_put(drv_data->clk);
-
-err_no_clk:
-	spi_master_put(master);
-
-err_no_pdata:
-err_no_mem:
-	return status;
-}
-
-static int __exit spi_imx_remove(struct platform_device *pdev)
-{
-	struct driver_data *drv_data = platform_get_drvdata(pdev);
-	int irq;
-	int status = 0;
-
-	if (!drv_data)
-		return 0;
-
-	tasklet_kill(&drv_data->pump_transfers);
-
-	/* Remove the queue */
-	status = destroy_queue(drv_data);
-	if (status != 0) {
-		dev_err(&pdev->dev, "queue remove failed (%d)\n", status);
-		return status;
-	}
-
-	/* Reset SPI */
-	writel(SPI_RESET_START, drv_data->regs + SPI_RESET);
-	writel(0, drv_data->regs + SPI_RESET);
-
-	/* Release DMA */
-	if (drv_data->master_info->enable_dma) {
-		RSSR(drv_data->rx_channel) = 0;
-		RSSR(drv_data->tx_channel) = 0;
-		imx_dma_free(drv_data->tx_channel);
-		imx_dma_free(drv_data->rx_channel);
-	}
-
-	/* Release IRQ */
-	irq = platform_get_irq(pdev, 0);
-	if (irq >= 0)
-		free_irq(irq, drv_data);
-
-	clk_disable(drv_data->clk);
-	clk_put(drv_data->clk);
-
-	/* Release map resources */
-	iounmap(drv_data->regs);
-	release_resource(drv_data->ioarea);
-	kfree(drv_data->ioarea);
-
-	/* Disconnect from the SPI framework */
-	spi_unregister_master(drv_data->master);
-	spi_master_put(drv_data->master);
-
-	/* Prevent double remove */
-	platform_set_drvdata(pdev, NULL);
-
-	dev_dbg(&pdev->dev, "remove succeded\n");
-
-	return 0;
-}
-
-static void spi_imx_shutdown(struct platform_device *pdev)
-{
-	struct driver_data *drv_data = platform_get_drvdata(pdev);
-
-	/* Reset SPI */
-	writel(SPI_RESET_START, drv_data->regs + SPI_RESET);
-	writel(0, drv_data->regs + SPI_RESET);
-
-	dev_dbg(&pdev->dev, "shutdown succeded\n");
-}
-
-#ifdef CONFIG_PM
-
-static int spi_imx_suspend(struct platform_device *pdev, pm_message_t state)
-{
-	struct driver_data *drv_data = platform_get_drvdata(pdev);
-	int status = 0;
-
-	status = stop_queue(drv_data);
-	if (status != 0) {
-		dev_warn(&pdev->dev, "suspend cannot stop queue\n");
-		return status;
-	}
-
-	dev_dbg(&pdev->dev, "suspended\n");
-
-	return 0;
-}
-
-static int spi_imx_resume(struct platform_device *pdev)
-{
-	struct driver_data *drv_data = platform_get_drvdata(pdev);
-	int status = 0;
-
-	/* Start the queue running */
-	status = start_queue(drv_data);
-	if (status != 0)
-		dev_err(&pdev->dev, "problem starting queue (%d)\n", status);
-	else
-		dev_dbg(&pdev->dev, "resumed\n");
-
-	return status;
-}
-#else
-#define spi_imx_suspend NULL
-#define spi_imx_resume NULL
-#endif /* CONFIG_PM */
-
-/* work with hotplug and coldplug */
-MODULE_ALIAS("platform:spi_imx");
-
-static struct platform_driver driver = {
-	.driver = {
-		.name = "spi_imx",
-		.owner = THIS_MODULE,
-	},
-	.remove = __exit_p(spi_imx_remove),
-	.shutdown = spi_imx_shutdown,
-	.suspend = spi_imx_suspend,
-	.resume = spi_imx_resume,
-};
-
-static int __init spi_imx_init(void)
-{
-	return platform_driver_probe(&driver, spi_imx_probe);
-}
-module_init(spi_imx_init);
-
-static void __exit spi_imx_exit(void)
-{
-	platform_driver_unregister(&driver);
-}
-module_exit(spi_imx_exit);
-
-MODULE_AUTHOR("Andrea Paterniani, <a.paterniani@swapp-eng.it>");
-MODULE_DESCRIPTION("iMX SPI Controller Driver");
-MODULE_LICENSE("GPL");
diff --git a/drivers/spi/spi_ppc4xx.c b/drivers/spi/spi_ppc4xx.c
new file mode 100644
index 0000000..140a18d
--- /dev/null
+++ b/drivers/spi/spi_ppc4xx.c
@@ -0,0 +1,612 @@
+/*
+ * SPI_PPC4XX SPI controller driver.
+ *
+ * Copyright (C) 2007 Gary Jennejohn <garyj@denx.de>
+ * Copyright 2008 Stefan Roese <sr@denx.de>, DENX Software Engineering
+ * Copyright 2009 Harris Corporation, Steven A. Falco <sfalco@harris.com>
+ *
+ * Based in part on drivers/spi/spi_s3c24xx.c
+ *
+ * Copyright (c) 2006 Ben Dooks
+ * Copyright (c) 2006 Simtec Electronics
+ *	Ben Dooks <ben@simtec.co.uk>
+ *
+ * This program is free software; you can redistribute  it and/or modify it
+ * under the terms of the GNU General Public License version 2 as published
+ * by the Free Software Foundation.
+ */
+
+/*
+ * The PPC4xx SPI controller has no FIFO so each sent/received byte will
+ * generate an interrupt to the CPU. This can cause high CPU utilization.
+ * This driver allows platforms to reduce the interrupt load on the CPU
+ * during SPI transfers by setting max_speed_hz via the device tree.
+ */
+
+#include <linux/module.h>
+#include <linux/init.h>
+#include <linux/sched.h>
+#include <linux/errno.h>
+#include <linux/wait.h>
+#include <linux/of_platform.h>
+#include <linux/of_spi.h>
+#include <linux/of_gpio.h>
+#include <linux/interrupt.h>
+#include <linux/delay.h>
+
+#include <linux/gpio.h>
+#include <linux/spi/spi.h>
+#include <linux/spi/spi_bitbang.h>
+
+#include <asm/io.h>
+#include <asm/dcr.h>
+#include <asm/dcr-regs.h>
+
+/* bits in mode register - bit 0 is MSb */
+
+/*
+ * SPI_PPC4XX_MODE_SCP = 0 means "data latched on trailing edge of clock"
+ * SPI_PPC4XX_MODE_SCP = 1 means "data latched on leading edge of clock"
+ * Note: This is the inverse of CPHA.
+ */
+#define SPI_PPC4XX_MODE_SCP	(0x80 >> 3)
+
+/* SPI_PPC4XX_MODE_SPE = 1 means "port enabled" */
+#define SPI_PPC4XX_MODE_SPE	(0x80 >> 4)
+
+/*
+ * SPI_PPC4XX_MODE_RD = 0 means "MSB first" - this is the normal mode
+ * SPI_PPC4XX_MODE_RD = 1 means "LSB first" - this is bit-reversed mode
+ * Note: This is identical to SPI_LSB_FIRST.
+ */
+#define SPI_PPC4XX_MODE_RD	(0x80 >> 5)
+
+/*
+ * SPI_PPC4XX_MODE_CI = 0 means "clock idles low"
+ * SPI_PPC4XX_MODE_CI = 1 means "clock idles high"
+ * Note: This is identical to CPOL.
+ */
+#define SPI_PPC4XX_MODE_CI	(0x80 >> 6)
+
+/*
+ * SPI_PPC4XX_MODE_IL = 0 means "loopback disable"
+ * SPI_PPC4XX_MODE_IL = 1 means "loopback enable"
+ */
+#define SPI_PPC4XX_MODE_IL	(0x80 >> 7)
+
+/* bits in control register */
+/* starts a transfer when set */
+#define SPI_PPC4XX_CR_STR	(0x80 >> 7)
+
+/* bits in status register */
+/* port is busy with a transfer */
+#define SPI_PPC4XX_SR_BSY	(0x80 >> 6)
+/* RxD ready */
+#define SPI_PPC4XX_SR_RBR	(0x80 >> 7)
+
+/* clock settings (SCP and CI) for various SPI modes */
+#define SPI_CLK_MODE0	(SPI_PPC4XX_MODE_SCP | 0)
+#define SPI_CLK_MODE1	(0 | 0)
+#define SPI_CLK_MODE2	(SPI_PPC4XX_MODE_SCP | SPI_PPC4XX_MODE_CI)
+#define SPI_CLK_MODE3	(0 | SPI_PPC4XX_MODE_CI)
+
+#define DRIVER_NAME	"spi_ppc4xx_of"
+
+struct spi_ppc4xx_regs {
+	u8 mode;
+	u8 rxd;
+	u8 txd;
+	u8 cr;
+	u8 sr;
+	u8 dummy;
+	/*
+	 * Clock divisor modulus register
+	 * This uses the follwing formula:
+	 *    SCPClkOut = OPBCLK/(4(CDM + 1))
+	 * or
+	 *    CDM = (OPBCLK/4*SCPClkOut) - 1
+	 * bit 0 is the MSb!
+	 */
+	u8 cdm;
+};
+
+/* SPI Controller driver's private data. */
+struct ppc4xx_spi {
+	/* bitbang has to be first */
+	struct spi_bitbang bitbang;
+	struct completion done;
+
+	u64 mapbase;
+	u64 mapsize;
+	int irqnum;
+	/* need this to set the SPI clock */
+	unsigned int opb_freq;
+
+	/* for transfers */
+	int len;
+	int count;
+	/* data buffers */
+	const unsigned char *tx;
+	unsigned char *rx;
+
+	int *gpios;
+
+	struct spi_ppc4xx_regs __iomem *regs; /* pointer to the registers */
+	struct spi_master *master;
+	struct device *dev;
+};
+
+/* need this so we can set the clock in the chipselect routine */
+struct spi_ppc4xx_cs {
+	u8 mode;
+};
+
+static int spi_ppc4xx_txrx(struct spi_device *spi, struct spi_transfer *t)
+{
+	struct ppc4xx_spi *hw;
+	u8 data;
+
+	dev_dbg(&spi->dev, "txrx: tx %p, rx %p, len %d\n",
+		t->tx_buf, t->rx_buf, t->len);
+
+	hw = spi_master_get_devdata(spi->master);
+
+	hw->tx = t->tx_buf;
+	hw->rx = t->rx_buf;
+	hw->len = t->len;
+	hw->count = 0;
+
+	/* send the first byte */
+	data = hw->tx ? hw->tx[0] : 0;
+	out_8(&hw->regs->txd, data);
+	out_8(&hw->regs->cr, SPI_PPC4XX_CR_STR);
+	wait_for_completion(&hw->done);
+
+	return hw->count;
+}
+
+static int spi_ppc4xx_setupxfer(struct spi_device *spi, struct spi_transfer *t)
+{
+	struct ppc4xx_spi *hw = spi_master_get_devdata(spi->master);
+	struct spi_ppc4xx_cs *cs = spi->controller_state;
+	int scr;
+	u8 cdm = 0;
+	u32 speed;
+	u8 bits_per_word;
+
+	/* Start with the generic configuration for this device. */
+	bits_per_word = spi->bits_per_word;
+	speed = spi->max_speed_hz;
+
+	/*
+	 * Modify the configuration if the transfer overrides it.  Do not allow
+	 * the transfer to overwrite the generic configuration with zeros.
+	 */
+	if (t) {
+		if (t->bits_per_word)
+			bits_per_word = t->bits_per_word;
+
+		if (t->speed_hz)
+			speed = min(t->speed_hz, spi->max_speed_hz);
+	}
+
+	if (bits_per_word != 8) {
+		dev_err(&spi->dev, "invalid bits-per-word (%d)\n",
+				bits_per_word);
+		return -EINVAL;
+	}
+
+	if (!speed || (speed > spi->max_speed_hz)) {
+		dev_err(&spi->dev, "invalid speed_hz (%d)\n", speed);
+		return -EINVAL;
+	}
+
+	/* Write new configration */
+	out_8(&hw->regs->mode, cs->mode);
+
+	/* Set the clock */
+	/* opb_freq was already divided by 4 */
+	scr = (hw->opb_freq / speed) - 1;
+	if (scr > 0)
+		cdm = min(scr, 0xff);
+
+	dev_dbg(&spi->dev, "setting pre-scaler to %d (hz %d)\n", cdm, speed);
+
+	if (in_8(&hw->regs->cdm) != cdm)
+		out_8(&hw->regs->cdm, cdm);
+
+	spin_lock(&hw->bitbang.lock);
+	if (!hw->bitbang.busy) {
+		hw->bitbang.chipselect(spi, BITBANG_CS_INACTIVE);
+		/* Need to ndelay here? */
+	}
+	spin_unlock(&hw->bitbang.lock);
+
+	return 0;
+}
+
+static int spi_ppc4xx_setup(struct spi_device *spi)
+{
+	struct spi_ppc4xx_cs *cs = spi->controller_state;
+
+	if (spi->bits_per_word != 8) {
+		dev_err(&spi->dev, "invalid bits-per-word (%d)\n",
+			spi->bits_per_word);
+		return -EINVAL;
+	}
+
+	if (!spi->max_speed_hz) {
+		dev_err(&spi->dev, "invalid max_speed_hz (must be non-zero)\n");
+		return -EINVAL;
+	}
+
+	if (cs == NULL) {
+		cs = kzalloc(sizeof *cs, GFP_KERNEL);
+		if (!cs)
+			return -ENOMEM;
+		spi->controller_state = cs;
+	}
+
+	/*
+	 * We set all bits of the SPI0_MODE register, so,
+	 * no need to read-modify-write
+	 */
+	cs->mode = SPI_PPC4XX_MODE_SPE;
+
+	switch (spi->mode & (SPI_CPHA | SPI_CPOL)) {
+	case SPI_MODE_0:
+		cs->mode |= SPI_CLK_MODE0;
+		break;
+	case SPI_MODE_1:
+		cs->mode |= SPI_CLK_MODE1;
+		break;
+	case SPI_MODE_2:
+		cs->mode |= SPI_CLK_MODE2;
+		break;
+	case SPI_MODE_3:
+		cs->mode |= SPI_CLK_MODE3;
+		break;
+	}
+
+	if (spi->mode & SPI_LSB_FIRST)
+		cs->mode |= SPI_PPC4XX_MODE_RD;
+
+	return 0;
+}
+
+static void spi_ppc4xx_chipsel(struct spi_device *spi, int value)
+{
+	struct ppc4xx_spi *hw = spi_master_get_devdata(spi->master);
+	unsigned int cs = spi->chip_select;
+	unsigned int cspol;
+
+	/*
+	 * If there are no chip selects at all, or if this is the special
+	 * case of a non-existent (dummy) chip select, do nothing.
+	 */
+
+	if (!hw->master->num_chipselect || hw->gpios[cs] == -EEXIST)
+		return;
+
+	cspol = spi->mode & SPI_CS_HIGH ? 1 : 0;
+	if (value == BITBANG_CS_INACTIVE)
+		cspol = !cspol;
+
+	gpio_set_value(hw->gpios[cs], cspol);
+}
+
+static irqreturn_t spi_ppc4xx_int(int irq, void *dev_id)
+{
+	struct ppc4xx_spi *hw;
+	u8 status;
+	u8 data;
+	unsigned int count;
+
+	hw = (struct ppc4xx_spi *)dev_id;
+
+	status = in_8(&hw->regs->sr);
+	if (!status)
+		return IRQ_NONE;
+
+	/*
+	 * BSY de-asserts one cycle after the transfer is complete.  The
+	 * interrupt is asserted after the transfer is complete.  The exact
+	 * relationship is not documented, hence this code.
+	 */
+
+	if (unlikely(status & SPI_PPC4XX_SR_BSY)) {
+		u8 lstatus;
+		int cnt = 0;
+
+		dev_dbg(hw->dev, "got interrupt but spi still busy?\n");
+		do {
+			ndelay(10);
+			lstatus = in_8(&hw->regs->sr);
+		} while (++cnt < 100 && lstatus & SPI_PPC4XX_SR_BSY);
+
+		if (cnt >= 100) {
+			dev_err(hw->dev, "busywait: too many loops!\n");
+			complete(&hw->done);
+			return IRQ_HANDLED;
+		} else {
+			/* status is always 1 (RBR) here */
+			status = in_8(&hw->regs->sr);
+			dev_dbg(hw->dev, "loops %d status %x\n", cnt, status);
+		}
+	}
+
+	count = hw->count;
+	hw->count++;
+
+	/* RBR triggered this interrupt.  Therefore, data must be ready. */
+	data = in_8(&hw->regs->rxd);
+	if (hw->rx)
+		hw->rx[count] = data;
+
+	count++;
+
+	if (count < hw->len) {
+		data = hw->tx ? hw->tx[count] : 0;
+		out_8(&hw->regs->txd, data);
+		out_8(&hw->regs->cr, SPI_PPC4XX_CR_STR);
+	} else {
+		complete(&hw->done);
+	}
+
+	return IRQ_HANDLED;
+}
+
+static void spi_ppc4xx_cleanup(struct spi_device *spi)
+{
+	kfree(spi->controller_state);
+}
+
+static void spi_ppc4xx_enable(struct ppc4xx_spi *hw)
+{
+	/*
+	 * On all 4xx PPC's the SPI bus is shared/multiplexed with
+	 * the 2nd I2C bus. We need to enable the the SPI bus before
+	 * using it.
+	 */
+
+	/* need to clear bit 14 to enable SPC */
+	dcri_clrset(SDR0, SDR0_PFC1, 0x80000000 >> 14, 0);
+}
+
+static void free_gpios(struct ppc4xx_spi *hw)
+{
+	if (hw->master->num_chipselect) {
+		int i;
+		for (i = 0; i < hw->master->num_chipselect; i++)
+			if (gpio_is_valid(hw->gpios[i]))
+				gpio_free(hw->gpios[i]);
+
+		kfree(hw->gpios);
+		hw->gpios = NULL;
+	}
+}
+
+/*
+ * of_device layer stuff...
+ */
+static int __init spi_ppc4xx_of_probe(struct of_device *op,
+				      const struct of_device_id *match)
+{
+	struct ppc4xx_spi *hw;
+	struct spi_master *master;
+	struct spi_bitbang *bbp;
+	struct resource resource;
+	struct device_node *np = op->node;
+	struct device *dev = &op->dev;
+	struct device_node *opbnp;
+	int ret;
+	int num_gpios;
+	const unsigned int *clk;
+
+	master = spi_alloc_master(dev, sizeof *hw);
+	if (master == NULL)
+		return -ENOMEM;
+	dev_set_drvdata(dev, master);
+	hw = spi_master_get_devdata(master);
+	hw->master = spi_master_get(master);
+	hw->dev = dev;
+
+	init_completion(&hw->done);
+
+	/*
+	 * A count of zero implies a single SPI device without any chip-select.
+	 * Note that of_gpio_count counts all gpios assigned to this spi master.
+	 * This includes both "null" gpio's and real ones.
+	 */
+	num_gpios = of_gpio_count(np);
+	if (num_gpios) {
+		int i;
+
+		hw->gpios = kzalloc(sizeof(int) * num_gpios, GFP_KERNEL);
+		if (!hw->gpios) {
+			ret = -ENOMEM;
+			goto free_master;
+		}
+
+		for (i = 0; i < num_gpios; i++) {
+			int gpio;
+			enum of_gpio_flags flags;
+
+			gpio = of_get_gpio_flags(np, i, &flags);
+			hw->gpios[i] = gpio;
+
+			if (gpio_is_valid(gpio)) {
+				/* Real CS - set the initial state. */
+				ret = gpio_request(gpio, np->name);
+				if (ret < 0) {
+					dev_err(dev, "can't request gpio "
+							"#%d: %d\n", i, ret);
+					goto free_gpios;
+				}
+
+				gpio_direction_output(gpio,
+						!!(flags & OF_GPIO_ACTIVE_LOW));
+			} else if (gpio == -EEXIST) {
+				; /* No CS, but that's OK. */
+			} else {
+				dev_err(dev, "invalid gpio #%d: %d\n", i, gpio);
+				ret = -EINVAL;
+				goto free_gpios;
+			}
+		}
+	}
+
+	/* Setup the state for the bitbang driver */
+	bbp = &hw->bitbang;
+	bbp->master = hw->master;
+	bbp->setup_transfer = spi_ppc4xx_setupxfer;
+	bbp->chipselect = spi_ppc4xx_chipsel;
+	bbp->txrx_bufs = spi_ppc4xx_txrx;
+	bbp->use_dma = 0;
+	bbp->master->setup = spi_ppc4xx_setup;
+	bbp->master->cleanup = spi_ppc4xx_cleanup;
+
+	/* Allocate bus num dynamically. */
+	bbp->master->bus_num = -1;
+
+	/* the spi->mode bits understood by this driver: */
+	bbp->master->mode_bits =
+		SPI_CPHA | SPI_CPOL | SPI_CS_HIGH | SPI_LSB_FIRST;
+
+	/* this many pins in all GPIO controllers */
+	bbp->master->num_chipselect = num_gpios;
+
+	/* Get the clock for the OPB */
+	opbnp = of_find_compatible_node(NULL, NULL, "ibm,opb");
+	if (opbnp == NULL) {
+		dev_err(dev, "OPB: cannot find node\n");
+		ret = -ENODEV;
+		goto free_gpios;
+	}
+	/* Get the clock (Hz) for the OPB */
+	clk = of_get_property(opbnp, "clock-frequency", NULL);
+	if (clk == NULL) {
+		dev_err(dev, "OPB: no clock-frequency property set\n");
+		of_node_put(opbnp);
+		ret = -ENODEV;
+		goto free_gpios;
+	}
+	hw->opb_freq = *clk;
+	hw->opb_freq >>= 2;
+	of_node_put(opbnp);
+
+	ret = of_address_to_resource(np, 0, &resource);
+	if (ret) {
+		dev_err(dev, "error while parsing device node resource\n");
+		goto free_gpios;
+	}
+	hw->mapbase = resource.start;
+	hw->mapsize = resource.end - resource.start + 1;
+
+	/* Sanity check */
+	if (hw->mapsize < sizeof(struct spi_ppc4xx_regs)) {
+		dev_err(dev, "too small to map registers\n");
+		ret = -EINVAL;
+		goto free_gpios;
+	}
+
+	/* Request IRQ */
+	hw->irqnum = irq_of_parse_and_map(np, 0);
+	ret = request_irq(hw->irqnum, spi_ppc4xx_int,
+			  IRQF_DISABLED, "spi_ppc4xx_of", (void *)hw);
+	if (ret) {
+		dev_err(dev, "unable to allocate interrupt\n");
+		goto free_gpios;
+	}
+
+	if (!request_mem_region(hw->mapbase, hw->mapsize, DRIVER_NAME)) {
+		dev_err(dev, "resource unavailable\n");
+		ret = -EBUSY;
+		goto request_mem_error;
+	}
+
+	hw->regs = ioremap(hw->mapbase, sizeof(struct spi_ppc4xx_regs));
+
+	if (!hw->regs) {
+		dev_err(dev, "unable to memory map registers\n");
+		ret = -ENXIO;
+		goto map_io_error;
+	}
+
+	spi_ppc4xx_enable(hw);
+
+	/* Finally register our spi controller */
+	dev->dma_mask = 0;
+	ret = spi_bitbang_start(bbp);
+	if (ret) {
+		dev_err(dev, "failed to register SPI master\n");
+		goto unmap_regs;
+	}
+
+	dev_info(dev, "driver initialized\n");
+	of_register_spi_devices(master, np);
+
+	return 0;
+
+unmap_regs:
+	iounmap(hw->regs);
+map_io_error:
+	release_mem_region(hw->mapbase, hw->mapsize);
+request_mem_error:
+	free_irq(hw->irqnum, hw);
+free_gpios:
+	free_gpios(hw);
+free_master:
+	dev_set_drvdata(dev, NULL);
+	spi_master_put(master);
+
+	dev_err(dev, "initialization failed\n");
+	return ret;
+}
+
+static int __exit spi_ppc4xx_of_remove(struct of_device *op)
+{
+	struct spi_master *master = dev_get_drvdata(&op->dev);
+	struct ppc4xx_spi *hw = spi_master_get_devdata(master);
+
+	spi_bitbang_stop(&hw->bitbang);
+	dev_set_drvdata(&op->dev, NULL);
+	release_mem_region(hw->mapbase, hw->mapsize);
+	free_irq(hw->irqnum, hw);
+	iounmap(hw->regs);
+	free_gpios(hw);
+	return 0;
+}
+
+static struct of_device_id spi_ppc4xx_of_match[] = {
+	{ .compatible = "ibm,ppc4xx-spi", },
+	{},
+};
+
+MODULE_DEVICE_TABLE(of, spi_ppc4xx_of_match);
+
+static struct of_platform_driver spi_ppc4xx_of_driver = {
+	.match_table = spi_ppc4xx_of_match,
+	.probe = spi_ppc4xx_of_probe,
+	.remove = __exit_p(spi_ppc4xx_of_remove),
+	.driver = {
+		.name = DRIVER_NAME,
+		.owner = THIS_MODULE,
+	},
+};
+
+static int __init spi_ppc4xx_init(void)
+{
+	return of_register_platform_driver(&spi_ppc4xx_of_driver);
+}
+module_init(spi_ppc4xx_init);
+
+static void __exit spi_ppc4xx_exit(void)
+{
+	of_unregister_platform_driver(&spi_ppc4xx_of_driver);
+}
+module_exit(spi_ppc4xx_exit);
+
+MODULE_AUTHOR("Gary Jennejohn & Stefan Roese");
+MODULE_DESCRIPTION("Simple PPC4xx SPI Driver");
+MODULE_LICENSE("GPL");
diff --git a/drivers/spi/spi_s3c24xx.c b/drivers/spi/spi_s3c24xx.c
index 6ba8aec..33d94f7 100644
--- a/drivers/spi/spi_s3c24xx.c
+++ b/drivers/spi/spi_s3c24xx.c
@@ -20,17 +20,28 @@
 #include <linux/clk.h>
 #include <linux/platform_device.h>
 #include <linux/gpio.h>
+#include <linux/io.h>
 
 #include <linux/spi/spi.h>
 #include <linux/spi/spi_bitbang.h>
 
-#include <asm/io.h>
-#include <asm/dma.h>
-#include <mach/hardware.h>
-
 #include <plat/regs-spi.h>
 #include <mach/spi.h>
 
+/**
+ * s3c24xx_spi_devstate - per device data
+ * @hz: Last frequency calculated for @sppre field.
+ * @mode: Last mode setting for the @spcon field.
+ * @spcon: Value to write to the SPCON register.
+ * @sppre: Value to write to the SPPRE register.
+ */
+struct s3c24xx_spi_devstate {
+	unsigned int	hz;
+	unsigned int	mode;
+	u8		spcon;
+	u8		sppre;
+};
+
 struct s3c24xx_spi {
 	/* bitbang has to be first */
 	struct spi_bitbang	 bitbang;
@@ -71,43 +82,31 @@
 
 static void s3c24xx_spi_chipsel(struct spi_device *spi, int value)
 {
+	struct s3c24xx_spi_devstate *cs = spi->controller_state;
 	struct s3c24xx_spi *hw = to_hw(spi);
 	unsigned int cspol = spi->mode & SPI_CS_HIGH ? 1 : 0;
-	unsigned int spcon;
+
+	/* change the chipselect state and the state of the spi engine clock */
 
 	switch (value) {
 	case BITBANG_CS_INACTIVE:
 		hw->set_cs(hw->pdata, spi->chip_select, cspol^1);
+		writeb(cs->spcon, hw->regs + S3C2410_SPCON);
 		break;
 
 	case BITBANG_CS_ACTIVE:
-		spcon = readb(hw->regs + S3C2410_SPCON);
-
-		if (spi->mode & SPI_CPHA)
-			spcon |= S3C2410_SPCON_CPHA_FMTB;
-		else
-			spcon &= ~S3C2410_SPCON_CPHA_FMTB;
-
-		if (spi->mode & SPI_CPOL)
-			spcon |= S3C2410_SPCON_CPOL_HIGH;
-		else
-			spcon &= ~S3C2410_SPCON_CPOL_HIGH;
-
-		spcon |= S3C2410_SPCON_ENSCK;
-
-		/* write new configration */
-
-		writeb(spcon, hw->regs + S3C2410_SPCON);
+		writeb(cs->spcon | S3C2410_SPCON_ENSCK,
+		       hw->regs + S3C2410_SPCON);
 		hw->set_cs(hw->pdata, spi->chip_select, cspol);
-
 		break;
 	}
 }
 
-static int s3c24xx_spi_setupxfer(struct spi_device *spi,
-				 struct spi_transfer *t)
+static int s3c24xx_spi_update_state(struct spi_device *spi,
+				    struct spi_transfer *t)
 {
 	struct s3c24xx_spi *hw = to_hw(spi);
+	struct s3c24xx_spi_devstate *cs = spi->controller_state;
 	unsigned int bpw;
 	unsigned int hz;
 	unsigned int div;
@@ -127,17 +126,73 @@
 		return -EINVAL;
 	}
 
-	clk = clk_get_rate(hw->clk);
-	div = DIV_ROUND_UP(clk, hz * 2) - 1;
+	if (spi->mode != cs->mode) {
+		u8 spcon = SPCON_DEFAULT;
 
-	if (div > 255)
-		div = 255;
+		if (spi->mode & SPI_CPHA)
+			spcon |= S3C2410_SPCON_CPHA_FMTB;
 
-	dev_dbg(&spi->dev, "setting pre-scaler to %d (wanted %d, got %ld)\n",
-		div, hz, clk / (2 * (div + 1)));
+		if (spi->mode & SPI_CPOL)
+			spcon |= S3C2410_SPCON_CPOL_HIGH;
 
+		cs->mode = spi->mode;
+		cs->spcon = spcon;
+	}
 
-	writeb(div, hw->regs + S3C2410_SPPRE);
+	if (cs->hz != hz) {
+		clk = clk_get_rate(hw->clk);
+		div = DIV_ROUND_UP(clk, hz * 2) - 1;
+
+		if (div > 255)
+			div = 255;
+
+		dev_dbg(&spi->dev, "pre-scaler=%d (wanted %d, got %ld)\n",
+			div, hz, clk / (2 * (div + 1)));
+
+		cs->hz = hz;
+		cs->sppre = div;
+	}
+
+	return 0;
+}
+
+static int s3c24xx_spi_setupxfer(struct spi_device *spi,
+				 struct spi_transfer *t)
+{
+	struct s3c24xx_spi_devstate *cs = spi->controller_state;
+	struct s3c24xx_spi *hw = to_hw(spi);
+	int ret;
+
+	ret = s3c24xx_spi_update_state(spi, t);
+	if (!ret)
+		writeb(cs->sppre, hw->regs + S3C2410_SPPRE);
+
+	return ret;
+}
+
+static int s3c24xx_spi_setup(struct spi_device *spi)
+{
+	struct s3c24xx_spi_devstate *cs = spi->controller_state;
+	struct s3c24xx_spi *hw = to_hw(spi);
+	int ret;
+
+	/* allocate settings on the first call */
+	if (!cs) {
+		cs = kzalloc(sizeof(struct s3c24xx_spi_devstate), GFP_KERNEL);
+		if (!cs) {
+			dev_err(&spi->dev, "no memory for controller state\n");
+			return -ENOMEM;
+		}
+
+		cs->spcon = SPCON_DEFAULT;
+		cs->hz = -1;
+		spi->controller_state = cs;
+	}
+
+	/* initialise the state from the device */
+	ret = s3c24xx_spi_update_state(spi, NULL);
+	if (ret)
+		return ret;
 
 	spin_lock(&hw->bitbang.lock);
 	if (!hw->bitbang.busy) {
@@ -149,17 +204,9 @@
 	return 0;
 }
 
-static int s3c24xx_spi_setup(struct spi_device *spi)
+static void s3c24xx_spi_cleanup(struct spi_device *spi)
 {
-	int ret;
-
-	ret = s3c24xx_spi_setupxfer(spi, NULL);
-	if (ret < 0) {
-		dev_err(&spi->dev, "setupxfer returned %d\n", ret);
-		return ret;
-	}
-
-	return 0;
+	kfree(spi->controller_state);
 }
 
 static inline unsigned int hw_txbyte(struct s3c24xx_spi *hw, int count)
@@ -289,7 +336,9 @@
 	hw->bitbang.setup_transfer = s3c24xx_spi_setupxfer;
 	hw->bitbang.chipselect     = s3c24xx_spi_chipsel;
 	hw->bitbang.txrx_bufs      = s3c24xx_spi_txrx;
-	hw->bitbang.master->setup  = s3c24xx_spi_setup;
+
+	hw->master->setup  = s3c24xx_spi_setup;
+	hw->master->cleanup = s3c24xx_spi_cleanup;
 
 	dev_dbg(hw->dev, "bitbang at %p\n", &hw->bitbang);
 
@@ -302,7 +351,7 @@
 		goto err_no_iores;
 	}
 
-	hw->ioarea = request_mem_region(res->start, (res->end - res->start)+1,
+	hw->ioarea = request_mem_region(res->start, resource_size(res),
 					pdev->name);
 
 	if (hw->ioarea == NULL) {
@@ -311,7 +360,7 @@
 		goto err_no_iores;
 	}
 
-	hw->regs = ioremap(res->start, (res->end - res->start)+1);
+	hw->regs = ioremap(res->start, resource_size(res));
 	if (hw->regs == NULL) {
 		dev_err(&pdev->dev, "Cannot map IO\n");
 		err = -ENXIO;
@@ -421,9 +470,9 @@
 
 #ifdef CONFIG_PM
 
-static int s3c24xx_spi_suspend(struct platform_device *pdev, pm_message_t msg)
+static int s3c24xx_spi_suspend(struct device *dev)
 {
-	struct s3c24xx_spi *hw = platform_get_drvdata(pdev);
+	struct s3c24xx_spi *hw = platform_get_drvdata(to_platform_device(dev));
 
 	if (hw->pdata && hw->pdata->gpio_setup)
 		hw->pdata->gpio_setup(hw->pdata, 0);
@@ -432,27 +481,31 @@
 	return 0;
 }
 
-static int s3c24xx_spi_resume(struct platform_device *pdev)
+static int s3c24xx_spi_resume(struct device *dev)
 {
-	struct s3c24xx_spi *hw = platform_get_drvdata(pdev);
+	struct s3c24xx_spi *hw = platform_get_drvdata(to_platform_device(dev));
 
 	s3c24xx_spi_initialsetup(hw);
 	return 0;
 }
 
+static struct dev_pm_ops s3c24xx_spi_pmops = {
+	.suspend	= s3c24xx_spi_suspend,
+	.resume		= s3c24xx_spi_resume,
+};
+
+#define S3C24XX_SPI_PMOPS &s3c24xx_spi_pmops
 #else
-#define s3c24xx_spi_suspend NULL
-#define s3c24xx_spi_resume  NULL
-#endif
+#define S3C24XX_SPI_PMOPS NULL
+#endif /* CONFIG_PM */
 
 MODULE_ALIAS("platform:s3c2410-spi");
 static struct platform_driver s3c24xx_spi_driver = {
 	.remove		= __exit_p(s3c24xx_spi_remove),
-	.suspend	= s3c24xx_spi_suspend,
-	.resume		= s3c24xx_spi_resume,
 	.driver		= {
 		.name	= "s3c2410-spi",
 		.owner	= THIS_MODULE,
+		.pm	= S3C24XX_SPI_PMOPS,
 	},
 };
 
diff --git a/drivers/spi/spi_stmp.c b/drivers/spi/spi_stmp.c
new file mode 100644
index 0000000..d871dc2
--- /dev/null
+++ b/drivers/spi/spi_stmp.c
@@ -0,0 +1,679 @@
+/*
+ * Freescale STMP378X SPI master driver
+ *
+ * Author: dmitry pervushin <dimka@embeddedalley.com>
+ *
+ * Copyright 2008 Freescale Semiconductor, Inc. All Rights Reserved.
+ * Copyright 2008 Embedded Alley Solutions, Inc All Rights Reserved.
+ */
+
+/*
+ * The code contained herein is licensed under the GNU General Public
+ * License. You may obtain a copy of the GNU General Public License
+ * Version 2 or later at the following locations:
+ *
+ * http://www.opensource.org/licenses/gpl-license.html
+ * http://www.gnu.org/copyleft/gpl.html
+ */
+#include <linux/module.h>
+#include <linux/init.h>
+#include <linux/interrupt.h>
+#include <linux/platform_device.h>
+#include <linux/spi/spi.h>
+#include <linux/err.h>
+#include <linux/clk.h>
+#include <linux/io.h>
+#include <linux/dma-mapping.h>
+#include <linux/delay.h>
+
+#include <mach/platform.h>
+#include <mach/stmp3xxx.h>
+#include <mach/dma.h>
+#include <mach/regs-ssp.h>
+#include <mach/regs-apbh.h>
+
+
+/* 0 means DMA mode(recommended, default), !0 - PIO mode */
+static int pio;
+static int clock;
+
+/* default timeout for busy waits is 2 seconds */
+#define STMP_SPI_TIMEOUT	(2 * HZ)
+
+struct stmp_spi {
+	int		id;
+
+	void *  __iomem regs;	/* vaddr of the control registers */
+
+	int		irq, err_irq;
+	u32		dma;
+	struct stmp3xxx_dma_descriptor d;
+
+	u32		speed_khz;
+	u32		saved_timings;
+	u32		divider;
+
+	struct clk	*clk;
+	struct device	*master_dev;
+
+	struct work_struct work;
+	struct workqueue_struct *workqueue;
+
+	/* lock protects queue access */
+	spinlock_t lock;
+	struct list_head queue;
+
+	struct completion done;
+};
+
+#define busy_wait(cond)							\
+	({								\
+	unsigned long end_jiffies = jiffies + STMP_SPI_TIMEOUT;		\
+	bool succeeded = false;						\
+	do {								\
+		if (cond) {						\
+			succeeded = true;				\
+			break;						\
+		}							\
+		cpu_relax();						\
+	} while (time_before(end_jiffies, jiffies));			\
+	succeeded;							\
+	})
+
+/**
+ * stmp_spi_init_hw
+ * Initialize the SSP port
+ */
+static int stmp_spi_init_hw(struct stmp_spi *ss)
+{
+	int err = 0;
+	void *pins = ss->master_dev->platform_data;
+
+	err = stmp3xxx_request_pin_group(pins, dev_name(ss->master_dev));
+	if (err)
+		goto out;
+
+	ss->clk = clk_get(NULL, "ssp");
+	if (IS_ERR(ss->clk)) {
+		err = PTR_ERR(ss->clk);
+		goto out_free_pins;
+	}
+	clk_enable(ss->clk);
+
+	stmp3xxx_reset_block(ss->regs, false);
+	stmp3xxx_dma_reset_channel(ss->dma);
+
+	return 0;
+
+out_free_pins:
+	stmp3xxx_release_pin_group(pins, dev_name(ss->master_dev));
+out:
+	return err;
+}
+
+static void stmp_spi_release_hw(struct stmp_spi *ss)
+{
+	void *pins = ss->master_dev->platform_data;
+
+	if (ss->clk && !IS_ERR(ss->clk)) {
+		clk_disable(ss->clk);
+		clk_put(ss->clk);
+	}
+	stmp3xxx_release_pin_group(pins, dev_name(ss->master_dev));
+}
+
+static int stmp_spi_setup_transfer(struct spi_device *spi,
+		struct spi_transfer *t)
+{
+	u8 bits_per_word;
+	u32 hz;
+	struct stmp_spi *ss = spi_master_get_devdata(spi->master);
+	u16 rate;
+
+	bits_per_word = spi->bits_per_word;
+	if (t && t->bits_per_word)
+		bits_per_word = t->bits_per_word;
+
+	/*
+	 * Calculate speed:
+	 *	- by default, use maximum speed from ssp clk
+	 *	- if device overrides it, use it
+	 *	- if transfer specifies other speed, use transfer's one
+	 */
+	hz = 1000 * ss->speed_khz / ss->divider;
+	if (spi->max_speed_hz)
+		hz = min(hz, spi->max_speed_hz);
+	if (t && t->speed_hz)
+		hz = min(hz, t->speed_hz);
+
+	if (hz == 0) {
+		dev_err(&spi->dev, "Cannot continue with zero clock\n");
+		return -EINVAL;
+	}
+
+	if (bits_per_word != 8) {
+		dev_err(&spi->dev, "%s, unsupported bits_per_word=%d\n",
+			__func__, bits_per_word);
+		return -EINVAL;
+	}
+
+	dev_dbg(&spi->dev, "Requested clk rate = %uHz, max = %uHz/%d = %uHz\n",
+		hz, ss->speed_khz, ss->divider,
+		ss->speed_khz * 1000 / ss->divider);
+
+	if (ss->speed_khz * 1000 / ss->divider < hz) {
+		dev_err(&spi->dev, "%s, unsupported clock rate %uHz\n",
+			__func__, hz);
+		return -EINVAL;
+	}
+
+	rate = 1000 * ss->speed_khz/ss->divider/hz;
+
+	writel(BF(ss->divider, SSP_TIMING_CLOCK_DIVIDE)		|
+	       BF(rate - 1, SSP_TIMING_CLOCK_RATE),
+	       HW_SSP_TIMING + ss->regs);
+
+	writel(BF(1 /* mode SPI */, SSP_CTRL1_SSP_MODE)		|
+	       BF(4 /* 8 bits   */, SSP_CTRL1_WORD_LENGTH)	|
+	       ((spi->mode & SPI_CPOL) ? BM_SSP_CTRL1_POLARITY : 0) |
+	       ((spi->mode & SPI_CPHA) ? BM_SSP_CTRL1_PHASE : 0) |
+	       (pio ? 0 : BM_SSP_CTRL1_DMA_ENABLE),
+	       ss->regs + HW_SSP_CTRL1);
+
+	return 0;
+}
+
+static int stmp_spi_setup(struct spi_device *spi)
+{
+	/* spi_setup() does basic checks,
+	 * stmp_spi_setup_transfer() does more later
+	 */
+	if (spi->bits_per_word != 8) {
+		dev_err(&spi->dev, "%s, unsupported bits_per_word=%d\n",
+			__func__, spi->bits_per_word);
+		return -EINVAL;
+	}
+	return 0;
+}
+
+static inline u32 stmp_spi_cs(unsigned cs)
+{
+	return  ((cs & 1) ? BM_SSP_CTRL0_WAIT_FOR_CMD : 0) |
+		((cs & 2) ? BM_SSP_CTRL0_WAIT_FOR_IRQ : 0);
+}
+
+static int stmp_spi_txrx_dma(struct stmp_spi *ss, int cs,
+		unsigned char *buf, dma_addr_t dma_buf, int len,
+		int first, int last, bool write)
+{
+	u32 c0 = 0;
+	dma_addr_t spi_buf_dma = dma_buf;
+	int status = 0;
+	enum dma_data_direction dir = write ? DMA_TO_DEVICE : DMA_FROM_DEVICE;
+
+	c0 |= (first ? BM_SSP_CTRL0_LOCK_CS : 0);
+	c0 |= (last ? BM_SSP_CTRL0_IGNORE_CRC : 0);
+	c0 |= (write ? 0 : BM_SSP_CTRL0_READ);
+	c0 |= BM_SSP_CTRL0_DATA_XFER;
+
+	c0 |= stmp_spi_cs(cs);
+
+	c0 |= BF(len, SSP_CTRL0_XFER_COUNT);
+
+	if (!dma_buf)
+		spi_buf_dma = dma_map_single(ss->master_dev, buf, len, dir);
+
+	ss->d.command->cmd =
+		BF(len, APBH_CHn_CMD_XFER_COUNT)	|
+		BF(1, APBH_CHn_CMD_CMDWORDS)		|
+		BM_APBH_CHn_CMD_WAIT4ENDCMD		|
+		BM_APBH_CHn_CMD_IRQONCMPLT		|
+		BF(write ? BV_APBH_CHn_CMD_COMMAND__DMA_READ :
+			   BV_APBH_CHn_CMD_COMMAND__DMA_WRITE,
+		   APBH_CHn_CMD_COMMAND);
+	ss->d.command->pio_words[0] = c0;
+	ss->d.command->buf_ptr = spi_buf_dma;
+
+	stmp3xxx_dma_reset_channel(ss->dma);
+	stmp3xxx_dma_clear_interrupt(ss->dma);
+	stmp3xxx_dma_enable_interrupt(ss->dma);
+	init_completion(&ss->done);
+	stmp3xxx_dma_go(ss->dma, &ss->d, 1);
+	wait_for_completion(&ss->done);
+
+	if (!busy_wait(readl(ss->regs + HW_SSP_CTRL0) & BM_SSP_CTRL0_RUN))
+		status = ETIMEDOUT;
+
+	if (!dma_buf)
+		dma_unmap_single(ss->master_dev, spi_buf_dma, len, dir);
+
+	return status;
+}
+
+static inline void stmp_spi_enable(struct stmp_spi *ss)
+{
+	stmp3xxx_setl(BM_SSP_CTRL0_LOCK_CS, ss->regs + HW_SSP_CTRL0);
+	stmp3xxx_clearl(BM_SSP_CTRL0_IGNORE_CRC, ss->regs + HW_SSP_CTRL0);
+}
+
+static inline void stmp_spi_disable(struct stmp_spi *ss)
+{
+	stmp3xxx_clearl(BM_SSP_CTRL0_LOCK_CS, ss->regs + HW_SSP_CTRL0);
+	stmp3xxx_setl(BM_SSP_CTRL0_IGNORE_CRC, ss->regs + HW_SSP_CTRL0);
+}
+
+static int stmp_spi_txrx_pio(struct stmp_spi *ss, int cs,
+		unsigned char *buf, int len,
+		bool first, bool last, bool write)
+{
+	if (first)
+		stmp_spi_enable(ss);
+
+	stmp3xxx_setl(stmp_spi_cs(cs), ss->regs + HW_SSP_CTRL0);
+
+	while (len--) {
+		if (last && len <= 0)
+			stmp_spi_disable(ss);
+
+		stmp3xxx_clearl(BM_SSP_CTRL0_XFER_COUNT,
+				ss->regs + HW_SSP_CTRL0);
+		stmp3xxx_setl(1, ss->regs + HW_SSP_CTRL0);
+
+		if (write)
+			stmp3xxx_clearl(BM_SSP_CTRL0_READ,
+					ss->regs + HW_SSP_CTRL0);
+		else
+			stmp3xxx_setl(BM_SSP_CTRL0_READ,
+					ss->regs + HW_SSP_CTRL0);
+
+		/* Run! */
+		stmp3xxx_setl(BM_SSP_CTRL0_RUN, ss->regs + HW_SSP_CTRL0);
+
+		if (!busy_wait(readl(ss->regs + HW_SSP_CTRL0) &
+				BM_SSP_CTRL0_RUN))
+			break;
+
+		if (write)
+			writel(*buf, ss->regs + HW_SSP_DATA);
+
+		/* Set TRANSFER */
+		stmp3xxx_setl(BM_SSP_CTRL0_DATA_XFER, ss->regs + HW_SSP_CTRL0);
+
+		if (!write) {
+			if (busy_wait((readl(ss->regs + HW_SSP_STATUS) &
+					BM_SSP_STATUS_FIFO_EMPTY)))
+				break;
+			*buf = readl(ss->regs + HW_SSP_DATA) & 0xFF;
+		}
+
+		if (!busy_wait(readl(ss->regs + HW_SSP_CTRL0) &
+					BM_SSP_CTRL0_RUN))
+			break;
+
+		/* advance to the next byte */
+		buf++;
+	}
+
+	return len < 0 ? 0 : -ETIMEDOUT;
+}
+
+static int stmp_spi_handle_message(struct stmp_spi *ss, struct spi_message *m)
+{
+	bool first, last;
+	struct spi_transfer *t, *tmp_t;
+	int status = 0;
+	int cs;
+
+	cs = m->spi->chip_select;
+
+	list_for_each_entry_safe(t, tmp_t, &m->transfers, transfer_list) {
+
+		first = (&t->transfer_list == m->transfers.next);
+		last = (&t->transfer_list == m->transfers.prev);
+
+		if (first || t->speed_hz || t->bits_per_word)
+			stmp_spi_setup_transfer(m->spi, t);
+
+		/* reject "not last" transfers which request to change cs */
+		if (t->cs_change && !last) {
+			dev_err(&m->spi->dev,
+				"Message with t->cs_change has been skipped\n");
+			continue;
+		}
+
+		if (t->tx_buf) {
+			status = pio ?
+			   stmp_spi_txrx_pio(ss, cs, (void *)t->tx_buf,
+				   t->len, first, last, true) :
+			   stmp_spi_txrx_dma(ss, cs, (void *)t->tx_buf,
+				   t->tx_dma, t->len, first, last, true);
+#ifdef DEBUG
+			if (t->len < 0x10)
+				print_hex_dump_bytes("Tx ",
+					DUMP_PREFIX_OFFSET,
+					t->tx_buf, t->len);
+			else
+				pr_debug("Tx: %d bytes\n", t->len);
+#endif
+		}
+		if (t->rx_buf) {
+			status = pio ?
+			   stmp_spi_txrx_pio(ss, cs, t->rx_buf,
+				   t->len, first, last, false) :
+			   stmp_spi_txrx_dma(ss, cs, t->rx_buf,
+				   t->rx_dma, t->len, first, last, false);
+#ifdef DEBUG
+			if (t->len < 0x10)
+				print_hex_dump_bytes("Rx ",
+					DUMP_PREFIX_OFFSET,
+					t->rx_buf, t->len);
+			else
+				pr_debug("Rx: %d bytes\n", t->len);
+#endif
+		}
+
+		if (t->delay_usecs)
+			udelay(t->delay_usecs);
+
+		if (status)
+			break;
+
+	}
+	return status;
+}
+
+/**
+ * stmp_spi_handle - handle messages from the queue
+ */
+static void stmp_spi_handle(struct work_struct *w)
+{
+	struct stmp_spi *ss = container_of(w, struct stmp_spi, work);
+	unsigned long flags;
+	struct spi_message *m;
+
+	spin_lock_irqsave(&ss->lock, flags);
+	while (!list_empty(&ss->queue)) {
+		m = list_entry(ss->queue.next, struct spi_message, queue);
+		list_del_init(&m->queue);
+		spin_unlock_irqrestore(&ss->lock, flags);
+
+		m->status = stmp_spi_handle_message(ss, m);
+		m->complete(m->context);
+
+		spin_lock_irqsave(&ss->lock, flags);
+	}
+	spin_unlock_irqrestore(&ss->lock, flags);
+
+	return;
+}
+
+/**
+ * stmp_spi_transfer - perform message transfer.
+ * Called indirectly from spi_async, queues all the messages to
+ * spi_handle_message.
+ * @spi: spi device
+ * @m: message to be queued
+ */
+static int stmp_spi_transfer(struct spi_device *spi, struct spi_message *m)
+{
+	struct stmp_spi *ss = spi_master_get_devdata(spi->master);
+	unsigned long flags;
+
+	m->status = -EINPROGRESS;
+	spin_lock_irqsave(&ss->lock, flags);
+	list_add_tail(&m->queue, &ss->queue);
+	queue_work(ss->workqueue, &ss->work);
+	spin_unlock_irqrestore(&ss->lock, flags);
+	return 0;
+}
+
+static irqreturn_t stmp_spi_irq(int irq, void *dev_id)
+{
+	struct stmp_spi *ss = dev_id;
+
+	stmp3xxx_dma_clear_interrupt(ss->dma);
+	complete(&ss->done);
+	return IRQ_HANDLED;
+}
+
+static irqreturn_t stmp_spi_irq_err(int irq, void *dev_id)
+{
+	struct stmp_spi *ss = dev_id;
+	u32 c1, st;
+
+	c1 = readl(ss->regs + HW_SSP_CTRL1);
+	st = readl(ss->regs + HW_SSP_STATUS);
+	dev_err(ss->master_dev, "%s: status = 0x%08X, c1 = 0x%08X\n",
+		__func__, st, c1);
+	stmp3xxx_clearl(c1 & 0xCCCC0000, ss->regs + HW_SSP_CTRL1);
+
+	return IRQ_HANDLED;
+}
+
+static int __devinit stmp_spi_probe(struct platform_device *dev)
+{
+	int err = 0;
+	struct spi_master *master;
+	struct stmp_spi *ss;
+	struct resource *r;
+
+	master = spi_alloc_master(&dev->dev, sizeof(struct stmp_spi));
+	if (master == NULL) {
+		err = -ENOMEM;
+		goto out0;
+	}
+	master->flags = SPI_MASTER_HALF_DUPLEX;
+
+	ss = spi_master_get_devdata(master);
+	platform_set_drvdata(dev, master);
+
+	/* Get resources(memory, IRQ) associated with the device */
+	r = platform_get_resource(dev, IORESOURCE_MEM, 0);
+	if (r == NULL) {
+		err = -ENODEV;
+		goto out_put_master;
+	}
+	ss->regs = ioremap(r->start, resource_size(r));
+	if (!ss->regs) {
+		err = -EINVAL;
+		goto out_put_master;
+	}
+
+	ss->master_dev = &dev->dev;
+	ss->id = dev->id;
+
+	INIT_WORK(&ss->work, stmp_spi_handle);
+	INIT_LIST_HEAD(&ss->queue);
+	spin_lock_init(&ss->lock);
+
+	ss->workqueue = create_singlethread_workqueue(dev_name(&dev->dev));
+	if (!ss->workqueue) {
+		err = -ENXIO;
+		goto out_put_master;
+	}
+	master->transfer = stmp_spi_transfer;
+	master->setup = stmp_spi_setup;
+
+	/* the spi->mode bits understood by this driver: */
+	master->mode_bits = SPI_CPOL | SPI_CPHA;
+
+	ss->irq = platform_get_irq(dev, 0);
+	if (ss->irq < 0) {
+		err = ss->irq;
+		goto out_put_master;
+	}
+	ss->err_irq = platform_get_irq(dev, 1);
+	if (ss->err_irq < 0) {
+		err = ss->err_irq;
+		goto out_put_master;
+	}
+
+	r = platform_get_resource(dev, IORESOURCE_DMA, 0);
+	if (r == NULL) {
+		err = -ENODEV;
+		goto out_put_master;
+	}
+
+	ss->dma = r->start;
+	err = stmp3xxx_dma_request(ss->dma, &dev->dev, dev_name(&dev->dev));
+	if (err)
+		goto out_put_master;
+
+	err = stmp3xxx_dma_allocate_command(ss->dma, &ss->d);
+	if (err)
+		goto out_free_dma;
+
+	master->bus_num = dev->id;
+	master->num_chipselect = 1;
+
+	/* SPI controller initializations */
+	err = stmp_spi_init_hw(ss);
+	if (err) {
+		dev_dbg(&dev->dev, "cannot initialize hardware\n");
+		goto out_free_dma_desc;
+	}
+
+	if (clock) {
+		dev_info(&dev->dev, "clock rate forced to %d\n", clock);
+		clk_set_rate(ss->clk, clock);
+	}
+	ss->speed_khz = clk_get_rate(ss->clk);
+	ss->divider = 2;
+	dev_info(&dev->dev, "max possible speed %d = %ld/%d kHz\n",
+		ss->speed_khz, clk_get_rate(ss->clk), ss->divider);
+
+	/* Register for SPI interrupt */
+	err = request_irq(ss->irq, stmp_spi_irq, 0,
+			  dev_name(&dev->dev), ss);
+	if (err) {
+		dev_dbg(&dev->dev, "request_irq failed, %d\n", err);
+		goto out_release_hw;
+	}
+
+	/* ..and shared interrupt for all SSP controllers */
+	err = request_irq(ss->err_irq, stmp_spi_irq_err, IRQF_SHARED,
+			  dev_name(&dev->dev), ss);
+	if (err) {
+		dev_dbg(&dev->dev, "request_irq(error) failed, %d\n", err);
+		goto out_free_irq;
+	}
+
+	err = spi_register_master(master);
+	if (err) {
+		dev_dbg(&dev->dev, "cannot register spi master, %d\n", err);
+		goto out_free_irq_2;
+	}
+	dev_info(&dev->dev, "at (mapped) 0x%08X, irq=%d, bus %d, %s mode\n",
+			(u32)ss->regs, ss->irq, master->bus_num,
+			pio ? "PIO" : "DMA");
+	return 0;
+
+out_free_irq_2:
+	free_irq(ss->err_irq, ss);
+out_free_irq:
+	free_irq(ss->irq, ss);
+out_free_dma_desc:
+	stmp3xxx_dma_free_command(ss->dma, &ss->d);
+out_free_dma:
+	stmp3xxx_dma_release(ss->dma);
+out_release_hw:
+	stmp_spi_release_hw(ss);
+out_put_master:
+	if (ss->workqueue)
+		destroy_workqueue(ss->workqueue);
+	if (ss->regs)
+		iounmap(ss->regs);
+	platform_set_drvdata(dev, NULL);
+	spi_master_put(master);
+out0:
+	return err;
+}
+
+static int __devexit stmp_spi_remove(struct platform_device *dev)
+{
+	struct stmp_spi *ss;
+	struct spi_master *master;
+
+	master = platform_get_drvdata(dev);
+	if (master == NULL)
+		goto out0;
+	ss = spi_master_get_devdata(master);
+
+	spi_unregister_master(master);
+
+	free_irq(ss->err_irq, ss);
+	free_irq(ss->irq, ss);
+	stmp3xxx_dma_free_command(ss->dma, &ss->d);
+	stmp3xxx_dma_release(ss->dma);
+	stmp_spi_release_hw(ss);
+	destroy_workqueue(ss->workqueue);
+	iounmap(ss->regs);
+	spi_master_put(master);
+	platform_set_drvdata(dev, NULL);
+out0:
+	return 0;
+}
+
+#ifdef CONFIG_PM
+static int stmp_spi_suspend(struct platform_device *pdev, pm_message_t pmsg)
+{
+	struct stmp_spi *ss;
+	struct spi_master *master;
+
+	master = platform_get_drvdata(pdev);
+	ss = spi_master_get_devdata(master);
+
+	ss->saved_timings = readl(HW_SSP_TIMING + ss->regs);
+	clk_disable(ss->clk);
+
+	return 0;
+}
+
+static int stmp_spi_resume(struct platform_device *pdev)
+{
+	struct stmp_spi *ss;
+	struct spi_master *master;
+
+	master = platform_get_drvdata(pdev);
+	ss = spi_master_get_devdata(master);
+
+	clk_enable(ss->clk);
+	stmp3xxx_reset_block(ss->regs, false);
+	writel(ss->saved_timings, ss->regs + HW_SSP_TIMING);
+
+	return 0;
+}
+
+#else
+#define stmp_spi_suspend NULL
+#define stmp_spi_resume  NULL
+#endif
+
+static struct platform_driver stmp_spi_driver = {
+	.probe	= stmp_spi_probe,
+	.remove	= __devexit_p(stmp_spi_remove),
+	.driver = {
+		.name = "stmp3xxx_ssp",
+		.owner = THIS_MODULE,
+	},
+	.suspend = stmp_spi_suspend,
+	.resume  = stmp_spi_resume,
+};
+
+static int __init stmp_spi_init(void)
+{
+	return platform_driver_register(&stmp_spi_driver);
+}
+
+static void __exit stmp_spi_exit(void)
+{
+	platform_driver_unregister(&stmp_spi_driver);
+}
+
+module_init(stmp_spi_init);
+module_exit(stmp_spi_exit);
+module_param(pio, int, S_IRUGO);
+module_param(clock, int, S_IRUGO);
+MODULE_AUTHOR("dmitry pervushin <dpervushin@embeddedalley.com>");
+MODULE_DESCRIPTION("STMP3xxx SPI/SSP driver");
+MODULE_LICENSE("GPL");
diff --git a/drivers/spi/spidev.c b/drivers/spi/spidev.c
index 606e7a4..f921bd1 100644
--- a/drivers/spi/spidev.c
+++ b/drivers/spi/spidev.c
@@ -688,3 +688,4 @@
 MODULE_AUTHOR("Andrea Paterniani, <a.paterniani@swapp-eng.it>");
 MODULE_DESCRIPTION("User mode SPI device interface");
 MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:spidev");
diff --git a/drivers/spi/tle62x0.c b/drivers/spi/tle62x0.c
index 455991f..bf9540f 100644
--- a/drivers/spi/tle62x0.c
+++ b/drivers/spi/tle62x0.c
@@ -329,3 +329,4 @@
 MODULE_AUTHOR("Ben Dooks <ben@simtec.co.uk>");
 MODULE_DESCRIPTION("TLE62x0 SPI driver");
 MODULE_LICENSE("GPL v2");
+MODULE_ALIAS("spi:tle62x0");
diff --git a/drivers/staging/stlc45xx/stlc45xx.c b/drivers/staging/stlc45xx/stlc45xx.c
index 12d414d..be99eb3 100644
--- a/drivers/staging/stlc45xx/stlc45xx.c
+++ b/drivers/staging/stlc45xx/stlc45xx.c
@@ -2591,3 +2591,4 @@
 
 MODULE_LICENSE("GPL");
 MODULE_AUTHOR("Kalle Valo <kalle.valo@nokia.com>");
+MODULE_ALIAS("spi:cx3110x");
diff --git a/drivers/video/Kconfig b/drivers/video/Kconfig
index 11af4cb..9bbb285 100644
--- a/drivers/video/Kconfig
+++ b/drivers/video/Kconfig
@@ -1275,26 +1275,6 @@
 	  painting procedures (the secondary head does not use acceleration
 	  engine).
 
-config FB_MATROX_MULTIHEAD
-	bool "Multihead support"
-	depends on FB_MATROX
-	---help---
-	  Say Y here if you have more than one (supported) Matrox device in
-	  your computer and you want to use all of them for different monitors
-	  ("multihead"). If you have only one device, you should say N because
-	  the driver compiled with Y is larger and a bit slower, especially on
-	  ia32 (ix86).
-
-	  If you said M to "Matrox unified accelerated driver" and N here, you
-	  will still be able to use several Matrox devices simultaneously:
-	  insert several instances of the module matroxfb into the kernel
-	  with insmod, supplying the parameter "dev=N" where N is 0, 1, etc.
-	  for the different Matrox devices. This method is slightly faster but
-	  uses 40 KB of kernel memory per Matrox card.
-
-	  There is no need for enabling 'Matrox multihead support' if you have
-	  only one Matrox card in the box.
-
 config FB_RADEON
 	tristate "ATI Radeon display support"
 	depends on FB && PCI
@@ -2041,6 +2021,17 @@
 	  and 8, 15 or 16 bpp color; 90 degrees clockwise display rotation for
 	  panels <= 320 pixel horizontal resolution.
 
+config FB_DA8XX
+	tristate "DA8xx/OMAP-L1xx Framebuffer support"
+	depends on FB && ARCH_DAVINCI_DA8XX
+	select FB_CFB_FILLRECT
+	select FB_CFB_COPYAREA
+	select FB_CFB_IMAGEBLIT
+	---help---
+	  This is the frame buffer device driver for the TI LCD controller
+	  found on DA8xx/OMAP-L1xx SoCs.
+	  If unsure, say N.
+
 config FB_VIRTUAL
 	tristate "Virtual Frame Buffer support (ONLY FOR TESTING!)"
 	depends on FB
@@ -2117,6 +2108,17 @@
 	---help---
 	  Framebuffer support for Fujitsu Lime GDC on host CPU bus.
 
+config FB_EP93XX
+	tristate "EP93XX frame buffer support"
+	depends on FB && ARCH_EP93XX
+	select FB_CFB_FILLRECT
+	select FB_CFB_COPYAREA
+	select FB_CFB_IMAGEBLIT
+	---help---
+	  Framebuffer driver for the Cirrus Logic EP93XX series of processors.
+	  This driver is also available as a module. The module will be called
+	  ep93xx-fb.
+
 config FB_PRE_INIT_FB
 	bool "Don't reinitialize, use bootloader's GDC/Display configuration"
 	depends on FB_MB862XX_LIME
@@ -2124,6 +2126,14 @@
 	  Select this option if display contents should be inherited as set by
 	  the bootloader.
 
+config FB_MSM
+	tristate
+	depends on FB && ARCH_MSM
+	select FB_CFB_FILLRECT
+	select FB_CFB_COPYAREA
+	select FB_CFB_IMAGEBLIT
+	default y
+
 config FB_MX3
 	tristate "MX3 Framebuffer support"
 	depends on FB && MX3_IPU
diff --git a/drivers/video/Makefile b/drivers/video/Makefile
index 01a819f..80232e1 100644
--- a/drivers/video/Makefile
+++ b/drivers/video/Makefile
@@ -85,6 +85,7 @@
 obj-$(CONFIG_FB_TGA)              += tgafb.o
 obj-$(CONFIG_FB_HP300)            += hpfb.o
 obj-$(CONFIG_FB_G364)             += g364fb.o
+obj-$(CONFIG_FB_EP93XX)		  += ep93xx-fb.o
 obj-$(CONFIG_FB_SA1100)           += sa1100fb.o
 obj-$(CONFIG_FB_HIT)              += hitfb.o
 obj-$(CONFIG_FB_EPSON1355)	  += epson1355fb.o
@@ -126,6 +127,7 @@
 obj-$(CONFIG_XEN_FBDEV_FRONTEND)  += xen-fbfront.o
 obj-$(CONFIG_FB_CARMINE)          += carminefb.o
 obj-$(CONFIG_FB_MB862XX)	  += mb862xx/
+obj-$(CONFIG_FB_MSM)              += msm/
 
 # Platform or fallback drivers go here
 obj-$(CONFIG_FB_UVESA)            += uvesafb.o
@@ -136,6 +138,7 @@
 obj-$(CONFIG_FB_BF54X_LQ043)	  += bf54x-lq043fb.o
 obj-$(CONFIG_FB_BFIN_T350MCQB)	  += bfin-t350mcqb-fb.o
 obj-$(CONFIG_FB_MX3)		  += mx3fb.o
+obj-$(CONFIG_FB_DA8XX)		  += da8xx-fb.o
 
 # the test framebuffer is last
 obj-$(CONFIG_FB_VIRTUAL)          += vfb.o
diff --git a/drivers/video/aty/atyfb_base.c b/drivers/video/aty/atyfb_base.c
index 63d3739..913b4a4 100644
--- a/drivers/video/aty/atyfb_base.c
+++ b/drivers/video/aty/atyfb_base.c
@@ -132,7 +132,7 @@
 #endif
 
 #define PRINTKI(fmt, args...)	printk(KERN_INFO "atyfb: " fmt, ## args)
-#define PRINTKE(fmt, args...)	 printk(KERN_ERR "atyfb: " fmt, ## args)
+#define PRINTKE(fmt, args...)	printk(KERN_ERR "atyfb: " fmt, ## args)
 
 #if defined(CONFIG_PM) || defined(CONFIG_PMAC_BACKLIGHT) || \
 defined (CONFIG_FB_ATY_GENERIC_LCD) || defined(CONFIG_FB_ATY_BACKLIGHT)
@@ -188,24 +188,23 @@
  */
 static void ATIReduceRatio(int *Numerator, int *Denominator)
 {
-    int Multiplier, Divider, Remainder;
+	int Multiplier, Divider, Remainder;
 
-    Multiplier = *Numerator;
-    Divider = *Denominator;
+	Multiplier = *Numerator;
+	Divider = *Denominator;
 
-    while ((Remainder = Multiplier % Divider))
-    {
-        Multiplier = Divider;
-        Divider = Remainder;
-    }
+	while ((Remainder = Multiplier % Divider)) {
+		Multiplier = Divider;
+		Divider = Remainder;
+	}
 
-    *Numerator /= Divider;
-    *Denominator /= Divider;
+	*Numerator /= Divider;
+	*Denominator /= Divider;
 }
 #endif
-    /*
-     *  The Hardware parameters for each card
-     */
+/*
+ * The Hardware parameters for each card
+ */
 
 struct pci_mmap_map {
 	unsigned long voff;
@@ -223,17 +222,19 @@
 	.ypanstep	= 1,
 };
 
-    /*
-     *  Frame buffer device API
-     */
+/*
+ * Frame buffer device API
+ */
 
 static int atyfb_open(struct fb_info *info, int user);
 static int atyfb_release(struct fb_info *info, int user);
-static int atyfb_check_var(struct fb_var_screeninfo *var, struct fb_info *info);
+static int atyfb_check_var(struct fb_var_screeninfo *var,
+			   struct fb_info *info);
 static int atyfb_set_par(struct fb_info *info);
 static int atyfb_setcolreg(u_int regno, u_int red, u_int green, u_int blue,
-	u_int transp, struct fb_info *info);
-static int atyfb_pan_display(struct fb_var_screeninfo *var, struct fb_info *info);
+			   u_int transp, struct fb_info *info);
+static int atyfb_pan_display(struct fb_var_screeninfo *var,
+			     struct fb_info *info);
 static int atyfb_blank(int blank, struct fb_info *info);
 static int atyfb_ioctl(struct fb_info *info, u_int cmd, u_long arg);
 #ifdef __sparc__
@@ -241,9 +242,9 @@
 #endif
 static int atyfb_sync(struct fb_info *info);
 
-    /*
-     *  Internal routines
-     */
+/*
+ * Internal routines
+ */
 
 static int aty_init(struct fb_info *info);
 
@@ -254,8 +255,11 @@
 static void aty_get_crtc(const struct atyfb_par *par, struct crtc *crtc);
 
 static void aty_set_crtc(const struct atyfb_par *par, const struct crtc *crtc);
-static int aty_var_to_crtc(const struct fb_info *info, const struct fb_var_screeninfo *var, struct crtc *crtc);
-static int aty_crtc_to_var(const struct crtc *crtc, struct fb_var_screeninfo *var);
+static int aty_var_to_crtc(const struct fb_info *info,
+			   const struct fb_var_screeninfo *var,
+			   struct crtc *crtc);
+static int aty_crtc_to_var(const struct crtc *crtc,
+			   struct fb_var_screeninfo *var);
 static void set_off_pitch(struct atyfb_par *par, const struct fb_info *info);
 #ifdef CONFIG_PPC
 static int read_aty_sense(const struct atyfb_par *par);
@@ -264,9 +268,9 @@
 static DEFINE_MUTEX(reboot_lock);
 static struct fb_info *reboot_info;
 
-    /*
-     *  Interface used by the world
-     */
+/*
+ * Interface used by the world
+ */
 
 static struct fb_var_screeninfo default_var = {
 	/* 640x480, 60 Hz, Non-Interlaced (25.175 MHz dotclock) */
@@ -452,14 +456,14 @@
 	type = chip_id & CFG_CHIP_TYPE;
 	rev = (chip_id & CFG_CHIP_REV) >> 24;
 
-	switch(par->pci_id) {
+	switch (par->pci_id) {
 #ifdef CONFIG_FB_ATY_GX
 	case PCI_CHIP_MACH64GX:
-		if(type != 0x00d7)
+		if (type != 0x00d7)
 			return -ENODEV;
 		break;
 	case PCI_CHIP_MACH64CX:
-		if(type != 0x0057)
+		if (type != 0x0057)
 			return -ENODEV;
 		break;
 #endif
@@ -564,7 +568,8 @@
 };
 #endif /* CONFIG_FB_ATY_CT */
 
-static u32 atyfb_get_pixclock(struct fb_var_screeninfo *var, struct atyfb_par *par)
+static u32 atyfb_get_pixclock(struct fb_var_screeninfo *var,
+			      struct atyfb_par *par)
 {
 	u32 pixclock = var->pixclock;
 #ifdef CONFIG_FB_ATY_GENERIC_LCD
@@ -572,7 +577,7 @@
 	par->pll.ct.xres = 0;
 	if (par->lcd_table != 0) {
 		lcd_on_off = aty_ld_lcd(LCD_GEN_CNTL, par);
-		if(lcd_on_off & LCD_ON) {
+		if (lcd_on_off & LCD_ON) {
 			par->pll.ct.xres = var->xres;
 			pixclock = par->lcd_pixclock;
 		}
@@ -584,7 +589,7 @@
 #if defined(CONFIG_PPC)
 
 /*
- *  Apple monitor sense
+ * Apple monitor sense
  */
 
 static int __devinit read_aty_sense(const struct atyfb_par *par)
@@ -625,16 +630,16 @@
 /* ------------------------------------------------------------------------- */
 
 /*
- *  CRTC programming
+ * CRTC programming
  */
 
 static void aty_get_crtc(const struct atyfb_par *par, struct crtc *crtc)
 {
 #ifdef CONFIG_FB_ATY_GENERIC_LCD
 	if (par->lcd_table != 0) {
-		if(!M64_HAS(LT_LCD_REGS)) {
-		    crtc->lcd_index = aty_ld_le32(LCD_INDEX, par);
-		    aty_st_le32(LCD_INDEX, crtc->lcd_index, par);
+		if (!M64_HAS(LT_LCD_REGS)) {
+			crtc->lcd_index = aty_ld_le32(LCD_INDEX, par);
+			aty_st_le32(LCD_INDEX, crtc->lcd_index, par);
 		}
 		crtc->lcd_config_panel = aty_ld_lcd(CNFG_PANEL, par);
 		crtc->lcd_gen_cntl = aty_ld_lcd(LCD_GEN_CNTL, par);
@@ -642,7 +647,7 @@
 
 		/* switch to non shadow registers */
 		aty_st_lcd(LCD_GEN_CNTL, crtc->lcd_gen_cntl &
-                    ~(CRTC_RW_SELECT | SHADOW_EN | SHADOW_RW_EN), par);
+			   ~(CRTC_RW_SELECT | SHADOW_EN | SHADOW_RW_EN), par);
 
 		/* save stretching */
 		crtc->horz_stretching = aty_ld_lcd(HORZ_STRETCHING, par);
@@ -663,7 +668,7 @@
 	if (par->lcd_table != 0) {
 		/* switch to shadow registers */
 		aty_st_lcd(LCD_GEN_CNTL, (crtc->lcd_gen_cntl & ~CRTC_RW_SELECT) |
-			SHADOW_EN | SHADOW_RW_EN, par);
+			   SHADOW_EN | SHADOW_RW_EN, par);
 
 		crtc->shadow_h_tot_disp = aty_ld_le32(CRTC_H_TOTAL_DISP, par);
 		crtc->shadow_h_sync_strt_wid = aty_ld_le32(CRTC_H_SYNC_STRT_WID, par);
@@ -680,21 +685,20 @@
 #ifdef CONFIG_FB_ATY_GENERIC_LCD
 	if (par->lcd_table != 0) {
 		/* stop CRTC */
-		aty_st_le32(CRTC_GEN_CNTL, crtc->gen_cntl & ~(CRTC_EXT_DISP_EN | CRTC_EN), par);
+		aty_st_le32(CRTC_GEN_CNTL, crtc->gen_cntl &
+			    ~(CRTC_EXT_DISP_EN | CRTC_EN), par);
 
 		/* update non-shadow registers first */
 		aty_st_lcd(CNFG_PANEL, crtc->lcd_config_panel, par);
 		aty_st_lcd(LCD_GEN_CNTL, crtc->lcd_gen_cntl &
-			~(CRTC_RW_SELECT | SHADOW_EN | SHADOW_RW_EN), par);
+			   ~(CRTC_RW_SELECT | SHADOW_EN | SHADOW_RW_EN), par);
 
 		/* temporarily disable stretching */
-		aty_st_lcd(HORZ_STRETCHING,
-			crtc->horz_stretching &
-			~(HORZ_STRETCH_MODE | HORZ_STRETCH_EN), par);
-		aty_st_lcd(VERT_STRETCHING,
-			crtc->vert_stretching &
-			~(VERT_STRETCH_RATIO1 | VERT_STRETCH_RATIO2 |
-			VERT_STRETCH_USE0 | VERT_STRETCH_EN), par);
+		aty_st_lcd(HORZ_STRETCHING, crtc->horz_stretching &
+			   ~(HORZ_STRETCH_MODE | HORZ_STRETCH_EN), par);
+		aty_st_lcd(VERT_STRETCHING, crtc->vert_stretching &
+			   ~(VERT_STRETCH_RATIO1 | VERT_STRETCH_RATIO2 |
+			     VERT_STRETCH_USE0 | VERT_STRETCH_EN), par);
 	}
 #endif
 	/* turn off CRT */
@@ -702,17 +706,19 @@
 
 	DPRINTK("setting up CRTC\n");
 	DPRINTK("set primary CRT to %ix%i %c%c composite %c\n",
-	    ((((crtc->h_tot_disp>>16) & 0xff) + 1)<<3), (((crtc->v_tot_disp>>16) & 0x7ff) + 1),
-	    (crtc->h_sync_strt_wid & 0x200000)?'N':'P', (crtc->v_sync_strt_wid & 0x200000)?'N':'P',
-	    (crtc->gen_cntl & CRTC_CSYNC_EN)?'P':'N');
+		((((crtc->h_tot_disp >> 16) & 0xff) + 1) << 3),
+		(((crtc->v_tot_disp >> 16) & 0x7ff) + 1),
+		(crtc->h_sync_strt_wid & 0x200000) ? 'N' : 'P',
+		(crtc->v_sync_strt_wid & 0x200000) ? 'N' : 'P',
+		(crtc->gen_cntl & CRTC_CSYNC_EN) ? 'P' : 'N');
 
-	DPRINTK("CRTC_H_TOTAL_DISP: %x\n",crtc->h_tot_disp);
-	DPRINTK("CRTC_H_SYNC_STRT_WID: %x\n",crtc->h_sync_strt_wid);
-	DPRINTK("CRTC_V_TOTAL_DISP: %x\n",crtc->v_tot_disp);
-	DPRINTK("CRTC_V_SYNC_STRT_WID: %x\n",crtc->v_sync_strt_wid);
+	DPRINTK("CRTC_H_TOTAL_DISP: %x\n", crtc->h_tot_disp);
+	DPRINTK("CRTC_H_SYNC_STRT_WID: %x\n", crtc->h_sync_strt_wid);
+	DPRINTK("CRTC_V_TOTAL_DISP: %x\n", crtc->v_tot_disp);
+	DPRINTK("CRTC_V_SYNC_STRT_WID: %x\n", crtc->v_sync_strt_wid);
 	DPRINTK("CRTC_OFF_PITCH: %x\n", crtc->off_pitch);
 	DPRINTK("CRTC_VLINE_CRNT_VLINE: %x\n", crtc->vline_crnt_vline);
-	DPRINTK("CRTC_GEN_CNTL: %x\n",crtc->gen_cntl);
+	DPRINTK("CRTC_GEN_CNTL: %x\n", crtc->gen_cntl);
 
 	aty_st_le32(CRTC_H_TOTAL_DISP, crtc->h_tot_disp, par);
 	aty_st_le32(CRTC_H_SYNC_STRT_WID, crtc->h_sync_strt_wid, par);
@@ -732,16 +738,22 @@
 	if (par->lcd_table != 0) {
 		/* switch to shadow registers */
 		aty_st_lcd(LCD_GEN_CNTL, (crtc->lcd_gen_cntl & ~CRTC_RW_SELECT) |
-			(SHADOW_EN | SHADOW_RW_EN), par);
+			   SHADOW_EN | SHADOW_RW_EN, par);
 
 		DPRINTK("set shadow CRT to %ix%i %c%c\n",
-		    ((((crtc->shadow_h_tot_disp>>16) & 0xff) + 1)<<3), (((crtc->shadow_v_tot_disp>>16) & 0x7ff) + 1),
-		    (crtc->shadow_h_sync_strt_wid & 0x200000)?'N':'P', (crtc->shadow_v_sync_strt_wid & 0x200000)?'N':'P');
+			((((crtc->shadow_h_tot_disp >> 16) & 0xff) + 1) << 3),
+			(((crtc->shadow_v_tot_disp >> 16) & 0x7ff) + 1),
+			(crtc->shadow_h_sync_strt_wid & 0x200000) ? 'N' : 'P',
+			(crtc->shadow_v_sync_strt_wid & 0x200000) ? 'N' : 'P');
 
-		DPRINTK("SHADOW CRTC_H_TOTAL_DISP: %x\n", crtc->shadow_h_tot_disp);
-		DPRINTK("SHADOW CRTC_H_SYNC_STRT_WID: %x\n", crtc->shadow_h_sync_strt_wid);
-		DPRINTK("SHADOW CRTC_V_TOTAL_DISP: %x\n", crtc->shadow_v_tot_disp);
-		DPRINTK("SHADOW CRTC_V_SYNC_STRT_WID: %x\n", crtc->shadow_v_sync_strt_wid);
+		DPRINTK("SHADOW CRTC_H_TOTAL_DISP: %x\n",
+			crtc->shadow_h_tot_disp);
+		DPRINTK("SHADOW CRTC_H_SYNC_STRT_WID: %x\n",
+			crtc->shadow_h_sync_strt_wid);
+		DPRINTK("SHADOW CRTC_V_TOTAL_DISP: %x\n",
+			crtc->shadow_v_tot_disp);
+		DPRINTK("SHADOW CRTC_V_SYNC_STRT_WID: %x\n",
+			crtc->shadow_v_sync_strt_wid);
 
 		aty_st_le32(CRTC_H_TOTAL_DISP, crtc->shadow_h_tot_disp, par);
 		aty_st_le32(CRTC_H_SYNC_STRT_WID, crtc->shadow_h_sync_strt_wid, par);
@@ -752,16 +764,16 @@
 		DPRINTK("LCD_GEN_CNTL: %x\n", crtc->lcd_gen_cntl);
 		DPRINTK("HORZ_STRETCHING: %x\n", crtc->horz_stretching);
 		DPRINTK("VERT_STRETCHING: %x\n", crtc->vert_stretching);
-		if(!M64_HAS(LT_LCD_REGS))
-		    DPRINTK("EXT_VERT_STRETCH: %x\n", crtc->ext_vert_stretch);
+		if (!M64_HAS(LT_LCD_REGS))
+			DPRINTK("EXT_VERT_STRETCH: %x\n", crtc->ext_vert_stretch);
 
 		aty_st_lcd(LCD_GEN_CNTL, crtc->lcd_gen_cntl, par);
 		aty_st_lcd(HORZ_STRETCHING, crtc->horz_stretching, par);
 		aty_st_lcd(VERT_STRETCHING, crtc->vert_stretching, par);
-		if(!M64_HAS(LT_LCD_REGS)) {
-		    aty_st_lcd(EXT_VERT_STRETCH, crtc->ext_vert_stretch, par);
-		    aty_ld_le32(LCD_INDEX, par);
-		    aty_st_le32(LCD_INDEX, crtc->lcd_index, par);
+		if (!M64_HAS(LT_LCD_REGS)) {
+			aty_st_lcd(EXT_VERT_STRETCH, crtc->ext_vert_stretch, par);
+			aty_ld_le32(LCD_INDEX, par);
+			aty_st_le32(LCD_INDEX, crtc->lcd_index, par);
 		}
 	}
 #endif /* CONFIG_FB_ATY_GENERIC_LCD */
@@ -779,7 +791,8 @@
 }
 
 static int aty_var_to_crtc(const struct fb_info *info,
-	const struct fb_var_screeninfo *var, struct crtc *crtc)
+			   const struct fb_var_screeninfo *var,
+			   struct crtc *crtc)
 {
 	struct atyfb_par *par = (struct atyfb_par *) info->par;
 	u32 xres, yres, vxres, vyres, xoffset, yoffset, bpp;
@@ -814,34 +827,32 @@
 	if (bpp <= 8) {
 		bpp = 8;
 		pix_width = CRTC_PIX_WIDTH_8BPP;
-		dp_pix_width =
-		    HOST_8BPP | SRC_8BPP | DST_8BPP |
-		    BYTE_ORDER_LSB_TO_MSB;
+		dp_pix_width = HOST_8BPP | SRC_8BPP | DST_8BPP |
+			BYTE_ORDER_LSB_TO_MSB;
 		dp_chain_mask = DP_CHAIN_8BPP;
 	} else if (bpp <= 15) {
 		bpp = 16;
 		pix_width = CRTC_PIX_WIDTH_15BPP;
 		dp_pix_width = HOST_15BPP | SRC_15BPP | DST_15BPP |
-		    BYTE_ORDER_LSB_TO_MSB;
+			BYTE_ORDER_LSB_TO_MSB;
 		dp_chain_mask = DP_CHAIN_15BPP;
 	} else if (bpp <= 16) {
 		bpp = 16;
 		pix_width = CRTC_PIX_WIDTH_16BPP;
 		dp_pix_width = HOST_16BPP | SRC_16BPP | DST_16BPP |
-		    BYTE_ORDER_LSB_TO_MSB;
+			BYTE_ORDER_LSB_TO_MSB;
 		dp_chain_mask = DP_CHAIN_16BPP;
 	} else if (bpp <= 24 && M64_HAS(INTEGRATED)) {
 		bpp = 24;
 		pix_width = CRTC_PIX_WIDTH_24BPP;
-		dp_pix_width =
-		    HOST_8BPP | SRC_8BPP | DST_8BPP |
-		    BYTE_ORDER_LSB_TO_MSB;
+		dp_pix_width = HOST_8BPP | SRC_8BPP | DST_8BPP |
+			BYTE_ORDER_LSB_TO_MSB;
 		dp_chain_mask = DP_CHAIN_24BPP;
 	} else if (bpp <= 32) {
 		bpp = 32;
 		pix_width = CRTC_PIX_WIDTH_32BPP;
 		dp_pix_width = HOST_32BPP | SRC_32BPP | DST_32BPP |
-		    BYTE_ORDER_LSB_TO_MSB;
+			BYTE_ORDER_LSB_TO_MSB;
 		dp_chain_mask = DP_CHAIN_32BPP;
 	} else
 		FAIL("invalid bpp");
@@ -854,9 +865,9 @@
 	h_sync_pol = sync & FB_SYNC_HOR_HIGH_ACT ? 0 : 1;
 	v_sync_pol = sync & FB_SYNC_VERT_HIGH_ACT ? 0 : 1;
 
-	if((xres > 1600) || (yres > 1200)) {
+	if ((xres > 1600) || (yres > 1200)) {
 		FAIL("MACH64 chips are designed for max 1600x1200\n"
-		"select anoter resolution.");
+		     "select anoter resolution.");
 	}
 	h_sync_strt = h_disp + var->right_margin;
 	h_sync_end = h_sync_strt + var->hsync_len;
@@ -869,11 +880,12 @@
 
 #ifdef CONFIG_FB_ATY_GENERIC_LCD
 	if (par->lcd_table != 0) {
-		if(!M64_HAS(LT_LCD_REGS)) {
-		    u32 lcd_index = aty_ld_le32(LCD_INDEX, par);
-		    crtc->lcd_index = lcd_index &
-			~(LCD_INDEX_MASK | LCD_DISPLAY_DIS | LCD_SRC_SEL | CRTC2_DISPLAY_DIS);
-		    aty_st_le32(LCD_INDEX, lcd_index, par);
+		if (!M64_HAS(LT_LCD_REGS)) {
+			u32 lcd_index = aty_ld_le32(LCD_INDEX, par);
+			crtc->lcd_index = lcd_index &
+				~(LCD_INDEX_MASK | LCD_DISPLAY_DIS |
+				  LCD_SRC_SEL | CRTC2_DISPLAY_DIS);
+			aty_st_le32(LCD_INDEX, lcd_index, par);
 		}
 
 		if (!M64_HAS(MOBIL_BUS))
@@ -888,12 +900,14 @@
 			USE_SHADOWED_ROWCUR | SHADOW_EN | SHADOW_RW_EN);
 		crtc->lcd_gen_cntl |= DONT_SHADOW_VPAR | LOCK_8DOT;
 
-		if((crtc->lcd_gen_cntl & LCD_ON) &&
-			((xres > par->lcd_width) || (yres > par->lcd_height))) {
-			/* We cannot display the mode on the LCD. If the CRT is enabled
-			   we can turn off the LCD.
-			   If the CRT is off, it isn't a good idea to switch it on; we don't
-			   know if one is connected. So it's better to fail then.
+		if ((crtc->lcd_gen_cntl & LCD_ON) &&
+		    ((xres > par->lcd_width) || (yres > par->lcd_height))) {
+			/*
+			 * We cannot display the mode on the LCD. If the CRT is
+			 * enabled we can turn off the LCD.
+			 * If the CRT is off, it isn't a good idea to switch it
+			 * on; we don't know if one is connected. So it's better
+			 * to fail then.
 			 */
 			if (crtc->lcd_gen_cntl & CRT_ON) {
 				if (!(var->activate & FB_ACTIVATE_TEST))
@@ -916,17 +930,18 @@
 
 		vmode &= ~(FB_VMODE_DOUBLE | FB_VMODE_INTERLACED);
 
-		/* This is horror! When we simulate, say 640x480 on an 800x600
-		   LCD monitor, the CRTC should be programmed 800x600 values for
-		   the non visible part, but 640x480 for the visible part.
-		   This code has been tested on a laptop with it's 1400x1050 LCD
-		   monitor and a conventional monitor both switched on.
-		   Tested modes: 1280x1024, 1152x864, 1024x768, 800x600,
-		    works with little glitches also with DOUBLESCAN modes
+		/*
+		 * This is horror! When we simulate, say 640x480 on an 800x600
+		 * LCD monitor, the CRTC should be programmed 800x600 values for
+		 * the non visible part, but 640x480 for the visible part.
+		 * This code has been tested on a laptop with it's 1400x1050 LCD
+		 * monitor and a conventional monitor both switched on.
+		 * Tested modes: 1280x1024, 1152x864, 1024x768, 800x600,
+		 * works with little glitches also with DOUBLESCAN modes
 		 */
 		if (yres < par->lcd_height) {
 			VScan = par->lcd_height / yres;
-			if(VScan > 1) {
+			if (VScan > 1) {
 				VScan = 2;
 				vmode |= FB_VMODE_DOUBLE;
 			}
@@ -952,7 +967,7 @@
 	FAIL_MAX("h_disp too large", h_disp, 0xff);
 	FAIL_MAX("h_sync_strt too large", h_sync_strt, 0x1ff);
 	/*FAIL_MAX("h_sync_wid too large", h_sync_wid, 0x1f);*/
-	if(h_sync_wid > 0x1f)
+	if (h_sync_wid > 0x1f)
 		h_sync_wid = 0x1f;
 	FAIL_MAX("h_total too large", h_total, 0x1ff);
 
@@ -978,7 +993,7 @@
 	FAIL_MAX("v_disp too large", v_disp, 0x7ff);
 	FAIL_MAX("v_sync_stsrt too large", v_sync_strt, 0x7ff);
 	/*FAIL_MAX("v_sync_wid too large", v_sync_wid, 0x1f);*/
-	if(v_sync_wid > 0x1f)
+	if (v_sync_wid > 0x1f)
 		v_sync_wid = 0x1f;
 	FAIL_MAX("v_total too large", v_total, 0x7ff);
 
@@ -995,11 +1010,13 @@
 		((line_length / bpp) << 22);
 	crtc->vline_crnt_vline = 0;
 
-	crtc->h_tot_disp = h_total | (h_disp<<16);
-	crtc->h_sync_strt_wid = (h_sync_strt & 0xff) | (h_sync_dly<<8) |
-		((h_sync_strt & 0x100)<<4) | (h_sync_wid<<16) | (h_sync_pol<<21);
-	crtc->v_tot_disp = v_total | (v_disp<<16);
-	crtc->v_sync_strt_wid = v_sync_strt | (v_sync_wid<<16) | (v_sync_pol<<21);
+	crtc->h_tot_disp = h_total | (h_disp << 16);
+	crtc->h_sync_strt_wid = (h_sync_strt & 0xff) | (h_sync_dly << 8) |
+		((h_sync_strt & 0x100) << 4) | (h_sync_wid << 16) |
+		(h_sync_pol << 21);
+	crtc->v_tot_disp = v_total | (v_disp << 16);
+	crtc->v_sync_strt_wid = v_sync_strt | (v_sync_wid << 16) |
+		(v_sync_pol << 21);
 
 	/* crtc->gen_cntl = aty_ld_le32(CRTC_GEN_CNTL, par) & CRTC_PRESERVED_MASK; */
 	crtc->gen_cntl = CRTC_EXT_DISP_EN | CRTC_EN | pix_width | c_sync;
@@ -1014,13 +1031,15 @@
 #ifdef CONFIG_FB_ATY_GENERIC_LCD
 	if (par->lcd_table != 0) {
 		vdisplay = yres;
-		if(vmode & FB_VMODE_DOUBLE)
+		if (vmode & FB_VMODE_DOUBLE)
 			vdisplay <<= 1;
 		crtc->gen_cntl &= ~(CRTC2_EN | CRTC2_PIX_WIDTH);
 		crtc->lcd_gen_cntl &= ~(HORZ_DIVBY2_EN | DIS_HOR_CRT_DIVBY2 |
-			/*TVCLK_PM_EN | VCLK_DAC_PM_EN |*/
-			USE_SHADOWED_VEND | USE_SHADOWED_ROWCUR | SHADOW_EN | SHADOW_RW_EN);
-		crtc->lcd_gen_cntl |= (DONT_SHADOW_VPAR/* | LOCK_8DOT*/);
+					/*TVCLK_PM_EN | VCLK_DAC_PM_EN |*/
+					USE_SHADOWED_VEND |
+					USE_SHADOWED_ROWCUR |
+					SHADOW_EN | SHADOW_RW_EN);
+		crtc->lcd_gen_cntl |= DONT_SHADOW_VPAR/* | LOCK_8DOT*/;
 
 		/* MOBILITY M1 tested, FIXME: LT */
 		crtc->horz_stretching = aty_ld_lcd(HORZ_STRETCHING, par);
@@ -1028,28 +1047,32 @@
 			crtc->ext_vert_stretch = aty_ld_lcd(EXT_VERT_STRETCH, par) &
 				~(AUTO_VERT_RATIO | VERT_STRETCH_MODE | VERT_STRETCH_RATIO3);
 
-		crtc->horz_stretching &=
-			~(HORZ_STRETCH_RATIO | HORZ_STRETCH_LOOP | AUTO_HORZ_RATIO |
-			HORZ_STRETCH_MODE | HORZ_STRETCH_EN);
+		crtc->horz_stretching &= ~(HORZ_STRETCH_RATIO |
+					   HORZ_STRETCH_LOOP | AUTO_HORZ_RATIO |
+					   HORZ_STRETCH_MODE | HORZ_STRETCH_EN);
 		if (xres < par->lcd_width && crtc->lcd_gen_cntl & LCD_ON) {
 			do {
 				/*
-				* The horizontal blender misbehaves when HDisplay is less than a
-				* a certain threshold (440 for a 1024-wide panel).  It doesn't
-				* stretch such modes enough.  Use pixel replication instead of
-				* blending to stretch modes that can be made to exactly fit the
-				* panel width.  The undocumented "NoLCDBlend" option allows the
-				* pixel-replicated mode to be slightly wider or narrower than the
-				* panel width.  It also causes a mode that is exactly half as wide
-				* as the panel to be pixel-replicated, rather than blended.
-				*/
+				 * The horizontal blender misbehaves when
+				 * HDisplay is less than a certain threshold
+				 * (440 for a 1024-wide panel).  It doesn't
+				 * stretch such modes enough.  Use pixel
+				 * replication instead of blending to stretch
+				 * modes that can be made to exactly fit the
+				 * panel width.  The undocumented "NoLCDBlend"
+				 * option allows the pixel-replicated mode to
+				 * be slightly wider or narrower than the
+				 * panel width.  It also causes a mode that is
+				 * exactly half as wide as the panel to be
+				 * pixel-replicated, rather than blended.
+				 */
 				int HDisplay  = xres & ~7;
 				int nStretch  = par->lcd_width / HDisplay;
 				int Remainder = par->lcd_width % HDisplay;
 
 				if ((!Remainder && ((nStretch > 2))) ||
-					(((HDisplay * 16) / par->lcd_width) < 7)) {
-					static const char StretchLoops[] = {10, 12, 13, 15, 16};
+				    (((HDisplay * 16) / par->lcd_width) < 7)) {
+					static const char StretchLoops[] = { 10, 12, 13, 15, 16 };
 					int horz_stretch_loop = -1, BestRemainder;
 					int Numerator = HDisplay, Denominator = par->lcd_width;
 					int Index = 5;
@@ -1098,12 +1121,12 @@
 				(((vdisplay * (VERT_STRETCH_RATIO0 + 1)) / par->lcd_height) & VERT_STRETCH_RATIO0));
 
 			if (!M64_HAS(LT_LCD_REGS) &&
-			    xres <= (M64_HAS(MOBIL_BUS)?1024:800))
+			    xres <= (M64_HAS(MOBIL_BUS) ? 1024 : 800))
 				crtc->ext_vert_stretch |= VERT_STRETCH_MODE;
 		} else {
 			/*
-			 * Don't use vertical blending if the mode is too wide or not
-			 * vertically stretched.
+			 * Don't use vertical blending if the mode is too wide
+			 * or not vertically stretched.
 			 */
 			crtc->vert_stretching = 0;
 		}
@@ -1125,11 +1148,11 @@
 	return 0;
 }
 
-static int aty_crtc_to_var(const struct crtc *crtc, struct fb_var_screeninfo *var)
+static int aty_crtc_to_var(const struct crtc *crtc,
+			   struct fb_var_screeninfo *var)
 {
 	u32 xres, yres, bpp, left, right, upper, lower, hslen, vslen, sync;
-	u32 h_total, h_disp, h_sync_strt, h_sync_dly, h_sync_wid,
-	    h_sync_pol;
+	u32 h_total, h_disp, h_sync_strt, h_sync_dly, h_sync_wid, h_sync_pol;
 	u32 v_total, v_disp, v_sync_strt, v_sync_wid, v_sync_pol, c_sync;
 	u32 pix_width;
 	u32 double_scan, interlace;
@@ -1161,8 +1184,8 @@
 	lower = v_sync_strt - v_disp;
 	vslen = v_sync_wid;
 	sync = (h_sync_pol ? 0 : FB_SYNC_HOR_HIGH_ACT) |
-	    (v_sync_pol ? 0 : FB_SYNC_VERT_HIGH_ACT) |
-	    (c_sync ? FB_SYNC_COMP_HIGH_ACT : 0);
+		(v_sync_pol ? 0 : FB_SYNC_VERT_HIGH_ACT) |
+		(c_sync ? FB_SYNC_COMP_HIGH_ACT : 0);
 
 	switch (pix_width) {
 #if 0
@@ -1252,20 +1275,21 @@
 	var->vsync_len = vslen;
 	var->sync = sync;
 	var->vmode = FB_VMODE_NONINTERLACED;
-	/* In double scan mode, the vertical parameters are doubled, so we need to
-	   half them to get the right values.
-	   In interlaced mode the values are already correct, so no correction is
-	   necessary.
+	/*
+	 * In double scan mode, the vertical parameters are doubled,
+	 * so we need to halve them to get the right values.
+	 * In interlaced mode the values are already correct,
+	 * so no correction is necessary.
 	 */
 	if (interlace)
 		var->vmode = FB_VMODE_INTERLACED;
 
 	if (double_scan) {
 		var->vmode = FB_VMODE_DOUBLE;
-		var->yres>>=1;
-		var->upper_margin>>=1;
-		var->lower_margin>>=1;
-		var->vsync_len>>=1;
+		var->yres >>= 1;
+		var->upper_margin >>= 1;
+		var->lower_margin >>= 1;
+		var->vsync_len >>= 1;
 	}
 
 	return 0;
@@ -1286,7 +1310,8 @@
 	if (par->asleep)
 		return 0;
 
-	if ((err = aty_var_to_crtc(info, var, &par->crtc)))
+	err = aty_var_to_crtc(info, var, &par->crtc);
+	if (err)
 		return err;
 
 	pixclock = atyfb_get_pixclock(var, par);
@@ -1295,7 +1320,9 @@
 		PRINTKE("Invalid pixclock\n");
 		return -EINVAL;
 	} else {
-		if((err = par->pll_ops->var_to_pll(info, pixclock, var->bits_per_pixel, &par->pll)))
+		err = par->pll_ops->var_to_pll(info, pixclock,
+					       var->bits_per_pixel, &par->pll);
+		if (err)
 			return err;
 	}
 
@@ -1313,22 +1340,23 @@
 		wait_for_idle(par);
 
 	aty_set_crtc(par, &par->crtc);
-	par->dac_ops->set_dac(info, &par->pll, var->bits_per_pixel, par->accel_flags);
+	par->dac_ops->set_dac(info, &par->pll,
+			      var->bits_per_pixel, par->accel_flags);
 	par->pll_ops->set_pll(info, &par->pll);
 
 #ifdef DEBUG
-	if(par->pll_ops && par->pll_ops->pll_to_var)
-		pixclock_in_ps = par->pll_ops->pll_to_var(info, &(par->pll));
+	if (par->pll_ops && par->pll_ops->pll_to_var)
+		pixclock_in_ps = par->pll_ops->pll_to_var(info, &par->pll);
 	else
 		pixclock_in_ps = 0;
 
-	if(0 == pixclock_in_ps) {
+	if (0 == pixclock_in_ps) {
 		PRINTKE("ALERT ops->pll_to_var get 0\n");
 		pixclock_in_ps = pixclock;
 	}
 
 	memset(&debug, 0, sizeof(debug));
-	if(!aty_crtc_to_var(&(par->crtc), &debug)) {
+	if (!aty_crtc_to_var(&par->crtc, &debug)) {
 		u32 hSync, vRefresh;
 		u32 h_disp, h_sync_strt, h_sync_end, h_total;
 		u32 v_disp, v_sync_strt, v_sync_end, v_total;
@@ -1344,16 +1372,20 @@
 
 		hSync = 1000000000 / (pixclock_in_ps * h_total);
 		vRefresh = (hSync * 1000) / v_total;
-        	if (par->crtc.gen_cntl & CRTC_INTERLACE_EN)
-            	vRefresh *= 2;
-        	if (par->crtc.gen_cntl & CRTC_DBL_SCAN_EN)
-            	vRefresh /= 2;
+		if (par->crtc.gen_cntl & CRTC_INTERLACE_EN)
+			vRefresh *= 2;
+		if (par->crtc.gen_cntl & CRTC_DBL_SCAN_EN)
+			vRefresh /= 2;
 
 		DPRINTK("atyfb_set_par\n");
-		DPRINTK(" Set Visible Mode to %ix%i-%i\n", var->xres, var->yres, var->bits_per_pixel);
-		DPRINTK(" Virtual resolution %ix%i, pixclock_in_ps %i (calculated %i)\n",
-			var->xres_virtual, var->yres_virtual, pixclock, pixclock_in_ps);
-		DPRINTK(" Dot clock:           %i MHz\n", 1000000 / pixclock_in_ps);
+		DPRINTK(" Set Visible Mode to %ix%i-%i\n",
+			var->xres, var->yres, var->bits_per_pixel);
+		DPRINTK(" Virtual resolution %ix%i, "
+			"pixclock_in_ps %i (calculated %i)\n",
+			var->xres_virtual, var->yres_virtual,
+			pixclock, pixclock_in_ps);
+		DPRINTK(" Dot clock:           %i MHz\n",
+			1000000 / pixclock_in_ps);
 		DPRINTK(" Horizontal sync:     %i kHz\n", hSync);
 		DPRINTK(" Vertical refresh:    %i Hz\n", vRefresh);
 		DPRINTK(" x  style: %i.%03i %i %i %i %i   %i %i %i %i\n",
@@ -1448,7 +1480,8 @@
 	base = 0x2000;
 	printk("debug atyfb: Mach64 non-shadow register values:");
 	for (i = 0; i < 256; i = i+4) {
-		if(i%16 == 0) printk("\ndebug atyfb: 0x%04X: ", base + i);
+		if (i % 16 == 0)
+			printk("\ndebug atyfb: 0x%04X: ", base + i);
 		printk(" %08X", aty_ld_le32(i, par));
 	}
 	printk("\n\n");
@@ -1458,8 +1491,10 @@
 	base = 0x00;
 	printk("debug atyfb: Mach64 PLL register values:");
 	for (i = 0; i < 64; i++) {
-		if(i%16 == 0) printk("\ndebug atyfb: 0x%02X: ", base + i);
-		if(i%4 == 0)  printk(" ");
+		if (i % 16 == 0)
+			printk("\ndebug atyfb: 0x%02X: ", base + i);
+		if (i % 4 == 0)
+			printk(" ");
 		printk("%02X", aty_ld_pll_ct(i, par));
 	}
 	printk("\n\n");
@@ -1470,19 +1505,21 @@
 		/* LCD registers */
 		base = 0x00;
 		printk("debug atyfb: LCD register values:");
-		if(M64_HAS(LT_LCD_REGS)) {
-		    for(i = 0; i <= POWER_MANAGEMENT; i++) {
-			if(i == EXT_VERT_STRETCH)
-			    continue;
-			printk("\ndebug atyfb: 0x%04X: ", lt_lcd_regs[i]);
-			printk(" %08X", aty_ld_lcd(i, par));
-		    }
-
+		if (M64_HAS(LT_LCD_REGS)) {
+			for (i = 0; i <= POWER_MANAGEMENT; i++) {
+				if (i == EXT_VERT_STRETCH)
+					continue;
+				printk("\ndebug atyfb: 0x%04X: ",
+				       lt_lcd_regs[i]);
+				printk(" %08X", aty_ld_lcd(i, par));
+			}
 		} else {
-		    for (i = 0; i < 64; i++) {
-			if(i%4 == 0) printk("\ndebug atyfb: 0x%02X: ", base + i);
-			printk(" %08X", aty_ld_lcd(i, par));
-		    }
+			for (i = 0; i < 64; i++) {
+				if (i % 4 == 0)
+					printk("\ndebug atyfb: 0x%02X: ",
+					       base + i);
+				printk(" %08X", aty_ld_lcd(i, par));
+			}
 		}
 		printk("\n\n");
 	}
@@ -1500,9 +1537,10 @@
 	union aty_pll pll;
 	u32 pixclock;
 
-	memcpy(&pll, &(par->pll), sizeof(pll));
+	memcpy(&pll, &par->pll, sizeof(pll));
 
-	if((err = aty_var_to_crtc(info, var, &crtc)))
+	err = aty_var_to_crtc(info, var, &crtc);
+	if (err)
 		return err;
 
 	pixclock = atyfb_get_pixclock(var, par);
@@ -1512,7 +1550,9 @@
 			PRINTKE("Invalid pixclock\n");
 		return -EINVAL;
 	} else {
-		if((err = par->pll_ops->var_to_pll(info, pixclock, var->bits_per_pixel, &pll)))
+		err = par->pll_ops->var_to_pll(info, pixclock,
+					       var->bits_per_pixel, &pll);
+		if (err)
 			return err;
 	}
 
@@ -1539,9 +1579,9 @@
 }
 
 
-    /*
-     *  Open/Release the frame buffer device
-     */
+/*
+ * Open/Release the frame buffer device
+ */
 
 static int atyfb_open(struct fb_info *info, int user)
 {
@@ -1553,7 +1593,7 @@
 		par->mmaped = 0;
 #endif
 	}
-	return (0);
+	return 0;
 }
 
 static irqreturn_t aty_irq(int irq, void *dev_id)
@@ -1568,7 +1608,8 @@
 
 	if (int_cntl & CRTC_VBLANK_INT) {
 		/* clear interrupt */
-		aty_st_le32(CRTC_INT_CNTL, (int_cntl & CRTC_INT_EN_MASK) | CRTC_VBLANK_INT_AK, par);
+		aty_st_le32(CRTC_INT_CNTL, (int_cntl & CRTC_INT_EN_MASK) |
+			    CRTC_VBLANK_INT_AK, par);
 		par->vblank.count++;
 		if (par->vblank.pan_display) {
 			par->vblank.pan_display = 0;
@@ -1603,9 +1644,11 @@
 		spin_lock_irq(&par->int_lock);
 		int_cntl = aty_ld_le32(CRTC_INT_CNTL, par) & CRTC_INT_EN_MASK;
 		if (!(int_cntl & CRTC_VBLANK_INT_EN)) {
-			printk("atyfb: someone disabled IRQ [%08x]\n", int_cntl);
+			printk("atyfb: someone disabled IRQ [%08x]\n",
+			       int_cntl);
 			/* re-enable interrupt */
-			aty_st_le32(CRTC_INT_CNTL, int_cntl | CRTC_VBLANK_INT_EN, par );
+			aty_st_le32(CRTC_INT_CNTL, int_cntl |
+				    CRTC_VBLANK_INT_EN, par);
 		}
 		spin_unlock_irq(&par->int_lock);
 	}
@@ -1625,7 +1668,7 @@
 		spin_lock_irq(&par->int_lock);
 		int_cntl = aty_ld_le32(CRTC_INT_CNTL, par) & CRTC_INT_EN_MASK;
 		/* disable interrupt */
-		aty_st_le32(CRTC_INT_CNTL, int_cntl & ~CRTC_VBLANK_INT_EN, par );
+		aty_st_le32(CRTC_INT_CNTL, int_cntl & ~CRTC_VBLANK_INT_EN, par);
 		spin_unlock_irq(&par->int_lock);
 		free_irq(par->irq, par);
 	}
@@ -1636,50 +1679,62 @@
 static int atyfb_release(struct fb_info *info, int user)
 {
 	struct atyfb_par *par = (struct atyfb_par *) info->par;
-	if (user) {
-		par->open--;
-		mdelay(1);
-		wait_for_idle(par);
-		if (!par->open) {
 #ifdef __sparc__
-			int was_mmaped = par->mmaped;
-
-			par->mmaped = 0;
-
-			if (was_mmaped) {
-				struct fb_var_screeninfo var;
-
-				/* Now reset the default display config, we have no
-				 * idea what the program(s) which mmap'd the chip did
-				 * to the configuration, nor whether it restored it
-				 * correctly.
-				 */
-				var = default_var;
-				if (noaccel)
-					var.accel_flags &= ~FB_ACCELF_TEXT;
-				else
-					var.accel_flags |= FB_ACCELF_TEXT;
-				if (var.yres == var.yres_virtual) {
-					u32 videoram = (info->fix.smem_len - (PAGE_SIZE << 2));
-					var.yres_virtual = ((videoram * 8) / var.bits_per_pixel) / var.xres_virtual;
-					if (var.yres_virtual < var.yres)
-						var.yres_virtual = var.yres;
-				}
-			}
+	int was_mmaped;
 #endif
-			aty_disable_irq(par);
+
+	if (!user)
+		return 0;
+
+	par->open--;
+	mdelay(1);
+	wait_for_idle(par);
+
+	if (par->open)
+		return 0;
+
+#ifdef __sparc__
+	was_mmaped = par->mmaped;
+
+	par->mmaped = 0;
+
+	if (was_mmaped) {
+		struct fb_var_screeninfo var;
+
+		/*
+		 * Now reset the default display config, we have
+		 * no idea what the program(s) which mmap'd the
+		 * chip did to the configuration, nor whether it
+		 * restored it correctly.
+		 */
+		var = default_var;
+		if (noaccel)
+			var.accel_flags &= ~FB_ACCELF_TEXT;
+		else
+			var.accel_flags |= FB_ACCELF_TEXT;
+		if (var.yres == var.yres_virtual) {
+			u32 videoram = (info->fix.smem_len - (PAGE_SIZE << 2));
+			var.yres_virtual =
+				((videoram * 8) / var.bits_per_pixel) /
+				var.xres_virtual;
+			if (var.yres_virtual < var.yres)
+				var.yres_virtual = var.yres;
 		}
 	}
-	return (0);
+#endif
+	aty_disable_irq(par);
+
+	return 0;
 }
 
-    /*
-     *  Pan or Wrap the Display
-     *
-     *  This call looks only at xoffset, yoffset and the FB_VMODE_YWRAP flag
-     */
+/*
+ * Pan or Wrap the Display
+ *
+ * This call looks only at xoffset, yoffset and the FB_VMODE_YWRAP flag
+ */
 
-static int atyfb_pan_display(struct fb_var_screeninfo *var, struct fb_info *info)
+static int atyfb_pan_display(struct fb_var_screeninfo *var,
+			     struct fb_info *info)
 {
 	struct atyfb_par *par = (struct atyfb_par *) info->par;
 	u32 xres, yres, xoffset, yoffset;
@@ -1690,7 +1745,8 @@
 		yres >>= 1;
 	xoffset = (var->xoffset + 7) & ~7;
 	yoffset = var->yoffset;
-	if (xoffset + xres > par->crtc.vxres || yoffset + yres > par->crtc.vyres)
+	if (xoffset + xres > par->crtc.vxres ||
+	    yoffset + yres > par->crtc.vyres)
 		return -EINVAL;
 	info->var.xoffset = xoffset;
 	info->var.yoffset = yoffset;
@@ -1727,10 +1783,10 @@
 		return ret;
 
 	count = vbl->count;
-	ret = wait_event_interruptible_timeout(vbl->wait, count != vbl->count, HZ/10);
-	if (ret < 0) {
+	ret = wait_event_interruptible_timeout(vbl->wait,
+					       count != vbl->count, HZ/10);
+	if (ret < 0)
 		return ret;
-	}
 	if (ret == 0) {
 		aty_enable_irq(par, 1);
 		return -ETIMEDOUT;
@@ -1784,7 +1840,8 @@
 		fbtyp.fb_depth = info->var.bits_per_pixel;
 		fbtyp.fb_cmsize = info->cmap.len;
 		fbtyp.fb_size = info->fix.smem_len;
-		if (copy_to_user((struct fbtype __user *) arg, &fbtyp, sizeof(fbtyp)))
+		if (copy_to_user((struct fbtype __user *) arg, &fbtyp,
+				 sizeof(fbtyp)))
 			return -EFAULT;
 		break;
 #endif /* __sparc__ */
@@ -1804,7 +1861,7 @@
 	case ATYIO_CLKR:
 		if (M64_HAS(INTEGRATED)) {
 			struct atyclk clk;
-			union aty_pll *pll = &(par->pll);
+			union aty_pll *pll = &par->pll;
 			u32 dsp_config = pll->ct.dsp_config;
 			u32 dsp_on_off = pll->ct.dsp_on_off;
 			clk.ref_clk_per = par->ref_clk_per;
@@ -1829,8 +1886,9 @@
 	case ATYIO_CLKW:
 		if (M64_HAS(INTEGRATED)) {
 			struct atyclk clk;
-			union aty_pll *pll = &(par->pll);
-			if (copy_from_user(&clk, (struct atyclk __user *) arg, sizeof(clk)))
+			union aty_pll *pll = &par->pll;
+			if (copy_from_user(&clk, (struct atyclk __user *) arg,
+					   sizeof(clk)))
 				return -EFAULT;
 			par->ref_clk_per = clk.ref_clk_per;
 			pll->ct.pll_ref_div = clk.pll_ref_div;
@@ -1841,8 +1899,10 @@
 			pll->ct.vclk_fb_div = clk.vclk_fb_div;
 			pll->ct.vclk_post_div_real = clk.vclk_post_div;
 			pll->ct.dsp_config = (clk.dsp_xclks_per_row & 0x3fff) |
-				((clk.dsp_loop_latency & 0xf)<<16)| ((clk.dsp_precision & 7)<<20);
-			pll->ct.dsp_on_off = (clk.dsp_off & 0x7ff) | ((clk.dsp_on & 0x7ff)<<16);
+				((clk.dsp_loop_latency & 0xf) << 16) |
+				((clk.dsp_precision & 7) << 20);
+			pll->ct.dsp_on_off = (clk.dsp_off & 0x7ff) |
+				((clk.dsp_on & 0x7ff) << 16);
 			/*aty_calc_pll_ct(info, &pll->ct);*/
 			aty_set_pll_ct(info, pll);
 		} else
@@ -1913,8 +1973,7 @@
 				continue;
 
 			map_size = par->mmap_map[i].size - (offset - start);
-			map_offset =
-			    par->mmap_map[i].poff + (offset - start);
+			map_offset = par->mmap_map[i].poff + (offset - start);
 			break;
 		}
 		if (!map_size) {
@@ -1924,8 +1983,7 @@
 		if (page + map_size > size)
 			map_size = size - page;
 
-		pgprot_val(vma->vm_page_prot) &=
-		    ~(par->mmap_map[i].prot_mask);
+		pgprot_val(vma->vm_page_prot) &= ~(par->mmap_map[i].prot_mask);
 		pgprot_val(vma->vm_page_prot) |= par->mmap_map[i].prot_flag;
 
 		if (remap_pfn_range(vma, vma->vm_start + page,
@@ -2029,7 +2087,8 @@
 	par->asleep = 1;
 	par->lock_blank = 1;
 
-	/* Because we may change PCI D state ourselves, we need to
+	/*
+	 * Because we may change PCI D state ourselves, we need to
 	 * first save the config space content so the core can
 	 * restore it properly on resume.
 	 */
@@ -2080,7 +2139,8 @@
 
 	acquire_console_sem();
 
-	/* PCI state will have been restored by the core, so
+	/*
+	 * PCI state will have been restored by the core, so
 	 * we should be in D0 now with our config space fully
 	 * restored
 	 */
@@ -2192,8 +2252,8 @@
 
 	info->bl_dev = bd;
 	fb_bl_default_curve(info, 0,
-		0x3F * FB_BACKLIGHT_MAX / MAX_LEVEL,
-		0xFF * FB_BACKLIGHT_MAX / MAX_LEVEL);
+			    0x3F * FB_BACKLIGHT_MAX / MAX_LEVEL,
+			    0xFF * FB_BACKLIGHT_MAX / MAX_LEVEL);
 
 	bd->props.max_brightness = FB_BACKLIGHT_LEVELS - 1;
 	bd->props.brightness = bd->props.max_brightness;
@@ -2236,16 +2296,16 @@
 		size = ARRAY_SIZE(ragepro_tbl);
 	}
 
-	for (i=0; i < size; i++) {
+	for (i = 0; i < size; i++) {
 		if (xclk < refresh_tbl[i])
-		break;
+			break;
 	}
 	par->mem_refresh_rate = i;
 }
 
-    /*
-     *  Initialisation
-     */
+/*
+ * Initialisation
+ */
 
 static struct fb_info *fb_list = NULL;
 
@@ -2375,8 +2435,10 @@
 	}
 #endif
 #ifdef CONFIG_PPC_PMAC
-	/* The Apple iBook1 uses non-standard memory frequencies. We detect it
-	 * and set the frequency manually. */
+	/*
+	 * The Apple iBook1 uses non-standard memory frequencies.
+	 * We detect it and set the frequency manually.
+	 */
 	if (machine_is_compatible("PowerBook2,1")) {
 		par->pll_limits.mclk = 70;
 		par->pll_limits.xclk = 53;
@@ -2421,13 +2483,14 @@
 
 	/* save previous video mode */
 	aty_get_crtc(par, &par->saved_crtc);
-	if(par->pll_ops->get_pll)
+	if (par->pll_ops->get_pll)
 		par->pll_ops->get_pll(info, &par->saved_pll);
 
 	par->mem_cntl = aty_ld_le32(MEM_CNTL, par);
 	gtb_memsize = M64_HAS(GTB_DSP);
 	if (gtb_memsize)
-		switch (par->mem_cntl & 0xF) {	/* 0xF used instead of MEM_SIZE_ALIAS */
+		/* 0xF used instead of MEM_SIZE_ALIAS */
+		switch (par->mem_cntl & 0xF) {
 		case MEM_SIZE_512K:
 			info->fix.smem_len = 0x80000;
 			break;
@@ -2496,8 +2559,8 @@
 	}
 
 	/*
-	 *  Reg Block 0 (CT-compatible block) is at mmio_start
-	 *  Reg Block 1 (multimedia extensions) is at mmio_start - 0x400
+	 * Reg Block 0 (CT-compatible block) is at mmio_start
+	 * Reg Block 1 (multimedia extensions) is at mmio_start - 0x400
 	 */
 	if (M64_HAS(GX)) {
 		info->fix.mmio_len = 0x400;
@@ -2516,84 +2579,98 @@
 	}
 
 	PRINTKI("%d%c %s, %s MHz XTAL, %d MHz PLL, %d Mhz MCLK, %d MHz XCLK\n",
-	       info->fix.smem_len == 0x80000 ? 512 : (info->fix.smem_len >> 20),
-	       info->fix.smem_len == 0x80000 ? 'K' : 'M', ramname, xtal, par->pll_limits.pll_max,
-	       par->pll_limits.mclk, par->pll_limits.xclk);
+		info->fix.smem_len == 0x80000 ? 512 : (info->fix.smem_len>>20),
+		info->fix.smem_len == 0x80000 ? 'K' : 'M', ramname, xtal,
+		par->pll_limits.pll_max, par->pll_limits.mclk,
+		par->pll_limits.xclk);
 
 #if defined(DEBUG) && defined(CONFIG_FB_ATY_CT)
 	if (M64_HAS(INTEGRATED)) {
 		int i;
-		printk("debug atyfb: BUS_CNTL DAC_CNTL MEM_CNTL EXT_MEM_CNTL CRTC_GEN_CNTL "
-		       "DSP_CONFIG DSP_ON_OFF CLOCK_CNTL\n"
-		       "debug atyfb: %08x %08x %08x %08x     %08x      %08x   %08x   %08x\n"
+		printk("debug atyfb: BUS_CNTL DAC_CNTL MEM_CNTL "
+		       "EXT_MEM_CNTL CRTC_GEN_CNTL DSP_CONFIG "
+		       "DSP_ON_OFF CLOCK_CNTL\n"
+		       "debug atyfb: %08x %08x %08x "
+		       "%08x     %08x      %08x   "
+		       "%08x   %08x\n"
 		       "debug atyfb: PLL",
-			aty_ld_le32(BUS_CNTL, par), aty_ld_le32(DAC_CNTL, par),
-			aty_ld_le32(MEM_CNTL, par), aty_ld_le32(EXT_MEM_CNTL, par),
-			aty_ld_le32(CRTC_GEN_CNTL, par), aty_ld_le32(DSP_CONFIG, par),
-			aty_ld_le32(DSP_ON_OFF, par), aty_ld_le32(CLOCK_CNTL, par));
+		       aty_ld_le32(BUS_CNTL, par),
+		       aty_ld_le32(DAC_CNTL, par),
+		       aty_ld_le32(MEM_CNTL, par),
+		       aty_ld_le32(EXT_MEM_CNTL, par),
+		       aty_ld_le32(CRTC_GEN_CNTL, par),
+		       aty_ld_le32(DSP_CONFIG, par),
+		       aty_ld_le32(DSP_ON_OFF, par),
+		       aty_ld_le32(CLOCK_CNTL, par));
 		for (i = 0; i < 40; i++)
 			printk(" %02x", aty_ld_pll_ct(i, par));
 		printk("\n");
 	}
 #endif
-	if(par->pll_ops->init_pll)
+	if (par->pll_ops->init_pll)
 		par->pll_ops->init_pll(info, &par->pll);
 	if (par->pll_ops->resume_pll)
 		par->pll_ops->resume_pll(info, &par->pll);
 
 	/*
-	 *  Last page of 8 MB (4 MB on ISA) aperture is MMIO,
-	 *  unless the auxiliary register aperture is used.
+	 * Last page of 8 MB (4 MB on ISA) aperture is MMIO,
+	 * unless the auxiliary register aperture is used.
 	 */
-
 	if (!par->aux_start &&
-		(info->fix.smem_len == 0x800000 || (par->bus_type == ISA && info->fix.smem_len == 0x400000)))
+	    (info->fix.smem_len == 0x800000 ||
+	     (par->bus_type == ISA && info->fix.smem_len == 0x400000)))
 		info->fix.smem_len -= GUI_RESERVE;
 
 	/*
-	 *  Disable register access through the linear aperture
-	 *  if the auxiliary aperture is used so we can access
-	 *  the full 8 MB of video RAM on 8 MB boards.
+	 * Disable register access through the linear aperture
+	 * if the auxiliary aperture is used so we can access
+	 * the full 8 MB of video RAM on 8 MB boards.
 	 */
 	if (par->aux_start)
-		aty_st_le32(BUS_CNTL, aty_ld_le32(BUS_CNTL, par) | BUS_APER_REG_DIS, par);
+		aty_st_le32(BUS_CNTL, aty_ld_le32(BUS_CNTL, par) |
+			    BUS_APER_REG_DIS, par);
 
 #ifdef CONFIG_MTRR
 	par->mtrr_aper = -1;
 	par->mtrr_reg = -1;
 	if (!nomtrr) {
 		/* Cover the whole resource. */
-		 par->mtrr_aper = mtrr_add(par->res_start, par->res_size, MTRR_TYPE_WRCOMB, 1);
-		 if (par->mtrr_aper >= 0 && !par->aux_start) {
+		par->mtrr_aper = mtrr_add(par->res_start, par->res_size,
+					  MTRR_TYPE_WRCOMB, 1);
+		if (par->mtrr_aper >= 0 && !par->aux_start) {
 			/* Make a hole for mmio. */
-			par->mtrr_reg = mtrr_add(par->res_start + 0x800000 - GUI_RESERVE,
-				GUI_RESERVE, MTRR_TYPE_UNCACHABLE, 1);
+			par->mtrr_reg = mtrr_add(par->res_start + 0x800000 -
+						 GUI_RESERVE, GUI_RESERVE,
+						 MTRR_TYPE_UNCACHABLE, 1);
 			if (par->mtrr_reg < 0) {
 				mtrr_del(par->mtrr_aper, 0, 0);
 				par->mtrr_aper = -1;
 			}
-		 }
+		}
 	}
 #endif
 
 	info->fbops = &atyfb_ops;
 	info->pseudo_palette = par->pseudo_palette;
 	info->flags = FBINFO_DEFAULT           |
-	              FBINFO_HWACCEL_IMAGEBLIT |
-	              FBINFO_HWACCEL_FILLRECT  |
-	              FBINFO_HWACCEL_COPYAREA  |
-	              FBINFO_HWACCEL_YPAN;
+		      FBINFO_HWACCEL_IMAGEBLIT |
+		      FBINFO_HWACCEL_FILLRECT  |
+		      FBINFO_HWACCEL_COPYAREA  |
+		      FBINFO_HWACCEL_YPAN;
 
 #ifdef CONFIG_PMAC_BACKLIGHT
 	if (M64_HAS(G3_PB_1_1) && machine_is_compatible("PowerBook1,1")) {
-		/* these bits let the 101 powerbook wake up from sleep -- paulus */
-		aty_st_lcd(POWER_MANAGEMENT, aty_ld_lcd(POWER_MANAGEMENT, par)
-			   | (USE_F32KHZ | TRISTATE_MEM_EN), par);
+		/*
+		 * these bits let the 101 powerbook
+		 * wake up from sleep -- paulus
+		 */
+		aty_st_lcd(POWER_MANAGEMENT, aty_ld_lcd(POWER_MANAGEMENT, par) |
+			   USE_F32KHZ | TRISTATE_MEM_EN, par);
 	} else
 #endif
 	if (M64_HAS(MOBIL_BUS) && backlight) {
 #ifdef CONFIG_FB_ATY_BACKLIGHT
-		aty_bl_init (par);
+		aty_bl_init(par);
 #endif
 	}
 
@@ -2601,8 +2678,8 @@
 #ifdef CONFIG_PPC
 	if (machine_is(powermac)) {
 		/*
-		 *  FIXME: The NVRAM stuff should be put in a Mac-specific file, as it
-		 *         applies to all Mac video cards
+		 * FIXME: The NVRAM stuff should be put in a Mac-specific file,
+		 *        as it applies to all Mac video cards
 		 */
 		if (mode) {
 			if (mac_find_mode(&var, info, mode, 8))
@@ -2615,8 +2692,7 @@
 					default_vmode = VMODE_1024_768_60;
 				else if (machine_is_compatible("iMac"))
 					default_vmode = VMODE_1024_768_75;
-				else if (machine_is_compatible
-					 ("PowerBook2,1"))
+				else if (machine_is_compatible("PowerBook2,1"))
 					/* iBook with 800x600 LCD */
 					default_vmode = VMODE_800_600_60;
 				else
@@ -2630,7 +2706,7 @@
 			if (default_cmode < CMODE_8 || default_cmode > CMODE_32)
 				default_cmode = CMODE_8;
 			if (!mac_vmode_to_var(default_vmode, default_cmode,
-					       &var))
+					      &var))
 				has_var = 1;
 		}
 	}
@@ -2702,12 +2778,12 @@
 
 #ifdef CONFIG_MTRR
 	if (par->mtrr_reg >= 0) {
-	    mtrr_del(par->mtrr_reg, 0, 0);
-	    par->mtrr_reg = -1;
+		mtrr_del(par->mtrr_reg, 0, 0);
+		par->mtrr_reg = -1;
 	}
 	if (par->mtrr_aper >= 0) {
-	    mtrr_del(par->mtrr_aper, 0, 0);
-	    par->mtrr_aper = -1;
+		mtrr_del(par->mtrr_aper, 0, 0);
+		par->mtrr_aper = -1;
 	}
 #endif
 	return ret;
@@ -2735,18 +2811,18 @@
 	phys_size[m64_num] = size;
 	phys_guiregbase[m64_num] = guiregbase;
 	PRINTKI("stored them all: $%08lX $%08lX $%08lX \n", vmembase, size,
-	       guiregbase);
+		guiregbase);
 	return 0;
 
-      mach64_invalid:
+ mach64_invalid:
 	phys_vmembase[m64_num] = 0;
 	return -1;
 }
 #endif /* CONFIG_ATARI */
 
-    /*
-     *  Blank the display.
-     */
+/*
+ * Blank the display.
+ */
 
 static int atyfb_blank(int blank, struct fb_info *info)
 {
@@ -2768,20 +2844,20 @@
 	gen_cntl = aty_ld_le32(CRTC_GEN_CNTL, par);
 	gen_cntl &= ~0x400004c;
 	switch (blank) {
-		case FB_BLANK_UNBLANK:
-			break;
-		case FB_BLANK_NORMAL:
-			gen_cntl |= 0x4000040;
-			break;
-		case FB_BLANK_VSYNC_SUSPEND:
-			gen_cntl |= 0x4000048;
-			break;
-		case FB_BLANK_HSYNC_SUSPEND:
-			gen_cntl |= 0x4000044;
-			break;
-		case FB_BLANK_POWERDOWN:
-			gen_cntl |= 0x400004c;
-			break;
+	case FB_BLANK_UNBLANK:
+		break;
+	case FB_BLANK_NORMAL:
+		gen_cntl |= 0x4000040;
+		break;
+	case FB_BLANK_VSYNC_SUSPEND:
+		gen_cntl |= 0x4000048;
+		break;
+	case FB_BLANK_HSYNC_SUSPEND:
+		gen_cntl |= 0x4000044;
+		break;
+	case FB_BLANK_POWERDOWN:
+		gen_cntl |= 0x400004c;
+		break;
 	}
 	aty_st_le32(CRTC_GEN_CNTL, gen_cntl, par);
 
@@ -2806,15 +2882,15 @@
 	aty_st_8(DAC_DATA, blue, par);
 }
 
-    /*
-     *  Set a single color register. The values supplied are already
-     *  rounded down to the hardware's capabilities (according to the
-     *  entries in the var structure). Return != 0 for invalid regno.
-     *  !! 4 & 8 =  PSEUDO, > 8 = DIRECTCOLOR
-     */
+/*
+ * Set a single color register. The values supplied are already
+ * rounded down to the hardware's capabilities (according to the
+ * entries in the var structure). Return != 0 for invalid regno.
+ * !! 4 & 8 =  PSEUDO, > 8 = DIRECTCOLOR
+ */
 
 static int atyfb_setcolreg(u_int regno, u_int red, u_int green, u_int blue,
-	u_int transp, struct fb_info *info)
+			   u_int transp, struct fb_info *info)
 {
 	struct atyfb_par *par = (struct atyfb_par *) info->par;
 	int i, depth;
@@ -2868,16 +2944,15 @@
 		if (depth == 16) {
 			if (regno < 32)
 				aty_st_pal(regno << 3, red,
-					   par->palette[regno<<1].green,
+					   par->palette[regno << 1].green,
 					   blue, par);
-			red = par->palette[regno>>1].red;
-			blue = par->palette[regno>>1].blue;
+			red = par->palette[regno >> 1].red;
+			blue = par->palette[regno >> 1].blue;
 			regno <<= 2;
 		} else if (depth == 15) {
 			regno <<= 3;
-			for(i = 0; i < 8; i++) {
-			    aty_st_pal(regno + i, red, green, blue, par);
-			}
+			for (i = 0; i < 8; i++)
+				aty_st_pal(regno + i, red, green, blue, par);
 		}
 	}
 	aty_st_pal(regno, red, green, blue, par);
@@ -2890,7 +2965,8 @@
 #ifdef __sparc__
 
 static int __devinit atyfb_setup_sparc(struct pci_dev *pdev,
-			struct fb_info *info, unsigned long addr)
+				       struct fb_info *info,
+				       unsigned long addr)
 {
 	struct atyfb_par *par = info->par;
 	struct device_node *dp;
@@ -2978,7 +3054,8 @@
 		j++;
 	}
 
-	if((ret = correct_chipset(par)))
+	ret = correct_chipset(par);
+	if (ret)
 		return ret;
 
 	if (IS_XL(pdev->device)) {
@@ -3108,28 +3185,28 @@
 	u32 driv_inf_tab, sig;
 	u16 lcd_ofs;
 
-	/* To support an LCD panel, we should know it's dimensions and
+	/*
+	 * To support an LCD panel, we should know it's dimensions and
 	 *  it's desired pixel clock.
 	 * There are two ways to do it:
 	 *  - Check the startup video mode and calculate the panel
 	 *    size from it. This is unreliable.
 	 *  - Read it from the driver information table in the video BIOS.
-	*/
+	 */
 	/* Address of driver information table is at offset 0x78. */
 	driv_inf_tab = bios_base + *((u16 *)(bios_base+0x78));
 
 	/* Check for the driver information table signature. */
-	sig = (*(u32 *)driv_inf_tab);
+	sig = *(u32 *)driv_inf_tab;
 	if ((sig == 0x54504c24) || /* Rage LT pro */
-		(sig == 0x544d5224) || /* Rage mobility */
-		(sig == 0x54435824) || /* Rage XC */
-		(sig == 0x544c5824)) { /* Rage XL */
+	    (sig == 0x544d5224) || /* Rage mobility */
+	    (sig == 0x54435824) || /* Rage XC */
+	    (sig == 0x544c5824)) { /* Rage XL */
 		PRINTKI("BIOS contains driver information table.\n");
-		lcd_ofs = (*(u16 *)(driv_inf_tab + 10));
+		lcd_ofs = *(u16 *)(driv_inf_tab + 10);
 		par->lcd_table = 0;
-		if (lcd_ofs != 0) {
+		if (lcd_ofs != 0)
 			par->lcd_table = bios_base + lcd_ofs;
-		}
 	}
 
 	if (par->lcd_table != 0) {
@@ -3144,14 +3221,16 @@
 		u16 width, height, panel_type, refresh_rates;
 		u16 *lcdmodeptr;
 		u32 format;
-		u8 lcd_refresh_rates[16] = {50,56,60,67,70,72,75,76,85,90,100,120,140,150,160,200};
-		/* The most important information is the panel size at
+		u8 lcd_refresh_rates[16] = { 50, 56, 60, 67, 70, 72, 75, 76, 85,
+					     90, 100, 120, 140, 150, 160, 200 };
+		/*
+		 * The most important information is the panel size at
 		 * offset 25 and 27, but there's some other nice information
 		 * which we print to the screen.
 		 */
 		id = *(u8 *)par->lcd_table;
-		strncpy(model,(char *)par->lcd_table+1,24);
-		model[23]=0;
+		strncpy(model, (char *)par->lcd_table+1, 24);
+		model[23] = 0;
 
 		width = par->lcd_width = *(u16 *)(par->lcd_table+25);
 		height = par->lcd_height = *(u16 *)(par->lcd_table+27);
@@ -3164,7 +3243,7 @@
 			txtdual = "dual (split) ";
 		else
 			txtdual = "";
-		tech = (panel_type>>2) & 63;
+		tech = (panel_type >> 2) & 63;
 		switch (tech) {
 		case 0:
 			txtmonitor = "passive matrix";
@@ -3224,22 +3303,24 @@
 			}
 		}
 		PRINTKI("%s%s %s monitor detected: %s\n",
-			txtdual ,txtcolour, txtmonitor, model);
+			txtdual, txtcolour, txtmonitor, model);
 		PRINTKI("       id=%d, %dx%d pixels, %s\n",
 			id, width, height, txtformat);
 		refresh_rates_buf[0] = 0;
 		refresh_rates = *(u16 *)(par->lcd_table+62);
 		m = 1;
 		f = 0;
-		for (i=0;i<16;i++) {
+		for (i = 0; i < 16; i++) {
 			if (refresh_rates & m) {
 				if (f == 0) {
-					sprintf(strbuf, "%d", lcd_refresh_rates[i]);
+					sprintf(strbuf, "%d",
+						lcd_refresh_rates[i]);
 					f++;
 				} else {
-					sprintf(strbuf, ",%d", lcd_refresh_rates[i]);
+					sprintf(strbuf, ",%d",
+						lcd_refresh_rates[i]);
 				}
-				strcat(refresh_rates_buf,strbuf);
+				strcat(refresh_rates_buf, strbuf);
 			}
 			m = m << 1;
 		}
@@ -3247,7 +3328,8 @@
 		PRINTKI("       supports refresh rates [%s], default %d Hz\n",
 			refresh_rates_buf, lcd_refresh_rates[default_refresh_rate]);
 		par->lcd_refreshrate = lcd_refresh_rates[default_refresh_rate];
-		/* We now need to determine the crtc parameters for the
+		/*
+		 * We now need to determine the crtc parameters for the
 		 * LCD monitor. This is tricky, because they are not stored
 		 * individually in the BIOS. Instead, the BIOS contains a
 		 * table of display modes that work for this monitor.
@@ -3382,7 +3464,9 @@
 }
 #endif /* __i386__ */
 
-static int __devinit atyfb_setup_generic(struct pci_dev *pdev, struct fb_info *info, unsigned long addr)
+static int __devinit atyfb_setup_generic(struct pci_dev *pdev,
+					 struct fb_info *info,
+					 unsigned long addr)
 {
 	struct atyfb_par *par = info->par;
 	u16 tmp;
@@ -3429,10 +3513,12 @@
 		goto atyfb_setup_generic_fail;
 	}
 
-	if((ret = correct_chipset(par)))
+	ret = correct_chipset(par);
+	if (ret)
 		goto atyfb_setup_generic_fail;
 #ifdef __i386__
-	if((ret = init_from_bios(par)))
+	ret = init_from_bios(par);
+	if (ret)
 		goto atyfb_setup_generic_fail;
 #endif
 	if (!(aty_ld_le32(CRTC_GEN_CNTL, par) & CRTC_EXT_DISP_EN))
@@ -3457,7 +3543,8 @@
 
 #endif /* !__sparc__ */
 
-static int __devinit atyfb_pci_probe(struct pci_dev *pdev, const struct pci_device_id *ent)
+static int __devinit atyfb_pci_probe(struct pci_dev *pdev,
+				     const struct pci_device_id *ent)
 {
 	unsigned long addr, res_start, res_size;
 	struct fb_info *info;
@@ -3482,10 +3569,10 @@
 	/* Reserve space */
 	res_start = rp->start;
 	res_size = rp->end - rp->start + 1;
-	if (!request_mem_region (res_start, res_size, "atyfb"))
+	if (!request_mem_region(res_start, res_size, "atyfb"))
 		return -EBUSY;
 
-        /* Allocate framebuffer */
+	/* Allocate framebuffer */
 	info = framebuffer_alloc(sizeof(struct atyfb_par), &pdev->dev);
 	if (!info) {
 		PRINTKE("atyfb_pci_probe() can't alloc fb_info\n");
@@ -3573,7 +3660,8 @@
 	for (m64_num = 0; m64_num < mach64_count; m64_num++) {
 		if (!phys_vmembase[m64_num] || !phys_size[m64_num] ||
 		    !phys_guiregbase[m64_num]) {
-		    PRINTKI("phys_*[%d] parameters not set => returning early. \n", m64_num);
+			PRINTKI("phys_*[%d] parameters not set => "
+				"returning early. \n", m64_num);
 			continue;
 		}
 
@@ -3589,8 +3677,8 @@
 		par->irq = (unsigned int) -1; /* something invalid */
 
 		/*
-		 *  Map the video memory (physical address given) to somewhere in the
-		 *  kernel address space.
+		 * Map the video memory (physical address given)
+		 * to somewhere in the kernel address space.
 		 */
 		info->screen_base = ioremap(phys_vmembase[m64_num], phys_size[m64_num]);
 		info->fix.smem_start = (unsigned long)info->screen_base; /* Fake! */
@@ -3661,12 +3749,12 @@
 
 #ifdef CONFIG_MTRR
 	if (par->mtrr_reg >= 0) {
-	    mtrr_del(par->mtrr_reg, 0, 0);
-	    par->mtrr_reg = -1;
+		mtrr_del(par->mtrr_reg, 0, 0);
+		par->mtrr_reg = -1;
 	}
 	if (par->mtrr_aper >= 0) {
-	    mtrr_del(par->mtrr_aper, 0, 0);
-	    par->mtrr_aper = -1;
+		mtrr_del(par->mtrr_aper, 0, 0);
+		par->mtrr_aper = -1;
 	}
 #endif
 #ifndef __sparc__
@@ -3900,29 +3988,29 @@
 
 static int __init atyfb_init(void)
 {
-    int err1 = 1, err2 = 1;
+	int err1 = 1, err2 = 1;
 #ifndef MODULE
-    char *option = NULL;
+	char *option = NULL;
 
-    if (fb_get_options("atyfb", &option))
-	return -ENODEV;
-    atyfb_setup(option);
+	if (fb_get_options("atyfb", &option))
+		return -ENODEV;
+	atyfb_setup(option);
 #endif
 
 #ifdef CONFIG_PCI
-    err1 = pci_register_driver(&atyfb_driver);
+	err1 = pci_register_driver(&atyfb_driver);
 #endif
 #ifdef CONFIG_ATARI
-    err2 = atyfb_atari_probe();
+	err2 = atyfb_atari_probe();
 #endif
 
-    if (err1 && err2)
-	return -ENODEV;
+	if (err1 && err2)
+		return -ENODEV;
 
-    if (dmi_check_system(atyfb_reboot_ids))
-	register_reboot_notifier(&atyfb_reboot_notifier);
+	if (dmi_check_system(atyfb_reboot_ids))
+		register_reboot_notifier(&atyfb_reboot_notifier);
 
-    return 0;
+	return 0;
 }
 
 static void __exit atyfb_exit(void)
@@ -3951,8 +4039,7 @@
 module_param(xclk, int, 0);
 MODULE_PARM_DESC(xclk, "int: override accelerated engine clock");
 module_param(comp_sync, int, 0);
-MODULE_PARM_DESC(comp_sync,
-		 "Set composite sync signal to low (0) or high (1)");
+MODULE_PARM_DESC(comp_sync, "Set composite sync signal to low (0) or high (1)");
 module_param(mode, charp, 0);
 MODULE_PARM_DESC(mode, "Specify resolution as \"<xres>x<yres>[-<bpp>][@<refresh>]\" ");
 #ifdef CONFIG_MTRR
diff --git a/drivers/video/au1100fb.c b/drivers/video/au1100fb.c
index 378f277..a699aab 100644
--- a/drivers/video/au1100fb.c
+++ b/drivers/video/au1100fb.c
@@ -715,8 +715,11 @@
 			}
 			/* Mode option (only option that start with digit) */
 			else if (isdigit(this_opt[0])) {
-				mode = kmalloc(strlen(this_opt) + 1, GFP_KERNEL);
-				strncpy(mode, this_opt, strlen(this_opt) + 1);
+				mode = kstrdup(this_opt, GFP_KERNEL);
+				if (!mode) {
+					print_err("memory allocation failed");
+					return -ENOMEM;
+				}
 			}
 			/* Unsupported option */
 			else {
diff --git a/drivers/video/backlight/corgi_lcd.c b/drivers/video/backlight/corgi_lcd.c
index f8a4bb2..2211a85 100644
--- a/drivers/video/backlight/corgi_lcd.c
+++ b/drivers/video/backlight/corgi_lcd.c
@@ -639,3 +639,4 @@
 MODULE_DESCRIPTION("LCD and backlight driver for SHARP C7x0/Cxx00");
 MODULE_AUTHOR("Eric Miao <eric.miao@marvell.com>");
 MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:corgi-lcd");
diff --git a/drivers/video/backlight/ltv350qv.c b/drivers/video/backlight/ltv350qv.c
index 2eb206b..4631ca8f 100644
--- a/drivers/video/backlight/ltv350qv.c
+++ b/drivers/video/backlight/ltv350qv.c
@@ -328,3 +328,4 @@
 MODULE_AUTHOR("Haavard Skinnemoen <hskinnemoen@atmel.com>");
 MODULE_DESCRIPTION("Samsung LTV350QV LCD Driver");
 MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:ltv350qv");
diff --git a/drivers/video/backlight/tdo24m.c b/drivers/video/backlight/tdo24m.c
index 51422fc..bbfb502 100644
--- a/drivers/video/backlight/tdo24m.c
+++ b/drivers/video/backlight/tdo24m.c
@@ -472,3 +472,4 @@
 MODULE_AUTHOR("Eric Miao <eric.miao@marvell.com>");
 MODULE_DESCRIPTION("Driver for Toppoly TDO24M LCD Panel");
 MODULE_LICENSE("GPL");
+MODULE_ALIAS("spi:tdo24m");
diff --git a/drivers/video/backlight/tosa_lcd.c b/drivers/video/backlight/tosa_lcd.c
index b7fbc75..50ec17d 100644
--- a/drivers/video/backlight/tosa_lcd.c
+++ b/drivers/video/backlight/tosa_lcd.c
@@ -300,4 +300,4 @@
 MODULE_AUTHOR("Dmitry Baryshkov");
 MODULE_LICENSE("GPL v2");
 MODULE_DESCRIPTION("LCD/Backlight control for Sharp SL-6000 PDA");
-
+MODULE_ALIAS("spi:tosa-lcd");
diff --git a/drivers/video/backlight/vgg2432a4.c b/drivers/video/backlight/vgg2432a4.c
index 8e653b8..b49063c 100644
--- a/drivers/video/backlight/vgg2432a4.c
+++ b/drivers/video/backlight/vgg2432a4.c
@@ -280,5 +280,4 @@
 MODULE_AUTHOR("Ben Dooks <ben-linux@fluff.org>");
 MODULE_DESCRIPTION("VGG2432A4 LCD Driver");
 MODULE_LICENSE("GPL v2");
-
-
+MODULE_ALIAS("spi:VGG2432A4");
diff --git a/drivers/video/console/bitblit.c b/drivers/video/console/bitblit.c
index 69864b1..6b7c8fb 100644
--- a/drivers/video/console/bitblit.c
+++ b/drivers/video/console/bitblit.c
@@ -25,7 +25,7 @@
 			       struct vc_data *vc)
 {
 	int i, offset = (vc->vc_font.height < 10) ? 1 : 2;
-	int width = (vc->vc_font.width + 7) >> 3;
+	int width = DIV_ROUND_UP(vc->vc_font.width, 8);
 	unsigned int cellsize = vc->vc_font.height * width;
 	u8 c;
 
@@ -144,7 +144,7 @@
 		      int fg, int bg)
 {
 	struct fb_image image;
-	u32 width = (vc->vc_font.width + 7)/8;
+	u32 width = DIV_ROUND_UP(vc->vc_font.width, 8);
 	u32 cellsize = width * vc->vc_font.height;
 	u32 maxcnt = info->pixmap.size/cellsize;
 	u32 scan_align = info->pixmap.scan_align - 1;
@@ -173,7 +173,7 @@
 			cnt = count;
 
 		image.width = vc->vc_font.width * cnt;
-		pitch = ((image.width + 7) >> 3) + scan_align;
+		pitch = DIV_ROUND_UP(image.width, 8) + scan_align;
 		pitch &= ~scan_align;
 		size = pitch * image.height + buf_align;
 		size &= ~buf_align;
@@ -239,7 +239,7 @@
 	struct fb_cursor cursor;
 	struct fbcon_ops *ops = info->fbcon_par;
 	unsigned short charmask = vc->vc_hi_font_mask ? 0x1ff : 0xff;
-	int w = (vc->vc_font.width + 7) >> 3, c;
+	int w = DIV_ROUND_UP(vc->vc_font.width, 8), c;
 	int y = real_y(ops->p, vc->vc_y);
 	int attribute, use_sw = (vc->vc_cursor_type & 0x10);
 	int err = 1;
diff --git a/drivers/video/console/fbcon.c b/drivers/video/console/fbcon.c
index 3a44695..5a686ce 100644
--- a/drivers/video/console/fbcon.c
+++ b/drivers/video/console/fbcon.c
@@ -114,6 +114,7 @@
 static int fbcon_is_default = 1; 
 static int fbcon_has_exited;
 static int primary_device = -1;
+static int fbcon_has_console_bind;
 
 #ifdef CONFIG_FRAMEBUFFER_CONSOLE_DETECT_PRIMARY
 static int map_override;
@@ -544,6 +545,8 @@
 			con2fb_map[i] = -1;
 		}
 		info_idx = -1;
+	} else {
+		fbcon_has_console_bind = 1;
 	}
 
 	return err;
@@ -725,7 +728,7 @@
 				  int oldidx, int found)
 {
 	struct fbcon_ops *ops = oldinfo->fbcon_par;
-	int err = 0;
+	int err = 0, ret;
 
 	if (oldinfo->fbops->fb_release &&
 	    oldinfo->fbops->fb_release(oldinfo, 0)) {
@@ -752,8 +755,14 @@
 		  newinfo in an undefined state. Thus, a call to
 		  fb_set_par() may be needed for the newinfo.
 		*/
-		if (newinfo->fbops->fb_set_par)
-			newinfo->fbops->fb_set_par(newinfo);
+		if (newinfo->fbops->fb_set_par) {
+			ret = newinfo->fbops->fb_set_par(newinfo);
+
+			if (ret)
+				printk(KERN_ERR "con2fb_release_oldinfo: "
+					"detected unhandled fb_set_par error, "
+					"error code %d\n", ret);
+		}
 	}
 
 	return err;
@@ -763,11 +772,18 @@
 				int unit, int show_logo)
 {
 	struct fbcon_ops *ops = info->fbcon_par;
+	int ret;
 
 	ops->currcon = fg_console;
 
-	if (info->fbops->fb_set_par && !(ops->flags & FBCON_FLAGS_INIT))
-		info->fbops->fb_set_par(info);
+	if (info->fbops->fb_set_par && !(ops->flags & FBCON_FLAGS_INIT)) {
+		ret = info->fbops->fb_set_par(info);
+
+		if (ret)
+			printk(KERN_ERR "con2fb_init_display: detected "
+				"unhandled fb_set_par error, "
+				"error code %d\n", ret);
+	}
 
 	ops->flags |= FBCON_FLAGS_INIT;
 	ops->graphics = 0;
@@ -1006,7 +1022,7 @@
 	struct vc_data *svc = *default_mode;
 	struct display *t, *p = &fb_display[vc->vc_num];
 	int logo = 1, new_rows, new_cols, rows, cols, charcnt = 256;
-	int cap;
+	int cap, ret;
 
 	if (info_idx == -1 || info == NULL)
 	    return;
@@ -1092,8 +1108,15 @@
 	 */
 	if (CON_IS_VISIBLE(vc) && vc->vc_mode == KD_TEXT) {
 		if (info->fbops->fb_set_par &&
-		    !(ops->flags & FBCON_FLAGS_INIT))
-			info->fbops->fb_set_par(info);
+		    !(ops->flags & FBCON_FLAGS_INIT)) {
+			ret = info->fbops->fb_set_par(info);
+
+			if (ret)
+				printk(KERN_ERR "fbcon_init: detected "
+					"unhandled fb_set_par error, "
+					"error code %d\n", ret);
+		}
+
 		ops->flags |= FBCON_FLAGS_INIT;
 	}
 
@@ -2119,7 +2142,7 @@
 	struct fbcon_ops *ops;
 	struct display *p = &fb_display[vc->vc_num];
 	struct fb_var_screeninfo var;
-	int i, prev_console, charcnt = 256;
+	int i, ret, prev_console, charcnt = 256;
 
 	info = registered_fb[con2fb_map[vc->vc_num]];
 	ops = info->fbcon_par;
@@ -2174,8 +2197,14 @@
 
 	if (old_info != NULL && (old_info != info ||
 				 info->flags & FBINFO_MISC_ALWAYS_SETPAR)) {
-		if (info->fbops->fb_set_par)
-			info->fbops->fb_set_par(info);
+		if (info->fbops->fb_set_par) {
+			ret = info->fbops->fb_set_par(info);
+
+			if (ret)
+				printk(KERN_ERR "fbcon_switch: detected "
+					"unhandled fb_set_par error, "
+					"error code %d\n", ret);
+		}
 
 		if (old_info != info)
 			fbcon_del_cursor_timer(old_info);
@@ -2923,6 +2952,10 @@
 
 	ret = unbind_con_driver(&fb_con, first_fb_vc, last_fb_vc,
 				fbcon_is_default);
+
+	if (!ret)
+		fbcon_has_console_bind = 0;
+
 	return ret;
 }
 #else
@@ -2936,6 +2969,9 @@
 {
 	int i, new_idx = -1, ret = 0;
 
+	if (!fbcon_has_console_bind)
+		return 0;
+
 	for (i = first_fb_vc; i <= last_fb_vc; i++) {
 		if (con2fb_map[i] != idx &&
 		    con2fb_map[i] != -1) {
diff --git a/drivers/video/console/newport_con.c b/drivers/video/console/newport_con.c
index d31b203..3772433 100644
--- a/drivers/video/console/newport_con.c
+++ b/drivers/video/console/newport_con.c
@@ -216,7 +216,7 @@
 	}
 
 	newport_xsize = newport_ysize = 0;
-	for (i = 0; linetable[i + 1] && (i < sizeof(linetable)); i += 2) {
+	for (i = 0; i < ARRAY_SIZE(linetable) - 1 && linetable[i + 1]; i += 2) {
 		cols = 0;
 		newport_vc2_set(npregs, VC2_IREG_RADDR, linetable[i]);
 		npregs->set.dcbmode = (NPORT_DMODE_AVC2 | VC2_REGADDR_RAM |
diff --git a/drivers/video/console/vgacon.c b/drivers/video/console/vgacon.c
index 74e96cf..da55cca 100644
--- a/drivers/video/console/vgacon.c
+++ b/drivers/video/console/vgacon.c
@@ -589,12 +589,14 @@
 
 static void vgacon_deinit(struct vc_data *c)
 {
-	/* When closing the last console, reset video origin */
-	if (!--vgacon_uni_pagedir[1]) {
+	/* When closing the active console, reset video origin */
+	if (CON_IS_VISIBLE(c)) {
 		c->vc_visible_origin = vga_vram_base;
 		vga_set_mem_top(c);
-		con_free_unimap(c);
 	}
+
+	if (!--vgacon_uni_pagedir[1])
+		con_free_unimap(c);
 	c->vc_uni_pagedir_loc = &c->vc_uni_pagedir;
 	con_set_default_unimap(c);
 }
diff --git a/drivers/video/da8xx-fb.c b/drivers/video/da8xx-fb.c
new file mode 100644
index 0000000..42e1005
--- /dev/null
+++ b/drivers/video/da8xx-fb.c
@@ -0,0 +1,890 @@
+/*
+ * Copyright (C) 2008-2009 MontaVista Software Inc.
+ * Copyright (C) 2008-2009 Texas Instruments Inc
+ *
+ * Based on the LCD driver for TI Avalanche processors written by
+ * Ajay Singh and Shalom Hai.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License as published by
+ * the Free Software Foundation; either version 2 of the License, or
+ * (at your option)any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ */
+#include <linux/module.h>
+#include <linux/kernel.h>
+#include <linux/fb.h>
+#include <linux/dma-mapping.h>
+#include <linux/device.h>
+#include <linux/platform_device.h>
+#include <linux/uaccess.h>
+#include <linux/device.h>
+#include <linux/interrupt.h>
+#include <linux/clk.h>
+#include <video/da8xx-fb.h>
+
+#define DRIVER_NAME "da8xx_lcdc"
+
+/* LCD Status Register */
+#define LCD_END_OF_FRAME0		BIT(8)
+#define LCD_FIFO_UNDERFLOW		BIT(5)
+#define LCD_SYNC_LOST			BIT(2)
+
+/* LCD DMA Control Register */
+#define LCD_DMA_BURST_SIZE(x)		((x) << 4)
+#define LCD_DMA_BURST_1			0x0
+#define LCD_DMA_BURST_2			0x1
+#define LCD_DMA_BURST_4			0x2
+#define LCD_DMA_BURST_8			0x3
+#define LCD_DMA_BURST_16		0x4
+#define LCD_END_OF_FRAME_INT_ENA	BIT(2)
+#define LCD_DUAL_FRAME_BUFFER_ENABLE	BIT(0)
+
+/* LCD Control Register */
+#define LCD_CLK_DIVISOR(x)		((x) << 8)
+#define LCD_RASTER_MODE			0x01
+
+/* LCD Raster Control Register */
+#define LCD_PALETTE_LOAD_MODE(x)	((x) << 20)
+#define PALETTE_AND_DATA		0x00
+#define PALETTE_ONLY			0x01
+
+#define LCD_MONO_8BIT_MODE		BIT(9)
+#define LCD_RASTER_ORDER		BIT(8)
+#define LCD_TFT_MODE			BIT(7)
+#define LCD_UNDERFLOW_INT_ENA		BIT(6)
+#define LCD_MONOCHROME_MODE		BIT(1)
+#define LCD_RASTER_ENABLE		BIT(0)
+#define LCD_TFT_ALT_ENABLE		BIT(23)
+#define LCD_STN_565_ENABLE		BIT(24)
+
+/* LCD Raster Timing 2 Register */
+#define LCD_AC_BIAS_TRANSITIONS_PER_INT(x)	((x) << 16)
+#define LCD_AC_BIAS_FREQUENCY(x)		((x) << 8)
+#define LCD_SYNC_CTRL				BIT(25)
+#define LCD_SYNC_EDGE				BIT(24)
+#define LCD_INVERT_PIXEL_CLOCK			BIT(22)
+#define LCD_INVERT_LINE_CLOCK			BIT(21)
+#define LCD_INVERT_FRAME_CLOCK			BIT(20)
+
+/* LCD Block */
+#define  LCD_CTRL_REG				0x4
+#define  LCD_STAT_REG				0x8
+#define  LCD_RASTER_CTRL_REG			0x28
+#define  LCD_RASTER_TIMING_0_REG		0x2C
+#define  LCD_RASTER_TIMING_1_REG		0x30
+#define  LCD_RASTER_TIMING_2_REG		0x34
+#define  LCD_DMA_CTRL_REG			0x40
+#define  LCD_DMA_FRM_BUF_BASE_ADDR_0_REG	0x44
+#define  LCD_DMA_FRM_BUF_CEILING_ADDR_0_REG	0x48
+
+#define WSI_TIMEOUT	50
+#define PALETTE_SIZE	256
+#define LEFT_MARGIN	64
+#define RIGHT_MARGIN	64
+#define UPPER_MARGIN	32
+#define LOWER_MARGIN	32
+
+static resource_size_t da8xx_fb_reg_base;
+static struct resource *lcdc_regs;
+
+static inline unsigned int lcdc_read(unsigned int addr)
+{
+	return (unsigned int)__raw_readl(da8xx_fb_reg_base + (addr));
+}
+
+static inline void lcdc_write(unsigned int val, unsigned int addr)
+{
+	__raw_writel(val, da8xx_fb_reg_base + (addr));
+}
+
+struct da8xx_fb_par {
+	resource_size_t p_palette_base;
+	unsigned char *v_palette_base;
+	struct clk *lcdc_clk;
+	int irq;
+	unsigned short pseudo_palette[16];
+	unsigned int databuf_sz;
+	unsigned int palette_sz;
+};
+
+/* Variable Screen Information */
+static struct fb_var_screeninfo da8xx_fb_var __devinitdata = {
+	.xoffset = 0,
+	.yoffset = 0,
+	.transp = {0, 0, 0},
+	.nonstd = 0,
+	.activate = 0,
+	.height = -1,
+	.width = -1,
+	.pixclock = 46666,	/* 46us - AUO display */
+	.accel_flags = 0,
+	.left_margin = LEFT_MARGIN,
+	.right_margin = RIGHT_MARGIN,
+	.upper_margin = UPPER_MARGIN,
+	.lower_margin = LOWER_MARGIN,
+	.sync = 0,
+	.vmode = FB_VMODE_NONINTERLACED
+};
+
+static struct fb_fix_screeninfo da8xx_fb_fix __devinitdata = {
+	.id = "DA8xx FB Drv",
+	.type = FB_TYPE_PACKED_PIXELS,
+	.type_aux = 0,
+	.visual = FB_VISUAL_PSEUDOCOLOR,
+	.xpanstep = 1,
+	.ypanstep = 1,
+	.ywrapstep = 1,
+	.accel = FB_ACCEL_NONE
+};
+
+struct da8xx_panel {
+	const char	name[25];	/* Full name <vendor>_<model> */
+	unsigned short	width;
+	unsigned short	height;
+	int		hfp;		/* Horizontal front porch */
+	int		hbp;		/* Horizontal back porch */
+	int		hsw;		/* Horizontal Sync Pulse Width */
+	int		vfp;		/* Vertical front porch */
+	int		vbp;		/* Vertical back porch */
+	int		vsw;		/* Vertical Sync Pulse Width */
+	int		pxl_clk;	/* Pixel clock */
+	unsigned char	invert_pxl_clk;	/* Invert Pixel clock */
+};
+
+static struct da8xx_panel known_lcd_panels[] = {
+	/* Sharp LCD035Q3DG01 */
+	[0] = {
+		.name = "Sharp_LCD035Q3DG01",
+		.width = 320,
+		.height = 240,
+		.hfp = 8,
+		.hbp = 6,
+		.hsw = 0,
+		.vfp = 2,
+		.vbp = 2,
+		.vsw = 0,
+		.pxl_clk = 0x10,
+		.invert_pxl_clk = 1,
+	},
+	/* Sharp LK043T1DG01 */
+	[1] = {
+		.name = "Sharp_LK043T1DG01",
+		.width = 480,
+		.height = 272,
+		.hfp = 2,
+		.hbp = 2,
+		.hsw = 41,
+		.vfp = 2,
+		.vbp = 2,
+		.vsw = 10,
+		.pxl_clk = 0x12,
+		.invert_pxl_clk = 0,
+	},
+};
+
+/* Disable the Raster Engine of the LCD Controller */
+static void lcd_disable_raster(struct da8xx_fb_par *par)
+{
+	u32 reg;
+
+	reg = lcdc_read(LCD_RASTER_CTRL_REG);
+	if (reg & LCD_RASTER_ENABLE)
+		lcdc_write(reg & ~LCD_RASTER_ENABLE, LCD_RASTER_CTRL_REG);
+}
+
+static void lcd_blit(int load_mode, struct da8xx_fb_par *par)
+{
+	u32 tmp = par->p_palette_base + par->databuf_sz - 4;
+	u32 reg;
+
+	/* Update the databuf in the hw. */
+	lcdc_write(par->p_palette_base, LCD_DMA_FRM_BUF_BASE_ADDR_0_REG);
+	lcdc_write(tmp, LCD_DMA_FRM_BUF_CEILING_ADDR_0_REG);
+
+	/* Start the DMA. */
+	reg = lcdc_read(LCD_RASTER_CTRL_REG);
+	reg &= ~(3 << 20);
+	if (load_mode == LOAD_DATA)
+		reg |= LCD_PALETTE_LOAD_MODE(PALETTE_AND_DATA);
+	else if (load_mode == LOAD_PALETTE)
+		reg |= LCD_PALETTE_LOAD_MODE(PALETTE_ONLY);
+
+	lcdc_write(reg, LCD_RASTER_CTRL_REG);
+}
+
+/* Configure the Burst Size of DMA */
+static int lcd_cfg_dma(int burst_size)
+{
+	u32 reg;
+
+	reg = lcdc_read(LCD_DMA_CTRL_REG) & 0x00000001;
+	switch (burst_size) {
+	case 1:
+		reg |= LCD_DMA_BURST_SIZE(LCD_DMA_BURST_1);
+		break;
+	case 2:
+		reg |= LCD_DMA_BURST_SIZE(LCD_DMA_BURST_2);
+		break;
+	case 4:
+		reg |= LCD_DMA_BURST_SIZE(LCD_DMA_BURST_4);
+		break;
+	case 8:
+		reg |= LCD_DMA_BURST_SIZE(LCD_DMA_BURST_8);
+		break;
+	case 16:
+		reg |= LCD_DMA_BURST_SIZE(LCD_DMA_BURST_16);
+		break;
+	default:
+		return -EINVAL;
+	}
+	lcdc_write(reg, LCD_DMA_CTRL_REG);
+
+	return 0;
+}
+
+static void lcd_cfg_ac_bias(int period, int transitions_per_int)
+{
+	u32 reg;
+
+	/* Set the AC Bias Period and Number of Transisitons per Interrupt */
+	reg = lcdc_read(LCD_RASTER_TIMING_2_REG) & 0xFFF00000;
+	reg |= LCD_AC_BIAS_FREQUENCY(period) |
+		LCD_AC_BIAS_TRANSITIONS_PER_INT(transitions_per_int);
+	lcdc_write(reg, LCD_RASTER_TIMING_2_REG);
+}
+
+static void lcd_cfg_horizontal_sync(int back_porch, int pulse_width,
+		int front_porch)
+{
+	u32 reg;
+
+	reg = lcdc_read(LCD_RASTER_TIMING_0_REG) & 0xf;
+	reg |= ((back_porch & 0xff) << 24)
+	    | ((front_porch & 0xff) << 16)
+	    | ((pulse_width & 0x3f) << 10);
+	lcdc_write(reg, LCD_RASTER_TIMING_0_REG);
+}
+
+static void lcd_cfg_vertical_sync(int back_porch, int pulse_width,
+		int front_porch)
+{
+	u32 reg;
+
+	reg = lcdc_read(LCD_RASTER_TIMING_1_REG) & 0x3ff;
+	reg |= ((back_porch & 0xff) << 24)
+	    | ((front_porch & 0xff) << 16)
+	    | ((pulse_width & 0x3f) << 10);
+	lcdc_write(reg, LCD_RASTER_TIMING_1_REG);
+}
+
+static int lcd_cfg_display(const struct lcd_ctrl_config *cfg)
+{
+	u32 reg;
+
+	reg = lcdc_read(LCD_RASTER_CTRL_REG) & ~(LCD_TFT_MODE |
+						LCD_MONO_8BIT_MODE |
+						LCD_MONOCHROME_MODE);
+
+	switch (cfg->p_disp_panel->panel_shade) {
+	case MONOCHROME:
+		reg |= LCD_MONOCHROME_MODE;
+		if (cfg->mono_8bit_mode)
+			reg |= LCD_MONO_8BIT_MODE;
+		break;
+	case COLOR_ACTIVE:
+		reg |= LCD_TFT_MODE;
+		if (cfg->tft_alt_mode)
+			reg |= LCD_TFT_ALT_ENABLE;
+		break;
+
+	case COLOR_PASSIVE:
+		if (cfg->stn_565_mode)
+			reg |= LCD_STN_565_ENABLE;
+		break;
+
+	default:
+		return -EINVAL;
+	}
+
+	/* enable additional interrupts here */
+	reg |= LCD_UNDERFLOW_INT_ENA;
+
+	lcdc_write(reg, LCD_RASTER_CTRL_REG);
+
+	reg = lcdc_read(LCD_RASTER_TIMING_2_REG);
+
+	if (cfg->sync_ctrl)
+		reg |= LCD_SYNC_CTRL;
+	else
+		reg &= ~LCD_SYNC_CTRL;
+
+	if (cfg->sync_edge)
+		reg |= LCD_SYNC_EDGE;
+	else
+		reg &= ~LCD_SYNC_EDGE;
+
+	if (cfg->invert_line_clock)
+		reg |= LCD_INVERT_LINE_CLOCK;
+	else
+		reg &= ~LCD_INVERT_LINE_CLOCK;
+
+	if (cfg->invert_frm_clock)
+		reg |= LCD_INVERT_FRAME_CLOCK;
+	else
+		reg &= ~LCD_INVERT_FRAME_CLOCK;
+
+	lcdc_write(reg, LCD_RASTER_TIMING_2_REG);
+
+	return 0;
+}
+
+static int lcd_cfg_frame_buffer(struct da8xx_fb_par *par, u32 width, u32 height,
+		u32 bpp, u32 raster_order)
+{
+	u32 bpl, reg;
+
+	/* Disable Dual Frame Buffer. */
+	reg = lcdc_read(LCD_DMA_CTRL_REG);
+	lcdc_write(reg & ~LCD_DUAL_FRAME_BUFFER_ENABLE,
+						LCD_DMA_CTRL_REG);
+	/* Set the Panel Width */
+	/* Pixels per line = (PPL + 1)*16 */
+	/*0x3F in bits 4..9 gives max horisontal resolution = 1024 pixels*/
+	width &= 0x3f0;
+	reg = lcdc_read(LCD_RASTER_TIMING_0_REG);
+	reg &= 0xfffffc00;
+	reg |= ((width >> 4) - 1) << 4;
+	lcdc_write(reg, LCD_RASTER_TIMING_0_REG);
+
+	/* Set the Panel Height */
+	reg = lcdc_read(LCD_RASTER_TIMING_1_REG);
+	reg = ((height - 1) & 0x3ff) | (reg & 0xfffffc00);
+	lcdc_write(reg, LCD_RASTER_TIMING_1_REG);
+
+	/* Set the Raster Order of the Frame Buffer */
+	reg = lcdc_read(LCD_RASTER_CTRL_REG) & ~(1 << 8);
+	if (raster_order)
+		reg |= LCD_RASTER_ORDER;
+	lcdc_write(reg, LCD_RASTER_CTRL_REG);
+
+	switch (bpp) {
+	case 1:
+	case 2:
+	case 4:
+	case 16:
+		par->palette_sz = 16 * 2;
+		break;
+
+	case 8:
+		par->palette_sz = 256 * 2;
+		break;
+
+	default:
+		return -EINVAL;
+	}
+
+	bpl = width * bpp / 8;
+	par->databuf_sz = height * bpl + par->palette_sz;
+
+	return 0;
+}
+
+static int fb_setcolreg(unsigned regno, unsigned red, unsigned green,
+			      unsigned blue, unsigned transp,
+			      struct fb_info *info)
+{
+	struct da8xx_fb_par *par = info->par;
+	unsigned short *palette = (unsigned short *)par->v_palette_base;
+	u_short pal;
+
+	if (regno > 255)
+		return 1;
+
+	if (info->fix.visual == FB_VISUAL_DIRECTCOLOR)
+		return 1;
+
+	if (info->var.bits_per_pixel == 8) {
+		red >>= 4;
+		green >>= 8;
+		blue >>= 12;
+
+		pal = (red & 0x0f00);
+		pal |= (green & 0x00f0);
+		pal |= (blue & 0x000f);
+
+		palette[regno] = pal;
+
+	} else if ((info->var.bits_per_pixel == 16) && regno < 16) {
+		red >>= (16 - info->var.red.length);
+		red <<= info->var.red.offset;
+
+		green >>= (16 - info->var.green.length);
+		green <<= info->var.green.offset;
+
+		blue >>= (16 - info->var.blue.length);
+		blue <<= info->var.blue.offset;
+
+		par->pseudo_palette[regno] = red | green | blue;
+
+		palette[0] = 0x4000;
+	}
+
+	return 0;
+}
+
+static void lcd_reset(struct da8xx_fb_par *par)
+{
+	/* Disable the Raster if previously Enabled */
+	if (lcdc_read(LCD_RASTER_CTRL_REG) & LCD_RASTER_ENABLE)
+		lcd_disable_raster(par);
+
+	/* DMA has to be disabled */
+	lcdc_write(0, LCD_DMA_CTRL_REG);
+	lcdc_write(0, LCD_RASTER_CTRL_REG);
+}
+
+static int lcd_init(struct da8xx_fb_par *par, const struct lcd_ctrl_config *cfg,
+		struct da8xx_panel *panel)
+{
+	u32 bpp;
+	int ret = 0;
+
+	lcd_reset(par);
+
+	/* Configure the LCD clock divisor. */
+	lcdc_write(LCD_CLK_DIVISOR(panel->pxl_clk) |
+			(LCD_RASTER_MODE & 0x1), LCD_CTRL_REG);
+
+	if (panel->invert_pxl_clk)
+		lcdc_write((lcdc_read(LCD_RASTER_TIMING_2_REG) |
+			LCD_INVERT_PIXEL_CLOCK), LCD_RASTER_TIMING_2_REG);
+	else
+		lcdc_write((lcdc_read(LCD_RASTER_TIMING_2_REG) &
+			~LCD_INVERT_PIXEL_CLOCK), LCD_RASTER_TIMING_2_REG);
+
+	/* Configure the DMA burst size. */
+	ret = lcd_cfg_dma(cfg->dma_burst_sz);
+	if (ret < 0)
+		return ret;
+
+	/* Configure the AC bias properties. */
+	lcd_cfg_ac_bias(cfg->ac_bias, cfg->ac_bias_intrpt);
+
+	/* Configure the vertical and horizontal sync properties. */
+	lcd_cfg_vertical_sync(panel->vbp, panel->vsw, panel->vfp);
+	lcd_cfg_horizontal_sync(panel->hbp, panel->hsw, panel->hfp);
+
+	/* Configure for disply */
+	ret = lcd_cfg_display(cfg);
+	if (ret < 0)
+		return ret;
+
+	if (QVGA != cfg->p_disp_panel->panel_type)
+		return -EINVAL;
+
+	if (cfg->bpp <= cfg->p_disp_panel->max_bpp &&
+	    cfg->bpp >= cfg->p_disp_panel->min_bpp)
+		bpp = cfg->bpp;
+	else
+		bpp = cfg->p_disp_panel->max_bpp;
+	if (bpp == 12)
+		bpp = 16;
+	ret = lcd_cfg_frame_buffer(par, (unsigned int)panel->width,
+				(unsigned int)panel->height, bpp,
+				cfg->raster_order);
+	if (ret < 0)
+		return ret;
+
+	/* Configure FDD */
+	lcdc_write((lcdc_read(LCD_RASTER_CTRL_REG) & 0xfff00fff) |
+		       (cfg->fdd << 12), LCD_RASTER_CTRL_REG);
+
+	return 0;
+}
+
+static irqreturn_t lcdc_irq_handler(int irq, void *arg)
+{
+	u32 stat = lcdc_read(LCD_STAT_REG);
+	u32 reg;
+
+	if ((stat & LCD_SYNC_LOST) && (stat & LCD_FIFO_UNDERFLOW)) {
+		reg = lcdc_read(LCD_RASTER_CTRL_REG);
+		lcdc_write(reg & ~LCD_RASTER_ENABLE, LCD_RASTER_CTRL_REG);
+		lcdc_write(stat, LCD_STAT_REG);
+		lcdc_write(reg | LCD_RASTER_ENABLE, LCD_RASTER_CTRL_REG);
+	} else
+		lcdc_write(stat, LCD_STAT_REG);
+
+	return IRQ_HANDLED;
+}
+
+static int fb_check_var(struct fb_var_screeninfo *var,
+			struct fb_info *info)
+{
+	int err = 0;
+
+	switch (var->bits_per_pixel) {
+	case 1:
+	case 8:
+		var->red.offset = 0;
+		var->red.length = 8;
+		var->green.offset = 0;
+		var->green.length = 8;
+		var->blue.offset = 0;
+		var->blue.length = 8;
+		var->transp.offset = 0;
+		var->transp.length = 0;
+		break;
+	case 4:
+		var->red.offset = 0;
+		var->red.length = 4;
+		var->green.offset = 0;
+		var->green.length = 4;
+		var->blue.offset = 0;
+		var->blue.length = 4;
+		var->transp.offset = 0;
+		var->transp.length = 0;
+		break;
+	case 16:		/* RGB 565 */
+		var->red.offset = 0;
+		var->red.length = 5;
+		var->green.offset = 5;
+		var->green.length = 6;
+		var->blue.offset = 11;
+		var->blue.length = 5;
+		var->transp.offset = 0;
+		var->transp.length = 0;
+		break;
+	default:
+		err = -EINVAL;
+	}
+
+	var->red.msb_right = 0;
+	var->green.msb_right = 0;
+	var->blue.msb_right = 0;
+	var->transp.msb_right = 0;
+	return err;
+}
+
+static int __devexit fb_remove(struct platform_device *dev)
+{
+	struct fb_info *info = dev_get_drvdata(&dev->dev);
+
+	if (info) {
+		struct da8xx_fb_par *par = info->par;
+
+		if (lcdc_read(LCD_RASTER_CTRL_REG) & LCD_RASTER_ENABLE)
+			lcd_disable_raster(par);
+		lcdc_write(0, LCD_RASTER_CTRL_REG);
+
+		/* disable DMA  */
+		lcdc_write(0, LCD_DMA_CTRL_REG);
+
+		unregister_framebuffer(info);
+		fb_dealloc_cmap(&info->cmap);
+		dma_free_coherent(NULL, par->databuf_sz + PAGE_SIZE,
+					info->screen_base,
+					info->fix.smem_start);
+		free_irq(par->irq, par);
+		clk_disable(par->lcdc_clk);
+		clk_put(par->lcdc_clk);
+		framebuffer_release(info);
+		iounmap((void __iomem *)da8xx_fb_reg_base);
+		release_mem_region(lcdc_regs->start, resource_size(lcdc_regs));
+
+	}
+	return 0;
+}
+
+static int fb_ioctl(struct fb_info *info, unsigned int cmd,
+			  unsigned long arg)
+{
+	struct lcd_sync_arg sync_arg;
+
+	switch (cmd) {
+	case FBIOGET_CONTRAST:
+	case FBIOPUT_CONTRAST:
+	case FBIGET_BRIGHTNESS:
+	case FBIPUT_BRIGHTNESS:
+	case FBIGET_COLOR:
+	case FBIPUT_COLOR:
+		return -ENOTTY;
+	case FBIPUT_HSYNC:
+		if (copy_from_user(&sync_arg, (char *)arg,
+				sizeof(struct lcd_sync_arg)))
+			return -EFAULT;
+		lcd_cfg_horizontal_sync(sync_arg.back_porch,
+					sync_arg.pulse_width,
+					sync_arg.front_porch);
+		break;
+	case FBIPUT_VSYNC:
+		if (copy_from_user(&sync_arg, (char *)arg,
+				sizeof(struct lcd_sync_arg)))
+			return -EFAULT;
+		lcd_cfg_vertical_sync(sync_arg.back_porch,
+					sync_arg.pulse_width,
+					sync_arg.front_porch);
+		break;
+	default:
+		return -EINVAL;
+	}
+	return 0;
+}
+
+static struct fb_ops da8xx_fb_ops = {
+	.owner = THIS_MODULE,
+	.fb_check_var = fb_check_var,
+	.fb_setcolreg = fb_setcolreg,
+	.fb_ioctl = fb_ioctl,
+	.fb_fillrect = cfb_fillrect,
+	.fb_copyarea = cfb_copyarea,
+	.fb_imageblit = cfb_imageblit,
+};
+
+static int __init fb_probe(struct platform_device *device)
+{
+	struct da8xx_lcdc_platform_data *fb_pdata =
+						device->dev.platform_data;
+	struct lcd_ctrl_config *lcd_cfg;
+	struct da8xx_panel *lcdc_info;
+	struct fb_info *da8xx_fb_info;
+	struct clk *fb_clk = NULL;
+	struct da8xx_fb_par *par;
+	resource_size_t len;
+	int ret, i;
+
+	if (fb_pdata == NULL) {
+		dev_err(&device->dev, "Can not get platform data\n");
+		return -ENOENT;
+	}
+
+	lcdc_regs = platform_get_resource(device, IORESOURCE_MEM, 0);
+	if (!lcdc_regs) {
+		dev_err(&device->dev,
+			"Can not get memory resource for LCD controller\n");
+		return -ENOENT;
+	}
+
+	len = resource_size(lcdc_regs);
+
+	lcdc_regs = request_mem_region(lcdc_regs->start, len, lcdc_regs->name);
+	if (!lcdc_regs)
+		return -EBUSY;
+
+	da8xx_fb_reg_base = (resource_size_t)ioremap(lcdc_regs->start, len);
+	if (!da8xx_fb_reg_base) {
+		ret = -EBUSY;
+		goto err_request_mem;
+	}
+
+	fb_clk = clk_get(&device->dev, NULL);
+	if (IS_ERR(fb_clk)) {
+		dev_err(&device->dev, "Can not get device clock\n");
+		ret = -ENODEV;
+		goto err_ioremap;
+	}
+	ret = clk_enable(fb_clk);
+	if (ret)
+		goto err_clk_put;
+
+	for (i = 0, lcdc_info = known_lcd_panels;
+		i < ARRAY_SIZE(known_lcd_panels);
+		i++, lcdc_info++) {
+		if (strcmp(fb_pdata->type, lcdc_info->name) == 0)
+			break;
+	}
+
+	if (i == ARRAY_SIZE(known_lcd_panels)) {
+		dev_err(&device->dev, "GLCD: No valid panel found\n");
+		ret = ENODEV;
+		goto err_clk_disable;
+	} else
+		dev_info(&device->dev, "GLCD: Found %s panel\n",
+					fb_pdata->type);
+
+	lcd_cfg = (struct lcd_ctrl_config *)fb_pdata->controller_data;
+
+	da8xx_fb_info = framebuffer_alloc(sizeof(struct da8xx_fb_par),
+					&device->dev);
+	if (!da8xx_fb_info) {
+		dev_dbg(&device->dev, "Memory allocation failed for fb_info\n");
+		ret = -ENOMEM;
+		goto err_clk_disable;
+	}
+
+	par = da8xx_fb_info->par;
+
+	if (lcd_init(par, lcd_cfg, lcdc_info) < 0) {
+		dev_err(&device->dev, "lcd_init failed\n");
+		ret = -EFAULT;
+		goto err_release_fb;
+	}
+
+	/* allocate frame buffer */
+	da8xx_fb_info->screen_base = dma_alloc_coherent(NULL,
+					par->databuf_sz + PAGE_SIZE,
+					(resource_size_t *)
+					&da8xx_fb_info->fix.smem_start,
+					GFP_KERNEL | GFP_DMA);
+
+	if (!da8xx_fb_info->screen_base) {
+		dev_err(&device->dev,
+			"GLCD: kmalloc for frame buffer failed\n");
+		ret = -EINVAL;
+		goto err_release_fb;
+	}
+
+	/* move palette base pointer by (PAGE_SIZE - palette_sz) bytes */
+	par->v_palette_base = da8xx_fb_info->screen_base +
+				(PAGE_SIZE - par->palette_sz);
+	par->p_palette_base = da8xx_fb_info->fix.smem_start +
+				(PAGE_SIZE - par->palette_sz);
+
+	/* the rest of the frame buffer is pixel data */
+	da8xx_fb_fix.smem_start = par->p_palette_base + par->palette_sz;
+	da8xx_fb_fix.smem_len = par->databuf_sz - par->palette_sz;
+	da8xx_fb_fix.line_length = (lcdc_info->width * lcd_cfg->bpp) / 8;
+
+	par->lcdc_clk = fb_clk;
+
+	par->irq = platform_get_irq(device, 0);
+	if (par->irq < 0) {
+		ret = -ENOENT;
+		goto err_release_fb_mem;
+	}
+
+	ret = request_irq(par->irq, lcdc_irq_handler, 0, DRIVER_NAME, par);
+	if (ret)
+		goto err_release_fb_mem;
+
+	/* Initialize par */
+	da8xx_fb_info->var.bits_per_pixel = lcd_cfg->bpp;
+
+	da8xx_fb_var.xres = lcdc_info->width;
+	da8xx_fb_var.xres_virtual = lcdc_info->width;
+
+	da8xx_fb_var.yres = lcdc_info->height;
+	da8xx_fb_var.yres_virtual = lcdc_info->height;
+
+	da8xx_fb_var.grayscale =
+	    lcd_cfg->p_disp_panel->panel_shade == MONOCHROME ? 1 : 0;
+	da8xx_fb_var.bits_per_pixel = lcd_cfg->bpp;
+
+	da8xx_fb_var.hsync_len = lcdc_info->hsw;
+	da8xx_fb_var.vsync_len = lcdc_info->vsw;
+
+	/* Initialize fbinfo */
+	da8xx_fb_info->flags = FBINFO_FLAG_DEFAULT;
+	da8xx_fb_info->fix = da8xx_fb_fix;
+	da8xx_fb_info->var = da8xx_fb_var;
+	da8xx_fb_info->fbops = &da8xx_fb_ops;
+	da8xx_fb_info->pseudo_palette = par->pseudo_palette;
+
+	ret = fb_alloc_cmap(&da8xx_fb_info->cmap, PALETTE_SIZE, 0);
+	if (ret)
+		goto err_free_irq;
+
+	/* First palette_sz byte of the frame buffer is the palette */
+	da8xx_fb_info->cmap.len = par->palette_sz;
+
+	/* Flush the buffer to the screen. */
+	lcd_blit(LOAD_DATA, par);
+
+	/* initialize var_screeninfo */
+	da8xx_fb_var.activate = FB_ACTIVATE_FORCE;
+	fb_set_var(da8xx_fb_info, &da8xx_fb_var);
+
+	dev_set_drvdata(&device->dev, da8xx_fb_info);
+	/* Register the Frame Buffer  */
+	if (register_framebuffer(da8xx_fb_info) < 0) {
+		dev_err(&device->dev,
+			"GLCD: Frame Buffer Registration Failed!\n");
+		ret = -EINVAL;
+		goto err_dealloc_cmap;
+	}
+
+	/* enable raster engine */
+	lcdc_write(lcdc_read(LCD_RASTER_CTRL_REG) |
+			LCD_RASTER_ENABLE, LCD_RASTER_CTRL_REG);
+
+	return 0;
+
+err_dealloc_cmap:
+	fb_dealloc_cmap(&da8xx_fb_info->cmap);
+
+err_free_irq:
+	free_irq(par->irq, par);
+
+err_release_fb_mem:
+	dma_free_coherent(NULL, par->databuf_sz + PAGE_SIZE,
+				da8xx_fb_info->screen_base,
+				da8xx_fb_info->fix.smem_start);
+
+err_release_fb:
+	framebuffer_release(da8xx_fb_info);
+
+err_clk_disable:
+	clk_disable(fb_clk);
+
+err_clk_put:
+	clk_put(fb_clk);
+
+err_ioremap:
+	iounmap((void __iomem *)da8xx_fb_reg_base);
+
+err_request_mem:
+	release_mem_region(lcdc_regs->start, len);
+
+	return ret;
+}
+
+#ifdef CONFIG_PM
+static int fb_suspend(struct platform_device *dev, pm_message_t state)
+{
+	 return -EBUSY;
+}
+static int fb_resume(struct platform_device *dev)
+{
+	 return -EBUSY;
+}
+#else
+#define fb_suspend NULL
+#define fb_resume NULL
+#endif
+
+static struct platform_driver da8xx_fb_driver = {
+	.probe = fb_probe,
+	.remove = fb_remove,
+	.suspend = fb_suspend,
+	.resume = fb_resume,
+	.driver = {
+		   .name = DRIVER_NAME,
+		   .owner = THIS_MODULE,
+		   },
+};
+
+static int __init da8xx_fb_init(void)
+{
+	return platform_driver_register(&da8xx_fb_driver);
+}
+
+static void __exit da8xx_fb_cleanup(void)
+{
+	platform_driver_unregister(&da8xx_fb_driver);
+}
+
+module_init(da8xx_fb_init);
+module_exit(da8xx_fb_cleanup);
+
+MODULE_DESCRIPTION("Framebuffer driver for TI da8xx/omap-l1xx");
+MODULE_AUTHOR("Texas Instruments");
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/ep93xx-fb.c b/drivers/video/ep93xx-fb.c
new file mode 100644
index 0000000..bd9d46f
--- /dev/null
+++ b/drivers/video/ep93xx-fb.c
@@ -0,0 +1,646 @@
+/*
+ * linux/drivers/video/ep93xx-fb.c
+ *
+ * Framebuffer support for the EP93xx series.
+ *
+ * Copyright (C) 2007 Bluewater Systems Ltd
+ * Author: Ryan Mallon <ryan@bluewatersys.com>
+ *
+ * Copyright (c) 2009 H Hartley Sweeten <hsweeten@visionengravers.com>
+ *
+ * Based on the Cirrus Logic ep93xxfb driver, and various other ep93xxfb
+ * drivers.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ */
+
+#include <linux/platform_device.h>
+#include <linux/dma-mapping.h>
+#include <linux/clk.h>
+#include <linux/fb.h>
+
+#include <mach/fb.h>
+
+/* Vertical Frame Timing Registers */
+#define EP93XXFB_VLINES_TOTAL			0x0000	/* SW locked */
+#define EP93XXFB_VSYNC				0x0004	/* SW locked */
+#define EP93XXFB_VACTIVE			0x0008	/* SW locked */
+#define EP93XXFB_VBLANK				0x0228	/* SW locked */
+#define EP93XXFB_VCLK				0x000c	/* SW locked */
+
+/* Horizontal Frame Timing Registers */
+#define EP93XXFB_HCLKS_TOTAL			0x0010	/* SW locked */
+#define EP93XXFB_HSYNC				0x0014	/* SW locked */
+#define EP93XXFB_HACTIVE			0x0018	/* SW locked */
+#define EP93XXFB_HBLANK				0x022c	/* SW locked */
+#define EP93XXFB_HCLK				0x001c	/* SW locked */
+
+/* Frame Buffer Memory Configuration Registers */
+#define EP93XXFB_SCREEN_PAGE			0x0028
+#define EP93XXFB_SCREEN_HPAGE			0x002c
+#define EP93XXFB_SCREEN_LINES			0x0030
+#define EP93XXFB_LINE_LENGTH			0x0034
+#define EP93XXFB_VLINE_STEP			0x0038
+#define EP93XXFB_LINE_CARRY			0x003c	/* SW locked */
+#define EP93XXFB_EOL_OFFSET			0x0230
+
+/* Other Video Registers */
+#define EP93XXFB_BRIGHTNESS			0x0020
+#define EP93XXFB_ATTRIBS			0x0024	/* SW locked */
+#define EP93XXFB_SWLOCK				0x007c	/* SW locked */
+#define EP93XXFB_AC_RATE			0x0214
+#define EP93XXFB_FIFO_LEVEL			0x0234
+#define EP93XXFB_PIXELMODE			0x0054
+#define EP93XXFB_PIXELMODE_32BPP		(0x7 << 0)
+#define EP93XXFB_PIXELMODE_24BPP		(0x6 << 0)
+#define EP93XXFB_PIXELMODE_16BPP		(0x4 << 0)
+#define EP93XXFB_PIXELMODE_8BPP			(0x2 << 0)
+#define EP93XXFB_PIXELMODE_SHIFT_1P_24B		(0x0 << 3)
+#define EP93XXFB_PIXELMODE_SHIFT_1P_18B		(0x1 << 3)
+#define EP93XXFB_PIXELMODE_COLOR_LUT		(0x0 << 10)
+#define EP93XXFB_PIXELMODE_COLOR_888		(0x4 << 10)
+#define EP93XXFB_PIXELMODE_COLOR_555		(0x5 << 10)
+#define EP93XXFB_PARL_IF_OUT			0x0058
+#define EP93XXFB_PARL_IF_IN			0x005c
+
+/* Blink Control Registers */
+#define EP93XXFB_BLINK_RATE			0x0040
+#define EP93XXFB_BLINK_MASK			0x0044
+#define EP93XXFB_BLINK_PATTRN			0x0048
+#define EP93XXFB_PATTRN_MASK			0x004c
+#define EP93XXFB_BKGRND_OFFSET			0x0050
+
+/* Hardware Cursor Registers */
+#define EP93XXFB_CURSOR_ADR_START		0x0060
+#define EP93XXFB_CURSOR_ADR_RESET		0x0064
+#define EP93XXFB_CURSOR_SIZE			0x0068
+#define EP93XXFB_CURSOR_COLOR1			0x006c
+#define EP93XXFB_CURSOR_COLOR2			0x0070
+#define EP93XXFB_CURSOR_BLINK_COLOR1		0x021c
+#define EP93XXFB_CURSOR_BLINK_COLOR2		0x0220
+#define EP93XXFB_CURSOR_XY_LOC			0x0074
+#define EP93XXFB_CURSOR_DSCAN_HY_LOC		0x0078
+#define EP93XXFB_CURSOR_BLINK_RATE_CTRL		0x0224
+
+/* LUT Registers */
+#define EP93XXFB_GRY_SCL_LUTR			0x0080
+#define EP93XXFB_GRY_SCL_LUTG			0x0280
+#define EP93XXFB_GRY_SCL_LUTB			0x0300
+#define EP93XXFB_LUT_SW_CONTROL			0x0218
+#define EP93XXFB_LUT_SW_CONTROL_SWTCH		(1 << 0)
+#define EP93XXFB_LUT_SW_CONTROL_SSTAT		(1 << 1)
+#define EP93XXFB_COLOR_LUT			0x0400
+
+/* Video Signature Registers */
+#define EP93XXFB_VID_SIG_RSLT_VAL		0x0200
+#define EP93XXFB_VID_SIG_CTRL			0x0204
+#define EP93XXFB_VSIG				0x0208
+#define EP93XXFB_HSIG				0x020c
+#define EP93XXFB_SIG_CLR_STR			0x0210
+
+/* Minimum / Maximum resolutions supported */
+#define EP93XXFB_MIN_XRES			64
+#define EP93XXFB_MIN_YRES			64
+#define EP93XXFB_MAX_XRES			1024
+#define EP93XXFB_MAX_YRES			768
+
+struct ep93xx_fbi {
+	struct ep93xxfb_mach_info	*mach_info;
+	struct clk			*clk;
+	struct resource			*res;
+	void __iomem			*mmio_base;
+	unsigned int			pseudo_palette[256];
+};
+
+static int check_screenpage_bug = 1;
+module_param(check_screenpage_bug, int, 0644);
+MODULE_PARM_DESC(check_screenpage_bug,
+		 "Check for bit 27 screen page bug. Default = 1");
+
+static inline unsigned int ep93xxfb_readl(struct ep93xx_fbi *fbi,
+					  unsigned int off)
+{
+	return __raw_readl(fbi->mmio_base + off);
+}
+
+static inline void ep93xxfb_writel(struct ep93xx_fbi *fbi,
+				   unsigned int val, unsigned int off)
+{
+	__raw_writel(val, fbi->mmio_base + off);
+}
+
+/*
+ * Write to one of the locked raster registers.
+ */
+static inline void ep93xxfb_out_locked(struct ep93xx_fbi *fbi,
+				       unsigned int val, unsigned int reg)
+{
+	/*
+	 * We don't need a lock or delay here since the raster register
+	 * block will remain unlocked until the next access.
+	 */
+	ep93xxfb_writel(fbi, 0xaa, EP93XXFB_SWLOCK);
+	ep93xxfb_writel(fbi, val, reg);
+}
+
+static void ep93xxfb_set_video_attribs(struct fb_info *info)
+{
+	struct ep93xx_fbi *fbi = info->par;
+	unsigned int attribs;
+
+	attribs = EP93XXFB_ENABLE;
+	attribs |= fbi->mach_info->flags;
+	ep93xxfb_out_locked(fbi, attribs, EP93XXFB_ATTRIBS);
+}
+
+static int ep93xxfb_set_pixelmode(struct fb_info *info)
+{
+	struct ep93xx_fbi *fbi = info->par;
+	unsigned int val;
+
+	info->var.transp.offset = 0;
+	info->var.transp.length = 0;
+
+	switch (info->var.bits_per_pixel) {
+	case 8:
+		val = EP93XXFB_PIXELMODE_8BPP | EP93XXFB_PIXELMODE_COLOR_LUT |
+			EP93XXFB_PIXELMODE_SHIFT_1P_18B;
+
+		info->var.red.offset	= 0;
+		info->var.red.length	= 8;
+		info->var.green.offset	= 0;
+		info->var.green.length	= 8;
+		info->var.blue.offset	= 0;
+		info->var.blue.length	= 8;
+		info->fix.visual 	= FB_VISUAL_PSEUDOCOLOR;
+		break;
+
+	case 16:
+		val = EP93XXFB_PIXELMODE_16BPP | EP93XXFB_PIXELMODE_COLOR_555 |
+			EP93XXFB_PIXELMODE_SHIFT_1P_18B;
+
+		info->var.red.offset	= 11;
+		info->var.red.length	= 5;
+		info->var.green.offset	= 5;
+		info->var.green.length	= 6;
+		info->var.blue.offset	= 0;
+		info->var.blue.length	= 5;
+		info->fix.visual 	= FB_VISUAL_TRUECOLOR;
+		break;
+
+	case 24:
+		val = EP93XXFB_PIXELMODE_24BPP | EP93XXFB_PIXELMODE_COLOR_888 |
+			EP93XXFB_PIXELMODE_SHIFT_1P_24B;
+
+		info->var.red.offset	= 16;
+		info->var.red.length	= 8;
+		info->var.green.offset	= 8;
+		info->var.green.length	= 8;
+		info->var.blue.offset	= 0;
+		info->var.blue.length	= 8;
+		info->fix.visual 	= FB_VISUAL_TRUECOLOR;
+		break;
+
+	case 32:
+		val = EP93XXFB_PIXELMODE_32BPP | EP93XXFB_PIXELMODE_COLOR_888 |
+			EP93XXFB_PIXELMODE_SHIFT_1P_24B;
+
+		info->var.red.offset	= 16;
+		info->var.red.length	= 8;
+		info->var.green.offset	= 8;
+		info->var.green.length	= 8;
+		info->var.blue.offset	= 0;
+		info->var.blue.length	= 8;
+		info->fix.visual 	= FB_VISUAL_TRUECOLOR;
+		break;
+
+	default:
+		return -EINVAL;
+	}
+
+	ep93xxfb_writel(fbi, val, EP93XXFB_PIXELMODE);
+	return 0;
+}
+
+static void ep93xxfb_set_timing(struct fb_info *info)
+{
+	struct ep93xx_fbi *fbi = info->par;
+	unsigned int vlines_total, hclks_total, start, stop;
+
+	vlines_total = info->var.yres + info->var.upper_margin +
+		info->var.lower_margin + info->var.vsync_len - 1;
+
+	hclks_total = info->var.xres + info->var.left_margin +
+		info->var.right_margin + info->var.hsync_len - 1;
+
+	ep93xxfb_out_locked(fbi, vlines_total, EP93XXFB_VLINES_TOTAL);
+	ep93xxfb_out_locked(fbi, hclks_total, EP93XXFB_HCLKS_TOTAL);
+
+	start = vlines_total;
+	stop = vlines_total - info->var.vsync_len;
+	ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_VSYNC);
+
+	start = vlines_total - info->var.vsync_len - info->var.upper_margin;
+	stop = info->var.lower_margin - 1;
+	ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_VBLANK);
+	ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_VACTIVE);
+
+	start = vlines_total;
+	stop = vlines_total + 1;
+	ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_VCLK);
+
+	start = hclks_total;
+	stop = hclks_total - info->var.hsync_len;
+	ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_HSYNC);
+
+	start = hclks_total - info->var.hsync_len - info->var.left_margin;
+	stop = info->var.right_margin - 1;
+	ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_HBLANK);
+	ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_HACTIVE);
+
+	start = hclks_total;
+	stop = hclks_total;
+	ep93xxfb_out_locked(fbi, start | (stop << 16), EP93XXFB_HCLK);
+
+	ep93xxfb_out_locked(fbi, 0x0, EP93XXFB_LINE_CARRY);
+}
+
+static int ep93xxfb_set_par(struct fb_info *info)
+{
+	struct ep93xx_fbi *fbi = info->par;
+
+	clk_set_rate(fbi->clk, 1000 * PICOS2KHZ(info->var.pixclock));
+
+	ep93xxfb_set_timing(info);
+
+	info->fix.line_length = info->var.xres_virtual *
+		info->var.bits_per_pixel / 8;
+
+	ep93xxfb_writel(fbi, info->fix.smem_start, EP93XXFB_SCREEN_PAGE);
+	ep93xxfb_writel(fbi, info->var.yres - 1, EP93XXFB_SCREEN_LINES);
+	ep93xxfb_writel(fbi, ((info->var.xres * info->var.bits_per_pixel)
+			      / 32) - 1, EP93XXFB_LINE_LENGTH);
+	ep93xxfb_writel(fbi, info->fix.line_length / 4, EP93XXFB_VLINE_STEP);
+	ep93xxfb_set_video_attribs(info);
+	return 0;
+}
+
+static int ep93xxfb_check_var(struct fb_var_screeninfo *var,
+			      struct fb_info *info)
+{
+	int err;
+
+	err = ep93xxfb_set_pixelmode(info);
+	if (err)
+		return err;
+
+	var->xres = max_t(unsigned int, var->xres, EP93XXFB_MIN_XRES);
+	var->xres = min_t(unsigned int, var->xres, EP93XXFB_MAX_XRES);
+	var->xres_virtual = max(var->xres_virtual, var->xres);
+
+	var->yres = max_t(unsigned int, var->yres, EP93XXFB_MIN_YRES);
+	var->yres = min_t(unsigned int, var->yres, EP93XXFB_MAX_YRES);
+	var->yres_virtual = max(var->yres_virtual, var->yres);
+
+	return 0;
+}
+
+static int ep93xxfb_mmap(struct fb_info *info, struct vm_area_struct *vma)
+{
+	unsigned int offset = vma->vm_pgoff << PAGE_SHIFT;
+
+	if (offset < info->fix.smem_len) {
+		return dma_mmap_writecombine(info->dev, vma, info->screen_base,
+					     info->fix.smem_start,
+					     info->fix.smem_len);
+	}
+
+	return -EINVAL;
+}
+
+static int ep93xxfb_blank(int blank_mode, struct fb_info *info)
+{
+	struct ep93xx_fbi *fbi = info->par;
+	unsigned int attribs = ep93xxfb_readl(fbi, EP93XXFB_ATTRIBS);
+
+	if (blank_mode) {
+		if (fbi->mach_info->blank)
+			fbi->mach_info->blank(blank_mode, info);
+		ep93xxfb_out_locked(fbi, attribs & ~EP93XXFB_ENABLE,
+				    EP93XXFB_ATTRIBS);
+		clk_disable(fbi->clk);
+	} else {
+		clk_enable(fbi->clk);
+		ep93xxfb_out_locked(fbi, attribs | EP93XXFB_ENABLE,
+				    EP93XXFB_ATTRIBS);
+		if (fbi->mach_info->blank)
+			fbi->mach_info->blank(blank_mode, info);
+	}
+
+	return 0;
+}
+
+static inline int ep93xxfb_convert_color(int val, int width)
+{
+	return ((val << width) + 0x7fff - val) >> 16;
+}
+
+static int ep93xxfb_setcolreg(unsigned int regno, unsigned int red,
+			      unsigned int green, unsigned int blue,
+			      unsigned int transp, struct fb_info *info)
+{
+	struct ep93xx_fbi *fbi = info->par;
+	unsigned int *pal = info->pseudo_palette;
+	unsigned int ctrl, i, rgb, lut_current, lut_stat;
+
+	switch (info->fix.visual) {
+	case FB_VISUAL_PSEUDOCOLOR:
+		rgb = ((red & 0xff00) << 8) | (green & 0xff00) |
+			((blue & 0xff00) >> 8);
+
+		pal[regno] = rgb;
+		ep93xxfb_writel(fbi, rgb, (EP93XXFB_COLOR_LUT + (regno << 2)));
+		ctrl = ep93xxfb_readl(fbi, EP93XXFB_LUT_SW_CONTROL);
+		lut_stat = !!(ctrl & EP93XXFB_LUT_SW_CONTROL_SSTAT);
+		lut_current = !!(ctrl & EP93XXFB_LUT_SW_CONTROL_SWTCH);
+
+		if (lut_stat == lut_current) {
+			for (i = 0; i < 256; i++) {
+				ep93xxfb_writel(fbi, pal[i],
+					EP93XXFB_COLOR_LUT + (i << 2));
+			}
+
+			ep93xxfb_writel(fbi,
+					ctrl ^ EP93XXFB_LUT_SW_CONTROL_SWTCH,
+					EP93XXFB_LUT_SW_CONTROL);
+		}
+		break;
+
+	case FB_VISUAL_TRUECOLOR:
+		if (regno > 16)
+			return 1;
+
+		red = ep93xxfb_convert_color(red, info->var.red.length);
+		green = ep93xxfb_convert_color(green, info->var.green.length);
+		blue = ep93xxfb_convert_color(blue, info->var.blue.length);
+		transp = ep93xxfb_convert_color(transp,
+						info->var.transp.length);
+
+		pal[regno] = (red << info->var.red.offset) |
+			(green << info->var.green.offset) |
+			(blue << info->var.blue.offset) |
+			(transp << info->var.transp.offset);
+		break;
+
+	default:
+		return 1;
+	}
+
+	return 0;
+}
+
+static struct fb_ops ep93xxfb_ops = {
+	.owner		= THIS_MODULE,
+	.fb_check_var	= ep93xxfb_check_var,
+	.fb_set_par	= ep93xxfb_set_par,
+	.fb_blank	= ep93xxfb_blank,
+	.fb_fillrect	= cfb_fillrect,
+	.fb_copyarea	= cfb_copyarea,
+	.fb_imageblit	= cfb_imageblit,
+	.fb_setcolreg	= ep93xxfb_setcolreg,
+	.fb_mmap	= ep93xxfb_mmap,
+};
+
+static int __init ep93xxfb_calc_fbsize(struct ep93xxfb_mach_info *mach_info)
+{
+	int i, fb_size = 0;
+
+	if (mach_info->num_modes == EP93XXFB_USE_MODEDB) {
+		fb_size = EP93XXFB_MAX_XRES * EP93XXFB_MAX_YRES *
+			mach_info->bpp / 8;
+	} else {
+		for (i = 0; i < mach_info->num_modes; i++) {
+			const struct fb_videomode *mode;
+			int size;
+
+			mode = &mach_info->modes[i];
+			size = mode->xres * mode->yres * mach_info->bpp / 8;
+			if (size > fb_size)
+				fb_size = size;
+		}
+	}
+
+	return fb_size;
+}
+
+static int __init ep93xxfb_alloc_videomem(struct fb_info *info)
+{
+	struct ep93xx_fbi *fbi = info->par;
+	char __iomem *virt_addr;
+	dma_addr_t phys_addr;
+	unsigned int fb_size;
+
+	fb_size = ep93xxfb_calc_fbsize(fbi->mach_info);
+	virt_addr = dma_alloc_writecombine(info->dev, fb_size,
+					   &phys_addr, GFP_KERNEL);
+	if (!virt_addr)
+		return -ENOMEM;
+
+	/*
+	 * There is a bug in the ep93xx framebuffer which causes problems
+	 * if bit 27 of the physical address is set.
+	 * See: http://marc.info/?l=linux-arm-kernel&m=110061245502000&w=2
+	 * There does not seem to be any offical errata for this, but I
+	 * have confirmed the problem exists on my hardware (ep9315) at
+	 * least.
+	 */
+	if (check_screenpage_bug && phys_addr & (1 << 27)) {
+		dev_err(info->dev, "ep93xx framebuffer bug. phys addr (0x%x) "
+			"has bit 27 set: cannot init framebuffer\n",
+			phys_addr);
+
+		dma_free_coherent(info->dev, fb_size, virt_addr, phys_addr);
+		return -ENOMEM;
+	}
+
+	info->fix.smem_start = phys_addr;
+	info->fix.smem_len = fb_size;
+	info->screen_base = virt_addr;
+
+	return 0;
+}
+
+static void ep93xxfb_dealloc_videomem(struct fb_info *info)
+{
+	if (info->screen_base)
+		dma_free_coherent(info->dev, info->fix.smem_len,
+				  info->screen_base, info->fix.smem_start);
+}
+
+static int __init ep93xxfb_probe(struct platform_device *pdev)
+{
+	struct ep93xxfb_mach_info *mach_info = pdev->dev.platform_data;
+	struct fb_info *info;
+	struct ep93xx_fbi *fbi;
+	struct resource *res;
+	char *video_mode;
+	int err;
+
+	if (!mach_info)
+		return -EINVAL;
+
+	info = framebuffer_alloc(sizeof(struct ep93xx_fbi), &pdev->dev);
+	if (!info)
+		return -ENOMEM;
+
+	info->dev = &pdev->dev;
+	platform_set_drvdata(pdev, info);
+	fbi = info->par;
+	fbi->mach_info = mach_info;
+
+	err = fb_alloc_cmap(&info->cmap, 256, 0);
+	if (err)
+		goto failed;
+
+	err = ep93xxfb_alloc_videomem(info);
+	if (err)
+		goto failed;
+
+	res = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+	if (!res) {
+		err = -ENXIO;
+		goto failed;
+	}
+
+	res = request_mem_region(res->start, resource_size(res), pdev->name);
+	if (!res) {
+		err = -EBUSY;
+		goto failed;
+	}
+
+	fbi->res = res;
+	fbi->mmio_base = ioremap(res->start, resource_size(res));
+	if (!fbi->mmio_base) {
+		err = -ENXIO;
+		goto failed;
+	}
+
+	strcpy(info->fix.id, pdev->name);
+	info->fbops		= &ep93xxfb_ops;
+	info->fix.type		= FB_TYPE_PACKED_PIXELS;
+	info->fix.accel		= FB_ACCEL_NONE;
+	info->var.activate	= FB_ACTIVATE_NOW;
+	info->var.vmode		= FB_VMODE_NONINTERLACED;
+	info->flags		= FBINFO_DEFAULT;
+	info->node		= -1;
+	info->state		= FBINFO_STATE_RUNNING;
+	info->pseudo_palette	= &fbi->pseudo_palette;
+
+	fb_get_options("ep93xx-fb", &video_mode);
+	err = fb_find_mode(&info->var, info, video_mode,
+			   fbi->mach_info->modes, fbi->mach_info->num_modes,
+			   fbi->mach_info->default_mode, fbi->mach_info->bpp);
+	if (err == 0) {
+		dev_err(info->dev, "No suitable video mode found\n");
+		err = -EINVAL;
+		goto failed;
+	}
+
+	if (mach_info->setup) {
+		err = mach_info->setup(pdev);
+		if (err)
+			return err;
+	}
+
+	err = ep93xxfb_check_var(&info->var, info);
+	if (err)
+		goto failed;
+
+	fbi->clk = clk_get(info->dev, NULL);
+	if (IS_ERR(fbi->clk)) {
+		err = PTR_ERR(fbi->clk);
+		fbi->clk = NULL;
+		goto failed;
+	}
+
+	ep93xxfb_set_par(info);
+	clk_enable(fbi->clk);
+
+	err = register_framebuffer(info);
+	if (err)
+		goto failed;
+
+	dev_info(info->dev, "registered. Mode = %dx%d-%d\n",
+		 info->var.xres, info->var.yres, info->var.bits_per_pixel);
+	return 0;
+
+failed:
+	if (fbi->clk)
+		clk_put(fbi->clk);
+	if (fbi->mmio_base)
+		iounmap(fbi->mmio_base);
+	if (fbi->res)
+		release_mem_region(fbi->res->start, resource_size(fbi->res));
+	ep93xxfb_dealloc_videomem(info);
+	if (&info->cmap)
+		fb_dealloc_cmap(&info->cmap);
+	if (fbi->mach_info->teardown)
+		fbi->mach_info->teardown(pdev);
+	kfree(info);
+	platform_set_drvdata(pdev, NULL);
+
+	return err;
+}
+
+static int ep93xxfb_remove(struct platform_device *pdev)
+{
+	struct fb_info *info = platform_get_drvdata(pdev);
+	struct ep93xx_fbi *fbi = info->par;
+
+	unregister_framebuffer(info);
+	clk_disable(fbi->clk);
+	clk_put(fbi->clk);
+	iounmap(fbi->mmio_base);
+	release_mem_region(fbi->res->start, resource_size(fbi->res));
+	ep93xxfb_dealloc_videomem(info);
+	fb_dealloc_cmap(&info->cmap);
+
+	if (fbi->mach_info->teardown)
+		fbi->mach_info->teardown(pdev);
+
+	kfree(info);
+	platform_set_drvdata(pdev, NULL);
+
+	return 0;
+}
+
+static struct platform_driver ep93xxfb_driver = {
+	.probe		= ep93xxfb_probe,
+	.remove		= ep93xxfb_remove,
+	.driver = {
+		.name	= "ep93xx-fb",
+		.owner	= THIS_MODULE,
+	},
+};
+
+static int __devinit ep93xxfb_init(void)
+{
+	return platform_driver_register(&ep93xxfb_driver);
+}
+
+static void __exit ep93xxfb_exit(void)
+{
+	platform_driver_unregister(&ep93xxfb_driver);
+}
+
+module_init(ep93xxfb_init);
+module_exit(ep93xxfb_exit);
+
+MODULE_DESCRIPTION("EP93XX Framebuffer Driver");
+MODULE_ALIAS("platform:ep93xx-fb");
+MODULE_AUTHOR("Ryan Mallon <ryan&bluewatersys.com>, "
+	      "H Hartley Sweeten <hsweeten@visionengravers.com");
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/fbmem.c b/drivers/video/fbmem.c
index a85c818..a1f2e7c 100644
--- a/drivers/video/fbmem.c
+++ b/drivers/video/fbmem.c
@@ -871,8 +871,8 @@
 		err = -EINVAL;
 
 	if (err || !info->fbops->fb_pan_display ||
-	    var->yoffset + yres > info->var.yres_virtual ||
-	    var->xoffset + info->var.xres > info->var.xres_virtual)
+	    var->yoffset > info->var.yres_virtual - yres ||
+	    var->xoffset > info->var.xres_virtual - info->var.xres)
 		return -EINVAL;
 
 	if ((err = info->fbops->fb_pan_display(var, info)))
@@ -954,6 +954,7 @@
 			goto done;
 
 		if ((var->activate & FB_ACTIVATE_MASK) == FB_ACTIVATE_NOW) {
+			struct fb_var_screeninfo old_var;
 			struct fb_videomode mode;
 
 			if (info->fbops->fb_get_caps) {
@@ -963,10 +964,20 @@
 					goto done;
 			}
 
+			old_var = info->var;
 			info->var = *var;
 
-			if (info->fbops->fb_set_par)
-				info->fbops->fb_set_par(info);
+			if (info->fbops->fb_set_par) {
+				ret = info->fbops->fb_set_par(info);
+
+				if (ret) {
+					info->var = old_var;
+					printk(KERN_WARNING "detected "
+						"fb_set_par error, "
+						"error code: %d\n", ret);
+					goto done;
+				}
+			}
 
 			fb_pan_display(info, &info->var);
 			fb_set_cmap(&info->cmap, info);
diff --git a/drivers/video/matrox/g450_pll.c b/drivers/video/matrox/g450_pll.c
index d42346e..09f6e04 100644
--- a/drivers/video/matrox/g450_pll.c
+++ b/drivers/video/matrox/g450_pll.c
@@ -25,16 +25,19 @@
 	return (p & 0x40) ? fin : fin << ((p & 3) + 1);
 }
 
-static unsigned int g450_mnp2vco(CPMINFO unsigned int mnp) {
+static unsigned int g450_mnp2vco(const struct matrox_fb_info *minfo,
+				 unsigned int mnp)
+{
 	unsigned int m, n;
 
 	m = ((mnp >> 16) & 0x0FF) + 1;
 	n = ((mnp >>  7) & 0x1FE) + 4;
-	return (ACCESS_FBINFO(features).pll.ref_freq * n + (m >> 1)) / m;
+	return (minfo->features.pll.ref_freq * n + (m >> 1)) / m;
 }
 
-unsigned int g450_mnp2f(CPMINFO unsigned int mnp) {
-	return g450_vco2f(mnp, g450_mnp2vco(PMINFO mnp));
+unsigned int g450_mnp2f(const struct matrox_fb_info *minfo, unsigned int mnp)
+{
+	return g450_vco2f(mnp, g450_mnp2vco(minfo, mnp));
 }
 
 static inline unsigned int pll_freq_delta(unsigned int f1, unsigned int f2) {
@@ -49,7 +52,10 @@
 #define NO_MORE_MNP	0x01FFFFFF
 #define G450_MNP_FREQBITS	(0xFFFFFF43)	/* do not mask high byte so we'll catch NO_MORE_MNP */
 
-static unsigned int g450_nextpll(CPMINFO const struct matrox_pll_limits* pi, unsigned int* fvco, unsigned int mnp) {
+static unsigned int g450_nextpll(const struct matrox_fb_info *minfo,
+				 const struct matrox_pll_limits *pi,
+				 unsigned int *fvco, unsigned int mnp)
+{
 	unsigned int m, n, p;
 	unsigned int tvco = *fvco;
 
@@ -90,12 +96,15 @@
 		} else {
 			m--;
 		}
-        	n = ((tvco * (m+1) + ACCESS_FBINFO(features).pll.ref_freq) / (ACCESS_FBINFO(features).pll.ref_freq * 2)) - 2;
+		n = ((tvco * (m+1) + minfo->features.pll.ref_freq) / (minfo->features.pll.ref_freq * 2)) - 2;
 	} while (n < 0x03 || n > 0x7A);
 	return (m << 16) | (n << 8) | p;
 }
 
-static unsigned int g450_firstpll(CPMINFO const struct matrox_pll_limits* pi, unsigned int* vco, unsigned int fout) {
+static unsigned int g450_firstpll(const struct matrox_fb_info *minfo,
+				  const struct matrox_pll_limits *pi,
+				  unsigned int *vco, unsigned int fout)
+{
 	unsigned int p;
 	unsigned int vcomax;
 
@@ -121,88 +130,94 @@
 		}
 		*vco = tvco;
 	}
-	return g450_nextpll(PMINFO pi, vco, 0xFF0000 | p);
+	return g450_nextpll(minfo, pi, vco, 0xFF0000 | p);
 }
 
-static inline unsigned int g450_setpll(CPMINFO unsigned int mnp, unsigned int pll) {
+static inline unsigned int g450_setpll(const struct matrox_fb_info *minfo,
+				       unsigned int mnp, unsigned int pll)
+{
 	switch (pll) {
 		case M_PIXEL_PLL_A:
-			matroxfb_DAC_out(PMINFO M1064_XPIXPLLAM, mnp >> 16);
-			matroxfb_DAC_out(PMINFO M1064_XPIXPLLAN, mnp >> 8);
-			matroxfb_DAC_out(PMINFO M1064_XPIXPLLAP, mnp);
+			matroxfb_DAC_out(minfo, M1064_XPIXPLLAM, mnp >> 16);
+			matroxfb_DAC_out(minfo, M1064_XPIXPLLAN, mnp >> 8);
+			matroxfb_DAC_out(minfo, M1064_XPIXPLLAP, mnp);
 			return M1064_XPIXPLLSTAT;
 
 		case M_PIXEL_PLL_B:
-			matroxfb_DAC_out(PMINFO M1064_XPIXPLLBM, mnp >> 16);
-			matroxfb_DAC_out(PMINFO M1064_XPIXPLLBN, mnp >> 8);
-			matroxfb_DAC_out(PMINFO M1064_XPIXPLLBP, mnp);
+			matroxfb_DAC_out(minfo, M1064_XPIXPLLBM, mnp >> 16);
+			matroxfb_DAC_out(minfo, M1064_XPIXPLLBN, mnp >> 8);
+			matroxfb_DAC_out(minfo, M1064_XPIXPLLBP, mnp);
 			return M1064_XPIXPLLSTAT;
 
 		case M_PIXEL_PLL_C:
-			matroxfb_DAC_out(PMINFO M1064_XPIXPLLCM, mnp >> 16);
-			matroxfb_DAC_out(PMINFO M1064_XPIXPLLCN, mnp >> 8);
-			matroxfb_DAC_out(PMINFO M1064_XPIXPLLCP, mnp);
+			matroxfb_DAC_out(minfo, M1064_XPIXPLLCM, mnp >> 16);
+			matroxfb_DAC_out(minfo, M1064_XPIXPLLCN, mnp >> 8);
+			matroxfb_DAC_out(minfo, M1064_XPIXPLLCP, mnp);
 			return M1064_XPIXPLLSTAT;
 
 		case M_SYSTEM_PLL:
-			matroxfb_DAC_out(PMINFO DAC1064_XSYSPLLM, mnp >> 16);
-			matroxfb_DAC_out(PMINFO DAC1064_XSYSPLLN, mnp >> 8);
-			matroxfb_DAC_out(PMINFO DAC1064_XSYSPLLP, mnp);
+			matroxfb_DAC_out(minfo, DAC1064_XSYSPLLM, mnp >> 16);
+			matroxfb_DAC_out(minfo, DAC1064_XSYSPLLN, mnp >> 8);
+			matroxfb_DAC_out(minfo, DAC1064_XSYSPLLP, mnp);
 			return DAC1064_XSYSPLLSTAT;
 
 		case M_VIDEO_PLL:
-			matroxfb_DAC_out(PMINFO M1064_XVIDPLLM, mnp >> 16);
-			matroxfb_DAC_out(PMINFO M1064_XVIDPLLN, mnp >> 8);
-			matroxfb_DAC_out(PMINFO M1064_XVIDPLLP, mnp);
+			matroxfb_DAC_out(minfo, M1064_XVIDPLLM, mnp >> 16);
+			matroxfb_DAC_out(minfo, M1064_XVIDPLLN, mnp >> 8);
+			matroxfb_DAC_out(minfo, M1064_XVIDPLLP, mnp);
 			return M1064_XVIDPLLSTAT;
 	}
 	return 0;
 }
 
-static inline unsigned int g450_cmppll(CPMINFO unsigned int mnp, unsigned int pll) {
+static inline unsigned int g450_cmppll(const struct matrox_fb_info *minfo,
+				       unsigned int mnp, unsigned int pll)
+{
 	unsigned char m = mnp >> 16;
 	unsigned char n = mnp >> 8;
 	unsigned char p = mnp;
 
 	switch (pll) {
 		case M_PIXEL_PLL_A:
-			return (matroxfb_DAC_in(PMINFO M1064_XPIXPLLAM) != m ||
-				matroxfb_DAC_in(PMINFO M1064_XPIXPLLAN) != n ||
-				matroxfb_DAC_in(PMINFO M1064_XPIXPLLAP) != p);
+			return (matroxfb_DAC_in(minfo, M1064_XPIXPLLAM) != m ||
+				matroxfb_DAC_in(minfo, M1064_XPIXPLLAN) != n ||
+				matroxfb_DAC_in(minfo, M1064_XPIXPLLAP) != p);
 
 		case M_PIXEL_PLL_B:
-			return (matroxfb_DAC_in(PMINFO M1064_XPIXPLLBM) != m ||
-				matroxfb_DAC_in(PMINFO M1064_XPIXPLLBN) != n ||
-				matroxfb_DAC_in(PMINFO M1064_XPIXPLLBP) != p);
+			return (matroxfb_DAC_in(minfo, M1064_XPIXPLLBM) != m ||
+				matroxfb_DAC_in(minfo, M1064_XPIXPLLBN) != n ||
+				matroxfb_DAC_in(minfo, M1064_XPIXPLLBP) != p);
 
 		case M_PIXEL_PLL_C:
-			return (matroxfb_DAC_in(PMINFO M1064_XPIXPLLCM) != m ||
-				matroxfb_DAC_in(PMINFO M1064_XPIXPLLCN) != n ||
-				matroxfb_DAC_in(PMINFO M1064_XPIXPLLCP) != p);
+			return (matroxfb_DAC_in(minfo, M1064_XPIXPLLCM) != m ||
+				matroxfb_DAC_in(minfo, M1064_XPIXPLLCN) != n ||
+				matroxfb_DAC_in(minfo, M1064_XPIXPLLCP) != p);
 
 		case M_SYSTEM_PLL:
-			return (matroxfb_DAC_in(PMINFO DAC1064_XSYSPLLM) != m ||
-				matroxfb_DAC_in(PMINFO DAC1064_XSYSPLLN) != n ||
-				matroxfb_DAC_in(PMINFO DAC1064_XSYSPLLP) != p);
+			return (matroxfb_DAC_in(minfo, DAC1064_XSYSPLLM) != m ||
+				matroxfb_DAC_in(minfo, DAC1064_XSYSPLLN) != n ||
+				matroxfb_DAC_in(minfo, DAC1064_XSYSPLLP) != p);
 
 		case M_VIDEO_PLL:
-			return (matroxfb_DAC_in(PMINFO M1064_XVIDPLLM) != m ||
-				matroxfb_DAC_in(PMINFO M1064_XVIDPLLN) != n ||
-				matroxfb_DAC_in(PMINFO M1064_XVIDPLLP) != p);
+			return (matroxfb_DAC_in(minfo, M1064_XVIDPLLM) != m ||
+				matroxfb_DAC_in(minfo, M1064_XVIDPLLN) != n ||
+				matroxfb_DAC_in(minfo, M1064_XVIDPLLP) != p);
 	}
 	return 1;
 }
 
-static inline int g450_isplllocked(CPMINFO unsigned int regidx) {
+static inline int g450_isplllocked(const struct matrox_fb_info *minfo,
+				   unsigned int regidx)
+{
 	unsigned int j;
 
 	for (j = 0; j < 1000; j++) {
-		if (matroxfb_DAC_in(PMINFO regidx) & 0x40) {
+		if (matroxfb_DAC_in(minfo, regidx) & 0x40) {
 			unsigned int r = 0;
 			int i;
 
 			for (i = 0; i < 100; i++) {
-				r += matroxfb_DAC_in(PMINFO regidx) & 0x40;
+				r += matroxfb_DAC_in(minfo, regidx) & 0x40;
 			}
 			return r >= (90 * 0x40);
 		}
@@ -211,8 +226,10 @@
 	return 0;
 }
 
-static int g450_testpll(CPMINFO unsigned int mnp, unsigned int pll) {
-	return g450_isplllocked(PMINFO g450_setpll(PMINFO mnp, pll));
+static int g450_testpll(const struct matrox_fb_info *minfo, unsigned int mnp,
+			unsigned int pll)
+{
+	return g450_isplllocked(minfo, g450_setpll(minfo, mnp, pll));
 }
 
 static void updatehwstate_clk(struct matrox_hw_state* hw, unsigned int mnp, unsigned int pll) {
@@ -225,13 +242,19 @@
 	}
 }
 
-void matroxfb_g450_setpll_cond(WPMINFO unsigned int mnp, unsigned int pll) {
-	if (g450_cmppll(PMINFO mnp, pll)) {
-		g450_setpll(PMINFO mnp, pll);
+void matroxfb_g450_setpll_cond(struct matrox_fb_info *minfo, unsigned int mnp,
+			       unsigned int pll)
+{
+	if (g450_cmppll(minfo, mnp, pll)) {
+		g450_setpll(minfo, mnp, pll);
 	}
 }
 
-static inline unsigned int g450_findworkingpll(WPMINFO unsigned int pll, unsigned int* mnparray, unsigned int mnpcount) {
+static inline unsigned int g450_findworkingpll(struct matrox_fb_info *minfo,
+					       unsigned int pll,
+					       unsigned int *mnparray,
+					       unsigned int mnpcount)
+{
 	unsigned int found = 0;
 	unsigned int idx;
 	unsigned int mnpfound = mnparray[0];
@@ -255,22 +278,22 @@
 		while (sptr >= sarray) {
 			unsigned int mnp = *sptr--;
 		
-			if (g450_testpll(PMINFO mnp - 0x0300, pll) &&
-			    g450_testpll(PMINFO mnp + 0x0300, pll) &&
-			    g450_testpll(PMINFO mnp - 0x0200, pll) &&
-			    g450_testpll(PMINFO mnp + 0x0200, pll) &&
-			    g450_testpll(PMINFO mnp - 0x0100, pll) &&
-			    g450_testpll(PMINFO mnp + 0x0100, pll)) {
-				if (g450_testpll(PMINFO mnp, pll)) {
+			if (g450_testpll(minfo, mnp - 0x0300, pll) &&
+			    g450_testpll(minfo, mnp + 0x0300, pll) &&
+			    g450_testpll(minfo, mnp - 0x0200, pll) &&
+			    g450_testpll(minfo, mnp + 0x0200, pll) &&
+			    g450_testpll(minfo, mnp - 0x0100, pll) &&
+			    g450_testpll(minfo, mnp + 0x0100, pll)) {
+				if (g450_testpll(minfo, mnp, pll)) {
 					return mnp;
 				}
-			} else if (!found && g450_testpll(PMINFO mnp, pll)) {
+			} else if (!found && g450_testpll(minfo, mnp, pll)) {
 				mnpfound = mnp;
 				found = 1;
 			}
 		}
 	}
-	g450_setpll(PMINFO mnpfound, pll);
+	g450_setpll(minfo, mnpfound, pll);
 	return mnpfound;
 }
 
@@ -283,7 +306,9 @@
 	ci->data[0].mnp_value = mnp_value;
 }
 
-static int g450_checkcache(WPMINFO struct matrox_pll_cache* ci, unsigned int mnp_key) {
+static int g450_checkcache(struct matrox_fb_info *minfo,
+			   struct matrox_pll_cache *ci, unsigned int mnp_key)
+{
 	unsigned int i;
 	
 	mnp_key &= G450_MNP_FREQBITS;
@@ -303,8 +328,10 @@
 	return NO_MORE_MNP;
 }
 
-static int __g450_setclk(WPMINFO unsigned int fout, unsigned int pll, 
-		unsigned int* mnparray, unsigned int* deltaarray) {
+static int __g450_setclk(struct matrox_fb_info *minfo, unsigned int fout,
+			 unsigned int pll, unsigned int *mnparray,
+			 unsigned int *deltaarray)
+{
 	unsigned int mnpcount;
 	unsigned int pixel_vco;
 	const struct matrox_pll_limits* pi;
@@ -321,19 +348,19 @@
 				
 				matroxfb_DAC_lock_irqsave(flags);
 
-				xpwrctrl = matroxfb_DAC_in(PMINFO M1064_XPWRCTRL);
-				matroxfb_DAC_out(PMINFO M1064_XPWRCTRL, xpwrctrl & ~M1064_XPWRCTRL_PANELPDN);
+				xpwrctrl = matroxfb_DAC_in(minfo, M1064_XPWRCTRL);
+				matroxfb_DAC_out(minfo, M1064_XPWRCTRL, xpwrctrl & ~M1064_XPWRCTRL_PANELPDN);
 				mga_outb(M_SEQ_INDEX, M_SEQ1);
 				mga_outb(M_SEQ_DATA, mga_inb(M_SEQ_DATA) | M_SEQ1_SCROFF);
-				tmp = matroxfb_DAC_in(PMINFO M1064_XPIXCLKCTRL);
+				tmp = matroxfb_DAC_in(minfo, M1064_XPIXCLKCTRL);
 				tmp |= M1064_XPIXCLKCTRL_DIS;
 				if (!(tmp & M1064_XPIXCLKCTRL_PLL_UP)) {
 					tmp |= M1064_XPIXCLKCTRL_PLL_UP;
 				}
-				matroxfb_DAC_out(PMINFO M1064_XPIXCLKCTRL, tmp);
+				matroxfb_DAC_out(minfo, M1064_XPIXCLKCTRL, tmp);
 				/* DVI PLL preferred for frequencies up to
 				   panel link max, standard PLL otherwise */
-				if (fout >= MINFO->max_pixel_clock_panellink)
+				if (fout >= minfo->max_pixel_clock_panellink)
 					tmp = 0;
 				else tmp =
 					M1064_XDVICLKCTRL_DVIDATAPATHSEL |
@@ -341,8 +368,8 @@
 					M1064_XDVICLKCTRL_C1DVICLKEN |
 					M1064_XDVICLKCTRL_DVILOOPCTL |
 					M1064_XDVICLKCTRL_P1LOOPBWDTCTL;
-				matroxfb_DAC_out(PMINFO M1064_XDVICLKCTRL,tmp);
-				matroxfb_DAC_out(PMINFO M1064_XPWRCTRL,
+				matroxfb_DAC_out(minfo, M1064_XDVICLKCTRL, tmp);
+				matroxfb_DAC_out(minfo, M1064_XPWRCTRL,
 						 xpwrctrl);
 
 				matroxfb_DAC_unlock_irqrestore(flags);
@@ -363,20 +390,20 @@
 				}
 				mga_outb(M_MISC_REG, misc);
 			}
-			pi = &ACCESS_FBINFO(limits.pixel);
-			ci = &ACCESS_FBINFO(cache.pixel);
+			pi = &minfo->limits.pixel;
+			ci = &minfo->cache.pixel;
 			break;
 		case M_SYSTEM_PLL:
 			{
 				u_int32_t opt;
 
-				pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, &opt);
+				pci_read_config_dword(minfo->pcidev, PCI_OPTION_REG, &opt);
 				if (!(opt & 0x20)) {
-					pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, opt | 0x20);
+					pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, opt | 0x20);
 				}
 			}
-			pi = &ACCESS_FBINFO(limits.system);
-			ci = &ACCESS_FBINFO(cache.system);
+			pi = &minfo->limits.system;
+			ci = &minfo->cache.system;
 			break;
 		case M_VIDEO_PLL:
 			{
@@ -385,18 +412,18 @@
 				unsigned long flags;
 				
 				matroxfb_DAC_lock_irqsave(flags);
-				tmp = matroxfb_DAC_in(PMINFO M1064_XPWRCTRL);
+				tmp = matroxfb_DAC_in(minfo, M1064_XPWRCTRL);
 				if (!(tmp & 2)) {
-					matroxfb_DAC_out(PMINFO M1064_XPWRCTRL, tmp | 2);
+					matroxfb_DAC_out(minfo, M1064_XPWRCTRL, tmp | 2);
 				}
 				
-				mnp = matroxfb_DAC_in(PMINFO M1064_XPIXPLLCM) << 16;
-				mnp |= matroxfb_DAC_in(PMINFO M1064_XPIXPLLCN) << 8;
-				pixel_vco = g450_mnp2vco(PMINFO mnp);
+				mnp = matroxfb_DAC_in(minfo, M1064_XPIXPLLCM) << 16;
+				mnp |= matroxfb_DAC_in(minfo, M1064_XPIXPLLCN) << 8;
+				pixel_vco = g450_mnp2vco(minfo, mnp);
 				matroxfb_DAC_unlock_irqrestore(flags);
 			}
-			pi = &ACCESS_FBINFO(limits.video);
-			ci = &ACCESS_FBINFO(cache.video);
+			pi = &minfo->limits.video;
+			ci = &minfo->cache.video;
 			break;
 		default:
 			return -EINVAL;
@@ -407,12 +434,12 @@
 		unsigned int mnp;
 		unsigned int xvco;
 
-		for(mnp = g450_firstpll(PMINFO pi, &xvco, fout); mnp != NO_MORE_MNP; mnp = g450_nextpll(PMINFO pi, &xvco, mnp)) {
+		for (mnp = g450_firstpll(minfo, pi, &xvco, fout); mnp != NO_MORE_MNP; mnp = g450_nextpll(minfo, pi, &xvco, mnp)) {
 			unsigned int idx;
 			unsigned int vco;
 			unsigned int delta;
 
-			vco = g450_mnp2vco(PMINFO mnp);
+			vco = g450_mnp2vco(minfo, mnp);
 #if 0			
 			if (pll == M_VIDEO_PLL) {
 				unsigned int big, small;
@@ -444,7 +471,7 @@
 					 * (freqs near VCOmin aren't as stable)
 					 */
 					if (delta == deltaarray[idx-1]
-					    && vco != g450_mnp2vco(PMINFO mnparray[idx-1])
+					    && vco != g450_mnp2vco(minfo, mnparray[idx-1])
 					    && vco < (pi->vcomin * 17 / 16)) {
 						break;
 					}
@@ -468,14 +495,14 @@
 		unsigned int mnp;
 		
 		matroxfb_DAC_lock_irqsave(flags);
-		mnp = g450_checkcache(PMINFO ci, mnparray[0]);
+		mnp = g450_checkcache(minfo, ci, mnparray[0]);
 		if (mnp != NO_MORE_MNP) {
-			matroxfb_g450_setpll_cond(PMINFO mnp, pll);
+			matroxfb_g450_setpll_cond(minfo, mnp, pll);
 		} else {
-			mnp = g450_findworkingpll(PMINFO pll, mnparray, mnpcount);
+			mnp = g450_findworkingpll(minfo, pll, mnparray, mnpcount);
 			g450_addcache(ci, mnparray[0], mnp);
 		}
-		updatehwstate_clk(&ACCESS_FBINFO(hw), mnp, pll);
+		updatehwstate_clk(&minfo->hw, mnp, pll);
 		matroxfb_DAC_unlock_irqrestore(flags);
 		return mnp;
 	}
@@ -485,14 +512,16 @@
  * Currently there is 5(p) * 10(m) = 50 possible values. */
 #define MNP_TABLE_SIZE  64
 
-int matroxfb_g450_setclk(WPMINFO unsigned int fout, unsigned int pll) {
+int matroxfb_g450_setclk(struct matrox_fb_info *minfo, unsigned int fout,
+			 unsigned int pll)
+{
 	unsigned int* arr;
 	
 	arr = kmalloc(sizeof(*arr) * MNP_TABLE_SIZE * 2, GFP_KERNEL);
 	if (arr) {
 		int r;
 
-		r = __g450_setclk(PMINFO fout, pll, arr, arr + MNP_TABLE_SIZE);
+		r = __g450_setclk(minfo, fout, pll, arr, arr + MNP_TABLE_SIZE);
 		kfree(arr);
 		return r;
 	}
diff --git a/drivers/video/matrox/g450_pll.h b/drivers/video/matrox/g450_pll.h
index c17ed74..aac615d 100644
--- a/drivers/video/matrox/g450_pll.h
+++ b/drivers/video/matrox/g450_pll.h
@@ -3,8 +3,10 @@
 
 #include "matroxfb_base.h"
 
-int matroxfb_g450_setclk(WPMINFO unsigned int fout, unsigned int pll);
-unsigned int g450_mnp2f(CPMINFO unsigned int mnp);
-void matroxfb_g450_setpll_cond(WPMINFO unsigned int mnp, unsigned int pll);
+int matroxfb_g450_setclk(struct matrox_fb_info *minfo, unsigned int fout,
+			 unsigned int pll);
+unsigned int g450_mnp2f(const struct matrox_fb_info *minfo, unsigned int mnp);
+void matroxfb_g450_setpll_cond(struct matrox_fb_info *minfo, unsigned int mnp,
+			       unsigned int pll);
 
 #endif	/* __G450_PLL_H__ */
diff --git a/drivers/video/matrox/i2c-matroxfb.c b/drivers/video/matrox/i2c-matroxfb.c
index c14e3e2..f3728ab 100644
--- a/drivers/video/matrox/i2c-matroxfb.c
+++ b/drivers/video/matrox/i2c-matroxfb.c
@@ -41,7 +41,7 @@
 	int v;
 
 	matroxfb_DAC_lock_irqsave(flags);
-	v = matroxfb_DAC_in(PMINFO DAC_XGENIODATA);
+	v = matroxfb_DAC_in(minfo, DAC_XGENIODATA);
 	matroxfb_DAC_unlock_irqrestore(flags);
 	return v;
 }
@@ -51,10 +51,10 @@
 	int v;
 
 	matroxfb_DAC_lock_irqsave(flags);
-	v = (matroxfb_DAC_in(PMINFO DAC_XGENIOCTRL) & mask) | val;
-	matroxfb_DAC_out(PMINFO DAC_XGENIOCTRL, v);
+	v = (matroxfb_DAC_in(minfo, DAC_XGENIOCTRL) & mask) | val;
+	matroxfb_DAC_out(minfo, DAC_XGENIOCTRL, v);
 	/* We must reset GENIODATA very often... XFree plays with this register */
-	matroxfb_DAC_out(PMINFO DAC_XGENIODATA, 0x00);
+	matroxfb_DAC_out(minfo, DAC_XGENIODATA, 0x00);
 	matroxfb_DAC_unlock_irqrestore(flags);
 }
 
@@ -112,7 +112,7 @@
 	i2c_set_adapdata(&b->adapter, b);
 	b->adapter.class = class;
 	b->adapter.algo_data = &b->bac;
-	b->adapter.dev.parent = &ACCESS_FBINFO(pcidev)->dev;
+	b->adapter.dev.parent = &minfo->pcidev->dev;
 	b->bac = matrox_i2c_algo_template;
 	b->bac.data = b;
 	err = i2c_bit_add_bus(&b->adapter);
@@ -149,11 +149,11 @@
 		return NULL;
 
 	matroxfb_DAC_lock_irqsave(flags);
-	matroxfb_DAC_out(PMINFO DAC_XGENIODATA, 0xFF);
-	matroxfb_DAC_out(PMINFO DAC_XGENIOCTRL, 0x00);
+	matroxfb_DAC_out(minfo, DAC_XGENIODATA, 0xFF);
+	matroxfb_DAC_out(minfo, DAC_XGENIOCTRL, 0x00);
 	matroxfb_DAC_unlock_irqrestore(flags);
 
-	switch (ACCESS_FBINFO(chip)) {
+	switch (minfo->chip) {
 		case MGA_2064:
 		case MGA_2164:
 			err = i2c_bus_reg(&m2info->ddc1, minfo,
@@ -168,7 +168,7 @@
 	}
 	if (err)
 		goto fail_ddc1;
-	if (ACCESS_FBINFO(devflags.dualhead)) {
+	if (minfo->devflags.dualhead) {
 		err = i2c_bus_reg(&m2info->ddc2, minfo,
 				  DDC2_DATA, DDC2_CLK,
 				  "DDC:fb%u #1", I2C_CLASS_DDC);
diff --git a/drivers/video/matrox/matroxfb_DAC1064.c b/drivers/video/matrox/matroxfb_DAC1064.c
index a74e5da..f9fa0fd 100644
--- a/drivers/video/matrox/matroxfb_DAC1064.c
+++ b/drivers/video/matrox/matroxfb_DAC1064.c
@@ -33,7 +33,11 @@
 #define DAC1064_OPT_MDIV2	0x00
 #define DAC1064_OPT_RESERVED	0x10
 
-static void DAC1064_calcclock(CPMINFO unsigned int freq, unsigned int fmax, unsigned int* in, unsigned int* feed, unsigned int* post) {
+static void DAC1064_calcclock(const struct matrox_fb_info *minfo,
+			      unsigned int freq, unsigned int fmax,
+			      unsigned int *in, unsigned int *feed,
+			      unsigned int *post)
+{
 	unsigned int fvco;
 	unsigned int p;
 
@@ -41,7 +45,7 @@
 	
 	/* only for devices older than G450 */
 
-	fvco = PLL_calcclock(PMINFO freq, fmax, in, feed, &p);
+	fvco = PLL_calcclock(minfo, freq, fmax, in, feed, &p);
 	
 	p = (1 << p) - 1;
 	if (fvco <= 100000)
@@ -80,32 +84,35 @@
 		0x00,
 		0x00, 0x00, 0xFF, 0xFF};
 
-static void DAC1064_setpclk(WPMINFO unsigned long fout) {
+static void DAC1064_setpclk(struct matrox_fb_info *minfo, unsigned long fout)
+{
 	unsigned int m, n, p;
 
 	DBG(__func__)
 
-	DAC1064_calcclock(PMINFO fout, ACCESS_FBINFO(max_pixel_clock), &m, &n, &p);
-	ACCESS_FBINFO(hw).DACclk[0] = m;
-	ACCESS_FBINFO(hw).DACclk[1] = n;
-	ACCESS_FBINFO(hw).DACclk[2] = p;
+	DAC1064_calcclock(minfo, fout, minfo->max_pixel_clock, &m, &n, &p);
+	minfo->hw.DACclk[0] = m;
+	minfo->hw.DACclk[1] = n;
+	minfo->hw.DACclk[2] = p;
 }
 
-static void DAC1064_setmclk(WPMINFO int oscinfo, unsigned long fmem) {
+static void DAC1064_setmclk(struct matrox_fb_info *minfo, int oscinfo,
+			    unsigned long fmem)
+{
 	u_int32_t mx;
-	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+	struct matrox_hw_state *hw = &minfo->hw;
 
 	DBG(__func__)
 
-	if (ACCESS_FBINFO(devflags.noinit)) {
+	if (minfo->devflags.noinit) {
 		/* read MCLK and give up... */
-		hw->DACclk[3] = inDAC1064(PMINFO DAC1064_XSYSPLLM);
-		hw->DACclk[4] = inDAC1064(PMINFO DAC1064_XSYSPLLN);
-		hw->DACclk[5] = inDAC1064(PMINFO DAC1064_XSYSPLLP);
+		hw->DACclk[3] = inDAC1064(minfo, DAC1064_XSYSPLLM);
+		hw->DACclk[4] = inDAC1064(minfo, DAC1064_XSYSPLLN);
+		hw->DACclk[5] = inDAC1064(minfo, DAC1064_XSYSPLLP);
 		return;
 	}
 	mx = hw->MXoptionReg | 0x00000004;
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, mx);
 	mx &= ~0x000000BB;
 	if (oscinfo & DAC1064_OPT_GDIV1)
 		mx |= 0x00000008;
@@ -120,9 +127,9 @@
 
 		/* powerup system PLL, select PCI clock */
 		mx |= 0x00000020;
-		pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+		pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, mx);
 		mx &= ~0x00000004;
-		pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+		pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, mx);
 
 		/* !!! you must not access device if MCLK is not running !!!
 		   Doing so cause immediate PCI lockup :-( Maybe they should
@@ -131,12 +138,12 @@
 		   perfect... */
 		/* (bit 2 of PCI_OPTION_REG must be 0... and bits 0,1 must not
 		   select PLL... because of PLL can be stopped at this time) */
-		DAC1064_calcclock(PMINFO fmem, ACCESS_FBINFO(max_pixel_clock), &m, &n, &p);
-		outDAC1064(PMINFO DAC1064_XSYSPLLM, hw->DACclk[3] = m);
-		outDAC1064(PMINFO DAC1064_XSYSPLLN, hw->DACclk[4] = n);
-		outDAC1064(PMINFO DAC1064_XSYSPLLP, hw->DACclk[5] = p);
+		DAC1064_calcclock(minfo, fmem, minfo->max_pixel_clock, &m, &n, &p);
+		outDAC1064(minfo, DAC1064_XSYSPLLM, hw->DACclk[3] = m);
+		outDAC1064(minfo, DAC1064_XSYSPLLN, hw->DACclk[4] = n);
+		outDAC1064(minfo, DAC1064_XSYSPLLP, hw->DACclk[5] = p);
 		for (clk = 65536; clk; --clk) {
-			if (inDAC1064(PMINFO DAC1064_XSYSPLLSTAT) & 0x40)
+			if (inDAC1064(minfo, DAC1064_XSYSPLLSTAT) & 0x40)
 				break;
 		}
 		if (!clk)
@@ -147,29 +154,30 @@
 		/* select specified system clock source */
 		mx |= oscinfo & DAC1064_OPT_SCLK_MASK;
 	}
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, mx);
 	mx &= ~0x00000004;
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, mx);
 	hw->MXoptionReg = mx;
 }
 
 #ifdef CONFIG_FB_MATROX_G
-static void g450_set_plls(WPMINFO2) {
+static void g450_set_plls(struct matrox_fb_info *minfo)
+{
 	u_int32_t c2_ctl;
 	unsigned int pxc;
-	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+	struct matrox_hw_state *hw = &minfo->hw;
 	int pixelmnp;
 	int videomnp;
 	
 	c2_ctl = hw->crtc2.ctl & ~0x4007;	/* Clear PLL + enable for CRTC2 */
 	c2_ctl |= 0x0001;			/* Enable CRTC2 */
 	hw->DACreg[POS1064_XPWRCTRL] &= ~0x02;	/* Stop VIDEO PLL */
-	pixelmnp = ACCESS_FBINFO(crtc1).mnp;
-	videomnp = ACCESS_FBINFO(crtc2).mnp;
+	pixelmnp = minfo->crtc1.mnp;
+	videomnp = minfo->crtc2.mnp;
 	if (videomnp < 0) {
 		c2_ctl &= ~0x0001;			/* Disable CRTC2 */
 		hw->DACreg[POS1064_XPWRCTRL] &= ~0x10;	/* Powerdown CRTC2 */
-	} else if (ACCESS_FBINFO(crtc2).pixclock == ACCESS_FBINFO(features).pll.ref_freq) {
+	} else if (minfo->crtc2.pixclock == minfo->features.pll.ref_freq) {
 		c2_ctl |=  0x4002;	/* Use reference directly */
 	} else if (videomnp == pixelmnp) {
 		c2_ctl |=  0x0004;	/* Use pixel PLL */
@@ -184,27 +192,27 @@
 		c2_ctl |=  0x0006;	/* Use video PLL */
 		hw->DACreg[POS1064_XPWRCTRL] |= 0x02;
 		
-		outDAC1064(PMINFO M1064_XPWRCTRL, hw->DACreg[POS1064_XPWRCTRL]);
-		matroxfb_g450_setpll_cond(PMINFO videomnp, M_VIDEO_PLL);
+		outDAC1064(minfo, M1064_XPWRCTRL, hw->DACreg[POS1064_XPWRCTRL]);
+		matroxfb_g450_setpll_cond(minfo, videomnp, M_VIDEO_PLL);
 	}
 
 	hw->DACreg[POS1064_XPIXCLKCTRL] &= ~M1064_XPIXCLKCTRL_PLL_UP;
 	if (pixelmnp >= 0) {
 		hw->DACreg[POS1064_XPIXCLKCTRL] |= M1064_XPIXCLKCTRL_PLL_UP;
 		
-		outDAC1064(PMINFO M1064_XPIXCLKCTRL, hw->DACreg[POS1064_XPIXCLKCTRL]);
-		matroxfb_g450_setpll_cond(PMINFO pixelmnp, M_PIXEL_PLL_C);
+		outDAC1064(minfo, M1064_XPIXCLKCTRL, hw->DACreg[POS1064_XPIXCLKCTRL]);
+		matroxfb_g450_setpll_cond(minfo, pixelmnp, M_PIXEL_PLL_C);
 	}
 	if (c2_ctl != hw->crtc2.ctl) {
 		hw->crtc2.ctl = c2_ctl;
 		mga_outl(0x3C10, c2_ctl);
 	}
 
-	pxc = ACCESS_FBINFO(crtc1).pixclock;
-	if (pxc == 0 || ACCESS_FBINFO(outputs[2]).src == MATROXFB_SRC_CRTC2) {
-		pxc = ACCESS_FBINFO(crtc2).pixclock;
+	pxc = minfo->crtc1.pixclock;
+	if (pxc == 0 || minfo->outputs[2].src == MATROXFB_SRC_CRTC2) {
+		pxc = minfo->crtc2.pixclock;
 	}
-	if (ACCESS_FBINFO(chip) == MGA_G550) {
+	if (minfo->chip == MGA_G550) {
 		if (pxc < 45000) {
 			hw->DACreg[POS1064_XPANMODE] = 0x00;	/* 0-50 */
 		} else if (pxc < 55000) {
@@ -245,18 +253,19 @@
 }
 #endif
 
-void DAC1064_global_init(WPMINFO2) {
-	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+void DAC1064_global_init(struct matrox_fb_info *minfo)
+{
+	struct matrox_hw_state *hw = &minfo->hw;
 
 	hw->DACreg[POS1064_XMISCCTRL] &= M1064_XMISCCTRL_DAC_WIDTHMASK;
 	hw->DACreg[POS1064_XMISCCTRL] |= M1064_XMISCCTRL_LUT_EN;
 	hw->DACreg[POS1064_XPIXCLKCTRL] = M1064_XPIXCLKCTRL_PLL_UP | M1064_XPIXCLKCTRL_EN | M1064_XPIXCLKCTRL_SRC_PLL;
 #ifdef CONFIG_FB_MATROX_G
-	if (ACCESS_FBINFO(devflags.g450dac)) {
+	if (minfo->devflags.g450dac) {
 		hw->DACreg[POS1064_XPWRCTRL] = 0x1F;	/* powerup everything */
 		hw->DACreg[POS1064_XOUTPUTCONN] = 0x00;	/* disable outputs */
 		hw->DACreg[POS1064_XMISCCTRL] |= M1064_XMISCCTRL_DAC_EN;
-		switch (ACCESS_FBINFO(outputs[0]).src) {
+		switch (minfo->outputs[0].src) {
 			case MATROXFB_SRC_CRTC1:
 			case MATROXFB_SRC_CRTC2:
 				hw->DACreg[POS1064_XOUTPUTCONN] |= 0x01;	/* enable output; CRTC1/2 selection is in CRTC2 ctl */
@@ -265,12 +274,12 @@
 				hw->DACreg[POS1064_XMISCCTRL] &= ~M1064_XMISCCTRL_DAC_EN;
 				break;
 		}
-		switch (ACCESS_FBINFO(outputs[1]).src) {
+		switch (minfo->outputs[1].src) {
 			case MATROXFB_SRC_CRTC1:
 				hw->DACreg[POS1064_XOUTPUTCONN] |= 0x04;
 				break;
 			case MATROXFB_SRC_CRTC2:
-				if (ACCESS_FBINFO(outputs[1]).mode == MATROXFB_OUTPUT_MODE_MONITOR) {
+				if (minfo->outputs[1].mode == MATROXFB_OUTPUT_MODE_MONITOR) {
 					hw->DACreg[POS1064_XOUTPUTCONN] |= 0x08;
 				} else {
 					hw->DACreg[POS1064_XOUTPUTCONN] |= 0x0C;
@@ -280,7 +289,7 @@
 				hw->DACreg[POS1064_XPWRCTRL] &= ~0x01;		/* Poweroff DAC2 */
 				break;
 		}
-		switch (ACCESS_FBINFO(outputs[2]).src) {
+		switch (minfo->outputs[2].src) {
 			case MATROXFB_SRC_CRTC1:
 				hw->DACreg[POS1064_XOUTPUTCONN] |= 0x20;
 				break;
@@ -299,55 +308,57 @@
 				break;
 		}
 		/* Now set timming related variables... */
-		g450_set_plls(PMINFO2);
+		g450_set_plls(minfo);
 	} else
 #endif
 	{
-		if (ACCESS_FBINFO(outputs[1]).src == MATROXFB_SRC_CRTC1) {
+		if (minfo->outputs[1].src == MATROXFB_SRC_CRTC1) {
 			hw->DACreg[POS1064_XPIXCLKCTRL] = M1064_XPIXCLKCTRL_PLL_UP | M1064_XPIXCLKCTRL_EN | M1064_XPIXCLKCTRL_SRC_EXT;
 			hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_MAFC | G400_XMISCCTRL_VDO_MAFC12;
-		} else if (ACCESS_FBINFO(outputs[1]).src == MATROXFB_SRC_CRTC2) {
+		} else if (minfo->outputs[1].src == MATROXFB_SRC_CRTC2) {
 			hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_MAFC | G400_XMISCCTRL_VDO_C2_MAFC12;
-		} else if (ACCESS_FBINFO(outputs[2]).src == MATROXFB_SRC_CRTC1)
+		} else if (minfo->outputs[2].src == MATROXFB_SRC_CRTC1)
 			hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_PANELLINK | G400_XMISCCTRL_VDO_MAFC12;
 		else
 			hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_DIS;
 
-		if (ACCESS_FBINFO(outputs[0]).src != MATROXFB_SRC_NONE)
+		if (minfo->outputs[0].src != MATROXFB_SRC_NONE)
 			hw->DACreg[POS1064_XMISCCTRL] |= M1064_XMISCCTRL_DAC_EN;
 	}
 }
 
-void DAC1064_global_restore(WPMINFO2) {
-	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+void DAC1064_global_restore(struct matrox_fb_info *minfo)
+{
+	struct matrox_hw_state *hw = &minfo->hw;
 
-	outDAC1064(PMINFO M1064_XPIXCLKCTRL, hw->DACreg[POS1064_XPIXCLKCTRL]);
-	outDAC1064(PMINFO M1064_XMISCCTRL, hw->DACreg[POS1064_XMISCCTRL]);
-	if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400) {
-		outDAC1064(PMINFO 0x20, 0x04);
-		outDAC1064(PMINFO 0x1F, ACCESS_FBINFO(devflags.dfp_type));
-		if (ACCESS_FBINFO(devflags.g450dac)) {
-			outDAC1064(PMINFO M1064_XSYNCCTRL, 0xCC);
-			outDAC1064(PMINFO M1064_XPWRCTRL, hw->DACreg[POS1064_XPWRCTRL]);
-			outDAC1064(PMINFO M1064_XPANMODE, hw->DACreg[POS1064_XPANMODE]);
-			outDAC1064(PMINFO M1064_XOUTPUTCONN, hw->DACreg[POS1064_XOUTPUTCONN]);
+	outDAC1064(minfo, M1064_XPIXCLKCTRL, hw->DACreg[POS1064_XPIXCLKCTRL]);
+	outDAC1064(minfo, M1064_XMISCCTRL, hw->DACreg[POS1064_XMISCCTRL]);
+	if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG400) {
+		outDAC1064(minfo, 0x20, 0x04);
+		outDAC1064(minfo, 0x1F, minfo->devflags.dfp_type);
+		if (minfo->devflags.g450dac) {
+			outDAC1064(minfo, M1064_XSYNCCTRL, 0xCC);
+			outDAC1064(minfo, M1064_XPWRCTRL, hw->DACreg[POS1064_XPWRCTRL]);
+			outDAC1064(minfo, M1064_XPANMODE, hw->DACreg[POS1064_XPANMODE]);
+			outDAC1064(minfo, M1064_XOUTPUTCONN, hw->DACreg[POS1064_XOUTPUTCONN]);
 		}
 	}
 }
 
-static int DAC1064_init_1(WPMINFO struct my_timming* m) {
-	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+static int DAC1064_init_1(struct matrox_fb_info *minfo, struct my_timming *m)
+{
+	struct matrox_hw_state *hw = &minfo->hw;
 
 	DBG(__func__)
 
 	memcpy(hw->DACreg, MGA1064_DAC, sizeof(MGA1064_DAC_regs));
-	switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+	switch (minfo->fbcon.var.bits_per_pixel) {
 		/* case 4: not supported by MGA1064 DAC */
 		case 8:
 			hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_8BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED;
 			break;
 		case 16:
-			if (ACCESS_FBINFO(fbcon).var.green.length == 5)
+			if (minfo->fbcon.var.green.length == 5)
 				hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_15BPP_1BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED;
 			else
 				hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_16BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED;
@@ -361,22 +372,23 @@
 		default:
 			return 1;	/* unsupported depth */
 	}
-	hw->DACreg[POS1064_XVREFCTRL] = ACCESS_FBINFO(features.DAC1064.xvrefctrl);
+	hw->DACreg[POS1064_XVREFCTRL] = minfo->features.DAC1064.xvrefctrl;
 	hw->DACreg[POS1064_XGENCTRL] &= ~M1064_XGENCTRL_SYNC_ON_GREEN_MASK;
 	hw->DACreg[POS1064_XGENCTRL] |= (m->sync & FB_SYNC_ON_GREEN)?M1064_XGENCTRL_SYNC_ON_GREEN:M1064_XGENCTRL_NO_SYNC_ON_GREEN;
 	hw->DACreg[POS1064_XCURADDL] = 0;
 	hw->DACreg[POS1064_XCURADDH] = 0;
 
-	DAC1064_global_init(PMINFO2);
+	DAC1064_global_init(minfo);
 	return 0;
 }
 
-static int DAC1064_init_2(WPMINFO struct my_timming* m) {
-	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+static int DAC1064_init_2(struct matrox_fb_info *minfo, struct my_timming *m)
+{
+	struct matrox_hw_state *hw = &minfo->hw;
 
 	DBG(__func__)
 
-	if (ACCESS_FBINFO(fbcon).var.bits_per_pixel > 16) {	/* 256 entries */
+	if (minfo->fbcon.var.bits_per_pixel > 16) {	/* 256 entries */
 		int i;
 
 		for (i = 0; i < 256; i++) {
@@ -384,8 +396,8 @@
 			hw->DACpal[i * 3 + 1] = i;
 			hw->DACpal[i * 3 + 2] = i;
 		}
-	} else if (ACCESS_FBINFO(fbcon).var.bits_per_pixel > 8) {
-		if (ACCESS_FBINFO(fbcon).var.green.length == 5) {	/* 0..31, 128..159 */
+	} else if (minfo->fbcon.var.bits_per_pixel > 8) {
+		if (minfo->fbcon.var.green.length == 5) {	/* 0..31, 128..159 */
 			int i;
 
 			for (i = 0; i < 32; i++) {
@@ -413,8 +425,9 @@
 	return 0;
 }
 
-static void DAC1064_restore_1(WPMINFO2) {
-	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+static void DAC1064_restore_1(struct matrox_fb_info *minfo)
+{
+	struct matrox_hw_state *hw = &minfo->hw;
 
 	CRITFLAGS
 
@@ -422,28 +435,29 @@
 
 	CRITBEGIN
 
-	if ((inDAC1064(PMINFO DAC1064_XSYSPLLM) != hw->DACclk[3]) ||
-	    (inDAC1064(PMINFO DAC1064_XSYSPLLN) != hw->DACclk[4]) ||
-	    (inDAC1064(PMINFO DAC1064_XSYSPLLP) != hw->DACclk[5])) {
-		outDAC1064(PMINFO DAC1064_XSYSPLLM, hw->DACclk[3]);
-		outDAC1064(PMINFO DAC1064_XSYSPLLN, hw->DACclk[4]);
-		outDAC1064(PMINFO DAC1064_XSYSPLLP, hw->DACclk[5]);
+	if ((inDAC1064(minfo, DAC1064_XSYSPLLM) != hw->DACclk[3]) ||
+	    (inDAC1064(minfo, DAC1064_XSYSPLLN) != hw->DACclk[4]) ||
+	    (inDAC1064(minfo, DAC1064_XSYSPLLP) != hw->DACclk[5])) {
+		outDAC1064(minfo, DAC1064_XSYSPLLM, hw->DACclk[3]);
+		outDAC1064(minfo, DAC1064_XSYSPLLN, hw->DACclk[4]);
+		outDAC1064(minfo, DAC1064_XSYSPLLP, hw->DACclk[5]);
 	}
 	{
 		unsigned int i;
 
 		for (i = 0; i < sizeof(MGA1064_DAC_regs); i++) {
 			if ((i != POS1064_XPIXCLKCTRL) && (i != POS1064_XMISCCTRL))
-				outDAC1064(PMINFO MGA1064_DAC_regs[i], hw->DACreg[i]);
+				outDAC1064(minfo, MGA1064_DAC_regs[i], hw->DACreg[i]);
 		}
 	}
 
-	DAC1064_global_restore(PMINFO2);
+	DAC1064_global_restore(minfo);
 
 	CRITEND
 };
 
-static void DAC1064_restore_2(WPMINFO2) {
+static void DAC1064_restore_2(struct matrox_fb_info *minfo)
+{
 #ifdef DEBUG
 	unsigned int i;
 #endif
@@ -453,12 +467,12 @@
 #ifdef DEBUG
 	dprintk(KERN_DEBUG "DAC1064regs ");
 	for (i = 0; i < sizeof(MGA1064_DAC_regs); i++) {
-		dprintk("R%02X=%02X ", MGA1064_DAC_regs[i], ACCESS_FBINFO(hw).DACreg[i]);
+		dprintk("R%02X=%02X ", MGA1064_DAC_regs[i], minfo->hw.DACreg[i]);
 		if ((i & 0x7) == 0x7) dprintk(KERN_DEBUG "continuing... ");
 	}
 	dprintk(KERN_DEBUG "DAC1064clk ");
 	for (i = 0; i < 6; i++)
-		dprintk("C%02X=%02X ", i, ACCESS_FBINFO(hw).DACclk[i]);
+		dprintk("C%02X=%02X ", i, minfo->hw.DACclk[i]);
 	dprintk("\n");
 #endif
 }
@@ -470,14 +484,14 @@
 		int tmout;
 		CRITFLAGS
 
-		DAC1064_setpclk(PMINFO m->pixclock);
+		DAC1064_setpclk(minfo, m->pixclock);
 
 		CRITBEGIN
 
 		for (i = 0; i < 3; i++)
-			outDAC1064(PMINFO M1064_XPIXPLLCM + i, ACCESS_FBINFO(hw).DACclk[i]);
+			outDAC1064(minfo, M1064_XPIXPLLCM + i, minfo->hw.DACclk[i]);
 		for (tmout = 500000; tmout; tmout--) {
-			if (inDAC1064(PMINFO M1064_XPIXPLLSTAT) & 0x40)
+			if (inDAC1064(minfo, M1064_XPIXPLLSTAT) & 0x40)
 				break;
 			udelay(10);
 		};
@@ -500,9 +514,9 @@
 static int g450_compute(void* out, struct my_timming* m) {
 #define minfo ((struct matrox_fb_info*)out)
 	if (m->mnp < 0) {
-		m->mnp = matroxfb_g450_setclk(PMINFO m->pixclock, (m->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
+		m->mnp = matroxfb_g450_setclk(minfo, m->pixclock, (m->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
 		if (m->mnp >= 0) {
-			m->pixclock = g450_mnp2f(PMINFO m->mnp);
+			m->pixclock = g450_mnp2f(minfo, m->mnp);
 		}
 	}
 #undef minfo
@@ -518,13 +532,14 @@
 #endif /* NEED_DAC1064 */
 
 #ifdef CONFIG_FB_MATROX_MYSTIQUE
-static int MGA1064_init(WPMINFO struct my_timming* m) {
-	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+static int MGA1064_init(struct matrox_fb_info *minfo, struct my_timming *m)
+{
+	struct matrox_hw_state *hw = &minfo->hw;
 
 	DBG(__func__)
 
-	if (DAC1064_init_1(PMINFO m)) return 1;
-	if (matroxfb_vgaHWinit(PMINFO m)) return 1;
+	if (DAC1064_init_1(minfo, m)) return 1;
+	if (matroxfb_vgaHWinit(minfo, m)) return 1;
 
 	hw->MiscOutReg = 0xCB;
 	if (m->sync & FB_SYNC_HOR_HIGH_ACT)
@@ -534,20 +549,21 @@
 	if (m->sync & FB_SYNC_COMP_HIGH_ACT) /* should be only FB_SYNC_COMP */
 		hw->CRTCEXT[3] |= 0x40;
 
-	if (DAC1064_init_2(PMINFO m)) return 1;
+	if (DAC1064_init_2(minfo, m)) return 1;
 	return 0;
 }
 #endif
 
 #ifdef CONFIG_FB_MATROX_G
-static int MGAG100_init(WPMINFO struct my_timming* m) {
-	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+static int MGAG100_init(struct matrox_fb_info *minfo, struct my_timming *m)
+{
+	struct matrox_hw_state *hw = &minfo->hw;
 
 	DBG(__func__)
 
-	if (DAC1064_init_1(PMINFO m)) return 1;
+	if (DAC1064_init_1(minfo, m)) return 1;
 	hw->MXoptionReg &= ~0x2000;
-	if (matroxfb_vgaHWinit(PMINFO m)) return 1;
+	if (matroxfb_vgaHWinit(minfo, m)) return 1;
 
 	hw->MiscOutReg = 0xEF;
 	if (m->sync & FB_SYNC_HOR_HIGH_ACT)
@@ -557,27 +573,28 @@
 	if (m->sync & FB_SYNC_COMP_HIGH_ACT) /* should be only FB_SYNC_COMP */
 		hw->CRTCEXT[3] |= 0x40;
 
-	if (DAC1064_init_2(PMINFO m)) return 1;
+	if (DAC1064_init_2(minfo, m)) return 1;
 	return 0;
 }
 #endif	/* G */
 
 #ifdef CONFIG_FB_MATROX_MYSTIQUE
-static void MGA1064_ramdac_init(WPMINFO2) {
+static void MGA1064_ramdac_init(struct matrox_fb_info *minfo)
+{
 
 	DBG(__func__)
 
-	/* ACCESS_FBINFO(features.DAC1064.vco_freq_min) = 120000; */
-	ACCESS_FBINFO(features.pll.vco_freq_min) = 62000;
-	ACCESS_FBINFO(features.pll.ref_freq)	 = 14318;
-	ACCESS_FBINFO(features.pll.feed_div_min) = 100;
-	ACCESS_FBINFO(features.pll.feed_div_max) = 127;
-	ACCESS_FBINFO(features.pll.in_div_min)	 = 1;
-	ACCESS_FBINFO(features.pll.in_div_max)	 = 31;
-	ACCESS_FBINFO(features.pll.post_shift_max) = 3;
-	ACCESS_FBINFO(features.DAC1064.xvrefctrl) = DAC1064_XVREFCTRL_EXTERNAL;
+	/* minfo->features.DAC1064.vco_freq_min = 120000; */
+	minfo->features.pll.vco_freq_min = 62000;
+	minfo->features.pll.ref_freq	 = 14318;
+	minfo->features.pll.feed_div_min = 100;
+	minfo->features.pll.feed_div_max = 127;
+	minfo->features.pll.in_div_min	 = 1;
+	minfo->features.pll.in_div_max	 = 31;
+	minfo->features.pll.post_shift_max = 3;
+	minfo->features.DAC1064.xvrefctrl = DAC1064_XVREFCTRL_EXTERNAL;
 	/* maybe cmdline MCLK= ?, doc says gclk=44MHz, mclk=66MHz... it was 55/83 with old values */
-	DAC1064_setmclk(PMINFO DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV3 | DAC1064_OPT_SCLK_PLL, 133333);
+	DAC1064_setmclk(minfo, DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV3 | DAC1064_OPT_SCLK_PLL, 133333);
 }
 #endif
 
@@ -589,23 +606,25 @@
 static int def50 = 0;	/* reg50, & 0x0F, & 0x3000 (only 0x0000, 0x1000, 0x2000 (0x3000 disallowed and treated as 0) */
 #endif
 
-static void MGAG100_progPixClock(CPMINFO int flags, int m, int n, int p) {
+static void MGAG100_progPixClock(const struct matrox_fb_info *minfo, int flags,
+				 int m, int n, int p)
+{
 	int reg;
 	int selClk;
 	int clk;
 
 	DBG(__func__)
 
-	outDAC1064(PMINFO M1064_XPIXCLKCTRL, inDAC1064(PMINFO M1064_XPIXCLKCTRL) | M1064_XPIXCLKCTRL_DIS |
+	outDAC1064(minfo, M1064_XPIXCLKCTRL, inDAC1064(minfo, M1064_XPIXCLKCTRL) | M1064_XPIXCLKCTRL_DIS |
 		   M1064_XPIXCLKCTRL_PLL_UP);
 	switch (flags & 3) {
 		case 0:		reg = M1064_XPIXPLLAM; break;
 		case 1:		reg = M1064_XPIXPLLBM; break;
 		default:	reg = M1064_XPIXPLLCM; break;
 	}
-	outDAC1064(PMINFO reg++, m);
-	outDAC1064(PMINFO reg++, n);
-	outDAC1064(PMINFO reg, p);
+	outDAC1064(minfo, reg++, m);
+	outDAC1064(minfo, reg++, n);
+	outDAC1064(minfo, reg, p);
 	selClk = mga_inb(M_MISC_REG_READ) & ~0xC;
 	/* there should be flags & 0x03 & case 0/1/else */
 	/* and we should first select source and after that we should wait for PLL */
@@ -617,61 +636,64 @@
 	}
 	mga_outb(M_MISC_REG, selClk);
 	for (clk = 500000; clk; clk--) {
-		if (inDAC1064(PMINFO M1064_XPIXPLLSTAT) & 0x40)
+		if (inDAC1064(minfo, M1064_XPIXPLLSTAT) & 0x40)
 			break;
 		udelay(10);
 	};
 	if (!clk)
 		printk(KERN_ERR "matroxfb: Pixel PLL%c not locked after usual time\n", (reg-M1064_XPIXPLLAM-2)/4 + 'A');
-	selClk = inDAC1064(PMINFO M1064_XPIXCLKCTRL) & ~M1064_XPIXCLKCTRL_SRC_MASK;
+	selClk = inDAC1064(minfo, M1064_XPIXCLKCTRL) & ~M1064_XPIXCLKCTRL_SRC_MASK;
 	switch (flags & 0x0C) {
 		case 0x00:	selClk |= M1064_XPIXCLKCTRL_SRC_PCI; break;
 		case 0x04:	selClk |= M1064_XPIXCLKCTRL_SRC_PLL; break;
 		default:	selClk |= M1064_XPIXCLKCTRL_SRC_EXT; break;
 	}
-	outDAC1064(PMINFO M1064_XPIXCLKCTRL, selClk);
-	outDAC1064(PMINFO M1064_XPIXCLKCTRL, inDAC1064(PMINFO M1064_XPIXCLKCTRL) & ~M1064_XPIXCLKCTRL_DIS);
+	outDAC1064(minfo, M1064_XPIXCLKCTRL, selClk);
+	outDAC1064(minfo, M1064_XPIXCLKCTRL, inDAC1064(minfo, M1064_XPIXCLKCTRL) & ~M1064_XPIXCLKCTRL_DIS);
 }
 
-static void MGAG100_setPixClock(CPMINFO int flags, int freq) {
+static void MGAG100_setPixClock(const struct matrox_fb_info *minfo, int flags,
+				int freq)
+{
 	unsigned int m, n, p;
 
 	DBG(__func__)
 
-	DAC1064_calcclock(PMINFO freq, ACCESS_FBINFO(max_pixel_clock), &m, &n, &p);
-	MGAG100_progPixClock(PMINFO flags, m, n, p);
+	DAC1064_calcclock(minfo, freq, minfo->max_pixel_clock, &m, &n, &p);
+	MGAG100_progPixClock(minfo, flags, m, n, p);
 }
 #endif
 
 #ifdef CONFIG_FB_MATROX_MYSTIQUE
-static int MGA1064_preinit(WPMINFO2) {
+static int MGA1064_preinit(struct matrox_fb_info *minfo)
+{
 	static const int vxres_mystique[] = { 512,        640, 768,  800,  832,  960,
 					     1024, 1152, 1280,      1600, 1664, 1920,
 					     2048,    0};
-	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+	struct matrox_hw_state *hw = &minfo->hw;
 
 	DBG(__func__)
 
-	/* ACCESS_FBINFO(capable.cfb4) = 0; ... preinitialized by 0 */
-	ACCESS_FBINFO(capable.text) = 1;
-	ACCESS_FBINFO(capable.vxres) = vxres_mystique;
+	/* minfo->capable.cfb4 = 0; ... preinitialized by 0 */
+	minfo->capable.text = 1;
+	minfo->capable.vxres = vxres_mystique;
 
-	ACCESS_FBINFO(outputs[0]).output = &m1064;
-	ACCESS_FBINFO(outputs[0]).src = ACCESS_FBINFO(outputs[0]).default_src;
-	ACCESS_FBINFO(outputs[0]).data = MINFO;
-	ACCESS_FBINFO(outputs[0]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+	minfo->outputs[0].output = &m1064;
+	minfo->outputs[0].src = minfo->outputs[0].default_src;
+	minfo->outputs[0].data = minfo;
+	minfo->outputs[0].mode = MATROXFB_OUTPUT_MODE_MONITOR;
 
-	if (ACCESS_FBINFO(devflags.noinit))
+	if (minfo->devflags.noinit)
 		return 0;	/* do not modify settings */
 	hw->MXoptionReg &= 0xC0000100;
 	hw->MXoptionReg |= 0x00094E20;
-	if (ACCESS_FBINFO(devflags.novga))
+	if (minfo->devflags.novga)
 		hw->MXoptionReg &= ~0x00000100;
-	if (ACCESS_FBINFO(devflags.nobios))
+	if (minfo->devflags.nobios)
 		hw->MXoptionReg &= ~0x40000000;
-	if (ACCESS_FBINFO(devflags.nopciretry))
+	if (minfo->devflags.nopciretry)
 		hw->MXoptionReg |=  0x20000000;
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
 	mga_setr(M_SEQ_INDEX, 0x01, 0x20);
 	mga_outl(M_CTLWTST, 0x00000000);
 	udelay(200);
@@ -681,101 +703,105 @@
 	return 0;
 }
 
-static void MGA1064_reset(WPMINFO2) {
+static void MGA1064_reset(struct matrox_fb_info *minfo)
+{
 
 	DBG(__func__);
 
-	MGA1064_ramdac_init(PMINFO2);
+	MGA1064_ramdac_init(minfo);
 }
 #endif
 
 #ifdef CONFIG_FB_MATROX_G
-static void g450_mclk_init(WPMINFO2) {
+static void g450_mclk_init(struct matrox_fb_info *minfo)
+{
 	/* switch all clocks to PCI source */
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg | 4);
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION3_REG, ACCESS_FBINFO(values).reg.opt3 & ~0x00300C03);
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
-	
-	if (((ACCESS_FBINFO(values).reg.opt3 & 0x000003) == 0x000003) ||
-	    ((ACCESS_FBINFO(values).reg.opt3 & 0x000C00) == 0x000C00) ||
-	    ((ACCESS_FBINFO(values).reg.opt3 & 0x300000) == 0x300000)) {
-		matroxfb_g450_setclk(PMINFO ACCESS_FBINFO(values.pll.video), M_VIDEO_PLL);
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg | 4);
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION3_REG, minfo->values.reg.opt3 & ~0x00300C03);
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
+
+	if (((minfo->values.reg.opt3 & 0x000003) == 0x000003) ||
+	    ((minfo->values.reg.opt3 & 0x000C00) == 0x000C00) ||
+	    ((minfo->values.reg.opt3 & 0x300000) == 0x300000)) {
+		matroxfb_g450_setclk(minfo, minfo->values.pll.video, M_VIDEO_PLL);
 	} else {
 		unsigned long flags;
 		unsigned int pwr;
 		
 		matroxfb_DAC_lock_irqsave(flags);
-		pwr = inDAC1064(PMINFO M1064_XPWRCTRL) & ~0x02;
-		outDAC1064(PMINFO M1064_XPWRCTRL, pwr);
+		pwr = inDAC1064(minfo, M1064_XPWRCTRL) & ~0x02;
+		outDAC1064(minfo, M1064_XPWRCTRL, pwr);
 		matroxfb_DAC_unlock_irqrestore(flags);
 	}
-	matroxfb_g450_setclk(PMINFO ACCESS_FBINFO(values.pll.system), M_SYSTEM_PLL);
+	matroxfb_g450_setclk(minfo, minfo->values.pll.system, M_SYSTEM_PLL);
 	
 	/* switch clocks to their real PLL source(s) */
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg | 4);
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION3_REG, ACCESS_FBINFO(values).reg.opt3);
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg | 4);
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION3_REG, minfo->values.reg.opt3);
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
 
 }
 
-static void g450_memory_init(WPMINFO2) {
+static void g450_memory_init(struct matrox_fb_info *minfo)
+{
 	/* disable memory refresh */
-	ACCESS_FBINFO(hw).MXoptionReg &= ~0x001F8000;
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+	minfo->hw.MXoptionReg &= ~0x001F8000;
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
 	
 	/* set memory interface parameters */
-	ACCESS_FBINFO(hw).MXoptionReg &= ~0x00207E00;
-	ACCESS_FBINFO(hw).MXoptionReg |= 0x00207E00 & ACCESS_FBINFO(values).reg.opt;
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, ACCESS_FBINFO(values).reg.opt2);
+	minfo->hw.MXoptionReg &= ~0x00207E00;
+	minfo->hw.MXoptionReg |= 0x00207E00 & minfo->values.reg.opt;
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION2_REG, minfo->values.reg.opt2);
 	
-	mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst);
+	mga_outl(M_CTLWTST, minfo->values.reg.mctlwtst);
 	
 	/* first set up memory interface with disabled memory interface clocks */
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_MEMMISC_REG, ACCESS_FBINFO(values).reg.memmisc & ~0x80000000U);
-	mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
-	mga_outl(M_MACCESS, ACCESS_FBINFO(values).reg.maccess);
+	pci_write_config_dword(minfo->pcidev, PCI_MEMMISC_REG, minfo->values.reg.memmisc & ~0x80000000U);
+	mga_outl(M_MEMRDBK, minfo->values.reg.memrdbk);
+	mga_outl(M_MACCESS, minfo->values.reg.maccess);
 	/* start memory clocks */
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_MEMMISC_REG, ACCESS_FBINFO(values).reg.memmisc | 0x80000000U);
+	pci_write_config_dword(minfo->pcidev, PCI_MEMMISC_REG, minfo->values.reg.memmisc | 0x80000000U);
 
 	udelay(200);
 	
-	if (ACCESS_FBINFO(values).memory.ddr && (!ACCESS_FBINFO(values).memory.emrswen || !ACCESS_FBINFO(values).memory.dll)) {
-		mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk & ~0x1000);
+	if (minfo->values.memory.ddr && (!minfo->values.memory.emrswen || !minfo->values.memory.dll)) {
+		mga_outl(M_MEMRDBK, minfo->values.reg.memrdbk & ~0x1000);
 	}
-	mga_outl(M_MACCESS, ACCESS_FBINFO(values).reg.maccess | 0x8000);
+	mga_outl(M_MACCESS, minfo->values.reg.maccess | 0x8000);
 	
 	udelay(200);
 	
-	ACCESS_FBINFO(hw).MXoptionReg |= 0x001F8000 & ACCESS_FBINFO(values).reg.opt;
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+	minfo->hw.MXoptionReg |= 0x001F8000 & minfo->values.reg.opt;
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
 	
 	/* value is written to memory chips only if old != new */
 	mga_outl(M_PLNWT, 0);
 	mga_outl(M_PLNWT, ~0);
 	
-	if (ACCESS_FBINFO(values).reg.mctlwtst != ACCESS_FBINFO(values).reg.mctlwtst_core) {
-		mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst_core);
+	if (minfo->values.reg.mctlwtst != minfo->values.reg.mctlwtst_core) {
+		mga_outl(M_CTLWTST, minfo->values.reg.mctlwtst_core);
 	}
 	
 }
 
-static void g450_preinit(WPMINFO2) {
+static void g450_preinit(struct matrox_fb_info *minfo)
+{
 	u_int32_t c2ctl;
 	u_int8_t curctl;
 	u_int8_t c1ctl;
 	
-	/* ACCESS_FBINFO(hw).MXoptionReg = minfo->values.reg.opt; */
-	ACCESS_FBINFO(hw).MXoptionReg &= 0xC0000100;
-	ACCESS_FBINFO(hw).MXoptionReg |= 0x00000020;
-	if (ACCESS_FBINFO(devflags.novga))
-		ACCESS_FBINFO(hw).MXoptionReg &= ~0x00000100;
-	if (ACCESS_FBINFO(devflags.nobios))
-		ACCESS_FBINFO(hw).MXoptionReg &= ~0x40000000;
-	if (ACCESS_FBINFO(devflags.nopciretry))
-		ACCESS_FBINFO(hw).MXoptionReg |=  0x20000000;
-	ACCESS_FBINFO(hw).MXoptionReg |= ACCESS_FBINFO(values).reg.opt & 0x03400040;
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+	/* minfo->hw.MXoptionReg = minfo->values.reg.opt; */
+	minfo->hw.MXoptionReg &= 0xC0000100;
+	minfo->hw.MXoptionReg |= 0x00000020;
+	if (minfo->devflags.novga)
+		minfo->hw.MXoptionReg &= ~0x00000100;
+	if (minfo->devflags.nobios)
+		minfo->hw.MXoptionReg &= ~0x40000000;
+	if (minfo->devflags.nopciretry)
+		minfo->hw.MXoptionReg |=  0x20000000;
+	minfo->hw.MXoptionReg |= minfo->values.reg.opt & 0x03400040;
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
 
 	/* Init system clocks */
 		
@@ -783,24 +809,24 @@
 	c2ctl = mga_inl(M_C2CTL);
 	mga_outl(M_C2CTL, c2ctl & ~1);
 	/* stop cursor */
-	curctl = inDAC1064(PMINFO M1064_XCURCTRL);
-	outDAC1064(PMINFO M1064_XCURCTRL, 0);
+	curctl = inDAC1064(minfo, M1064_XCURCTRL);
+	outDAC1064(minfo, M1064_XCURCTRL, 0);
 	/* stop crtc1 */
 	c1ctl = mga_readr(M_SEQ_INDEX, 1);
 	mga_setr(M_SEQ_INDEX, 1, c1ctl | 0x20);
 
-	g450_mclk_init(PMINFO2);
-	g450_memory_init(PMINFO2);
+	g450_mclk_init(minfo);
+	g450_memory_init(minfo);
 	
 	/* set legacy VGA clock sources for DOSEmu or VMware... */
-	matroxfb_g450_setclk(PMINFO 25175, M_PIXEL_PLL_A);
-	matroxfb_g450_setclk(PMINFO 28322, M_PIXEL_PLL_B);
+	matroxfb_g450_setclk(minfo, 25175, M_PIXEL_PLL_A);
+	matroxfb_g450_setclk(minfo, 28322, M_PIXEL_PLL_B);
 
 	/* restore crtc1 */
 	mga_setr(M_SEQ_INDEX, 1, c1ctl);
 	
 	/* restore cursor */
-	outDAC1064(PMINFO M1064_XCURCTRL, curctl);
+	outDAC1064(minfo, M1064_XCURCTRL, curctl);
 
 	/* restore crtc2 */
 	mga_outl(M_C2CTL, c2ctl);
@@ -808,11 +834,12 @@
 	return;
 }
 
-static int MGAG100_preinit(WPMINFO2) {
+static int MGAG100_preinit(struct matrox_fb_info *minfo)
+{
 	static const int vxres_g100[] = {  512,        640, 768,  800,  832,  960,
                                           1024, 1152, 1280,      1600, 1664, 1920,
                                           2048, 0};
-	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+	struct matrox_hw_state *hw = &minfo->hw;
 
         u_int32_t reg50;
 #if 0
@@ -822,68 +849,68 @@
 	DBG(__func__)
 
 	/* there are some instabilities if in_div > 19 && vco < 61000 */
-	if (ACCESS_FBINFO(devflags.g450dac)) {
-		ACCESS_FBINFO(features.pll.vco_freq_min) = 130000;	/* my sample: >118 */
+	if (minfo->devflags.g450dac) {
+		minfo->features.pll.vco_freq_min = 130000;	/* my sample: >118 */
 	} else {
-		ACCESS_FBINFO(features.pll.vco_freq_min) = 62000;
+		minfo->features.pll.vco_freq_min = 62000;
 	}
-	if (!ACCESS_FBINFO(features.pll.ref_freq)) {
-		ACCESS_FBINFO(features.pll.ref_freq)	 = 27000;
+	if (!minfo->features.pll.ref_freq) {
+		minfo->features.pll.ref_freq	 = 27000;
 	}
-	ACCESS_FBINFO(features.pll.feed_div_min) = 7;
-	ACCESS_FBINFO(features.pll.feed_div_max) = 127;
-	ACCESS_FBINFO(features.pll.in_div_min)	 = 1;
-	ACCESS_FBINFO(features.pll.in_div_max)	 = 31;
-	ACCESS_FBINFO(features.pll.post_shift_max) = 3;
-	ACCESS_FBINFO(features.DAC1064.xvrefctrl) = DAC1064_XVREFCTRL_G100_DEFAULT;
-	/* ACCESS_FBINFO(capable.cfb4) = 0; ... preinitialized by 0 */
-	ACCESS_FBINFO(capable.text) = 1;
-	ACCESS_FBINFO(capable.vxres) = vxres_g100;
-	ACCESS_FBINFO(capable.plnwt) = ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG100
-			? ACCESS_FBINFO(devflags.sgram) : 1;
+	minfo->features.pll.feed_div_min = 7;
+	minfo->features.pll.feed_div_max = 127;
+	minfo->features.pll.in_div_min	 = 1;
+	minfo->features.pll.in_div_max	 = 31;
+	minfo->features.pll.post_shift_max = 3;
+	minfo->features.DAC1064.xvrefctrl = DAC1064_XVREFCTRL_G100_DEFAULT;
+	/* minfo->capable.cfb4 = 0; ... preinitialized by 0 */
+	minfo->capable.text = 1;
+	minfo->capable.vxres = vxres_g100;
+	minfo->capable.plnwt = minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG100
+			? minfo->devflags.sgram : 1;
 
 #ifdef CONFIG_FB_MATROX_G
-	if (ACCESS_FBINFO(devflags.g450dac)) {
-		ACCESS_FBINFO(outputs[0]).output = &g450out;
+	if (minfo->devflags.g450dac) {
+		minfo->outputs[0].output = &g450out;
 	} else
 #endif
 	{
-		ACCESS_FBINFO(outputs[0]).output = &m1064;
+		minfo->outputs[0].output = &m1064;
 	}
-	ACCESS_FBINFO(outputs[0]).src = ACCESS_FBINFO(outputs[0]).default_src;
-	ACCESS_FBINFO(outputs[0]).data = MINFO;
-	ACCESS_FBINFO(outputs[0]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+	minfo->outputs[0].src = minfo->outputs[0].default_src;
+	minfo->outputs[0].data = minfo;
+	minfo->outputs[0].mode = MATROXFB_OUTPUT_MODE_MONITOR;
 
-	if (ACCESS_FBINFO(devflags.g450dac)) {
+	if (minfo->devflags.g450dac) {
 		/* we must do this always, BIOS does not do it for us
 		   and accelerator dies without it */
 		mga_outl(0x1C0C, 0);
 	}
-	if (ACCESS_FBINFO(devflags.noinit))
+	if (minfo->devflags.noinit)
 		return 0;
-	if (ACCESS_FBINFO(devflags.g450dac)) {
-		g450_preinit(PMINFO2);
+	if (minfo->devflags.g450dac) {
+		g450_preinit(minfo);
 		return 0;
 	}
 	hw->MXoptionReg &= 0xC0000100;
 	hw->MXoptionReg |= 0x00000020;
-	if (ACCESS_FBINFO(devflags.novga))
+	if (minfo->devflags.novga)
 		hw->MXoptionReg &= ~0x00000100;
-	if (ACCESS_FBINFO(devflags.nobios))
+	if (minfo->devflags.nobios)
 		hw->MXoptionReg &= ~0x40000000;
-	if (ACCESS_FBINFO(devflags.nopciretry))
+	if (minfo->devflags.nopciretry)
 		hw->MXoptionReg |=  0x20000000;
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
-	DAC1064_setmclk(PMINFO DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV3 | DAC1064_OPT_SCLK_PCI, 133333);
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
+	DAC1064_setmclk(minfo, DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV3 | DAC1064_OPT_SCLK_PCI, 133333);
 
-	if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG100) {
-		pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, &reg50);
+	if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG100) {
+		pci_read_config_dword(minfo->pcidev, PCI_OPTION2_REG, &reg50);
 		reg50 &= ~0x3000;
-		pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, reg50);
+		pci_write_config_dword(minfo->pcidev, PCI_OPTION2_REG, reg50);
 
 		hw->MXoptionReg |= 0x1080;
-		pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
-		mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst);
+		pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
+		mga_outl(M_CTLWTST, minfo->values.reg.mctlwtst);
 		udelay(100);
 		mga_outb(0x1C05, 0x00);
 		mga_outb(0x1C05, 0x80);
@@ -893,68 +920,69 @@
 		udelay(100);
 		reg50 &= ~0xFF;
 		reg50 |=  0x07;
-		pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, reg50);
+		pci_write_config_dword(minfo->pcidev, PCI_OPTION2_REG, reg50);
 		/* it should help with G100 */
 		mga_outb(M_GRAPHICS_INDEX, 6);
 		mga_outb(M_GRAPHICS_DATA, (mga_inb(M_GRAPHICS_DATA) & 3) | 4);
 		mga_setr(M_EXTVGA_INDEX, 0x03, 0x81);
 		mga_setr(M_EXTVGA_INDEX, 0x04, 0x00);
-		mga_writeb(ACCESS_FBINFO(video.vbase), 0x0000, 0xAA);
-		mga_writeb(ACCESS_FBINFO(video.vbase), 0x0800, 0x55);
-		mga_writeb(ACCESS_FBINFO(video.vbase), 0x4000, 0x55);
+		mga_writeb(minfo->video.vbase, 0x0000, 0xAA);
+		mga_writeb(minfo->video.vbase, 0x0800, 0x55);
+		mga_writeb(minfo->video.vbase, 0x4000, 0x55);
 #if 0
-		if (mga_readb(ACCESS_FBINFO(video.vbase), 0x0000) != 0xAA) {
+		if (mga_readb(minfo->video.vbase, 0x0000) != 0xAA) {
 			hw->MXoptionReg &= ~0x1000;
 		}
 #endif
 		hw->MXoptionReg |= 0x00078020;
-	} else if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG200) {
-		pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, &reg50);
+	} else if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG200) {
+		pci_read_config_dword(minfo->pcidev, PCI_OPTION2_REG, &reg50);
 		reg50 &= ~0x3000;
-		pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, reg50);
+		pci_write_config_dword(minfo->pcidev, PCI_OPTION2_REG, reg50);
 
-		if (ACCESS_FBINFO(devflags.memtype) == -1)
-			hw->MXoptionReg |= ACCESS_FBINFO(values).reg.opt & 0x1C00;
+		if (minfo->devflags.memtype == -1)
+			hw->MXoptionReg |= minfo->values.reg.opt & 0x1C00;
 		else
-			hw->MXoptionReg |= (ACCESS_FBINFO(devflags.memtype) & 7) << 10;
-		if (ACCESS_FBINFO(devflags.sgram))
+			hw->MXoptionReg |= (minfo->devflags.memtype & 7) << 10;
+		if (minfo->devflags.sgram)
 			hw->MXoptionReg |= 0x4000;
-		mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst);
-		mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+		mga_outl(M_CTLWTST, minfo->values.reg.mctlwtst);
+		mga_outl(M_MEMRDBK, minfo->values.reg.memrdbk);
 		udelay(200);
 		mga_outl(M_MACCESS, 0x00000000);
 		mga_outl(M_MACCESS, 0x00008000);
 		udelay(100);
-		mga_outw(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+		mga_outw(M_MEMRDBK, minfo->values.reg.memrdbk);
 		hw->MXoptionReg |= 0x00078020;
 	} else {
-		pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, &reg50);
+		pci_read_config_dword(minfo->pcidev, PCI_OPTION2_REG, &reg50);
 		reg50 &= ~0x00000100;
 		reg50 |=  0x00000000;
-		pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, reg50);
+		pci_write_config_dword(minfo->pcidev, PCI_OPTION2_REG, reg50);
 
-		if (ACCESS_FBINFO(devflags.memtype) == -1)
-			hw->MXoptionReg |= ACCESS_FBINFO(values).reg.opt & 0x1C00;
+		if (minfo->devflags.memtype == -1)
+			hw->MXoptionReg |= minfo->values.reg.opt & 0x1C00;
 		else
-			hw->MXoptionReg |= (ACCESS_FBINFO(devflags.memtype) & 7) << 10;
-		if (ACCESS_FBINFO(devflags.sgram))
+			hw->MXoptionReg |= (minfo->devflags.memtype & 7) << 10;
+		if (minfo->devflags.sgram)
 			hw->MXoptionReg |= 0x4000;
-		mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst);
-		mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+		mga_outl(M_CTLWTST, minfo->values.reg.mctlwtst);
+		mga_outl(M_MEMRDBK, minfo->values.reg.memrdbk);
 		udelay(200);
 		mga_outl(M_MACCESS, 0x00000000);
 		mga_outl(M_MACCESS, 0x00008000);
 		udelay(100);
-		mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+		mga_outl(M_MEMRDBK, minfo->values.reg.memrdbk);
 		hw->MXoptionReg |= 0x00040020;
 	}
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
 	return 0;
 }
 
-static void MGAG100_reset(WPMINFO2) {
+static void MGAG100_reset(struct matrox_fb_info *minfo)
+{
 	u_int8_t b;
-	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+	struct matrox_hw_state *hw = &minfo->hw;
 
 	DBG(__func__)
 
@@ -964,54 +992,55 @@
 
 		find 1014/22 (IBM/82351); /* if found and bridging Matrox, do some strange stuff */
 		pci_read_config_byte(ibm, PCI_SECONDARY_BUS, &b);
-		if (b == ACCESS_FBINFO(pcidev)->bus->number) {
+		if (b == minfo->pcidev->bus->number) {
 			pci_write_config_byte(ibm, PCI_COMMAND+1, 0);	/* disable back-to-back & SERR */
 			pci_write_config_byte(ibm, 0x41, 0xF4);		/* ??? */
 			pci_write_config_byte(ibm, PCI_IO_BASE, 0xF0);	/* ??? */
 			pci_write_config_byte(ibm, PCI_IO_LIMIT, 0x00);	/* ??? */
 		}
 #endif
-		if (!ACCESS_FBINFO(devflags.noinit)) {
+		if (!minfo->devflags.noinit) {
 			if (x7AF4 & 8) {
 				hw->MXoptionReg |= 0x40;	/* FIXME... */
-				pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+				pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
 			}
 			mga_setr(M_EXTVGA_INDEX, 0x06, 0x00);
 		}
 	}
-	if (ACCESS_FBINFO(devflags.g450dac)) {
+	if (minfo->devflags.g450dac) {
 		/* either leave MCLK as is... or they were set in preinit */
-		hw->DACclk[3] = inDAC1064(PMINFO DAC1064_XSYSPLLM);
-		hw->DACclk[4] = inDAC1064(PMINFO DAC1064_XSYSPLLN);
-		hw->DACclk[5] = inDAC1064(PMINFO DAC1064_XSYSPLLP);
+		hw->DACclk[3] = inDAC1064(minfo, DAC1064_XSYSPLLM);
+		hw->DACclk[4] = inDAC1064(minfo, DAC1064_XSYSPLLN);
+		hw->DACclk[5] = inDAC1064(minfo, DAC1064_XSYSPLLP);
 	} else {
-		DAC1064_setmclk(PMINFO DAC1064_OPT_RESERVED | DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV1 | DAC1064_OPT_SCLK_PLL, 133333);
+		DAC1064_setmclk(minfo, DAC1064_OPT_RESERVED | DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV1 | DAC1064_OPT_SCLK_PLL, 133333);
 	}
-	if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400) {
-		if (ACCESS_FBINFO(devflags.dfp_type) == -1) {
-			ACCESS_FBINFO(devflags.dfp_type) = inDAC1064(PMINFO 0x1F);
+	if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG400) {
+		if (minfo->devflags.dfp_type == -1) {
+			minfo->devflags.dfp_type = inDAC1064(minfo, 0x1F);
 		}
 	}
-	if (ACCESS_FBINFO(devflags.noinit))
+	if (minfo->devflags.noinit)
 		return;
-	if (ACCESS_FBINFO(devflags.g450dac)) {
+	if (minfo->devflags.g450dac) {
 	} else {
-		MGAG100_setPixClock(PMINFO 4, 25175);
-		MGAG100_setPixClock(PMINFO 5, 28322);
+		MGAG100_setPixClock(minfo, 4, 25175);
+		MGAG100_setPixClock(minfo, 5, 28322);
 		if (x7AF4 & 0x10) {
-			b = inDAC1064(PMINFO M1064_XGENIODATA) & ~1;
-			outDAC1064(PMINFO M1064_XGENIODATA, b);
-			b = inDAC1064(PMINFO M1064_XGENIOCTRL) | 1;
-			outDAC1064(PMINFO M1064_XGENIOCTRL, b);
+			b = inDAC1064(minfo, M1064_XGENIODATA) & ~1;
+			outDAC1064(minfo, M1064_XGENIODATA, b);
+			b = inDAC1064(minfo, M1064_XGENIOCTRL) | 1;
+			outDAC1064(minfo, M1064_XGENIOCTRL, b);
 		}
 	}
 }
 #endif
 
 #ifdef CONFIG_FB_MATROX_MYSTIQUE
-static void MGA1064_restore(WPMINFO2) {
+static void MGA1064_restore(struct matrox_fb_info *minfo)
+{
 	int i;
-	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+	struct matrox_hw_state *hw = &minfo->hw;
 
 	CRITFLAGS
 
@@ -1019,25 +1048,26 @@
 
 	CRITBEGIN
 
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
 	mga_outb(M_IEN, 0x00);
 	mga_outb(M_CACHEFLUSH, 0x00);
 
 	CRITEND
 
-	DAC1064_restore_1(PMINFO2);
-	matroxfb_vgaHWrestore(PMINFO2);
-	ACCESS_FBINFO(crtc1.panpos) = -1;
+	DAC1064_restore_1(minfo);
+	matroxfb_vgaHWrestore(minfo);
+	minfo->crtc1.panpos = -1;
 	for (i = 0; i < 6; i++)
 		mga_setr(M_EXTVGA_INDEX, i, hw->CRTCEXT[i]);
-	DAC1064_restore_2(PMINFO2);
+	DAC1064_restore_2(minfo);
 }
 #endif
 
 #ifdef CONFIG_FB_MATROX_G
-static void MGAG100_restore(WPMINFO2) {
+static void MGAG100_restore(struct matrox_fb_info *minfo)
+{
 	int i;
-	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+	struct matrox_hw_state *hw = &minfo->hw;
 
 	CRITFLAGS
 
@@ -1045,19 +1075,17 @@
 
 	CRITBEGIN
 
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
 	CRITEND
 
-	DAC1064_restore_1(PMINFO2);
-	matroxfb_vgaHWrestore(PMINFO2);
-#ifdef CONFIG_FB_MATROX_32MB
-	if (ACCESS_FBINFO(devflags.support32MB))
+	DAC1064_restore_1(minfo);
+	matroxfb_vgaHWrestore(minfo);
+	if (minfo->devflags.support32MB)
 		mga_setr(M_EXTVGA_INDEX, 8, hw->CRTCEXT[8]);
-#endif
-	ACCESS_FBINFO(crtc1.panpos) = -1;
+	minfo->crtc1.panpos = -1;
 	for (i = 0; i < 6; i++)
 		mga_setr(M_EXTVGA_INDEX, i, hw->CRTCEXT[i]);
-	DAC1064_restore_2(PMINFO2);
+	DAC1064_restore_2(minfo);
 }
 #endif
 
diff --git a/drivers/video/matrox/matroxfb_DAC1064.h b/drivers/video/matrox/matroxfb_DAC1064.h
index 7a98ce8..c6ed780 100644
--- a/drivers/video/matrox/matroxfb_DAC1064.h
+++ b/drivers/video/matrox/matroxfb_DAC1064.h
@@ -11,8 +11,8 @@
 extern struct matrox_switch matrox_G100;
 #endif
 #ifdef NEED_DAC1064
-void DAC1064_global_init(WPMINFO2);
-void DAC1064_global_restore(WPMINFO2);
+void DAC1064_global_init(struct matrox_fb_info *minfo);
+void DAC1064_global_restore(struct matrox_fb_info *minfo);
 #endif
 
 #define M1064_INDEX	0x00
diff --git a/drivers/video/matrox/matroxfb_Ti3026.c b/drivers/video/matrox/matroxfb_Ti3026.c
index 4e82511..835aaaa 100644
--- a/drivers/video/matrox/matroxfb_Ti3026.c
+++ b/drivers/video/matrox/matroxfb_Ti3026.c
@@ -279,27 +279,31 @@
   TVP3026_XCOLKEYCTRL_ZOOM1,
   0x00, 0x00, TVP3026_XCURCTRL_DIS };
 
-static int Ti3026_calcclock(CPMINFO unsigned int freq, unsigned int fmax, int* in, int* feed, int* post) {
+static int Ti3026_calcclock(const struct matrox_fb_info *minfo,
+			    unsigned int freq, unsigned int fmax, int *in,
+			    int *feed, int *post)
+{
 	unsigned int fvco;
 	unsigned int lin, lfeed, lpost;
 
 	DBG(__func__)
 
-	fvco = PLL_calcclock(PMINFO freq, fmax, &lin, &lfeed, &lpost);
+	fvco = PLL_calcclock(minfo, freq, fmax, &lin, &lfeed, &lpost);
 	fvco >>= (*post = lpost);
 	*in = 64 - lin;
 	*feed = 64 - lfeed;
 	return fvco;
 }
 
-static int Ti3026_setpclk(WPMINFO int clk) {
+static int Ti3026_setpclk(struct matrox_fb_info *minfo, int clk)
+{
 	unsigned int f_pll;
 	unsigned int pixfeed, pixin, pixpost;
-	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+	struct matrox_hw_state *hw = &minfo->hw;
 
 	DBG(__func__)
 
-	f_pll = Ti3026_calcclock(PMINFO clk, ACCESS_FBINFO(max_pixel_clock), &pixin, &pixfeed, &pixpost);
+	f_pll = Ti3026_calcclock(minfo, clk, minfo->max_pixel_clock, &pixin, &pixfeed, &pixpost);
 
 	hw->DACclk[0] = pixin | 0xC0;
 	hw->DACclk[1] = pixfeed;
@@ -309,9 +313,9 @@
 		unsigned int loopfeed, loopin, looppost, loopdiv, z;
 		unsigned int Bpp;
 
-		Bpp = ACCESS_FBINFO(curr.final_bppShift);
+		Bpp = minfo->curr.final_bppShift;
 
-		if (ACCESS_FBINFO(fbcon).var.bits_per_pixel == 24) {
+		if (minfo->fbcon.var.bits_per_pixel == 24) {
 			loopfeed = 3;		/* set lm to any possible value */
 			loopin = 3 * 32 / Bpp;
 		} else {
@@ -330,18 +334,18 @@
 			looppost = 3;
 			loopdiv = z/16;
 		}
-		if (ACCESS_FBINFO(fbcon).var.bits_per_pixel == 24) {
+		if (minfo->fbcon.var.bits_per_pixel == 24) {
 			hw->DACclk[3] = ((65 - loopin) & 0x3F) | 0xC0;
 			hw->DACclk[4] = (65 - loopfeed) | 0x80;
-			if (ACCESS_FBINFO(accel.ramdac_rev) > 0x20) {
-				if (isInterleave(MINFO))
+			if (minfo->accel.ramdac_rev > 0x20) {
+				if (isInterleave(minfo))
 					hw->DACreg[POS3026_XLATCHCTRL] = TVP3026B_XLATCHCTRL_8_3;
 				else {
 					hw->DACclk[4] &= ~0xC0;
 					hw->DACreg[POS3026_XLATCHCTRL] = TVP3026B_XLATCHCTRL_4_3;
 				}
 			} else {
-				if (isInterleave(MINFO))
+				if (isInterleave(minfo))
 					;	/* default... */
 				else {
 					hw->DACclk[4] ^= 0xC0;	/* change from 0x80 to 0x40 */
@@ -349,7 +353,7 @@
 				}
 			}
 			hw->DACclk[5] = looppost | 0xF8;
-			if (ACCESS_FBINFO(devflags.mga_24bpp_fix))
+			if (minfo->devflags.mga_24bpp_fix)
 				hw->DACclk[5] ^= 0x40;
 		} else {
 			hw->DACclk[3] = ((65 - loopin) & 0x3F) | 0xC0;
@@ -361,14 +365,15 @@
 	return 0;
 }
 
-static int Ti3026_init(WPMINFO struct my_timming* m) {
-	u_int8_t muxctrl = isInterleave(MINFO) ? TVP3026_XMUXCTRL_MEMORY_64BIT : TVP3026_XMUXCTRL_MEMORY_32BIT;
-	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+static int Ti3026_init(struct matrox_fb_info *minfo, struct my_timming *m)
+{
+	u_int8_t muxctrl = isInterleave(minfo) ? TVP3026_XMUXCTRL_MEMORY_64BIT : TVP3026_XMUXCTRL_MEMORY_32BIT;
+	struct matrox_hw_state *hw = &minfo->hw;
 
 	DBG(__func__)
 
 	memcpy(hw->DACreg, MGADACbpp32, sizeof(hw->DACreg));
-	switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+	switch (minfo->fbcon.var.bits_per_pixel) {
 		case 4:	hw->DACreg[POS3026_XLATCHCTRL] = TVP3026_XLATCHCTRL_16_1;	/* or _8_1, they are same */
 			hw->DACreg[POS3026_XTRUECOLORCTRL] = TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR;
 			hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_4BIT;
@@ -383,7 +388,7 @@
 			break;
 		case 16:
 			/* XLATCHCTRL should be _4_1 / _2_1... Why is not? (_2_1 is used everytime) */
-			hw->DACreg[POS3026_XTRUECOLORCTRL] = (ACCESS_FBINFO(fbcon).var.green.length == 5)? (TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_ORGB_1555 ) : (TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_RGB_565);
+			hw->DACreg[POS3026_XTRUECOLORCTRL] = (minfo->fbcon.var.green.length == 5) ? (TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_ORGB_1555) : (TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_RGB_565);
 			hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_16BIT;
 			hw->DACreg[POS3026_XCLKCTRL] = TVP3026_XCLKCTRL_SRC_PLL | TVP3026_XCLKCTRL_DIV2;
 			break;
@@ -400,7 +405,7 @@
 		default:
 			return 1;	/* TODO: failed */
 	}
-	if (matroxfb_vgaHWinit(PMINFO m)) return 1;
+	if (matroxfb_vgaHWinit(minfo, m)) return 1;
 
 	/* set SYNC */
 	hw->MiscOutReg = 0xCB;
@@ -412,9 +417,9 @@
 		hw->DACreg[POS3026_XGENCTRL] |= TVP3026_XGENCTRL_SYNC_ON_GREEN;
 
 	/* set DELAY */
-	if (ACCESS_FBINFO(video.len) < 0x400000)
+	if (minfo->video.len < 0x400000)
 		hw->CRTCEXT[3] |= 0x08;
-	else if (ACCESS_FBINFO(video.len) > 0x400000)
+	else if (minfo->video.len > 0x400000)
 		hw->CRTCEXT[3] |= 0x10;
 
 	/* set HWCURSOR */
@@ -426,14 +431,15 @@
 
 	/* set interleaving */
 	hw->MXoptionReg &= ~0x00001000;
-	if (isInterleave(MINFO)) hw->MXoptionReg |= 0x00001000;
+	if (isInterleave(minfo)) hw->MXoptionReg |= 0x00001000;
 
 	/* set DAC */
-	Ti3026_setpclk(PMINFO m->pixclock);
+	Ti3026_setpclk(minfo, m->pixclock);
 	return 0;
 }
 
-static void ti3026_setMCLK(WPMINFO int fout){
+static void ti3026_setMCLK(struct matrox_fb_info *minfo, int fout)
+{
 	unsigned int f_pll;
 	unsigned int pclk_m, pclk_n, pclk_p;
 	unsigned int mclk_m, mclk_n, mclk_p;
@@ -442,29 +448,29 @@
 
 	DBG(__func__)
 
-	f_pll = Ti3026_calcclock(PMINFO fout, ACCESS_FBINFO(max_pixel_clock), &mclk_n, &mclk_m, &mclk_p);
+	f_pll = Ti3026_calcclock(minfo, fout, minfo->max_pixel_clock, &mclk_n, &mclk_m, &mclk_p);
 
 	/* save pclk */
-	outTi3026(PMINFO TVP3026_XPLLADDR, 0xFC);
-	pclk_n = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
-	outTi3026(PMINFO TVP3026_XPLLADDR, 0xFD);
-	pclk_m = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
-	outTi3026(PMINFO TVP3026_XPLLADDR, 0xFE);
-	pclk_p = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
+	outTi3026(minfo, TVP3026_XPLLADDR, 0xFC);
+	pclk_n = inTi3026(minfo, TVP3026_XPIXPLLDATA);
+	outTi3026(minfo, TVP3026_XPLLADDR, 0xFD);
+	pclk_m = inTi3026(minfo, TVP3026_XPIXPLLDATA);
+	outTi3026(minfo, TVP3026_XPLLADDR, 0xFE);
+	pclk_p = inTi3026(minfo, TVP3026_XPIXPLLDATA);
 
 	/* stop pclk */
-	outTi3026(PMINFO TVP3026_XPLLADDR, 0xFE);
-	outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0x00);
+	outTi3026(minfo, TVP3026_XPLLADDR, 0xFE);
+	outTi3026(minfo, TVP3026_XPIXPLLDATA, 0x00);
 
 	/* set pclk to new mclk */
-	outTi3026(PMINFO TVP3026_XPLLADDR, 0xFC);
-	outTi3026(PMINFO TVP3026_XPIXPLLDATA, mclk_n | 0xC0);
-	outTi3026(PMINFO TVP3026_XPIXPLLDATA, mclk_m);
-	outTi3026(PMINFO TVP3026_XPIXPLLDATA, mclk_p | 0xB0);
+	outTi3026(minfo, TVP3026_XPLLADDR, 0xFC);
+	outTi3026(minfo, TVP3026_XPIXPLLDATA, mclk_n | 0xC0);
+	outTi3026(minfo, TVP3026_XPIXPLLDATA, mclk_m);
+	outTi3026(minfo, TVP3026_XPIXPLLDATA, mclk_p | 0xB0);
 
 	/* wait for PLL to lock */
 	for (tmout = 500000; tmout; tmout--) {
-		if (inTi3026(PMINFO TVP3026_XPIXPLLDATA) & 0x40)
+		if (inTi3026(minfo, TVP3026_XPIXPLLDATA) & 0x40)
 			break;
 		udelay(10);
 	};
@@ -472,23 +478,23 @@
 		printk(KERN_ERR "matroxfb: Temporary pixel PLL not locked after 5 secs\n");
 
 	/* output pclk on mclk pin */
-	mclk_ctl = inTi3026(PMINFO TVP3026_XMEMPLLCTRL);
-	outTi3026(PMINFO TVP3026_XMEMPLLCTRL, mclk_ctl & 0xE7);
-	outTi3026(PMINFO TVP3026_XMEMPLLCTRL, (mclk_ctl & 0xE7) | TVP3026_XMEMPLLCTRL_STROBEMKC4);
+	mclk_ctl = inTi3026(minfo, TVP3026_XMEMPLLCTRL);
+	outTi3026(minfo, TVP3026_XMEMPLLCTRL, mclk_ctl & 0xE7);
+	outTi3026(minfo, TVP3026_XMEMPLLCTRL, (mclk_ctl & 0xE7) | TVP3026_XMEMPLLCTRL_STROBEMKC4);
 
 	/* stop MCLK */
-	outTi3026(PMINFO TVP3026_XPLLADDR, 0xFB);
-	outTi3026(PMINFO TVP3026_XMEMPLLDATA, 0x00);
+	outTi3026(minfo, TVP3026_XPLLADDR, 0xFB);
+	outTi3026(minfo, TVP3026_XMEMPLLDATA, 0x00);
 
 	/* set mclk to new freq */
-	outTi3026(PMINFO TVP3026_XPLLADDR, 0xF3);
-	outTi3026(PMINFO TVP3026_XMEMPLLDATA, mclk_n | 0xC0);
-	outTi3026(PMINFO TVP3026_XMEMPLLDATA, mclk_m);
-	outTi3026(PMINFO TVP3026_XMEMPLLDATA, mclk_p | 0xB0);
+	outTi3026(minfo, TVP3026_XPLLADDR, 0xF3);
+	outTi3026(minfo, TVP3026_XMEMPLLDATA, mclk_n | 0xC0);
+	outTi3026(minfo, TVP3026_XMEMPLLDATA, mclk_m);
+	outTi3026(minfo, TVP3026_XMEMPLLDATA, mclk_p | 0xB0);
 
 	/* wait for PLL to lock */
 	for (tmout = 500000; tmout; tmout--) {
-		if (inTi3026(PMINFO TVP3026_XMEMPLLDATA) & 0x40)
+		if (inTi3026(minfo, TVP3026_XMEMPLLDATA) & 0x40)
 			break;
 		udelay(10);
 	}
@@ -496,7 +502,7 @@
 		printk(KERN_ERR "matroxfb: Memory PLL not locked after 5 secs\n");
 
 	f_pll = f_pll * 333 / (10000 << mclk_p);
-	if (isMilleniumII(MINFO)) {
+	if (isMilleniumII(minfo)) {
 		rfhcnt = (f_pll - 128) / 256;
 		if (rfhcnt > 15)
 			rfhcnt = 15;
@@ -505,26 +511,26 @@
 		if (rfhcnt > 15)
 			rfhcnt = 0;
 	}
-	ACCESS_FBINFO(hw).MXoptionReg = (ACCESS_FBINFO(hw).MXoptionReg & ~0x000F0000) | (rfhcnt << 16);
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+	minfo->hw.MXoptionReg = (minfo->hw.MXoptionReg & ~0x000F0000) | (rfhcnt << 16);
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, minfo->hw.MXoptionReg);
 
 	/* output MCLK to MCLK pin */
-	outTi3026(PMINFO TVP3026_XMEMPLLCTRL, (mclk_ctl & 0xE7) | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL);
-	outTi3026(PMINFO TVP3026_XMEMPLLCTRL, (mclk_ctl       ) | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL | TVP3026_XMEMPLLCTRL_STROBEMKC4);
+	outTi3026(minfo, TVP3026_XMEMPLLCTRL, (mclk_ctl & 0xE7) | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL);
+	outTi3026(minfo, TVP3026_XMEMPLLCTRL, (mclk_ctl       ) | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL | TVP3026_XMEMPLLCTRL_STROBEMKC4);
 
 	/* stop PCLK */
-	outTi3026(PMINFO TVP3026_XPLLADDR, 0xFE);
-	outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0x00);
+	outTi3026(minfo, TVP3026_XPLLADDR, 0xFE);
+	outTi3026(minfo, TVP3026_XPIXPLLDATA, 0x00);
 
 	/* restore pclk */
-	outTi3026(PMINFO TVP3026_XPLLADDR, 0xFC);
-	outTi3026(PMINFO TVP3026_XPIXPLLDATA, pclk_n);
-	outTi3026(PMINFO TVP3026_XPIXPLLDATA, pclk_m);
-	outTi3026(PMINFO TVP3026_XPIXPLLDATA, pclk_p);
+	outTi3026(minfo, TVP3026_XPLLADDR, 0xFC);
+	outTi3026(minfo, TVP3026_XPIXPLLDATA, pclk_n);
+	outTi3026(minfo, TVP3026_XPIXPLLDATA, pclk_m);
+	outTi3026(minfo, TVP3026_XPIXPLLDATA, pclk_p);
 
 	/* wait for PLL to lock */
 	for (tmout = 500000; tmout; tmout--) {
-		if (inTi3026(PMINFO TVP3026_XPIXPLLDATA) & 0x40)
+		if (inTi3026(minfo, TVP3026_XPIXPLLDATA) & 0x40)
 			break;
 		udelay(10);
 	}
@@ -532,26 +538,27 @@
 		printk(KERN_ERR "matroxfb: Pixel PLL not locked after 5 secs\n");
 }
 
-static void ti3026_ramdac_init(WPMINFO2) {
-
+static void ti3026_ramdac_init(struct matrox_fb_info *minfo)
+{
 	DBG(__func__)
 
-	ACCESS_FBINFO(features.pll.vco_freq_min) = 110000;
-	ACCESS_FBINFO(features.pll.ref_freq)	 = 114545;
-	ACCESS_FBINFO(features.pll.feed_div_min) = 2;
-	ACCESS_FBINFO(features.pll.feed_div_max) = 24;
-	ACCESS_FBINFO(features.pll.in_div_min)	 = 2;
-	ACCESS_FBINFO(features.pll.in_div_max)	 = 63;
-	ACCESS_FBINFO(features.pll.post_shift_max) = 3;
-	if (ACCESS_FBINFO(devflags.noinit))
+	minfo->features.pll.vco_freq_min = 110000;
+	minfo->features.pll.ref_freq	 = 114545;
+	minfo->features.pll.feed_div_min = 2;
+	minfo->features.pll.feed_div_max = 24;
+	minfo->features.pll.in_div_min	 = 2;
+	minfo->features.pll.in_div_max	 = 63;
+	minfo->features.pll.post_shift_max = 3;
+	if (minfo->devflags.noinit)
 		return;
-	ti3026_setMCLK(PMINFO 60000);
+	ti3026_setMCLK(minfo, 60000);
 }
 
-static void Ti3026_restore(WPMINFO2) {
+static void Ti3026_restore(struct matrox_fb_info *minfo)
+{
 	int i;
 	unsigned char progdac[6];
-	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+	struct matrox_hw_state *hw = &minfo->hw;
 	CRITFLAGS
 
 	DBG(__func__)
@@ -565,31 +572,31 @@
 
 	CRITBEGIN
 
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
 
 	CRITEND
 
-	matroxfb_vgaHWrestore(PMINFO2);
+	matroxfb_vgaHWrestore(minfo);
 
 	CRITBEGIN
 
-	ACCESS_FBINFO(crtc1.panpos) = -1;
+	minfo->crtc1.panpos = -1;
 	for (i = 0; i < 6; i++)
 		mga_setr(M_EXTVGA_INDEX, i, hw->CRTCEXT[i]);
 
 	for (i = 0; i < 21; i++) {
-		outTi3026(PMINFO DACseq[i], hw->DACreg[i]);
+		outTi3026(minfo, DACseq[i], hw->DACreg[i]);
 	}
 
-	outTi3026(PMINFO TVP3026_XPLLADDR, 0x00);
-	progdac[0] = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
-	progdac[3] = inTi3026(PMINFO TVP3026_XLOOPPLLDATA);
-	outTi3026(PMINFO TVP3026_XPLLADDR, 0x15);
-	progdac[1] = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
-	progdac[4] = inTi3026(PMINFO TVP3026_XLOOPPLLDATA);
-	outTi3026(PMINFO TVP3026_XPLLADDR, 0x2A);
-	progdac[2] = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
-	progdac[5] = inTi3026(PMINFO TVP3026_XLOOPPLLDATA);
+	outTi3026(minfo, TVP3026_XPLLADDR, 0x00);
+	progdac[0] = inTi3026(minfo, TVP3026_XPIXPLLDATA);
+	progdac[3] = inTi3026(minfo, TVP3026_XLOOPPLLDATA);
+	outTi3026(minfo, TVP3026_XPLLADDR, 0x15);
+	progdac[1] = inTi3026(minfo, TVP3026_XPIXPLLDATA);
+	progdac[4] = inTi3026(minfo, TVP3026_XLOOPPLLDATA);
+	outTi3026(minfo, TVP3026_XPLLADDR, 0x2A);
+	progdac[2] = inTi3026(minfo, TVP3026_XPIXPLLDATA);
+	progdac[5] = inTi3026(minfo, TVP3026_XLOOPPLLDATA);
 
 	CRITEND
 	if (memcmp(hw->DACclk, progdac, 6)) {
@@ -598,20 +605,20 @@
 		/* Maybe even we should call schedule() ? */
 
 		CRITBEGIN
-		outTi3026(PMINFO TVP3026_XCLKCTRL, hw->DACreg[POS3026_XCLKCTRL]);
-		outTi3026(PMINFO TVP3026_XPLLADDR, 0x2A);
-		outTi3026(PMINFO TVP3026_XLOOPPLLDATA, 0);
-		outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0);
+		outTi3026(minfo, TVP3026_XCLKCTRL, hw->DACreg[POS3026_XCLKCTRL]);
+		outTi3026(minfo, TVP3026_XPLLADDR, 0x2A);
+		outTi3026(minfo, TVP3026_XLOOPPLLDATA, 0);
+		outTi3026(minfo, TVP3026_XPIXPLLDATA, 0);
 
-		outTi3026(PMINFO TVP3026_XPLLADDR, 0x00);
+		outTi3026(minfo, TVP3026_XPLLADDR, 0x00);
 		for (i = 0; i < 3; i++)
-			outTi3026(PMINFO TVP3026_XPIXPLLDATA, hw->DACclk[i]);
+			outTi3026(minfo, TVP3026_XPIXPLLDATA, hw->DACclk[i]);
 		/* wait for PLL only if PLL clock requested (always for PowerMode, never for VGA) */
 		if (hw->MiscOutReg & 0x08) {
 			int tmout;
-			outTi3026(PMINFO TVP3026_XPLLADDR, 0x3F);
+			outTi3026(minfo, TVP3026_XPLLADDR, 0x3F);
 			for (tmout = 500000; tmout; --tmout) {
-				if (inTi3026(PMINFO TVP3026_XPIXPLLDATA) & 0x40)
+				if (inTi3026(minfo, TVP3026_XPIXPLLDATA) & 0x40)
 					break;
 				udelay(10);
 			}
@@ -624,18 +631,18 @@
 				dprintk(KERN_INFO "PixelPLL: %d\n", 500000-tmout);
 			CRITBEGIN
 		}
-		outTi3026(PMINFO TVP3026_XMEMPLLCTRL, hw->DACreg[POS3026_XMEMPLLCTRL]);
-		outTi3026(PMINFO TVP3026_XPLLADDR, 0x00);
+		outTi3026(minfo, TVP3026_XMEMPLLCTRL, hw->DACreg[POS3026_XMEMPLLCTRL]);
+		outTi3026(minfo, TVP3026_XPLLADDR, 0x00);
 		for (i = 3; i < 6; i++)
-			outTi3026(PMINFO TVP3026_XLOOPPLLDATA, hw->DACclk[i]);
+			outTi3026(minfo, TVP3026_XLOOPPLLDATA, hw->DACclk[i]);
 		CRITEND
 		if ((hw->MiscOutReg & 0x08) && ((hw->DACclk[5] & 0x80) == 0x80)) {
 			int tmout;
 
 			CRITBEGIN
-			outTi3026(PMINFO TVP3026_XPLLADDR, 0x3F);
+			outTi3026(minfo, TVP3026_XPLLADDR, 0x3F);
 			for (tmout = 500000; tmout; --tmout) {
-				if (inTi3026(PMINFO TVP3026_XLOOPPLLDATA) & 0x40)
+				if (inTi3026(minfo, TVP3026_XLOOPPLLDATA) & 0x40)
 					break;
 				udelay(10);
 			}
@@ -660,65 +667,66 @@
 #endif
 }
 
-static void Ti3026_reset(WPMINFO2) {
-
+static void Ti3026_reset(struct matrox_fb_info *minfo)
+{
 	DBG(__func__)
 
-	ti3026_ramdac_init(PMINFO2);
+	ti3026_ramdac_init(minfo);
 }
 
 static struct matrox_altout ti3026_output = {
 	.name	 = "Primary output",
 };
 
-static int Ti3026_preinit(WPMINFO2) {
+static int Ti3026_preinit(struct matrox_fb_info *minfo)
+{
 	static const int vxres_mill2[] = { 512,        640, 768,  800,  832,  960,
 					  1024, 1152, 1280,      1600, 1664, 1920,
 					  2048, 0};
 	static const int vxres_mill1[] = {             640, 768,  800,        960,
 					  1024, 1152, 1280,      1600,       1920,
 					  2048, 0};
-	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+	struct matrox_hw_state *hw = &minfo->hw;
 
 	DBG(__func__)
 
-	ACCESS_FBINFO(millenium) = 1;
-	ACCESS_FBINFO(milleniumII) = (ACCESS_FBINFO(pcidev)->device != PCI_DEVICE_ID_MATROX_MIL);
-	ACCESS_FBINFO(capable.cfb4) = 1;
-	ACCESS_FBINFO(capable.text) = 1; /* isMilleniumII(MINFO); */
-	ACCESS_FBINFO(capable.vxres) = isMilleniumII(MINFO)?vxres_mill2:vxres_mill1;
+	minfo->millenium = 1;
+	minfo->milleniumII = (minfo->pcidev->device != PCI_DEVICE_ID_MATROX_MIL);
+	minfo->capable.cfb4 = 1;
+	minfo->capable.text = 1; /* isMilleniumII(minfo); */
+	minfo->capable.vxres = isMilleniumII(minfo) ? vxres_mill2 : vxres_mill1;
 
-	ACCESS_FBINFO(outputs[0]).data = MINFO;
-	ACCESS_FBINFO(outputs[0]).output = &ti3026_output;
-	ACCESS_FBINFO(outputs[0]).src = ACCESS_FBINFO(outputs[0]).default_src;
-	ACCESS_FBINFO(outputs[0]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+	minfo->outputs[0].data = minfo;
+	minfo->outputs[0].output = &ti3026_output;
+	minfo->outputs[0].src = minfo->outputs[0].default_src;
+	minfo->outputs[0].mode = MATROXFB_OUTPUT_MODE_MONITOR;
 
-	if (ACCESS_FBINFO(devflags.noinit))
+	if (minfo->devflags.noinit)
 		return 0;
 	/* preserve VGA I/O, BIOS and PPC */
 	hw->MXoptionReg &= 0xC0000100;
 	hw->MXoptionReg |= 0x002C0000;
-	if (ACCESS_FBINFO(devflags.novga))
+	if (minfo->devflags.novga)
 		hw->MXoptionReg &= ~0x00000100;
-	if (ACCESS_FBINFO(devflags.nobios))
+	if (minfo->devflags.nobios)
 		hw->MXoptionReg &= ~0x40000000;
-	if (ACCESS_FBINFO(devflags.nopciretry))
+	if (minfo->devflags.nopciretry)
 		hw->MXoptionReg |=  0x20000000;
-	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+	pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, hw->MXoptionReg);
 
-	ACCESS_FBINFO(accel.ramdac_rev) = inTi3026(PMINFO TVP3026_XSILICONREV);
+	minfo->accel.ramdac_rev = inTi3026(minfo, TVP3026_XSILICONREV);
 
-	outTi3026(PMINFO TVP3026_XCLKCTRL, TVP3026_XCLKCTRL_SRC_CLK0VGA | TVP3026_XCLKCTRL_CLKSTOPPED);
-	outTi3026(PMINFO TVP3026_XTRUECOLORCTRL, TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR);
-	outTi3026(PMINFO TVP3026_XMUXCTRL, TVP3026_XMUXCTRL_VGA);
+	outTi3026(minfo, TVP3026_XCLKCTRL, TVP3026_XCLKCTRL_SRC_CLK0VGA | TVP3026_XCLKCTRL_CLKSTOPPED);
+	outTi3026(minfo, TVP3026_XTRUECOLORCTRL, TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR);
+	outTi3026(minfo, TVP3026_XMUXCTRL, TVP3026_XMUXCTRL_VGA);
 
-	outTi3026(PMINFO TVP3026_XPLLADDR, 0x2A);
-	outTi3026(PMINFO TVP3026_XLOOPPLLDATA, 0x00);
-	outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0x00);
+	outTi3026(minfo, TVP3026_XPLLADDR, 0x2A);
+	outTi3026(minfo, TVP3026_XLOOPPLLDATA, 0x00);
+	outTi3026(minfo, TVP3026_XPIXPLLDATA, 0x00);
 
 	mga_outb(M_MISC_REG, 0x67);
 
-	outTi3026(PMINFO TVP3026_XMEMPLLCTRL, TVP3026_XMEMPLLCTRL_STROBEMKC4 | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL);
+	outTi3026(minfo, TVP3026_XMEMPLLCTRL, TVP3026_XMEMPLLCTRL_STROBEMKC4 | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL);
 
 	mga_outl(M_RESET, 1);
 	udelay(250);
diff --git a/drivers/video/matrox/matroxfb_accel.c b/drivers/video/matrox/matroxfb_accel.c
index 9c3aeee..8335a6fe 100644
--- a/drivers/video/matrox/matroxfb_accel.c
+++ b/drivers/video/matrox/matroxfb_accel.c
@@ -81,7 +81,7 @@
 #include "matroxfb_Ti3026.h"
 #include "matroxfb_misc.h"
 
-#define curr_ydstorg(x)	ACCESS_FBINFO2(x, curr.ydstorg.pixels)
+#define curr_ydstorg(x)	((x)->curr.ydstorg.pixels)
 
 #define mga_ydstlen(y,l) mga_outl(M_YDSTLEN | M_EXEC, ((y) << 16) | (l))
 
@@ -107,7 +107,8 @@
 static void matroxfb_cfb4_fillrect(struct fb_info* info, const struct fb_fillrect* rect);
 static void matroxfb_cfb4_copyarea(struct fb_info* info, const struct fb_copyarea* area);
 
-void matrox_cfbX_init(WPMINFO2) {
+void matrox_cfbX_init(struct matrox_fb_info *minfo)
+{
 	u_int32_t maccess;
 	u_int32_t mpitch;
 	u_int32_t mopmode;
@@ -115,59 +116,59 @@
 
 	DBG(__func__)
 
-	mpitch = ACCESS_FBINFO(fbcon).var.xres_virtual;
+	mpitch = minfo->fbcon.var.xres_virtual;
 
-	ACCESS_FBINFO(fbops).fb_copyarea = cfb_copyarea;
-	ACCESS_FBINFO(fbops).fb_fillrect = cfb_fillrect;
-	ACCESS_FBINFO(fbops).fb_imageblit = cfb_imageblit;
-	ACCESS_FBINFO(fbops).fb_cursor = NULL;
+	minfo->fbops.fb_copyarea = cfb_copyarea;
+	minfo->fbops.fb_fillrect = cfb_fillrect;
+	minfo->fbops.fb_imageblit = cfb_imageblit;
+	minfo->fbops.fb_cursor = NULL;
 
-	accel = (ACCESS_FBINFO(fbcon).var.accel_flags & FB_ACCELF_TEXT) == FB_ACCELF_TEXT;
+	accel = (minfo->fbcon.var.accel_flags & FB_ACCELF_TEXT) == FB_ACCELF_TEXT;
 
-	switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+	switch (minfo->fbcon.var.bits_per_pixel) {
 		case 4:		maccess = 0x00000000;	/* accelerate as 8bpp video */
 				mpitch = (mpitch >> 1) | 0x8000; /* disable linearization */
 				mopmode = M_OPMODE_4BPP;
-				matrox_cfb4_pal(ACCESS_FBINFO(cmap));
+				matrox_cfb4_pal(minfo->cmap);
 				if (accel && !(mpitch & 1)) {
-					ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_cfb4_copyarea;
-					ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_cfb4_fillrect;
+					minfo->fbops.fb_copyarea = matroxfb_cfb4_copyarea;
+					minfo->fbops.fb_fillrect = matroxfb_cfb4_fillrect;
 				}
 				break;
 		case 8:		maccess = 0x00000000;
 				mopmode = M_OPMODE_8BPP;
-				matrox_cfb8_pal(ACCESS_FBINFO(cmap));
+				matrox_cfb8_pal(minfo->cmap);
 				if (accel) {
-					ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_copyarea;
-					ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_fillrect;
-					ACCESS_FBINFO(fbops).fb_imageblit = matroxfb_imageblit;
+					minfo->fbops.fb_copyarea = matroxfb_copyarea;
+					minfo->fbops.fb_fillrect = matroxfb_fillrect;
+					minfo->fbops.fb_imageblit = matroxfb_imageblit;
 				}
 				break;
-		case 16:	if (ACCESS_FBINFO(fbcon).var.green.length == 5)
+		case 16:	if (minfo->fbcon.var.green.length == 5)
 					maccess = 0xC0000001;
 				else
 					maccess = 0x40000001;
 				mopmode = M_OPMODE_16BPP;
 				if (accel) {
-					ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_copyarea;
-					ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_fillrect;
-					ACCESS_FBINFO(fbops).fb_imageblit = matroxfb_imageblit;
+					minfo->fbops.fb_copyarea = matroxfb_copyarea;
+					minfo->fbops.fb_fillrect = matroxfb_fillrect;
+					minfo->fbops.fb_imageblit = matroxfb_imageblit;
 				}
 				break;
 		case 24:	maccess = 0x00000003;
 				mopmode = M_OPMODE_24BPP;
 				if (accel) {
-					ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_copyarea;
-					ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_fillrect;
-					ACCESS_FBINFO(fbops).fb_imageblit = matroxfb_imageblit;
+					minfo->fbops.fb_copyarea = matroxfb_copyarea;
+					minfo->fbops.fb_fillrect = matroxfb_fillrect;
+					minfo->fbops.fb_imageblit = matroxfb_imageblit;
 				}
 				break;
 		case 32:	maccess = 0x00000002;
 				mopmode = M_OPMODE_32BPP;
 				if (accel) {
-					ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_copyarea;
-					ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_fillrect;
-					ACCESS_FBINFO(fbops).fb_imageblit = matroxfb_imageblit;
+					minfo->fbops.fb_copyarea = matroxfb_copyarea;
+					minfo->fbops.fb_fillrect = matroxfb_fillrect;
+					minfo->fbops.fb_imageblit = matroxfb_imageblit;
 				}
 				break;
 		default:	maccess = 0x00000000;
@@ -176,10 +177,10 @@
 	}
 	mga_fifo(8);
 	mga_outl(M_PITCH, mpitch);
-	mga_outl(M_YDSTORG, curr_ydstorg(MINFO));
-	if (ACCESS_FBINFO(capable.plnwt))
+	mga_outl(M_YDSTORG, curr_ydstorg(minfo));
+	if (minfo->capable.plnwt)
 		mga_outl(M_PLNWT, -1);
-	if (ACCESS_FBINFO(capable.srcorg)) {
+	if (minfo->capable.srcorg) {
 		mga_outl(M_SRCORG, 0);
 		mga_outl(M_DSTORG, 0);
 	}
@@ -188,14 +189,16 @@
 	mga_outl(M_YTOP, 0);
 	mga_outl(M_YBOT, 0x01FFFFFF);
 	mga_outl(M_MACCESS, maccess);
-	ACCESS_FBINFO(accel.m_dwg_rect) = M_DWG_TRAP | M_DWG_SOLID | M_DWG_ARZERO | M_DWG_SGNZERO | M_DWG_SHIFTZERO;
-	if (isMilleniumII(MINFO)) ACCESS_FBINFO(accel.m_dwg_rect) |= M_DWG_TRANSC;
-	ACCESS_FBINFO(accel.m_opmode) = mopmode;
+	minfo->accel.m_dwg_rect = M_DWG_TRAP | M_DWG_SOLID | M_DWG_ARZERO | M_DWG_SGNZERO | M_DWG_SHIFTZERO;
+	if (isMilleniumII(minfo)) minfo->accel.m_dwg_rect |= M_DWG_TRANSC;
+	minfo->accel.m_opmode = mopmode;
 }
 
 EXPORT_SYMBOL(matrox_cfbX_init);
 
-static void matrox_accel_bmove(WPMINFO int vxres, int sy, int sx, int dy, int dx, int height, int width) {
+static void matrox_accel_bmove(struct matrox_fb_info *minfo, int vxres, int sy,
+			       int sx, int dy, int dx, int height, int width)
+{
 	int start, end;
 	CRITFLAGS
 
@@ -209,7 +212,7 @@
 			 M_DWG_BFCOL | M_DWG_REPLACE);
 		mga_outl(M_AR5, vxres);
 		width--;
-		start = sy*vxres+sx+curr_ydstorg(MINFO);
+		start = sy*vxres+sx+curr_ydstorg(minfo);
 		end = start+width;
 	} else {
 		mga_fifo(3);
@@ -217,7 +220,7 @@
 		mga_outl(M_SGN, 5);
 		mga_outl(M_AR5, -vxres);
 		width--;
-		end = (sy+height-1)*vxres+sx+curr_ydstorg(MINFO);
+		end = (sy+height-1)*vxres+sx+curr_ydstorg(minfo);
 		start = end+width;
 		dy += height-1;
 	}
@@ -231,7 +234,10 @@
 	CRITEND
 }
 
-static void matrox_accel_bmove_lin(WPMINFO int vxres, int sy, int sx, int dy, int dx, int height, int width) {
+static void matrox_accel_bmove_lin(struct matrox_fb_info *minfo, int vxres,
+				   int sy, int sx, int dy, int dx, int height,
+				   int width)
+{
 	int start, end;
 	CRITFLAGS
 
@@ -245,7 +251,7 @@
 			M_DWG_BFCOL | M_DWG_REPLACE);
 		mga_outl(M_AR5, vxres);
 		width--;
-		start = sy*vxres+sx+curr_ydstorg(MINFO);
+		start = sy*vxres+sx+curr_ydstorg(minfo);
 		end = start+width;
 	} else {
 		mga_fifo(3);
@@ -253,7 +259,7 @@
 		mga_outl(M_SGN, 5);
 		mga_outl(M_AR5, -vxres);
 		width--;
-		end = (sy+height-1)*vxres+sx+curr_ydstorg(MINFO);
+		end = (sy+height-1)*vxres+sx+curr_ydstorg(minfo);
 		start = end+width;
 		dy += height-1;
 	}
@@ -269,22 +275,23 @@
 }
 
 static void matroxfb_cfb4_copyarea(struct fb_info* info, const struct fb_copyarea* area) {
-	MINFO_FROM_INFO(info);
+	struct matrox_fb_info *minfo = info2minfo(info);
 
 	if ((area->sx | area->dx | area->width) & 1)
 		cfb_copyarea(info, area);
 	else
-		matrox_accel_bmove_lin(PMINFO ACCESS_FBINFO(fbcon.var.xres_virtual) >> 1, area->sy, area->sx >> 1, area->dy, area->dx >> 1, area->height, area->width >> 1);
+		matrox_accel_bmove_lin(minfo, minfo->fbcon.var.xres_virtual >> 1, area->sy, area->sx >> 1, area->dy, area->dx >> 1, area->height, area->width >> 1);
 }
 
 static void matroxfb_copyarea(struct fb_info* info, const struct fb_copyarea* area) {
-	MINFO_FROM_INFO(info);
+	struct matrox_fb_info *minfo = info2minfo(info);
 
-	matrox_accel_bmove(PMINFO ACCESS_FBINFO(fbcon.var.xres_virtual), area->sy, area->sx, area->dy, area->dx, area->height, area->width);
+	matrox_accel_bmove(minfo, minfo->fbcon.var.xres_virtual, area->sy, area->sx, area->dy, area->dx, area->height, area->width);
 }
 
-static void matroxfb_accel_clear(WPMINFO u_int32_t color, int sy, int sx, int height,
-		int width) {
+static void matroxfb_accel_clear(struct matrox_fb_info *minfo, u_int32_t color,
+				 int sy, int sx, int height, int width)
+{
 	CRITFLAGS
 
 	DBG(__func__)
@@ -292,7 +299,7 @@
 	CRITBEGIN
 
 	mga_fifo(5);
-	mga_outl(M_DWGCTL, ACCESS_FBINFO(accel.m_dwg_rect) | M_DWG_REPLACE);
+	mga_outl(M_DWGCTL, minfo->accel.m_dwg_rect | M_DWG_REPLACE);
 	mga_outl(M_FCOL, color);
 	mga_outl(M_FXBNDRY, ((sx + width) << 16) | sx);
 	mga_ydstlen(sy, height);
@@ -302,16 +309,18 @@
 }
 
 static void matroxfb_fillrect(struct fb_info* info, const struct fb_fillrect* rect) {
-	MINFO_FROM_INFO(info);
+	struct matrox_fb_info *minfo = info2minfo(info);
 
 	switch (rect->rop) {
 		case ROP_COPY:
-			matroxfb_accel_clear(PMINFO ((u_int32_t*)info->pseudo_palette)[rect->color], rect->dy, rect->dx, rect->height, rect->width);
+			matroxfb_accel_clear(minfo, ((u_int32_t *)info->pseudo_palette)[rect->color], rect->dy, rect->dx, rect->height, rect->width);
 			break;
 	}
 }
 
-static void matroxfb_cfb4_clear(WPMINFO u_int32_t bgx, int sy, int sx, int height, int width) {
+static void matroxfb_cfb4_clear(struct matrox_fb_info *minfo, u_int32_t bgx,
+				int sy, int sx, int height, int width)
+{
 	int whattodo;
 	CRITFLAGS
 
@@ -333,16 +342,16 @@
 	sx >>= 1;
 	if (width) {
 		mga_fifo(5);
-		mga_outl(M_DWGCTL, ACCESS_FBINFO(accel.m_dwg_rect) | M_DWG_REPLACE2);
+		mga_outl(M_DWGCTL, minfo->accel.m_dwg_rect | M_DWG_REPLACE2);
 		mga_outl(M_FCOL, bgx);
 		mga_outl(M_FXBNDRY, ((sx + width) << 16) | sx);
-		mga_outl(M_YDST, sy * ACCESS_FBINFO(fbcon).var.xres_virtual >> 6);
+		mga_outl(M_YDST, sy * minfo->fbcon.var.xres_virtual >> 6);
 		mga_outl(M_LEN | M_EXEC, height);
 		WaitTillIdle();
 	}
 	if (whattodo) {
-		u_int32_t step = ACCESS_FBINFO(fbcon).var.xres_virtual >> 1;
-		vaddr_t vbase = ACCESS_FBINFO(video.vbase);
+		u_int32_t step = minfo->fbcon.var.xres_virtual >> 1;
+		vaddr_t vbase = minfo->video.vbase;
 		if (whattodo & 1) {
 			unsigned int uaddr = sy * step + sx - 1;
 			u_int32_t loop;
@@ -367,17 +376,19 @@
 }
 
 static void matroxfb_cfb4_fillrect(struct fb_info* info, const struct fb_fillrect* rect) {
-	MINFO_FROM_INFO(info);
+	struct matrox_fb_info *minfo = info2minfo(info);
 
 	switch (rect->rop) {
 		case ROP_COPY:
-			matroxfb_cfb4_clear(PMINFO ((u_int32_t*)info->pseudo_palette)[rect->color], rect->dy, rect->dx, rect->height, rect->width);
+			matroxfb_cfb4_clear(minfo, ((u_int32_t *)info->pseudo_palette)[rect->color], rect->dy, rect->dx, rect->height, rect->width);
 			break;
 	}
 }
 
-static void matroxfb_1bpp_imageblit(WPMINFO u_int32_t fgx, u_int32_t bgx,
-		const u_int8_t* chardata, int width, int height, int yy, int xx) {
+static void matroxfb_1bpp_imageblit(struct matrox_fb_info *minfo, u_int32_t fgx,
+				    u_int32_t bgx, const u_int8_t *chardata,
+				    int width, int height, int yy, int xx)
+{
 	u_int32_t step;
 	u_int32_t ydstlen;
 	u_int32_t xlen;
@@ -412,7 +423,7 @@
 	mga_outl(M_FCOL, fgx);
 	mga_outl(M_BCOL, bgx);
 	fxbndry = ((xx + width - 1) << 16) | xx;
-	mmio = ACCESS_FBINFO(mmio.vbase);
+	mmio = minfo->mmio.vbase;
 
 	mga_fifo(6);
 	mga_writel(mmio, M_FXBNDRY, fxbndry);
@@ -467,7 +478,7 @@
 
 
 static void matroxfb_imageblit(struct fb_info* info, const struct fb_image* image) {
-	MINFO_FROM_INFO(info);
+	struct matrox_fb_info *minfo = info2minfo(info);
 
 	DBG_HEAVY(__func__);
 
@@ -476,7 +487,7 @@
 
 		fgx = ((u_int32_t*)info->pseudo_palette)[image->fg_color];
 		bgx = ((u_int32_t*)info->pseudo_palette)[image->bg_color];
-		matroxfb_1bpp_imageblit(PMINFO fgx, bgx, image->data, image->width, image->height, image->dy, image->dx);
+		matroxfb_1bpp_imageblit(minfo, fgx, bgx, image->data, image->width, image->height, image->dy, image->dx);
 	} else {
 		/* Danger! image->depth is useless: logo painting code always
 		   passes framebuffer color depth here, although logo data are
diff --git a/drivers/video/matrox/matroxfb_accel.h b/drivers/video/matrox/matroxfb_accel.h
index f40c314..1e418e62 100644
--- a/drivers/video/matrox/matroxfb_accel.h
+++ b/drivers/video/matrox/matroxfb_accel.h
@@ -3,6 +3,6 @@
 
 #include "matroxfb_base.h"
 
-void matrox_cfbX_init(WPMINFO2);
+void matrox_cfbX_init(struct matrox_fb_info *minfo);
 
 #endif
diff --git a/drivers/video/matrox/matroxfb_base.c b/drivers/video/matrox/matroxfb_base.c
index 0c1049b..7064fb4 100644
--- a/drivers/video/matrox/matroxfb_base.c
+++ b/drivers/video/matrox/matroxfb_base.c
@@ -154,21 +154,22 @@
 
 
 /* --------------------------------------------------------------------- */
-static void update_crtc2(WPMINFO unsigned int pos) {
-	struct matroxfb_dh_fb_info* info = ACCESS_FBINFO(crtc2.info);
+static void update_crtc2(struct matrox_fb_info *minfo, unsigned int pos)
+{
+	struct matroxfb_dh_fb_info *info = minfo->crtc2.info;
 
 	/* Make sure that displays are compatible */
-	if (info && (info->fbcon.var.bits_per_pixel == ACCESS_FBINFO(fbcon).var.bits_per_pixel)
-		 && (info->fbcon.var.xres_virtual == ACCESS_FBINFO(fbcon).var.xres_virtual)
-		 && (info->fbcon.var.green.length == ACCESS_FBINFO(fbcon).var.green.length)
+	if (info && (info->fbcon.var.bits_per_pixel == minfo->fbcon.var.bits_per_pixel)
+		 && (info->fbcon.var.xres_virtual == minfo->fbcon.var.xres_virtual)
+		 && (info->fbcon.var.green.length == minfo->fbcon.var.green.length)
 		 ) {
-		switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+		switch (minfo->fbcon.var.bits_per_pixel) {
 			case 16:
 			case 32:
 				pos = pos * 8;
 				if (info->interlaced) {
 					mga_outl(0x3C2C, pos);
-					mga_outl(0x3C28, pos + ACCESS_FBINFO(fbcon).var.xres_virtual * ACCESS_FBINFO(fbcon).var.bits_per_pixel / 8);
+					mga_outl(0x3C28, pos + minfo->fbcon.var.xres_virtual * minfo->fbcon.var.bits_per_pixel / 8);
 				} else {
 					mga_outl(0x3C28, pos);
 				}
@@ -177,17 +178,18 @@
 	}
 }
 
-static void matroxfb_crtc1_panpos(WPMINFO2) {
-	if (ACCESS_FBINFO(crtc1.panpos) >= 0) {
+static void matroxfb_crtc1_panpos(struct matrox_fb_info *minfo)
+{
+	if (minfo->crtc1.panpos >= 0) {
 		unsigned long flags;
 		int panpos;
 
 		matroxfb_DAC_lock_irqsave(flags);
-		panpos = ACCESS_FBINFO(crtc1.panpos);
+		panpos = minfo->crtc1.panpos;
 		if (panpos >= 0) {
 			unsigned int extvga_reg;
 
-			ACCESS_FBINFO(crtc1.panpos) = -1; /* No update pending anymore */
+			minfo->crtc1.panpos = -1; /* No update pending anymore */
 			extvga_reg = mga_inb(M_EXTVGA_INDEX);
 			mga_setr(M_EXTVGA_INDEX, 0x00, panpos);
 			if (extvga_reg != 0x00) {
@@ -202,39 +204,39 @@
 {
 	u_int32_t status;
 	int handled = 0;
-
-	MINFO_FROM(dev_id);
+	struct matrox_fb_info *minfo = dev_id;
 
 	status = mga_inl(M_STATUS);
 
 	if (status & 0x20) {
 		mga_outl(M_ICLEAR, 0x20);
-		ACCESS_FBINFO(crtc1.vsync.cnt)++;
-		matroxfb_crtc1_panpos(PMINFO2);
-		wake_up_interruptible(&ACCESS_FBINFO(crtc1.vsync.wait));
+		minfo->crtc1.vsync.cnt++;
+		matroxfb_crtc1_panpos(minfo);
+		wake_up_interruptible(&minfo->crtc1.vsync.wait);
 		handled = 1;
 	}
 	if (status & 0x200) {
 		mga_outl(M_ICLEAR, 0x200);
-		ACCESS_FBINFO(crtc2.vsync.cnt)++;
-		wake_up_interruptible(&ACCESS_FBINFO(crtc2.vsync.wait));
+		minfo->crtc2.vsync.cnt++;
+		wake_up_interruptible(&minfo->crtc2.vsync.wait);
 		handled = 1;
 	}
 	return IRQ_RETVAL(handled);
 }
 
-int matroxfb_enable_irq(WPMINFO int reenable) {
+int matroxfb_enable_irq(struct matrox_fb_info *minfo, int reenable)
+{
 	u_int32_t bm;
 
-	if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400)
+	if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG400)
 		bm = 0x220;
 	else
 		bm = 0x020;
 
-	if (!test_and_set_bit(0, &ACCESS_FBINFO(irq_flags))) {
-		if (request_irq(ACCESS_FBINFO(pcidev)->irq, matrox_irq,
-				IRQF_SHARED, "matroxfb", MINFO)) {
-			clear_bit(0, &ACCESS_FBINFO(irq_flags));
+	if (!test_and_set_bit(0, &minfo->irq_flags)) {
+		if (request_irq(minfo->pcidev->irq, matrox_irq,
+				IRQF_SHARED, "matroxfb", minfo)) {
+			clear_bit(0, &minfo->irq_flags);
 			return -EINVAL;
 		}
 		/* Clear any pending field interrupts */
@@ -252,37 +254,39 @@
 	return 0;
 }
 
-static void matroxfb_disable_irq(WPMINFO2) {
-	if (test_and_clear_bit(0, &ACCESS_FBINFO(irq_flags))) {
+static void matroxfb_disable_irq(struct matrox_fb_info *minfo)
+{
+	if (test_and_clear_bit(0, &minfo->irq_flags)) {
 		/* Flush pending pan-at-vbl request... */
-		matroxfb_crtc1_panpos(PMINFO2);
-		if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400)
+		matroxfb_crtc1_panpos(minfo);
+		if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG400)
 			mga_outl(M_IEN, mga_inl(M_IEN) & ~0x220);
 		else
 			mga_outl(M_IEN, mga_inl(M_IEN) & ~0x20);
-		free_irq(ACCESS_FBINFO(pcidev)->irq, MINFO);
+		free_irq(minfo->pcidev->irq, minfo);
 	}
 }
 
-int matroxfb_wait_for_sync(WPMINFO u_int32_t crtc) {
+int matroxfb_wait_for_sync(struct matrox_fb_info *minfo, u_int32_t crtc)
+{
 	struct matrox_vsync *vs;
 	unsigned int cnt;
 	int ret;
 
 	switch (crtc) {
 		case 0:
-			vs = &ACCESS_FBINFO(crtc1.vsync);
+			vs = &minfo->crtc1.vsync;
 			break;
 		case 1:
-			if (ACCESS_FBINFO(devflags.accelerator) != FB_ACCEL_MATROX_MGAG400) {
+			if (minfo->devflags.accelerator != FB_ACCEL_MATROX_MGAG400) {
 				return -ENODEV;
 			}
-			vs = &ACCESS_FBINFO(crtc2.vsync);
+			vs = &minfo->crtc2.vsync;
 			break;
 		default:
 			return -ENODEV;
 	}
-	ret = matroxfb_enable_irq(PMINFO 0);
+	ret = matroxfb_enable_irq(minfo, 0);
 	if (ret) {
 		return ret;
 	}
@@ -293,7 +297,7 @@
 		return ret;
 	}
 	if (ret == 0) {
-		matroxfb_enable_irq(PMINFO 1);
+		matroxfb_enable_irq(minfo, 1);
 		return -ETIMEDOUT;
 	}
 	return 0;
@@ -301,12 +305,12 @@
 
 /* --------------------------------------------------------------------- */
 
-static void matrox_pan_var(WPMINFO struct fb_var_screeninfo *var) {
+static void matrox_pan_var(struct matrox_fb_info *minfo,
+			   struct fb_var_screeninfo *var)
+{
 	unsigned int pos;
 	unsigned short p0, p1, p2;
-#ifdef CONFIG_FB_MATROX_32MB
 	unsigned int p3;
-#endif
 	int vbl;
 	unsigned long flags;
 
@@ -314,47 +318,44 @@
 
 	DBG(__func__)
 
-	if (ACCESS_FBINFO(dead))
+	if (minfo->dead)
 		return;
 
-	ACCESS_FBINFO(fbcon).var.xoffset = var->xoffset;
-	ACCESS_FBINFO(fbcon).var.yoffset = var->yoffset;
-	pos = (ACCESS_FBINFO(fbcon).var.yoffset * ACCESS_FBINFO(fbcon).var.xres_virtual + ACCESS_FBINFO(fbcon).var.xoffset) * ACCESS_FBINFO(curr.final_bppShift) / 32;
-	pos += ACCESS_FBINFO(curr.ydstorg.chunks);
-	p0 = ACCESS_FBINFO(hw).CRTC[0x0D] = pos & 0xFF;
-	p1 = ACCESS_FBINFO(hw).CRTC[0x0C] = (pos & 0xFF00) >> 8;
-	p2 = ACCESS_FBINFO(hw).CRTCEXT[0] = (ACCESS_FBINFO(hw).CRTCEXT[0] & 0xB0) | ((pos >> 16) & 0x0F) | ((pos >> 14) & 0x40);
-#ifdef CONFIG_FB_MATROX_32MB
-	p3 = ACCESS_FBINFO(hw).CRTCEXT[8] = pos >> 21;
-#endif
+	minfo->fbcon.var.xoffset = var->xoffset;
+	minfo->fbcon.var.yoffset = var->yoffset;
+	pos = (minfo->fbcon.var.yoffset * minfo->fbcon.var.xres_virtual + minfo->fbcon.var.xoffset) * minfo->curr.final_bppShift / 32;
+	pos += minfo->curr.ydstorg.chunks;
+	p0 = minfo->hw.CRTC[0x0D] = pos & 0xFF;
+	p1 = minfo->hw.CRTC[0x0C] = (pos & 0xFF00) >> 8;
+	p2 = minfo->hw.CRTCEXT[0] = (minfo->hw.CRTCEXT[0] & 0xB0) | ((pos >> 16) & 0x0F) | ((pos >> 14) & 0x40);
+	p3 = minfo->hw.CRTCEXT[8] = pos >> 21;
 
 	/* FB_ACTIVATE_VBL and we can acquire interrupts? Honor FB_ACTIVATE_VBL then... */
-	vbl = (var->activate & FB_ACTIVATE_VBL) && (matroxfb_enable_irq(PMINFO 0) == 0);
+	vbl = (var->activate & FB_ACTIVATE_VBL) && (matroxfb_enable_irq(minfo, 0) == 0);
 
 	CRITBEGIN
 
 	matroxfb_DAC_lock_irqsave(flags);
 	mga_setr(M_CRTC_INDEX, 0x0D, p0);
 	mga_setr(M_CRTC_INDEX, 0x0C, p1);
-#ifdef CONFIG_FB_MATROX_32MB
-	if (ACCESS_FBINFO(devflags.support32MB))
+	if (minfo->devflags.support32MB)
 		mga_setr(M_EXTVGA_INDEX, 0x08, p3);
-#endif
 	if (vbl) {
-		ACCESS_FBINFO(crtc1.panpos) = p2;
+		minfo->crtc1.panpos = p2;
 	} else {
 		/* Abort any pending change */
-		ACCESS_FBINFO(crtc1.panpos) = -1;
+		minfo->crtc1.panpos = -1;
 		mga_setr(M_EXTVGA_INDEX, 0x00, p2);
 	}
 	matroxfb_DAC_unlock_irqrestore(flags);
 
-	update_crtc2(PMINFO pos);
+	update_crtc2(minfo, pos);
 
 	CRITEND
 }
 
-static void matroxfb_remove(WPMINFO int dummy) {
+static void matroxfb_remove(struct matrox_fb_info *minfo, int dummy)
+{
 	/* Currently we are holding big kernel lock on all dead & usecount updates.
 	 * Destroy everything after all users release it. Especially do not unregister
 	 * framebuffer and iounmap memory, neither fbmem nor fbcon-cfb* does not check
@@ -363,25 +364,23 @@
 	 * write data without causing too much damage...
 	 */
 
-	ACCESS_FBINFO(dead) = 1;
-	if (ACCESS_FBINFO(usecount)) {
+	minfo->dead = 1;
+	if (minfo->usecount) {
 		/* destroy it later */
 		return;
 	}
-	matroxfb_unregister_device(MINFO);
-	unregister_framebuffer(&ACCESS_FBINFO(fbcon));
-	matroxfb_g450_shutdown(PMINFO2);
+	matroxfb_unregister_device(minfo);
+	unregister_framebuffer(&minfo->fbcon);
+	matroxfb_g450_shutdown(minfo);
 #ifdef CONFIG_MTRR
-	if (ACCESS_FBINFO(mtrr.vram_valid))
-		mtrr_del(ACCESS_FBINFO(mtrr.vram), ACCESS_FBINFO(video.base), ACCESS_FBINFO(video.len));
+	if (minfo->mtrr.vram_valid)
+		mtrr_del(minfo->mtrr.vram, minfo->video.base, minfo->video.len);
 #endif
-	mga_iounmap(ACCESS_FBINFO(mmio.vbase));
-	mga_iounmap(ACCESS_FBINFO(video.vbase));
-	release_mem_region(ACCESS_FBINFO(video.base), ACCESS_FBINFO(video.len_maximum));
-	release_mem_region(ACCESS_FBINFO(mmio.base), 16384);
-#ifdef CONFIG_FB_MATROX_MULTIHEAD
+	mga_iounmap(minfo->mmio.vbase);
+	mga_iounmap(minfo->video.vbase);
+	release_mem_region(minfo->video.base, minfo->video.len_maximum);
+	release_mem_region(minfo->mmio.base, 16384);
 	kfree(minfo);
-#endif
 }
 
 	/*
@@ -390,48 +389,50 @@
 
 static int matroxfb_open(struct fb_info *info, int user)
 {
-	MINFO_FROM_INFO(info);
+	struct matrox_fb_info *minfo = info2minfo(info);
 
 	DBG_LOOP(__func__)
 
-	if (ACCESS_FBINFO(dead)) {
+	if (minfo->dead) {
 		return -ENXIO;
 	}
-	ACCESS_FBINFO(usecount)++;
+	minfo->usecount++;
 	if (user) {
-		ACCESS_FBINFO(userusecount)++;
+		minfo->userusecount++;
 	}
 	return(0);
 }
 
 static int matroxfb_release(struct fb_info *info, int user)
 {
-	MINFO_FROM_INFO(info);
+	struct matrox_fb_info *minfo = info2minfo(info);
 
 	DBG_LOOP(__func__)
 
 	if (user) {
-		if (0 == --ACCESS_FBINFO(userusecount)) {
-			matroxfb_disable_irq(PMINFO2);
+		if (0 == --minfo->userusecount) {
+			matroxfb_disable_irq(minfo);
 		}
 	}
-	if (!(--ACCESS_FBINFO(usecount)) && ACCESS_FBINFO(dead)) {
-		matroxfb_remove(PMINFO 0);
+	if (!(--minfo->usecount) && minfo->dead) {
+		matroxfb_remove(minfo, 0);
 	}
 	return(0);
 }
 
 static int matroxfb_pan_display(struct fb_var_screeninfo *var,
 		struct fb_info* info) {
-	MINFO_FROM_INFO(info);
+	struct matrox_fb_info *minfo = info2minfo(info);
 
 	DBG(__func__)
 
-	matrox_pan_var(PMINFO var);
+	matrox_pan_var(minfo, var);
 	return 0;
 }
 
-static int matroxfb_get_final_bppShift(CPMINFO int bpp) {
+static int matroxfb_get_final_bppShift(const struct matrox_fb_info *minfo,
+				       int bpp)
+{
 	int bppshft2;
 
 	DBG(__func__)
@@ -440,14 +441,16 @@
 	if (!bppshft2) {
 		return 8;
 	}
-	if (isInterleave(MINFO))
+	if (isInterleave(minfo))
 		bppshft2 >>= 1;
-	if (ACCESS_FBINFO(devflags.video64bits))
+	if (minfo->devflags.video64bits)
 		bppshft2 >>= 1;
 	return bppshft2;
 }
 
-static int matroxfb_test_and_set_rounding(CPMINFO int xres, int bpp) {
+static int matroxfb_test_and_set_rounding(const struct matrox_fb_info *minfo,
+					  int xres, int bpp)
+{
 	int over;
 	int rounding;
 
@@ -465,11 +468,11 @@
 				break;
 		default:	rounding = 16;
 				/* on G400, 16 really does not work */
-				if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400)
+				if (minfo->devflags.accelerator == FB_ACCEL_MATROX_MGAG400)
 					rounding = 32;
 				break;
 	}
-	if (isInterleave(MINFO)) {
+	if (isInterleave(minfo)) {
 		rounding *= 2;
 	}
 	over = xres % rounding;
@@ -478,7 +481,9 @@
 	return xres;
 }
 
-static int matroxfb_pitch_adjust(CPMINFO int xres, int bpp) {
+static int matroxfb_pitch_adjust(const struct matrox_fb_info *minfo, int xres,
+				 int bpp)
+{
 	const int* width;
 	int xres_new;
 
@@ -486,18 +491,18 @@
 
 	if (!bpp) return xres;
 
-	width = ACCESS_FBINFO(capable.vxres);
+	width = minfo->capable.vxres;
 
-	if (ACCESS_FBINFO(devflags.precise_width)) {
+	if (minfo->devflags.precise_width) {
 		while (*width) {
-			if ((*width >= xres) && (matroxfb_test_and_set_rounding(PMINFO *width, bpp) == *width)) {
+			if ((*width >= xres) && (matroxfb_test_and_set_rounding(minfo, *width, bpp) == *width)) {
 				break;
 			}
 			width++;
 		}
 		xres_new = *width;
 	} else {
-		xres_new = matroxfb_test_and_set_rounding(PMINFO xres, bpp);
+		xres_new = matroxfb_test_and_set_rounding(minfo, xres, bpp);
 	}
 	return xres_new;
 }
@@ -524,7 +529,10 @@
 	return 16;	/* return something reasonable... or panic()? */
 }
 
-static int matroxfb_decode_var(CPMINFO struct fb_var_screeninfo *var, int *visual, int *video_cmap_len, unsigned int* ydstorg) {
+static int matroxfb_decode_var(const struct matrox_fb_info *minfo,
+			       struct fb_var_screeninfo *var, int *visual,
+			       int *video_cmap_len, unsigned int* ydstorg)
+{
 	struct RGBT {
 		unsigned char bpp;
 		struct {
@@ -551,7 +559,7 @@
 	DBG(__func__)
 
 	switch (bpp) {
-		case 4:	 if (!ACCESS_FBINFO(capable.cfb4)) return -EINVAL;
+		case 4:	 if (!minfo->capable.cfb4) return -EINVAL;
 			 break;
 		case 8:	 break;
 		case 16: break;
@@ -560,13 +568,13 @@
 		default: return -EINVAL;
 	}
 	*ydstorg = 0;
-	vramlen = ACCESS_FBINFO(video.len_usable);
+	vramlen = minfo->video.len_usable;
 	if (var->yres_virtual < var->yres)
 		var->yres_virtual = var->yres;
 	if (var->xres_virtual < var->xres)
 		var->xres_virtual = var->xres;
 
-	var->xres_virtual = matroxfb_pitch_adjust(PMINFO var->xres_virtual, bpp);
+	var->xres_virtual = matroxfb_pitch_adjust(minfo, var->xres_virtual, bpp);
 	memlen = var->xres_virtual * bpp * var->yres_virtual / 8;
 	if (memlen > vramlen) {
 		var->yres_virtual = vramlen * 8 / (var->xres_virtual * bpp);
@@ -575,7 +583,7 @@
 	/* There is hardware bug that no line can cross 4MB boundary */
 	/* give up for CFB24, it is impossible to easy workaround it */
 	/* for other try to do something */
-	if (!ACCESS_FBINFO(capable.cross4MB) && (memlen > 0x400000)) {
+	if (!minfo->capable.cross4MB && (memlen > 0x400000)) {
 		if (bpp == 24) {
 			/* sorry */
 		} else {
@@ -644,9 +652,7 @@
 			      unsigned blue, unsigned transp,
 			      struct fb_info *fb_info)
 {
-#ifdef CONFIG_FB_MATROX_MULTIHEAD
 	struct matrox_fb_info* minfo = container_of(fb_info, struct matrox_fb_info, fbcon);
-#endif
 
 	DBG(__func__)
 
@@ -657,20 +663,20 @@
 	 *  != 0 for invalid regno.
 	 */
 
-	if (regno >= ACCESS_FBINFO(curr.cmap_len))
+	if (regno >= minfo->curr.cmap_len)
 		return 1;
 
-	if (ACCESS_FBINFO(fbcon).var.grayscale) {
+	if (minfo->fbcon.var.grayscale) {
 		/* gray = 0.30*R + 0.59*G + 0.11*B */
 		red = green = blue = (red * 77 + green * 151 + blue * 28) >> 8;
 	}
 
-	red = CNVT_TOHW(red, ACCESS_FBINFO(fbcon).var.red.length);
-	green = CNVT_TOHW(green, ACCESS_FBINFO(fbcon).var.green.length);
-	blue = CNVT_TOHW(blue, ACCESS_FBINFO(fbcon).var.blue.length);
-	transp = CNVT_TOHW(transp, ACCESS_FBINFO(fbcon).var.transp.length);
+	red = CNVT_TOHW(red, minfo->fbcon.var.red.length);
+	green = CNVT_TOHW(green, minfo->fbcon.var.green.length);
+	blue = CNVT_TOHW(blue, minfo->fbcon.var.blue.length);
+	transp = CNVT_TOHW(transp, minfo->fbcon.var.transp.length);
 
-	switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+	switch (minfo->fbcon.var.bits_per_pixel) {
 	case 4:
 	case 8:
 		mga_outb(M_DAC_REG, regno);
@@ -683,30 +689,30 @@
 			break;
 		{
 			u_int16_t col =
-				(red << ACCESS_FBINFO(fbcon).var.red.offset)     |
-				(green << ACCESS_FBINFO(fbcon).var.green.offset) |
-				(blue << ACCESS_FBINFO(fbcon).var.blue.offset)   |
-				(transp << ACCESS_FBINFO(fbcon).var.transp.offset); /* for 1:5:5:5 */
-			ACCESS_FBINFO(cmap[regno]) = col | (col << 16);
+				(red << minfo->fbcon.var.red.offset)     |
+				(green << minfo->fbcon.var.green.offset) |
+				(blue << minfo->fbcon.var.blue.offset)   |
+				(transp << minfo->fbcon.var.transp.offset); /* for 1:5:5:5 */
+			minfo->cmap[regno] = col | (col << 16);
 		}
 		break;
 	case 24:
 	case 32:
 		if (regno >= 16)
 			break;
-		ACCESS_FBINFO(cmap[regno]) =
-			(red   << ACCESS_FBINFO(fbcon).var.red.offset)   |
-			(green << ACCESS_FBINFO(fbcon).var.green.offset) |
-			(blue  << ACCESS_FBINFO(fbcon).var.blue.offset)  |
-			(transp << ACCESS_FBINFO(fbcon).var.transp.offset);	/* 8:8:8:8 */
+		minfo->cmap[regno] =
+			(red   << minfo->fbcon.var.red.offset)   |
+			(green << minfo->fbcon.var.green.offset) |
+			(blue  << minfo->fbcon.var.blue.offset)  |
+			(transp << minfo->fbcon.var.transp.offset);	/* 8:8:8:8 */
 		break;
 	}
 	return 0;
 }
 
-static void matroxfb_init_fix(WPMINFO2)
+static void matroxfb_init_fix(struct matrox_fb_info *minfo)
 {
-	struct fb_fix_screeninfo *fix = &ACCESS_FBINFO(fbcon).fix;
+	struct fb_fix_screeninfo *fix = &minfo->fbcon.fix;
 	DBG(__func__)
 
 	strcpy(fix->id,"MATROX");
@@ -714,20 +720,20 @@
 	fix->xpanstep = 8;	/* 8 for 8bpp, 4 for 16bpp, 2 for 32bpp */
 	fix->ypanstep = 1;
 	fix->ywrapstep = 0;
-	fix->mmio_start = ACCESS_FBINFO(mmio.base);
-	fix->mmio_len = ACCESS_FBINFO(mmio.len);
-	fix->accel = ACCESS_FBINFO(devflags.accelerator);
+	fix->mmio_start = minfo->mmio.base;
+	fix->mmio_len = minfo->mmio.len;
+	fix->accel = minfo->devflags.accelerator;
 }
 
-static void matroxfb_update_fix(WPMINFO2)
+static void matroxfb_update_fix(struct matrox_fb_info *minfo)
 {
-	struct fb_fix_screeninfo *fix = &ACCESS_FBINFO(fbcon).fix;
+	struct fb_fix_screeninfo *fix = &minfo->fbcon.fix;
 	DBG(__func__)
 
-	mutex_lock(&ACCESS_FBINFO(fbcon).mm_lock);
-	fix->smem_start = ACCESS_FBINFO(video.base) + ACCESS_FBINFO(curr.ydstorg.bytes);
-	fix->smem_len = ACCESS_FBINFO(video.len_usable) - ACCESS_FBINFO(curr.ydstorg.bytes);
-	mutex_unlock(&ACCESS_FBINFO(fbcon).mm_lock);
+	mutex_lock(&minfo->fbcon.mm_lock);
+	fix->smem_start = minfo->video.base + minfo->curr.ydstorg.bytes;
+	fix->smem_len = minfo->video.len_usable - minfo->curr.ydstorg.bytes;
+	mutex_unlock(&minfo->fbcon.mm_lock);
 }
 
 static int matroxfb_check_var(struct fb_var_screeninfo *var, struct fb_info *info)
@@ -736,12 +742,12 @@
 	int visual;
 	int cmap_len;
 	unsigned int ydstorg;
-	MINFO_FROM_INFO(info);
+	struct matrox_fb_info *minfo = info2minfo(info);
 
-	if (ACCESS_FBINFO(dead)) {
+	if (minfo->dead) {
 		return -ENXIO;
 	}
-	if ((err = matroxfb_decode_var(PMINFO var, &visual, &cmap_len, &ydstorg)) != 0)
+	if ((err = matroxfb_decode_var(minfo, var, &visual, &cmap_len, &ydstorg)) != 0)
 		return err;
 	return 0;
 }
@@ -753,35 +759,35 @@
 	int cmap_len;
 	unsigned int ydstorg;
 	struct fb_var_screeninfo *var;
-	MINFO_FROM_INFO(info);
+	struct matrox_fb_info *minfo = info2minfo(info);
 
 	DBG(__func__)
 
-	if (ACCESS_FBINFO(dead)) {
+	if (minfo->dead) {
 		return -ENXIO;
 	}
 
 	var = &info->var;
-	if ((err = matroxfb_decode_var(PMINFO var, &visual, &cmap_len, &ydstorg)) != 0)
+	if ((err = matroxfb_decode_var(minfo, var, &visual, &cmap_len, &ydstorg)) != 0)
 		return err;
-	ACCESS_FBINFO(fbcon.screen_base) = vaddr_va(ACCESS_FBINFO(video.vbase)) + ydstorg;
-	matroxfb_update_fix(PMINFO2);
-	ACCESS_FBINFO(fbcon).fix.visual = visual;
-	ACCESS_FBINFO(fbcon).fix.type = FB_TYPE_PACKED_PIXELS;
-	ACCESS_FBINFO(fbcon).fix.type_aux = 0;
-	ACCESS_FBINFO(fbcon).fix.line_length = (var->xres_virtual * var->bits_per_pixel) >> 3;
+	minfo->fbcon.screen_base = vaddr_va(minfo->video.vbase) + ydstorg;
+	matroxfb_update_fix(minfo);
+	minfo->fbcon.fix.visual = visual;
+	minfo->fbcon.fix.type = FB_TYPE_PACKED_PIXELS;
+	minfo->fbcon.fix.type_aux = 0;
+	minfo->fbcon.fix.line_length = (var->xres_virtual * var->bits_per_pixel) >> 3;
 	{
 		unsigned int pos;
 
-		ACCESS_FBINFO(curr.cmap_len) = cmap_len;
-		ydstorg += ACCESS_FBINFO(devflags.ydstorg);
-		ACCESS_FBINFO(curr.ydstorg.bytes) = ydstorg;
-		ACCESS_FBINFO(curr.ydstorg.chunks) = ydstorg >> (isInterleave(MINFO)?3:2);
+		minfo->curr.cmap_len = cmap_len;
+		ydstorg += minfo->devflags.ydstorg;
+		minfo->curr.ydstorg.bytes = ydstorg;
+		minfo->curr.ydstorg.chunks = ydstorg >> (isInterleave(minfo) ? 3 : 2);
 		if (var->bits_per_pixel == 4)
-			ACCESS_FBINFO(curr.ydstorg.pixels) = ydstorg;
+			minfo->curr.ydstorg.pixels = ydstorg;
 		else
-			ACCESS_FBINFO(curr.ydstorg.pixels) = (ydstorg * 8) / var->bits_per_pixel;
-		ACCESS_FBINFO(curr.final_bppShift) = matroxfb_get_final_bppShift(PMINFO var->bits_per_pixel);
+			minfo->curr.ydstorg.pixels = (ydstorg * 8) / var->bits_per_pixel;
+		minfo->curr.final_bppShift = matroxfb_get_final_bppShift(minfo, var->bits_per_pixel);
 		{	struct my_timming mt;
 			struct matrox_hw_state* hw;
 			int out;
@@ -797,54 +803,55 @@
 				default:	mt.delay = 31 + 8; break;
 			}
 
-			hw = &ACCESS_FBINFO(hw);
+			hw = &minfo->hw;
 
-			down_read(&ACCESS_FBINFO(altout).lock);
+			down_read(&minfo->altout.lock);
 			for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
-				if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC1 &&
-				    ACCESS_FBINFO(outputs[out]).output->compute) {
-					ACCESS_FBINFO(outputs[out]).output->compute(ACCESS_FBINFO(outputs[out]).data, &mt);
+				if (minfo->outputs[out].src == MATROXFB_SRC_CRTC1 &&
+				    minfo->outputs[out].output->compute) {
+					minfo->outputs[out].output->compute(minfo->outputs[out].data, &mt);
 				}
 			}
-			up_read(&ACCESS_FBINFO(altout).lock);
-			ACCESS_FBINFO(crtc1).pixclock = mt.pixclock;
-			ACCESS_FBINFO(crtc1).mnp = mt.mnp;
-			ACCESS_FBINFO(hw_switch->init(PMINFO &mt));
-			pos = (var->yoffset * var->xres_virtual + var->xoffset) * ACCESS_FBINFO(curr.final_bppShift) / 32;
-			pos += ACCESS_FBINFO(curr.ydstorg.chunks);
+			up_read(&minfo->altout.lock);
+			minfo->crtc1.pixclock = mt.pixclock;
+			minfo->crtc1.mnp = mt.mnp;
+			minfo->hw_switch->init(minfo, &mt);
+			pos = (var->yoffset * var->xres_virtual + var->xoffset) * minfo->curr.final_bppShift / 32;
+			pos += minfo->curr.ydstorg.chunks;
 
 			hw->CRTC[0x0D] = pos & 0xFF;
 			hw->CRTC[0x0C] = (pos & 0xFF00) >> 8;
 			hw->CRTCEXT[0] = (hw->CRTCEXT[0] & 0xF0) | ((pos >> 16) & 0x0F) | ((pos >> 14) & 0x40);
 			hw->CRTCEXT[8] = pos >> 21;
-			ACCESS_FBINFO(hw_switch->restore(PMINFO2));
-			update_crtc2(PMINFO pos);
-			down_read(&ACCESS_FBINFO(altout).lock);
+			minfo->hw_switch->restore(minfo);
+			update_crtc2(minfo, pos);
+			down_read(&minfo->altout.lock);
 			for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
-				if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC1 &&
-				    ACCESS_FBINFO(outputs[out]).output->program) {
-					ACCESS_FBINFO(outputs[out]).output->program(ACCESS_FBINFO(outputs[out]).data);
+				if (minfo->outputs[out].src == MATROXFB_SRC_CRTC1 &&
+				    minfo->outputs[out].output->program) {
+					minfo->outputs[out].output->program(minfo->outputs[out].data);
 				}
 			}
 			for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
-				if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC1 &&
-				    ACCESS_FBINFO(outputs[out]).output->start) {
-					ACCESS_FBINFO(outputs[out]).output->start(ACCESS_FBINFO(outputs[out]).data);
+				if (minfo->outputs[out].src == MATROXFB_SRC_CRTC1 &&
+				    minfo->outputs[out].output->start) {
+					minfo->outputs[out].output->start(minfo->outputs[out].data);
 				}
 			}
-			up_read(&ACCESS_FBINFO(altout).lock);
-			matrox_cfbX_init(PMINFO2);
+			up_read(&minfo->altout.lock);
+			matrox_cfbX_init(minfo);
 		}
 	}
-	ACCESS_FBINFO(initialized) = 1;
+	minfo->initialized = 1;
 	return 0;
 }
 
-static int matroxfb_get_vblank(WPMINFO struct fb_vblank *vblank)
+static int matroxfb_get_vblank(struct matrox_fb_info *minfo,
+			       struct fb_vblank *vblank)
 {
 	unsigned int sts1;
 
-	matroxfb_enable_irq(PMINFO 0);
+	matroxfb_enable_irq(minfo, 0);
 	memset(vblank, 0, sizeof(*vblank));
 	vblank->flags = FB_VBLANK_HAVE_VCOUNT | FB_VBLANK_HAVE_VSYNC |
 			FB_VBLANK_HAVE_VBLANK | FB_VBLANK_HAVE_HBLANK;
@@ -857,13 +864,13 @@
 		vblank->flags |= FB_VBLANK_HBLANKING;
 	if (sts1 & 8)
 		vblank->flags |= FB_VBLANK_VSYNCING;
-	if (vblank->vcount >= ACCESS_FBINFO(fbcon).var.yres)
+	if (vblank->vcount >= minfo->fbcon.var.yres)
 		vblank->flags |= FB_VBLANK_VBLANKING;
-	if (test_bit(0, &ACCESS_FBINFO(irq_flags))) {
+	if (test_bit(0, &minfo->irq_flags)) {
 		vblank->flags |= FB_VBLANK_HAVE_COUNT;
 		/* Only one writer, aligned int value...
 		   it should work without lock and without atomic_t */
-		vblank->count = ACCESS_FBINFO(crtc1).vsync.cnt;
+		vblank->count = minfo->crtc1.vsync.cnt;
 	}
 	return 0;
 }
@@ -876,11 +883,11 @@
 			  unsigned int cmd, unsigned long arg)
 {
 	void __user *argp = (void __user *)arg;
-	MINFO_FROM_INFO(info);
+	struct matrox_fb_info *minfo = info2minfo(info);
 
 	DBG(__func__)
 
-	if (ACCESS_FBINFO(dead)) {
+	if (minfo->dead) {
 		return -ENXIO;
 	}
 
@@ -890,7 +897,7 @@
 				struct fb_vblank vblank;
 				int err;
 
-				err = matroxfb_get_vblank(PMINFO &vblank);
+				err = matroxfb_get_vblank(minfo, &vblank);
 				if (err)
 					return err;
 				if (copy_to_user(argp, &vblank, sizeof(vblank)))
@@ -904,7 +911,7 @@
 				if (get_user(crt, (u_int32_t __user *)arg))
 					return -EFAULT;
 
-				return matroxfb_wait_for_sync(PMINFO crt);
+				return matroxfb_wait_for_sync(minfo, crt);
 			}
 		case MATROXFB_SET_OUTPUT_MODE:
 			{
@@ -916,8 +923,8 @@
 					return -EFAULT;
 				if (mom.output >= MATROXFB_MAX_OUTPUTS)
 					return -ENXIO;
-				down_read(&ACCESS_FBINFO(altout.lock));
-				oproc = ACCESS_FBINFO(outputs[mom.output]).output;
+				down_read(&minfo->altout.lock);
+				oproc = minfo->outputs[mom.output].output;
 				if (!oproc) {
 					val = -ENXIO;
 				} else if (!oproc->verifymode) {
@@ -927,18 +934,18 @@
 						val = -EINVAL;
 					}
 				} else {
-					val = oproc->verifymode(ACCESS_FBINFO(outputs[mom.output]).data, mom.mode);
+					val = oproc->verifymode(minfo->outputs[mom.output].data, mom.mode);
 				}
 				if (!val) {
-					if (ACCESS_FBINFO(outputs[mom.output]).mode != mom.mode) {
-						ACCESS_FBINFO(outputs[mom.output]).mode = mom.mode;
+					if (minfo->outputs[mom.output].mode != mom.mode) {
+						minfo->outputs[mom.output].mode = mom.mode;
 						val = 1;
 					}
 				}
-				up_read(&ACCESS_FBINFO(altout.lock));
+				up_read(&minfo->altout.lock);
 				if (val != 1)
 					return val;
-				switch (ACCESS_FBINFO(outputs[mom.output]).src) {
+				switch (minfo->outputs[mom.output].src) {
 					case MATROXFB_SRC_CRTC1:
 						matroxfb_set_par(info);
 						break;
@@ -946,11 +953,11 @@
 						{
 							struct matroxfb_dh_fb_info* crtc2;
 
-							down_read(&ACCESS_FBINFO(crtc2.lock));
-							crtc2 = ACCESS_FBINFO(crtc2.info);
+							down_read(&minfo->crtc2.lock);
+							crtc2 = minfo->crtc2.info;
 							if (crtc2)
 								crtc2->fbcon.fbops->fb_set_par(&crtc2->fbcon);
-							up_read(&ACCESS_FBINFO(crtc2.lock));
+							up_read(&minfo->crtc2.lock);
 						}
 						break;
 				}
@@ -966,15 +973,15 @@
 					return -EFAULT;
 				if (mom.output >= MATROXFB_MAX_OUTPUTS)
 					return -ENXIO;
-				down_read(&ACCESS_FBINFO(altout.lock));
-				oproc = ACCESS_FBINFO(outputs[mom.output]).output;
+				down_read(&minfo->altout.lock);
+				oproc = minfo->outputs[mom.output].output;
 				if (!oproc) {
 					val = -ENXIO;
 				} else {
-					mom.mode = ACCESS_FBINFO(outputs[mom.output]).mode;
+					mom.mode = minfo->outputs[mom.output].mode;
 					val = 0;
 				}
-				up_read(&ACCESS_FBINFO(altout.lock));
+				up_read(&minfo->altout.lock);
 				if (val)
 					return val;
 				if (copy_to_user(argp, &mom, sizeof(mom)))
@@ -993,9 +1000,9 @@
 					if (tmp & (1 << i)) {
 						if (i >= MATROXFB_MAX_OUTPUTS)
 							return -ENXIO;
-						if (!ACCESS_FBINFO(outputs[i]).output)
+						if (!minfo->outputs[i].output)
 							return -ENXIO;
-						switch (ACCESS_FBINFO(outputs[i]).src) {
+						switch (minfo->outputs[i].src) {
 							case MATROXFB_SRC_NONE:
 							case MATROXFB_SRC_CRTC1:
 								break;
@@ -1004,12 +1011,12 @@
 						}
 					}
 				}
-				if (ACCESS_FBINFO(devflags.panellink)) {
+				if (minfo->devflags.panellink) {
 					if (tmp & MATROXFB_OUTPUT_CONN_DFP) {
 						if (tmp & MATROXFB_OUTPUT_CONN_SECONDARY)
 							return -EINVAL;
 						for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
-							if (ACCESS_FBINFO(outputs[i]).src == MATROXFB_SRC_CRTC2) {
+							if (minfo->outputs[i].src == MATROXFB_SRC_CRTC2) {
 								return -EBUSY;
 							}
 						}
@@ -1018,13 +1025,13 @@
 				changes = 0;
 				for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
 					if (tmp & (1 << i)) {
-						if (ACCESS_FBINFO(outputs[i]).src != MATROXFB_SRC_CRTC1) {
+						if (minfo->outputs[i].src != MATROXFB_SRC_CRTC1) {
 							changes = 1;
-							ACCESS_FBINFO(outputs[i]).src = MATROXFB_SRC_CRTC1;
+							minfo->outputs[i].src = MATROXFB_SRC_CRTC1;
 						}
-					} else if (ACCESS_FBINFO(outputs[i]).src == MATROXFB_SRC_CRTC1) {
+					} else if (minfo->outputs[i].src == MATROXFB_SRC_CRTC1) {
 						changes = 1;
-						ACCESS_FBINFO(outputs[i]).src = MATROXFB_SRC_NONE;
+						minfo->outputs[i].src = MATROXFB_SRC_NONE;
 					}
 				}
 				if (!changes)
@@ -1038,7 +1045,7 @@
 				int i;
 
 				for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
-					if (ACCESS_FBINFO(outputs[i]).src == MATROXFB_SRC_CRTC1) {
+					if (minfo->outputs[i].src == MATROXFB_SRC_CRTC1) {
 						conn |= 1 << i;
 					}
 				}
@@ -1052,8 +1059,8 @@
 				int i;
 
 				for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
-					if (ACCESS_FBINFO(outputs[i]).output) {
-						switch (ACCESS_FBINFO(outputs[i]).src) {
+					if (minfo->outputs[i].output) {
+						switch (minfo->outputs[i].src) {
 							case MATROXFB_SRC_NONE:
 							case MATROXFB_SRC_CRTC1:
 								conn |= 1 << i;
@@ -1061,7 +1068,7 @@
 						}
 					}
 				}
-				if (ACCESS_FBINFO(devflags.panellink)) {
+				if (minfo->devflags.panellink) {
 					if (conn & MATROXFB_OUTPUT_CONN_DFP)
 						conn &= ~MATROXFB_OUTPUT_CONN_SECONDARY;
 					if (conn & MATROXFB_OUTPUT_CONN_SECONDARY)
@@ -1077,7 +1084,7 @@
 				int i;
 
 				for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
-					if (ACCESS_FBINFO(outputs[i]).output) {
+					if (minfo->outputs[i].output) {
 						conn |= 1 << i;
 					}
 				}
@@ -1092,7 +1099,7 @@
 				memset(&r, 0, sizeof(r));
 				strcpy(r.driver, "matroxfb");
 				strcpy(r.card, "Matrox");
-				sprintf(r.bus_info, "PCI:%s", pci_name(ACCESS_FBINFO(pcidev)));
+				sprintf(r.bus_info, "PCI:%s", pci_name(minfo->pcidev));
 				r.version = KERNEL_VERSION(1,0,0);
 				r.capabilities = V4L2_CAP_VIDEO_OUTPUT;
 				if (copy_to_user(argp, &r, sizeof(r)))
@@ -1108,15 +1115,15 @@
 				if (copy_from_user(&qctrl, argp, sizeof(qctrl)))
 					return -EFAULT;
 
-				down_read(&ACCESS_FBINFO(altout).lock);
-				if (!ACCESS_FBINFO(outputs[1]).output) {
+				down_read(&minfo->altout.lock);
+				if (!minfo->outputs[1].output) {
 					err = -ENXIO;
-				} else if (ACCESS_FBINFO(outputs[1]).output->getqueryctrl) {
-					err = ACCESS_FBINFO(outputs[1]).output->getqueryctrl(ACCESS_FBINFO(outputs[1]).data, &qctrl);
+				} else if (minfo->outputs[1].output->getqueryctrl) {
+					err = minfo->outputs[1].output->getqueryctrl(minfo->outputs[1].data, &qctrl);
 				} else {
 					err = -EINVAL;
 				}
-				up_read(&ACCESS_FBINFO(altout).lock);
+				up_read(&minfo->altout.lock);
 				if (err >= 0 &&
 				    copy_to_user(argp, &qctrl, sizeof(qctrl)))
 					return -EFAULT;
@@ -1130,15 +1137,15 @@
 				if (copy_from_user(&ctrl, argp, sizeof(ctrl)))
 					return -EFAULT;
 
-				down_read(&ACCESS_FBINFO(altout).lock);
-				if (!ACCESS_FBINFO(outputs[1]).output) {
+				down_read(&minfo->altout.lock);
+				if (!minfo->outputs[1].output) {
 					err = -ENXIO;
-				} else if (ACCESS_FBINFO(outputs[1]).output->getctrl) {
-					err = ACCESS_FBINFO(outputs[1]).output->getctrl(ACCESS_FBINFO(outputs[1]).data, &ctrl);
+				} else if (minfo->outputs[1].output->getctrl) {
+					err = minfo->outputs[1].output->getctrl(minfo->outputs[1].data, &ctrl);
 				} else {
 					err = -EINVAL;
 				}
-				up_read(&ACCESS_FBINFO(altout).lock);
+				up_read(&minfo->altout.lock);
 				if (err >= 0 &&
 				    copy_to_user(argp, &ctrl, sizeof(ctrl)))
 					return -EFAULT;
@@ -1153,15 +1160,15 @@
 				if (copy_from_user(&ctrl, argp, sizeof(ctrl)))
 					return -EFAULT;
 
-				down_read(&ACCESS_FBINFO(altout).lock);
-				if (!ACCESS_FBINFO(outputs[1]).output) {
+				down_read(&minfo->altout.lock);
+				if (!minfo->outputs[1].output) {
 					err = -ENXIO;
-				} else if (ACCESS_FBINFO(outputs[1]).output->setctrl) {
-					err = ACCESS_FBINFO(outputs[1]).output->setctrl(ACCESS_FBINFO(outputs[1]).data, &ctrl);
+				} else if (minfo->outputs[1].output->setctrl) {
+					err = minfo->outputs[1].output->setctrl(minfo->outputs[1].data, &ctrl);
 				} else {
 					err = -EINVAL;
 				}
-				up_read(&ACCESS_FBINFO(altout).lock);
+				up_read(&minfo->altout.lock);
 				return err;
 			}
 	}
@@ -1175,11 +1182,11 @@
 	int seq;
 	int crtc;
 	CRITFLAGS
-	MINFO_FROM_INFO(info);
+	struct matrox_fb_info *minfo = info2minfo(info);
 
 	DBG(__func__)
 
-	if (ACCESS_FBINFO(dead))
+	if (minfo->dead)
 		return 1;
 
 	switch (blank) {
@@ -1281,7 +1288,9 @@
 static char videomode[64];		/* "matrox:mode:xxxxx" or "matrox:xxxxx" */
 #endif
 
-static int matroxfb_getmemory(WPMINFO unsigned int maxSize, unsigned int *realSize){
+static int matroxfb_getmemory(struct matrox_fb_info *minfo,
+			      unsigned int maxSize, unsigned int *realSize)
+{
 	vaddr_t vm;
 	unsigned int offs;
 	unsigned int offs2;
@@ -1291,7 +1300,7 @@
 
 	DBG(__func__)
 
-	vm = ACCESS_FBINFO(video.vbase);
+	vm = minfo->video.vbase;
 	maxSize &= ~0x1FFFFF;	/* must be X*2MB (really it must be 2 or X*4MB) */
 	/* at least 2MB */
 	if (maxSize < 0x0200000) return 0;
@@ -1323,7 +1332,7 @@
 
 	*realSize = offs - 0x100000;
 #ifdef CONFIG_FB_MATROX_MILLENIUM
-	ACCESS_FBINFO(interleave) = !(!isMillenium(MINFO) || ((offs - 0x100000) & 0x3FFFFF));
+	minfo->interleave = !(!isMillenium(minfo) || ((offs - 0x100000) & 0x3FFFFF));
 #endif
 	return 1;
 }
@@ -1345,13 +1354,9 @@
 #ifdef CONFIG_FB_MATROX_G
 static struct video_board vbG100		= {0x0800000, 0x0800000, FB_ACCEL_MATROX_MGAG100,	&matrox_G100};
 static struct video_board vbG200		= {0x1000000, 0x1000000, FB_ACCEL_MATROX_MGAG200,	&matrox_G100};
-#ifdef CONFIG_FB_MATROX_32MB
 /* from doc it looks like that accelerator can draw only to low 16MB :-( Direct accesses & displaying are OK for
    whole 32MB */
 static struct video_board vbG400		= {0x2000000, 0x1000000, FB_ACCEL_MATROX_MGAG400,	&matrox_G100};
-#else
-static struct video_board vbG400		= {0x2000000, 0x1000000, FB_ACCEL_MATROX_MGAG400,	&matrox_G100};
-#endif
 #endif
 
 #define DEVF_VIDEO64BIT		0x0001
@@ -1558,16 +1563,17 @@
 
 static int hotplug = 0;
 
-static void setDefaultOutputs(WPMINFO2) {
+static void setDefaultOutputs(struct matrox_fb_info *minfo)
+{
 	unsigned int i;
 	const char* ptr;
 
-	ACCESS_FBINFO(outputs[0]).default_src = MATROXFB_SRC_CRTC1;
-	if (ACCESS_FBINFO(devflags.g450dac)) {
-		ACCESS_FBINFO(outputs[1]).default_src = MATROXFB_SRC_CRTC1;
-		ACCESS_FBINFO(outputs[2]).default_src = MATROXFB_SRC_CRTC1;
+	minfo->outputs[0].default_src = MATROXFB_SRC_CRTC1;
+	if (minfo->devflags.g450dac) {
+		minfo->outputs[1].default_src = MATROXFB_SRC_CRTC1;
+		minfo->outputs[2].default_src = MATROXFB_SRC_CRTC1;
 	} else if (dfp) {
-		ACCESS_FBINFO(outputs[2]).default_src = MATROXFB_SRC_CRTC1;
+		minfo->outputs[2].default_src = MATROXFB_SRC_CRTC1;
 	}
 	ptr = outputs;
 	for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
@@ -1577,11 +1583,11 @@
 			break;
 		}
 		if (c == '0') {
-			ACCESS_FBINFO(outputs[i]).default_src = MATROXFB_SRC_NONE;
+			minfo->outputs[i].default_src = MATROXFB_SRC_NONE;
 		} else if (c == '1') {
-			ACCESS_FBINFO(outputs[i]).default_src = MATROXFB_SRC_CRTC1;
-		} else if (c == '2' && ACCESS_FBINFO(devflags.crtc2)) {
-			ACCESS_FBINFO(outputs[i]).default_src = MATROXFB_SRC_CRTC2;
+			minfo->outputs[i].default_src = MATROXFB_SRC_CRTC1;
+		} else if (c == '2' && minfo->devflags.crtc2) {
+			minfo->outputs[i].default_src = MATROXFB_SRC_CRTC2;
 		} else {
 			printk(KERN_ERR "matroxfb: Unknown outputs setting\n");
 			break;
@@ -1591,7 +1597,8 @@
 	outputs[0] = 0;
 }
 
-static int initMatrox2(WPMINFO struct board* b){
+static int initMatrox2(struct matrox_fb_info *minfo, struct board *b)
+{
 	unsigned long ctrlptr_phys = 0;
 	unsigned long video_base_phys = 0;
 	unsigned int memsize;
@@ -1607,58 +1614,56 @@
 	/* set default values... */
 	vesafb_defined.accel_flags = FB_ACCELF_TEXT;
 
-	ACCESS_FBINFO(hw_switch) = b->base->lowlevel;
-	ACCESS_FBINFO(devflags.accelerator) = b->base->accelID;
-	ACCESS_FBINFO(max_pixel_clock) = b->maxclk;
+	minfo->hw_switch = b->base->lowlevel;
+	minfo->devflags.accelerator = b->base->accelID;
+	minfo->max_pixel_clock = b->maxclk;
 
 	printk(KERN_INFO "matroxfb: Matrox %s detected\n", b->name);
-	ACCESS_FBINFO(capable.plnwt) = 1;
-	ACCESS_FBINFO(chip) = b->chip;
-	ACCESS_FBINFO(capable.srcorg) = b->flags & DEVF_SRCORG;
-	ACCESS_FBINFO(devflags.video64bits) = b->flags & DEVF_VIDEO64BIT;
+	minfo->capable.plnwt = 1;
+	minfo->chip = b->chip;
+	minfo->capable.srcorg = b->flags & DEVF_SRCORG;
+	minfo->devflags.video64bits = b->flags & DEVF_VIDEO64BIT;
 	if (b->flags & DEVF_TEXT4B) {
-		ACCESS_FBINFO(devflags.vgastep) = 4;
-		ACCESS_FBINFO(devflags.textmode) = 4;
-		ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP16;
+		minfo->devflags.vgastep = 4;
+		minfo->devflags.textmode = 4;
+		minfo->devflags.text_type_aux = FB_AUX_TEXT_MGA_STEP16;
 	} else if (b->flags & DEVF_TEXT16B) {
-		ACCESS_FBINFO(devflags.vgastep) = 16;
-		ACCESS_FBINFO(devflags.textmode) = 1;
-		ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP16;
+		minfo->devflags.vgastep = 16;
+		minfo->devflags.textmode = 1;
+		minfo->devflags.text_type_aux = FB_AUX_TEXT_MGA_STEP16;
 	} else {
-		ACCESS_FBINFO(devflags.vgastep) = 8;
-		ACCESS_FBINFO(devflags.textmode) = 1;
-		ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP8;
+		minfo->devflags.vgastep = 8;
+		minfo->devflags.textmode = 1;
+		minfo->devflags.text_type_aux = FB_AUX_TEXT_MGA_STEP8;
 	}
-#ifdef CONFIG_FB_MATROX_32MB
-	ACCESS_FBINFO(devflags.support32MB) = (b->flags & DEVF_SUPPORT32MB) != 0;
-#endif
-	ACCESS_FBINFO(devflags.precise_width) = !(b->flags & DEVF_ANY_VXRES);
-	ACCESS_FBINFO(devflags.crtc2) = (b->flags & DEVF_CRTC2) != 0;
-	ACCESS_FBINFO(devflags.maven_capable) = (b->flags & DEVF_MAVEN_CAPABLE) != 0;
-	ACCESS_FBINFO(devflags.dualhead) = (b->flags & DEVF_DUALHEAD) != 0;
-	ACCESS_FBINFO(devflags.dfp_type) = dfp_type;
-	ACCESS_FBINFO(devflags.g450dac) = (b->flags & DEVF_G450DAC) != 0;
-	ACCESS_FBINFO(devflags.textstep) = ACCESS_FBINFO(devflags.vgastep) * ACCESS_FBINFO(devflags.textmode);
-	ACCESS_FBINFO(devflags.textvram) = 65536 / ACCESS_FBINFO(devflags.textmode);
-	setDefaultOutputs(PMINFO2);
+	minfo->devflags.support32MB = (b->flags & DEVF_SUPPORT32MB) != 0;
+	minfo->devflags.precise_width = !(b->flags & DEVF_ANY_VXRES);
+	minfo->devflags.crtc2 = (b->flags & DEVF_CRTC2) != 0;
+	minfo->devflags.maven_capable = (b->flags & DEVF_MAVEN_CAPABLE) != 0;
+	minfo->devflags.dualhead = (b->flags & DEVF_DUALHEAD) != 0;
+	minfo->devflags.dfp_type = dfp_type;
+	minfo->devflags.g450dac = (b->flags & DEVF_G450DAC) != 0;
+	minfo->devflags.textstep = minfo->devflags.vgastep * minfo->devflags.textmode;
+	minfo->devflags.textvram = 65536 / minfo->devflags.textmode;
+	setDefaultOutputs(minfo);
 	if (b->flags & DEVF_PANELLINK_CAPABLE) {
-		ACCESS_FBINFO(outputs[2]).data = MINFO;
-		ACCESS_FBINFO(outputs[2]).output = &panellink_output;
-		ACCESS_FBINFO(outputs[2]).src = ACCESS_FBINFO(outputs[2]).default_src;
-		ACCESS_FBINFO(outputs[2]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
-		ACCESS_FBINFO(devflags.panellink) = 1;
+		minfo->outputs[2].data = minfo;
+		minfo->outputs[2].output = &panellink_output;
+		minfo->outputs[2].src = minfo->outputs[2].default_src;
+		minfo->outputs[2].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+		minfo->devflags.panellink = 1;
 	}
 
-	if (ACCESS_FBINFO(capable.cross4MB) < 0)
-		ACCESS_FBINFO(capable.cross4MB) = b->flags & DEVF_CROSS4MB;
+	if (minfo->capable.cross4MB < 0)
+		minfo->capable.cross4MB = b->flags & DEVF_CROSS4MB;
 	if (b->flags & DEVF_SWAPS) {
-		ctrlptr_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 1);
-		video_base_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 0);
-		ACCESS_FBINFO(devflags.fbResource) = PCI_BASE_ADDRESS_0;
+		ctrlptr_phys = pci_resource_start(minfo->pcidev, 1);
+		video_base_phys = pci_resource_start(minfo->pcidev, 0);
+		minfo->devflags.fbResource = PCI_BASE_ADDRESS_0;
 	} else {
-		ctrlptr_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 0);
-		video_base_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 1);
-		ACCESS_FBINFO(devflags.fbResource) = PCI_BASE_ADDRESS_1;
+		ctrlptr_phys = pci_resource_start(minfo->pcidev, 0);
+		video_base_phys = pci_resource_start(minfo->pcidev, 1);
+		minfo->devflags.fbResource = PCI_BASE_ADDRESS_1;
 	}
 	err = -EINVAL;
 	if (!ctrlptr_phys) {
@@ -1676,7 +1681,7 @@
 	if (!request_mem_region(video_base_phys, memsize, "matroxfb FB")) {
 		goto failCtrlMR;
 	}
-	ACCESS_FBINFO(video.len_maximum) = memsize;
+	minfo->video.len_maximum = memsize;
 	/* convert mem (autodetect k, M) */
 	if (mem < 1024) mem *= 1024;
 	if (mem < 0x00100000) mem *= 1024;
@@ -1684,14 +1689,14 @@
 	if (mem && (mem < memsize))
 		memsize = mem;
 	err = -ENOMEM;
-	if (mga_ioremap(ctrlptr_phys, 16384, MGA_IOREMAP_MMIO, &ACCESS_FBINFO(mmio.vbase))) {
+	if (mga_ioremap(ctrlptr_phys, 16384, MGA_IOREMAP_MMIO, &minfo->mmio.vbase)) {
 		printk(KERN_ERR "matroxfb: cannot ioremap(%lX, 16384), matroxfb disabled\n", ctrlptr_phys);
 		goto failVideoMR;
 	}
-	ACCESS_FBINFO(mmio.base) = ctrlptr_phys;
-	ACCESS_FBINFO(mmio.len) = 16384;
-	ACCESS_FBINFO(video.base) = video_base_phys;
-	if (mga_ioremap(video_base_phys, memsize, MGA_IOREMAP_FB, &ACCESS_FBINFO(video.vbase))) {
+	minfo->mmio.base = ctrlptr_phys;
+	minfo->mmio.len = 16384;
+	minfo->video.base = video_base_phys;
+	if (mga_ioremap(video_base_phys, memsize, MGA_IOREMAP_FB, &minfo->video.vbase)) {
 		printk(KERN_ERR "matroxfb: cannot ioremap(%lX, %d), matroxfb disabled\n",
 			video_base_phys, memsize);
 		goto failCtrlIO;
@@ -1700,63 +1705,63 @@
 		u_int32_t cmd;
 		u_int32_t mga_option;
 
-		pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, &mga_option);
-		pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_COMMAND, &cmd);
+		pci_read_config_dword(minfo->pcidev, PCI_OPTION_REG, &mga_option);
+		pci_read_config_dword(minfo->pcidev, PCI_COMMAND, &cmd);
 		mga_option &= 0x7FFFFFFF; /* clear BIG_ENDIAN */
 		mga_option |= MX_OPTION_BSWAP;
 		/* disable palette snooping */
 		cmd &= ~PCI_COMMAND_VGA_PALETTE;
 		if (pci_dev_present(intel_82437)) {
-			if (!(mga_option & 0x20000000) && !ACCESS_FBINFO(devflags.nopciretry)) {
+			if (!(mga_option & 0x20000000) && !minfo->devflags.nopciretry) {
 				printk(KERN_WARNING "matroxfb: Disabling PCI retries due to i82437 present\n");
 			}
 			mga_option |= 0x20000000;
-			ACCESS_FBINFO(devflags.nopciretry) = 1;
+			minfo->devflags.nopciretry = 1;
 		}
-		pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_COMMAND, cmd);
-		pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mga_option);
-		ACCESS_FBINFO(hw).MXoptionReg = mga_option;
+		pci_write_config_dword(minfo->pcidev, PCI_COMMAND, cmd);
+		pci_write_config_dword(minfo->pcidev, PCI_OPTION_REG, mga_option);
+		minfo->hw.MXoptionReg = mga_option;
 
 		/* select non-DMA memory for PCI_MGA_DATA, otherwise dump of PCI cfg space can lock PCI bus */
 		/* maybe preinit() candidate, but it is same... for all devices... at this time... */
-		pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_MGA_INDEX, 0x00003C00);
+		pci_write_config_dword(minfo->pcidev, PCI_MGA_INDEX, 0x00003C00);
 	}
 
 	err = -ENXIO;
-	matroxfb_read_pins(PMINFO2);
-	if (ACCESS_FBINFO(hw_switch)->preinit(PMINFO2)) {
+	matroxfb_read_pins(minfo);
+	if (minfo->hw_switch->preinit(minfo)) {
 		goto failVideoIO;
 	}
 
 	err = -ENOMEM;
-	if (!matroxfb_getmemory(PMINFO memsize, &ACCESS_FBINFO(video.len)) || !ACCESS_FBINFO(video.len)) {
+	if (!matroxfb_getmemory(minfo, memsize, &minfo->video.len) || !minfo->video.len) {
 		printk(KERN_ERR "matroxfb: cannot determine memory size\n");
 		goto failVideoIO;
 	}
-	ACCESS_FBINFO(devflags.ydstorg) = 0;
+	minfo->devflags.ydstorg = 0;
 
-	ACCESS_FBINFO(video.base) = video_base_phys;
-	ACCESS_FBINFO(video.len_usable) = ACCESS_FBINFO(video.len);
-	if (ACCESS_FBINFO(video.len_usable) > b->base->maxdisplayable)
-		ACCESS_FBINFO(video.len_usable) = b->base->maxdisplayable;
+	minfo->video.base = video_base_phys;
+	minfo->video.len_usable = minfo->video.len;
+	if (minfo->video.len_usable > b->base->maxdisplayable)
+		minfo->video.len_usable = b->base->maxdisplayable;
 #ifdef CONFIG_MTRR
 	if (mtrr) {
-		ACCESS_FBINFO(mtrr.vram) = mtrr_add(video_base_phys, ACCESS_FBINFO(video.len), MTRR_TYPE_WRCOMB, 1);
-		ACCESS_FBINFO(mtrr.vram_valid) = 1;
+		minfo->mtrr.vram = mtrr_add(video_base_phys, minfo->video.len, MTRR_TYPE_WRCOMB, 1);
+		minfo->mtrr.vram_valid = 1;
 		printk(KERN_INFO "matroxfb: MTRR's turned on\n");
 	}
 #endif	/* CONFIG_MTRR */
 
-	if (!ACCESS_FBINFO(devflags.novga))
+	if (!minfo->devflags.novga)
 		request_region(0x3C0, 32, "matrox");
-	matroxfb_g450_connect(PMINFO2);
-	ACCESS_FBINFO(hw_switch->reset(PMINFO2));
+	matroxfb_g450_connect(minfo);
+	minfo->hw_switch->reset(minfo);
 
-	ACCESS_FBINFO(fbcon.monspecs.hfmin) = 0;
-	ACCESS_FBINFO(fbcon.monspecs.hfmax) = fh;
-	ACCESS_FBINFO(fbcon.monspecs.vfmin) = 0;
-	ACCESS_FBINFO(fbcon.monspecs.vfmax) = fv;
-	ACCESS_FBINFO(fbcon.monspecs.dpms) = 0;	/* TBD */
+	minfo->fbcon.monspecs.hfmin = 0;
+	minfo->fbcon.monspecs.hfmax = fh;
+	minfo->fbcon.monspecs.vfmin = 0;
+	minfo->fbcon.monspecs.vfmax = fv;
+	minfo->fbcon.monspecs.dpms = 0;	/* TBD */
 
 	/* static settings */
 	vesafb_defined.red = colors[depth-1].red;
@@ -1768,24 +1773,24 @@
 	if (noaccel)
 		vesafb_defined.accel_flags &= ~FB_ACCELF_TEXT;
 
-	ACCESS_FBINFO(fbops) = matroxfb_ops;
-	ACCESS_FBINFO(fbcon.fbops) = &ACCESS_FBINFO(fbops);
-	ACCESS_FBINFO(fbcon.pseudo_palette) = ACCESS_FBINFO(cmap);
+	minfo->fbops = matroxfb_ops;
+	minfo->fbcon.fbops = &minfo->fbops;
+	minfo->fbcon.pseudo_palette = minfo->cmap;
 	/* after __init time we are like module... no logo */
-	ACCESS_FBINFO(fbcon.flags) = hotplug ? FBINFO_FLAG_MODULE : FBINFO_FLAG_DEFAULT;
-	ACCESS_FBINFO(fbcon.flags) |= FBINFO_PARTIAL_PAN_OK | 	 /* Prefer panning for scroll under MC viewer/edit */
+	minfo->fbcon.flags = hotplug ? FBINFO_FLAG_MODULE : FBINFO_FLAG_DEFAULT;
+	minfo->fbcon.flags |= FBINFO_PARTIAL_PAN_OK | 	 /* Prefer panning for scroll under MC viewer/edit */
 				      FBINFO_HWACCEL_COPYAREA |  /* We have hw-assisted bmove */
 				      FBINFO_HWACCEL_FILLRECT |  /* And fillrect */
 				      FBINFO_HWACCEL_IMAGEBLIT | /* And imageblit */
 				      FBINFO_HWACCEL_XPAN |      /* And we support both horizontal */
 				      FBINFO_HWACCEL_YPAN;       /* And vertical panning */
-	ACCESS_FBINFO(video.len_usable) &= PAGE_MASK;
-	fb_alloc_cmap(&ACCESS_FBINFO(fbcon.cmap), 256, 1);
+	minfo->video.len_usable &= PAGE_MASK;
+	fb_alloc_cmap(&minfo->fbcon.cmap, 256, 1);
 
 #ifndef MODULE
 	/* mode database is marked __init!!! */
 	if (!hotplug) {
-		fb_find_mode(&vesafb_defined, &ACCESS_FBINFO(fbcon), videomode[0]?videomode:NULL,
+		fb_find_mode(&vesafb_defined, &minfo->fbcon, videomode[0] ? videomode : NULL,
 			NULL, 0, &defaultmode, vesafb_defined.bits_per_pixel);
 	}
 #endif /* !MODULE */
@@ -1874,52 +1879,52 @@
 		vesafb_defined.yres_virtual = 65536; /* large enough to be INF, but small enough
 							to yres_virtual * xres_virtual < 2^32 */
 	}
-	matroxfb_init_fix(PMINFO2);
-	ACCESS_FBINFO(fbcon.screen_base) = vaddr_va(ACCESS_FBINFO(video.vbase));
+	matroxfb_init_fix(minfo);
+	minfo->fbcon.screen_base = vaddr_va(minfo->video.vbase);
 	/* Normalize values (namely yres_virtual) */
-	matroxfb_check_var(&vesafb_defined, &ACCESS_FBINFO(fbcon));
+	matroxfb_check_var(&vesafb_defined, &minfo->fbcon);
 	/* And put it into "current" var. Do NOT program hardware yet, or we'll not take over
 	 * vgacon correctly. fbcon_startup will call fb_set_par for us, WITHOUT check_var,
 	 * and unfortunately it will do it BEFORE vgacon contents is saved, so it won't work
 	 * anyway. But we at least tried... */
-	ACCESS_FBINFO(fbcon.var) = vesafb_defined;
+	minfo->fbcon.var = vesafb_defined;
 	err = -EINVAL;
 
 	printk(KERN_INFO "matroxfb: %dx%dx%dbpp (virtual: %dx%d)\n",
 		vesafb_defined.xres, vesafb_defined.yres, vesafb_defined.bits_per_pixel,
 		vesafb_defined.xres_virtual, vesafb_defined.yres_virtual);
 	printk(KERN_INFO "matroxfb: framebuffer at 0x%lX, mapped to 0x%p, size %d\n",
-		ACCESS_FBINFO(video.base), vaddr_va(ACCESS_FBINFO(video.vbase)), ACCESS_FBINFO(video.len));
+		minfo->video.base, vaddr_va(minfo->video.vbase), minfo->video.len);
 
 /* We do not have to set currcon to 0... register_framebuffer do it for us on first console
  * and we do not want currcon == 0 for subsequent framebuffers */
 
-	ACCESS_FBINFO(fbcon).device = &ACCESS_FBINFO(pcidev)->dev;
-	if (register_framebuffer(&ACCESS_FBINFO(fbcon)) < 0) {
+	minfo->fbcon.device = &minfo->pcidev->dev;
+	if (register_framebuffer(&minfo->fbcon) < 0) {
 		goto failVideoIO;
 	}
 	printk("fb%d: %s frame buffer device\n",
-	       ACCESS_FBINFO(fbcon.node), ACCESS_FBINFO(fbcon.fix.id));
+	       minfo->fbcon.node, minfo->fbcon.fix.id);
 
 	/* there is no console on this fb... but we have to initialize hardware
 	 * until someone tells me what is proper thing to do */
-	if (!ACCESS_FBINFO(initialized)) {
+	if (!minfo->initialized) {
 		printk(KERN_INFO "fb%d: initializing hardware\n",
-		       ACCESS_FBINFO(fbcon.node));
+		       minfo->fbcon.node);
 		/* We have to use FB_ACTIVATE_FORCE, as we had to put vesafb_defined to the fbcon.var
 		 * already before, so register_framebuffer works correctly. */
 		vesafb_defined.activate |= FB_ACTIVATE_FORCE;
-		fb_set_var(&ACCESS_FBINFO(fbcon), &vesafb_defined);
+		fb_set_var(&minfo->fbcon, &vesafb_defined);
 	}
 
 	return 0;
 failVideoIO:;
-	matroxfb_g450_shutdown(PMINFO2);
-	mga_iounmap(ACCESS_FBINFO(video.vbase));
+	matroxfb_g450_shutdown(minfo);
+	mga_iounmap(minfo->video.vbase);
 failCtrlIO:;
-	mga_iounmap(ACCESS_FBINFO(mmio.vbase));
+	mga_iounmap(minfo->mmio.vbase);
 failVideoMR:;
-	release_mem_region(video_base_phys, ACCESS_FBINFO(video.len_maximum));
+	release_mem_region(video_base_phys, minfo->video.len_maximum);
 failCtrlMR:;
 	release_mem_region(ctrlptr_phys, 16384);
 fail:;
@@ -1975,7 +1980,7 @@
 static void matroxfb_register_device(struct matrox_fb_info* minfo) {
 	struct matroxfb_driver* drv;
 	int i = 0;
-	list_add(&ACCESS_FBINFO(next_fb), &matroxfb_list);
+	list_add(&minfo->next_fb, &matroxfb_list);
 	for (drv = matroxfb_driver_l(matroxfb_driver_list.next);
 	     drv != matroxfb_driver_l(&matroxfb_driver_list);
 	     drv = matroxfb_driver_l(drv->node.next)) {
@@ -1995,7 +2000,7 @@
 static void matroxfb_unregister_device(struct matrox_fb_info* minfo) {
 	int i;
 
-	list_del(&ACCESS_FBINFO(next_fb));
+	list_del(&minfo->next_fb);
 	for (i = 0; i < minfo->drivers_count; i++) {
 		struct matroxfb_driver* drv = minfo->drivers[i];
 
@@ -2011,9 +2016,6 @@
 	struct matrox_fb_info* minfo;
 	int err;
 	u_int32_t cmd;
-#ifndef CONFIG_FB_MATROX_MULTIHEAD
-	static int registered = 0;
-#endif
 	DBG(__func__)
 
 	svid = pdev->subsystem_vendor;
@@ -2037,68 +2039,57 @@
 		return -1;
 	}
 
-#ifdef CONFIG_FB_MATROX_MULTIHEAD
 	minfo = kmalloc(sizeof(*minfo), GFP_KERNEL);
 	if (!minfo)
 		return -1;
-#else
-	if (registered)	/* singlehead driver... */
-		return -1;
-	minfo = &matroxfb_global_mxinfo;
-#endif
-	memset(MINFO, 0, sizeof(*MINFO));
+	memset(minfo, 0, sizeof(*minfo));
 
-	ACCESS_FBINFO(pcidev) = pdev;
-	ACCESS_FBINFO(dead) = 0;
-	ACCESS_FBINFO(usecount) = 0;
-	ACCESS_FBINFO(userusecount) = 0;
+	minfo->pcidev = pdev;
+	minfo->dead = 0;
+	minfo->usecount = 0;
+	minfo->userusecount = 0;
 
-	pci_set_drvdata(pdev, MINFO);
+	pci_set_drvdata(pdev, minfo);
 	/* DEVFLAGS */
-	ACCESS_FBINFO(devflags.memtype) = memtype;
+	minfo->devflags.memtype = memtype;
 	if (memtype != -1)
 		noinit = 0;
 	if (cmd & PCI_COMMAND_MEMORY) {
-		ACCESS_FBINFO(devflags.novga) = novga;
-		ACCESS_FBINFO(devflags.nobios) = nobios;
-		ACCESS_FBINFO(devflags.noinit) = noinit;
+		minfo->devflags.novga = novga;
+		minfo->devflags.nobios = nobios;
+		minfo->devflags.noinit = noinit;
 		/* subsequent heads always needs initialization and must not enable BIOS */
 		novga = 1;
 		nobios = 1;
 		noinit = 0;
 	} else {
-		ACCESS_FBINFO(devflags.novga) = 1;
-		ACCESS_FBINFO(devflags.nobios) = 1;
-		ACCESS_FBINFO(devflags.noinit) = 0;
+		minfo->devflags.novga = 1;
+		minfo->devflags.nobios = 1;
+		minfo->devflags.noinit = 0;
 	}
 
-	ACCESS_FBINFO(devflags.nopciretry) = no_pci_retry;
-	ACCESS_FBINFO(devflags.mga_24bpp_fix) = inv24;
-	ACCESS_FBINFO(devflags.precise_width) = option_precise_width;
-	ACCESS_FBINFO(devflags.sgram) = sgram;
-	ACCESS_FBINFO(capable.cross4MB) = cross4MB;
+	minfo->devflags.nopciretry = no_pci_retry;
+	minfo->devflags.mga_24bpp_fix = inv24;
+	minfo->devflags.precise_width = option_precise_width;
+	minfo->devflags.sgram = sgram;
+	minfo->capable.cross4MB = cross4MB;
 
-	spin_lock_init(&ACCESS_FBINFO(lock.DAC));
-	spin_lock_init(&ACCESS_FBINFO(lock.accel));
-	init_rwsem(&ACCESS_FBINFO(crtc2.lock));
-	init_rwsem(&ACCESS_FBINFO(altout.lock));
-	mutex_init(&ACCESS_FBINFO(fbcon).mm_lock);
-	ACCESS_FBINFO(irq_flags) = 0;
-	init_waitqueue_head(&ACCESS_FBINFO(crtc1.vsync.wait));
-	init_waitqueue_head(&ACCESS_FBINFO(crtc2.vsync.wait));
-	ACCESS_FBINFO(crtc1.panpos) = -1;
+	spin_lock_init(&minfo->lock.DAC);
+	spin_lock_init(&minfo->lock.accel);
+	init_rwsem(&minfo->crtc2.lock);
+	init_rwsem(&minfo->altout.lock);
+	mutex_init(&minfo->fbcon.mm_lock);
+	minfo->irq_flags = 0;
+	init_waitqueue_head(&minfo->crtc1.vsync.wait);
+	init_waitqueue_head(&minfo->crtc2.vsync.wait);
+	minfo->crtc1.panpos = -1;
 
-	err = initMatrox2(PMINFO b);
+	err = initMatrox2(minfo, b);
 	if (!err) {
-#ifndef CONFIG_FB_MATROX_MULTIHEAD
-		registered = 1;
-#endif
-		matroxfb_register_device(MINFO);
+		matroxfb_register_device(minfo);
 		return 0;
 	}
-#ifdef CONFIG_FB_MATROX_MULTIHEAD
 	kfree(minfo);
-#endif
 	return -1;
 }
 
@@ -2106,7 +2097,7 @@
 	struct matrox_fb_info* minfo;
 
 	minfo = pci_get_drvdata(pdev);
-	matroxfb_remove(PMINFO 1);
+	matroxfb_remove(minfo, 1);
 }
 
 static struct pci_device_id matroxfb_devices[] = {
@@ -2510,13 +2501,8 @@
 MODULE_PARM_DESC(inv24, "Inverts clock polarity for 24bpp and loop frequency > 100MHz (default=do not invert polarity)");
 module_param(inverse, int, 0);
 MODULE_PARM_DESC(inverse, "Inverse (0 or 1) (default=0)");
-#ifdef CONFIG_FB_MATROX_MULTIHEAD
 module_param(dev, int, 0);
 MODULE_PARM_DESC(dev, "Multihead support, attach to device ID (0..N) (default=all working)");
-#else
-module_param(dev, int, 0);
-MODULE_PARM_DESC(dev, "Multihead support, attach to device ID (0..N) (default=first working)");
-#endif
 module_param(vesa, int, 0);
 MODULE_PARM_DESC(vesa, "Startup videomode (0x000-0x1FF) (default=0x101)");
 module_param(xres, int, 0);
diff --git a/drivers/video/matrox/matroxfb_base.h b/drivers/video/matrox/matroxfb_base.h
index 9588323..f3a4e15 100644
--- a/drivers/video/matrox/matroxfb_base.h
+++ b/drivers/video/matrox/matroxfb_base.h
@@ -54,9 +54,6 @@
 #include "../macmodes.h"
 #endif
 
-/* always compile support for 32MB... It cost almost nothing */
-#define CONFIG_FB_MATROX_32MB
-
 #ifdef MATROXFB_DEBUG
 
 #define DEBUG
@@ -464,9 +461,7 @@
 		int		nopciretry;
 		int		noinit;
 		int		sgram;
-#ifdef CONFIG_FB_MATROX_32MB
 		int		support32MB;
-#endif
 
 		int		accelerator;
 		int		text_type_aux;
@@ -524,47 +519,11 @@
 
 #define info2minfo(info) container_of(info, struct matrox_fb_info, fbcon)
 
-#ifdef CONFIG_FB_MATROX_MULTIHEAD
-#define ACCESS_FBINFO2(info, x) (info->x)
-#define ACCESS_FBINFO(x) ACCESS_FBINFO2(minfo,x)
-
-#define MINFO minfo
-
-#define WPMINFO2 struct matrox_fb_info* minfo
-#define WPMINFO  WPMINFO2 ,
-#define CPMINFO2 const struct matrox_fb_info* minfo
-#define CPMINFO	 CPMINFO2 ,
-#define PMINFO2  minfo
-#define PMINFO   PMINFO2 ,
-
-#define MINFO_FROM(x)	   struct matrox_fb_info* minfo = x
-#else
-
-extern struct matrox_fb_info matroxfb_global_mxinfo;
-
-#define ACCESS_FBINFO(x) (matroxfb_global_mxinfo.x)
-#define ACCESS_FBINFO2(info, x) (matroxfb_global_mxinfo.x)
-
-#define MINFO (&matroxfb_global_mxinfo)
-
-#define WPMINFO2 void
-#define WPMINFO
-#define CPMINFO2 void
-#define CPMINFO
-#define PMINFO2
-#define PMINFO
-
-#define MINFO_FROM(x)
-
-#endif
-
-#define MINFO_FROM_INFO(x) MINFO_FROM(info2minfo(x))
-
 struct matrox_switch {
-	int	(*preinit)(WPMINFO2);
-	void	(*reset)(WPMINFO2);
-	int	(*init)(WPMINFO struct my_timming*);
-	void	(*restore)(WPMINFO2);
+	int	(*preinit)(struct matrox_fb_info *minfo);
+	void	(*reset)(struct matrox_fb_info *minfo);
+	int	(*init)(struct matrox_fb_info *minfo, struct my_timming*);
+	void	(*restore)(struct matrox_fb_info *minfo);
 };
 
 struct matroxfb_driver {
@@ -727,11 +686,11 @@
 #endif
 #endif
 
-#define mga_inb(addr)		mga_readb(ACCESS_FBINFO(mmio.vbase), (addr))
-#define mga_inl(addr)		mga_readl(ACCESS_FBINFO(mmio.vbase), (addr))
-#define mga_outb(addr,val)	mga_writeb(ACCESS_FBINFO(mmio.vbase), (addr), (val))
-#define mga_outw(addr,val)	mga_writew(ACCESS_FBINFO(mmio.vbase), (addr), (val))
-#define mga_outl(addr,val)	mga_writel(ACCESS_FBINFO(mmio.vbase), (addr), (val))
+#define mga_inb(addr)		mga_readb(minfo->mmio.vbase, (addr))
+#define mga_inl(addr)		mga_readl(minfo->mmio.vbase, (addr))
+#define mga_outb(addr,val)	mga_writeb(minfo->mmio.vbase, (addr), (val))
+#define mga_outw(addr,val)	mga_writew(minfo->mmio.vbase, (addr), (val))
+#define mga_outl(addr,val)	mga_writel(minfo->mmio.vbase, (addr), (val))
 #define mga_readr(port,idx)	(mga_outb((port),(idx)), mga_inb((port)+1))
 #define mga_setr(addr,port,val)	mga_outw(addr, ((val)<<8) | (port))
 
@@ -750,19 +709,20 @@
 #define isMilleniumII(x) (0)
 #endif
 
-#define matroxfb_DAC_lock()                   spin_lock(&ACCESS_FBINFO(lock.DAC))
-#define matroxfb_DAC_unlock()                 spin_unlock(&ACCESS_FBINFO(lock.DAC))
-#define matroxfb_DAC_lock_irqsave(flags)      spin_lock_irqsave(&ACCESS_FBINFO(lock.DAC),flags)
-#define matroxfb_DAC_unlock_irqrestore(flags) spin_unlock_irqrestore(&ACCESS_FBINFO(lock.DAC),flags)
-extern void matroxfb_DAC_out(CPMINFO int reg, int val);
-extern int matroxfb_DAC_in(CPMINFO int reg);
+#define matroxfb_DAC_lock()                   spin_lock(&minfo->lock.DAC)
+#define matroxfb_DAC_unlock()                 spin_unlock(&minfo->lock.DAC)
+#define matroxfb_DAC_lock_irqsave(flags)      spin_lock_irqsave(&minfo->lock.DAC, flags)
+#define matroxfb_DAC_unlock_irqrestore(flags) spin_unlock_irqrestore(&minfo->lock.DAC, flags)
+extern void matroxfb_DAC_out(const struct matrox_fb_info *minfo, int reg,
+			     int val);
+extern int matroxfb_DAC_in(const struct matrox_fb_info *minfo, int reg);
 extern void matroxfb_var2my(struct fb_var_screeninfo* fvsi, struct my_timming* mt);
-extern int matroxfb_wait_for_sync(WPMINFO u_int32_t crtc);
-extern int matroxfb_enable_irq(WPMINFO int reenable);
+extern int matroxfb_wait_for_sync(struct matrox_fb_info *minfo, u_int32_t crtc);
+extern int matroxfb_enable_irq(struct matrox_fb_info *minfo, int reenable);
 
 #ifdef MATROXFB_USE_SPINLOCKS
-#define CRITBEGIN  spin_lock_irqsave(&ACCESS_FBINFO(lock.accel), critflags);
-#define CRITEND	   spin_unlock_irqrestore(&ACCESS_FBINFO(lock.accel), critflags);
+#define CRITBEGIN  spin_lock_irqsave(&minfo->lock.accel, critflags);
+#define CRITEND	   spin_unlock_irqrestore(&minfo->lock.accel, critflags);
 #define CRITFLAGS  unsigned long critflags;
 #else
 #define CRITBEGIN
diff --git a/drivers/video/matrox/matroxfb_crtc2.c b/drivers/video/matrox/matroxfb_crtc2.c
index ebcb5c6..78414ba 100644
--- a/drivers/video/matrox/matroxfb_crtc2.c
+++ b/drivers/video/matrox/matroxfb_crtc2.c
@@ -65,7 +65,7 @@
 		unsigned int pos) {
 	u_int32_t tmp;
 	u_int32_t datactl;
-	MINFO_FROM(m2info->primary_dev);
+	struct matrox_fb_info *minfo = m2info->primary_dev;
 
 	switch (mode) {
 		case 15:
@@ -81,11 +81,11 @@
 	}
 	tmp |= 0x00000001;	/* enable CRTC2 */
 	datactl = 0;
-	if (ACCESS_FBINFO(outputs[1]).src == MATROXFB_SRC_CRTC2) {
-		if (ACCESS_FBINFO(devflags.g450dac)) {
+	if (minfo->outputs[1].src == MATROXFB_SRC_CRTC2) {
+		if (minfo->devflags.g450dac) {
 			tmp |= 0x00000006; /* source from secondary pixel PLL */
 			/* no vidrst when in monitor mode */
-			if (ACCESS_FBINFO(outputs[1]).mode != MATROXFB_OUTPUT_MODE_MONITOR) {
+			if (minfo->outputs[1].mode != MATROXFB_OUTPUT_MODE_MONITOR) {
 				tmp |=  0xC0001000; /* Enable H/V vidrst */
 			}
 		} else {
@@ -93,11 +93,11 @@
 			tmp |= 0xC0000000; /* enable vvidrst & hvidrst */
 			/* MGA TVO is our clock source */
 		}
-	} else if (ACCESS_FBINFO(outputs[0]).src == MATROXFB_SRC_CRTC2) {
+	} else if (minfo->outputs[0].src == MATROXFB_SRC_CRTC2) {
 		tmp |= 0x00000004; /* source from pixclock */
 		/* PIXPLL is our clock source */
 	}
-	if (ACCESS_FBINFO(outputs[0]).src == MATROXFB_SRC_CRTC2) {
+	if (minfo->outputs[0].src == MATROXFB_SRC_CRTC2) {
 		tmp |= 0x00100000;	/* connect CRTC2 to DAC */
 	}
 	if (mt->interlaced) {
@@ -146,7 +146,7 @@
 		}
 	}
 	mga_outl(0x3C10, tmp);
-	ACCESS_FBINFO(hw).crtc2.ctl = tmp;
+	minfo->hw.crtc2.ctl = tmp;
 
 	tmp = mt->VDisplay << 16;	/* line compare */
 	if (mt->sync & FB_SYNC_HOR_HIGH_ACT)
@@ -157,10 +157,10 @@
 }
 
 static void matroxfb_dh_disable(struct matroxfb_dh_fb_info* m2info) {
-	MINFO_FROM(m2info->primary_dev);
+	struct matrox_fb_info *minfo = m2info->primary_dev;
 
 	mga_outl(0x3C10, 0x00000004);	/* disable CRTC2, CRTC1->DAC1, PLL as clock source */
-	ACCESS_FBINFO(hw).crtc2.ctl = 0x00000004;
+	minfo->hw.crtc2.ctl = 0x00000004;
 }
 
 static void matroxfb_dh_pan_var(struct matroxfb_dh_fb_info* m2info,
@@ -168,7 +168,7 @@
 	unsigned int pos;
 	unsigned int linelen;
 	unsigned int pixelsize;
-	MINFO_FROM(m2info->primary_dev);
+	struct matrox_fb_info *minfo = m2info->primary_dev;
 
 	m2info->fbcon.var.xoffset = var->xoffset;
 	m2info->fbcon.var.yoffset = var->yoffset;
@@ -260,15 +260,15 @@
 
 static int matroxfb_dh_open(struct fb_info* info, int user) {
 #define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
-	MINFO_FROM(m2info->primary_dev);
+	struct matrox_fb_info *minfo = m2info->primary_dev;
 
-	if (MINFO) {
+	if (minfo) {
 		int err;
 
-		if (ACCESS_FBINFO(dead)) {
+		if (minfo->dead) {
 			return -ENXIO;
 		}
-		err = ACCESS_FBINFO(fbops).fb_open(&ACCESS_FBINFO(fbcon), user);
+		err = minfo->fbops.fb_open(&minfo->fbcon, user);
 		if (err) {
 			return err;
 		}
@@ -280,10 +280,10 @@
 static int matroxfb_dh_release(struct fb_info* info, int user) {
 #define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
 	int err = 0;
-	MINFO_FROM(m2info->primary_dev);
+	struct matrox_fb_info *minfo = m2info->primary_dev;
 
-	if (MINFO) {
-		err = ACCESS_FBINFO(fbops).fb_release(&ACCESS_FBINFO(fbcon), user);
+	if (minfo) {
+		err = minfo->fbops.fb_release(&minfo->fbcon, user);
 	}
 	return err;
 #undef m2info
@@ -326,7 +326,7 @@
 	int mode;
 	int err;
 	struct fb_var_screeninfo* var = &info->var;
-	MINFO_FROM(m2info->primary_dev);
+	struct matrox_fb_info *minfo = m2info->primary_dev;
 
 	if ((err = matroxfb_dh_decode_var(m2info, var, &visual, &cmap_len, &mode)) != 0)
 		return err;
@@ -352,39 +352,39 @@
 		pos = (m2info->fbcon.var.yoffset * m2info->fbcon.var.xres_virtual + m2info->fbcon.var.xoffset) * m2info->fbcon.var.bits_per_pixel >> 3;
 		pos += m2info->video.offbase;
 		cnt = 0;
-		down_read(&ACCESS_FBINFO(altout).lock);
+		down_read(&minfo->altout.lock);
 		for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
-			if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2) {
+			if (minfo->outputs[out].src == MATROXFB_SRC_CRTC2) {
 				cnt++;
-				if (ACCESS_FBINFO(outputs[out]).output->compute) {
-					ACCESS_FBINFO(outputs[out]).output->compute(ACCESS_FBINFO(outputs[out]).data, &mt);
+				if (minfo->outputs[out].output->compute) {
+					minfo->outputs[out].output->compute(minfo->outputs[out].data, &mt);
 				}
 			}
 		}
-		ACCESS_FBINFO(crtc2).pixclock = mt.pixclock;
-		ACCESS_FBINFO(crtc2).mnp = mt.mnp;
-		up_read(&ACCESS_FBINFO(altout).lock);
+		minfo->crtc2.pixclock = mt.pixclock;
+		minfo->crtc2.mnp = mt.mnp;
+		up_read(&minfo->altout.lock);
 		if (cnt) {
 			matroxfb_dh_restore(m2info, &mt, mode, pos);
 		} else {
 			matroxfb_dh_disable(m2info);
 		}
-		DAC1064_global_init(PMINFO2);
-		DAC1064_global_restore(PMINFO2);
-		down_read(&ACCESS_FBINFO(altout).lock);
+		DAC1064_global_init(minfo);
+		DAC1064_global_restore(minfo);
+		down_read(&minfo->altout.lock);
 		for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
-			if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2 &&
-			    ACCESS_FBINFO(outputs[out]).output->program) {
-				ACCESS_FBINFO(outputs[out]).output->program(ACCESS_FBINFO(outputs[out]).data);
+			if (minfo->outputs[out].src == MATROXFB_SRC_CRTC2 &&
+			    minfo->outputs[out].output->program) {
+				minfo->outputs[out].output->program(minfo->outputs[out].data);
 			}
 		}
 		for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
-			if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2 &&
-			    ACCESS_FBINFO(outputs[out]).output->start) {
-				ACCESS_FBINFO(outputs[out]).output->start(ACCESS_FBINFO(outputs[out]).data);
+			if (minfo->outputs[out].src == MATROXFB_SRC_CRTC2 &&
+			    minfo->outputs[out].output->start) {
+				minfo->outputs[out].output->start(minfo->outputs[out].data);
 			}
 		}
-		up_read(&ACCESS_FBINFO(altout).lock);
+		up_read(&minfo->altout.lock);
 	}
 	m2info->initialized = 1;
 	return 0;
@@ -399,9 +399,9 @@
 }
 
 static int matroxfb_dh_get_vblank(const struct matroxfb_dh_fb_info* m2info, struct fb_vblank* vblank) {
-	MINFO_FROM(m2info->primary_dev);
+	struct matrox_fb_info *minfo = m2info->primary_dev;
 
-	matroxfb_enable_irq(PMINFO 0);
+	matroxfb_enable_irq(minfo, 0);
 	memset(vblank, 0, sizeof(*vblank));
 	vblank->flags = FB_VBLANK_HAVE_VCOUNT | FB_VBLANK_HAVE_VBLANK;
 	/* mask out reserved bits + field number (odd/even) */
@@ -409,11 +409,11 @@
 	/* compatibility stuff */
 	if (vblank->vcount >= m2info->fbcon.var.yres)
 		vblank->flags |= FB_VBLANK_VBLANKING;
-        if (test_bit(0, &ACCESS_FBINFO(irq_flags))) {
+	if (test_bit(0, &minfo->irq_flags)) {
                 vblank->flags |= FB_VBLANK_HAVE_COUNT;
                 /* Only one writer, aligned int value...
                    it should work without lock and without atomic_t */
-                vblank->count = ACCESS_FBINFO(crtc2).vsync.cnt;
+		vblank->count = minfo->crtc2.vsync.cnt;
         }
 	return 0;
 }
@@ -423,7 +423,7 @@
 		unsigned long arg)
 {
 #define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
-	MINFO_FROM(m2info->primary_dev);
+	struct matrox_fb_info *minfo = m2info->primary_dev;
 
 	DBG(__func__)
 
@@ -449,13 +449,13 @@
 
 				if (crt != 0)
 					return -ENODEV;
-				return matroxfb_wait_for_sync(PMINFO 1);
+				return matroxfb_wait_for_sync(minfo, 1);
 			}
 		case MATROXFB_SET_OUTPUT_MODE:
 		case MATROXFB_GET_OUTPUT_MODE:
 		case MATROXFB_GET_ALL_OUTPUTS:
 			{
-				return ACCESS_FBINFO(fbcon.fbops)->fb_ioctl(&ACCESS_FBINFO(fbcon), cmd, arg);
+				return minfo->fbcon.fbops->fb_ioctl(&minfo->fbcon, cmd, arg);
 			}
 		case MATROXFB_SET_OUTPUT_CONNECTION:
 			{
@@ -469,9 +469,9 @@
 					if (tmp & (1 << out)) {
 						if (out >= MATROXFB_MAX_OUTPUTS)
 							return -ENXIO;
-						if (!ACCESS_FBINFO(outputs[out]).output)
+						if (!minfo->outputs[out].output)
 							return -ENXIO;
-						switch (ACCESS_FBINFO(outputs[out]).src) {
+						switch (minfo->outputs[out].src) {
 							case MATROXFB_SRC_NONE:
 							case MATROXFB_SRC_CRTC2:
 								break;
@@ -480,22 +480,22 @@
 						}
 					}
 				}
-				if (ACCESS_FBINFO(devflags.panellink)) {
+				if (minfo->devflags.panellink) {
 					if (tmp & MATROXFB_OUTPUT_CONN_DFP)
 						return -EINVAL;
-					if ((ACCESS_FBINFO(outputs[2]).src == MATROXFB_SRC_CRTC1) && tmp)
+					if ((minfo->outputs[2].src == MATROXFB_SRC_CRTC1) && tmp)
 						return -EBUSY;
 				}
 				changes = 0;
 				for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
 					if (tmp & (1 << out)) {
-						if (ACCESS_FBINFO(outputs[out]).src != MATROXFB_SRC_CRTC2) {
+						if (minfo->outputs[out].src != MATROXFB_SRC_CRTC2) {
 							changes = 1;
-							ACCESS_FBINFO(outputs[out]).src = MATROXFB_SRC_CRTC2;
+							minfo->outputs[out].src = MATROXFB_SRC_CRTC2;
 						}
-					} else if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2) {
+					} else if (minfo->outputs[out].src == MATROXFB_SRC_CRTC2) {
 						changes = 1;
-						ACCESS_FBINFO(outputs[out]).src = MATROXFB_SRC_NONE;
+						minfo->outputs[out].src = MATROXFB_SRC_NONE;
 					}
 				}
 				if (!changes)
@@ -509,7 +509,7 @@
 				int out;
 
 				for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
-					if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2) {
+					if (minfo->outputs[out].src == MATROXFB_SRC_CRTC2) {
 						conn |= 1 << out;
 					}
 				}
@@ -523,8 +523,8 @@
 				int out;
 
 				for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
-					if (ACCESS_FBINFO(outputs[out]).output) {
-						switch (ACCESS_FBINFO(outputs[out]).src) {
+					if (minfo->outputs[out].output) {
+						switch (minfo->outputs[out].src) {
 							case MATROXFB_SRC_NONE:
 							case MATROXFB_SRC_CRTC2:
 								tmp |= 1 << out;
@@ -532,9 +532,9 @@
 						}
 					}
 				}
-				if (ACCESS_FBINFO(devflags.panellink)) {
+				if (minfo->devflags.panellink) {
 					tmp &= ~MATROXFB_OUTPUT_CONN_DFP;
-					if (ACCESS_FBINFO(outputs[2]).src == MATROXFB_SRC_CRTC1) {
+					if (minfo->outputs[2].src == MATROXFB_SRC_CRTC1) {
 						tmp = 0;
 					}
 				}
@@ -595,7 +595,9 @@
 		0, {0,0,0,0,0}
 };
 
-static int matroxfb_dh_regit(CPMINFO struct matroxfb_dh_fb_info* m2info) {
+static int matroxfb_dh_regit(const struct matrox_fb_info *minfo,
+			     struct matroxfb_dh_fb_info *m2info)
+{
 #define minfo (m2info->primary_dev)
 	void* oldcrtc2;
 
@@ -611,21 +613,21 @@
 	if (mem < 64*1024)
 		mem *= 1024;
 	mem &= ~0x00000FFF;	/* PAGE_MASK? */
-	if (ACCESS_FBINFO(video.len_usable) + mem <= ACCESS_FBINFO(video.len))
-		m2info->video.offbase = ACCESS_FBINFO(video.len) - mem;
-	else if (ACCESS_FBINFO(video.len) < mem) {
+	if (minfo->video.len_usable + mem <= minfo->video.len)
+		m2info->video.offbase = minfo->video.len - mem;
+	else if (minfo->video.len < mem) {
 		return -ENOMEM;
 	} else { /* check yres on first head... */
 		m2info->video.borrowed = mem;
-		ACCESS_FBINFO(video.len_usable) -= mem;
-		m2info->video.offbase = ACCESS_FBINFO(video.len_usable);
+		minfo->video.len_usable -= mem;
+		m2info->video.offbase = minfo->video.len_usable;
 	}
-	m2info->video.base = ACCESS_FBINFO(video.base) + m2info->video.offbase;
+	m2info->video.base = minfo->video.base + m2info->video.offbase;
 	m2info->video.len = m2info->video.len_usable = m2info->video.len_maximum = mem;
-	m2info->video.vbase.vaddr = vaddr_va(ACCESS_FBINFO(video.vbase)) + m2info->video.offbase;
-	m2info->mmio.base = ACCESS_FBINFO(mmio.base);
-	m2info->mmio.vbase = ACCESS_FBINFO(mmio.vbase);
-	m2info->mmio.len = ACCESS_FBINFO(mmio.len);
+	m2info->video.vbase.vaddr = vaddr_va(minfo->video.vbase) + m2info->video.offbase;
+	m2info->mmio.base = minfo->mmio.base;
+	m2info->mmio.vbase = minfo->mmio.vbase;
+	m2info->mmio.len = minfo->mmio.len;
 
 	matroxfb_dh_init_fix(m2info);
 	if (register_framebuffer(&m2info->fbcon)) {
@@ -633,10 +635,10 @@
 	}
 	if (!m2info->initialized)
 		fb_set_var(&m2info->fbcon, &matroxfb_dh_defined);
-	down_write(&ACCESS_FBINFO(crtc2.lock));
-	oldcrtc2 = ACCESS_FBINFO(crtc2.info);
-	ACCESS_FBINFO(crtc2.info) = m2info;
-	up_write(&ACCESS_FBINFO(crtc2.lock));
+	down_write(&minfo->crtc2.lock);
+	oldcrtc2 = minfo->crtc2.info;
+	minfo->crtc2.info = m2info;
+	up_write(&minfo->crtc2.lock);
 	if (oldcrtc2) {
 		printk(KERN_ERR "matroxfb_crtc2: Internal consistency check failed: crtc2 already present: %p\n",
 			oldcrtc2);
@@ -649,12 +651,12 @@
 
 static int matroxfb_dh_registerfb(struct matroxfb_dh_fb_info* m2info) {
 #define minfo (m2info->primary_dev)
-	if (matroxfb_dh_regit(PMINFO m2info)) {
+	if (matroxfb_dh_regit(minfo, m2info)) {
 		printk(KERN_ERR "matroxfb_crtc2: secondary head failed to register\n");
 		return -1;
 	}
 	printk(KERN_INFO "matroxfb_crtc2: secondary head of fb%u was registered as fb%u\n",
-		ACCESS_FBINFO(fbcon.node), m2info->fbcon.node);
+		minfo->fbcon.node, m2info->fbcon.node);
 	m2info->fbcon_registered = 1;
 	return 0;
 #undef minfo
@@ -666,11 +668,11 @@
 		int id;
 		struct matroxfb_dh_fb_info* crtc2;
 
-		down_write(&ACCESS_FBINFO(crtc2.lock));
-		crtc2 = ACCESS_FBINFO(crtc2.info);
+		down_write(&minfo->crtc2.lock);
+		crtc2 = minfo->crtc2.info;
 		if (crtc2 == m2info)
-			ACCESS_FBINFO(crtc2.info) = NULL;
-		up_write(&ACCESS_FBINFO(crtc2.lock));
+			minfo->crtc2.info = NULL;
+		up_write(&minfo->crtc2.lock);
 		if (crtc2 != m2info) {
 			printk(KERN_ERR "matroxfb_crtc2: Internal consistency check failed: crtc2 mismatch at unload: %p != %p\n",
 				crtc2, m2info);
@@ -680,7 +682,7 @@
 		id = m2info->fbcon.node;
 		unregister_framebuffer(&m2info->fbcon);
 		/* return memory back to primary head */
-		ACCESS_FBINFO(video.len_usable) += m2info->video.borrowed;
+		minfo->video.len_usable += m2info->video.borrowed;
 		printk(KERN_INFO "matroxfb_crtc2: fb%u unregistered\n", id);
 		m2info->fbcon_registered = 0;
 	}
@@ -691,14 +693,14 @@
 	struct matroxfb_dh_fb_info* m2info;
 
 	/* hardware is CRTC2 incapable... */
-	if (!ACCESS_FBINFO(devflags.crtc2))
+	if (!minfo->devflags.crtc2)
 		return NULL;
 	m2info = kzalloc(sizeof(*m2info), GFP_KERNEL);
 	if (!m2info) {
 		printk(KERN_ERR "matroxfb_crtc2: Not enough memory for CRTC2 control structs\n");
 		return NULL;
 	}
-	m2info->primary_dev = MINFO;
+	m2info->primary_dev = minfo;
 	if (matroxfb_dh_registerfb(m2info)) {
 		kfree(m2info);
 		printk(KERN_ERR "matroxfb_crtc2: CRTC2 framebuffer failed to register\n");
diff --git a/drivers/video/matrox/matroxfb_g450.c b/drivers/video/matrox/matroxfb_g450.c
index 6209a76..cff0546 100644
--- a/drivers/video/matrox/matroxfb_g450.c
+++ b/drivers/video/matrox/matroxfb_g450.c
@@ -80,52 +80,59 @@
 	return -EINVAL;
 }
 
-static inline int* get_ctrl_ptr(WPMINFO unsigned int idx) {
-	return (int*)((char*)MINFO + g450_controls[idx].control);
+static inline int *get_ctrl_ptr(struct matrox_fb_info *minfo, unsigned int idx)
+{
+	return (int*)((char*)minfo + g450_controls[idx].control);
 }
 
-static void tvo_fill_defaults(WPMINFO2) {
+static void tvo_fill_defaults(struct matrox_fb_info *minfo)
+{
 	unsigned int i;
 	
 	for (i = 0; i < G450CTRLS; i++) {
-		*get_ctrl_ptr(PMINFO i) = g450_controls[i].desc.default_value;
+		*get_ctrl_ptr(minfo, i) = g450_controls[i].desc.default_value;
 	}
 }
 
-static int cve2_get_reg(WPMINFO int reg) {
+static int cve2_get_reg(struct matrox_fb_info *minfo, int reg)
+{
 	unsigned long flags;
 	int val;
 	
 	matroxfb_DAC_lock_irqsave(flags);
-	matroxfb_DAC_out(PMINFO 0x87, reg);
-	val = matroxfb_DAC_in(PMINFO 0x88);
+	matroxfb_DAC_out(minfo, 0x87, reg);
+	val = matroxfb_DAC_in(minfo, 0x88);
 	matroxfb_DAC_unlock_irqrestore(flags);
 	return val;
 }
 
-static void cve2_set_reg(WPMINFO int reg, int val) {
+static void cve2_set_reg(struct matrox_fb_info *minfo, int reg, int val)
+{
 	unsigned long flags;
 
 	matroxfb_DAC_lock_irqsave(flags);
-	matroxfb_DAC_out(PMINFO 0x87, reg);
-	matroxfb_DAC_out(PMINFO 0x88, val);
+	matroxfb_DAC_out(minfo, 0x87, reg);
+	matroxfb_DAC_out(minfo, 0x88, val);
 	matroxfb_DAC_unlock_irqrestore(flags);
 }
 
-static void cve2_set_reg10(WPMINFO int reg, int val) {
+static void cve2_set_reg10(struct matrox_fb_info *minfo, int reg, int val)
+{
 	unsigned long flags;
 
 	matroxfb_DAC_lock_irqsave(flags);
-	matroxfb_DAC_out(PMINFO 0x87, reg);
-	matroxfb_DAC_out(PMINFO 0x88, val >> 2);
-	matroxfb_DAC_out(PMINFO 0x87, reg + 1);
-	matroxfb_DAC_out(PMINFO 0x88, val & 3);
+	matroxfb_DAC_out(minfo, 0x87, reg);
+	matroxfb_DAC_out(minfo, 0x88, val >> 2);
+	matroxfb_DAC_out(minfo, 0x87, reg + 1);
+	matroxfb_DAC_out(minfo, 0x88, val & 3);
 	matroxfb_DAC_unlock_irqrestore(flags);
 }
 
-static void g450_compute_bwlevel(CPMINFO int *bl, int *wl) {
-	const int b = ACCESS_FBINFO(altout.tvo_params.brightness) + BLMIN;
-	const int c = ACCESS_FBINFO(altout.tvo_params.contrast);
+static void g450_compute_bwlevel(const struct matrox_fb_info *minfo, int *bl,
+				 int *wl)
+{
+	const int b = minfo->altout.tvo_params.brightness + BLMIN;
+	const int c = minfo->altout.tvo_params.contrast;
 
 	*bl = max(b - c, BLMIN);
 	*wl = min(b + c, WLMAX);
@@ -154,7 +161,7 @@
 
 static int g450_set_ctrl(void* md, struct v4l2_control *p) {
 	int i;
-	MINFO_FROM(md);
+	struct matrox_fb_info *minfo = md;
 	
 	i = get_ctrl_id(p->id);
 	if (i < 0) return -EINVAL;
@@ -162,7 +169,7 @@
 	/*
 	 * Check if changed.
 	 */
-	if (p->value == *get_ctrl_ptr(PMINFO i)) return 0;
+	if (p->value == *get_ctrl_ptr(minfo, i)) return 0;
 
 	/*
 	 * Check limits.
@@ -173,31 +180,31 @@
 	/*
 	 * Store new value.
 	 */
-	*get_ctrl_ptr(PMINFO i) = p->value;
+	*get_ctrl_ptr(minfo, i) = p->value;
 
 	switch (p->id) {
 		case V4L2_CID_BRIGHTNESS:
 		case V4L2_CID_CONTRAST:
 			{
 				int blacklevel, whitelevel;
-				g450_compute_bwlevel(PMINFO &blacklevel, &whitelevel);
-				cve2_set_reg10(PMINFO 0x0e, blacklevel);
-				cve2_set_reg10(PMINFO 0x1e, whitelevel);
+				g450_compute_bwlevel(minfo, &blacklevel, &whitelevel);
+				cve2_set_reg10(minfo, 0x0e, blacklevel);
+				cve2_set_reg10(minfo, 0x1e, whitelevel);
 			}
 			break;
 		case V4L2_CID_SATURATION:
-			cve2_set_reg(PMINFO 0x20, p->value);
-			cve2_set_reg(PMINFO 0x22, p->value);
+			cve2_set_reg(minfo, 0x20, p->value);
+			cve2_set_reg(minfo, 0x22, p->value);
 			break;
 		case V4L2_CID_HUE:
-			cve2_set_reg(PMINFO 0x25, p->value);
+			cve2_set_reg(minfo, 0x25, p->value);
 			break;
 		case MATROXFB_CID_TESTOUT:
 			{
-				unsigned char val = cve2_get_reg (PMINFO 0x05);
+				unsigned char val = cve2_get_reg(minfo, 0x05);
 				if (p->value) val |=  0x02;
 				else          val &= ~0x02;
-				cve2_set_reg(PMINFO 0x05, val);
+				cve2_set_reg(minfo, 0x05, val);
 			}
 			break;
 	}
@@ -208,11 +215,11 @@
 
 static int g450_get_ctrl(void* md, struct v4l2_control *p) {
 	int i;
-	MINFO_FROM(md);
+	struct matrox_fb_info *minfo = md;
 	
 	i = get_ctrl_id(p->id);
 	if (i < 0) return -EINVAL;
-	p->value = *get_ctrl_ptr(PMINFO i);
+	p->value = *get_ctrl_ptr(minfo, i);
 	return 0;
 }
 
@@ -226,7 +233,9 @@
 	unsigned int	v_total;
 };
 
-static void computeRegs(WPMINFO struct mavenregs* r, struct my_timming* mt, const struct output_desc* outd) {
+static void computeRegs(struct matrox_fb_info *minfo, struct mavenregs *r,
+			struct my_timming *mt, const struct output_desc *outd)
+{
 	u_int32_t chromasc;
 	u_int32_t hlen;
 	u_int32_t hsl;
@@ -251,10 +260,10 @@
 
 	dprintk(KERN_DEBUG "Want %u kHz pixclock\n", (unsigned int)piic);
 	
-	mnp = matroxfb_g450_setclk(PMINFO piic, M_VIDEO_PLL);
+	mnp = matroxfb_g450_setclk(minfo, piic, M_VIDEO_PLL);
 	
 	mt->mnp = mnp;
-	mt->pixclock = g450_mnp2f(PMINFO mnp);
+	mt->pixclock = g450_mnp2f(minfo, mnp);
 
 	dprintk(KERN_DEBUG "MNP=%08X\n", mnp);
 
@@ -490,65 +499,67 @@
  	return;
 }
 
-#define LR(x) cve2_set_reg(PMINFO (x), m->regs[(x)])
-static void cve2_init_TV(WPMINFO const struct mavenregs* m) {
+#define LR(x) cve2_set_reg(minfo, (x), m->regs[(x)])
+static void cve2_init_TV(struct matrox_fb_info *minfo,
+			 const struct mavenregs *m)
+{
 	int i;
 
 	LR(0x80);
 	LR(0x82); LR(0x83);
 	LR(0x84); LR(0x85);
 	
-	cve2_set_reg(PMINFO 0x3E, 0x01);
+	cve2_set_reg(minfo, 0x3E, 0x01);
 	
 	for (i = 0; i < 0x3E; i++) {
 		LR(i);
 	}
-	cve2_set_reg(PMINFO 0x3E, 0x00);
+	cve2_set_reg(minfo, 0x3E, 0x00);
 }
 
 static int matroxfb_g450_compute(void* md, struct my_timming* mt) {
-	MINFO_FROM(md);
+	struct matrox_fb_info *minfo = md;
 
-	dprintk(KERN_DEBUG "Computing, mode=%u\n", ACCESS_FBINFO(outputs[1]).mode);
+	dprintk(KERN_DEBUG "Computing, mode=%u\n", minfo->outputs[1].mode);
 
 	if (mt->crtc == MATROXFB_SRC_CRTC2 &&
-	    ACCESS_FBINFO(outputs[1]).mode != MATROXFB_OUTPUT_MODE_MONITOR) {
+	    minfo->outputs[1].mode != MATROXFB_OUTPUT_MODE_MONITOR) {
 		const struct output_desc* outd;
 
-		cve2_init_TVdata(ACCESS_FBINFO(outputs[1]).mode, &ACCESS_FBINFO(hw).maven, &outd);
+		cve2_init_TVdata(minfo->outputs[1].mode, &minfo->hw.maven, &outd);
 		{
 			int blacklevel, whitelevel;
-			g450_compute_bwlevel(PMINFO &blacklevel, &whitelevel);
-			ACCESS_FBINFO(hw).maven.regs[0x0E] = blacklevel >> 2;
-			ACCESS_FBINFO(hw).maven.regs[0x0F] = blacklevel & 3;
-			ACCESS_FBINFO(hw).maven.regs[0x1E] = whitelevel >> 2;
-			ACCESS_FBINFO(hw).maven.regs[0x1F] = whitelevel & 3;
+			g450_compute_bwlevel(minfo, &blacklevel, &whitelevel);
+			minfo->hw.maven.regs[0x0E] = blacklevel >> 2;
+			minfo->hw.maven.regs[0x0F] = blacklevel & 3;
+			minfo->hw.maven.regs[0x1E] = whitelevel >> 2;
+			minfo->hw.maven.regs[0x1F] = whitelevel & 3;
 
-			ACCESS_FBINFO(hw).maven.regs[0x20] =
-			ACCESS_FBINFO(hw).maven.regs[0x22] = ACCESS_FBINFO(altout.tvo_params.saturation);
+			minfo->hw.maven.regs[0x20] =
+			minfo->hw.maven.regs[0x22] = minfo->altout.tvo_params.saturation;
 
-			ACCESS_FBINFO(hw).maven.regs[0x25] = ACCESS_FBINFO(altout.tvo_params.hue);
+			minfo->hw.maven.regs[0x25] = minfo->altout.tvo_params.hue;
 
-			if (ACCESS_FBINFO(altout.tvo_params.testout)) {
-				ACCESS_FBINFO(hw).maven.regs[0x05] |= 0x02;
+			if (minfo->altout.tvo_params.testout) {
+				minfo->hw.maven.regs[0x05] |= 0x02;
 			}
 		}
-		computeRegs(PMINFO &ACCESS_FBINFO(hw).maven, mt, outd);
+		computeRegs(minfo, &minfo->hw.maven, mt, outd);
 	} else if (mt->mnp < 0) {
 		/* We must program clocks before CRTC2, otherwise interlaced mode
 		   startup may fail */
-		mt->mnp = matroxfb_g450_setclk(PMINFO mt->pixclock, (mt->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
-		mt->pixclock = g450_mnp2f(PMINFO mt->mnp);
+		mt->mnp = matroxfb_g450_setclk(minfo, mt->pixclock, (mt->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
+		mt->pixclock = g450_mnp2f(minfo, mt->mnp);
 	}
 	dprintk(KERN_DEBUG "Pixclock = %u\n", mt->pixclock);
 	return 0;
 }
 
 static int matroxfb_g450_program(void* md) {
-	MINFO_FROM(md);
+	struct matrox_fb_info *minfo = md;
 	
-	if (ACCESS_FBINFO(outputs[1]).mode != MATROXFB_OUTPUT_MODE_MONITOR) {
-		cve2_init_TV(PMINFO &ACCESS_FBINFO(hw).maven);
+	if (minfo->outputs[1].mode != MATROXFB_OUTPUT_MODE_MONITOR) {
+		cve2_init_TV(minfo, &minfo->hw.maven);
 	}
 	return 0;
 }
@@ -564,11 +575,11 @@
 }
 
 static int g450_dvi_compute(void* md, struct my_timming* mt) {
-	MINFO_FROM(md);
+	struct matrox_fb_info *minfo = md;
 
 	if (mt->mnp < 0) {
-		mt->mnp = matroxfb_g450_setclk(PMINFO mt->pixclock, (mt->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
-		mt->pixclock = g450_mnp2f(PMINFO mt->mnp);
+		mt->mnp = matroxfb_g450_setclk(minfo, mt->pixclock, (mt->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
+		mt->pixclock = g450_mnp2f(minfo, mt->mnp);
 	}
 	return 0;
 }
@@ -588,34 +599,36 @@
 	.compute	= g450_dvi_compute,
 };
 
-void matroxfb_g450_connect(WPMINFO2) {
-	if (ACCESS_FBINFO(devflags.g450dac)) {
-		down_write(&ACCESS_FBINFO(altout.lock));
-		tvo_fill_defaults(PMINFO2);
-		ACCESS_FBINFO(outputs[1]).src = ACCESS_FBINFO(outputs[1]).default_src;
-		ACCESS_FBINFO(outputs[1]).data = MINFO;
-		ACCESS_FBINFO(outputs[1]).output = &matroxfb_g450_altout;
-		ACCESS_FBINFO(outputs[1]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
-		ACCESS_FBINFO(outputs[2]).src = ACCESS_FBINFO(outputs[2]).default_src;
-		ACCESS_FBINFO(outputs[2]).data = MINFO;
-		ACCESS_FBINFO(outputs[2]).output = &matroxfb_g450_dvi;
-		ACCESS_FBINFO(outputs[2]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
-		up_write(&ACCESS_FBINFO(altout.lock));
+void matroxfb_g450_connect(struct matrox_fb_info *minfo)
+{
+	if (minfo->devflags.g450dac) {
+		down_write(&minfo->altout.lock);
+		tvo_fill_defaults(minfo);
+		minfo->outputs[1].src = minfo->outputs[1].default_src;
+		minfo->outputs[1].data = minfo;
+		minfo->outputs[1].output = &matroxfb_g450_altout;
+		minfo->outputs[1].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+		minfo->outputs[2].src = minfo->outputs[2].default_src;
+		minfo->outputs[2].data = minfo;
+		minfo->outputs[2].output = &matroxfb_g450_dvi;
+		minfo->outputs[2].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+		up_write(&minfo->altout.lock);
 	}
 }
 
-void matroxfb_g450_shutdown(WPMINFO2) {
-	if (ACCESS_FBINFO(devflags.g450dac)) {
-		down_write(&ACCESS_FBINFO(altout.lock));
-		ACCESS_FBINFO(outputs[1]).src = MATROXFB_SRC_NONE;
-		ACCESS_FBINFO(outputs[1]).output = NULL;
-		ACCESS_FBINFO(outputs[1]).data = NULL;
-		ACCESS_FBINFO(outputs[1]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
-		ACCESS_FBINFO(outputs[2]).src = MATROXFB_SRC_NONE;
-		ACCESS_FBINFO(outputs[2]).output = NULL;
-		ACCESS_FBINFO(outputs[2]).data = NULL;
-		ACCESS_FBINFO(outputs[2]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
-		up_write(&ACCESS_FBINFO(altout.lock));
+void matroxfb_g450_shutdown(struct matrox_fb_info *minfo)
+{
+	if (minfo->devflags.g450dac) {
+		down_write(&minfo->altout.lock);
+		minfo->outputs[1].src = MATROXFB_SRC_NONE;
+		minfo->outputs[1].output = NULL;
+		minfo->outputs[1].data = NULL;
+		minfo->outputs[1].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+		minfo->outputs[2].src = MATROXFB_SRC_NONE;
+		minfo->outputs[2].output = NULL;
+		minfo->outputs[2].data = NULL;
+		minfo->outputs[2].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+		up_write(&minfo->altout.lock);
 	}
 }
 
diff --git a/drivers/video/matrox/matroxfb_g450.h b/drivers/video/matrox/matroxfb_g450.h
index a0822a6..3a3e654 100644
--- a/drivers/video/matrox/matroxfb_g450.h
+++ b/drivers/video/matrox/matroxfb_g450.h
@@ -4,11 +4,11 @@
 #include "matroxfb_base.h"
 
 #ifdef CONFIG_FB_MATROX_G
-void matroxfb_g450_connect(WPMINFO2);
-void matroxfb_g450_shutdown(WPMINFO2);
+void matroxfb_g450_connect(struct matrox_fb_info *minfo);
+void matroxfb_g450_shutdown(struct matrox_fb_info *minfo);
 #else
-static inline void matroxfb_g450_connect(WPMINFO2) { };
-static inline void matroxfb_g450_shutdown(WPMINFO2) { };
+static inline void matroxfb_g450_connect(struct matrox_fb_info *minfo) { };
+static inline void matroxfb_g450_shutdown(struct matrox_fb_info *minfo) { };
 #endif
 
 #endif /* __MATROXFB_G450_H__ */
diff --git a/drivers/video/matrox/matroxfb_maven.c b/drivers/video/matrox/matroxfb_maven.c
index 042408a..91af915 100644
--- a/drivers/video/matrox/matroxfb_maven.c
+++ b/drivers/video/matrox/matroxfb_maven.c
@@ -458,9 +458,9 @@
 		0x00,	/* 3E written multiple times */
 		0x00,	/* never written */
 	}, MATROXFB_OUTPUT_MODE_NTSC, 525, 60 };
-	MINFO_FROM(md->primary_head);
+	struct matrox_fb_info *minfo = md->primary_head;
 
-	if (ACCESS_FBINFO(outputs[1]).mode == MATROXFB_OUTPUT_MODE_PAL)
+	if (minfo->outputs[1].mode == MATROXFB_OUTPUT_MODE_PAL)
 		*data = palregs;
 	else
 		*data = ntscregs;
@@ -496,11 +496,11 @@
 	/* Set saturation */
 	{
 		data->regs[0x20] =
-		data->regs[0x22] = ACCESS_FBINFO(altout.tvo_params.saturation);
+		data->regs[0x22] = minfo->altout.tvo_params.saturation;
 	}
  
 	/* Set HUE */
-	data->regs[0x25] = ACCESS_FBINFO(altout.tvo_params.hue);
+	data->regs[0x25] = minfo->altout.tvo_params.hue;
 	return;
 }
 
@@ -741,9 +741,9 @@
 		struct mavenregs* m) {
 	unsigned int tmpi;
 	unsigned int a, bv, c;
-	MINFO_FROM(md->primary_head);
+	struct matrox_fb_info *minfo = md->primary_head;
 
-	m->mode = ACCESS_FBINFO(outputs[1]).mode;
+	m->mode = minfo->outputs[1].mode;
 	if (m->mode != MATROXFB_OUTPUT_MODE_MONITOR) {
 		unsigned int lmargin;
 		unsigned int umargin;
@@ -1132,7 +1132,7 @@
 static int maven_out_compute(void* md, struct my_timming* mt) {
 #define mdinfo ((struct maven_data*)md)
 #define minfo (mdinfo->primary_head)
-	return maven_compute_timming(md, mt, &ACCESS_FBINFO(hw).maven);
+	return maven_compute_timming(md, mt, &minfo->hw.maven);
 #undef minfo
 #undef mdinfo
 }
@@ -1140,7 +1140,7 @@
 static int maven_out_program(void* md) {
 #define mdinfo ((struct maven_data*)md)
 #define minfo (mdinfo->primary_head)
-	return maven_program_timming(md, &ACCESS_FBINFO(hw).maven);
+	return maven_program_timming(md, &minfo->hw.maven);
 #undef minfo
 #undef mdinfo
 }
@@ -1184,16 +1184,18 @@
 
 static int maven_init_client(struct i2c_client* clnt) {
 	struct maven_data* md = i2c_get_clientdata(clnt);
-	MINFO_FROM(container_of(clnt->adapter, struct i2c_bit_adapter, adapter)->minfo);
+	struct matrox_fb_info *minfo = container_of(clnt->adapter,
+						    struct i2c_bit_adapter,
+						    adapter)->minfo;
 
-	md->primary_head = MINFO;
+	md->primary_head = minfo;
 	md->client = clnt;
-	down_write(&ACCESS_FBINFO(altout.lock));
-	ACCESS_FBINFO(outputs[1]).output = &maven_altout;
-	ACCESS_FBINFO(outputs[1]).src = ACCESS_FBINFO(outputs[1]).default_src;
-	ACCESS_FBINFO(outputs[1]).data = md;
-	ACCESS_FBINFO(outputs[1]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
-	up_write(&ACCESS_FBINFO(altout.lock));
+	down_write(&minfo->altout.lock);
+	minfo->outputs[1].output = &maven_altout;
+	minfo->outputs[1].src = minfo->outputs[1].default_src;
+	minfo->outputs[1].data = md;
+	minfo->outputs[1].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+	up_write(&minfo->altout.lock);
 	if (maven_get_reg(clnt, 0xB2) < 0x14) {
 		md->version = MGATVO_B;
 		/* Tweak some things for this old chip */
@@ -1218,14 +1220,14 @@
 	struct maven_data* md = i2c_get_clientdata(clnt);
 
 	if (md->primary_head) {
-		MINFO_FROM(md->primary_head);
+		struct matrox_fb_info *minfo = md->primary_head;
 
-		down_write(&ACCESS_FBINFO(altout.lock));
-		ACCESS_FBINFO(outputs[1]).src = MATROXFB_SRC_NONE;
-		ACCESS_FBINFO(outputs[1]).output = NULL;
-		ACCESS_FBINFO(outputs[1]).data = NULL;
-		ACCESS_FBINFO(outputs[1]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
-		up_write(&ACCESS_FBINFO(altout.lock));
+		down_write(&minfo->altout.lock);
+		minfo->outputs[1].src = MATROXFB_SRC_NONE;
+		minfo->outputs[1].output = NULL;
+		minfo->outputs[1].data = NULL;
+		minfo->outputs[1].mode = MATROXFB_OUTPUT_MODE_MONITOR;
+		up_write(&minfo->altout.lock);
 		md->primary_head = NULL;
 	}
 	return 0;
diff --git a/drivers/video/matrox/matroxfb_misc.c b/drivers/video/matrox/matroxfb_misc.c
index 5b5f072..9948ca2 100644
--- a/drivers/video/matrox/matroxfb_misc.c
+++ b/drivers/video/matrox/matroxfb_misc.c
@@ -89,13 +89,15 @@
 #include <linux/interrupt.h>
 #include <linux/matroxfb.h>
 
-void matroxfb_DAC_out(CPMINFO int reg, int val) {
+void matroxfb_DAC_out(const struct matrox_fb_info *minfo, int reg, int val)
+{
 	DBG_REG(__func__)
 	mga_outb(M_RAMDAC_BASE+M_X_INDEX, reg);
 	mga_outb(M_RAMDAC_BASE+M_X_DATAREG, val);
 }
 
-int matroxfb_DAC_in(CPMINFO int reg) {
+int matroxfb_DAC_in(const struct matrox_fb_info *minfo, int reg)
+{
 	DBG_REG(__func__)
 	mga_outb(M_RAMDAC_BASE+M_X_INDEX, reg);
 	return mga_inb(M_RAMDAC_BASE+M_X_DATAREG);
@@ -184,13 +186,14 @@
 	return bestvco;
 }
 
-int matroxfb_vgaHWinit(WPMINFO struct my_timming* m) {
+int matroxfb_vgaHWinit(struct matrox_fb_info *minfo, struct my_timming *m)
+{
 	unsigned int hd, hs, he, hbe, ht;
 	unsigned int vd, vs, ve, vt, lc;
 	unsigned int wd;
 	unsigned int divider;
 	int i;
-	struct matrox_hw_state * const hw = &ACCESS_FBINFO(hw);
+	struct matrox_hw_state * const hw = &minfo->hw;
 
 	DBG(__func__)
 
@@ -240,7 +243,7 @@
 	/* standard timmings are in 8pixels, but for interleaved we cannot */
 	/* do it for 4bpp (because of (4bpp >> 1(interleaved))/4 == 0) */
 	/* using 16 or more pixels per unit can save us */
-	divider = ACCESS_FBINFO(curr.final_bppShift);
+	divider = minfo->curr.final_bppShift;
 	while (divider & 3) {
 		hd >>= 1;
 		hs >>= 1;
@@ -270,7 +273,7 @@
 	if (((ht & 0x07) == 0x06) || ((ht & 0x0F) == 0x04))
 		ht++;
 	hbe = ht;
-	wd = ACCESS_FBINFO(fbcon).var.xres_virtual * ACCESS_FBINFO(curr.final_bppShift) / 64;
+	wd = minfo->fbcon.var.xres_virtual * minfo->curr.final_bppShift / 64;
 
 	hw->CRTCEXT[0] = 0;
 	hw->CRTCEXT[5] = 0;
@@ -287,7 +290,7 @@
 			  ((hs      & 0x100) >> 6) | /* sync start */
 			   (hbe     & 0x040);	 /* end hor. blanking */
 	/* FIXME: Enable vidrst only on G400, and only if TV-out is used */
-	if (ACCESS_FBINFO(outputs[1]).src == MATROXFB_SRC_CRTC1)
+	if (minfo->outputs[1].src == MATROXFB_SRC_CRTC1)
 		hw->CRTCEXT[1] |= 0x88;		/* enable horizontal and vertical vidrst */
 	hw->CRTCEXT[2] =  ((vt & 0xC00) >> 10) |
 			  ((vd & 0x400) >>  8) |	/* disp end */
@@ -331,9 +334,10 @@
 	return 0;
 };
 
-void matroxfb_vgaHWrestore(WPMINFO2) {
+void matroxfb_vgaHWrestore(struct matrox_fb_info *minfo)
+{
 	int i;
-	struct matrox_hw_state * const hw = &ACCESS_FBINFO(hw);
+	struct matrox_hw_state * const hw = &minfo->hw;
 	CRITFLAGS
 
 	DBG(__func__)
@@ -522,7 +526,9 @@
 #endif
 }
 
-static int parse_pins1(WPMINFO const struct matrox_bios* bd) {
+static int parse_pins1(struct matrox_fb_info *minfo,
+		       const struct matrox_bios *bd)
+{
 	unsigned int maxdac;
 
 	switch (bd->pins[22]) {
@@ -533,173 +539,188 @@
 	if (get_unaligned_le16(bd->pins + 24)) {
 		maxdac = get_unaligned_le16(bd->pins + 24) * 10;
 	}
-	MINFO->limits.pixel.vcomax = maxdac;
-	MINFO->values.pll.system = get_unaligned_le16(bd->pins + 28) ?
+	minfo->limits.pixel.vcomax = maxdac;
+	minfo->values.pll.system = get_unaligned_le16(bd->pins + 28) ?
 		get_unaligned_le16(bd->pins + 28) * 10 : 50000;
 	/* ignore 4MB, 8MB, module clocks */
-	MINFO->features.pll.ref_freq = 14318;
-	MINFO->values.reg.mctlwtst	= 0x00030101;
+	minfo->features.pll.ref_freq = 14318;
+	minfo->values.reg.mctlwtst	= 0x00030101;
 	return 0;
 }
 
-static void default_pins1(WPMINFO2) {
+static void default_pins1(struct matrox_fb_info *minfo)
+{
 	/* Millennium */
-	MINFO->limits.pixel.vcomax	= 220000;
-	MINFO->values.pll.system	=  50000;
-	MINFO->features.pll.ref_freq	=  14318;
-	MINFO->values.reg.mctlwtst	= 0x00030101;
+	minfo->limits.pixel.vcomax	= 220000;
+	minfo->values.pll.system	=  50000;
+	minfo->features.pll.ref_freq	=  14318;
+	minfo->values.reg.mctlwtst	= 0x00030101;
 }
 
-static int parse_pins2(WPMINFO const struct matrox_bios* bd) {
-	MINFO->limits.pixel.vcomax	=
-	MINFO->limits.system.vcomax	= (bd->pins[41] == 0xFF) ? 230000 : ((bd->pins[41] + 100) * 1000);
-	MINFO->values.reg.mctlwtst	= ((bd->pins[51] & 0x01) ? 0x00000001 : 0) |
+static int parse_pins2(struct matrox_fb_info *minfo,
+		       const struct matrox_bios *bd)
+{
+	minfo->limits.pixel.vcomax	=
+	minfo->limits.system.vcomax	= (bd->pins[41] == 0xFF) ? 230000 : ((bd->pins[41] + 100) * 1000);
+	minfo->values.reg.mctlwtst	= ((bd->pins[51] & 0x01) ? 0x00000001 : 0) |
 					  ((bd->pins[51] & 0x02) ? 0x00000100 : 0) |
 					  ((bd->pins[51] & 0x04) ? 0x00010000 : 0) |
 					  ((bd->pins[51] & 0x08) ? 0x00020000 : 0);
-	MINFO->values.pll.system	= (bd->pins[43] == 0xFF) ? 50000 : ((bd->pins[43] + 100) * 1000);
-	MINFO->features.pll.ref_freq	= 14318;
+	minfo->values.pll.system	= (bd->pins[43] == 0xFF) ? 50000 : ((bd->pins[43] + 100) * 1000);
+	minfo->features.pll.ref_freq	= 14318;
 	return 0;
 }
 
-static void default_pins2(WPMINFO2) {
+static void default_pins2(struct matrox_fb_info *minfo)
+{
 	/* Millennium II, Mystique */
-	MINFO->limits.pixel.vcomax	=
-	MINFO->limits.system.vcomax	= 230000;
-	MINFO->values.reg.mctlwtst	= 0x00030101;
-	MINFO->values.pll.system	=  50000;
-	MINFO->features.pll.ref_freq	=  14318;
+	minfo->limits.pixel.vcomax	=
+	minfo->limits.system.vcomax	= 230000;
+	minfo->values.reg.mctlwtst	= 0x00030101;
+	minfo->values.pll.system	=  50000;
+	minfo->features.pll.ref_freq	=  14318;
 }
 
-static int parse_pins3(WPMINFO const struct matrox_bios* bd) {
-	MINFO->limits.pixel.vcomax	=
-	MINFO->limits.system.vcomax	= (bd->pins[36] == 0xFF) ? 230000			: ((bd->pins[36] + 100) * 1000);
-	MINFO->values.reg.mctlwtst	= get_unaligned_le32(bd->pins + 48) == 0xFFFFFFFF ?
+static int parse_pins3(struct matrox_fb_info *minfo,
+		       const struct matrox_bios *bd)
+{
+	minfo->limits.pixel.vcomax	=
+	minfo->limits.system.vcomax	= (bd->pins[36] == 0xFF) ? 230000			: ((bd->pins[36] + 100) * 1000);
+	minfo->values.reg.mctlwtst	= get_unaligned_le32(bd->pins + 48) == 0xFFFFFFFF ?
 		0x01250A21 : get_unaligned_le32(bd->pins + 48);
 	/* memory config */
-	MINFO->values.reg.memrdbk	= ((bd->pins[57] << 21) & 0x1E000000) |
+	minfo->values.reg.memrdbk	= ((bd->pins[57] << 21) & 0x1E000000) |
 					  ((bd->pins[57] << 22) & 0x00C00000) |
 					  ((bd->pins[56] <<  1) & 0x000001E0) |
 					  ( bd->pins[56]        & 0x0000000F);
-	MINFO->values.reg.opt		= (bd->pins[54] & 7) << 10;
-	MINFO->values.reg.opt2		= bd->pins[58] << 12;
-	MINFO->features.pll.ref_freq	= (bd->pins[52] & 0x20) ? 14318 : 27000;
+	minfo->values.reg.opt		= (bd->pins[54] & 7) << 10;
+	minfo->values.reg.opt2		= bd->pins[58] << 12;
+	minfo->features.pll.ref_freq	= (bd->pins[52] & 0x20) ? 14318 : 27000;
 	return 0;
 }
 
-static void default_pins3(WPMINFO2) {
+static void default_pins3(struct matrox_fb_info *minfo)
+{
 	/* G100, G200 */
-	MINFO->limits.pixel.vcomax	=
-	MINFO->limits.system.vcomax	= 230000;
-	MINFO->values.reg.mctlwtst	= 0x01250A21;
-	MINFO->values.reg.memrdbk	= 0x00000000;
-	MINFO->values.reg.opt		= 0x00000C00;
-	MINFO->values.reg.opt2		= 0x00000000;
-	MINFO->features.pll.ref_freq	=  27000;
+	minfo->limits.pixel.vcomax	=
+	minfo->limits.system.vcomax	= 230000;
+	minfo->values.reg.mctlwtst	= 0x01250A21;
+	minfo->values.reg.memrdbk	= 0x00000000;
+	minfo->values.reg.opt		= 0x00000C00;
+	minfo->values.reg.opt2		= 0x00000000;
+	minfo->features.pll.ref_freq	=  27000;
 }
 
-static int parse_pins4(WPMINFO const struct matrox_bios* bd) {
-	MINFO->limits.pixel.vcomax	= (bd->pins[ 39] == 0xFF) ? 230000			: bd->pins[ 39] * 4000;
-	MINFO->limits.system.vcomax	= (bd->pins[ 38] == 0xFF) ? MINFO->limits.pixel.vcomax	: bd->pins[ 38] * 4000;
-	MINFO->values.reg.mctlwtst	= get_unaligned_le32(bd->pins + 71);
-	MINFO->values.reg.memrdbk	= ((bd->pins[87] << 21) & 0x1E000000) |
+static int parse_pins4(struct matrox_fb_info *minfo,
+		       const struct matrox_bios *bd)
+{
+	minfo->limits.pixel.vcomax	= (bd->pins[ 39] == 0xFF) ? 230000			: bd->pins[ 39] * 4000;
+	minfo->limits.system.vcomax	= (bd->pins[ 38] == 0xFF) ? minfo->limits.pixel.vcomax	: bd->pins[ 38] * 4000;
+	minfo->values.reg.mctlwtst	= get_unaligned_le32(bd->pins + 71);
+	minfo->values.reg.memrdbk	= ((bd->pins[87] << 21) & 0x1E000000) |
 					  ((bd->pins[87] << 22) & 0x00C00000) |
 					  ((bd->pins[86] <<  1) & 0x000001E0) |
 					  ( bd->pins[86]        & 0x0000000F);
-	MINFO->values.reg.opt		= ((bd->pins[53] << 15) & 0x00400000) |
+	minfo->values.reg.opt		= ((bd->pins[53] << 15) & 0x00400000) |
 					  ((bd->pins[53] << 22) & 0x10000000) |
 					  ((bd->pins[53] <<  7) & 0x00001C00);
-	MINFO->values.reg.opt3		= get_unaligned_le32(bd->pins + 67);
-	MINFO->values.pll.system	= (bd->pins[ 65] == 0xFF) ? 200000 			: bd->pins[ 65] * 4000;
-	MINFO->features.pll.ref_freq	= (bd->pins[ 92] & 0x01) ? 14318 : 27000;
+	minfo->values.reg.opt3		= get_unaligned_le32(bd->pins + 67);
+	minfo->values.pll.system	= (bd->pins[ 65] == 0xFF) ? 200000 			: bd->pins[ 65] * 4000;
+	minfo->features.pll.ref_freq	= (bd->pins[ 92] & 0x01) ? 14318 : 27000;
 	return 0;
 }
 
-static void default_pins4(WPMINFO2) {
+static void default_pins4(struct matrox_fb_info *minfo)
+{
 	/* G400 */
-	MINFO->limits.pixel.vcomax	=
-	MINFO->limits.system.vcomax	= 252000;
-	MINFO->values.reg.mctlwtst	= 0x04A450A1;
-	MINFO->values.reg.memrdbk	= 0x000000E7;
-	MINFO->values.reg.opt		= 0x10000400;
-	MINFO->values.reg.opt3		= 0x0190A419;
-	MINFO->values.pll.system	= 200000;
-	MINFO->features.pll.ref_freq	= 27000;
+	minfo->limits.pixel.vcomax	=
+	minfo->limits.system.vcomax	= 252000;
+	minfo->values.reg.mctlwtst	= 0x04A450A1;
+	minfo->values.reg.memrdbk	= 0x000000E7;
+	minfo->values.reg.opt		= 0x10000400;
+	minfo->values.reg.opt3		= 0x0190A419;
+	minfo->values.pll.system	= 200000;
+	minfo->features.pll.ref_freq	= 27000;
 }
 
-static int parse_pins5(WPMINFO const struct matrox_bios* bd) {
+static int parse_pins5(struct matrox_fb_info *minfo,
+		       const struct matrox_bios *bd)
+{
 	unsigned int mult;
 	
 	mult = bd->pins[4]?8000:6000;
 	
-	MINFO->limits.pixel.vcomax	= (bd->pins[ 38] == 0xFF) ? 600000			: bd->pins[ 38] * mult;
-	MINFO->limits.system.vcomax	= (bd->pins[ 36] == 0xFF) ? MINFO->limits.pixel.vcomax	: bd->pins[ 36] * mult;
-	MINFO->limits.video.vcomax	= (bd->pins[ 37] == 0xFF) ? MINFO->limits.system.vcomax	: bd->pins[ 37] * mult;
-	MINFO->limits.pixel.vcomin	= (bd->pins[123] == 0xFF) ? 256000			: bd->pins[123] * mult;
-	MINFO->limits.system.vcomin	= (bd->pins[121] == 0xFF) ? MINFO->limits.pixel.vcomin	: bd->pins[121] * mult;
-	MINFO->limits.video.vcomin	= (bd->pins[122] == 0xFF) ? MINFO->limits.system.vcomin	: bd->pins[122] * mult;
-	MINFO->values.pll.system	=
-	MINFO->values.pll.video		= (bd->pins[ 92] == 0xFF) ? 284000			: bd->pins[ 92] * 4000;
-	MINFO->values.reg.opt		= get_unaligned_le32(bd->pins + 48);
-	MINFO->values.reg.opt2		= get_unaligned_le32(bd->pins + 52);
-	MINFO->values.reg.opt3		= get_unaligned_le32(bd->pins + 94);
-	MINFO->values.reg.mctlwtst	= get_unaligned_le32(bd->pins + 98);
-	MINFO->values.reg.memmisc	= get_unaligned_le32(bd->pins + 102);
-	MINFO->values.reg.memrdbk	= get_unaligned_le32(bd->pins + 106);
-	MINFO->features.pll.ref_freq	= (bd->pins[110] & 0x01) ? 14318 : 27000;
-	MINFO->values.memory.ddr	= (bd->pins[114] & 0x60) == 0x20;
-	MINFO->values.memory.dll	= (bd->pins[115] & 0x02) != 0;
-	MINFO->values.memory.emrswen	= (bd->pins[115] & 0x01) != 0;
-	MINFO->values.reg.maccess	= MINFO->values.memory.emrswen ? 0x00004000 : 0x00000000;
+	minfo->limits.pixel.vcomax	= (bd->pins[ 38] == 0xFF) ? 600000			: bd->pins[ 38] * mult;
+	minfo->limits.system.vcomax	= (bd->pins[ 36] == 0xFF) ? minfo->limits.pixel.vcomax	: bd->pins[ 36] * mult;
+	minfo->limits.video.vcomax	= (bd->pins[ 37] == 0xFF) ? minfo->limits.system.vcomax	: bd->pins[ 37] * mult;
+	minfo->limits.pixel.vcomin	= (bd->pins[123] == 0xFF) ? 256000			: bd->pins[123] * mult;
+	minfo->limits.system.vcomin	= (bd->pins[121] == 0xFF) ? minfo->limits.pixel.vcomin	: bd->pins[121] * mult;
+	minfo->limits.video.vcomin	= (bd->pins[122] == 0xFF) ? minfo->limits.system.vcomin	: bd->pins[122] * mult;
+	minfo->values.pll.system	=
+	minfo->values.pll.video		= (bd->pins[ 92] == 0xFF) ? 284000			: bd->pins[ 92] * 4000;
+	minfo->values.reg.opt		= get_unaligned_le32(bd->pins + 48);
+	minfo->values.reg.opt2		= get_unaligned_le32(bd->pins + 52);
+	minfo->values.reg.opt3		= get_unaligned_le32(bd->pins + 94);
+	minfo->values.reg.mctlwtst	= get_unaligned_le32(bd->pins + 98);
+	minfo->values.reg.memmisc	= get_unaligned_le32(bd->pins + 102);
+	minfo->values.reg.memrdbk	= get_unaligned_le32(bd->pins + 106);
+	minfo->features.pll.ref_freq	= (bd->pins[110] & 0x01) ? 14318 : 27000;
+	minfo->values.memory.ddr	= (bd->pins[114] & 0x60) == 0x20;
+	minfo->values.memory.dll	= (bd->pins[115] & 0x02) != 0;
+	minfo->values.memory.emrswen	= (bd->pins[115] & 0x01) != 0;
+	minfo->values.reg.maccess	= minfo->values.memory.emrswen ? 0x00004000 : 0x00000000;
 	if (bd->pins[115] & 4) {
-		MINFO->values.reg.mctlwtst_core = MINFO->values.reg.mctlwtst;
+		minfo->values.reg.mctlwtst_core = minfo->values.reg.mctlwtst;
 	} else {
 		u_int32_t wtst_xlat[] = { 0, 1, 5, 6, 7, 5, 2, 3 };
-		MINFO->values.reg.mctlwtst_core = (MINFO->values.reg.mctlwtst & ~7) |
-		                                  wtst_xlat[MINFO->values.reg.mctlwtst & 7];
+		minfo->values.reg.mctlwtst_core = (minfo->values.reg.mctlwtst & ~7) |
+						  wtst_xlat[minfo->values.reg.mctlwtst & 7];
 	}
-	MINFO->max_pixel_clock_panellink = bd->pins[47] * 4000;
+	minfo->max_pixel_clock_panellink = bd->pins[47] * 4000;
 	return 0;
 }
 
-static void default_pins5(WPMINFO2) {
+static void default_pins5(struct matrox_fb_info *minfo)
+{
 	/* Mine 16MB G450 with SDRAM DDR */
-	MINFO->limits.pixel.vcomax	=
-	MINFO->limits.system.vcomax	=
-	MINFO->limits.video.vcomax	= 600000;
-	MINFO->limits.pixel.vcomin	=
-	MINFO->limits.system.vcomin	=
-	MINFO->limits.video.vcomin	= 256000;
-	MINFO->values.pll.system	=
-	MINFO->values.pll.video		= 284000;
-	MINFO->values.reg.opt		= 0x404A1160;
-	MINFO->values.reg.opt2		= 0x0000AC00;
-	MINFO->values.reg.opt3		= 0x0090A409;
-	MINFO->values.reg.mctlwtst_core	=
-	MINFO->values.reg.mctlwtst	= 0x0C81462B;
-	MINFO->values.reg.memmisc	= 0x80000004;
-	MINFO->values.reg.memrdbk	= 0x01001103;
-	MINFO->features.pll.ref_freq	= 27000;
-	MINFO->values.memory.ddr	= 1;
-	MINFO->values.memory.dll	= 1;
-	MINFO->values.memory.emrswen	= 1;
-	MINFO->values.reg.maccess	= 0x00004000;
+	minfo->limits.pixel.vcomax	=
+	minfo->limits.system.vcomax	=
+	minfo->limits.video.vcomax	= 600000;
+	minfo->limits.pixel.vcomin	=
+	minfo->limits.system.vcomin	=
+	minfo->limits.video.vcomin	= 256000;
+	minfo->values.pll.system	=
+	minfo->values.pll.video		= 284000;
+	minfo->values.reg.opt		= 0x404A1160;
+	minfo->values.reg.opt2		= 0x0000AC00;
+	minfo->values.reg.opt3		= 0x0090A409;
+	minfo->values.reg.mctlwtst_core	=
+	minfo->values.reg.mctlwtst	= 0x0C81462B;
+	minfo->values.reg.memmisc	= 0x80000004;
+	minfo->values.reg.memrdbk	= 0x01001103;
+	minfo->features.pll.ref_freq	= 27000;
+	minfo->values.memory.ddr	= 1;
+	minfo->values.memory.dll	= 1;
+	minfo->values.memory.emrswen	= 1;
+	minfo->values.reg.maccess	= 0x00004000;
 }
 
-static int matroxfb_set_limits(WPMINFO const struct matrox_bios* bd) {
+static int matroxfb_set_limits(struct matrox_fb_info *minfo,
+			       const struct matrox_bios *bd)
+{
 	unsigned int pins_version;
 	static const unsigned int pinslen[] = { 64, 64, 64, 128, 128 };
 
-	switch (ACCESS_FBINFO(chip)) {
-		case MGA_2064:	default_pins1(PMINFO2); break;
+	switch (minfo->chip) {
+		case MGA_2064:	default_pins1(minfo); break;
 		case MGA_2164:
 		case MGA_1064:
-		case MGA_1164:	default_pins2(PMINFO2); break;
+		case MGA_1164:	default_pins2(minfo); break;
 		case MGA_G100:
-		case MGA_G200:	default_pins3(PMINFO2); break;
-		case MGA_G400:	default_pins4(PMINFO2); break;
+		case MGA_G200:	default_pins3(minfo); break;
+		case MGA_G400:	default_pins4(minfo); break;
 		case MGA_G450:
-		case MGA_G550:	default_pins5(PMINFO2); break;
+		case MGA_G550:	default_pins5(minfo); break;
 	}
 	if (!bd->bios_valid) {
 		printk(KERN_INFO "matroxfb: Your Matrox device does not have BIOS\n");
@@ -724,38 +745,39 @@
 	}
 	switch (pins_version) {
 		case 1:
-			return parse_pins1(PMINFO bd);
+			return parse_pins1(minfo, bd);
 		case 2:
-			return parse_pins2(PMINFO bd);
+			return parse_pins2(minfo, bd);
 		case 3:
-			return parse_pins3(PMINFO bd);
+			return parse_pins3(minfo, bd);
 		case 4:
-			return parse_pins4(PMINFO bd);
+			return parse_pins4(minfo, bd);
 		case 5:
-			return parse_pins5(PMINFO bd);
+			return parse_pins5(minfo, bd);
 		default:
 			printk(KERN_DEBUG "matroxfb: Powerup info version %u is not yet supported\n", pins_version);
 			return -1;
 	}
 }
 
-void matroxfb_read_pins(WPMINFO2) {
+void matroxfb_read_pins(struct matrox_fb_info *minfo)
+{
 	u32 opt;
 	u32 biosbase;
 	u32 fbbase;
-	struct pci_dev* pdev = ACCESS_FBINFO(pcidev);
+	struct pci_dev *pdev = minfo->pcidev;
 	
-	memset(&ACCESS_FBINFO(bios), 0, sizeof(ACCESS_FBINFO(bios)));
+	memset(&minfo->bios, 0, sizeof(minfo->bios));
 	pci_read_config_dword(pdev, PCI_OPTION_REG, &opt);
 	pci_write_config_dword(pdev, PCI_OPTION_REG, opt | PCI_OPTION_ENABLE_ROM);
 	pci_read_config_dword(pdev, PCI_ROM_ADDRESS, &biosbase);
-	pci_read_config_dword(pdev, ACCESS_FBINFO(devflags.fbResource), &fbbase);
+	pci_read_config_dword(pdev, minfo->devflags.fbResource, &fbbase);
 	pci_write_config_dword(pdev, PCI_ROM_ADDRESS, (fbbase & PCI_ROM_ADDRESS_MASK) | PCI_ROM_ADDRESS_ENABLE);
-	parse_bios(vaddr_va(ACCESS_FBINFO(video).vbase), &ACCESS_FBINFO(bios));
+	parse_bios(vaddr_va(minfo->video.vbase), &minfo->bios);
 	pci_write_config_dword(pdev, PCI_ROM_ADDRESS, biosbase);
 	pci_write_config_dword(pdev, PCI_OPTION_REG, opt);
 #ifdef CONFIG_X86
-	if (!ACCESS_FBINFO(bios).bios_valid) {
+	if (!minfo->bios.bios_valid) {
 		unsigned char __iomem* b;
 
 		b = ioremap(0x000C0000, 65536);
@@ -769,25 +791,21 @@
 				printk(KERN_INFO "matroxfb: Legacy BIOS is for %04X:%04X, while this device is %04X:%04X\n",
 					ven, dev, pdev->vendor, pdev->device);
 			} else {
-				parse_bios(b, &ACCESS_FBINFO(bios));
+				parse_bios(b, &minfo->bios);
 			}
 			iounmap(b);
 		}
 	}
 #endif
-	matroxfb_set_limits(PMINFO &ACCESS_FBINFO(bios));
+	matroxfb_set_limits(minfo, &minfo->bios);
 	printk(KERN_INFO "PInS memtype = %u\n",
-	       (ACCESS_FBINFO(values).reg.opt & 0x1C00) >> 10);
+	       (minfo->values.reg.opt & 0x1C00) >> 10);
 }
 
 EXPORT_SYMBOL(matroxfb_DAC_in);
 EXPORT_SYMBOL(matroxfb_DAC_out);
 EXPORT_SYMBOL(matroxfb_var2my);
 EXPORT_SYMBOL(matroxfb_PLL_calcclock);
-#ifndef CONFIG_FB_MATROX_MULTIHEAD
-struct matrox_fb_info matroxfb_global_mxinfo;
-EXPORT_SYMBOL(matroxfb_global_mxinfo);
-#endif
 EXPORT_SYMBOL(matroxfb_vgaHWinit);		/* DAC1064, Ti3026 */
 EXPORT_SYMBOL(matroxfb_vgaHWrestore);		/* DAC1064, Ti3026 */
 EXPORT_SYMBOL(matroxfb_read_pins);
diff --git a/drivers/video/matrox/matroxfb_misc.h b/drivers/video/matrox/matroxfb_misc.h
index cb62cc0..351c823 100644
--- a/drivers/video/matrox/matroxfb_misc.h
+++ b/drivers/video/matrox/matroxfb_misc.h
@@ -6,13 +6,16 @@
 /* also for modules */
 int matroxfb_PLL_calcclock(const struct matrox_pll_features* pll, unsigned int freq, unsigned int fmax,
 	unsigned int* in, unsigned int* feed, unsigned int* post);
-static inline int PLL_calcclock(CPMINFO unsigned int freq, unsigned int fmax,
-		unsigned int* in, unsigned int* feed, unsigned int* post) {
-	return matroxfb_PLL_calcclock(&ACCESS_FBINFO(features.pll), freq, fmax, in, feed, post);
+static inline int PLL_calcclock(const struct matrox_fb_info *minfo,
+				unsigned int freq, unsigned int fmax,
+				unsigned int *in, unsigned int *feed,
+				unsigned int *post)
+{
+	return matroxfb_PLL_calcclock(&minfo->features.pll, freq, fmax, in, feed, post);
 }
 
-int matroxfb_vgaHWinit(WPMINFO struct my_timming* m);
-void matroxfb_vgaHWrestore(WPMINFO2);
-void matroxfb_read_pins(WPMINFO2);
+int matroxfb_vgaHWinit(struct matrox_fb_info *minfo, struct my_timming* m);
+void matroxfb_vgaHWrestore(struct matrox_fb_info *minfo);
+void matroxfb_read_pins(struct matrox_fb_info *minfo);
 
 #endif	/* __MATROXFB_MISC_H__ */
diff --git a/drivers/video/msm/Makefile b/drivers/video/msm/Makefile
new file mode 100644
index 0000000..802d6ae
--- /dev/null
+++ b/drivers/video/msm/Makefile
@@ -0,0 +1,19 @@
+
+# core framebuffer
+#
+obj-y := msm_fb.o
+
+# MDP DMA/PPP engine
+#
+obj-y += mdp.o mdp_scale_tables.o mdp_ppp.o
+
+# MDDI interface
+#
+obj-y += mddi.o
+
+# MDDI client/panel drivers
+#
+obj-y += mddi_client_dummy.o
+obj-y += mddi_client_toshiba.o
+obj-y += mddi_client_nt35399.o
+
diff --git a/drivers/video/msm/mddi.c b/drivers/video/msm/mddi.c
new file mode 100644
index 0000000..f2de5a1
--- /dev/null
+++ b/drivers/video/msm/mddi.c
@@ -0,0 +1,828 @@
+/*
+ * MSM MDDI Transport
+ *
+ * Copyright (C) 2007 Google Incorporated
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.	 See the
+ * GNU General Public License for more details.
+ *
+ */
+
+#include <linux/module.h>
+#include <linux/kernel.h>
+#include <linux/dma-mapping.h>
+#include <linux/interrupt.h>
+#include <linux/platform_device.h>
+#include <linux/delay.h>
+#include <linux/spinlock.h>
+#include <linux/clk.h>
+#include <linux/io.h>
+#include <mach/msm_iomap.h>
+#include <mach/irqs.h>
+#include <mach/board.h>
+#include <linux/delay.h>
+
+#include <mach/msm_fb.h>
+#include "mddi_hw.h"
+
+#define FLAG_DISABLE_HIBERNATION 0x0001
+#define FLAG_HAVE_CAPS		 0x0002
+#define FLAG_HAS_VSYNC_IRQ	 0x0004
+#define FLAG_HAVE_STATUS	 0x0008
+
+#define CMD_GET_CLIENT_CAP     0x0601
+#define CMD_GET_CLIENT_STATUS  0x0602
+
+union mddi_rev {
+	unsigned char raw[MDDI_REV_BUFFER_SIZE];
+	struct mddi_rev_packet hdr;
+	struct mddi_client_status status;
+	struct mddi_client_caps caps;
+	struct mddi_register_access reg;
+};
+
+struct reg_read_info {
+	struct completion done;
+	uint32_t reg;
+	uint32_t status;
+	uint32_t result;
+};
+
+struct mddi_info {
+	uint16_t flags;
+	uint16_t version;
+	char __iomem *base;
+	int irq;
+	struct clk *clk;
+	struct msm_mddi_client_data client_data;
+
+	/* buffer for rev encap packets */
+	void *rev_data;
+	dma_addr_t rev_addr;
+	struct mddi_llentry *reg_write_data;
+	dma_addr_t reg_write_addr;
+	struct mddi_llentry *reg_read_data;
+	dma_addr_t reg_read_addr;
+	size_t rev_data_curr;
+
+	spinlock_t int_lock;
+	uint32_t int_enable;
+	uint32_t got_int;
+	wait_queue_head_t int_wait;
+
+	struct mutex reg_write_lock;
+	struct mutex reg_read_lock;
+	struct reg_read_info *reg_read;
+
+	struct mddi_client_caps caps;
+	struct mddi_client_status status;
+
+	void (*power_client)(struct msm_mddi_client_data *, int);
+
+	/* client device published to bind us to the
+	 * appropriate mddi_client driver
+	 */
+	char client_name[20];
+
+	struct platform_device client_pdev;
+};
+
+static void mddi_init_rev_encap(struct mddi_info *mddi);
+
+#define mddi_readl(r) readl(mddi->base + (MDDI_##r))
+#define mddi_writel(v, r) writel((v), mddi->base + (MDDI_##r))
+
+void mddi_activate_link(struct msm_mddi_client_data *cdata)
+{
+	struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+					      client_data);
+
+	mddi_writel(MDDI_CMD_LINK_ACTIVE, CMD);
+}
+
+static void mddi_handle_link_list_done(struct mddi_info *mddi)
+{
+}
+
+static void mddi_reset_rev_encap_ptr(struct mddi_info *mddi)
+{
+	printk(KERN_INFO "mddi: resetting rev ptr\n");
+	mddi->rev_data_curr = 0;
+	mddi_writel(mddi->rev_addr, REV_PTR);
+	mddi_writel(mddi->rev_addr, REV_PTR);
+	mddi_writel(MDDI_CMD_FORCE_NEW_REV_PTR, CMD);
+}
+
+static void mddi_handle_rev_data(struct mddi_info *mddi, union mddi_rev *rev)
+{
+	int i;
+	struct reg_read_info *ri;
+
+	if ((rev->hdr.length <= MDDI_REV_BUFFER_SIZE - 2) &&
+	   (rev->hdr.length >= sizeof(struct mddi_rev_packet) - 2)) {
+
+		switch (rev->hdr.type) {
+		case TYPE_CLIENT_CAPS:
+			memcpy(&mddi->caps, &rev->caps,
+			       sizeof(struct mddi_client_caps));
+			mddi->flags |= FLAG_HAVE_CAPS;
+			wake_up(&mddi->int_wait);
+			break;
+		case TYPE_CLIENT_STATUS:
+			memcpy(&mddi->status, &rev->status,
+			       sizeof(struct mddi_client_status));
+			mddi->flags |= FLAG_HAVE_STATUS;
+			wake_up(&mddi->int_wait);
+			break;
+		case TYPE_REGISTER_ACCESS:
+			ri = mddi->reg_read;
+			if (ri == 0) {
+				printk(KERN_INFO "rev: got reg %x = %x without "
+						 " pending read\n",
+				       rev->reg.register_address,
+				       rev->reg.register_data_list);
+				break;
+			}
+			if (ri->reg != rev->reg.register_address) {
+				printk(KERN_INFO "rev: got reg %x = %x for "
+						 "wrong register, expected "
+						 "%x\n",
+				       rev->reg.register_address,
+				       rev->reg.register_data_list, ri->reg);
+				break;
+			}
+			mddi->reg_read = NULL;
+			ri->status = 0;
+			ri->result = rev->reg.register_data_list;
+			complete(&ri->done);
+			break;
+		default:
+			printk(KERN_INFO "rev: unknown reverse packet: "
+					 "len=%04x type=%04x CURR_REV_PTR=%x\n",
+			       rev->hdr.length, rev->hdr.type,
+			       mddi_readl(CURR_REV_PTR));
+			for (i = 0; i < rev->hdr.length + 2; i++) {
+				if ((i % 16) == 0)
+					printk(KERN_INFO "\n");
+				printk(KERN_INFO " %02x", rev->raw[i]);
+			}
+			printk(KERN_INFO "\n");
+			mddi_reset_rev_encap_ptr(mddi);
+		}
+	} else {
+		printk(KERN_INFO "bad rev length, %d, CURR_REV_PTR %x\n",
+		       rev->hdr.length, mddi_readl(CURR_REV_PTR));
+		mddi_reset_rev_encap_ptr(mddi);
+	}
+}
+
+static void mddi_wait_interrupt(struct mddi_info *mddi, uint32_t intmask);
+
+static void mddi_handle_rev_data_avail(struct mddi_info *mddi)
+{
+	union mddi_rev *rev = mddi->rev_data;
+	uint32_t rev_data_count;
+	uint32_t rev_crc_err_count;
+	int i;
+	struct reg_read_info *ri;
+	size_t prev_offset;
+	uint16_t length;
+
+	union mddi_rev *crev = mddi->rev_data + mddi->rev_data_curr;
+
+	/* clear the interrupt */
+	mddi_writel(MDDI_INT_REV_DATA_AVAIL, INT);
+	rev_data_count = mddi_readl(REV_PKT_CNT);
+	rev_crc_err_count = mddi_readl(REV_CRC_ERR);
+	if (rev_data_count > 1)
+		printk(KERN_INFO "rev_data_count %d\n", rev_data_count);
+
+	if (rev_crc_err_count) {
+		printk(KERN_INFO "rev_crc_err_count %d, INT %x\n",
+		       rev_crc_err_count,  mddi_readl(INT));
+		ri = mddi->reg_read;
+		if (ri == 0) {
+			printk(KERN_INFO "rev: got crc error without pending "
+			       "read\n");
+		} else {
+			mddi->reg_read = NULL;
+			ri->status = -EIO;
+			ri->result = -1;
+			complete(&ri->done);
+		}
+	}
+
+	if (rev_data_count == 0)
+		return;
+
+	prev_offset = mddi->rev_data_curr;
+
+	length = *((uint8_t *)mddi->rev_data + mddi->rev_data_curr);
+	mddi->rev_data_curr++;
+	if (mddi->rev_data_curr == MDDI_REV_BUFFER_SIZE)
+		mddi->rev_data_curr = 0;
+	length += *((uint8_t *)mddi->rev_data + mddi->rev_data_curr) << 8;
+	mddi->rev_data_curr += 1 + length;
+	if (mddi->rev_data_curr >= MDDI_REV_BUFFER_SIZE)
+		mddi->rev_data_curr =
+			mddi->rev_data_curr % MDDI_REV_BUFFER_SIZE;
+
+	if (length > MDDI_REV_BUFFER_SIZE - 2) {
+		printk(KERN_INFO "mddi: rev data length greater than buffer"
+			"size\n");
+		mddi_reset_rev_encap_ptr(mddi);
+		return;
+	}
+
+	if (prev_offset + 2 + length >= MDDI_REV_BUFFER_SIZE) {
+		union mddi_rev tmprev;
+		size_t rem = MDDI_REV_BUFFER_SIZE - prev_offset;
+		memcpy(&tmprev.raw[0], mddi->rev_data + prev_offset, rem);
+		memcpy(&tmprev.raw[rem], mddi->rev_data, 2 + length - rem);
+		mddi_handle_rev_data(mddi, &tmprev);
+	} else {
+		mddi_handle_rev_data(mddi, crev);
+	}
+
+	if (prev_offset < MDDI_REV_BUFFER_SIZE / 2 &&
+	    mddi->rev_data_curr >= MDDI_REV_BUFFER_SIZE / 2) {
+		mddi_writel(mddi->rev_addr, REV_PTR);
+	}
+}
+
+static irqreturn_t mddi_isr(int irq, void *data)
+{
+	struct msm_mddi_client_data *cdata = data;
+	struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+					      client_data);
+	uint32_t active, status;
+
+	spin_lock(&mddi->int_lock);
+
+	active = mddi_readl(INT);
+	status = mddi_readl(STAT);
+
+	mddi_writel(active, INT);
+
+	/* ignore any interrupts we have disabled */
+	active &= mddi->int_enable;
+
+	mddi->got_int |= active;
+	wake_up(&mddi->int_wait);
+
+	if (active & MDDI_INT_PRI_LINK_LIST_DONE) {
+		mddi->int_enable &= (~MDDI_INT_PRI_LINK_LIST_DONE);
+		mddi_handle_link_list_done(mddi);
+	}
+	if (active & MDDI_INT_REV_DATA_AVAIL)
+		mddi_handle_rev_data_avail(mddi);
+
+	if (active & ~MDDI_INT_NEED_CLEAR)
+		mddi->int_enable &= ~(active & ~MDDI_INT_NEED_CLEAR);
+
+	if (active & MDDI_INT_LINK_ACTIVE) {
+		mddi->int_enable &= (~MDDI_INT_LINK_ACTIVE);
+		mddi->int_enable |= MDDI_INT_IN_HIBERNATION;
+	}
+
+	if (active & MDDI_INT_IN_HIBERNATION) {
+		mddi->int_enable &= (~MDDI_INT_IN_HIBERNATION);
+		mddi->int_enable |= MDDI_INT_LINK_ACTIVE;
+	}
+
+	mddi_writel(mddi->int_enable, INTEN);
+	spin_unlock(&mddi->int_lock);
+
+	return IRQ_HANDLED;
+}
+
+static long mddi_wait_interrupt_timeout(struct mddi_info *mddi,
+					uint32_t intmask, int timeout)
+{
+	unsigned long irq_flags;
+
+	spin_lock_irqsave(&mddi->int_lock, irq_flags);
+	mddi->got_int &= ~intmask;
+	mddi->int_enable |= intmask;
+	mddi_writel(mddi->int_enable, INTEN);
+	spin_unlock_irqrestore(&mddi->int_lock, irq_flags);
+	return wait_event_timeout(mddi->int_wait, mddi->got_int & intmask,
+				  timeout);
+}
+
+static void mddi_wait_interrupt(struct mddi_info *mddi, uint32_t intmask)
+{
+	if (mddi_wait_interrupt_timeout(mddi, intmask, HZ/10) == 0)
+		printk(KERN_INFO KERN_ERR "mddi_wait_interrupt %d, timeout "
+		       "waiting for %x, INT = %x, STAT = %x gotint = %x\n",
+		       current->pid, intmask, mddi_readl(INT), mddi_readl(STAT),
+		       mddi->got_int);
+}
+
+static void mddi_init_rev_encap(struct mddi_info *mddi)
+{
+	memset(mddi->rev_data, 0xee, MDDI_REV_BUFFER_SIZE);
+	mddi_writel(mddi->rev_addr, REV_PTR);
+	mddi_writel(MDDI_CMD_FORCE_NEW_REV_PTR, CMD);
+	mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+}
+
+void mddi_set_auto_hibernate(struct msm_mddi_client_data *cdata, int on)
+{
+	struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+					      client_data);
+	mddi_writel(MDDI_CMD_POWERDOWN, CMD);
+	mddi_wait_interrupt(mddi, MDDI_INT_IN_HIBERNATION);
+	mddi_writel(MDDI_CMD_HIBERNATE | !!on, CMD);
+	mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+}
+
+
+static uint16_t mddi_init_registers(struct mddi_info *mddi)
+{
+	mddi_writel(0x0001, VERSION);
+	mddi_writel(MDDI_HOST_BYTES_PER_SUBFRAME, BPS);
+	mddi_writel(0x0003, SPM); /* subframes per media */
+	mddi_writel(0x0005, TA1_LEN);
+	mddi_writel(MDDI_HOST_TA2_LEN, TA2_LEN);
+	mddi_writel(0x0096, DRIVE_HI);
+	/* 0x32 normal, 0x50 for Toshiba display */
+	mddi_writel(0x0050, DRIVE_LO);
+	mddi_writel(0x003C, DISP_WAKE); /* wakeup counter */
+	mddi_writel(MDDI_HOST_REV_RATE_DIV, REV_RATE_DIV);
+
+	mddi_writel(MDDI_REV_BUFFER_SIZE, REV_SIZE);
+	mddi_writel(MDDI_MAX_REV_PKT_SIZE, REV_ENCAP_SZ);
+
+	/* disable periodic rev encap */
+	mddi_writel(MDDI_CMD_PERIODIC_REV_ENCAP, CMD);
+	mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+
+	if (mddi_readl(PAD_CTL) == 0) {
+		/* If we are turning on band gap, need to wait 5us before
+		 * turning on the rest of the PAD */
+		mddi_writel(0x08000, PAD_CTL);
+		udelay(5);
+	}
+
+	/* Recommendation from PAD hw team */
+	mddi_writel(0xa850f, PAD_CTL);
+
+
+	/* Need an even number for counts */
+	mddi_writel(0x60006, DRIVER_START_CNT);
+
+	mddi_set_auto_hibernate(&mddi->client_data, 0);
+
+	mddi_writel(MDDI_CMD_DISP_IGNORE, CMD);
+	mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+
+	mddi_init_rev_encap(mddi);
+	return mddi_readl(CORE_VER) & 0xffff;
+}
+
+static void mddi_suspend(struct msm_mddi_client_data *cdata)
+{
+	struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+					      client_data);
+	/* turn off the client */
+	if (mddi->power_client)
+		mddi->power_client(&mddi->client_data, 0);
+	/* turn off the link */
+	mddi_writel(MDDI_CMD_RESET, CMD);
+	mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+	/* turn off the clock */
+	clk_disable(mddi->clk);
+}
+
+static void mddi_resume(struct msm_mddi_client_data *cdata)
+{
+	struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+					      client_data);
+	mddi_set_auto_hibernate(&mddi->client_data, 0);
+	/* turn on the client */
+	if (mddi->power_client)
+		mddi->power_client(&mddi->client_data, 1);
+	/* turn on the clock */
+	clk_enable(mddi->clk);
+	/* set up the local registers */
+	mddi->rev_data_curr = 0;
+	mddi_init_registers(mddi);
+	mddi_writel(mddi->int_enable, INTEN);
+	mddi_writel(MDDI_CMD_LINK_ACTIVE, CMD);
+	mddi_writel(MDDI_CMD_SEND_RTD, CMD);
+	mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+	mddi_set_auto_hibernate(&mddi->client_data, 1);
+}
+
+static int __init mddi_get_client_caps(struct mddi_info *mddi)
+{
+	int i, j;
+
+	/* clear any stale interrupts */
+	mddi_writel(0xffffffff, INT);
+
+	mddi->int_enable = MDDI_INT_LINK_ACTIVE |
+			   MDDI_INT_IN_HIBERNATION |
+			   MDDI_INT_PRI_LINK_LIST_DONE |
+			   MDDI_INT_REV_DATA_AVAIL |
+			   MDDI_INT_REV_OVERFLOW |
+			   MDDI_INT_REV_OVERWRITE |
+			   MDDI_INT_RTD_FAILURE;
+	mddi_writel(mddi->int_enable, INTEN);
+
+	mddi_writel(MDDI_CMD_LINK_ACTIVE, CMD);
+	mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+
+	for (j = 0; j < 3; j++) {
+		/* the toshiba vga panel does not respond to get
+		 * caps unless you SEND_RTD, but the first SEND_RTD
+		 * will fail...
+		 */
+		for (i = 0; i < 4; i++) {
+			uint32_t stat;
+
+			mddi_writel(MDDI_CMD_SEND_RTD, CMD);
+			mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+			stat = mddi_readl(STAT);
+			printk(KERN_INFO "mddi cmd send rtd: int %x, stat %x, "
+					"rtd val %x\n", mddi_readl(INT), stat,
+					mddi_readl(RTD_VAL));
+			if ((stat & MDDI_STAT_RTD_MEAS_FAIL) == 0)
+				break;
+			msleep(1);
+		}
+
+		mddi_writel(CMD_GET_CLIENT_CAP, CMD);
+		mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+		wait_event_timeout(mddi->int_wait, mddi->flags & FLAG_HAVE_CAPS,
+				   HZ / 100);
+
+		if (mddi->flags & FLAG_HAVE_CAPS)
+			break;
+		printk(KERN_INFO KERN_ERR "mddi_init, timeout waiting for "
+				"caps\n");
+	}
+	return mddi->flags & FLAG_HAVE_CAPS;
+}
+
+/* link must be active when this is called */
+int mddi_check_status(struct mddi_info *mddi)
+{
+	int ret = -1, retry = 3;
+	mutex_lock(&mddi->reg_read_lock);
+	mddi_writel(MDDI_CMD_PERIODIC_REV_ENCAP | 1, CMD);
+	mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+
+	do {
+		mddi->flags &= ~FLAG_HAVE_STATUS;
+		mddi_writel(CMD_GET_CLIENT_STATUS, CMD);
+		mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+		wait_event_timeout(mddi->int_wait,
+				   mddi->flags & FLAG_HAVE_STATUS,
+				   HZ / 100);
+
+		if (mddi->flags & FLAG_HAVE_STATUS) {
+			if (mddi->status.crc_error_count)
+				printk(KERN_INFO "mddi status: crc_error "
+					"count: %d\n",
+					mddi->status.crc_error_count);
+			else
+				ret = 0;
+			break;
+		} else
+			printk(KERN_INFO "mddi status: failed to get client "
+				"status\n");
+		mddi_writel(MDDI_CMD_SEND_RTD, CMD);
+		mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+	} while (--retry);
+
+	mddi_writel(MDDI_CMD_PERIODIC_REV_ENCAP | 0, CMD);
+	mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+	mutex_unlock(&mddi->reg_read_lock);
+	return ret;
+}
+
+
+void mddi_remote_write(struct msm_mddi_client_data *cdata, uint32_t val,
+		       uint32_t reg)
+{
+	struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+					      client_data);
+	struct mddi_llentry *ll;
+	struct mddi_register_access *ra;
+
+	mutex_lock(&mddi->reg_write_lock);
+
+	ll = mddi->reg_write_data;
+
+	ra = &(ll->u.r);
+	ra->length = 14 + 4;
+	ra->type = TYPE_REGISTER_ACCESS;
+	ra->client_id = 0;
+	ra->read_write_info = MDDI_WRITE | 1;
+	ra->crc16 = 0;
+
+	ra->register_address = reg;
+	ra->register_data_list = val;
+
+	ll->flags = 1;
+	ll->header_count = 14;
+	ll->data_count = 4;
+	ll->data = mddi->reg_write_addr + offsetof(struct mddi_llentry,
+						   u.r.register_data_list);
+	ll->next = 0;
+	ll->reserved = 0;
+
+	mddi_writel(mddi->reg_write_addr, PRI_PTR);
+
+	mddi_wait_interrupt(mddi, MDDI_INT_PRI_LINK_LIST_DONE);
+	mutex_unlock(&mddi->reg_write_lock);
+}
+
+uint32_t mddi_remote_read(struct msm_mddi_client_data *cdata, uint32_t reg)
+{
+	struct mddi_info *mddi = container_of(cdata, struct mddi_info,
+					      client_data);
+	struct mddi_llentry *ll;
+	struct mddi_register_access *ra;
+	struct reg_read_info ri;
+	unsigned s;
+	int retry_count = 2;
+	unsigned long irq_flags;
+
+	mutex_lock(&mddi->reg_read_lock);
+
+	ll = mddi->reg_read_data;
+
+	ra = &(ll->u.r);
+	ra->length = 14;
+	ra->type = TYPE_REGISTER_ACCESS;
+	ra->client_id = 0;
+	ra->read_write_info = MDDI_READ | 1;
+	ra->crc16 = 0;
+
+	ra->register_address = reg;
+
+	ll->flags = 0x11;
+	ll->header_count = 14;
+	ll->data_count = 0;
+	ll->data = 0;
+	ll->next = 0;
+	ll->reserved = 0;
+
+	s = mddi_readl(STAT);
+
+	ri.reg = reg;
+	ri.status = -1;
+
+	do {
+		init_completion(&ri.done);
+		mddi->reg_read = &ri;
+		mddi_writel(mddi->reg_read_addr, PRI_PTR);
+
+		mddi_wait_interrupt(mddi, MDDI_INT_PRI_LINK_LIST_DONE);
+
+		/* Enable Periodic Reverse Encapsulation. */
+		mddi_writel(MDDI_CMD_PERIODIC_REV_ENCAP | 1, CMD);
+		mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+		if (wait_for_completion_timeout(&ri.done, HZ/10) == 0 &&
+		    !ri.done.done) {
+			printk(KERN_INFO "mddi_remote_read(%x) timeout "
+					 "(%d %d %d)\n",
+			       reg, ri.status, ri.result, ri.done.done);
+			spin_lock_irqsave(&mddi->int_lock, irq_flags);
+			mddi->reg_read = NULL;
+			spin_unlock_irqrestore(&mddi->int_lock, irq_flags);
+			ri.status = -1;
+			ri.result = -1;
+		}
+		if (ri.status == 0)
+			break;
+
+		mddi_writel(MDDI_CMD_SEND_RTD, CMD);
+		mddi_writel(MDDI_CMD_LINK_ACTIVE, CMD);
+		mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+		printk(KERN_INFO "mddi_remote_read: failed, sent "
+		       "MDDI_CMD_SEND_RTD: int %x, stat %x, rtd val %x "
+		       "curr_rev_ptr %x\n", mddi_readl(INT), mddi_readl(STAT),
+		       mddi_readl(RTD_VAL), mddi_readl(CURR_REV_PTR));
+	} while (retry_count-- > 0);
+	/* Disable Periodic Reverse Encapsulation. */
+	mddi_writel(MDDI_CMD_PERIODIC_REV_ENCAP | 0, CMD);
+	mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+	mddi->reg_read = NULL;
+	mutex_unlock(&mddi->reg_read_lock);
+	return ri.result;
+}
+
+static struct mddi_info mddi_info[2];
+
+static int __init mddi_clk_setup(struct platform_device *pdev,
+				 struct mddi_info *mddi,
+				 unsigned long clk_rate)
+{
+	int ret;
+
+	/* set up the clocks */
+	mddi->clk = clk_get(&pdev->dev, "mddi_clk");
+	if (IS_ERR(mddi->clk)) {
+		printk(KERN_INFO "mddi: failed to get clock\n");
+		return PTR_ERR(mddi->clk);
+	}
+	ret =  clk_enable(mddi->clk);
+	if (ret)
+		goto fail;
+	ret = clk_set_rate(mddi->clk, clk_rate);
+	if (ret)
+		goto fail;
+	return 0;
+
+fail:
+	clk_put(mddi->clk);
+	return ret;
+}
+
+static int __init mddi_rev_data_setup(struct mddi_info *mddi)
+{
+	void *dma;
+	dma_addr_t dma_addr;
+
+	/* set up dma buffer */
+	dma = dma_alloc_coherent(NULL, 0x1000, &dma_addr, GFP_KERNEL);
+	if (dma == 0)
+		return -ENOMEM;
+	mddi->rev_data = dma;
+	mddi->rev_data_curr = 0;
+	mddi->rev_addr = dma_addr;
+	mddi->reg_write_data = dma + MDDI_REV_BUFFER_SIZE;
+	mddi->reg_write_addr = dma_addr + MDDI_REV_BUFFER_SIZE;
+	mddi->reg_read_data = mddi->reg_write_data + 1;
+	mddi->reg_read_addr = mddi->reg_write_addr +
+			      sizeof(*mddi->reg_write_data);
+	return 0;
+}
+
+static int __init mddi_probe(struct platform_device *pdev)
+{
+	struct msm_mddi_platform_data *pdata = pdev->dev.platform_data;
+	struct mddi_info *mddi = &mddi_info[pdev->id];
+	struct resource *resource;
+	int ret, i;
+
+	resource = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+	if (!resource) {
+		printk(KERN_ERR "mddi: no associated mem resource!\n");
+		return -ENOMEM;
+	}
+	mddi->base = ioremap(resource->start, resource->end - resource->start);
+	if (!mddi->base) {
+		printk(KERN_ERR "mddi: failed to remap base!\n");
+		ret = -EINVAL;
+		goto error_ioremap;
+	}
+	resource = platform_get_resource(pdev, IORESOURCE_IRQ, 0);
+	if (!resource) {
+		printk(KERN_ERR "mddi: no associated irq resource!\n");
+		ret = -EINVAL;
+		goto error_get_irq_resource;
+	}
+	mddi->irq = resource->start;
+	printk(KERN_INFO "mddi: init() base=0x%p irq=%d\n", mddi->base,
+	       mddi->irq);
+	mddi->power_client = pdata->power_client;
+
+	mutex_init(&mddi->reg_write_lock);
+	mutex_init(&mddi->reg_read_lock);
+	spin_lock_init(&mddi->int_lock);
+	init_waitqueue_head(&mddi->int_wait);
+
+	ret = mddi_clk_setup(pdev, mddi, pdata->clk_rate);
+	if (ret) {
+		printk(KERN_ERR "mddi: failed to setup clock!\n");
+		goto error_clk_setup;
+	}
+
+	ret = mddi_rev_data_setup(mddi);
+	if (ret) {
+		printk(KERN_ERR "mddi: failed to setup rev data!\n");
+		goto error_rev_data;
+	}
+
+	mddi->int_enable = 0;
+	mddi_writel(mddi->int_enable, INTEN);
+	ret = request_irq(mddi->irq, mddi_isr, IRQF_DISABLED, "mddi",
+			  &mddi->client_data);
+	if (ret) {
+		printk(KERN_ERR "mddi: failed to request enable irq!\n");
+		goto error_request_irq;
+	}
+
+	/* turn on the mddi client bridge chip */
+	if (mddi->power_client)
+		mddi->power_client(&mddi->client_data, 1);
+
+	/* initialize the mddi registers */
+	mddi_set_auto_hibernate(&mddi->client_data, 0);
+	mddi_writel(MDDI_CMD_RESET, CMD);
+	mddi_wait_interrupt(mddi, MDDI_INT_NO_CMD_PKTS_PEND);
+	mddi->version = mddi_init_registers(mddi);
+	if (mddi->version < 0x20) {
+		printk(KERN_ERR "mddi: unsupported version 0x%x\n",
+		       mddi->version);
+		ret = -ENODEV;
+		goto error_mddi_version;
+	}
+
+	/* read the capabilities off the client */
+	if (!mddi_get_client_caps(mddi)) {
+		printk(KERN_INFO "mddi: no client found\n");
+		/* power down the panel */
+		mddi_writel(MDDI_CMD_POWERDOWN, CMD);
+		printk(KERN_INFO "mddi powerdown: stat %x\n", mddi_readl(STAT));
+		msleep(100);
+		printk(KERN_INFO "mddi powerdown: stat %x\n", mddi_readl(STAT));
+		return 0;
+	}
+	mddi_set_auto_hibernate(&mddi->client_data, 1);
+
+	if (mddi->caps.Mfr_Name == 0 && mddi->caps.Product_Code == 0)
+		pdata->fixup(&mddi->caps.Mfr_Name, &mddi->caps.Product_Code);
+
+	mddi->client_pdev.id = 0;
+	for (i = 0; i < pdata->num_clients; i++) {
+		if (pdata->client_platform_data[i].product_id ==
+		    (mddi->caps.Mfr_Name << 16 | mddi->caps.Product_Code)) {
+			mddi->client_data.private_client_data =
+				pdata->client_platform_data[i].client_data;
+			mddi->client_pdev.name =
+				pdata->client_platform_data[i].name;
+			mddi->client_pdev.id =
+				pdata->client_platform_data[i].id;
+			/* XXX: possibly set clock */
+			break;
+		}
+	}
+
+	if (i >= pdata->num_clients)
+		mddi->client_pdev.name = "mddi_c_dummy";
+	printk(KERN_INFO "mddi: registering panel %s\n",
+		mddi->client_pdev.name);
+
+	mddi->client_data.suspend = mddi_suspend;
+	mddi->client_data.resume = mddi_resume;
+	mddi->client_data.activate_link = mddi_activate_link;
+	mddi->client_data.remote_write = mddi_remote_write;
+	mddi->client_data.remote_read = mddi_remote_read;
+	mddi->client_data.auto_hibernate = mddi_set_auto_hibernate;
+	mddi->client_data.fb_resource = pdata->fb_resource;
+	if (pdev->id == 0)
+		mddi->client_data.interface_type = MSM_MDDI_PMDH_INTERFACE;
+	else if (pdev->id == 1)
+		mddi->client_data.interface_type = MSM_MDDI_EMDH_INTERFACE;
+	else {
+		printk(KERN_ERR "mddi: can not determine interface %d!\n",
+		       pdev->id);
+		ret = -EINVAL;
+		goto error_mddi_interface;
+	}
+
+	mddi->client_pdev.dev.platform_data = &mddi->client_data;
+	printk(KERN_INFO "mddi: publish: %s\n", mddi->client_name);
+	platform_device_register(&mddi->client_pdev);
+	return 0;
+
+error_mddi_interface:
+error_mddi_version:
+	free_irq(mddi->irq, 0);
+error_request_irq:
+	dma_free_coherent(NULL, 0x1000, mddi->rev_data, mddi->rev_addr);
+error_rev_data:
+error_clk_setup:
+error_get_irq_resource:
+	iounmap(mddi->base);
+error_ioremap:
+
+	printk(KERN_INFO "mddi: mddi_init() failed (%d)\n", ret);
+	return ret;
+}
+
+
+static struct platform_driver mddi_driver = {
+	.probe = mddi_probe,
+	.driver = { .name = "msm_mddi" },
+};
+
+static int __init _mddi_init(void)
+{
+	return platform_driver_register(&mddi_driver);
+}
+
+module_init(_mddi_init);
diff --git a/drivers/video/msm/mddi_client_dummy.c b/drivers/video/msm/mddi_client_dummy.c
new file mode 100644
index 0000000..ebbae87
--- /dev/null
+++ b/drivers/video/msm/mddi_client_dummy.c
@@ -0,0 +1,97 @@
+/* drivers/video/msm_fb/mddi_client_dummy.c
+ *
+ * Support for "dummy" mddi client devices which require no
+ * special initialization code.
+ *
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+
+#include <linux/module.h>
+#include <linux/kernel.h>
+#include <linux/platform_device.h>
+
+#include <mach/msm_fb.h>
+
+struct panel_info {
+	struct platform_device pdev;
+	struct msm_panel_data panel_data;
+};
+
+static int mddi_dummy_suspend(struct msm_panel_data *panel_data)
+{
+	return 0;
+}
+
+static int mddi_dummy_resume(struct msm_panel_data *panel_data)
+{
+	return 0;
+}
+
+static int mddi_dummy_blank(struct msm_panel_data *panel_data)
+{
+	return 0;
+}
+
+static int mddi_dummy_unblank(struct msm_panel_data *panel_data)
+{
+	return 0;
+}
+
+static int mddi_dummy_probe(struct platform_device *pdev)
+{
+	struct msm_mddi_client_data *client_data = pdev->dev.platform_data;
+	struct panel_info *panel =
+		kzalloc(sizeof(struct panel_info), GFP_KERNEL);
+	int ret;
+	if (!panel)
+		return -ENOMEM;
+	platform_set_drvdata(pdev, panel);
+	panel->panel_data.suspend = mddi_dummy_suspend;
+	panel->panel_data.resume = mddi_dummy_resume;
+	panel->panel_data.blank = mddi_dummy_blank;
+	panel->panel_data.unblank = mddi_dummy_unblank;
+	panel->panel_data.caps = MSMFB_CAP_PARTIAL_UPDATES;
+	panel->pdev.name = "msm_panel";
+	panel->pdev.id = pdev->id;
+	platform_device_add_resources(&panel->pdev,
+				      client_data->fb_resource, 1);
+	panel->panel_data.fb_data = client_data->private_client_data;
+	panel->pdev.dev.platform_data = &panel->panel_data;
+	ret = platform_device_register(&panel->pdev);
+	if (ret) {
+		kfree(panel);
+		return ret;
+	}
+	return 0;
+}
+
+static int mddi_dummy_remove(struct platform_device *pdev)
+{
+	struct panel_info *panel = platform_get_drvdata(pdev);
+	kfree(panel);
+	return 0;
+}
+
+static struct platform_driver mddi_client_dummy = {
+	.probe = mddi_dummy_probe,
+	.remove = mddi_dummy_remove,
+	.driver = { .name = "mddi_c_dummy" },
+};
+
+static int __init mddi_client_dummy_init(void)
+{
+	platform_driver_register(&mddi_client_dummy);
+	return 0;
+}
+
+module_init(mddi_client_dummy_init);
+
diff --git a/drivers/video/msm/mddi_client_nt35399.c b/drivers/video/msm/mddi_client_nt35399.c
new file mode 100644
index 0000000..9c78050
--- /dev/null
+++ b/drivers/video/msm/mddi_client_nt35399.c
@@ -0,0 +1,255 @@
+/* drivers/video/msm_fb/mddi_client_nt35399.c
+ *
+ * Support for Novatek NT35399 MDDI client of Sapphire
+ *
+ * Copyright (C) 2008 HTC Incorporated
+ * Author: Solomon Chiu (solomon_chiu@htc.com)
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+
+#include <linux/module.h>
+#include <linux/kernel.h>
+#include <linux/platform_device.h>
+#include <linux/interrupt.h>
+#include <linux/gpio.h>
+#include <mach/msm_fb.h>
+
+static DECLARE_WAIT_QUEUE_HEAD(nt35399_vsync_wait);
+
+struct panel_info {
+	struct msm_mddi_client_data *client_data;
+	struct platform_device pdev;
+	struct msm_panel_data panel_data;
+	struct msmfb_callback *fb_callback;
+	struct work_struct panel_work;
+	struct workqueue_struct *fb_wq;
+	int nt35399_got_int;
+};
+
+static void
+nt35399_request_vsync(struct msm_panel_data *panel_data,
+		      struct msmfb_callback *callback)
+{
+	struct panel_info *panel = container_of(panel_data, struct panel_info,
+						panel_data);
+	struct msm_mddi_client_data *client_data = panel->client_data;
+
+	panel->fb_callback = callback;
+	if (panel->nt35399_got_int) {
+		panel->nt35399_got_int = 0;
+		client_data->activate_link(client_data); /* clears interrupt */
+	}
+}
+
+static void nt35399_wait_vsync(struct msm_panel_data *panel_data)
+{
+	struct panel_info *panel = container_of(panel_data, struct panel_info,
+						panel_data);
+	struct msm_mddi_client_data *client_data = panel->client_data;
+
+	if (panel->nt35399_got_int) {
+		panel->nt35399_got_int = 0;
+		client_data->activate_link(client_data); /* clears interrupt */
+	}
+
+	if (wait_event_timeout(nt35399_vsync_wait, panel->nt35399_got_int,
+				HZ/2) == 0)
+		printk(KERN_ERR "timeout waiting for VSYNC\n");
+
+	panel->nt35399_got_int = 0;
+	/* interrupt clears when screen dma starts */
+}
+
+static int nt35399_suspend(struct msm_panel_data *panel_data)
+{
+	struct panel_info *panel = container_of(panel_data, struct panel_info,
+						panel_data);
+	struct msm_mddi_client_data *client_data = panel->client_data;
+
+	struct msm_mddi_bridge_platform_data *bridge_data =
+		client_data->private_client_data;
+	int ret;
+
+	ret = bridge_data->uninit(bridge_data, client_data);
+	if (ret) {
+		printk(KERN_INFO "mddi nt35399 client: non zero return from "
+			"uninit\n");
+		return ret;
+	}
+	client_data->suspend(client_data);
+	return 0;
+}
+
+static int nt35399_resume(struct msm_panel_data *panel_data)
+{
+	struct panel_info *panel = container_of(panel_data, struct panel_info,
+						panel_data);
+	struct msm_mddi_client_data *client_data = panel->client_data;
+
+	struct msm_mddi_bridge_platform_data *bridge_data =
+		client_data->private_client_data;
+	int ret;
+
+	client_data->resume(client_data);
+	ret = bridge_data->init(bridge_data, client_data);
+	if (ret)
+		return ret;
+	return 0;
+}
+
+static int nt35399_blank(struct msm_panel_data *panel_data)
+{
+	struct panel_info *panel = container_of(panel_data, struct panel_info,
+						panel_data);
+	struct msm_mddi_client_data *client_data = panel->client_data;
+	struct msm_mddi_bridge_platform_data *bridge_data =
+		client_data->private_client_data;
+
+	return bridge_data->blank(bridge_data, client_data);
+}
+
+static int nt35399_unblank(struct msm_panel_data *panel_data)
+{
+	struct panel_info *panel = container_of(panel_data, struct panel_info,
+						panel_data);
+	struct msm_mddi_client_data *client_data = panel->client_data;
+	struct msm_mddi_bridge_platform_data *bridge_data =
+		client_data->private_client_data;
+
+	return bridge_data->unblank(bridge_data, client_data);
+}
+
+irqreturn_t nt35399_vsync_interrupt(int irq, void *data)
+{
+	struct panel_info *panel = data;
+
+	panel->nt35399_got_int = 1;
+
+	if (panel->fb_callback) {
+		panel->fb_callback->func(panel->fb_callback);
+		panel->fb_callback = NULL;
+	}
+
+	wake_up(&nt35399_vsync_wait);
+
+	return IRQ_HANDLED;
+}
+
+static int setup_vsync(struct panel_info *panel, int init)
+{
+	int ret;
+	int gpio = 97;
+	unsigned int irq;
+
+	if (!init) {
+		ret = 0;
+		goto uninit;
+	}
+	ret = gpio_request(gpio, "vsync");
+	if (ret)
+		goto err_request_gpio_failed;
+
+	ret = gpio_direction_input(gpio);
+	if (ret)
+		goto err_gpio_direction_input_failed;
+
+	ret = irq = gpio_to_irq(gpio);
+	if (ret < 0)
+		goto err_get_irq_num_failed;
+
+	ret = request_irq(irq, nt35399_vsync_interrupt, IRQF_TRIGGER_RISING,
+			  "vsync", panel);
+	if (ret)
+		goto err_request_irq_failed;
+
+	printk(KERN_INFO "vsync on gpio %d now %d\n",
+	       gpio, gpio_get_value(gpio));
+	return 0;
+
+uninit:
+	free_irq(gpio_to_irq(gpio), panel->client_data);
+err_request_irq_failed:
+err_get_irq_num_failed:
+err_gpio_direction_input_failed:
+	gpio_free(gpio);
+err_request_gpio_failed:
+	return ret;
+}
+
+static int mddi_nt35399_probe(struct platform_device *pdev)
+{
+	struct msm_mddi_client_data *client_data = pdev->dev.platform_data;
+	struct msm_mddi_bridge_platform_data *bridge_data =
+		client_data->private_client_data;
+
+	int ret;
+
+	struct panel_info *panel = kzalloc(sizeof(struct panel_info),
+					   GFP_KERNEL);
+
+	printk(KERN_DEBUG "%s: enter.\n", __func__);
+
+	if (!panel)
+		return -ENOMEM;
+	platform_set_drvdata(pdev, panel);
+
+	ret = setup_vsync(panel, 1);
+	if (ret) {
+		dev_err(&pdev->dev, "mddi_nt35399_setup_vsync failed\n");
+		return ret;
+	}
+
+	panel->client_data = client_data;
+	panel->panel_data.suspend = nt35399_suspend;
+	panel->panel_data.resume = nt35399_resume;
+	panel->panel_data.wait_vsync = nt35399_wait_vsync;
+	panel->panel_data.request_vsync = nt35399_request_vsync;
+	panel->panel_data.blank = nt35399_blank;
+	panel->panel_data.unblank = nt35399_unblank;
+	panel->panel_data.fb_data = &bridge_data->fb_data;
+	panel->panel_data.caps = 0;
+
+	panel->pdev.name = "msm_panel";
+	panel->pdev.id = pdev->id;
+	panel->pdev.resource = client_data->fb_resource;
+	panel->pdev.num_resources = 1;
+	panel->pdev.dev.platform_data = &panel->panel_data;
+
+	if (bridge_data->init)
+		bridge_data->init(bridge_data, client_data);
+
+	platform_device_register(&panel->pdev);
+
+	return 0;
+}
+
+static int mddi_nt35399_remove(struct platform_device *pdev)
+{
+	struct panel_info *panel = platform_get_drvdata(pdev);
+
+	setup_vsync(panel, 0);
+	kfree(panel);
+	return 0;
+}
+
+static struct platform_driver mddi_client_0bda_8a47 = {
+	.probe = mddi_nt35399_probe,
+	.remove = mddi_nt35399_remove,
+	.driver = { .name = "mddi_c_0bda_8a47" },
+};
+
+static int __init mddi_client_nt35399_init(void)
+{
+	return platform_driver_register(&mddi_client_0bda_8a47);
+}
+
+module_init(mddi_client_nt35399_init);
+
diff --git a/drivers/video/msm/mddi_client_toshiba.c b/drivers/video/msm/mddi_client_toshiba.c
new file mode 100644
index 0000000..80d0f5f
--- /dev/null
+++ b/drivers/video/msm/mddi_client_toshiba.c
@@ -0,0 +1,283 @@
+/* drivers/video/msm_fb/mddi_client_toshiba.c
+ *
+ * Support for Toshiba TC358720XBG mddi client devices which require no
+ * special initialization code.
+ *
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+
+#include <linux/module.h>
+#include <linux/kernel.h>
+#include <linux/platform_device.h>
+#include <linux/interrupt.h>
+#include <linux/gpio.h>
+#include <mach/msm_fb.h>
+
+
+#define LCD_CONTROL_BLOCK_BASE 0x110000
+#define CMN         (LCD_CONTROL_BLOCK_BASE|0x10)
+#define INTFLG      (LCD_CONTROL_BLOCK_BASE|0x18)
+#define HCYCLE      (LCD_CONTROL_BLOCK_BASE|0x34)
+#define HDE_START   (LCD_CONTROL_BLOCK_BASE|0x3C)
+#define VPOS        (LCD_CONTROL_BLOCK_BASE|0xC0)
+#define MPLFBUF     (LCD_CONTROL_BLOCK_BASE|0x20)
+#define WAKEUP      (LCD_CONTROL_BLOCK_BASE|0x54)
+#define WSYN_DLY    (LCD_CONTROL_BLOCK_BASE|0x58)
+#define REGENB      (LCD_CONTROL_BLOCK_BASE|0x5C)
+
+#define BASE5 0x150000
+#define BASE6 0x160000
+#define BASE7 0x170000
+
+#define GPIOIEV     (BASE5 + 0x10)
+#define GPIOIE      (BASE5 + 0x14)
+#define GPIORIS     (BASE5 + 0x18)
+#define GPIOMIS     (BASE5 + 0x1C)
+#define GPIOIC      (BASE5 + 0x20)
+
+#define INTMASK     (BASE6 + 0x0C)
+#define INTMASK_VWAKEOUT (1U << 0)
+#define INTMASK_VWAKEOUT_ACTIVE_LOW (1U << 8)
+#define GPIOSEL     (BASE7 + 0x00)
+#define GPIOSEL_VWAKEINT (1U << 0)
+
+static DECLARE_WAIT_QUEUE_HEAD(toshiba_vsync_wait);
+
+struct panel_info {
+	struct msm_mddi_client_data *client_data;
+	struct platform_device pdev;
+	struct msm_panel_data panel_data;
+	struct msmfb_callback *toshiba_callback;
+	int toshiba_got_int;
+};
+
+
+static void toshiba_request_vsync(struct msm_panel_data *panel_data,
+				  struct msmfb_callback *callback)
+{
+	struct panel_info *panel = container_of(panel_data, struct panel_info,
+						panel_data);
+	struct msm_mddi_client_data *client_data = panel->client_data;
+
+	panel->toshiba_callback = callback;
+	if (panel->toshiba_got_int) {
+		panel->toshiba_got_int = 0;
+		client_data->activate_link(client_data);
+	}
+}
+
+static void toshiba_clear_vsync(struct msm_panel_data *panel_data)
+{
+	struct panel_info *panel = container_of(panel_data, struct panel_info,
+						panel_data);
+	struct msm_mddi_client_data *client_data = panel->client_data;
+
+	client_data->activate_link(client_data);
+}
+
+static void toshiba_wait_vsync(struct msm_panel_data *panel_data)
+{
+	struct panel_info *panel = container_of(panel_data, struct panel_info,
+						panel_data);
+	struct msm_mddi_client_data *client_data = panel->client_data;
+
+	if (panel->toshiba_got_int) {
+		panel->toshiba_got_int = 0;
+		client_data->activate_link(client_data); /* clears interrupt */
+	}
+	if (wait_event_timeout(toshiba_vsync_wait, panel->toshiba_got_int,
+				HZ/2) == 0)
+		printk(KERN_ERR "timeout waiting for VSYNC\n");
+	panel->toshiba_got_int = 0;
+	/* interrupt clears when screen dma starts */
+}
+
+static int toshiba_suspend(struct msm_panel_data *panel_data)
+{
+	struct panel_info *panel = container_of(panel_data, struct panel_info,
+						panel_data);
+	struct msm_mddi_client_data *client_data = panel->client_data;
+
+	struct msm_mddi_bridge_platform_data *bridge_data =
+		client_data->private_client_data;
+	int ret;
+
+	ret = bridge_data->uninit(bridge_data, client_data);
+	if (ret) {
+		printk(KERN_INFO "mddi toshiba client: non zero return from "
+			"uninit\n");
+		return ret;
+	}
+	client_data->suspend(client_data);
+	return 0;
+}
+
+static int toshiba_resume(struct msm_panel_data *panel_data)
+{
+	struct panel_info *panel = container_of(panel_data, struct panel_info,
+						panel_data);
+	struct msm_mddi_client_data *client_data = panel->client_data;
+
+	struct msm_mddi_bridge_platform_data *bridge_data =
+		client_data->private_client_data;
+	int ret;
+
+	client_data->resume(client_data);
+	ret = bridge_data->init(bridge_data, client_data);
+	if (ret)
+		return ret;
+	return 0;
+}
+
+static int toshiba_blank(struct msm_panel_data *panel_data)
+{
+	struct panel_info *panel = container_of(panel_data, struct panel_info,
+						panel_data);
+	struct msm_mddi_client_data *client_data = panel->client_data;
+	struct msm_mddi_bridge_platform_data *bridge_data =
+		client_data->private_client_data;
+
+	return bridge_data->blank(bridge_data, client_data);
+}
+
+static int toshiba_unblank(struct msm_panel_data *panel_data)
+{
+	struct panel_info *panel = container_of(panel_data, struct panel_info,
+						panel_data);
+	struct msm_mddi_client_data *client_data = panel->client_data;
+	struct msm_mddi_bridge_platform_data *bridge_data =
+		client_data->private_client_data;
+
+	return bridge_data->unblank(bridge_data, client_data);
+}
+
+irqreturn_t toshiba_vsync_interrupt(int irq, void *data)
+{
+	struct panel_info *panel = data;
+
+	panel->toshiba_got_int = 1;
+	if (panel->toshiba_callback) {
+		panel->toshiba_callback->func(panel->toshiba_callback);
+		panel->toshiba_callback = 0;
+	}
+	wake_up(&toshiba_vsync_wait);
+	return IRQ_HANDLED;
+}
+
+static int setup_vsync(struct panel_info *panel,
+		       int init)
+{
+	int ret;
+	int gpio = 97;
+	unsigned int irq;
+
+	if (!init) {
+		ret = 0;
+		goto uninit;
+	}
+	ret = gpio_request(gpio, "vsync");
+	if (ret)
+		goto err_request_gpio_failed;
+
+	ret = gpio_direction_input(gpio);
+	if (ret)
+		goto err_gpio_direction_input_failed;
+
+	ret = irq = gpio_to_irq(gpio);
+	if (ret < 0)
+		goto err_get_irq_num_failed;
+
+	ret = request_irq(irq, toshiba_vsync_interrupt, IRQF_TRIGGER_RISING,
+			  "vsync", panel);
+	if (ret)
+		goto err_request_irq_failed;
+	printk(KERN_INFO "vsync on gpio %d now %d\n",
+	       gpio, gpio_get_value(gpio));
+	return 0;
+
+uninit:
+	free_irq(gpio_to_irq(gpio), panel);
+err_request_irq_failed:
+err_get_irq_num_failed:
+err_gpio_direction_input_failed:
+	gpio_free(gpio);
+err_request_gpio_failed:
+	return ret;
+}
+
+static int mddi_toshiba_probe(struct platform_device *pdev)
+{
+	int ret;
+	struct msm_mddi_client_data *client_data = pdev->dev.platform_data;
+	struct msm_mddi_bridge_platform_data *bridge_data =
+		client_data->private_client_data;
+	struct panel_info *panel =
+		kzalloc(sizeof(struct panel_info), GFP_KERNEL);
+	if (!panel)
+		return -ENOMEM;
+	platform_set_drvdata(pdev, panel);
+
+	/* mddi_remote_write(mddi, 0, WAKEUP); */
+	client_data->remote_write(client_data, GPIOSEL_VWAKEINT, GPIOSEL);
+	client_data->remote_write(client_data, INTMASK_VWAKEOUT, INTMASK);
+
+	ret = setup_vsync(panel, 1);
+	if (ret) {
+		dev_err(&pdev->dev, "mddi_bridge_setup_vsync failed\n");
+		return ret;
+	}
+
+	panel->client_data = client_data;
+	panel->panel_data.suspend = toshiba_suspend;
+	panel->panel_data.resume = toshiba_resume;
+	panel->panel_data.wait_vsync = toshiba_wait_vsync;
+	panel->panel_data.request_vsync = toshiba_request_vsync;
+	panel->panel_data.clear_vsync = toshiba_clear_vsync;
+	panel->panel_data.blank = toshiba_blank;
+	panel->panel_data.unblank = toshiba_unblank;
+	panel->panel_data.fb_data =  &bridge_data->fb_data;
+	panel->panel_data.caps = MSMFB_CAP_PARTIAL_UPDATES;
+
+	panel->pdev.name = "msm_panel";
+	panel->pdev.id = pdev->id;
+	panel->pdev.resource = client_data->fb_resource;
+	panel->pdev.num_resources = 1;
+	panel->pdev.dev.platform_data = &panel->panel_data;
+	bridge_data->init(bridge_data, client_data);
+	platform_device_register(&panel->pdev);
+
+	return 0;
+}
+
+static int mddi_toshiba_remove(struct platform_device *pdev)
+{
+	struct panel_info *panel = platform_get_drvdata(pdev);
+
+	setup_vsync(panel, 0);
+	kfree(panel);
+	return 0;
+}
+
+static struct platform_driver mddi_client_d263_0000 = {
+	.probe = mddi_toshiba_probe,
+	.remove = mddi_toshiba_remove,
+	.driver = { .name = "mddi_c_d263_0000" },
+};
+
+static int __init mddi_client_toshiba_init(void)
+{
+	platform_driver_register(&mddi_client_d263_0000);
+	return 0;
+}
+
+module_init(mddi_client_toshiba_init);
+
diff --git a/drivers/video/msm/mddi_hw.h b/drivers/video/msm/mddi_hw.h
new file mode 100644
index 0000000..45cc01f
--- /dev/null
+++ b/drivers/video/msm/mddi_hw.h
@@ -0,0 +1,305 @@
+/* drivers/video/msm_fb/mddi_hw.h
+ *
+ * MSM MDDI Hardware Registers and Structures
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+
+#ifndef _MDDI_HW_H_
+#define _MDDI_HW_H_
+
+#include <linux/types.h>
+
+#define MDDI_CMD                0x0000
+#define MDDI_VERSION            0x0004
+#define MDDI_PRI_PTR            0x0008
+#define MDDI_SEC_PTR            0x000c
+#define MDDI_BPS                0x0010
+#define MDDI_SPM                0x0014
+#define MDDI_INT                0x0018
+#define MDDI_INTEN              0x001c
+#define MDDI_REV_PTR            0x0020
+#define MDDI_REV_SIZE           0x0024
+#define MDDI_STAT               0x0028
+#define MDDI_REV_RATE_DIV       0x002c
+#define MDDI_REV_CRC_ERR        0x0030
+#define MDDI_TA1_LEN            0x0034
+#define MDDI_TA2_LEN            0x0038
+#define MDDI_TEST_BUS           0x003c
+#define MDDI_TEST               0x0040
+#define MDDI_REV_PKT_CNT        0x0044
+#define MDDI_DRIVE_HI           0x0048
+#define MDDI_DRIVE_LO           0x004c
+#define MDDI_DISP_WAKE          0x0050
+#define MDDI_REV_ENCAP_SZ       0x0054
+#define MDDI_RTD_VAL            0x0058
+#define MDDI_PAD_CTL            0x0068
+#define MDDI_DRIVER_START_CNT   0x006c
+#define MDDI_NEXT_PRI_PTR       0x0070
+#define MDDI_NEXT_SEC_PTR       0x0074
+#define MDDI_MISR_CTL           0x0078
+#define MDDI_MISR_DATA          0x007c
+#define MDDI_SF_CNT             0x0080
+#define MDDI_MF_CNT             0x0084
+#define MDDI_CURR_REV_PTR       0x0088
+#define MDDI_CORE_VER           0x008c
+
+#define MDDI_INT_PRI_PTR_READ       0x0001
+#define MDDI_INT_SEC_PTR_READ       0x0002
+#define MDDI_INT_REV_DATA_AVAIL     0x0004
+#define MDDI_INT_DISP_REQ           0x0008
+#define MDDI_INT_PRI_UNDERFLOW      0x0010
+#define MDDI_INT_SEC_UNDERFLOW      0x0020
+#define MDDI_INT_REV_OVERFLOW       0x0040
+#define MDDI_INT_CRC_ERROR          0x0080
+#define MDDI_INT_MDDI_IN            0x0100
+#define MDDI_INT_PRI_OVERWRITE      0x0200
+#define MDDI_INT_SEC_OVERWRITE      0x0400
+#define MDDI_INT_REV_OVERWRITE      0x0800
+#define MDDI_INT_DMA_FAILURE        0x1000
+#define MDDI_INT_LINK_ACTIVE        0x2000
+#define MDDI_INT_IN_HIBERNATION     0x4000
+#define MDDI_INT_PRI_LINK_LIST_DONE 0x8000
+#define MDDI_INT_SEC_LINK_LIST_DONE 0x10000
+#define MDDI_INT_NO_CMD_PKTS_PEND   0x20000
+#define MDDI_INT_RTD_FAILURE        0x40000
+#define MDDI_INT_REV_PKT_RECEIVED   0x80000
+#define MDDI_INT_REV_PKTS_AVAIL     0x100000
+
+#define MDDI_INT_NEED_CLEAR ( \
+	MDDI_INT_REV_DATA_AVAIL | \
+	MDDI_INT_PRI_UNDERFLOW | \
+	MDDI_INT_SEC_UNDERFLOW | \
+	MDDI_INT_REV_OVERFLOW | \
+	MDDI_INT_CRC_ERROR | \
+	MDDI_INT_REV_PKT_RECEIVED)
+
+
+#define MDDI_STAT_LINK_ACTIVE        0x0001
+#define MDDI_STAT_NEW_REV_PTR        0x0002
+#define MDDI_STAT_NEW_PRI_PTR        0x0004
+#define MDDI_STAT_NEW_SEC_PTR        0x0008
+#define MDDI_STAT_IN_HIBERNATION     0x0010
+#define MDDI_STAT_PRI_LINK_LIST_DONE 0x0020
+#define MDDI_STAT_SEC_LINK_LIST_DONE 0x0040
+#define MDDI_STAT_PENDING_TIMING_PKT 0x0080
+#define MDDI_STAT_PENDING_REV_ENCAP  0x0100
+#define MDDI_STAT_PENDING_POWERDOWN  0x0200
+#define MDDI_STAT_RTD_MEAS_FAIL      0x0800
+#define MDDI_STAT_CLIENT_WAKEUP_REQ  0x1000
+
+
+#define MDDI_CMD_POWERDOWN           0x0100
+#define MDDI_CMD_POWERUP             0x0200
+#define MDDI_CMD_HIBERNATE           0x0300
+#define MDDI_CMD_RESET               0x0400
+#define MDDI_CMD_DISP_IGNORE         0x0501
+#define MDDI_CMD_DISP_LISTEN         0x0500
+#define MDDI_CMD_SEND_REV_ENCAP      0x0600
+#define MDDI_CMD_GET_CLIENT_CAP      0x0601
+#define MDDI_CMD_GET_CLIENT_STATUS   0x0602
+#define MDDI_CMD_SEND_RTD            0x0700
+#define MDDI_CMD_LINK_ACTIVE         0x0900
+#define MDDI_CMD_PERIODIC_REV_ENCAP  0x0A00
+#define MDDI_CMD_FORCE_NEW_REV_PTR   0x0C00
+
+
+
+#define MDDI_VIDEO_REV_PKT_SIZE              0x40
+#define MDDI_CLIENT_CAPABILITY_REV_PKT_SIZE  0x60
+#define MDDI_MAX_REV_PKT_SIZE                0x60
+
+/* #define MDDI_REV_BUFFER_SIZE 128 */
+#define MDDI_REV_BUFFER_SIZE (MDDI_MAX_REV_PKT_SIZE * 4)
+
+/* MDP sends 256 pixel packets, so lower value hibernates more without
+ * significantly increasing latency of waiting for next subframe */
+#define MDDI_HOST_BYTES_PER_SUBFRAME  0x3C00
+#define MDDI_HOST_TA2_LEN       0x000c
+#define MDDI_HOST_REV_RATE_DIV  0x0002
+
+
+struct __attribute__((packed)) mddi_rev_packet {
+	uint16_t length;
+	uint16_t type;
+	uint16_t client_id;
+};
+
+struct __attribute__((packed)) mddi_client_status {
+	uint16_t length;
+	uint16_t type;
+	uint16_t client_id;
+	uint16_t reverse_link_request;  /* bytes needed in rev encap message */
+	uint8_t  crc_error_count;
+	uint8_t  capability_change;
+	uint16_t graphics_busy_flags;
+	uint16_t crc16;
+};
+
+struct __attribute__((packed)) mddi_client_caps {
+	uint16_t length; /* length, exclusive of this field */
+	uint16_t type; /* 66 */
+	uint16_t client_id;
+
+	uint16_t Protocol_Version;
+	uint16_t Minimum_Protocol_Version;
+	uint16_t Data_Rate_Capability;
+	uint8_t  Interface_Type_Capability;
+	uint8_t  Number_of_Alt_Displays;
+	uint16_t PostCal_Data_Rate;
+	uint16_t Bitmap_Width;
+	uint16_t Bitmap_Height;
+	uint16_t Display_Window_Width;
+	uint16_t Display_Window_Height;
+	uint32_t Color_Map_Size;
+	uint16_t Color_Map_RGB_Width;
+	uint16_t RGB_Capability;
+	uint8_t  Monochrome_Capability;
+	uint8_t  Reserved_1;
+	uint16_t Y_Cb_Cr_Capability;
+	uint16_t Bayer_Capability;
+	uint16_t Alpha_Cursor_Image_Planes;
+	uint32_t Client_Feature_Capability_Indicators;
+	uint8_t  Maximum_Video_Frame_Rate_Capability;
+	uint8_t  Minimum_Video_Frame_Rate_Capability;
+	uint16_t Minimum_Sub_frame_Rate;
+	uint16_t Audio_Buffer_Depth;
+	uint16_t Audio_Channel_Capability;
+	uint16_t Audio_Sample_Rate_Capability;
+	uint8_t  Audio_Sample_Resolution;
+	uint8_t  Mic_Audio_Sample_Resolution;
+	uint16_t Mic_Sample_Rate_Capability;
+	uint8_t  Keyboard_Data_Format;
+	uint8_t  pointing_device_data_format;
+	uint16_t content_protection_type;
+	uint16_t Mfr_Name;
+	uint16_t Product_Code;
+	uint16_t Reserved_3;
+	uint32_t Serial_Number;
+	uint8_t  Week_of_Manufacture;
+	uint8_t  Year_of_Manufacture;
+
+	uint16_t crc16;
+} mddi_client_capability_type;
+
+
+struct __attribute__((packed)) mddi_video_stream {
+	uint16_t length;
+	uint16_t type; /* 16 */
+	uint16_t client_id; /* 0 */
+
+	uint16_t video_data_format_descriptor;
+/* format of each pixel in the Pixel Data in the present stream in the
+ * present packet.
+ * If bits [15:13] = 000 monochrome
+ * If bits [15:13] = 001 color pixels (palette).
+ * If bits [15:13] = 010 color pixels in raw RGB
+ * If bits [15:13] = 011 data in 4:2:2 Y Cb Cr format
+ * If bits [15:13] = 100 Bayer pixels
+ */
+
+	uint16_t pixel_data_attributes;
+/* interpreted as follows:
+ * Bits [1:0] = 11  pixel data is displayed to both eyes
+ * Bits [1:0] = 10  pixel data is routed to the left eye only.
+ * Bits [1:0] = 01  pixel data is routed to the right eye only.
+ * Bits [1:0] = 00  pixel data is routed to the alternate display.
+ * Bit 2 is 0  Pixel Data is in the standard progressive format.
+ * Bit 2 is 1  Pixel Data is in interlace format.
+ * Bit 3 is 0  Pixel Data is in the standard progressive format.
+ * Bit 3 is 1  Pixel Data is in alternate pixel format.
+ * Bit 4 is 0  Pixel Data is to or from the display frame buffer.
+ * Bit 4 is 1  Pixel Data is to or from the camera.
+ * Bit 5 is 0  pixel data contains the next consecutive row of pixels.
+ * Bit 5 is 1  X Left Edge, Y Top Edge, X Right Edge, Y Bottom Edge,
+ *             X Start, and Y Start parameters are not defined and
+ *             shall be ignored by the client.
+ * Bits [7:6] = 01  Pixel data is written to the offline image buffer.
+ * Bits [7:6] = 00  Pixel data is written to the buffer to refresh display.
+ * Bits [7:6] = 11  Pixel data is written to all image buffers.
+ * Bits [7:6] = 10  Invalid. Reserved for future use.
+ * Bits 8 through 11 alternate display number.
+ * Bits 12 through 14 are reserved for future use and shall be set to zero.
+ * Bit 15 is 1 the row of pixels is the last row of pixels in a frame.
+ */
+
+	uint16_t x_left_edge;
+	uint16_t y_top_edge;
+	/* X,Y coordinate of the top left edge of the screen window */
+
+	uint16_t x_right_edge;
+	uint16_t y_bottom_edge;
+	/* X,Y coordinate of the bottom right edge of the window being
+	 * updated. */
+
+	uint16_t x_start;
+	uint16_t y_start;
+	/* (X Start, Y Start) is the first pixel in the Pixel Data field
+	 * below. */
+
+	uint16_t pixel_count;
+	/* number of pixels in the Pixel Data field below. */
+
+	uint16_t parameter_CRC;
+	/* 16-bit CRC of all bytes from the Packet Length to the Pixel Count. */
+
+	uint16_t reserved;
+	/* 16-bit variable to make structure align on 4 byte boundary */
+};
+
+#define TYPE_VIDEO_STREAM      16
+#define TYPE_CLIENT_CAPS       66
+#define TYPE_REGISTER_ACCESS   146
+#define TYPE_CLIENT_STATUS     70
+
+struct __attribute__((packed)) mddi_register_access {
+	uint16_t length;
+	uint16_t type; /* 146 */
+	uint16_t client_id;
+
+	uint16_t read_write_info;
+	/* Bits 13:0  a 14-bit unsigned integer that specifies the number of
+	 *            32-bit Register Data List items to be transferred in the
+	 *            Register Data List field.
+	 * Bits[15:14] = 00  Write to register(s);
+	 * Bits[15:14] = 10  Read from register(s);
+	 * Bits[15:14] = 11  Response to a Read.
+	 * Bits[15:14] = 01  this value is reserved for future use. */
+#define MDDI_WRITE     (0 << 14)
+#define MDDI_READ      (2 << 14)
+#define MDDI_READ_RESP (3 << 14)
+
+	uint32_t register_address;
+	/* the register address that is to be written to or read from. */
+
+	uint16_t crc16;
+
+	uint32_t register_data_list;
+	/* list of 4-byte register data values for/from client registers */
+};
+
+struct __attribute__((packed)) mddi_llentry {
+	uint16_t flags;
+	uint16_t header_count;
+	uint16_t data_count;
+	dma_addr_t data; /* 32 bit */
+	struct mddi_llentry *next;
+	uint16_t reserved;
+	union {
+		struct mddi_video_stream v;
+		struct mddi_register_access r;
+		uint32_t _[12];
+	} u;
+};
+
+#endif
diff --git a/drivers/video/msm/mdp.c b/drivers/video/msm/mdp.c
new file mode 100644
index 0000000..99636a2
--- /dev/null
+++ b/drivers/video/msm/mdp.c
@@ -0,0 +1,538 @@
+/* drivers/video/msm_fb/mdp.c
+ *
+ * MSM MDP Interface (used by framebuffer core)
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+
+#include <linux/kernel.h>
+#include <linux/fb.h>
+#include <linux/msm_mdp.h>
+#include <linux/interrupt.h>
+#include <linux/wait.h>
+#include <linux/clk.h>
+#include <linux/file.h>
+#ifdef CONFIG_ANDROID_PMEM
+#include <linux/android_pmem.h>
+#endif
+#include <linux/major.h>
+
+#include <mach/msm_iomap.h>
+#include <mach/msm_fb.h>
+#include <linux/platform_device.h>
+
+#include "mdp_hw.h"
+
+struct class *mdp_class;
+
+#define MDP_CMD_DEBUG_ACCESS_BASE (0x10000)
+
+static uint16_t mdp_default_ccs[] = {
+	0x254, 0x000, 0x331, 0x254, 0xF38, 0xE61, 0x254, 0x409, 0x000,
+	0x010, 0x080, 0x080
+};
+
+static DECLARE_WAIT_QUEUE_HEAD(mdp_dma2_waitqueue);
+static DECLARE_WAIT_QUEUE_HEAD(mdp_ppp_waitqueue);
+static struct msmfb_callback *dma_callback;
+static struct clk *clk;
+static unsigned int mdp_irq_mask;
+static DEFINE_SPINLOCK(mdp_lock);
+DEFINE_MUTEX(mdp_mutex);
+
+static int enable_mdp_irq(struct mdp_info *mdp, uint32_t mask)
+{
+	unsigned long irq_flags;
+	int ret = 0;
+
+	BUG_ON(!mask);
+
+	spin_lock_irqsave(&mdp_lock, irq_flags);
+	/* if the mask bits are already set return an error, this interrupt
+	 * is already enabled */
+	if (mdp_irq_mask & mask) {
+		printk(KERN_ERR "mdp irq already on already on %x %x\n",
+		       mdp_irq_mask, mask);
+		ret = -1;
+	}
+	/* if the mdp irq is not already enabled enable it */
+	if (!mdp_irq_mask) {
+		if (clk)
+			clk_enable(clk);
+		enable_irq(mdp->irq);
+	}
+
+	/* update the irq mask to reflect the fact that the interrupt is
+	 * enabled */
+	mdp_irq_mask |= mask;
+	spin_unlock_irqrestore(&mdp_lock, irq_flags);
+	return ret;
+}
+
+static int locked_disable_mdp_irq(struct mdp_info *mdp, uint32_t mask)
+{
+	/* this interrupt is already disabled! */
+	if (!(mdp_irq_mask & mask)) {
+		printk(KERN_ERR "mdp irq already off %x %x\n",
+		       mdp_irq_mask, mask);
+		return -1;
+	}
+	/* update the irq mask to reflect the fact that the interrupt is
+	 * disabled */
+	mdp_irq_mask &= ~(mask);
+	/* if no one is waiting on the interrupt, disable it */
+	if (!mdp_irq_mask) {
+		disable_irq(mdp->irq);
+		if (clk)
+			clk_disable(clk);
+	}
+	return 0;
+}
+
+static int disable_mdp_irq(struct mdp_info *mdp, uint32_t mask)
+{
+	unsigned long irq_flags;
+	int ret;
+
+	spin_lock_irqsave(&mdp_lock, irq_flags);
+	ret = locked_disable_mdp_irq(mdp, mask);
+	spin_unlock_irqrestore(&mdp_lock, irq_flags);
+	return ret;
+}
+
+static irqreturn_t mdp_isr(int irq, void *data)
+{
+	uint32_t status;
+	unsigned long irq_flags;
+	struct mdp_info *mdp = data;
+
+	spin_lock_irqsave(&mdp_lock, irq_flags);
+
+	status = mdp_readl(mdp, MDP_INTR_STATUS);
+	mdp_writel(mdp, status, MDP_INTR_CLEAR);
+
+	status &= mdp_irq_mask;
+	if (status & DL0_DMA2_TERM_DONE) {
+		if (dma_callback) {
+			dma_callback->func(dma_callback);
+			dma_callback = NULL;
+		}
+		wake_up(&mdp_dma2_waitqueue);
+	}
+
+	if (status & DL0_ROI_DONE)
+		wake_up(&mdp_ppp_waitqueue);
+
+	if (status)
+		locked_disable_mdp_irq(mdp, status);
+
+	spin_unlock_irqrestore(&mdp_lock, irq_flags);
+	return IRQ_HANDLED;
+}
+
+static uint32_t mdp_check_mask(uint32_t mask)
+{
+	uint32_t ret;
+	unsigned long irq_flags;
+
+	spin_lock_irqsave(&mdp_lock, irq_flags);
+	ret = mdp_irq_mask & mask;
+	spin_unlock_irqrestore(&mdp_lock, irq_flags);
+	return ret;
+}
+
+static int mdp_wait(struct mdp_info *mdp, uint32_t mask, wait_queue_head_t *wq)
+{
+	int ret = 0;
+	unsigned long irq_flags;
+
+	wait_event_timeout(*wq, !mdp_check_mask(mask), HZ);
+
+	spin_lock_irqsave(&mdp_lock, irq_flags);
+	if (mdp_irq_mask & mask) {
+		locked_disable_mdp_irq(mdp, mask);
+		printk(KERN_WARNING "timeout waiting for mdp to complete %x\n",
+		       mask);
+		ret = -ETIMEDOUT;
+	}
+	spin_unlock_irqrestore(&mdp_lock, irq_flags);
+
+	return ret;
+}
+
+void mdp_dma_wait(struct mdp_device *mdp_dev)
+{
+#define MDP_MAX_TIMEOUTS 20
+	static int timeout_count;
+	struct mdp_info *mdp = container_of(mdp_dev, struct mdp_info, mdp_dev);
+
+	if (mdp_wait(mdp, DL0_DMA2_TERM_DONE, &mdp_dma2_waitqueue) == -ETIMEDOUT)
+		timeout_count++;
+	else
+		timeout_count = 0;
+
+	if (timeout_count > MDP_MAX_TIMEOUTS) {
+		printk(KERN_ERR "mdp: dma failed %d times, somethings wrong!\n",
+		       MDP_MAX_TIMEOUTS);
+		BUG();
+	}
+}
+
+static int mdp_ppp_wait(struct mdp_info *mdp)
+{
+	return mdp_wait(mdp, DL0_ROI_DONE, &mdp_ppp_waitqueue);
+}
+
+void mdp_dma_to_mddi(struct mdp_info *mdp, uint32_t addr, uint32_t stride,
+		     uint32_t width, uint32_t height, uint32_t x, uint32_t y,
+		     struct msmfb_callback *callback)
+{
+	uint32_t dma2_cfg;
+	uint16_t ld_param = 0; /* 0=PRIM, 1=SECD, 2=EXT */
+
+	if (enable_mdp_irq(mdp, DL0_DMA2_TERM_DONE)) {
+		printk(KERN_ERR "mdp_dma_to_mddi: busy\n");
+		return;
+	}
+
+	dma_callback = callback;
+
+	dma2_cfg = DMA_PACK_TIGHT |
+		DMA_PACK_ALIGN_LSB |
+		DMA_PACK_PATTERN_RGB |
+		DMA_OUT_SEL_AHB |
+		DMA_IBUF_NONCONTIGUOUS;
+
+	dma2_cfg |= DMA_IBUF_FORMAT_RGB565;
+
+	dma2_cfg |= DMA_OUT_SEL_MDDI;
+
+	dma2_cfg |= DMA_MDDI_DMAOUT_LCD_SEL_PRIMARY;
+
+	dma2_cfg |= DMA_DITHER_EN;
+
+	/* setup size, address, and stride */
+	mdp_writel(mdp, (height << 16) | (width),
+		   MDP_CMD_DEBUG_ACCESS_BASE + 0x0184);
+	mdp_writel(mdp, addr, MDP_CMD_DEBUG_ACCESS_BASE + 0x0188);
+	mdp_writel(mdp, stride, MDP_CMD_DEBUG_ACCESS_BASE + 0x018C);
+
+	/* 666 18BPP */
+	dma2_cfg |= DMA_DSTC0G_6BITS | DMA_DSTC1B_6BITS | DMA_DSTC2R_6BITS;
+
+	/* set y & x offset and MDDI transaction parameters */
+	mdp_writel(mdp, (y << 16) | (x), MDP_CMD_DEBUG_ACCESS_BASE + 0x0194);
+	mdp_writel(mdp, ld_param, MDP_CMD_DEBUG_ACCESS_BASE + 0x01a0);
+	mdp_writel(mdp, (MDDI_VDO_PACKET_DESC << 16) | MDDI_VDO_PACKET_PRIM,
+		   MDP_CMD_DEBUG_ACCESS_BASE + 0x01a4);
+
+	mdp_writel(mdp, dma2_cfg, MDP_CMD_DEBUG_ACCESS_BASE + 0x0180);
+
+	/* start DMA2 */
+	mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0044);
+}
+
+void mdp_dma(struct mdp_device *mdp_dev, uint32_t addr, uint32_t stride,
+	     uint32_t width, uint32_t height, uint32_t x, uint32_t y,
+	     struct msmfb_callback *callback, int interface)
+{
+	struct mdp_info *mdp = container_of(mdp_dev, struct mdp_info, mdp_dev);
+
+	if (interface == MSM_MDDI_PMDH_INTERFACE) {
+		mdp_dma_to_mddi(mdp, addr, stride, width, height, x, y,
+				callback);
+	}
+}
+
+int get_img(struct mdp_img *img, struct fb_info *info,
+	    unsigned long *start, unsigned long *len,
+	    struct file **filep)
+{
+	int put_needed, ret = 0;
+	struct file *file;
+	unsigned long vstart;
+
+#ifdef CONFIG_ANDROID_PMEM
+	if (!get_pmem_file(img->memory_id, start, &vstart, len, filep))
+		return 0;
+#endif
+
+	file = fget_light(img->memory_id, &put_needed);
+	if (file == NULL)
+		return -1;
+
+	if (MAJOR(file->f_dentry->d_inode->i_rdev) == FB_MAJOR) {
+		*start = info->fix.smem_start;
+		*len = info->fix.smem_len;
+	} else
+		ret = -1;
+	fput_light(file, put_needed);
+
+	return ret;
+}
+
+void put_img(struct file *src_file, struct file *dst_file)
+{
+#ifdef CONFIG_ANDROID_PMEM
+	if (src_file)
+		put_pmem_file(src_file);
+	if (dst_file)
+		put_pmem_file(dst_file);
+#endif
+}
+
+int mdp_blit(struct mdp_device *mdp_dev, struct fb_info *fb,
+	     struct mdp_blit_req *req)
+{
+	int ret;
+	unsigned long src_start = 0, src_len = 0, dst_start = 0, dst_len = 0;
+	struct mdp_info *mdp = container_of(mdp_dev, struct mdp_info, mdp_dev);
+	struct file *src_file = 0, *dst_file = 0;
+
+	/* WORKAROUND FOR HARDWARE BUG IN BG TILE FETCH */
+	if (unlikely(req->src_rect.h == 0 ||
+		     req->src_rect.w == 0)) {
+		printk(KERN_ERR "mpd_ppp: src img of zero size!\n");
+		return -EINVAL;
+	}
+	if (unlikely(req->dst_rect.h == 0 ||
+		     req->dst_rect.w == 0))
+		return -EINVAL;
+
+	/* do this first so that if this fails, the caller can always
+	 * safely call put_img */
+	if (unlikely(get_img(&req->src, fb, &src_start, &src_len, &src_file))) {
+		printk(KERN_ERR "mpd_ppp: could not retrieve src image from "
+				"memory\n");
+		return -EINVAL;
+	}
+
+	if (unlikely(get_img(&req->dst, fb, &dst_start, &dst_len, &dst_file))) {
+		printk(KERN_ERR "mpd_ppp: could not retrieve dst image from "
+				"memory\n");
+#ifdef CONFIG_ANDROID_PMEM
+		put_pmem_file(src_file);
+#endif
+		return -EINVAL;
+	}
+	mutex_lock(&mdp_mutex);
+
+	/* transp_masking unimplemented */
+	req->transp_mask = MDP_TRANSP_NOP;
+	if (unlikely((req->transp_mask != MDP_TRANSP_NOP ||
+		      req->alpha != MDP_ALPHA_NOP ||
+		      HAS_ALPHA(req->src.format)) &&
+		     (req->flags & MDP_ROT_90 &&
+		      req->dst_rect.w <= 16 && req->dst_rect.h >= 16))) {
+		int i;
+		unsigned int tiles = req->dst_rect.h / 16;
+		unsigned int remainder = req->dst_rect.h % 16;
+		req->src_rect.w = 16*req->src_rect.w / req->dst_rect.h;
+		req->dst_rect.h = 16;
+		for (i = 0; i < tiles; i++) {
+			enable_mdp_irq(mdp, DL0_ROI_DONE);
+			ret = mdp_ppp_blit(mdp, req, src_file, src_start,
+					   src_len, dst_file, dst_start,
+					   dst_len);
+			if (ret)
+				goto err_bad_blit;
+			ret = mdp_ppp_wait(mdp);
+			if (ret)
+				goto err_wait_failed;
+			req->dst_rect.y += 16;
+			req->src_rect.x += req->src_rect.w;
+		}
+		if (!remainder)
+			goto end;
+		req->src_rect.w = remainder*req->src_rect.w / req->dst_rect.h;
+		req->dst_rect.h = remainder;
+	}
+	enable_mdp_irq(mdp, DL0_ROI_DONE);
+	ret = mdp_ppp_blit(mdp, req, src_file, src_start, src_len, dst_file,
+			   dst_start,
+			   dst_len);
+	if (ret)
+		goto err_bad_blit;
+	ret = mdp_ppp_wait(mdp);
+	if (ret)
+		goto err_wait_failed;
+end:
+	put_img(src_file, dst_file);
+	mutex_unlock(&mdp_mutex);
+	return 0;
+err_bad_blit:
+	disable_mdp_irq(mdp, DL0_ROI_DONE);
+err_wait_failed:
+	put_img(src_file, dst_file);
+	mutex_unlock(&mdp_mutex);
+	return ret;
+}
+
+void mdp_set_grp_disp(struct mdp_device *mdp_dev, unsigned disp_id)
+{
+	struct mdp_info *mdp = container_of(mdp_dev, struct mdp_info, mdp_dev);
+
+	disp_id &= 0xf;
+	mdp_writel(mdp, disp_id, MDP_FULL_BYPASS_WORD43);
+}
+
+int register_mdp_client(struct class_interface *cint)
+{
+	if (!mdp_class) {
+		pr_err("mdp: no mdp_class when registering mdp client\n");
+		return -ENODEV;
+	}
+	cint->class = mdp_class;
+	return class_interface_register(cint);
+}
+
+#include "mdp_csc_table.h"
+#include "mdp_scale_tables.h"
+
+int mdp_probe(struct platform_device *pdev)
+{
+	struct resource *resource;
+	int ret;
+	int n;
+	struct mdp_info *mdp;
+
+	resource = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+	if (!resource) {
+		pr_err("mdp: can not get mdp mem resource!\n");
+		return -ENOMEM;
+	}
+
+	mdp = kzalloc(sizeof(struct mdp_info), GFP_KERNEL);
+	if (!mdp)
+		return -ENOMEM;
+
+	mdp->irq = platform_get_irq(pdev, 0);
+	if (mdp->irq < 0) {
+		pr_err("mdp: can not get mdp irq\n");
+		ret = mdp->irq;
+		goto error_get_irq;
+	}
+
+	mdp->base = ioremap(resource->start,
+			    resource->end - resource->start);
+	if (mdp->base == 0) {
+		printk(KERN_ERR "msmfb: cannot allocate mdp regs!\n");
+		ret = -ENOMEM;
+		goto error_ioremap;
+	}
+
+	mdp->mdp_dev.dma = mdp_dma;
+	mdp->mdp_dev.dma_wait = mdp_dma_wait;
+	mdp->mdp_dev.blit = mdp_blit;
+	mdp->mdp_dev.set_grp_disp = mdp_set_grp_disp;
+
+	clk = clk_get(&pdev->dev, "mdp_clk");
+	if (IS_ERR(clk)) {
+		printk(KERN_INFO "mdp: failed to get mdp clk");
+		return PTR_ERR(clk);
+	}
+
+	ret = request_irq(mdp->irq, mdp_isr, IRQF_DISABLED, "msm_mdp", mdp);
+	if (ret)
+		goto error_request_irq;
+	disable_irq(mdp->irq);
+	mdp_irq_mask = 0;
+
+	/* debug interface write access */
+	mdp_writel(mdp, 1, 0x60);
+
+	mdp_writel(mdp, MDP_ANY_INTR_MASK, MDP_INTR_ENABLE);
+	mdp_writel(mdp, 1, MDP_EBI2_PORTMAP_MODE);
+
+	mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01f8);
+	mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01fc);
+
+	for (n = 0; n < ARRAY_SIZE(csc_table); n++)
+		mdp_writel(mdp, csc_table[n].val, csc_table[n].reg);
+
+	/* clear up unused fg/main registers */
+	/* comp.plane 2&3 ystride */
+	mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0120);
+
+	/* unpacked pattern */
+	mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x012c);
+	mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0130);
+	mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0134);
+	mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0158);
+	mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x015c);
+	mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0160);
+	mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0170);
+	mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0174);
+	mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x017c);
+
+	/* comp.plane 2 & 3 */
+	mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0114);
+	mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x0118);
+
+	/* clear unused bg registers */
+	mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01c8);
+	mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01d0);
+	mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01dc);
+	mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01e0);
+	mdp_writel(mdp, 0, MDP_CMD_DEBUG_ACCESS_BASE + 0x01e4);
+
+	for (n = 0; n < ARRAY_SIZE(mdp_upscale_table); n++)
+		mdp_writel(mdp, mdp_upscale_table[n].val,
+		       mdp_upscale_table[n].reg);
+
+	for (n = 0; n < 9; n++)
+		mdp_writel(mdp, mdp_default_ccs[n], 0x40440 + 4 * n);
+	mdp_writel(mdp, mdp_default_ccs[9], 0x40500 + 4 * 0);
+	mdp_writel(mdp, mdp_default_ccs[10], 0x40500 + 4 * 0);
+	mdp_writel(mdp, mdp_default_ccs[11], 0x40500 + 4 * 0);
+
+	/* register mdp device */
+	mdp->mdp_dev.dev.parent = &pdev->dev;
+	mdp->mdp_dev.dev.class = mdp_class;
+	snprintf(mdp->mdp_dev.dev.bus_id, BUS_ID_SIZE, "mdp%d", pdev->id);
+
+	/* if you can remove the platform device you'd have to implement
+	 * this:
+	mdp_dev.release = mdp_class; */
+
+	ret = device_register(&mdp->mdp_dev.dev);
+	if (ret)
+		goto error_device_register;
+	return 0;
+
+error_device_register:
+	free_irq(mdp->irq, mdp);
+error_request_irq:
+	iounmap(mdp->base);
+error_get_irq:
+error_ioremap:
+	kfree(mdp);
+	return ret;
+}
+
+static struct platform_driver msm_mdp_driver = {
+	.probe = mdp_probe,
+	.driver = {.name = "msm_mdp"},
+};
+
+static int __init mdp_init(void)
+{
+	mdp_class = class_create(THIS_MODULE, "msm_mdp");
+	if (IS_ERR(mdp_class)) {
+		printk(KERN_ERR "Error creating mdp class\n");
+		return PTR_ERR(mdp_class);
+	}
+	return platform_driver_register(&msm_mdp_driver);
+}
+
+subsys_initcall(mdp_init);
diff --git a/drivers/video/msm/mdp_csc_table.h b/drivers/video/msm/mdp_csc_table.h
new file mode 100644
index 0000000..d1cde30
--- /dev/null
+++ b/drivers/video/msm/mdp_csc_table.h
@@ -0,0 +1,582 @@
+/* drivers/video/msm_fb/mdp_csc_table.h
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+
+static struct {
+	uint32_t reg;
+	uint32_t val;
+} csc_table[] = {
+	{ 0x40400, 0x83 },
+	{ 0x40404, 0x102 },
+	{ 0x40408, 0x32 },
+	{ 0x4040c, 0xffffffb5 },
+	{ 0x40410, 0xffffff6c },
+	{ 0x40414, 0xe1 },
+	{ 0x40418, 0xe1 },
+	{ 0x4041c, 0xffffff45 },
+	{ 0x40420, 0xffffffdc },
+	{ 0x40440, 0x254 },
+	{ 0x40444, 0x0 },
+	{ 0x40448, 0x331 },
+	{ 0x4044c, 0x254 },
+	{ 0x40450, 0xffffff38 },
+	{ 0x40454, 0xfffffe61 },
+	{ 0x40458, 0x254 },
+	{ 0x4045c, 0x409 },
+	{ 0x40460, 0x0 },
+	{ 0x40480, 0x5d },
+	{ 0x40484, 0x13a },
+	{ 0x40488, 0x20 },
+	{ 0x4048c, 0xffffffcd },
+	{ 0x40490, 0xffffff54 },
+	{ 0x40494, 0xe1 },
+	{ 0x40498, 0xe1 },
+	{ 0x4049c, 0xffffff35 },
+	{ 0x404a0, 0xffffffec },
+	{ 0x404c0, 0x254 },
+	{ 0x404c4, 0x0 },
+	{ 0x404c8, 0x396 },
+	{ 0x404cc, 0x254 },
+	{ 0x404d0, 0xffffff94 },
+	{ 0x404d4, 0xfffffef0 },
+	{ 0x404d8, 0x254 },
+	{ 0x404dc, 0x43a },
+	{ 0x404e0, 0x0 },
+	{ 0x40500, 0x10 },
+	{ 0x40504, 0x80 },
+	{ 0x40508, 0x80 },
+	{ 0x40540, 0x10 },
+	{ 0x40544, 0x80 },
+	{ 0x40548, 0x80 },
+	{ 0x40580, 0x10 },
+	{ 0x40584, 0xeb },
+	{ 0x40588, 0x10 },
+	{ 0x4058c, 0xf0 },
+	{ 0x405c0, 0x10 },
+	{ 0x405c4, 0xeb },
+	{ 0x405c8, 0x10 },
+	{ 0x405cc, 0xf0 },
+	{ 0x40800, 0x0 },
+	{ 0x40804, 0x151515 },
+	{ 0x40808, 0x1d1d1d },
+	{ 0x4080c, 0x232323 },
+	{ 0x40810, 0x272727 },
+	{ 0x40814, 0x2b2b2b },
+	{ 0x40818, 0x2f2f2f },
+	{ 0x4081c, 0x333333 },
+	{ 0x40820, 0x363636 },
+	{ 0x40824, 0x393939 },
+	{ 0x40828, 0x3b3b3b },
+	{ 0x4082c, 0x3e3e3e },
+	{ 0x40830, 0x404040 },
+	{ 0x40834, 0x434343 },
+	{ 0x40838, 0x454545 },
+	{ 0x4083c, 0x474747 },
+	{ 0x40840, 0x494949 },
+	{ 0x40844, 0x4b4b4b },
+	{ 0x40848, 0x4d4d4d },
+	{ 0x4084c, 0x4f4f4f },
+	{ 0x40850, 0x515151 },
+	{ 0x40854, 0x535353 },
+	{ 0x40858, 0x555555 },
+	{ 0x4085c, 0x565656 },
+	{ 0x40860, 0x585858 },
+	{ 0x40864, 0x5a5a5a },
+	{ 0x40868, 0x5b5b5b },
+	{ 0x4086c, 0x5d5d5d },
+	{ 0x40870, 0x5e5e5e },
+	{ 0x40874, 0x606060 },
+	{ 0x40878, 0x616161 },
+	{ 0x4087c, 0x636363 },
+	{ 0x40880, 0x646464 },
+	{ 0x40884, 0x666666 },
+	{ 0x40888, 0x676767 },
+	{ 0x4088c, 0x686868 },
+	{ 0x40890, 0x6a6a6a },
+	{ 0x40894, 0x6b6b6b },
+	{ 0x40898, 0x6c6c6c },
+	{ 0x4089c, 0x6e6e6e },
+	{ 0x408a0, 0x6f6f6f },
+	{ 0x408a4, 0x707070 },
+	{ 0x408a8, 0x717171 },
+	{ 0x408ac, 0x727272 },
+	{ 0x408b0, 0x747474 },
+	{ 0x408b4, 0x757575 },
+	{ 0x408b8, 0x767676 },
+	{ 0x408bc, 0x777777 },
+	{ 0x408c0, 0x787878 },
+	{ 0x408c4, 0x797979 },
+	{ 0x408c8, 0x7a7a7a },
+	{ 0x408cc, 0x7c7c7c },
+	{ 0x408d0, 0x7d7d7d },
+	{ 0x408d4, 0x7e7e7e },
+	{ 0x408d8, 0x7f7f7f },
+	{ 0x408dc, 0x808080 },
+	{ 0x408e0, 0x818181 },
+	{ 0x408e4, 0x828282 },
+	{ 0x408e8, 0x838383 },
+	{ 0x408ec, 0x848484 },
+	{ 0x408f0, 0x858585 },
+	{ 0x408f4, 0x868686 },
+	{ 0x408f8, 0x878787 },
+	{ 0x408fc, 0x888888 },
+	{ 0x40900, 0x898989 },
+	{ 0x40904, 0x8a8a8a },
+	{ 0x40908, 0x8b8b8b },
+	{ 0x4090c, 0x8c8c8c },
+	{ 0x40910, 0x8d8d8d },
+	{ 0x40914, 0x8e8e8e },
+	{ 0x40918, 0x8f8f8f },
+	{ 0x4091c, 0x8f8f8f },
+	{ 0x40920, 0x909090 },
+	{ 0x40924, 0x919191 },
+	{ 0x40928, 0x929292 },
+	{ 0x4092c, 0x939393 },
+	{ 0x40930, 0x949494 },
+	{ 0x40934, 0x959595 },
+	{ 0x40938, 0x969696 },
+	{ 0x4093c, 0x969696 },
+	{ 0x40940, 0x979797 },
+	{ 0x40944, 0x989898 },
+	{ 0x40948, 0x999999 },
+	{ 0x4094c, 0x9a9a9a },
+	{ 0x40950, 0x9b9b9b },
+	{ 0x40954, 0x9c9c9c },
+	{ 0x40958, 0x9c9c9c },
+	{ 0x4095c, 0x9d9d9d },
+	{ 0x40960, 0x9e9e9e },
+	{ 0x40964, 0x9f9f9f },
+	{ 0x40968, 0xa0a0a0 },
+	{ 0x4096c, 0xa0a0a0 },
+	{ 0x40970, 0xa1a1a1 },
+	{ 0x40974, 0xa2a2a2 },
+	{ 0x40978, 0xa3a3a3 },
+	{ 0x4097c, 0xa4a4a4 },
+	{ 0x40980, 0xa4a4a4 },
+	{ 0x40984, 0xa5a5a5 },
+	{ 0x40988, 0xa6a6a6 },
+	{ 0x4098c, 0xa7a7a7 },
+	{ 0x40990, 0xa7a7a7 },
+	{ 0x40994, 0xa8a8a8 },
+	{ 0x40998, 0xa9a9a9 },
+	{ 0x4099c, 0xaaaaaa },
+	{ 0x409a0, 0xaaaaaa },
+	{ 0x409a4, 0xababab },
+	{ 0x409a8, 0xacacac },
+	{ 0x409ac, 0xadadad },
+	{ 0x409b0, 0xadadad },
+	{ 0x409b4, 0xaeaeae },
+	{ 0x409b8, 0xafafaf },
+	{ 0x409bc, 0xafafaf },
+	{ 0x409c0, 0xb0b0b0 },
+	{ 0x409c4, 0xb1b1b1 },
+	{ 0x409c8, 0xb2b2b2 },
+	{ 0x409cc, 0xb2b2b2 },
+	{ 0x409d0, 0xb3b3b3 },
+	{ 0x409d4, 0xb4b4b4 },
+	{ 0x409d8, 0xb4b4b4 },
+	{ 0x409dc, 0xb5b5b5 },
+	{ 0x409e0, 0xb6b6b6 },
+	{ 0x409e4, 0xb6b6b6 },
+	{ 0x409e8, 0xb7b7b7 },
+	{ 0x409ec, 0xb8b8b8 },
+	{ 0x409f0, 0xb8b8b8 },
+	{ 0x409f4, 0xb9b9b9 },
+	{ 0x409f8, 0xbababa },
+	{ 0x409fc, 0xbababa },
+	{ 0x40a00, 0xbbbbbb },
+	{ 0x40a04, 0xbcbcbc },
+	{ 0x40a08, 0xbcbcbc },
+	{ 0x40a0c, 0xbdbdbd },
+	{ 0x40a10, 0xbebebe },
+	{ 0x40a14, 0xbebebe },
+	{ 0x40a18, 0xbfbfbf },
+	{ 0x40a1c, 0xc0c0c0 },
+	{ 0x40a20, 0xc0c0c0 },
+	{ 0x40a24, 0xc1c1c1 },
+	{ 0x40a28, 0xc1c1c1 },
+	{ 0x40a2c, 0xc2c2c2 },
+	{ 0x40a30, 0xc3c3c3 },
+	{ 0x40a34, 0xc3c3c3 },
+	{ 0x40a38, 0xc4c4c4 },
+	{ 0x40a3c, 0xc5c5c5 },
+	{ 0x40a40, 0xc5c5c5 },
+	{ 0x40a44, 0xc6c6c6 },
+	{ 0x40a48, 0xc6c6c6 },
+	{ 0x40a4c, 0xc7c7c7 },
+	{ 0x40a50, 0xc8c8c8 },
+	{ 0x40a54, 0xc8c8c8 },
+	{ 0x40a58, 0xc9c9c9 },
+	{ 0x40a5c, 0xc9c9c9 },
+	{ 0x40a60, 0xcacaca },
+	{ 0x40a64, 0xcbcbcb },
+	{ 0x40a68, 0xcbcbcb },
+	{ 0x40a6c, 0xcccccc },
+	{ 0x40a70, 0xcccccc },
+	{ 0x40a74, 0xcdcdcd },
+	{ 0x40a78, 0xcecece },
+	{ 0x40a7c, 0xcecece },
+	{ 0x40a80, 0xcfcfcf },
+	{ 0x40a84, 0xcfcfcf },
+	{ 0x40a88, 0xd0d0d0 },
+	{ 0x40a8c, 0xd0d0d0 },
+	{ 0x40a90, 0xd1d1d1 },
+	{ 0x40a94, 0xd2d2d2 },
+	{ 0x40a98, 0xd2d2d2 },
+	{ 0x40a9c, 0xd3d3d3 },
+	{ 0x40aa0, 0xd3d3d3 },
+	{ 0x40aa4, 0xd4d4d4 },
+	{ 0x40aa8, 0xd4d4d4 },
+	{ 0x40aac, 0xd5d5d5 },
+	{ 0x40ab0, 0xd6d6d6 },
+	{ 0x40ab4, 0xd6d6d6 },
+	{ 0x40ab8, 0xd7d7d7 },
+	{ 0x40abc, 0xd7d7d7 },
+	{ 0x40ac0, 0xd8d8d8 },
+	{ 0x40ac4, 0xd8d8d8 },
+	{ 0x40ac8, 0xd9d9d9 },
+	{ 0x40acc, 0xd9d9d9 },
+	{ 0x40ad0, 0xdadada },
+	{ 0x40ad4, 0xdbdbdb },
+	{ 0x40ad8, 0xdbdbdb },
+	{ 0x40adc, 0xdcdcdc },
+	{ 0x40ae0, 0xdcdcdc },
+	{ 0x40ae4, 0xdddddd },
+	{ 0x40ae8, 0xdddddd },
+	{ 0x40aec, 0xdedede },
+	{ 0x40af0, 0xdedede },
+	{ 0x40af4, 0xdfdfdf },
+	{ 0x40af8, 0xdfdfdf },
+	{ 0x40afc, 0xe0e0e0 },
+	{ 0x40b00, 0xe0e0e0 },
+	{ 0x40b04, 0xe1e1e1 },
+	{ 0x40b08, 0xe1e1e1 },
+	{ 0x40b0c, 0xe2e2e2 },
+	{ 0x40b10, 0xe3e3e3 },
+	{ 0x40b14, 0xe3e3e3 },
+	{ 0x40b18, 0xe4e4e4 },
+	{ 0x40b1c, 0xe4e4e4 },
+	{ 0x40b20, 0xe5e5e5 },
+	{ 0x40b24, 0xe5e5e5 },
+	{ 0x40b28, 0xe6e6e6 },
+	{ 0x40b2c, 0xe6e6e6 },
+	{ 0x40b30, 0xe7e7e7 },
+	{ 0x40b34, 0xe7e7e7 },
+	{ 0x40b38, 0xe8e8e8 },
+	{ 0x40b3c, 0xe8e8e8 },
+	{ 0x40b40, 0xe9e9e9 },
+	{ 0x40b44, 0xe9e9e9 },
+	{ 0x40b48, 0xeaeaea },
+	{ 0x40b4c, 0xeaeaea },
+	{ 0x40b50, 0xebebeb },
+	{ 0x40b54, 0xebebeb },
+	{ 0x40b58, 0xececec },
+	{ 0x40b5c, 0xececec },
+	{ 0x40b60, 0xededed },
+	{ 0x40b64, 0xededed },
+	{ 0x40b68, 0xeeeeee },
+	{ 0x40b6c, 0xeeeeee },
+	{ 0x40b70, 0xefefef },
+	{ 0x40b74, 0xefefef },
+	{ 0x40b78, 0xf0f0f0 },
+	{ 0x40b7c, 0xf0f0f0 },
+	{ 0x40b80, 0xf1f1f1 },
+	{ 0x40b84, 0xf1f1f1 },
+	{ 0x40b88, 0xf2f2f2 },
+	{ 0x40b8c, 0xf2f2f2 },
+	{ 0x40b90, 0xf2f2f2 },
+	{ 0x40b94, 0xf3f3f3 },
+	{ 0x40b98, 0xf3f3f3 },
+	{ 0x40b9c, 0xf4f4f4 },
+	{ 0x40ba0, 0xf4f4f4 },
+	{ 0x40ba4, 0xf5f5f5 },
+	{ 0x40ba8, 0xf5f5f5 },
+	{ 0x40bac, 0xf6f6f6 },
+	{ 0x40bb0, 0xf6f6f6 },
+	{ 0x40bb4, 0xf7f7f7 },
+	{ 0x40bb8, 0xf7f7f7 },
+	{ 0x40bbc, 0xf8f8f8 },
+	{ 0x40bc0, 0xf8f8f8 },
+	{ 0x40bc4, 0xf9f9f9 },
+	{ 0x40bc8, 0xf9f9f9 },
+	{ 0x40bcc, 0xfafafa },
+	{ 0x40bd0, 0xfafafa },
+	{ 0x40bd4, 0xfafafa },
+	{ 0x40bd8, 0xfbfbfb },
+	{ 0x40bdc, 0xfbfbfb },
+	{ 0x40be0, 0xfcfcfc },
+	{ 0x40be4, 0xfcfcfc },
+	{ 0x40be8, 0xfdfdfd },
+	{ 0x40bec, 0xfdfdfd },
+	{ 0x40bf0, 0xfefefe },
+	{ 0x40bf4, 0xfefefe },
+	{ 0x40bf8, 0xffffff },
+	{ 0x40bfc, 0xffffff },
+	{ 0x40c00, 0x0 },
+	{ 0x40c04, 0x0 },
+	{ 0x40c08, 0x0 },
+	{ 0x40c0c, 0x0 },
+	{ 0x40c10, 0x0 },
+	{ 0x40c14, 0x0 },
+	{ 0x40c18, 0x0 },
+	{ 0x40c1c, 0x0 },
+	{ 0x40c20, 0x0 },
+	{ 0x40c24, 0x0 },
+	{ 0x40c28, 0x0 },
+	{ 0x40c2c, 0x0 },
+	{ 0x40c30, 0x0 },
+	{ 0x40c34, 0x0 },
+	{ 0x40c38, 0x0 },
+	{ 0x40c3c, 0x0 },
+	{ 0x40c40, 0x10101 },
+	{ 0x40c44, 0x10101 },
+	{ 0x40c48, 0x10101 },
+	{ 0x40c4c, 0x10101 },
+	{ 0x40c50, 0x10101 },
+	{ 0x40c54, 0x10101 },
+	{ 0x40c58, 0x10101 },
+	{ 0x40c5c, 0x10101 },
+	{ 0x40c60, 0x10101 },
+	{ 0x40c64, 0x10101 },
+	{ 0x40c68, 0x20202 },
+	{ 0x40c6c, 0x20202 },
+	{ 0x40c70, 0x20202 },
+	{ 0x40c74, 0x20202 },
+	{ 0x40c78, 0x20202 },
+	{ 0x40c7c, 0x20202 },
+	{ 0x40c80, 0x30303 },
+	{ 0x40c84, 0x30303 },
+	{ 0x40c88, 0x30303 },
+	{ 0x40c8c, 0x30303 },
+	{ 0x40c90, 0x30303 },
+	{ 0x40c94, 0x40404 },
+	{ 0x40c98, 0x40404 },
+	{ 0x40c9c, 0x40404 },
+	{ 0x40ca0, 0x40404 },
+	{ 0x40ca4, 0x40404 },
+	{ 0x40ca8, 0x50505 },
+	{ 0x40cac, 0x50505 },
+	{ 0x40cb0, 0x50505 },
+	{ 0x40cb4, 0x50505 },
+	{ 0x40cb8, 0x60606 },
+	{ 0x40cbc, 0x60606 },
+	{ 0x40cc0, 0x60606 },
+	{ 0x40cc4, 0x70707 },
+	{ 0x40cc8, 0x70707 },
+	{ 0x40ccc, 0x70707 },
+	{ 0x40cd0, 0x70707 },
+	{ 0x40cd4, 0x80808 },
+	{ 0x40cd8, 0x80808 },
+	{ 0x40cdc, 0x80808 },
+	{ 0x40ce0, 0x90909 },
+	{ 0x40ce4, 0x90909 },
+	{ 0x40ce8, 0xa0a0a },
+	{ 0x40cec, 0xa0a0a },
+	{ 0x40cf0, 0xa0a0a },
+	{ 0x40cf4, 0xb0b0b },
+	{ 0x40cf8, 0xb0b0b },
+	{ 0x40cfc, 0xb0b0b },
+	{ 0x40d00, 0xc0c0c },
+	{ 0x40d04, 0xc0c0c },
+	{ 0x40d08, 0xd0d0d },
+	{ 0x40d0c, 0xd0d0d },
+	{ 0x40d10, 0xe0e0e },
+	{ 0x40d14, 0xe0e0e },
+	{ 0x40d18, 0xe0e0e },
+	{ 0x40d1c, 0xf0f0f },
+	{ 0x40d20, 0xf0f0f },
+	{ 0x40d24, 0x101010 },
+	{ 0x40d28, 0x101010 },
+	{ 0x40d2c, 0x111111 },
+	{ 0x40d30, 0x111111 },
+	{ 0x40d34, 0x121212 },
+	{ 0x40d38, 0x121212 },
+	{ 0x40d3c, 0x131313 },
+	{ 0x40d40, 0x131313 },
+	{ 0x40d44, 0x141414 },
+	{ 0x40d48, 0x151515 },
+	{ 0x40d4c, 0x151515 },
+	{ 0x40d50, 0x161616 },
+	{ 0x40d54, 0x161616 },
+	{ 0x40d58, 0x171717 },
+	{ 0x40d5c, 0x171717 },
+	{ 0x40d60, 0x181818 },
+	{ 0x40d64, 0x191919 },
+	{ 0x40d68, 0x191919 },
+	{ 0x40d6c, 0x1a1a1a },
+	{ 0x40d70, 0x1b1b1b },
+	{ 0x40d74, 0x1b1b1b },
+	{ 0x40d78, 0x1c1c1c },
+	{ 0x40d7c, 0x1c1c1c },
+	{ 0x40d80, 0x1d1d1d },
+	{ 0x40d84, 0x1e1e1e },
+	{ 0x40d88, 0x1f1f1f },
+	{ 0x40d8c, 0x1f1f1f },
+	{ 0x40d90, 0x202020 },
+	{ 0x40d94, 0x212121 },
+	{ 0x40d98, 0x212121 },
+	{ 0x40d9c, 0x222222 },
+	{ 0x40da0, 0x232323 },
+	{ 0x40da4, 0x242424 },
+	{ 0x40da8, 0x242424 },
+	{ 0x40dac, 0x252525 },
+	{ 0x40db0, 0x262626 },
+	{ 0x40db4, 0x272727 },
+	{ 0x40db8, 0x272727 },
+	{ 0x40dbc, 0x282828 },
+	{ 0x40dc0, 0x292929 },
+	{ 0x40dc4, 0x2a2a2a },
+	{ 0x40dc8, 0x2b2b2b },
+	{ 0x40dcc, 0x2c2c2c },
+	{ 0x40dd0, 0x2c2c2c },
+	{ 0x40dd4, 0x2d2d2d },
+	{ 0x40dd8, 0x2e2e2e },
+	{ 0x40ddc, 0x2f2f2f },
+	{ 0x40de0, 0x303030 },
+	{ 0x40de4, 0x313131 },
+	{ 0x40de8, 0x323232 },
+	{ 0x40dec, 0x333333 },
+	{ 0x40df0, 0x333333 },
+	{ 0x40df4, 0x343434 },
+	{ 0x40df8, 0x353535 },
+	{ 0x40dfc, 0x363636 },
+	{ 0x40e00, 0x373737 },
+	{ 0x40e04, 0x383838 },
+	{ 0x40e08, 0x393939 },
+	{ 0x40e0c, 0x3a3a3a },
+	{ 0x40e10, 0x3b3b3b },
+	{ 0x40e14, 0x3c3c3c },
+	{ 0x40e18, 0x3d3d3d },
+	{ 0x40e1c, 0x3e3e3e },
+	{ 0x40e20, 0x3f3f3f },
+	{ 0x40e24, 0x404040 },
+	{ 0x40e28, 0x414141 },
+	{ 0x40e2c, 0x424242 },
+	{ 0x40e30, 0x434343 },
+	{ 0x40e34, 0x444444 },
+	{ 0x40e38, 0x464646 },
+	{ 0x40e3c, 0x474747 },
+	{ 0x40e40, 0x484848 },
+	{ 0x40e44, 0x494949 },
+	{ 0x40e48, 0x4a4a4a },
+	{ 0x40e4c, 0x4b4b4b },
+	{ 0x40e50, 0x4c4c4c },
+	{ 0x40e54, 0x4d4d4d },
+	{ 0x40e58, 0x4f4f4f },
+	{ 0x40e5c, 0x505050 },
+	{ 0x40e60, 0x515151 },
+	{ 0x40e64, 0x525252 },
+	{ 0x40e68, 0x535353 },
+	{ 0x40e6c, 0x545454 },
+	{ 0x40e70, 0x565656 },
+	{ 0x40e74, 0x575757 },
+	{ 0x40e78, 0x585858 },
+	{ 0x40e7c, 0x595959 },
+	{ 0x40e80, 0x5b5b5b },
+	{ 0x40e84, 0x5c5c5c },
+	{ 0x40e88, 0x5d5d5d },
+	{ 0x40e8c, 0x5e5e5e },
+	{ 0x40e90, 0x606060 },
+	{ 0x40e94, 0x616161 },
+	{ 0x40e98, 0x626262 },
+	{ 0x40e9c, 0x646464 },
+	{ 0x40ea0, 0x656565 },
+	{ 0x40ea4, 0x666666 },
+	{ 0x40ea8, 0x686868 },
+	{ 0x40eac, 0x696969 },
+	{ 0x40eb0, 0x6a6a6a },
+	{ 0x40eb4, 0x6c6c6c },
+	{ 0x40eb8, 0x6d6d6d },
+	{ 0x40ebc, 0x6f6f6f },
+	{ 0x40ec0, 0x707070 },
+	{ 0x40ec4, 0x717171 },
+	{ 0x40ec8, 0x737373 },
+	{ 0x40ecc, 0x747474 },
+	{ 0x40ed0, 0x767676 },
+	{ 0x40ed4, 0x777777 },
+	{ 0x40ed8, 0x797979 },
+	{ 0x40edc, 0x7a7a7a },
+	{ 0x40ee0, 0x7c7c7c },
+	{ 0x40ee4, 0x7d7d7d },
+	{ 0x40ee8, 0x7f7f7f },
+	{ 0x40eec, 0x808080 },
+	{ 0x40ef0, 0x828282 },
+	{ 0x40ef4, 0x838383 },
+	{ 0x40ef8, 0x858585 },
+	{ 0x40efc, 0x868686 },
+	{ 0x40f00, 0x888888 },
+	{ 0x40f04, 0x898989 },
+	{ 0x40f08, 0x8b8b8b },
+	{ 0x40f0c, 0x8d8d8d },
+	{ 0x40f10, 0x8e8e8e },
+	{ 0x40f14, 0x909090 },
+	{ 0x40f18, 0x919191 },
+	{ 0x40f1c, 0x939393 },
+	{ 0x40f20, 0x959595 },
+	{ 0x40f24, 0x969696 },
+	{ 0x40f28, 0x989898 },
+	{ 0x40f2c, 0x9a9a9a },
+	{ 0x40f30, 0x9b9b9b },
+	{ 0x40f34, 0x9d9d9d },
+	{ 0x40f38, 0x9f9f9f },
+	{ 0x40f3c, 0xa1a1a1 },
+	{ 0x40f40, 0xa2a2a2 },
+	{ 0x40f44, 0xa4a4a4 },
+	{ 0x40f48, 0xa6a6a6 },
+	{ 0x40f4c, 0xa7a7a7 },
+	{ 0x40f50, 0xa9a9a9 },
+	{ 0x40f54, 0xababab },
+	{ 0x40f58, 0xadadad },
+	{ 0x40f5c, 0xafafaf },
+	{ 0x40f60, 0xb0b0b0 },
+	{ 0x40f64, 0xb2b2b2 },
+	{ 0x40f68, 0xb4b4b4 },
+	{ 0x40f6c, 0xb6b6b6 },
+	{ 0x40f70, 0xb8b8b8 },
+	{ 0x40f74, 0xbababa },
+	{ 0x40f78, 0xbbbbbb },
+	{ 0x40f7c, 0xbdbdbd },
+	{ 0x40f80, 0xbfbfbf },
+	{ 0x40f84, 0xc1c1c1 },
+	{ 0x40f88, 0xc3c3c3 },
+	{ 0x40f8c, 0xc5c5c5 },
+	{ 0x40f90, 0xc7c7c7 },
+	{ 0x40f94, 0xc9c9c9 },
+	{ 0x40f98, 0xcbcbcb },
+	{ 0x40f9c, 0xcdcdcd },
+	{ 0x40fa0, 0xcfcfcf },
+	{ 0x40fa4, 0xd1d1d1 },
+	{ 0x40fa8, 0xd3d3d3 },
+	{ 0x40fac, 0xd5d5d5 },
+	{ 0x40fb0, 0xd7d7d7 },
+	{ 0x40fb4, 0xd9d9d9 },
+	{ 0x40fb8, 0xdbdbdb },
+	{ 0x40fbc, 0xdddddd },
+	{ 0x40fc0, 0xdfdfdf },
+	{ 0x40fc4, 0xe1e1e1 },
+	{ 0x40fc8, 0xe3e3e3 },
+	{ 0x40fcc, 0xe5e5e5 },
+	{ 0x40fd0, 0xe7e7e7 },
+	{ 0x40fd4, 0xe9e9e9 },
+	{ 0x40fd8, 0xebebeb },
+	{ 0x40fdc, 0xeeeeee },
+	{ 0x40fe0, 0xf0f0f0 },
+	{ 0x40fe4, 0xf2f2f2 },
+	{ 0x40fe8, 0xf4f4f4 },
+	{ 0x40fec, 0xf6f6f6 },
+	{ 0x40ff0, 0xf8f8f8 },
+	{ 0x40ff4, 0xfbfbfb },
+	{ 0x40ff8, 0xfdfdfd },
+	{ 0x40ffc, 0xffffff },
+};
diff --git a/drivers/video/msm/mdp_hw.h b/drivers/video/msm/mdp_hw.h
new file mode 100644
index 0000000..4e3deb4
--- /dev/null
+++ b/drivers/video/msm/mdp_hw.h
@@ -0,0 +1,621 @@
+/* drivers/video/msm_fb/mdp_hw.h
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+#ifndef _MDP_HW_H_
+#define _MDP_HW_H_
+
+#include <mach/msm_iomap.h>
+#include <mach/msm_fb.h>
+
+struct mdp_info {
+	struct mdp_device mdp_dev;
+	char * __iomem base;
+	int irq;
+};
+struct mdp_blit_req;
+struct mdp_device;
+int mdp_ppp_blit(const struct mdp_info *mdp, struct mdp_blit_req *req,
+		 struct file *src_file, unsigned long src_start,
+		 unsigned long src_len, struct file *dst_file,
+		 unsigned long dst_start, unsigned long dst_len);
+#define mdp_writel(mdp, value, offset) writel(value, mdp->base + offset)
+#define mdp_readl(mdp, offset) readl(mdp->base + offset)
+
+#define MDP_SYNC_CONFIG_0                (0x00000)
+#define MDP_SYNC_CONFIG_1                (0x00004)
+#define MDP_SYNC_CONFIG_2                (0x00008)
+#define MDP_SYNC_STATUS_0                (0x0000c)
+#define MDP_SYNC_STATUS_1                (0x00010)
+#define MDP_SYNC_STATUS_2                (0x00014)
+#define MDP_SYNC_THRESH_0                (0x00018)
+#define MDP_SYNC_THRESH_1                (0x0001c)
+#define MDP_INTR_ENABLE                  (0x00020)
+#define MDP_INTR_STATUS                  (0x00024)
+#define MDP_INTR_CLEAR                   (0x00028)
+#define MDP_DISPLAY0_START               (0x00030)
+#define MDP_DISPLAY1_START               (0x00034)
+#define MDP_DISPLAY_STATUS               (0x00038)
+#define MDP_EBI2_LCD0                    (0x0003c)
+#define MDP_EBI2_LCD1                    (0x00040)
+#define MDP_DISPLAY0_ADDR                (0x00054)
+#define MDP_DISPLAY1_ADDR                (0x00058)
+#define MDP_EBI2_PORTMAP_MODE            (0x0005c)
+#define MDP_MODE                         (0x00060)
+#define MDP_TV_OUT_STATUS                (0x00064)
+#define MDP_HW_VERSION                   (0x00070)
+#define MDP_SW_RESET                     (0x00074)
+#define MDP_AXI_ERROR_MASTER_STOP        (0x00078)
+#define MDP_SEL_CLK_OR_HCLK_TEST_BUS     (0x0007c)
+#define MDP_PRIMARY_VSYNC_OUT_CTRL       (0x00080)
+#define MDP_SECONDARY_VSYNC_OUT_CTRL     (0x00084)
+#define MDP_EXTERNAL_VSYNC_OUT_CTRL      (0x00088)
+#define MDP_VSYNC_CTRL                   (0x0008c)
+#define MDP_CGC_EN                       (0x00100)
+#define MDP_CMD_STATUS                   (0x10008)
+#define MDP_PROFILE_EN                   (0x10010)
+#define MDP_PROFILE_COUNT                (0x10014)
+#define MDP_DMA_START                    (0x10044)
+#define MDP_FULL_BYPASS_WORD0            (0x10100)
+#define MDP_FULL_BYPASS_WORD1            (0x10104)
+#define MDP_COMMAND_CONFIG               (0x10104)
+#define MDP_FULL_BYPASS_WORD2            (0x10108)
+#define MDP_FULL_BYPASS_WORD3            (0x1010c)
+#define MDP_FULL_BYPASS_WORD4            (0x10110)
+#define MDP_FULL_BYPASS_WORD6            (0x10118)
+#define MDP_FULL_BYPASS_WORD7            (0x1011c)
+#define MDP_FULL_BYPASS_WORD8            (0x10120)
+#define MDP_FULL_BYPASS_WORD9            (0x10124)
+#define MDP_PPP_SOURCE_CONFIG            (0x10124)
+#define MDP_FULL_BYPASS_WORD10           (0x10128)
+#define MDP_FULL_BYPASS_WORD11           (0x1012c)
+#define MDP_FULL_BYPASS_WORD12           (0x10130)
+#define MDP_FULL_BYPASS_WORD13           (0x10134)
+#define MDP_FULL_BYPASS_WORD14           (0x10138)
+#define MDP_PPP_OPERATION_CONFIG         (0x10138)
+#define MDP_FULL_BYPASS_WORD15           (0x1013c)
+#define MDP_FULL_BYPASS_WORD16           (0x10140)
+#define MDP_FULL_BYPASS_WORD17           (0x10144)
+#define MDP_FULL_BYPASS_WORD18           (0x10148)
+#define MDP_FULL_BYPASS_WORD19           (0x1014c)
+#define MDP_FULL_BYPASS_WORD20           (0x10150)
+#define MDP_PPP_DESTINATION_CONFIG       (0x10150)
+#define MDP_FULL_BYPASS_WORD21           (0x10154)
+#define MDP_FULL_BYPASS_WORD22           (0x10158)
+#define MDP_FULL_BYPASS_WORD23           (0x1015c)
+#define MDP_FULL_BYPASS_WORD24           (0x10160)
+#define MDP_FULL_BYPASS_WORD25           (0x10164)
+#define MDP_FULL_BYPASS_WORD26           (0x10168)
+#define MDP_FULL_BYPASS_WORD27           (0x1016c)
+#define MDP_FULL_BYPASS_WORD29           (0x10174)
+#define MDP_FULL_BYPASS_WORD30           (0x10178)
+#define MDP_FULL_BYPASS_WORD31           (0x1017c)
+#define MDP_FULL_BYPASS_WORD32           (0x10180)
+#define MDP_DMA_CONFIG                   (0x10180)
+#define MDP_FULL_BYPASS_WORD33           (0x10184)
+#define MDP_FULL_BYPASS_WORD34           (0x10188)
+#define MDP_FULL_BYPASS_WORD35           (0x1018c)
+#define MDP_FULL_BYPASS_WORD37           (0x10194)
+#define MDP_FULL_BYPASS_WORD39           (0x1019c)
+#define MDP_FULL_BYPASS_WORD40           (0x101a0)
+#define MDP_FULL_BYPASS_WORD41           (0x101a4)
+#define MDP_FULL_BYPASS_WORD43           (0x101ac)
+#define MDP_FULL_BYPASS_WORD46           (0x101b8)
+#define MDP_FULL_BYPASS_WORD47           (0x101bc)
+#define MDP_FULL_BYPASS_WORD48           (0x101c0)
+#define MDP_FULL_BYPASS_WORD49           (0x101c4)
+#define MDP_FULL_BYPASS_WORD50           (0x101c8)
+#define MDP_FULL_BYPASS_WORD51           (0x101cc)
+#define MDP_FULL_BYPASS_WORD52           (0x101d0)
+#define MDP_FULL_BYPASS_WORD53           (0x101d4)
+#define MDP_FULL_BYPASS_WORD54           (0x101d8)
+#define MDP_FULL_BYPASS_WORD55           (0x101dc)
+#define MDP_FULL_BYPASS_WORD56           (0x101e0)
+#define MDP_FULL_BYPASS_WORD57           (0x101e4)
+#define MDP_FULL_BYPASS_WORD58           (0x101e8)
+#define MDP_FULL_BYPASS_WORD59           (0x101ec)
+#define MDP_FULL_BYPASS_WORD60           (0x101f0)
+#define MDP_VSYNC_THRESHOLD              (0x101f0)
+#define MDP_FULL_BYPASS_WORD61           (0x101f4)
+#define MDP_FULL_BYPASS_WORD62           (0x101f8)
+#define MDP_FULL_BYPASS_WORD63           (0x101fc)
+#define MDP_TFETCH_TEST_MODE             (0x20004)
+#define MDP_TFETCH_STATUS                (0x20008)
+#define MDP_TFETCH_TILE_COUNT            (0x20010)
+#define MDP_TFETCH_FETCH_COUNT           (0x20014)
+#define MDP_TFETCH_CONSTANT_COLOR        (0x20040)
+#define MDP_CSC_BYPASS                   (0x40004)
+#define MDP_SCALE_COEFF_LSB              (0x5fffc)
+#define MDP_TV_OUT_CTL                   (0xc0000)
+#define MDP_TV_OUT_FIR_COEFF             (0xc0004)
+#define MDP_TV_OUT_BUF_ADDR              (0xc0008)
+#define MDP_TV_OUT_CC_DATA               (0xc000c)
+#define MDP_TV_OUT_SOBEL                 (0xc0010)
+#define MDP_TV_OUT_Y_CLAMP               (0xc0018)
+#define MDP_TV_OUT_CB_CLAMP              (0xc001c)
+#define MDP_TV_OUT_CR_CLAMP              (0xc0020)
+#define MDP_TEST_MODE_CLK                (0xd0000)
+#define MDP_TEST_MISR_RESET_CLK          (0xd0004)
+#define MDP_TEST_EXPORT_MISR_CLK         (0xd0008)
+#define MDP_TEST_MISR_CURR_VAL_CLK       (0xd000c)
+#define MDP_TEST_MODE_HCLK               (0xd0100)
+#define MDP_TEST_MISR_RESET_HCLK         (0xd0104)
+#define MDP_TEST_EXPORT_MISR_HCLK        (0xd0108)
+#define MDP_TEST_MISR_CURR_VAL_HCLK      (0xd010c)
+#define MDP_TEST_MODE_DCLK               (0xd0200)
+#define MDP_TEST_MISR_RESET_DCLK         (0xd0204)
+#define MDP_TEST_EXPORT_MISR_DCLK        (0xd0208)
+#define MDP_TEST_MISR_CURR_VAL_DCLK      (0xd020c)
+#define MDP_TEST_CAPTURED_DCLK           (0xd0210)
+#define MDP_TEST_MISR_CAPT_VAL_DCLK      (0xd0214)
+#define MDP_LCDC_CTL                     (0xe0000)
+#define MDP_LCDC_HSYNC_CTL               (0xe0004)
+#define MDP_LCDC_VSYNC_CTL               (0xe0008)
+#define MDP_LCDC_ACTIVE_HCTL             (0xe000c)
+#define MDP_LCDC_ACTIVE_VCTL             (0xe0010)
+#define MDP_LCDC_BORDER_CLR              (0xe0014)
+#define MDP_LCDC_H_BLANK                 (0xe0018)
+#define MDP_LCDC_V_BLANK                 (0xe001c)
+#define MDP_LCDC_UNDERFLOW_CLR           (0xe0020)
+#define MDP_LCDC_HSYNC_SKEW              (0xe0024)
+#define MDP_LCDC_TEST_CTL                (0xe0028)
+#define MDP_LCDC_LINE_IRQ                (0xe002c)
+#define MDP_LCDC_CTL_POLARITY            (0xe0030)
+#define MDP_LCDC_DMA_CONFIG              (0xe1000)
+#define MDP_LCDC_DMA_SIZE                (0xe1004)
+#define MDP_LCDC_DMA_IBUF_ADDR           (0xe1008)
+#define MDP_LCDC_DMA_IBUF_Y_STRIDE       (0xe100c)
+
+
+#define MDP_DMA2_TERM 0x1
+#define MDP_DMA3_TERM 0x2
+#define MDP_PPP_TERM 0x3
+
+/* MDP_INTR_ENABLE */
+#define DL0_ROI_DONE           (1<<0)
+#define DL1_ROI_DONE           (1<<1)
+#define DL0_DMA2_TERM_DONE     (1<<2)
+#define DL1_DMA2_TERM_DONE     (1<<3)
+#define DL0_PPP_TERM_DONE      (1<<4)
+#define DL1_PPP_TERM_DONE      (1<<5)
+#define TV_OUT_DMA3_DONE       (1<<6)
+#define TV_ENC_UNDERRUN        (1<<7)
+#define DL0_FETCH_DONE         (1<<11)
+#define DL1_FETCH_DONE         (1<<12)
+
+#define MDP_PPP_BUSY_STATUS (DL0_ROI_DONE| \
+			   DL1_ROI_DONE| \
+			   DL0_PPP_TERM_DONE| \
+			   DL1_PPP_TERM_DONE)
+
+#define MDP_ANY_INTR_MASK (DL0_ROI_DONE| \
+			   DL1_ROI_DONE| \
+			   DL0_DMA2_TERM_DONE| \
+			   DL1_DMA2_TERM_DONE| \
+			   DL0_PPP_TERM_DONE| \
+			   DL1_PPP_TERM_DONE| \
+			   DL0_FETCH_DONE| \
+			   DL1_FETCH_DONE| \
+			   TV_ENC_UNDERRUN)
+
+#define MDP_TOP_LUMA       16
+#define MDP_TOP_CHROMA     0
+#define MDP_BOTTOM_LUMA    19
+#define MDP_BOTTOM_CHROMA  3
+#define MDP_LEFT_LUMA      22
+#define MDP_LEFT_CHROMA    6
+#define MDP_RIGHT_LUMA     25
+#define MDP_RIGHT_CHROMA   9
+
+#define CLR_G 0x0
+#define CLR_B 0x1
+#define CLR_R 0x2
+#define CLR_ALPHA 0x3
+
+#define CLR_Y  CLR_G
+#define CLR_CB CLR_B
+#define CLR_CR CLR_R
+
+/* from lsb to msb */
+#define MDP_GET_PACK_PATTERN(a, x, y, z, bit) \
+	(((a)<<(bit*3))|((x)<<(bit*2))|((y)<<bit)|(z))
+
+/* MDP_SYNC_CONFIG_0/1/2 */
+#define MDP_SYNCFG_HGT_LOC 22
+#define MDP_SYNCFG_VSYNC_EXT_EN (1<<21)
+#define MDP_SYNCFG_VSYNC_INT_EN (1<<20)
+
+/* MDP_SYNC_THRESH_0 */
+#define MDP_PRIM_BELOW_LOC 0
+#define MDP_PRIM_ABOVE_LOC 8
+
+/* MDP_{PRIMARY,SECONDARY,EXTERNAL}_VSYNC_OUT_CRL */
+#define VSYNC_PULSE_EN (1<<31)
+#define VSYNC_PULSE_INV (1<<30)
+
+/* MDP_VSYNC_CTRL */
+#define DISP0_VSYNC_MAP_VSYNC0 0
+#define DISP0_VSYNC_MAP_VSYNC1 (1<<0)
+#define DISP0_VSYNC_MAP_VSYNC2 ((1<<0)|(1<<1))
+
+#define DISP1_VSYNC_MAP_VSYNC0 0
+#define DISP1_VSYNC_MAP_VSYNC1 (1<<2)
+#define DISP1_VSYNC_MAP_VSYNC2 ((1<<2)|(1<<3))
+
+#define PRIMARY_LCD_SYNC_EN (1<<4)
+#define PRIMARY_LCD_SYNC_DISABLE 0
+
+#define SECONDARY_LCD_SYNC_EN (1<<5)
+#define SECONDARY_LCD_SYNC_DISABLE 0
+
+#define EXTERNAL_LCD_SYNC_EN (1<<6)
+#define EXTERNAL_LCD_SYNC_DISABLE 0
+
+/* MDP_VSYNC_THRESHOLD / MDP_FULL_BYPASS_WORD60 */
+#define VSYNC_THRESHOLD_ABOVE_LOC 0
+#define VSYNC_THRESHOLD_BELOW_LOC 16
+#define VSYNC_ANTI_TEAR_EN (1<<31)
+
+/* MDP_COMMAND_CONFIG / MDP_FULL_BYPASS_WORD1 */
+#define MDP_CMD_DBGBUS_EN (1<<0)
+
+/* MDP_PPP_SOURCE_CONFIG / MDP_FULL_BYPASS_WORD9&53 */
+#define PPP_SRC_C0G_8BIT ((1<<1)|(1<<0))
+#define PPP_SRC_C1B_8BIT ((1<<3)|(1<<2))
+#define PPP_SRC_C2R_8BIT ((1<<5)|(1<<4))
+#define PPP_SRC_C3A_8BIT ((1<<7)|(1<<6))
+
+#define PPP_SRC_C0G_6BIT (1<<1)
+#define PPP_SRC_C1B_6BIT (1<<3)
+#define PPP_SRC_C2R_6BIT (1<<5)
+
+#define PPP_SRC_C0G_5BIT (1<<0)
+#define PPP_SRC_C1B_5BIT (1<<2)
+#define PPP_SRC_C2R_5BIT (1<<4)
+
+#define PPP_SRC_C3ALPHA_EN (1<<8)
+
+#define PPP_SRC_BPP_1BYTES 0
+#define PPP_SRC_BPP_2BYTES (1<<9)
+#define PPP_SRC_BPP_3BYTES (1<<10)
+#define PPP_SRC_BPP_4BYTES ((1<<10)|(1<<9))
+
+#define PPP_SRC_BPP_ROI_ODD_X (1<<11)
+#define PPP_SRC_BPP_ROI_ODD_Y (1<<12)
+#define PPP_SRC_INTERLVD_2COMPONENTS (1<<13)
+#define PPP_SRC_INTERLVD_3COMPONENTS (1<<14)
+#define PPP_SRC_INTERLVD_4COMPONENTS ((1<<14)|(1<<13))
+
+
+/* RGB666 unpack format
+** TIGHT means R6+G6+B6 together
+** LOOSE means R6+2 +G6+2+ B6+2 (with MSB)
+**          or 2+R6 +2+G6 +2+B6 (with LSB)
+*/
+#define PPP_SRC_PACK_TIGHT (1<<17)
+#define PPP_SRC_PACK_LOOSE 0
+#define PPP_SRC_PACK_ALIGN_LSB 0
+#define PPP_SRC_PACK_ALIGN_MSB (1<<18)
+
+#define PPP_SRC_PLANE_INTERLVD 0
+#define PPP_SRC_PLANE_PSEUDOPLNR (1<<20)
+
+#define PPP_SRC_WMV9_MODE (1<<21)
+
+/* MDP_PPP_OPERATION_CONFIG / MDP_FULL_BYPASS_WORD14 */
+#define PPP_OP_SCALE_X_ON (1<<0)
+#define PPP_OP_SCALE_Y_ON (1<<1)
+
+#define PPP_OP_CONVERT_RGB2YCBCR 0
+#define PPP_OP_CONVERT_YCBCR2RGB (1<<2)
+#define PPP_OP_CONVERT_ON (1<<3)
+
+#define PPP_OP_CONVERT_MATRIX_PRIMARY 0
+#define PPP_OP_CONVERT_MATRIX_SECONDARY (1<<4)
+
+#define PPP_OP_LUT_C0_ON (1<<5)
+#define PPP_OP_LUT_C1_ON (1<<6)
+#define PPP_OP_LUT_C2_ON (1<<7)
+
+/* rotate or blend enable */
+#define PPP_OP_ROT_ON (1<<8)
+
+#define PPP_OP_ROT_90 (1<<9)
+#define PPP_OP_FLIP_LR (1<<10)
+#define PPP_OP_FLIP_UD (1<<11)
+
+#define PPP_OP_BLEND_ON (1<<12)
+
+#define PPP_OP_BLEND_SRCPIXEL_ALPHA 0
+#define PPP_OP_BLEND_DSTPIXEL_ALPHA (1<<13)
+#define PPP_OP_BLEND_CONSTANT_ALPHA (1<<14)
+#define PPP_OP_BLEND_SRCPIXEL_TRANSP ((1<<13)|(1<<14))
+
+#define PPP_OP_BLEND_ALPHA_BLEND_NORMAL 0
+#define PPP_OP_BLEND_ALPHA_BLEND_REVERSE (1<<15)
+
+#define PPP_OP_DITHER_EN (1<<16)
+
+#define PPP_OP_COLOR_SPACE_RGB 0
+#define PPP_OP_COLOR_SPACE_YCBCR (1<<17)
+
+#define PPP_OP_SRC_CHROMA_RGB 0
+#define PPP_OP_SRC_CHROMA_H2V1 (1<<18)
+#define PPP_OP_SRC_CHROMA_H1V2 (1<<19)
+#define PPP_OP_SRC_CHROMA_420 ((1<<18)|(1<<19))
+#define PPP_OP_SRC_CHROMA_COSITE 0
+#define PPP_OP_SRC_CHROMA_OFFSITE (1<<20)
+
+#define PPP_OP_DST_CHROMA_RGB 0
+#define PPP_OP_DST_CHROMA_H2V1 (1<<21)
+#define PPP_OP_DST_CHROMA_H1V2 (1<<22)
+#define PPP_OP_DST_CHROMA_420 ((1<<21)|(1<<22))
+#define PPP_OP_DST_CHROMA_COSITE 0
+#define PPP_OP_DST_CHROMA_OFFSITE (1<<23)
+
+#define PPP_BLEND_ALPHA_TRANSP (1<<24)
+
+#define PPP_OP_BG_CHROMA_RGB 0
+#define PPP_OP_BG_CHROMA_H2V1 (1<<25)
+#define PPP_OP_BG_CHROMA_H1V2 (1<<26)
+#define PPP_OP_BG_CHROMA_420 ((1<<25)|(1<<26))
+#define PPP_OP_BG_CHROMA_SITE_COSITE 0
+#define PPP_OP_BG_CHROMA_SITE_OFFSITE (1<<27)
+
+/* MDP_PPP_DESTINATION_CONFIG / MDP_FULL_BYPASS_WORD20 */
+#define PPP_DST_C0G_8BIT ((1<<0)|(1<<1))
+#define PPP_DST_C1B_8BIT ((1<<3)|(1<<2))
+#define PPP_DST_C2R_8BIT ((1<<5)|(1<<4))
+#define PPP_DST_C3A_8BIT ((1<<7)|(1<<6))
+
+#define PPP_DST_C0G_6BIT (1<<1)
+#define PPP_DST_C1B_6BIT (1<<3)
+#define PPP_DST_C2R_6BIT (1<<5)
+
+#define PPP_DST_C0G_5BIT (1<<0)
+#define PPP_DST_C1B_5BIT (1<<2)
+#define PPP_DST_C2R_5BIT (1<<4)
+
+#define PPP_DST_C3A_8BIT ((1<<7)|(1<<6))
+#define PPP_DST_C3ALPHA_EN (1<<8)
+
+#define PPP_DST_INTERLVD_2COMPONENTS (1<<9)
+#define PPP_DST_INTERLVD_3COMPONENTS (1<<10)
+#define PPP_DST_INTERLVD_4COMPONENTS ((1<<10)|(1<<9))
+#define PPP_DST_INTERLVD_6COMPONENTS ((1<<11)|(1<<9))
+
+#define PPP_DST_PACK_LOOSE 0
+#define PPP_DST_PACK_TIGHT (1<<13)
+#define PPP_DST_PACK_ALIGN_LSB 0
+#define PPP_DST_PACK_ALIGN_MSB (1<<14)
+
+#define PPP_DST_OUT_SEL_AXI 0
+#define PPP_DST_OUT_SEL_MDDI (1<<15)
+
+#define PPP_DST_BPP_2BYTES (1<<16)
+#define PPP_DST_BPP_3BYTES (1<<17)
+#define PPP_DST_BPP_4BYTES ((1<<17)|(1<<16))
+
+#define PPP_DST_PLANE_INTERLVD 0
+#define PPP_DST_PLANE_PLANAR (1<<18)
+#define PPP_DST_PLANE_PSEUDOPLNR (1<<19)
+
+#define PPP_DST_TO_TV (1<<20)
+
+#define PPP_DST_MDDI_PRIMARY 0
+#define PPP_DST_MDDI_SECONDARY (1<<21)
+#define PPP_DST_MDDI_EXTERNAL (1<<22)
+
+/* image configurations by image type */
+#define PPP_CFG_MDP_RGB_565(dir)       (PPP_##dir##_C2R_5BIT | \
+					PPP_##dir##_C0G_6BIT | \
+					PPP_##dir##_C1B_5BIT | \
+					PPP_##dir##_BPP_2BYTES | \
+					PPP_##dir##_INTERLVD_3COMPONENTS | \
+					PPP_##dir##_PACK_TIGHT | \
+					PPP_##dir##_PACK_ALIGN_LSB | \
+					PPP_##dir##_PLANE_INTERLVD)
+
+#define PPP_CFG_MDP_RGB_888(dir)       (PPP_##dir##_C2R_8BIT | \
+					PPP_##dir##_C0G_8BIT | \
+					PPP_##dir##_C1B_8BIT | \
+					PPP_##dir##_BPP_3BYTES | \
+					PPP_##dir##_INTERLVD_3COMPONENTS | \
+					PPP_##dir##_PACK_TIGHT | \
+					PPP_##dir##_PACK_ALIGN_LSB | \
+					PPP_##dir##_PLANE_INTERLVD)
+
+#define PPP_CFG_MDP_ARGB_8888(dir)     (PPP_##dir##_C2R_8BIT | \
+					PPP_##dir##_C0G_8BIT | \
+					PPP_##dir##_C1B_8BIT | \
+					PPP_##dir##_C3A_8BIT | \
+					PPP_##dir##_C3ALPHA_EN | \
+					PPP_##dir##_BPP_4BYTES | \
+					PPP_##dir##_INTERLVD_4COMPONENTS | \
+					PPP_##dir##_PACK_TIGHT | \
+					PPP_##dir##_PACK_ALIGN_LSB | \
+					PPP_##dir##_PLANE_INTERLVD)
+
+#define PPP_CFG_MDP_XRGB_8888(dir) PPP_CFG_MDP_ARGB_8888(dir)
+#define PPP_CFG_MDP_RGBA_8888(dir) PPP_CFG_MDP_ARGB_8888(dir)
+#define PPP_CFG_MDP_BGRA_8888(dir) PPP_CFG_MDP_ARGB_8888(dir)
+
+#define PPP_CFG_MDP_Y_CBCR_H2V2(dir)   (PPP_##dir##_C2R_8BIT | \
+					PPP_##dir##_C0G_8BIT | \
+					PPP_##dir##_C1B_8BIT | \
+					PPP_##dir##_C3A_8BIT | \
+					PPP_##dir##_BPP_2BYTES | \
+					PPP_##dir##_INTERLVD_2COMPONENTS | \
+					PPP_##dir##_PACK_TIGHT | \
+					PPP_##dir##_PACK_ALIGN_LSB | \
+					PPP_##dir##_PLANE_PSEUDOPLNR)
+
+#define PPP_CFG_MDP_Y_CRCB_H2V2(dir)	PPP_CFG_MDP_Y_CBCR_H2V2(dir)
+
+#define PPP_CFG_MDP_YCRYCB_H2V1(dir)   (PPP_##dir##_C2R_8BIT | \
+					PPP_##dir##_C0G_8BIT | \
+					PPP_##dir##_C1B_8BIT | \
+					PPP_##dir##_C3A_8BIT | \
+					PPP_##dir##_BPP_2BYTES | \
+					PPP_##dir##_INTERLVD_4COMPONENTS | \
+					PPP_##dir##_PACK_TIGHT | \
+					PPP_##dir##_PACK_ALIGN_LSB |\
+					PPP_##dir##_PLANE_INTERLVD)
+
+#define PPP_CFG_MDP_Y_CBCR_H2V1(dir)   (PPP_##dir##_C2R_8BIT | \
+					PPP_##dir##_C0G_8BIT | \
+					PPP_##dir##_C1B_8BIT | \
+					PPP_##dir##_C3A_8BIT | \
+					PPP_##dir##_BPP_2BYTES |   \
+					PPP_##dir##_INTERLVD_2COMPONENTS |  \
+					PPP_##dir##_PACK_TIGHT | \
+					PPP_##dir##_PACK_ALIGN_LSB | \
+					PPP_##dir##_PLANE_PSEUDOPLNR)
+
+#define PPP_CFG_MDP_Y_CRCB_H2V1(dir)	PPP_CFG_MDP_Y_CBCR_H2V1(dir)
+
+#define PPP_PACK_PATTERN_MDP_RGB_565 \
+	MDP_GET_PACK_PATTERN(0, CLR_R, CLR_G, CLR_B, 8)
+#define PPP_PACK_PATTERN_MDP_RGB_888 PPP_PACK_PATTERN_MDP_RGB_565
+#define PPP_PACK_PATTERN_MDP_XRGB_8888 \
+	MDP_GET_PACK_PATTERN(CLR_ALPHA, CLR_R, CLR_G, CLR_B, 8)
+#define PPP_PACK_PATTERN_MDP_ARGB_8888 PPP_PACK_PATTERN_MDP_XRGB_8888
+#define PPP_PACK_PATTERN_MDP_RGBA_8888 \
+	MDP_GET_PACK_PATTERN(CLR_ALPHA, CLR_B, CLR_G, CLR_R, 8)
+#define PPP_PACK_PATTERN_MDP_BGRA_8888 \
+	MDP_GET_PACK_PATTERN(CLR_ALPHA, CLR_R, CLR_G, CLR_B, 8)
+#define PPP_PACK_PATTERN_MDP_Y_CBCR_H2V1 \
+	MDP_GET_PACK_PATTERN(0, 0, CLR_CB, CLR_CR, 8)
+#define PPP_PACK_PATTERN_MDP_Y_CBCR_H2V2 PPP_PACK_PATTERN_MDP_Y_CBCR_H2V1
+#define PPP_PACK_PATTERN_MDP_Y_CRCB_H2V1 \
+	MDP_GET_PACK_PATTERN(0, 0, CLR_CR, CLR_CB, 8)
+#define PPP_PACK_PATTERN_MDP_Y_CRCB_H2V2 PPP_PACK_PATTERN_MDP_Y_CRCB_H2V1
+#define PPP_PACK_PATTERN_MDP_YCRYCB_H2V1 \
+	MDP_GET_PACK_PATTERN(CLR_Y, CLR_R, CLR_Y, CLR_B, 8)
+
+#define PPP_CHROMA_SAMP_MDP_RGB_565(dir) PPP_OP_##dir##_CHROMA_RGB
+#define PPP_CHROMA_SAMP_MDP_RGB_888(dir) PPP_OP_##dir##_CHROMA_RGB
+#define PPP_CHROMA_SAMP_MDP_XRGB_8888(dir) PPP_OP_##dir##_CHROMA_RGB
+#define PPP_CHROMA_SAMP_MDP_ARGB_8888(dir) PPP_OP_##dir##_CHROMA_RGB
+#define PPP_CHROMA_SAMP_MDP_RGBA_8888(dir) PPP_OP_##dir##_CHROMA_RGB
+#define PPP_CHROMA_SAMP_MDP_BGRA_8888(dir) PPP_OP_##dir##_CHROMA_RGB
+#define PPP_CHROMA_SAMP_MDP_Y_CBCR_H2V1(dir) PPP_OP_##dir##_CHROMA_H2V1
+#define PPP_CHROMA_SAMP_MDP_Y_CBCR_H2V2(dir) PPP_OP_##dir##_CHROMA_420
+#define PPP_CHROMA_SAMP_MDP_Y_CRCB_H2V1(dir) PPP_OP_##dir##_CHROMA_H2V1
+#define PPP_CHROMA_SAMP_MDP_Y_CRCB_H2V2(dir) PPP_OP_##dir##_CHROMA_420
+#define PPP_CHROMA_SAMP_MDP_YCRYCB_H2V1(dir) PPP_OP_##dir##_CHROMA_H2V1
+
+/* Helpful array generation macros */
+#define PPP_ARRAY0(name) \
+	[MDP_RGB_565] = PPP_##name##_MDP_RGB_565,\
+	[MDP_RGB_888] = PPP_##name##_MDP_RGB_888,\
+	[MDP_XRGB_8888] = PPP_##name##_MDP_XRGB_8888,\
+	[MDP_ARGB_8888] = PPP_##name##_MDP_ARGB_8888,\
+	[MDP_RGBA_8888] = PPP_##name##_MDP_RGBA_8888,\
+	[MDP_BGRA_8888] = PPP_##name##_MDP_BGRA_8888,\
+	[MDP_Y_CBCR_H2V1] = PPP_##name##_MDP_Y_CBCR_H2V1,\
+	[MDP_Y_CBCR_H2V2] = PPP_##name##_MDP_Y_CBCR_H2V2,\
+	[MDP_Y_CRCB_H2V1] = PPP_##name##_MDP_Y_CRCB_H2V1,\
+	[MDP_Y_CRCB_H2V2] = PPP_##name##_MDP_Y_CRCB_H2V2,\
+	[MDP_YCRYCB_H2V1] = PPP_##name##_MDP_YCRYCB_H2V1
+
+#define PPP_ARRAY1(name, dir) \
+	[MDP_RGB_565] = PPP_##name##_MDP_RGB_565(dir),\
+	[MDP_RGB_888] = PPP_##name##_MDP_RGB_888(dir),\
+	[MDP_XRGB_8888] = PPP_##name##_MDP_XRGB_8888(dir),\
+	[MDP_ARGB_8888] = PPP_##name##_MDP_ARGB_8888(dir),\
+	[MDP_RGBA_8888] = PPP_##name##_MDP_RGBA_8888(dir),\
+	[MDP_BGRA_8888] = PPP_##name##_MDP_BGRA_8888(dir),\
+	[MDP_Y_CBCR_H2V1] = PPP_##name##_MDP_Y_CBCR_H2V1(dir),\
+	[MDP_Y_CBCR_H2V2] = PPP_##name##_MDP_Y_CBCR_H2V2(dir),\
+	[MDP_Y_CRCB_H2V1] = PPP_##name##_MDP_Y_CRCB_H2V1(dir),\
+	[MDP_Y_CRCB_H2V2] = PPP_##name##_MDP_Y_CRCB_H2V2(dir),\
+	[MDP_YCRYCB_H2V1] = PPP_##name##_MDP_YCRYCB_H2V1(dir)
+
+#define IS_YCRCB(img) ((img == MDP_Y_CRCB_H2V2) | (img == MDP_Y_CBCR_H2V2) | \
+		       (img == MDP_Y_CRCB_H2V1) | (img == MDP_Y_CBCR_H2V1) | \
+		       (img == MDP_YCRYCB_H2V1))
+#define IS_RGB(img) ((img == MDP_RGB_565) | (img == MDP_RGB_888) | \
+		     (img == MDP_ARGB_8888) | (img == MDP_RGBA_8888) | \
+		     (img == MDP_XRGB_8888) | (img == MDP_BGRA_8888))
+#define HAS_ALPHA(img) ((img == MDP_ARGB_8888) | (img == MDP_RGBA_8888) | \
+			(img == MDP_BGRA_8888))
+
+#define IS_PSEUDOPLNR(img) ((img == MDP_Y_CRCB_H2V2) | \
+			    (img == MDP_Y_CBCR_H2V2) | \
+			    (img == MDP_Y_CRCB_H2V1) | \
+			    (img == MDP_Y_CBCR_H2V1))
+
+/* Mappings from addr to purpose */
+#define PPP_ADDR_SRC_ROI		MDP_FULL_BYPASS_WORD2
+#define PPP_ADDR_SRC0			MDP_FULL_BYPASS_WORD3
+#define PPP_ADDR_SRC1			MDP_FULL_BYPASS_WORD4
+#define PPP_ADDR_SRC_YSTRIDE		MDP_FULL_BYPASS_WORD7
+#define PPP_ADDR_SRC_CFG		MDP_FULL_BYPASS_WORD9
+#define PPP_ADDR_SRC_PACK_PATTERN	MDP_FULL_BYPASS_WORD10
+#define PPP_ADDR_OPERATION		MDP_FULL_BYPASS_WORD14
+#define PPP_ADDR_PHASEX_INIT		MDP_FULL_BYPASS_WORD15
+#define PPP_ADDR_PHASEY_INIT		MDP_FULL_BYPASS_WORD16
+#define PPP_ADDR_PHASEX_STEP		MDP_FULL_BYPASS_WORD17
+#define PPP_ADDR_PHASEY_STEP		MDP_FULL_BYPASS_WORD18
+#define PPP_ADDR_ALPHA_TRANSP		MDP_FULL_BYPASS_WORD19
+#define PPP_ADDR_DST_CFG		MDP_FULL_BYPASS_WORD20
+#define PPP_ADDR_DST_PACK_PATTERN	MDP_FULL_BYPASS_WORD21
+#define PPP_ADDR_DST_ROI		MDP_FULL_BYPASS_WORD25
+#define PPP_ADDR_DST0			MDP_FULL_BYPASS_WORD26
+#define PPP_ADDR_DST1			MDP_FULL_BYPASS_WORD27
+#define PPP_ADDR_DST_YSTRIDE		MDP_FULL_BYPASS_WORD30
+#define PPP_ADDR_EDGE			MDP_FULL_BYPASS_WORD46
+#define PPP_ADDR_BG0			MDP_FULL_BYPASS_WORD48
+#define PPP_ADDR_BG1			MDP_FULL_BYPASS_WORD49
+#define PPP_ADDR_BG_YSTRIDE		MDP_FULL_BYPASS_WORD51
+#define PPP_ADDR_BG_CFG			MDP_FULL_BYPASS_WORD53
+#define PPP_ADDR_BG_PACK_PATTERN	MDP_FULL_BYPASS_WORD54
+
+/* MDP_DMA_CONFIG / MDP_FULL_BYPASS_WORD32 */
+#define DMA_DSTC0G_6BITS (1<<1)
+#define DMA_DSTC1B_6BITS (1<<3)
+#define DMA_DSTC2R_6BITS (1<<5)
+#define DMA_DSTC0G_5BITS (1<<0)
+#define DMA_DSTC1B_5BITS (1<<2)
+#define DMA_DSTC2R_5BITS (1<<4)
+
+#define DMA_PACK_TIGHT (1<<6)
+#define DMA_PACK_LOOSE 0
+#define DMA_PACK_ALIGN_LSB 0
+#define DMA_PACK_ALIGN_MSB (1<<7)
+#define DMA_PACK_PATTERN_RGB \
+	(MDP_GET_PACK_PATTERN(0, CLR_R, CLR_G, CLR_B, 2)<<8)
+
+#define DMA_OUT_SEL_AHB  0
+#define DMA_OUT_SEL_MDDI (1<<14)
+#define DMA_AHBM_LCD_SEL_PRIMARY 0
+#define DMA_AHBM_LCD_SEL_SECONDARY (1<<15)
+#define DMA_IBUF_C3ALPHA_EN (1<<16)
+#define DMA_DITHER_EN (1<<17)
+
+#define DMA_MDDI_DMAOUT_LCD_SEL_PRIMARY 0
+#define DMA_MDDI_DMAOUT_LCD_SEL_SECONDARY (1<<18)
+#define DMA_MDDI_DMAOUT_LCD_SEL_EXTERNAL (1<<19)
+
+#define DMA_IBUF_FORMAT_RGB565 (1<<20)
+#define DMA_IBUF_FORMAT_RGB888_OR_ARGB8888 0
+
+#define DMA_IBUF_NONCONTIGUOUS (1<<21)
+
+/* MDDI REGISTER ? */
+#define MDDI_VDO_PACKET_DESC  0x5666
+#define MDDI_VDO_PACKET_PRIM  0xC3
+#define MDDI_VDO_PACKET_SECD  0xC0
+
+#endif
diff --git a/drivers/video/msm/mdp_ppp.c b/drivers/video/msm/mdp_ppp.c
new file mode 100644
index 0000000..ba2c467
--- /dev/null
+++ b/drivers/video/msm/mdp_ppp.c
@@ -0,0 +1,750 @@
+/* drivers/video/msm/mdp_ppp.c
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+#include <linux/fb.h>
+#include <linux/file.h>
+#include <linux/delay.h>
+#include <linux/msm_mdp.h>
+#include <linux/android_pmem.h>
+#include <mach/msm_fb.h>
+
+#include "mdp_hw.h"
+#include "mdp_scale_tables.h"
+
+#define DLOG(x...) do {} while (0)
+
+#define MDP_DOWNSCALE_BLUR (MDP_DOWNSCALE_MAX + 1)
+static int downscale_y_table = MDP_DOWNSCALE_MAX;
+static int downscale_x_table = MDP_DOWNSCALE_MAX;
+
+struct mdp_regs {
+	uint32_t src0;
+	uint32_t src1;
+	uint32_t dst0;
+	uint32_t dst1;
+	uint32_t src_cfg;
+	uint32_t dst_cfg;
+	uint32_t src_pack;
+	uint32_t dst_pack;
+	uint32_t src_rect;
+	uint32_t dst_rect;
+	uint32_t src_ystride;
+	uint32_t dst_ystride;
+	uint32_t op;
+	uint32_t src_bpp;
+	uint32_t dst_bpp;
+	uint32_t edge;
+	uint32_t phasex_init;
+	uint32_t phasey_init;
+	uint32_t phasex_step;
+	uint32_t phasey_step;
+};
+
+static uint32_t pack_pattern[] = {
+	PPP_ARRAY0(PACK_PATTERN)
+};
+
+static uint32_t src_img_cfg[] = {
+	PPP_ARRAY1(CFG, SRC)
+};
+
+static uint32_t dst_img_cfg[] = {
+	PPP_ARRAY1(CFG, DST)
+};
+
+static uint32_t bytes_per_pixel[] = {
+	[MDP_RGB_565] = 2,
+	[MDP_RGB_888] = 3,
+	[MDP_XRGB_8888] = 4,
+	[MDP_ARGB_8888] = 4,
+	[MDP_RGBA_8888] = 4,
+	[MDP_BGRA_8888] = 4,
+	[MDP_Y_CBCR_H2V1] = 1,
+	[MDP_Y_CBCR_H2V2] = 1,
+	[MDP_Y_CRCB_H2V1] = 1,
+	[MDP_Y_CRCB_H2V2] = 1,
+	[MDP_YCRYCB_H2V1] = 2
+};
+
+static uint32_t dst_op_chroma[] = {
+	PPP_ARRAY1(CHROMA_SAMP, DST)
+};
+
+static uint32_t src_op_chroma[] = {
+	PPP_ARRAY1(CHROMA_SAMP, SRC)
+};
+
+static uint32_t bg_op_chroma[] = {
+	PPP_ARRAY1(CHROMA_SAMP, BG)
+};
+
+static void rotate_dst_addr_x(struct mdp_blit_req *req, struct mdp_regs *regs)
+{
+	regs->dst0 += (req->dst_rect.w -
+		       min((uint32_t)16, req->dst_rect.w)) * regs->dst_bpp;
+	regs->dst1 += (req->dst_rect.w -
+		       min((uint32_t)16, req->dst_rect.w)) * regs->dst_bpp;
+}
+
+static void rotate_dst_addr_y(struct mdp_blit_req *req, struct mdp_regs *regs)
+{
+	regs->dst0 += (req->dst_rect.h -
+		       min((uint32_t)16, req->dst_rect.h)) *
+		       regs->dst_ystride;
+	regs->dst1 += (req->dst_rect.h -
+		       min((uint32_t)16, req->dst_rect.h)) *
+		       regs->dst_ystride;
+}
+
+static void blit_rotate(struct mdp_blit_req *req,
+			struct mdp_regs *regs)
+{
+	if (req->flags == MDP_ROT_NOP)
+		return;
+
+	regs->op |= PPP_OP_ROT_ON;
+	if ((req->flags & MDP_ROT_90 || req->flags & MDP_FLIP_LR) &&
+	    !(req->flags & MDP_ROT_90 && req->flags & MDP_FLIP_LR))
+		rotate_dst_addr_x(req, regs);
+	if (req->flags & MDP_ROT_90)
+		regs->op |= PPP_OP_ROT_90;
+	if (req->flags & MDP_FLIP_UD) {
+		regs->op |= PPP_OP_FLIP_UD;
+		rotate_dst_addr_y(req, regs);
+	}
+	if (req->flags & MDP_FLIP_LR)
+		regs->op |= PPP_OP_FLIP_LR;
+}
+
+static void blit_convert(struct mdp_blit_req *req, struct mdp_regs *regs)
+{
+	if (req->src.format == req->dst.format)
+		return;
+	if (IS_RGB(req->src.format) && IS_YCRCB(req->dst.format)) {
+		regs->op |= PPP_OP_CONVERT_RGB2YCBCR | PPP_OP_CONVERT_ON;
+	} else if (IS_YCRCB(req->src.format) && IS_RGB(req->dst.format)) {
+		regs->op |= PPP_OP_CONVERT_YCBCR2RGB | PPP_OP_CONVERT_ON;
+		if (req->dst.format == MDP_RGB_565)
+			regs->op |= PPP_OP_CONVERT_MATRIX_SECONDARY;
+	}
+}
+
+#define GET_BIT_RANGE(value, high, low) \
+	(((1 << (high - low + 1)) - 1) & (value >> low))
+static uint32_t transp_convert(struct mdp_blit_req *req)
+{
+	uint32_t transp = 0;
+	if (req->src.format == MDP_RGB_565) {
+		/* pad each value to 8 bits by copying the high bits into the
+		 * low end, convert RGB to RBG by switching low 2 components */
+		transp |= ((GET_BIT_RANGE(req->transp_mask, 15, 11) << 3) |
+			   (GET_BIT_RANGE(req->transp_mask, 15, 13))) << 16;
+
+		transp |= ((GET_BIT_RANGE(req->transp_mask, 4, 0) << 3) |
+			   (GET_BIT_RANGE(req->transp_mask, 4, 2))) << 8;
+
+		transp |= (GET_BIT_RANGE(req->transp_mask, 10, 5) << 2) |
+			  (GET_BIT_RANGE(req->transp_mask, 10, 9));
+	} else {
+		/* convert RGB to RBG */
+		transp |= (GET_BIT_RANGE(req->transp_mask, 15, 8)) |
+			  (GET_BIT_RANGE(req->transp_mask, 23, 16) << 16) |
+			  (GET_BIT_RANGE(req->transp_mask, 7, 0) << 8);
+	}
+	return transp;
+}
+#undef GET_BIT_RANGE
+
+static void blit_blend(struct mdp_blit_req *req, struct mdp_regs *regs)
+{
+	/* TRANSP BLEND */
+	if (req->transp_mask != MDP_TRANSP_NOP) {
+		req->transp_mask = transp_convert(req);
+		if (req->alpha != MDP_ALPHA_NOP) {
+			/* use blended transparancy mode
+			 * pixel = (src == transp) ? dst : blend
+			 * blend is combo of blend_eq_sel and
+			 * blend_alpha_sel */
+			regs->op |= PPP_OP_ROT_ON | PPP_OP_BLEND_ON |
+				PPP_OP_BLEND_ALPHA_BLEND_NORMAL |
+				PPP_OP_BLEND_CONSTANT_ALPHA |
+				PPP_BLEND_ALPHA_TRANSP;
+		} else {
+			/* simple transparancy mode
+			 * pixel = (src == transp) ? dst : src */
+			regs->op |= PPP_OP_ROT_ON | PPP_OP_BLEND_ON |
+				PPP_OP_BLEND_SRCPIXEL_TRANSP;
+		}
+	}
+
+	req->alpha &= 0xff;
+	/* ALPHA BLEND */
+	if (HAS_ALPHA(req->src.format)) {
+		regs->op |= PPP_OP_ROT_ON | PPP_OP_BLEND_ON |
+			PPP_OP_BLEND_SRCPIXEL_ALPHA;
+	} else if (req->alpha < MDP_ALPHA_NOP) {
+		/* just blend by alpha */
+		regs->op |= PPP_OP_ROT_ON | PPP_OP_BLEND_ON |
+			PPP_OP_BLEND_ALPHA_BLEND_NORMAL |
+			PPP_OP_BLEND_CONSTANT_ALPHA;
+	}
+
+	regs->op |= bg_op_chroma[req->dst.format];
+}
+
+#define ONE_HALF	(1LL << 32)
+#define ONE		(1LL << 33)
+#define TWO		(2LL << 33)
+#define THREE		(3LL << 33)
+#define FRAC_MASK (ONE - 1)
+#define INT_MASK (~FRAC_MASK)
+
+static int scale_params(uint32_t dim_in, uint32_t dim_out, uint32_t origin,
+			uint32_t *phase_init, uint32_t *phase_step)
+{
+	/* to improve precicsion calculations are done in U31.33 and converted
+	 * to U3.29 at the end */
+	int64_t k1, k2, k3, k4, tmp;
+	uint64_t n, d, os, os_p, od, od_p, oreq;
+	unsigned rpa = 0;
+	int64_t ip64, delta;
+
+	if (dim_out % 3 == 0)
+		rpa = !(dim_in % (dim_out / 3));
+
+	n = ((uint64_t)dim_out) << 34;
+	d = dim_in;
+	if (!d)
+		return -1;
+	do_div(n, d);
+	k3 = (n + 1) >> 1;
+	if ((k3 >> 4) < (1LL << 27) || (k3 >> 4) > (1LL << 31)) {
+		DLOG("crap bad scale\n");
+		return -1;
+	}
+	n = ((uint64_t)dim_in) << 34;
+	d = (uint64_t)dim_out;
+	if (!d)
+		return -1;
+	do_div(n, d);
+	k1 = (n + 1) >> 1;
+	k2 = (k1 - ONE) >> 1;
+
+	*phase_init = (int)(k2 >> 4);
+	k4 = (k3 - ONE) >> 1;
+
+	if (rpa) {
+		os = ((uint64_t)origin << 33) - ONE_HALF;
+		tmp = (dim_out * os) + ONE_HALF;
+		if (!dim_in)
+			return -1;
+		do_div(tmp, dim_in);
+		od = tmp - ONE_HALF;
+	} else {
+		os = ((uint64_t)origin << 1) - 1;
+		od = (((k3 * os) >> 1) + k4);
+	}
+
+	od_p = od & INT_MASK;
+	if (od_p != od)
+		od_p += ONE;
+
+	if (rpa) {
+		tmp = (dim_in * od_p) + ONE_HALF;
+		if (!dim_in)
+			return -1;
+		do_div(tmp, dim_in);
+		os_p = tmp - ONE_HALF;
+	} else {
+		os_p = ((k1 * (od_p >> 33)) + k2);
+	}
+
+	oreq = (os_p & INT_MASK) - ONE;
+
+	ip64 = os_p - oreq;
+	delta = ((int64_t)(origin) << 33) - oreq;
+	ip64 -= delta;
+	/* limit to valid range before the left shift */
+	delta = (ip64 & (1LL << 63)) ? 4 : -4;
+	delta <<= 33;
+	while (abs((int)(ip64 >> 33)) > 4)
+		ip64 += delta;
+	*phase_init = (int)(ip64 >> 4);
+	*phase_step = (uint32_t)(k1 >> 4);
+	return 0;
+}
+
+static void load_scale_table(const struct mdp_info *mdp,
+			     struct mdp_table_entry *table, int len)
+{
+	int i;
+	for (i = 0; i < len; i++)
+		mdp_writel(mdp, table[i].val, table[i].reg);
+}
+
+enum {
+IMG_LEFT,
+IMG_RIGHT,
+IMG_TOP,
+IMG_BOTTOM,
+};
+
+static void get_edge_info(uint32_t src, uint32_t src_coord, uint32_t dst,
+			  uint32_t *interp1, uint32_t *interp2,
+			  uint32_t *repeat1, uint32_t *repeat2) {
+	if (src > 3 * dst) {
+		*interp1 = 0;
+		*interp2 = src - 1;
+		*repeat1 = 0;
+		*repeat2 = 0;
+	} else if (src == 3 * dst) {
+		*interp1 = 0;
+		*interp2 = src;
+		*repeat1 = 0;
+		*repeat2 = 1;
+	} else if (src > dst && src < 3 * dst) {
+		*interp1 = -1;
+		*interp2 = src;
+		*repeat1 = 1;
+		*repeat2 = 1;
+	} else if (src == dst) {
+		*interp1 = -1;
+		*interp2 = src + 1;
+		*repeat1 = 1;
+		*repeat2 = 2;
+	} else {
+		*interp1 = -2;
+		*interp2 = src + 1;
+		*repeat1 = 2;
+		*repeat2 = 2;
+	}
+	*interp1 += src_coord;
+	*interp2 += src_coord;
+}
+
+static int get_edge_cond(struct mdp_blit_req *req, struct mdp_regs *regs)
+{
+	int32_t luma_interp[4];
+	int32_t luma_repeat[4];
+	int32_t chroma_interp[4];
+	int32_t chroma_bound[4];
+	int32_t chroma_repeat[4];
+	uint32_t dst_w, dst_h;
+
+	memset(&luma_interp, 0, sizeof(int32_t) * 4);
+	memset(&luma_repeat, 0, sizeof(int32_t) * 4);
+	memset(&chroma_interp, 0, sizeof(int32_t) * 4);
+	memset(&chroma_bound, 0, sizeof(int32_t) * 4);
+	memset(&chroma_repeat, 0, sizeof(int32_t) * 4);
+	regs->edge = 0;
+
+	if (req->flags & MDP_ROT_90) {
+		dst_w = req->dst_rect.h;
+		dst_h = req->dst_rect.w;
+	} else {
+		dst_w = req->dst_rect.w;
+		dst_h = req->dst_rect.h;
+	}
+
+	if (regs->op & (PPP_OP_SCALE_Y_ON | PPP_OP_SCALE_X_ON)) {
+		get_edge_info(req->src_rect.h, req->src_rect.y, dst_h,
+			      &luma_interp[IMG_TOP], &luma_interp[IMG_BOTTOM],
+			      &luma_repeat[IMG_TOP], &luma_repeat[IMG_BOTTOM]);
+		get_edge_info(req->src_rect.w, req->src_rect.x, dst_w,
+			      &luma_interp[IMG_LEFT], &luma_interp[IMG_RIGHT],
+			      &luma_repeat[IMG_LEFT], &luma_repeat[IMG_RIGHT]);
+	} else {
+		luma_interp[IMG_LEFT] = req->src_rect.x;
+		luma_interp[IMG_RIGHT] = req->src_rect.x + req->src_rect.w - 1;
+		luma_interp[IMG_TOP] = req->src_rect.y;
+		luma_interp[IMG_BOTTOM] = req->src_rect.y + req->src_rect.h - 1;
+		luma_repeat[IMG_LEFT] = 0;
+		luma_repeat[IMG_TOP] = 0;
+		luma_repeat[IMG_RIGHT] = 0;
+		luma_repeat[IMG_BOTTOM] = 0;
+	}
+
+	chroma_interp[IMG_LEFT] = luma_interp[IMG_LEFT];
+	chroma_interp[IMG_RIGHT] = luma_interp[IMG_RIGHT];
+	chroma_interp[IMG_TOP] = luma_interp[IMG_TOP];
+	chroma_interp[IMG_BOTTOM] = luma_interp[IMG_BOTTOM];
+
+	chroma_bound[IMG_LEFT] = req->src_rect.x;
+	chroma_bound[IMG_RIGHT] = req->src_rect.x + req->src_rect.w - 1;
+	chroma_bound[IMG_TOP] = req->src_rect.y;
+	chroma_bound[IMG_BOTTOM] = req->src_rect.y + req->src_rect.h - 1;
+
+	if (IS_YCRCB(req->src.format)) {
+		chroma_interp[IMG_LEFT] = chroma_interp[IMG_LEFT] >> 1;
+		chroma_interp[IMG_RIGHT] = (chroma_interp[IMG_RIGHT] + 1) >> 1;
+
+		chroma_bound[IMG_LEFT] = chroma_bound[IMG_LEFT] >> 1;
+		chroma_bound[IMG_RIGHT] = chroma_bound[IMG_RIGHT] >> 1;
+	}
+
+	if (req->src.format == MDP_Y_CBCR_H2V2 ||
+	    req->src.format == MDP_Y_CRCB_H2V2) {
+		chroma_interp[IMG_TOP] = (chroma_interp[IMG_TOP] - 1) >> 1;
+		chroma_interp[IMG_BOTTOM] = (chroma_interp[IMG_BOTTOM] + 1)
+					    >> 1;
+		chroma_bound[IMG_TOP] = (chroma_bound[IMG_TOP] + 1) >> 1;
+		chroma_bound[IMG_BOTTOM] = chroma_bound[IMG_BOTTOM] >> 1;
+	}
+
+	chroma_repeat[IMG_LEFT] = chroma_bound[IMG_LEFT] -
+				  chroma_interp[IMG_LEFT];
+	chroma_repeat[IMG_RIGHT] = chroma_interp[IMG_RIGHT] -
+				  chroma_bound[IMG_RIGHT];
+	chroma_repeat[IMG_TOP] = chroma_bound[IMG_TOP] -
+				  chroma_interp[IMG_TOP];
+	chroma_repeat[IMG_BOTTOM] = chroma_interp[IMG_BOTTOM] -
+				  chroma_bound[IMG_BOTTOM];
+
+	if (chroma_repeat[IMG_LEFT] < 0 || chroma_repeat[IMG_LEFT] > 3 ||
+	    chroma_repeat[IMG_RIGHT] < 0 || chroma_repeat[IMG_RIGHT] > 3 ||
+	    chroma_repeat[IMG_TOP] < 0 || chroma_repeat[IMG_TOP] > 3 ||
+	    chroma_repeat[IMG_BOTTOM] < 0 || chroma_repeat[IMG_BOTTOM] > 3 ||
+	    luma_repeat[IMG_LEFT] < 0 || luma_repeat[IMG_LEFT] > 3 ||
+	    luma_repeat[IMG_RIGHT] < 0 || luma_repeat[IMG_RIGHT] > 3 ||
+	    luma_repeat[IMG_TOP] < 0 || luma_repeat[IMG_TOP] > 3 ||
+	    luma_repeat[IMG_BOTTOM] < 0 || luma_repeat[IMG_BOTTOM] > 3)
+		return -1;
+
+	regs->edge |= (chroma_repeat[IMG_LEFT] & 3) << MDP_LEFT_CHROMA;
+	regs->edge |= (chroma_repeat[IMG_RIGHT] & 3) << MDP_RIGHT_CHROMA;
+	regs->edge |= (chroma_repeat[IMG_TOP] & 3) << MDP_TOP_CHROMA;
+	regs->edge |= (chroma_repeat[IMG_BOTTOM] & 3) << MDP_BOTTOM_CHROMA;
+	regs->edge |= (luma_repeat[IMG_LEFT] & 3) << MDP_LEFT_LUMA;
+	regs->edge |= (luma_repeat[IMG_RIGHT] & 3) << MDP_RIGHT_LUMA;
+	regs->edge |= (luma_repeat[IMG_TOP] & 3) << MDP_TOP_LUMA;
+	regs->edge |= (luma_repeat[IMG_BOTTOM] & 3) << MDP_BOTTOM_LUMA;
+	return 0;
+}
+
+static int blit_scale(const struct mdp_info *mdp, struct mdp_blit_req *req,
+		      struct mdp_regs *regs)
+{
+	uint32_t phase_init_x, phase_init_y, phase_step_x, phase_step_y;
+	uint32_t scale_factor_x, scale_factor_y;
+	uint32_t downscale;
+	uint32_t dst_w, dst_h;
+
+	if (req->flags & MDP_ROT_90) {
+		dst_w = req->dst_rect.h;
+		dst_h = req->dst_rect.w;
+	} else {
+		dst_w = req->dst_rect.w;
+		dst_h = req->dst_rect.h;
+	}
+	if ((req->src_rect.w == dst_w)  && (req->src_rect.h == dst_h) &&
+	    !(req->flags & MDP_BLUR)) {
+		regs->phasex_init = 0;
+		regs->phasey_init = 0;
+		regs->phasex_step = 0;
+		regs->phasey_step = 0;
+		return 0;
+	}
+
+	if (scale_params(req->src_rect.w, dst_w, 1, &phase_init_x,
+			 &phase_step_x) ||
+	    scale_params(req->src_rect.h, dst_h, 1, &phase_init_y,
+			 &phase_step_y))
+		return -1;
+
+	scale_factor_x = (dst_w * 10) / req->src_rect.w;
+	scale_factor_y = (dst_h * 10) / req->src_rect.h;
+
+	if (scale_factor_x > 8)
+		downscale = MDP_DOWNSCALE_PT8TO1;
+	else if (scale_factor_x > 6)
+		downscale = MDP_DOWNSCALE_PT6TOPT8;
+	else if (scale_factor_x > 4)
+		downscale = MDP_DOWNSCALE_PT4TOPT6;
+	else
+		downscale = MDP_DOWNSCALE_PT2TOPT4;
+	if (downscale != downscale_x_table) {
+		load_scale_table(mdp, mdp_downscale_x_table[downscale], 64);
+		downscale_x_table = downscale;
+	}
+
+	if (scale_factor_y > 8)
+		downscale = MDP_DOWNSCALE_PT8TO1;
+	else if (scale_factor_y > 6)
+		downscale = MDP_DOWNSCALE_PT6TOPT8;
+	else if (scale_factor_y > 4)
+		downscale = MDP_DOWNSCALE_PT4TOPT6;
+	else
+		downscale = MDP_DOWNSCALE_PT2TOPT4;
+	if (downscale != downscale_y_table) {
+		load_scale_table(mdp, mdp_downscale_y_table[downscale], 64);
+		downscale_y_table = downscale;
+	}
+
+	regs->phasex_init = phase_init_x;
+	regs->phasey_init = phase_init_y;
+	regs->phasex_step = phase_step_x;
+	regs->phasey_step = phase_step_y;
+	regs->op |= (PPP_OP_SCALE_Y_ON | PPP_OP_SCALE_X_ON);
+	return 0;
+
+}
+
+static void blit_blur(const struct mdp_info *mdp, struct mdp_blit_req *req,
+		      struct mdp_regs *regs)
+{
+	if (!(req->flags & MDP_BLUR))
+		return;
+
+	if (!(downscale_x_table == MDP_DOWNSCALE_BLUR &&
+	      downscale_y_table == MDP_DOWNSCALE_BLUR)) {
+		load_scale_table(mdp, mdp_gaussian_blur_table, 128);
+		downscale_x_table = MDP_DOWNSCALE_BLUR;
+		downscale_y_table = MDP_DOWNSCALE_BLUR;
+	}
+
+	regs->op |= (PPP_OP_SCALE_Y_ON | PPP_OP_SCALE_X_ON);
+}
+
+
+#define IMG_LEN(rect_h, w, rect_w, bpp) (((rect_h) * w) * bpp)
+
+#define Y_TO_CRCB_RATIO(format) \
+	((format == MDP_Y_CBCR_H2V2 || format == MDP_Y_CRCB_H2V2) ?  2 :\
+	 (format == MDP_Y_CBCR_H2V1 || format == MDP_Y_CRCB_H2V1) ?  1 : 1)
+
+static void get_len(struct mdp_img *img, struct mdp_rect *rect, uint32_t bpp,
+		    uint32_t *len0, uint32_t *len1)
+{
+	*len0 = IMG_LEN(rect->h, img->width, rect->w, bpp);
+	if (IS_PSEUDOPLNR(img->format))
+		*len1 = *len0/Y_TO_CRCB_RATIO(img->format);
+	else
+		*len1 = 0;
+}
+
+static int valid_src_dst(unsigned long src_start, unsigned long src_len,
+			 unsigned long dst_start, unsigned long dst_len,
+			 struct mdp_blit_req *req, struct mdp_regs *regs)
+{
+	unsigned long src_min_ok = src_start;
+	unsigned long src_max_ok = src_start + src_len;
+	unsigned long dst_min_ok = dst_start;
+	unsigned long dst_max_ok = dst_start + dst_len;
+	uint32_t src0_len, src1_len, dst0_len, dst1_len;
+	get_len(&req->src, &req->src_rect, regs->src_bpp, &src0_len,
+		 &src1_len);
+	get_len(&req->dst, &req->dst_rect, regs->dst_bpp, &dst0_len,
+		 &dst1_len);
+
+	if (regs->src0 < src_min_ok || regs->src0 > src_max_ok ||
+	    regs->src0 + src0_len > src_max_ok) {
+		DLOG("invalid_src %x %x %lx %lx\n", regs->src0,
+		      src0_len, src_min_ok, src_max_ok);
+		return 0;
+	}
+	if (regs->src_cfg & PPP_SRC_PLANE_PSEUDOPLNR) {
+		if (regs->src1 < src_min_ok || regs->src1 > src_max_ok ||
+		    regs->src1 + src1_len > src_max_ok) {
+			DLOG("invalid_src1");
+			return 0;
+		}
+	}
+	if (regs->dst0 < dst_min_ok || regs->dst0 > dst_max_ok ||
+	    regs->dst0 + dst0_len > dst_max_ok) {
+		DLOG("invalid_dst");
+		return 0;
+	}
+	if (regs->dst_cfg & PPP_SRC_PLANE_PSEUDOPLNR) {
+		if (regs->dst1 < dst_min_ok || regs->dst1 > dst_max_ok ||
+		    regs->dst1 + dst1_len > dst_max_ok) {
+			DLOG("invalid_dst1");
+			return 0;
+		}
+	}
+	return 1;
+}
+
+
+static void flush_imgs(struct mdp_blit_req *req, struct mdp_regs *regs,
+		       struct file *src_file, struct file *dst_file)
+{
+#ifdef CONFIG_ANDROID_PMEM
+	uint32_t src0_len, src1_len, dst0_len, dst1_len;
+
+	/* flush src images to memory before dma to mdp */
+	get_len(&req->src, &req->src_rect, regs->src_bpp, &src0_len,
+		&src1_len);
+	flush_pmem_file(src_file, req->src.offset, src0_len);
+	if (IS_PSEUDOPLNR(req->src.format))
+		flush_pmem_file(src_file, req->src.offset + src0_len,
+				src1_len);
+
+	/* flush dst images */
+	get_len(&req->dst, &req->dst_rect, regs->dst_bpp, &dst0_len,
+		&dst1_len);
+	flush_pmem_file(dst_file, req->dst.offset, dst0_len);
+	if (IS_PSEUDOPLNR(req->dst.format))
+		flush_pmem_file(dst_file, req->dst.offset + dst0_len,
+				dst1_len);
+#endif
+}
+
+static void get_chroma_addr(struct mdp_img *img, struct mdp_rect *rect,
+			    uint32_t base, uint32_t bpp, uint32_t cfg,
+			    uint32_t *addr, uint32_t *ystride)
+{
+	uint32_t compress_v = Y_TO_CRCB_RATIO(img->format);
+	uint32_t compress_h = 2;
+	uint32_t  offset;
+
+	if (IS_PSEUDOPLNR(img->format)) {
+		offset = (rect->x / compress_h) * compress_h;
+		offset += rect->y == 0 ? 0 :
+			  ((rect->y + 1) / compress_v) * img->width;
+		*addr = base + (img->width * img->height * bpp);
+		*addr += offset * bpp;
+		*ystride |= *ystride << 16;
+	} else {
+		*addr = 0;
+	}
+}
+
+static int send_blit(const struct mdp_info *mdp, struct mdp_blit_req *req,
+		     struct mdp_regs *regs, struct file *src_file,
+		     struct file *dst_file)
+{
+	mdp_writel(mdp, 1, 0x060);
+	mdp_writel(mdp, regs->src_rect, PPP_ADDR_SRC_ROI);
+	mdp_writel(mdp, regs->src0, PPP_ADDR_SRC0);
+	mdp_writel(mdp, regs->src1, PPP_ADDR_SRC1);
+	mdp_writel(mdp, regs->src_ystride, PPP_ADDR_SRC_YSTRIDE);
+	mdp_writel(mdp, regs->src_cfg, PPP_ADDR_SRC_CFG);
+	mdp_writel(mdp, regs->src_pack, PPP_ADDR_SRC_PACK_PATTERN);
+
+	mdp_writel(mdp, regs->op, PPP_ADDR_OPERATION);
+	mdp_writel(mdp, regs->phasex_init, PPP_ADDR_PHASEX_INIT);
+	mdp_writel(mdp, regs->phasey_init, PPP_ADDR_PHASEY_INIT);
+	mdp_writel(mdp, regs->phasex_step, PPP_ADDR_PHASEX_STEP);
+	mdp_writel(mdp, regs->phasey_step, PPP_ADDR_PHASEY_STEP);
+
+	mdp_writel(mdp, (req->alpha << 24) | (req->transp_mask & 0xffffff),
+	       PPP_ADDR_ALPHA_TRANSP);
+
+	mdp_writel(mdp, regs->dst_cfg, PPP_ADDR_DST_CFG);
+	mdp_writel(mdp, regs->dst_pack, PPP_ADDR_DST_PACK_PATTERN);
+	mdp_writel(mdp, regs->dst_rect, PPP_ADDR_DST_ROI);
+	mdp_writel(mdp, regs->dst0, PPP_ADDR_DST0);
+	mdp_writel(mdp, regs->dst1, PPP_ADDR_DST1);
+	mdp_writel(mdp, regs->dst_ystride, PPP_ADDR_DST_YSTRIDE);
+
+	mdp_writel(mdp, regs->edge, PPP_ADDR_EDGE);
+	if (regs->op & PPP_OP_BLEND_ON) {
+		mdp_writel(mdp, regs->dst0, PPP_ADDR_BG0);
+		mdp_writel(mdp, regs->dst1, PPP_ADDR_BG1);
+		mdp_writel(mdp, regs->dst_ystride, PPP_ADDR_BG_YSTRIDE);
+		mdp_writel(mdp, src_img_cfg[req->dst.format], PPP_ADDR_BG_CFG);
+		mdp_writel(mdp, pack_pattern[req->dst.format],
+			   PPP_ADDR_BG_PACK_PATTERN);
+	}
+	flush_imgs(req, regs, src_file, dst_file);
+	mdp_writel(mdp, 0x1000, MDP_DISPLAY0_START);
+	return 0;
+}
+
+int mdp_ppp_blit(const struct mdp_info *mdp, struct mdp_blit_req *req,
+		 struct file *src_file, unsigned long src_start, unsigned long src_len,
+		 struct file *dst_file, unsigned long dst_start, unsigned long dst_len)
+{
+	struct mdp_regs regs = {0};
+
+	if (unlikely(req->src.format >= MDP_IMGTYPE_LIMIT ||
+		     req->dst.format >= MDP_IMGTYPE_LIMIT)) {
+		printk(KERN_ERR "mpd_ppp: img is of wrong format\n");
+		return -EINVAL;
+	}
+
+	if (unlikely(req->src_rect.x > req->src.width ||
+		     req->src_rect.y > req->src.height ||
+		     req->dst_rect.x > req->dst.width ||
+		     req->dst_rect.y > req->dst.height)) {
+		printk(KERN_ERR "mpd_ppp: img rect is outside of img!\n");
+		return -EINVAL;
+	}
+
+	/* set the src image configuration */
+	regs.src_cfg = src_img_cfg[req->src.format];
+	regs.src_cfg |= (req->src_rect.x & 0x1) ? PPP_SRC_BPP_ROI_ODD_X : 0;
+	regs.src_cfg |= (req->src_rect.y & 0x1) ? PPP_SRC_BPP_ROI_ODD_Y : 0;
+	regs.src_rect = (req->src_rect.h << 16) | req->src_rect.w;
+	regs.src_pack = pack_pattern[req->src.format];
+
+	/* set the dest image configuration */
+	regs.dst_cfg = dst_img_cfg[req->dst.format] | PPP_DST_OUT_SEL_AXI;
+	regs.dst_rect = (req->dst_rect.h << 16) | req->dst_rect.w;
+	regs.dst_pack = pack_pattern[req->dst.format];
+
+	/* set src, bpp, start pixel and ystride */
+	regs.src_bpp = bytes_per_pixel[req->src.format];
+	regs.src0 = src_start + req->src.offset;
+	regs.src_ystride = req->src.width * regs.src_bpp;
+	get_chroma_addr(&req->src, &req->src_rect, regs.src0, regs.src_bpp,
+			regs.src_cfg, &regs.src1, &regs.src_ystride);
+	regs.src0 += (req->src_rect.x + (req->src_rect.y * req->src.width)) *
+		      regs.src_bpp;
+
+	/* set dst, bpp, start pixel and ystride */
+	regs.dst_bpp = bytes_per_pixel[req->dst.format];
+	regs.dst0 = dst_start + req->dst.offset;
+	regs.dst_ystride = req->dst.width * regs.dst_bpp;
+	get_chroma_addr(&req->dst, &req->dst_rect, regs.dst0, regs.dst_bpp,
+			regs.dst_cfg, &regs.dst1, &regs.dst_ystride);
+	regs.dst0 += (req->dst_rect.x + (req->dst_rect.y * req->dst.width)) *
+		      regs.dst_bpp;
+
+	if (!valid_src_dst(src_start, src_len, dst_start, dst_len, req,
+			   &regs)) {
+		printk(KERN_ERR "mpd_ppp: final src or dst location is "
+			"invalid, are you trying to make an image too large "
+			"or to place it outside the screen?\n");
+		return -EINVAL;
+	}
+
+	/* set up operation register */
+	regs.op = 0;
+	blit_rotate(req, &regs);
+	blit_convert(req, &regs);
+	if (req->flags & MDP_DITHER)
+		regs.op |= PPP_OP_DITHER_EN;
+	blit_blend(req, &regs);
+	if (blit_scale(mdp, req, &regs)) {
+		printk(KERN_ERR "mpd_ppp: error computing scale for img.\n");
+		return -EINVAL;
+	}
+	blit_blur(mdp, req, &regs);
+	regs.op |= dst_op_chroma[req->dst.format] |
+		   src_op_chroma[req->src.format];
+
+	/* if the image is YCRYCB, the x and w must be even */
+	if (unlikely(req->src.format == MDP_YCRYCB_H2V1)) {
+		req->src_rect.x = req->src_rect.x & (~0x1);
+		req->src_rect.w = req->src_rect.w & (~0x1);
+		req->dst_rect.x = req->dst_rect.x & (~0x1);
+		req->dst_rect.w = req->dst_rect.w & (~0x1);
+	}
+	if (get_edge_cond(req, &regs))
+		return -EINVAL;
+
+	send_blit(mdp, req, &regs, src_file, dst_file);
+	return 0;
+}
diff --git a/drivers/video/msm/mdp_scale_tables.c b/drivers/video/msm/mdp_scale_tables.c
new file mode 100644
index 0000000..604783b
--- /dev/null
+++ b/drivers/video/msm/mdp_scale_tables.c
@@ -0,0 +1,766 @@
+/* drivers/video/msm_fb/mdp_scale_tables.c
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+
+#include "mdp_scale_tables.h"
+#include "mdp_hw.h"
+
+struct mdp_table_entry mdp_upscale_table[] = {
+	{ 0x5fffc, 0x0 },
+	{ 0x50200, 0x7fc00000 },
+	{ 0x5fffc, 0xff80000d },
+	{ 0x50204, 0x7ec003f9 },
+	{ 0x5fffc, 0xfec0001c },
+	{ 0x50208, 0x7d4003f3 },
+	{ 0x5fffc, 0xfe40002b },
+	{ 0x5020c, 0x7b8003ed },
+	{ 0x5fffc, 0xfd80003c },
+	{ 0x50210, 0x794003e8 },
+	{ 0x5fffc, 0xfcc0004d },
+	{ 0x50214, 0x76c003e4 },
+	{ 0x5fffc, 0xfc40005f },
+	{ 0x50218, 0x73c003e0 },
+	{ 0x5fffc, 0xfb800071 },
+	{ 0x5021c, 0x708003de },
+	{ 0x5fffc, 0xfac00085 },
+	{ 0x50220, 0x6d0003db },
+	{ 0x5fffc, 0xfa000098 },
+	{ 0x50224, 0x698003d9 },
+	{ 0x5fffc, 0xf98000ac },
+	{ 0x50228, 0x654003d8 },
+	{ 0x5fffc, 0xf8c000c1 },
+	{ 0x5022c, 0x610003d7 },
+	{ 0x5fffc, 0xf84000d5 },
+	{ 0x50230, 0x5c8003d7 },
+	{ 0x5fffc, 0xf7c000e9 },
+	{ 0x50234, 0x580003d7 },
+	{ 0x5fffc, 0xf74000fd },
+	{ 0x50238, 0x534003d8 },
+	{ 0x5fffc, 0xf6c00112 },
+	{ 0x5023c, 0x4e8003d8 },
+	{ 0x5fffc, 0xf6800126 },
+	{ 0x50240, 0x494003da },
+	{ 0x5fffc, 0xf600013a },
+	{ 0x50244, 0x448003db },
+	{ 0x5fffc, 0xf600014d },
+	{ 0x50248, 0x3f4003dd },
+	{ 0x5fffc, 0xf5c00160 },
+	{ 0x5024c, 0x3a4003df },
+	{ 0x5fffc, 0xf5c00172 },
+	{ 0x50250, 0x354003e1 },
+	{ 0x5fffc, 0xf5c00184 },
+	{ 0x50254, 0x304003e3 },
+	{ 0x5fffc, 0xf6000195 },
+	{ 0x50258, 0x2b0003e6 },
+	{ 0x5fffc, 0xf64001a6 },
+	{ 0x5025c, 0x260003e8 },
+	{ 0x5fffc, 0xf6c001b4 },
+	{ 0x50260, 0x214003eb },
+	{ 0x5fffc, 0xf78001c2 },
+	{ 0x50264, 0x1c4003ee },
+	{ 0x5fffc, 0xf80001cf },
+	{ 0x50268, 0x17c003f1 },
+	{ 0x5fffc, 0xf90001db },
+	{ 0x5026c, 0x134003f3 },
+	{ 0x5fffc, 0xfa0001e5 },
+	{ 0x50270, 0xf0003f6 },
+	{ 0x5fffc, 0xfb4001ee },
+	{ 0x50274, 0xac003f9 },
+	{ 0x5fffc, 0xfcc001f5 },
+	{ 0x50278, 0x70003fb },
+	{ 0x5fffc, 0xfe4001fb },
+	{ 0x5027c, 0x34003fe },
+};
+
+static struct mdp_table_entry mdp_downscale_x_table_PT2TOPT4[] = {
+	{ 0x5fffc, 0x740008c },
+	{ 0x50280, 0x33800088 },
+	{ 0x5fffc, 0x800008e },
+	{ 0x50284, 0x33400084 },
+	{ 0x5fffc, 0x8400092 },
+	{ 0x50288, 0x33000080 },
+	{ 0x5fffc, 0x9000094 },
+	{ 0x5028c, 0x3300007b },
+	{ 0x5fffc, 0x9c00098 },
+	{ 0x50290, 0x32400077 },
+	{ 0x5fffc, 0xa40009b },
+	{ 0x50294, 0x32000073 },
+	{ 0x5fffc, 0xb00009d },
+	{ 0x50298,  0x31c0006f },
+	{ 0x5fffc,  0xbc000a0 },
+	{ 0x5029c,  0x3140006b },
+	{ 0x5fffc,  0xc8000a2 },
+	{ 0x502a0,  0x31000067 },
+	{ 0x5fffc,  0xd8000a5 },
+	{ 0x502a4,  0x30800062 },
+	{ 0x5fffc,  0xe4000a8 },
+	{ 0x502a8,  0x2fc0005f },
+	{ 0x5fffc,  0xec000aa },
+	{ 0x502ac,  0x2fc0005b },
+	{ 0x5fffc,  0xf8000ad },
+	{ 0x502b0,  0x2f400057 },
+	{ 0x5fffc,  0x108000b0 },
+	{ 0x502b4,  0x2e400054 },
+	{ 0x5fffc,  0x114000b2 },
+	{ 0x502b8,  0x2e000050 },
+	{ 0x5fffc,  0x124000b4 },
+	{ 0x502bc,  0x2d80004c },
+	{ 0x5fffc,  0x130000b6 },
+	{ 0x502c0,  0x2d000049 },
+	{ 0x5fffc,  0x140000b8 },
+	{ 0x502c4,  0x2c800045 },
+	{ 0x5fffc,  0x150000b9 },
+	{ 0x502c8,  0x2c000042 },
+	{ 0x5fffc,  0x15c000bd },
+	{ 0x502cc,  0x2b40003e },
+	{ 0x5fffc,  0x16c000bf },
+	{ 0x502d0,  0x2a80003b },
+	{ 0x5fffc,  0x17c000bf },
+	{ 0x502d4,  0x2a000039 },
+	{ 0x5fffc,  0x188000c2 },
+	{ 0x502d8,  0x29400036 },
+	{ 0x5fffc,  0x19c000c4 },
+	{ 0x502dc,  0x28800032 },
+	{ 0x5fffc,  0x1ac000c5 },
+	{ 0x502e0,  0x2800002f },
+	{ 0x5fffc,  0x1bc000c7 },
+	{ 0x502e4,  0x2740002c },
+	{ 0x5fffc,  0x1cc000c8 },
+	{ 0x502e8,  0x26c00029 },
+	{ 0x5fffc,  0x1dc000c9 },
+	{ 0x502ec,  0x26000027 },
+	{ 0x5fffc,  0x1ec000cc },
+	{ 0x502f0,  0x25000024 },
+	{ 0x5fffc,  0x200000cc },
+	{ 0x502f4,  0x24800021 },
+	{ 0x5fffc,  0x210000cd },
+	{ 0x502f8,  0x23800020 },
+	{ 0x5fffc,  0x220000ce },
+	{ 0x502fc,  0x2300001d },
+};
+
+static struct mdp_table_entry mdp_downscale_x_table_PT4TOPT6[] = {
+	{ 0x5fffc,  0x740008c },
+	{ 0x50280,  0x33800088 },
+	{ 0x5fffc,  0x800008e },
+	{ 0x50284,  0x33400084 },
+	{ 0x5fffc,  0x8400092 },
+	{ 0x50288,  0x33000080 },
+	{ 0x5fffc,  0x9000094 },
+	{ 0x5028c,  0x3300007b },
+	{ 0x5fffc,  0x9c00098 },
+	{ 0x50290,  0x32400077 },
+	{ 0x5fffc,  0xa40009b },
+	{ 0x50294,  0x32000073 },
+	{ 0x5fffc,  0xb00009d },
+	{ 0x50298,  0x31c0006f },
+	{ 0x5fffc,  0xbc000a0 },
+	{ 0x5029c,  0x3140006b },
+	{ 0x5fffc,  0xc8000a2 },
+	{ 0x502a0,  0x31000067 },
+	{ 0x5fffc,  0xd8000a5 },
+	{ 0x502a4,  0x30800062 },
+	{ 0x5fffc,  0xe4000a8 },
+	{ 0x502a8,  0x2fc0005f },
+	{ 0x5fffc,  0xec000aa },
+	{ 0x502ac,  0x2fc0005b },
+	{ 0x5fffc,  0xf8000ad },
+	{ 0x502b0,  0x2f400057 },
+	{ 0x5fffc,  0x108000b0 },
+	{ 0x502b4,  0x2e400054 },
+	{ 0x5fffc,  0x114000b2 },
+	{ 0x502b8,  0x2e000050 },
+	{ 0x5fffc,  0x124000b4 },
+	{ 0x502bc,  0x2d80004c },
+	{ 0x5fffc,  0x130000b6 },
+	{ 0x502c0,  0x2d000049 },
+	{ 0x5fffc,  0x140000b8 },
+	{ 0x502c4,  0x2c800045 },
+	{ 0x5fffc,  0x150000b9 },
+	{ 0x502c8,  0x2c000042 },
+	{ 0x5fffc,  0x15c000bd },
+	{ 0x502cc,  0x2b40003e },
+	{ 0x5fffc,  0x16c000bf },
+	{ 0x502d0,  0x2a80003b },
+	{ 0x5fffc,  0x17c000bf },
+	{ 0x502d4,  0x2a000039 },
+	{ 0x5fffc,  0x188000c2 },
+	{ 0x502d8,  0x29400036 },
+	{ 0x5fffc,  0x19c000c4 },
+	{ 0x502dc,  0x28800032 },
+	{ 0x5fffc,  0x1ac000c5 },
+	{ 0x502e0,  0x2800002f },
+	{ 0x5fffc,  0x1bc000c7 },
+	{ 0x502e4,  0x2740002c },
+	{ 0x5fffc,  0x1cc000c8 },
+	{ 0x502e8,  0x26c00029 },
+	{ 0x5fffc,  0x1dc000c9 },
+	{ 0x502ec,  0x26000027 },
+	{ 0x5fffc,  0x1ec000cc },
+	{ 0x502f0,  0x25000024 },
+	{ 0x5fffc,  0x200000cc },
+	{ 0x502f4,  0x24800021 },
+	{ 0x5fffc,  0x210000cd },
+	{ 0x502f8,  0x23800020 },
+	{ 0x5fffc,  0x220000ce },
+	{ 0x502fc,  0x2300001d },
+};
+
+static struct mdp_table_entry mdp_downscale_x_table_PT6TOPT8[] = {
+	{ 0x5fffc,  0xfe000070 },
+	{ 0x50280,  0x4bc00068 },
+	{ 0x5fffc,  0xfe000078 },
+	{ 0x50284,  0x4bc00060 },
+	{ 0x5fffc,  0xfe000080 },
+	{ 0x50288,  0x4b800059 },
+	{ 0x5fffc,  0xfe000089 },
+	{ 0x5028c,  0x4b000052 },
+	{ 0x5fffc,  0xfe400091 },
+	{ 0x50290,  0x4a80004b },
+	{ 0x5fffc,  0xfe40009a },
+	{ 0x50294,  0x4a000044 },
+	{ 0x5fffc,  0xfe8000a3 },
+	{ 0x50298,  0x4940003d },
+	{ 0x5fffc,  0xfec000ac },
+	{ 0x5029c,  0x48400037 },
+	{ 0x5fffc,  0xff0000b4 },
+	{ 0x502a0,  0x47800031 },
+	{ 0x5fffc,  0xff8000bd },
+	{ 0x502a4,  0x4640002b },
+	{ 0x5fffc,  0xc5 },
+	{ 0x502a8,  0x45000026 },
+	{ 0x5fffc,  0x8000ce },
+	{ 0x502ac,  0x43800021 },
+	{ 0x5fffc,  0x10000d6 },
+	{ 0x502b0,  0x4240001c },
+	{ 0x5fffc,  0x18000df },
+	{ 0x502b4,  0x40800018 },
+	{ 0x5fffc,  0x24000e6 },
+	{ 0x502b8,  0x3f000014 },
+	{ 0x5fffc,  0x30000ee },
+	{ 0x502bc,  0x3d400010 },
+	{ 0x5fffc,  0x40000f5 },
+	{ 0x502c0,  0x3b80000c },
+	{ 0x5fffc,  0x50000fc },
+	{ 0x502c4,  0x39800009 },
+	{ 0x5fffc,  0x6000102 },
+	{ 0x502c8,  0x37c00006 },
+	{ 0x5fffc,  0x7000109 },
+	{ 0x502cc,  0x35800004 },
+	{ 0x5fffc,  0x840010e },
+	{ 0x502d0,  0x33800002 },
+	{ 0x5fffc,  0x9800114 },
+	{ 0x502d4,  0x31400000 },
+	{ 0x5fffc,  0xac00119 },
+	{ 0x502d8,  0x2f4003fe },
+	{ 0x5fffc,  0xc40011e },
+	{ 0x502dc,  0x2d0003fc },
+	{ 0x5fffc,  0xdc00121 },
+	{ 0x502e0,  0x2b0003fb },
+	{ 0x5fffc,  0xf400125 },
+	{ 0x502e4,  0x28c003fa },
+	{ 0x5fffc,  0x11000128 },
+	{ 0x502e8,  0x268003f9 },
+	{ 0x5fffc,  0x12c0012a },
+	{ 0x502ec,  0x244003f9 },
+	{ 0x5fffc,  0x1480012c },
+	{ 0x502f0,  0x224003f8 },
+	{ 0x5fffc,  0x1640012e },
+	{ 0x502f4,  0x200003f8 },
+	{ 0x5fffc,  0x1800012f },
+	{ 0x502f8,  0x1e0003f8 },
+	{ 0x5fffc,  0x1a00012f },
+	{ 0x502fc,  0x1c0003f8 },
+};
+
+static struct mdp_table_entry mdp_downscale_x_table_PT8TO1[] = {
+	{ 0x5fffc,  0x0 },
+	{ 0x50280,  0x7fc00000 },
+	{ 0x5fffc,  0xff80000d },
+	{ 0x50284,  0x7ec003f9 },
+	{ 0x5fffc,  0xfec0001c },
+	{ 0x50288,  0x7d4003f3 },
+	{ 0x5fffc,  0xfe40002b },
+	{ 0x5028c,  0x7b8003ed },
+	{ 0x5fffc,  0xfd80003c },
+	{ 0x50290,  0x794003e8 },
+	{ 0x5fffc,  0xfcc0004d },
+	{ 0x50294,  0x76c003e4 },
+	{ 0x5fffc,  0xfc40005f },
+	{ 0x50298,  0x73c003e0 },
+	{ 0x5fffc,  0xfb800071 },
+	{ 0x5029c,  0x708003de },
+	{ 0x5fffc,  0xfac00085 },
+	{ 0x502a0,  0x6d0003db },
+	{ 0x5fffc,  0xfa000098 },
+	{ 0x502a4,  0x698003d9 },
+	{ 0x5fffc,  0xf98000ac },
+	{ 0x502a8,  0x654003d8 },
+	{ 0x5fffc,  0xf8c000c1 },
+	{ 0x502ac,  0x610003d7 },
+	{ 0x5fffc,  0xf84000d5 },
+	{ 0x502b0,  0x5c8003d7 },
+	{ 0x5fffc,  0xf7c000e9 },
+	{ 0x502b4,  0x580003d7 },
+	{ 0x5fffc,  0xf74000fd },
+	{ 0x502b8,  0x534003d8 },
+	{ 0x5fffc,  0xf6c00112 },
+	{ 0x502bc,  0x4e8003d8 },
+	{ 0x5fffc,  0xf6800126 },
+	{ 0x502c0,  0x494003da },
+	{ 0x5fffc,  0xf600013a },
+	{ 0x502c4,  0x448003db },
+	{ 0x5fffc,  0xf600014d },
+	{ 0x502c8,  0x3f4003dd },
+	{ 0x5fffc,  0xf5c00160 },
+	{ 0x502cc,  0x3a4003df },
+	{ 0x5fffc,  0xf5c00172 },
+	{ 0x502d0,  0x354003e1 },
+	{ 0x5fffc,  0xf5c00184 },
+	{ 0x502d4,  0x304003e3 },
+	{ 0x5fffc,  0xf6000195 },
+	{ 0x502d8,  0x2b0003e6 },
+	{ 0x5fffc,  0xf64001a6 },
+	{ 0x502dc,  0x260003e8 },
+	{ 0x5fffc,  0xf6c001b4 },
+	{ 0x502e0,  0x214003eb },
+	{ 0x5fffc,  0xf78001c2 },
+	{ 0x502e4,  0x1c4003ee },
+	{ 0x5fffc,  0xf80001cf },
+	{ 0x502e8,  0x17c003f1 },
+	{ 0x5fffc,  0xf90001db },
+	{ 0x502ec,  0x134003f3 },
+	{ 0x5fffc,  0xfa0001e5 },
+	{ 0x502f0,  0xf0003f6 },
+	{ 0x5fffc,  0xfb4001ee },
+	{ 0x502f4,  0xac003f9 },
+	{ 0x5fffc,  0xfcc001f5 },
+	{ 0x502f8,  0x70003fb },
+	{ 0x5fffc,  0xfe4001fb },
+	{ 0x502fc,  0x34003fe },
+};
+
+struct mdp_table_entry *mdp_downscale_x_table[MDP_DOWNSCALE_MAX] = {
+	[MDP_DOWNSCALE_PT2TOPT4] = mdp_downscale_x_table_PT2TOPT4,
+	[MDP_DOWNSCALE_PT4TOPT6] = mdp_downscale_x_table_PT4TOPT6,
+	[MDP_DOWNSCALE_PT6TOPT8] = mdp_downscale_x_table_PT6TOPT8,
+	[MDP_DOWNSCALE_PT8TO1]  = mdp_downscale_x_table_PT8TO1,
+};
+
+static struct mdp_table_entry mdp_downscale_y_table_PT2TOPT4[] = {
+	{ 0x5fffc,  0x740008c },
+	{ 0x50300,  0x33800088 },
+	{ 0x5fffc,  0x800008e },
+	{ 0x50304,  0x33400084 },
+	{ 0x5fffc,  0x8400092 },
+	{ 0x50308,  0x33000080 },
+	{ 0x5fffc,  0x9000094 },
+	{ 0x5030c,  0x3300007b },
+	{ 0x5fffc,  0x9c00098 },
+	{ 0x50310,  0x32400077 },
+	{ 0x5fffc,  0xa40009b },
+	{ 0x50314,  0x32000073 },
+	{ 0x5fffc,  0xb00009d },
+	{ 0x50318,  0x31c0006f },
+	{ 0x5fffc,  0xbc000a0 },
+	{ 0x5031c,  0x3140006b },
+	{ 0x5fffc,  0xc8000a2 },
+	{ 0x50320,  0x31000067 },
+	{ 0x5fffc,  0xd8000a5 },
+	{ 0x50324,  0x30800062 },
+	{ 0x5fffc,  0xe4000a8 },
+	{ 0x50328,  0x2fc0005f },
+	{ 0x5fffc,  0xec000aa },
+	{ 0x5032c,  0x2fc0005b },
+	{ 0x5fffc,  0xf8000ad },
+	{ 0x50330,  0x2f400057 },
+	{ 0x5fffc,  0x108000b0 },
+	{ 0x50334,  0x2e400054 },
+	{ 0x5fffc,  0x114000b2 },
+	{ 0x50338,  0x2e000050 },
+	{ 0x5fffc,  0x124000b4 },
+	{ 0x5033c,  0x2d80004c },
+	{ 0x5fffc,  0x130000b6 },
+	{ 0x50340,  0x2d000049 },
+	{ 0x5fffc,  0x140000b8 },
+	{ 0x50344,  0x2c800045 },
+	{ 0x5fffc,  0x150000b9 },
+	{ 0x50348,  0x2c000042 },
+	{ 0x5fffc,  0x15c000bd },
+	{ 0x5034c,  0x2b40003e },
+	{ 0x5fffc,  0x16c000bf },
+	{ 0x50350,  0x2a80003b },
+	{ 0x5fffc,  0x17c000bf },
+	{ 0x50354,  0x2a000039 },
+	{ 0x5fffc,  0x188000c2 },
+	{ 0x50358,  0x29400036 },
+	{ 0x5fffc,  0x19c000c4 },
+	{ 0x5035c,  0x28800032 },
+	{ 0x5fffc,  0x1ac000c5 },
+	{ 0x50360,  0x2800002f },
+	{ 0x5fffc,  0x1bc000c7 },
+	{ 0x50364,  0x2740002c },
+	{ 0x5fffc,  0x1cc000c8 },
+	{ 0x50368,  0x26c00029 },
+	{ 0x5fffc,  0x1dc000c9 },
+	{ 0x5036c,  0x26000027 },
+	{ 0x5fffc,  0x1ec000cc },
+	{ 0x50370,  0x25000024 },
+	{ 0x5fffc,  0x200000cc },
+	{ 0x50374,  0x24800021 },
+	{ 0x5fffc,  0x210000cd },
+	{ 0x50378,  0x23800020 },
+	{ 0x5fffc,  0x220000ce },
+	{ 0x5037c,  0x2300001d },
+};
+
+static struct mdp_table_entry mdp_downscale_y_table_PT4TOPT6[] = {
+	{ 0x5fffc,  0x740008c },
+	{ 0x50300,  0x33800088 },
+	{ 0x5fffc,  0x800008e },
+	{ 0x50304,  0x33400084 },
+	{ 0x5fffc,  0x8400092 },
+	{ 0x50308,  0x33000080 },
+	{ 0x5fffc,  0x9000094 },
+	{ 0x5030c,  0x3300007b },
+	{ 0x5fffc,  0x9c00098 },
+	{ 0x50310,  0x32400077 },
+	{ 0x5fffc,  0xa40009b },
+	{ 0x50314,  0x32000073 },
+	{ 0x5fffc,  0xb00009d },
+	{ 0x50318,  0x31c0006f },
+	{ 0x5fffc,  0xbc000a0 },
+	{ 0x5031c,  0x3140006b },
+	{ 0x5fffc,  0xc8000a2 },
+	{ 0x50320,  0x31000067 },
+	{ 0x5fffc,  0xd8000a5 },
+	{ 0x50324,  0x30800062 },
+	{ 0x5fffc,  0xe4000a8 },
+	{ 0x50328,  0x2fc0005f },
+	{ 0x5fffc,  0xec000aa },
+	{ 0x5032c,  0x2fc0005b },
+	{ 0x5fffc,  0xf8000ad },
+	{ 0x50330,  0x2f400057 },
+	{ 0x5fffc,  0x108000b0 },
+	{ 0x50334,  0x2e400054 },
+	{ 0x5fffc,  0x114000b2 },
+	{ 0x50338,  0x2e000050 },
+	{ 0x5fffc,  0x124000b4 },
+	{ 0x5033c,  0x2d80004c },
+	{ 0x5fffc,  0x130000b6 },
+	{ 0x50340,  0x2d000049 },
+	{ 0x5fffc,  0x140000b8 },
+	{ 0x50344,  0x2c800045 },
+	{ 0x5fffc,  0x150000b9 },
+	{ 0x50348,  0x2c000042 },
+	{ 0x5fffc,  0x15c000bd },
+	{ 0x5034c,  0x2b40003e },
+	{ 0x5fffc,  0x16c000bf },
+	{ 0x50350,  0x2a80003b },
+	{ 0x5fffc,  0x17c000bf },
+	{ 0x50354,  0x2a000039 },
+	{ 0x5fffc,  0x188000c2 },
+	{ 0x50358,  0x29400036 },
+	{ 0x5fffc,  0x19c000c4 },
+	{ 0x5035c,  0x28800032 },
+	{ 0x5fffc,  0x1ac000c5 },
+	{ 0x50360,  0x2800002f },
+	{ 0x5fffc,  0x1bc000c7 },
+	{ 0x50364,  0x2740002c },
+	{ 0x5fffc,  0x1cc000c8 },
+	{ 0x50368,  0x26c00029 },
+	{ 0x5fffc,  0x1dc000c9 },
+	{ 0x5036c,  0x26000027 },
+	{ 0x5fffc,  0x1ec000cc },
+	{ 0x50370,  0x25000024 },
+	{ 0x5fffc,  0x200000cc },
+	{ 0x50374,  0x24800021 },
+	{ 0x5fffc,  0x210000cd },
+	{ 0x50378,  0x23800020 },
+	{ 0x5fffc,  0x220000ce },
+	{ 0x5037c,  0x2300001d },
+};
+
+static struct mdp_table_entry mdp_downscale_y_table_PT6TOPT8[] = {
+	{ 0x5fffc,  0xfe000070 },
+	{ 0x50300,  0x4bc00068 },
+	{ 0x5fffc,  0xfe000078 },
+	{ 0x50304,  0x4bc00060 },
+	{ 0x5fffc,  0xfe000080 },
+	{ 0x50308,  0x4b800059 },
+	{ 0x5fffc,  0xfe000089 },
+	{ 0x5030c,  0x4b000052 },
+	{ 0x5fffc,  0xfe400091 },
+	{ 0x50310,  0x4a80004b },
+	{ 0x5fffc,  0xfe40009a },
+	{ 0x50314,  0x4a000044 },
+	{ 0x5fffc,  0xfe8000a3 },
+	{ 0x50318,  0x4940003d },
+	{ 0x5fffc,  0xfec000ac },
+	{ 0x5031c,  0x48400037 },
+	{ 0x5fffc,  0xff0000b4 },
+	{ 0x50320,  0x47800031 },
+	{ 0x5fffc,  0xff8000bd },
+	{ 0x50324,  0x4640002b },
+	{ 0x5fffc,  0xc5 },
+	{ 0x50328,  0x45000026 },
+	{ 0x5fffc,  0x8000ce },
+	{ 0x5032c,  0x43800021 },
+	{ 0x5fffc,  0x10000d6 },
+	{ 0x50330,  0x4240001c },
+	{ 0x5fffc,  0x18000df },
+	{ 0x50334,  0x40800018 },
+	{ 0x5fffc,  0x24000e6 },
+	{ 0x50338,  0x3f000014 },
+	{ 0x5fffc,  0x30000ee },
+	{ 0x5033c,  0x3d400010 },
+	{ 0x5fffc,  0x40000f5 },
+	{ 0x50340,  0x3b80000c },
+	{ 0x5fffc,  0x50000fc },
+	{ 0x50344,  0x39800009 },
+	{ 0x5fffc,  0x6000102 },
+	{ 0x50348,  0x37c00006 },
+	{ 0x5fffc,  0x7000109 },
+	{ 0x5034c,  0x35800004 },
+	{ 0x5fffc,  0x840010e },
+	{ 0x50350,  0x33800002 },
+	{ 0x5fffc,  0x9800114 },
+	{ 0x50354,  0x31400000 },
+	{ 0x5fffc,  0xac00119 },
+	{ 0x50358,  0x2f4003fe },
+	{ 0x5fffc,  0xc40011e },
+	{ 0x5035c,  0x2d0003fc },
+	{ 0x5fffc,  0xdc00121 },
+	{ 0x50360,  0x2b0003fb },
+	{ 0x5fffc,  0xf400125 },
+	{ 0x50364,  0x28c003fa },
+	{ 0x5fffc,  0x11000128 },
+	{ 0x50368,  0x268003f9 },
+	{ 0x5fffc,  0x12c0012a },
+	{ 0x5036c,  0x244003f9 },
+	{ 0x5fffc,  0x1480012c },
+	{ 0x50370,  0x224003f8 },
+	{ 0x5fffc,  0x1640012e },
+	{ 0x50374,  0x200003f8 },
+	{ 0x5fffc,  0x1800012f },
+	{ 0x50378,  0x1e0003f8 },
+	{ 0x5fffc,  0x1a00012f },
+	{ 0x5037c,  0x1c0003f8 },
+};
+
+static struct mdp_table_entry mdp_downscale_y_table_PT8TO1[] = {
+	{ 0x5fffc,  0x0 },
+	{ 0x50300,  0x7fc00000 },
+	{ 0x5fffc,  0xff80000d },
+	{ 0x50304,  0x7ec003f9 },
+	{ 0x5fffc,  0xfec0001c },
+	{ 0x50308,  0x7d4003f3 },
+	{ 0x5fffc,  0xfe40002b },
+	{ 0x5030c,  0x7b8003ed },
+	{ 0x5fffc,  0xfd80003c },
+	{ 0x50310,  0x794003e8 },
+	{ 0x5fffc,  0xfcc0004d },
+	{ 0x50314,  0x76c003e4 },
+	{ 0x5fffc,  0xfc40005f },
+	{ 0x50318,  0x73c003e0 },
+	{ 0x5fffc,  0xfb800071 },
+	{ 0x5031c,  0x708003de },
+	{ 0x5fffc,  0xfac00085 },
+	{ 0x50320,  0x6d0003db },
+	{ 0x5fffc,  0xfa000098 },
+	{ 0x50324,  0x698003d9 },
+	{ 0x5fffc,  0xf98000ac },
+	{ 0x50328,  0x654003d8 },
+	{ 0x5fffc,  0xf8c000c1 },
+	{ 0x5032c,  0x610003d7 },
+	{ 0x5fffc,  0xf84000d5 },
+	{ 0x50330,  0x5c8003d7 },
+	{ 0x5fffc,  0xf7c000e9 },
+	{ 0x50334,  0x580003d7 },
+	{ 0x5fffc,  0xf74000fd },
+	{ 0x50338,  0x534003d8 },
+	{ 0x5fffc,  0xf6c00112 },
+	{ 0x5033c,  0x4e8003d8 },
+	{ 0x5fffc,  0xf6800126 },
+	{ 0x50340,  0x494003da },
+	{ 0x5fffc,  0xf600013a },
+	{ 0x50344,  0x448003db },
+	{ 0x5fffc,  0xf600014d },
+	{ 0x50348,  0x3f4003dd },
+	{ 0x5fffc,  0xf5c00160 },
+	{ 0x5034c,  0x3a4003df },
+	{ 0x5fffc,  0xf5c00172 },
+	{ 0x50350,  0x354003e1 },
+	{ 0x5fffc,  0xf5c00184 },
+	{ 0x50354,  0x304003e3 },
+	{ 0x5fffc,  0xf6000195 },
+	{ 0x50358,  0x2b0003e6 },
+	{ 0x5fffc,  0xf64001a6 },
+	{ 0x5035c,  0x260003e8 },
+	{ 0x5fffc,  0xf6c001b4 },
+	{ 0x50360,  0x214003eb },
+	{ 0x5fffc,  0xf78001c2 },
+	{ 0x50364,  0x1c4003ee },
+	{ 0x5fffc,  0xf80001cf },
+	{ 0x50368,  0x17c003f1 },
+	{ 0x5fffc,  0xf90001db },
+	{ 0x5036c,  0x134003f3 },
+	{ 0x5fffc,  0xfa0001e5 },
+	{ 0x50370,  0xf0003f6 },
+	{ 0x5fffc,  0xfb4001ee },
+	{ 0x50374,  0xac003f9 },
+	{ 0x5fffc,  0xfcc001f5 },
+	{ 0x50378,  0x70003fb },
+	{ 0x5fffc,  0xfe4001fb },
+	{ 0x5037c,  0x34003fe },
+};
+
+struct mdp_table_entry *mdp_downscale_y_table[MDP_DOWNSCALE_MAX] = {
+	[MDP_DOWNSCALE_PT2TOPT4] = mdp_downscale_y_table_PT2TOPT4,
+	[MDP_DOWNSCALE_PT4TOPT6] = mdp_downscale_y_table_PT4TOPT6,
+	[MDP_DOWNSCALE_PT6TOPT8] = mdp_downscale_y_table_PT6TOPT8,
+	[MDP_DOWNSCALE_PT8TO1]  = mdp_downscale_y_table_PT8TO1,
+};
+
+struct mdp_table_entry mdp_gaussian_blur_table[] = {
+	/* max variance */
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50280, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50284, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50288, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x5028c, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50290, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50294, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50298, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x5029c, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502a0, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502a4, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502a8, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502ac, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502b0, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502b4, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502b8, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502bc, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502c0, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502c4, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502c8, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502cc, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502d0, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502d4, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502d8, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502dc, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502e0, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502e4, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502e8, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502ec, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502f0, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502f4, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502f8, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x502fc, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50300, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50304, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50308, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x5030c, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50310, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50314, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50318, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x5031c, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50320, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50324, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50328, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x5032c, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50330, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50334, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50338, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x5033c, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50340, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50344, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50348, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x5034c, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50350, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50354, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50358, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x5035c, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50360, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50364, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50368, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x5036c, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50370, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50374, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x50378, 0x20000080 },
+	{ 0x5fffc, 0x20000080 },
+	{ 0x5037c, 0x20000080 },
+};
diff --git a/drivers/video/msm/mdp_scale_tables.h b/drivers/video/msm/mdp_scale_tables.h
new file mode 100644
index 0000000..34077b1
--- /dev/null
+++ b/drivers/video/msm/mdp_scale_tables.h
@@ -0,0 +1,38 @@
+/* drivers/video/msm_fb/mdp_scale_tables.h
+ *
+ * Copyright (C) 2007 QUALCOMM Incorporated
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+#ifndef _MDP_SCALE_TABLES_H_
+#define _MDP_SCALE_TABLES_H_
+
+#include <linux/types.h>
+struct mdp_table_entry {
+	uint32_t reg;
+	uint32_t val;
+};
+
+extern struct mdp_table_entry mdp_upscale_table[64];
+
+enum {
+	MDP_DOWNSCALE_PT2TOPT4,
+	MDP_DOWNSCALE_PT4TOPT6,
+	MDP_DOWNSCALE_PT6TOPT8,
+	MDP_DOWNSCALE_PT8TO1,
+	MDP_DOWNSCALE_MAX,
+};
+
+extern struct mdp_table_entry *mdp_downscale_x_table[MDP_DOWNSCALE_MAX];
+extern struct mdp_table_entry *mdp_downscale_y_table[MDP_DOWNSCALE_MAX];
+extern struct mdp_table_entry mdp_gaussian_blur_table[];
+
+#endif
diff --git a/drivers/video/msm/msm_fb.c b/drivers/video/msm/msm_fb.c
new file mode 100644
index 0000000..49101dd
--- /dev/null
+++ b/drivers/video/msm/msm_fb.c
@@ -0,0 +1,636 @@
+/* drivers/video/msm/msm_fb.c
+ *
+ * Core MSM framebuffer driver.
+ *
+ * Copyright (C) 2007 Google Incorporated
+ *
+ * This software is licensed under the terms of the GNU General Public
+ * License version 2, as published by the Free Software Foundation, and
+ * may be copied, distributed, and modified under those terms.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ */
+
+#include <linux/platform_device.h>
+#include <linux/module.h>
+#include <linux/fb.h>
+#include <linux/delay.h>
+
+#include <linux/freezer.h>
+#include <linux/wait.h>
+#include <linux/msm_mdp.h>
+#include <linux/io.h>
+#include <linux/uaccess.h>
+#include <mach/msm_fb.h>
+#include <mach/board.h>
+#include <linux/workqueue.h>
+#include <linux/clk.h>
+#include <linux/debugfs.h>
+#include <linux/dma-mapping.h>
+
+#define PRINT_FPS 0
+#define PRINT_BLIT_TIME 0
+
+#define SLEEPING 0x4
+#define UPDATING 0x3
+#define FULL_UPDATE_DONE 0x2
+#define WAKING 0x1
+#define AWAKE 0x0
+
+#define NONE 0
+#define SUSPEND_RESUME 0x1
+#define FPS 0x2
+#define BLIT_TIME 0x4
+#define SHOW_UPDATES 0x8
+
+#define DLOG(mask, fmt, args...) \
+do { \
+	if (msmfb_debug_mask & mask) \
+		printk(KERN_INFO "msmfb: "fmt, ##args); \
+} while (0)
+
+static int msmfb_debug_mask;
+module_param_named(msmfb_debug_mask, msmfb_debug_mask, int,
+		   S_IRUGO | S_IWUSR | S_IWGRP);
+
+struct mdp_device *mdp;
+
+struct msmfb_info {
+	struct fb_info *fb;
+	struct msm_panel_data *panel;
+	int xres;
+	int yres;
+	unsigned output_format;
+	unsigned yoffset;
+	unsigned frame_requested;
+	unsigned frame_done;
+	int sleeping;
+	unsigned update_frame;
+	struct {
+		int left;
+		int top;
+		int eright; /* exclusive */
+		int ebottom; /* exclusive */
+	} update_info;
+	char *black;
+
+	spinlock_t update_lock;
+	struct mutex panel_init_lock;
+	wait_queue_head_t frame_wq;
+	struct workqueue_struct *resume_workqueue;
+	struct work_struct resume_work;
+	struct msmfb_callback dma_callback;
+	struct msmfb_callback vsync_callback;
+	struct hrtimer fake_vsync;
+	ktime_t vsync_request_time;
+};
+
+static int msmfb_open(struct fb_info *info, int user)
+{
+	return 0;
+}
+
+static int msmfb_release(struct fb_info *info, int user)
+{
+	return 0;
+}
+
+/* Called from dma interrupt handler, must not sleep */
+static void msmfb_handle_dma_interrupt(struct msmfb_callback *callback)
+{
+	unsigned long irq_flags;
+	struct msmfb_info *msmfb  = container_of(callback, struct msmfb_info,
+					       dma_callback);
+
+	spin_lock_irqsave(&msmfb->update_lock, irq_flags);
+	msmfb->frame_done = msmfb->frame_requested;
+	if (msmfb->sleeping == UPDATING &&
+	    msmfb->frame_done == msmfb->update_frame) {
+		DLOG(SUSPEND_RESUME, "full update completed\n");
+		queue_work(msmfb->resume_workqueue, &msmfb->resume_work);
+	}
+	spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+	wake_up(&msmfb->frame_wq);
+}
+
+static int msmfb_start_dma(struct msmfb_info *msmfb)
+{
+	uint32_t x, y, w, h;
+	unsigned addr;
+	unsigned long irq_flags;
+	uint32_t yoffset;
+	s64 time_since_request;
+	struct msm_panel_data *panel = msmfb->panel;
+
+	spin_lock_irqsave(&msmfb->update_lock, irq_flags);
+	time_since_request = ktime_to_ns(ktime_sub(ktime_get(),
+			     msmfb->vsync_request_time));
+	if (time_since_request > 20 * NSEC_PER_MSEC) {
+		uint32_t us;
+		us = do_div(time_since_request, NSEC_PER_MSEC) / NSEC_PER_USEC;
+		printk(KERN_WARNING "msmfb_start_dma %lld.%03u ms after vsync "
+			"request\n", time_since_request, us);
+	}
+	if (msmfb->frame_done == msmfb->frame_requested) {
+		spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+		return -1;
+	}
+	if (msmfb->sleeping == SLEEPING) {
+		DLOG(SUSPEND_RESUME, "tried to start dma while asleep\n");
+		spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+		return -1;
+	}
+	x = msmfb->update_info.left;
+	y = msmfb->update_info.top;
+	w = msmfb->update_info.eright - x;
+	h = msmfb->update_info.ebottom - y;
+	yoffset = msmfb->yoffset;
+	msmfb->update_info.left = msmfb->xres + 1;
+	msmfb->update_info.top = msmfb->yres + 1;
+	msmfb->update_info.eright = 0;
+	msmfb->update_info.ebottom = 0;
+	if (unlikely(w > msmfb->xres || h > msmfb->yres ||
+		     w == 0 || h == 0)) {
+		printk(KERN_INFO "invalid update: %d %d %d "
+				"%d\n", x, y, w, h);
+		msmfb->frame_done = msmfb->frame_requested;
+		goto error;
+	}
+	spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+
+	addr = ((msmfb->xres * (yoffset + y) + x) * 2);
+	mdp->dma(mdp, addr + msmfb->fb->fix.smem_start,
+		 msmfb->xres * 2, w, h, x, y, &msmfb->dma_callback,
+		 panel->interface_type);
+	return 0;
+error:
+	spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+	/* some clients need to clear their vsync interrupt */
+	if (panel->clear_vsync)
+		panel->clear_vsync(panel);
+	wake_up(&msmfb->frame_wq);
+	return 0;
+}
+
+/* Called from esync interrupt handler, must not sleep */
+static void msmfb_handle_vsync_interrupt(struct msmfb_callback *callback)
+{
+	struct msmfb_info *msmfb = container_of(callback, struct msmfb_info,
+					       vsync_callback);
+	msmfb_start_dma(msmfb);
+}
+
+static enum hrtimer_restart msmfb_fake_vsync(struct hrtimer *timer)
+{
+	struct msmfb_info *msmfb  = container_of(timer, struct msmfb_info,
+					       fake_vsync);
+	msmfb_start_dma(msmfb);
+	return HRTIMER_NORESTART;
+}
+
+static void msmfb_pan_update(struct fb_info *info, uint32_t left, uint32_t top,
+			     uint32_t eright, uint32_t ebottom,
+			     uint32_t yoffset, int pan_display)
+{
+	struct msmfb_info *msmfb = info->par;
+	struct msm_panel_data *panel = msmfb->panel;
+	unsigned long irq_flags;
+	int sleeping;
+	int retry = 1;
+
+	DLOG(SHOW_UPDATES, "update %d %d %d %d %d %d\n",
+		left, top, eright, ebottom, yoffset, pan_display);
+restart:
+	spin_lock_irqsave(&msmfb->update_lock, irq_flags);
+
+	/* if we are sleeping, on a pan_display wait 10ms (to throttle back
+	 * drawing otherwise return */
+	if (msmfb->sleeping == SLEEPING) {
+		DLOG(SUSPEND_RESUME, "drawing while asleep\n");
+		spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+		if (pan_display)
+			wait_event_interruptible_timeout(msmfb->frame_wq,
+				msmfb->sleeping != SLEEPING, HZ/10);
+		return;
+	}
+
+	sleeping = msmfb->sleeping;
+	/* on a full update, if the last frame has not completed, wait for it */
+	if (pan_display && (msmfb->frame_requested != msmfb->frame_done ||
+			    sleeping == UPDATING)) {
+		int ret;
+		spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+		ret = wait_event_interruptible_timeout(msmfb->frame_wq,
+			msmfb->frame_done == msmfb->frame_requested &&
+			msmfb->sleeping != UPDATING, 5 * HZ);
+		if (ret <= 0 && (msmfb->frame_requested != msmfb->frame_done ||
+				 msmfb->sleeping == UPDATING)) {
+			if (retry && panel->request_vsync &&
+			    (sleeping == AWAKE)) {
+				panel->request_vsync(panel,
+					&msmfb->vsync_callback);
+				retry = 0;
+				printk(KERN_WARNING "msmfb_pan_display timeout "
+					"rerequest vsync\n");
+			} else {
+				printk(KERN_WARNING "msmfb_pan_display timeout "
+					"waiting for frame start, %d %d\n",
+					msmfb->frame_requested,
+					msmfb->frame_done);
+				return;
+			}
+		}
+		goto restart;
+	}
+
+
+	msmfb->frame_requested++;
+	/* if necessary, update the y offset, if this is the
+	 * first full update on resume, set the sleeping state */
+	if (pan_display) {
+		msmfb->yoffset = yoffset;
+		if (left == 0 && top == 0 && eright == info->var.xres &&
+		    ebottom == info->var.yres) {
+			if (sleeping == WAKING) {
+				msmfb->update_frame = msmfb->frame_requested;
+				DLOG(SUSPEND_RESUME, "full update starting\n");
+				msmfb->sleeping = UPDATING;
+			}
+		}
+	}
+
+	/* set the update request */
+	if (left < msmfb->update_info.left)
+		msmfb->update_info.left = left;
+	if (top < msmfb->update_info.top)
+		msmfb->update_info.top = top;
+	if (eright > msmfb->update_info.eright)
+		msmfb->update_info.eright = eright;
+	if (ebottom > msmfb->update_info.ebottom)
+		msmfb->update_info.ebottom = ebottom;
+	DLOG(SHOW_UPDATES, "update queued %d %d %d %d %d\n",
+		msmfb->update_info.left, msmfb->update_info.top,
+		msmfb->update_info.eright, msmfb->update_info.ebottom,
+		msmfb->yoffset);
+	spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+
+	/* if the panel is all the way on wait for vsync, otherwise sleep
+	 * for 16 ms (long enough for the dma to panel) and then begin dma */
+	msmfb->vsync_request_time = ktime_get();
+	if (panel->request_vsync && (sleeping == AWAKE)) {
+		panel->request_vsync(panel, &msmfb->vsync_callback);
+	} else {
+		if (!hrtimer_active(&msmfb->fake_vsync)) {
+			hrtimer_start(&msmfb->fake_vsync,
+				      ktime_set(0, NSEC_PER_SEC/60),
+				      HRTIMER_MODE_REL);
+		}
+	}
+}
+
+static void msmfb_update(struct fb_info *info, uint32_t left, uint32_t top,
+			 uint32_t eright, uint32_t ebottom)
+{
+	msmfb_pan_update(info, left, top, eright, ebottom, 0, 0);
+}
+
+static void power_on_panel(struct work_struct *work)
+{
+	struct msmfb_info *msmfb =
+		container_of(work, struct msmfb_info, resume_work);
+	struct msm_panel_data *panel = msmfb->panel;
+	unsigned long irq_flags;
+
+	mutex_lock(&msmfb->panel_init_lock);
+	DLOG(SUSPEND_RESUME, "turning on panel\n");
+	if (msmfb->sleeping == UPDATING) {
+		if (panel->unblank(panel)) {
+			printk(KERN_INFO "msmfb: panel unblank failed,"
+			       "not starting drawing\n");
+			goto error;
+		}
+		spin_lock_irqsave(&msmfb->update_lock, irq_flags);
+		msmfb->sleeping = AWAKE;
+		wake_up(&msmfb->frame_wq);
+		spin_unlock_irqrestore(&msmfb->update_lock, irq_flags);
+	}
+error:
+	mutex_unlock(&msmfb->panel_init_lock);
+}
+
+
+static int msmfb_check_var(struct fb_var_screeninfo *var, struct fb_info *info)
+{
+	if ((var->xres != info->var.xres) ||
+	    (var->yres != info->var.yres) ||
+	    (var->xres_virtual != info->var.xres_virtual) ||
+	    (var->yres_virtual != info->var.yres_virtual) ||
+	    (var->xoffset != info->var.xoffset) ||
+	    (var->bits_per_pixel != info->var.bits_per_pixel) ||
+	    (var->grayscale != info->var.grayscale))
+		 return -EINVAL;
+	return 0;
+}
+
+int msmfb_pan_display(struct fb_var_screeninfo *var, struct fb_info *info)
+{
+	struct msmfb_info *msmfb = info->par;
+	struct msm_panel_data *panel = msmfb->panel;
+
+	/* "UPDT" */
+	if ((panel->caps & MSMFB_CAP_PARTIAL_UPDATES) &&
+	    (var->reserved[0] == 0x54445055)) {
+		msmfb_pan_update(info, var->reserved[1] & 0xffff,
+				 var->reserved[1] >> 16,
+				 var->reserved[2] & 0xffff,
+				 var->reserved[2] >> 16, var->yoffset, 1);
+	} else {
+		msmfb_pan_update(info, 0, 0, info->var.xres, info->var.yres,
+				 var->yoffset, 1);
+	}
+	return 0;
+}
+
+static void msmfb_fillrect(struct fb_info *p, const struct fb_fillrect *rect)
+{
+	cfb_fillrect(p, rect);
+	msmfb_update(p, rect->dx, rect->dy, rect->dx + rect->width,
+		     rect->dy + rect->height);
+}
+
+static void msmfb_copyarea(struct fb_info *p, const struct fb_copyarea *area)
+{
+	cfb_copyarea(p, area);
+	msmfb_update(p, area->dx, area->dy, area->dx + area->width,
+		     area->dy + area->height);
+}
+
+static void msmfb_imageblit(struct fb_info *p, const struct fb_image *image)
+{
+	cfb_imageblit(p, image);
+	msmfb_update(p, image->dx, image->dy, image->dx + image->width,
+		     image->dy + image->height);
+}
+
+
+static int msmfb_blit(struct fb_info *info,
+		      void __user *p)
+{
+	struct mdp_blit_req req;
+	struct mdp_blit_req_list req_list;
+	int i;
+	int ret;
+
+	if (copy_from_user(&req_list, p, sizeof(req_list)))
+		return -EFAULT;
+
+	for (i = 0; i < req_list.count; i++) {
+		struct mdp_blit_req_list *list =
+			(struct mdp_blit_req_list *)p;
+		if (copy_from_user(&req, &list->req[i], sizeof(req)))
+			return -EFAULT;
+		ret = mdp->blit(mdp, info, &req);
+		if (ret)
+			return ret;
+	}
+	return 0;
+}
+
+
+DEFINE_MUTEX(mdp_ppp_lock);
+
+static int msmfb_ioctl(struct fb_info *p, unsigned int cmd, unsigned long arg)
+{
+	void __user *argp = (void __user *)arg;
+	int ret;
+
+	switch (cmd) {
+	case MSMFB_GRP_DISP:
+		mdp->set_grp_disp(mdp, arg);
+		break;
+	case MSMFB_BLIT:
+		ret = msmfb_blit(p, argp);
+		if (ret)
+			return ret;
+		break;
+	default:
+			printk(KERN_INFO "msmfb unknown ioctl: %d\n", cmd);
+			return -EINVAL;
+	}
+	return 0;
+}
+
+static struct fb_ops msmfb_ops = {
+	.owner = THIS_MODULE,
+	.fb_open = msmfb_open,
+	.fb_release = msmfb_release,
+	.fb_check_var = msmfb_check_var,
+	.fb_pan_display = msmfb_pan_display,
+	.fb_fillrect = msmfb_fillrect,
+	.fb_copyarea = msmfb_copyarea,
+	.fb_imageblit = msmfb_imageblit,
+	.fb_ioctl = msmfb_ioctl,
+};
+
+static unsigned PP[16];
+
+
+
+#define BITS_PER_PIXEL 16
+
+static void setup_fb_info(struct msmfb_info *msmfb)
+{
+	struct fb_info *fb_info = msmfb->fb;
+	int r;
+
+	/* finish setting up the fb_info struct */
+	strncpy(fb_info->fix.id, "msmfb", 16);
+	fb_info->fix.ypanstep = 1;
+
+	fb_info->fbops = &msmfb_ops;
+	fb_info->flags = FBINFO_DEFAULT;
+
+	fb_info->fix.type = FB_TYPE_PACKED_PIXELS;
+	fb_info->fix.visual = FB_VISUAL_TRUECOLOR;
+	fb_info->fix.line_length = msmfb->xres * 2;
+
+	fb_info->var.xres = msmfb->xres;
+	fb_info->var.yres = msmfb->yres;
+	fb_info->var.width = msmfb->panel->fb_data->width;
+	fb_info->var.height = msmfb->panel->fb_data->height;
+	fb_info->var.xres_virtual = msmfb->xres;
+	fb_info->var.yres_virtual = msmfb->yres * 2;
+	fb_info->var.bits_per_pixel = BITS_PER_PIXEL;
+	fb_info->var.accel_flags = 0;
+
+	fb_info->var.yoffset = 0;
+
+	if (msmfb->panel->caps & MSMFB_CAP_PARTIAL_UPDATES) {
+		fb_info->var.reserved[0] = 0x54445055;
+		fb_info->var.reserved[1] = 0;
+		fb_info->var.reserved[2] = (uint16_t)msmfb->xres |
+					   ((uint32_t)msmfb->yres << 16);
+	}
+
+	fb_info->var.red.offset = 11;
+	fb_info->var.red.length = 5;
+	fb_info->var.red.msb_right = 0;
+	fb_info->var.green.offset = 5;
+	fb_info->var.green.length = 6;
+	fb_info->var.green.msb_right = 0;
+	fb_info->var.blue.offset = 0;
+	fb_info->var.blue.length = 5;
+	fb_info->var.blue.msb_right = 0;
+
+	r = fb_alloc_cmap(&fb_info->cmap, 16, 0);
+	fb_info->pseudo_palette = PP;
+
+	PP[0] = 0;
+	for (r = 1; r < 16; r++)
+		PP[r] = 0xffffffff;
+}
+
+static int setup_fbmem(struct msmfb_info *msmfb, struct platform_device *pdev)
+{
+	struct fb_info *fb = msmfb->fb;
+	struct resource *resource;
+	unsigned long size = msmfb->xres * msmfb->yres *
+			     (BITS_PER_PIXEL >> 3) * 2;
+	unsigned char *fbram;
+
+	/* board file might have attached a resource describing an fb */
+	resource = platform_get_resource(pdev, IORESOURCE_MEM, 0);
+	if (!resource)
+		return -EINVAL;
+
+	/* check the resource is large enough to fit the fb */
+	if (resource->end - resource->start < size) {
+		printk(KERN_ERR "allocated resource is too small for "
+				"fb\n");
+		return -ENOMEM;
+	}
+	fb->fix.smem_start = resource->start;
+	fb->fix.smem_len = resource->end - resource->start;
+	fbram = ioremap(resource->start,
+			resource->end - resource->start);
+	if (fbram == 0) {
+		printk(KERN_ERR "msmfb: cannot allocate fbram!\n");
+		return -ENOMEM;
+	}
+	fb->screen_base = fbram;
+	return 0;
+}
+
+static int msmfb_probe(struct platform_device *pdev)
+{
+	struct fb_info *fb;
+	struct msmfb_info *msmfb;
+	struct msm_panel_data *panel = pdev->dev.platform_data;
+	int ret;
+
+	if (!panel) {
+		pr_err("msmfb_probe: no platform data\n");
+		return -EINVAL;
+	}
+	if (!panel->fb_data) {
+		pr_err("msmfb_probe: no fb_data\n");
+		return -EINVAL;
+	}
+
+	fb = framebuffer_alloc(sizeof(struct msmfb_info), &pdev->dev);
+	if (!fb)
+		return -ENOMEM;
+	msmfb = fb->par;
+	msmfb->fb = fb;
+	msmfb->panel = panel;
+	msmfb->xres = panel->fb_data->xres;
+	msmfb->yres = panel->fb_data->yres;
+
+	ret = setup_fbmem(msmfb, pdev);
+	if (ret)
+		goto error_setup_fbmem;
+
+	setup_fb_info(msmfb);
+
+	spin_lock_init(&msmfb->update_lock);
+	mutex_init(&msmfb->panel_init_lock);
+	init_waitqueue_head(&msmfb->frame_wq);
+	msmfb->resume_workqueue = create_workqueue("panel_on");
+	if (msmfb->resume_workqueue == NULL) {
+		printk(KERN_ERR "failed to create panel_on workqueue\n");
+		ret = -ENOMEM;
+		goto error_create_workqueue;
+	}
+	INIT_WORK(&msmfb->resume_work, power_on_panel);
+	msmfb->black = kzalloc(msmfb->fb->var.bits_per_pixel*msmfb->xres,
+			       GFP_KERNEL);
+
+	printk(KERN_INFO "msmfb_probe() installing %d x %d panel\n",
+	       msmfb->xres, msmfb->yres);
+
+	msmfb->dma_callback.func = msmfb_handle_dma_interrupt;
+	msmfb->vsync_callback.func = msmfb_handle_vsync_interrupt;
+	hrtimer_init(&msmfb->fake_vsync, CLOCK_MONOTONIC,
+		     HRTIMER_MODE_REL);
+
+
+	msmfb->fake_vsync.function = msmfb_fake_vsync;
+
+	ret = register_framebuffer(fb);
+	if (ret)
+		goto error_register_framebuffer;
+
+	msmfb->sleeping = WAKING;
+
+	return 0;
+
+error_register_framebuffer:
+	destroy_workqueue(msmfb->resume_workqueue);
+error_create_workqueue:
+	iounmap(fb->screen_base);
+error_setup_fbmem:
+	framebuffer_release(msmfb->fb);
+	return ret;
+}
+
+static struct platform_driver msm_panel_driver = {
+	/* need to write remove */
+	.probe = msmfb_probe,
+	.driver = {.name = "msm_panel"},
+};
+
+
+static int msmfb_add_mdp_device(struct device *dev,
+				struct class_interface *class_intf)
+{
+	/* might need locking if mulitple mdp devices */
+	if (mdp)
+		return 0;
+	mdp = container_of(dev, struct mdp_device, dev);
+	return platform_driver_register(&msm_panel_driver);
+}
+
+static void msmfb_remove_mdp_device(struct device *dev,
+				struct class_interface *class_intf)
+{
+	/* might need locking if mulitple mdp devices */
+	if (dev != &mdp->dev)
+		return;
+	platform_driver_unregister(&msm_panel_driver);
+	mdp = NULL;
+}
+
+static struct class_interface msm_fb_interface = {
+	.add_dev = &msmfb_add_mdp_device,
+	.remove_dev = &msmfb_remove_mdp_device,
+};
+
+static int __init msmfb_init(void)
+{
+	return register_mdp_client(&msm_fb_interface);
+}
+
+module_init(msmfb_init);
diff --git a/drivers/video/omap/Kconfig b/drivers/video/omap/Kconfig
index 4440885..551e3e9 100644
--- a/drivers/video/omap/Kconfig
+++ b/drivers/video/omap/Kconfig
@@ -7,6 +7,69 @@
 	help
           Frame buffer driver for OMAP based boards.
 
+config FB_OMAP_LCD_VGA
+        bool "Use LCD in VGA mode"
+	        depends on MACH_OMAP_3430SDP || MACH_OMAP_LDP
+
+choice
+	depends on FB_OMAP && MACH_OVERO
+	prompt "Screen resolution"
+	default FB_OMAP_079M3R
+	help
+	  Selected desired screen resolution
+
+config FB_OMAP_031M3R
+	boolean "640 x 480 @ 60 Hz Reduced blanking"
+
+config FB_OMAP_048M3R
+	boolean "800 x 600 @ 60 Hz Reduced blanking"
+
+config FB_OMAP_079M3R
+	boolean "1024 x 768 @ 60 Hz Reduced blanking"
+
+config FB_OMAP_092M9R
+	boolean "1280 x 720 @ 60 Hz Reduced blanking"
+
+endchoice
+
+config FB_OMAP_LCDC_EXTERNAL
+	bool "External LCD controller support"
+	depends on FB_OMAP
+	help
+	  Say Y here, if you want to have support for boards with an
+	  external LCD controller connected to the SoSSI/RFBI interface.
+
+config FB_OMAP_LCDC_HWA742
+	bool "Epson HWA742 LCD controller support"
+	depends on FB_OMAP && FB_OMAP_LCDC_EXTERNAL
+	help
+	  Say Y here if you want to have support for the external
+	  Epson HWA742 LCD controller.
+
+config FB_OMAP_LCDC_BLIZZARD
+	bool "Epson Blizzard LCD controller support"
+	depends on FB_OMAP && FB_OMAP_LCDC_EXTERNAL
+	help
+	  Say Y here if you want to have support for the external
+	  Epson Blizzard LCD controller.
+
+config FB_OMAP_MANUAL_UPDATE
+	bool "Default to manual update mode"
+	depends on FB_OMAP && FB_OMAP_LCDC_EXTERNAL
+	help
+	  Say Y here, if your user-space applications are capable of
+	  notifying the frame buffer driver when a change has occured in
+	  the frame buffer content and thus a reload of the image data to
+	  the external frame buffer is required. If unsure, say N.
+
+config FB_OMAP_LCD_MIPID
+	bool "MIPI DBI-C/DCS compatible LCD support"
+	depends on FB_OMAP && SPI_MASTER
+	help
+	  Say Y here if you want to have support for LCDs compatible with
+	  the Mobile Industry Processor Interface DBI-C/DCS
+	  specification. (Supported LCDs: Philips LPH8923, Sharp LS041Y3)
+
 config FB_OMAP_BOOTLOADER_INIT
 	bool "Check bootloader initialization"
 	depends on FB_OMAP
@@ -36,23 +99,4 @@
           answer yes. Answer no if you have a dedicated video
           memory, or don't use any of the accelerated features.
 
-config FB_OMAP_LCDC_EXTERNAL
-	bool "External LCD controller support"
-	depends on FB_OMAP
-	help
-	  Say Y here, if you want to have support for boards with an
-	  external LCD controller connected to the SoSSI/RFBI interface.
 
-config FB_OMAP_LCDC_HWA742
-	bool "Epson HWA742 LCD controller support"
-	depends on FB_OMAP && FB_OMAP_LCDC_EXTERNAL
-	help
-	  Say Y here if you want to have support for the external
-	  Epson HWA742 LCD controller.
-
-config FB_OMAP_LCDC_BLIZZARD
-	bool "Epson Blizzard LCD controller support"
-	depends on FB_OMAP && FB_OMAP_LCDC_EXTERNAL
-	help
-	  Say Y here if you want to have support for the external
-	  Epson Blizzard LCD controller.
diff --git a/drivers/video/omap/Makefile b/drivers/video/omap/Makefile
index ed13889..b63b198 100644
--- a/drivers/video/omap/Makefile
+++ b/drivers/video/omap/Makefile
@@ -8,6 +8,7 @@
 
 objs-y$(CONFIG_ARCH_OMAP1) += lcdc.o
 objs-y$(CONFIG_ARCH_OMAP2) += dispc.o
+objs-y$(CONFIG_ARCH_OMAP3) += dispc.o
 
 objs-$(CONFIG_ARCH_OMAP1)$(CONFIG_FB_OMAP_LCDC_EXTERNAL) += sossi.o
 objs-$(CONFIG_ARCH_OMAP2)$(CONFIG_FB_OMAP_LCDC_EXTERNAL) += rfbi.o
@@ -15,6 +16,7 @@
 objs-y$(CONFIG_FB_OMAP_LCDC_HWA742) += hwa742.o
 objs-y$(CONFIG_FB_OMAP_LCDC_BLIZZARD) += blizzard.o
 
+objs-y$(CONFIG_MACH_AMS_DELTA) += lcd_ams_delta.o
 objs-y$(CONFIG_MACH_OMAP_H4) += lcd_h4.o
 objs-y$(CONFIG_MACH_OMAP_H3) += lcd_h3.o
 objs-y$(CONFIG_MACH_OMAP_PALMTE) += lcd_palmte.o
@@ -24,5 +26,15 @@
 objs-$(CONFIG_ARCH_OMAP15XX)$(CONFIG_MACH_OMAP_INNOVATOR) += lcd_inn1510.o
 objs-y$(CONFIG_MACH_OMAP_OSK) += lcd_osk.o
 
+objs-y$(CONFIG_MACH_OMAP_APOLLON) += lcd_apollon.o
+objs-y$(CONFIG_MACH_OMAP_2430SDP) += lcd_2430sdp.o
+objs-y$(CONFIG_MACH_OMAP_3430SDP) += lcd_2430sdp.o
+objs-y$(CONFIG_MACH_OMAP_LDP) += lcd_ldp.o
+objs-y$(CONFIG_MACH_OMAP2EVM) += lcd_omap2evm.o
+objs-y$(CONFIG_MACH_OMAP3EVM) += lcd_omap3evm.o
+objs-y$(CONFIG_MACH_OMAP3_BEAGLE) += lcd_omap3beagle.o
+objs-y$(CONFIG_FB_OMAP_LCD_MIPID) += lcd_mipid.o
+objs-y$(CONFIG_MACH_OVERO) += lcd_overo.o
+
 omapfb-objs := $(objs-yy)
 
diff --git a/drivers/video/omap/blizzard.c b/drivers/video/omap/blizzard.c
index 9dfcf39..d5e5955 100644
--- a/drivers/video/omap/blizzard.c
+++ b/drivers/video/omap/blizzard.c
@@ -44,6 +44,7 @@
 #define BLIZZARD_CLK_SRC			0x0e
 #define BLIZZARD_MEM_BANK0_ACTIVATE		0x10
 #define BLIZZARD_MEM_BANK0_STATUS		0x14
+#define BLIZZARD_PANEL_CONFIGURATION		0x28
 #define BLIZZARD_HDISP				0x2a
 #define BLIZZARD_HNDP				0x2c
 #define BLIZZARD_VDISP0				0x2e
@@ -162,6 +163,10 @@
 	int			vid_scaled;
 	int			last_color_mode;
 	int			zoom_on;
+	int			zoom_area_gx1;
+	int			zoom_area_gx2;
+	int			zoom_area_gy1;
+	int			zoom_area_gy2;
 	int			screen_width;
 	int			screen_height;
 	unsigned		te_connected:1;
@@ -513,6 +518,13 @@
 	return REQ_PENDING;
 }
 
+static int check_1d_intersect(int a1, int a2, int b1, int b2)
+{
+	if (a2 <= b1 || b2 <= a1)
+		return 0;
+	return 1;
+}
+
 /* Setup all planes with an overlapping area with the update window. */
 static int do_partial_update(struct blizzard_request *req, int plane,
 			     int x, int y, int w, int h,
@@ -525,6 +537,7 @@
 	int color_mode;
 	int flags;
 	int zoom_off;
+	int have_zoom_for_this_update = 0;
 
 	/* Global coordinates, relative to pixel 0,0 of the LCD */
 	gx1 = x + blizzard.plane[plane].pos_x;
@@ -544,10 +557,6 @@
 		gx2_out = gx1_out + w_out;
 		gy2_out = gy1_out + h_out;
 	}
-	zoom_off = blizzard.zoom_on && gx1 == 0 && gy1 == 0 &&
-		w == blizzard.screen_width && h == blizzard.screen_height;
-	blizzard.zoom_on = (!zoom_off && blizzard.zoom_on) ||
-			   (w < w_out || h < h_out);
 
 	for (i = 0; i < OMAPFB_PLANE_NUM; i++) {
 		struct plane_info *p = &blizzard.plane[i];
@@ -653,8 +662,49 @@
 	else
 		disable_tearsync();
 
+	if ((gx2_out - gx1_out) != (gx2 - gx1) ||
+	    (gy2_out - gy1_out) != (gy2 - gy1))
+		have_zoom_for_this_update = 1;
+
+	/* 'background' type of screen update (as opposed to 'destructive')
+	   can be used to disable scaling if scaling is active */
+	zoom_off = blizzard.zoom_on && !have_zoom_for_this_update &&
+	    (gx1_out == 0) && (gx2_out == blizzard.screen_width) &&
+	    (gy1_out == 0) && (gy2_out == blizzard.screen_height) &&
+	    (gx1 == 0) && (gy1 == 0);
+
+	if (blizzard.zoom_on && !have_zoom_for_this_update && !zoom_off &&
+	    check_1d_intersect(blizzard.zoom_area_gx1, blizzard.zoom_area_gx2,
+			       gx1_out, gx2_out) &&
+	    check_1d_intersect(blizzard.zoom_area_gy1, blizzard.zoom_area_gy2,
+			       gy1_out, gy2_out)) {
+		/* Previous screen update was using scaling, current update
+		 * is not using it. Additionally, current screen update is
+		 * going to overlap with the scaled area. Scaling needs to be
+		 * disabled in order to avoid 'magnifying glass' effect.
+		 * Dummy setup of background window can be used for this.
+		 */
+		set_window_regs(0, 0, blizzard.screen_width,
+				blizzard.screen_height,
+				0, 0, blizzard.screen_width,
+				blizzard.screen_height,
+				BLIZZARD_COLOR_RGB565, 1, flags);
+		blizzard.zoom_on = 0;
+	}
+
+	/* remember scaling settings if we have scaled update */
+	if (have_zoom_for_this_update) {
+		blizzard.zoom_on = 1;
+		blizzard.zoom_area_gx1 = gx1_out;
+		blizzard.zoom_area_gx2 = gx2_out;
+		blizzard.zoom_area_gy1 = gy1_out;
+		blizzard.zoom_area_gy2 = gy2_out;
+	}
+
 	set_window_regs(gx1, gy1, gx2, gy2, gx1_out, gy1_out, gx2_out, gy2_out,
 			color_mode, zoom_off, flags);
+	if (zoom_off)
+		blizzard.zoom_on = 0;
 
 	blizzard.extif->set_bits_per_cycle(16);
 	/* set_window_regs has left the register index at the right
@@ -908,6 +958,35 @@
 	return 0;
 }
 
+static int blizzard_set_rotate(int angle)
+{
+	u32 l;
+
+	l = blizzard_read_reg(BLIZZARD_PANEL_CONFIGURATION);
+	l &= ~0x03;
+
+	switch (angle) {
+	case 0:
+		l = l | 0x00;
+		break;
+	case 90:
+		l = l | 0x03;
+		break;
+	case 180:
+		l = l | 0x02;
+		break;
+	case 270:
+		l = l | 0x01;
+		break;
+	default:
+		return -EINVAL;
+	}
+
+	blizzard_write_reg(BLIZZARD_PANEL_CONFIGURATION, l);
+
+	return 0;
+}
+
 static int blizzard_enable_plane(int plane, int enable)
 {
 	if (enable)
@@ -1285,7 +1364,8 @@
 	caps->ctrl |= OMAPFB_CAPS_MANUAL_UPDATE |
 		OMAPFB_CAPS_WINDOW_PIXEL_DOUBLE |
 		OMAPFB_CAPS_WINDOW_SCALE |
-		OMAPFB_CAPS_WINDOW_OVERLAY;
+		OMAPFB_CAPS_WINDOW_OVERLAY |
+		OMAPFB_CAPS_WINDOW_ROTATE;
 	if (blizzard.te_connected)
 		caps->ctrl |= OMAPFB_CAPS_TEARSYNC;
 	caps->wnd_color |= (1 << OMAPFB_COLOR_RGB565) |
@@ -1560,6 +1640,7 @@
 	.setup_plane		= blizzard_setup_plane,
 	.set_scale		= blizzard_set_scale,
 	.enable_plane		= blizzard_enable_plane,
+	.set_rotate		= blizzard_set_rotate,
 	.update_window		= blizzard_update_window_async,
 	.sync			= blizzard_sync,
 	.suspend		= blizzard_suspend,
diff --git a/drivers/video/omap/dispc.c b/drivers/video/omap/dispc.c
index 915439d..80a11d0 100644
--- a/drivers/video/omap/dispc.c
+++ b/drivers/video/omap/dispc.c
@@ -155,6 +155,8 @@
 	unsigned long	*map;
 };
 
+#define MAX_IRQ_HANDLERS            4
+
 static struct {
 	void __iomem	*base;
 
@@ -167,9 +169,11 @@
 
 	int		ext_mode;
 
-	unsigned long	enabled_irqs;
-	void		(*irq_callback)(void *);
-	void		*irq_callback_data;
+	struct {
+		u32	irq_mask;
+		void	(*callback)(void *);
+		void	*data;
+	} irq_handlers[MAX_IRQ_HANDLERS];
 	struct completion	frame_done;
 
 	int		fir_hinc[OMAPFB_PLANE_NUM];
@@ -286,7 +290,7 @@
 	BUG_ON(plane > 2);
 
 	l = dispc_read_reg(fsz_reg[plane]);
-	l &= FLD_MASK(0, 9);
+	l &= FLD_MASK(0, 11);
 	if (ext_mode) {
 		low = l * 3 / 4;
 		high = l;
@@ -294,7 +298,7 @@
 		low = l / 4;
 		high = l * 3 / 4;
 	}
-	MOD_REG_FLD(ftrs_reg[plane], FLD_MASK(16, 9) | FLD_MASK(0, 9),
+	MOD_REG_FLD(ftrs_reg[plane], FLD_MASK(16, 12) | FLD_MASK(0, 12),
 			(high << 16) | low);
 }
 
@@ -809,57 +813,74 @@
 	panel->pixel_clock = fck / lck_div / pck_div / 1000;
 }
 
-int omap_dispc_request_irq(void (*callback)(void *data), void *data)
+static void recalc_irq_mask(void)
 {
-	int r = 0;
+	int i;
+	unsigned long irq_mask = DISPC_IRQ_MASK_ERROR;
+
+	for (i = 0; i < MAX_IRQ_HANDLERS; i++) {
+		if (!dispc.irq_handlers[i].callback)
+			continue;
+
+		irq_mask |= dispc.irq_handlers[i].irq_mask;
+	}
+
+	enable_lcd_clocks(1);
+	MOD_REG_FLD(DISPC_IRQENABLE, 0x7fff, irq_mask);
+	enable_lcd_clocks(0);
+}
+
+int omap_dispc_request_irq(unsigned long irq_mask, void (*callback)(void *data),
+			   void *data)
+{
+	int i;
 
 	BUG_ON(callback == NULL);
 
-	if (dispc.irq_callback)
-		r = -EBUSY;
-	else {
-		dispc.irq_callback = callback;
-		dispc.irq_callback_data = data;
+	for (i = 0; i < MAX_IRQ_HANDLERS; i++) {
+		if (dispc.irq_handlers[i].callback)
+			continue;
+
+		dispc.irq_handlers[i].irq_mask = irq_mask;
+		dispc.irq_handlers[i].callback = callback;
+		dispc.irq_handlers[i].data = data;
+		recalc_irq_mask();
+
+		return 0;
 	}
 
-	return r;
+	return -EBUSY;
 }
 EXPORT_SYMBOL(omap_dispc_request_irq);
 
-void omap_dispc_enable_irqs(int irq_mask)
+void omap_dispc_free_irq(unsigned long irq_mask, void (*callback)(void *data),
+			 void *data)
 {
-	enable_lcd_clocks(1);
-	dispc.enabled_irqs = irq_mask;
-	irq_mask |= DISPC_IRQ_MASK_ERROR;
-	MOD_REG_FLD(DISPC_IRQENABLE, 0x7fff, irq_mask);
-	enable_lcd_clocks(0);
-}
-EXPORT_SYMBOL(omap_dispc_enable_irqs);
+	int i;
 
-void omap_dispc_disable_irqs(int irq_mask)
-{
-	enable_lcd_clocks(1);
-	dispc.enabled_irqs &= ~irq_mask;
-	irq_mask &= ~DISPC_IRQ_MASK_ERROR;
-	MOD_REG_FLD(DISPC_IRQENABLE, 0x7fff, irq_mask);
-	enable_lcd_clocks(0);
-}
-EXPORT_SYMBOL(omap_dispc_disable_irqs);
+	for (i = 0; i < MAX_IRQ_HANDLERS; i++) {
+		if (dispc.irq_handlers[i].callback == callback &&
+		    dispc.irq_handlers[i].data == data) {
+			dispc.irq_handlers[i].irq_mask = 0;
+			dispc.irq_handlers[i].callback = NULL;
+			dispc.irq_handlers[i].data = NULL;
+			recalc_irq_mask();
+			return;
+		}
+	}
 
-void omap_dispc_free_irq(void)
-{
-	enable_lcd_clocks(1);
-	omap_dispc_disable_irqs(DISPC_IRQ_MASK_ALL);
-	dispc.irq_callback = NULL;
-	dispc.irq_callback_data = NULL;
-	enable_lcd_clocks(0);
+	BUG();
 }
 EXPORT_SYMBOL(omap_dispc_free_irq);
 
 static irqreturn_t omap_dispc_irq_handler(int irq, void *dev)
 {
-	u32 stat = dispc_read_reg(DISPC_IRQSTATUS);
+	u32 stat;
+	int i = 0;
 
+	enable_lcd_clocks(1);
+
+	stat = dispc_read_reg(DISPC_IRQSTATUS);
 	if (stat & DISPC_IRQ_FRAMEMASK)
 		complete(&dispc.frame_done);
 
@@ -870,11 +891,17 @@
 		}
 	}
 
-	if ((stat & dispc.enabled_irqs) && dispc.irq_callback)
-		dispc.irq_callback(dispc.irq_callback_data);
+	for (i = 0; i < MAX_IRQ_HANDLERS; i++) {
+		if (unlikely(dispc.irq_handlers[i].callback &&
+			     (stat & dispc.irq_handlers[i].irq_mask)))
+			dispc.irq_handlers[i].callback(
+						dispc.irq_handlers[i].data);
+	}
 
 	dispc_write_reg(DISPC_IRQSTATUS, stat);
 
+	enable_lcd_clocks(0);
+
 	return IRQ_HANDLED;
 }
 
@@ -913,18 +940,13 @@
 
 static void enable_lcd_clocks(int enable)
 {
-	if (enable)
-		clk_enable(dispc.dss1_fck);
-	else
-		clk_disable(dispc.dss1_fck);
-}
-
-static void enable_interface_clocks(int enable)
-{
-	if (enable)
+	if (enable) {
 		clk_enable(dispc.dss_ick);
-	else
+		clk_enable(dispc.dss1_fck);
+	} else {
+		clk_disable(dispc.dss1_fck);
 		clk_disable(dispc.dss_ick);
+	}
 }
 
 static void enable_digit_clocks(int enable)
@@ -1365,7 +1387,6 @@
 	if ((r = get_dss_clocks()) < 0)
 		goto fail0;
 
-	enable_interface_clocks(1);
 	enable_lcd_clocks(1);
 
 #ifdef CONFIG_FB_OMAP_BOOTLOADER_INIT
@@ -1396,10 +1417,10 @@
 		enable_digit_clocks(0);
 	}
 
-	/* Enable smart idle and autoidle */
-	l = dispc_read_reg(DISPC_CONTROL);
+	/* Enable smart standby/idle, autoidle and wakeup */
+	l = dispc_read_reg(DISPC_SYSCONFIG);
 	l &= ~((3 << 12) | (3 << 3));
-	l |= (2 << 12) | (2 << 3) | (1 << 0);
+	l |= (2 << 12) | (2 << 3) | (1 << 2) | (1 << 0);
 	dispc_write_reg(DISPC_SYSCONFIG, l);
 	omap_writel(1 << 0, DSS_BASE + DSS_SYSCONFIG);
 
@@ -1409,10 +1430,9 @@
 	dispc_write_reg(DISPC_CONFIG, l);
 
 	l = dispc_read_reg(DISPC_IRQSTATUS);
-	dispc_write_reg(l, DISPC_IRQSTATUS);
+	dispc_write_reg(DISPC_IRQSTATUS, l);
 
-	/* Enable those that we handle always */
-	omap_dispc_enable_irqs(DISPC_IRQ_FRAMEMASK);
+	recalc_irq_mask();
 
 	if ((r = request_irq(INT_24XX_DSS_IRQ, omap_dispc_irq_handler,
 			   0, MODULE_NAME, fbdev)) < 0) {
@@ -1469,7 +1489,6 @@
 	free_irq(INT_24XX_DSS_IRQ, fbdev);
 fail1:
 	enable_lcd_clocks(0);
-	enable_interface_clocks(0);
 	put_dss_clocks();
 fail0:
 	iounmap(dispc.base);
@@ -1487,7 +1506,6 @@
 	cleanup_fbmem();
 	free_palette_ram();
 	free_irq(INT_24XX_DSS_IRQ, dispc.fbdev);
-	enable_interface_clocks(0);
 	put_dss_clocks();
 	iounmap(dispc.base);
 }
diff --git a/drivers/video/omap/dispc.h b/drivers/video/omap/dispc.h
index ef720a7..c15ea77 100644
--- a/drivers/video/omap/dispc.h
+++ b/drivers/video/omap/dispc.h
@@ -37,9 +37,10 @@
 extern void omap_dispc_enable_lcd_out(int enable);
 extern void omap_dispc_enable_digit_out(int enable);
 
-extern int  omap_dispc_request_irq(void (*callback)(void *data), void *data);
-extern void omap_dispc_free_irq(void);
+extern int omap_dispc_request_irq(unsigned long irq_mask,
+				   void (*callback)(void *data), void *data);
+extern void omap_dispc_free_irq(unsigned long irq_mask,
+				 void (*callback)(void *data), void *data);
 
 extern const struct lcd_ctrl omap2_int_ctrl;
-
 #endif
diff --git a/drivers/video/omap/hwa742.c b/drivers/video/omap/hwa742.c
index 5d4f348..ca51583 100644
--- a/drivers/video/omap/hwa742.c
+++ b/drivers/video/omap/hwa742.c
@@ -131,7 +131,7 @@
 
 	struct omapfb_device	*fbdev;
 	struct lcd_ctrl_extif	*extif;
-	struct lcd_ctrl		*int_ctrl;
+	const struct lcd_ctrl	*int_ctrl;
 
 	struct clk		*sys_ck;
 } hwa742;
diff --git a/drivers/video/omap/lcd_2430sdp.c b/drivers/video/omap/lcd_2430sdp.c
new file mode 100644
index 0000000..393712b
--- /dev/null
+++ b/drivers/video/omap/lcd_2430sdp.c
@@ -0,0 +1,202 @@
+/*
+ * LCD panel support for the TI 2430SDP board
+ *
+ * Copyright (C) 2007 MontaVista
+ * Author: Hunyue Yau <hyau@mvista.com>
+ *
+ * Derived from drivers/video/omap/lcd-apollon.c
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA  02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/delay.h>
+#include <linux/gpio.h>
+#include <linux/i2c/twl4030.h>
+
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+#include <asm/mach-types.h>
+
+#define SDP2430_LCD_PANEL_BACKLIGHT_GPIO	91
+#define SDP2430_LCD_PANEL_ENABLE_GPIO		154
+#define SDP3430_LCD_PANEL_BACKLIGHT_GPIO	24
+#define SDP3430_LCD_PANEL_ENABLE_GPIO		28
+
+static unsigned backlight_gpio;
+static unsigned enable_gpio;
+
+#define LCD_PIXCLOCK_MAX		5400 /* freq 5.4 MHz */
+#define PM_RECEIVER             TWL4030_MODULE_PM_RECEIVER
+#define ENABLE_VAUX2_DEDICATED  0x09
+#define ENABLE_VAUX2_DEV_GRP    0x20
+#define ENABLE_VAUX3_DEDICATED	0x03
+#define ENABLE_VAUX3_DEV_GRP	0x20
+
+#define ENABLE_VPLL2_DEDICATED          0x05
+#define ENABLE_VPLL2_DEV_GRP            0xE0
+#define TWL4030_VPLL2_DEV_GRP           0x33
+#define TWL4030_VPLL2_DEDICATED         0x36
+
+#define t2_out(c, r, v) twl4030_i2c_write_u8(c, r, v)
+
+
+static int sdp2430_panel_init(struct lcd_panel *panel,
+				struct omapfb_device *fbdev)
+{
+	if (machine_is_omap_3430sdp()) {
+		enable_gpio    = SDP3430_LCD_PANEL_ENABLE_GPIO;
+		backlight_gpio = SDP3430_LCD_PANEL_BACKLIGHT_GPIO;
+	} else {
+		enable_gpio    = SDP2430_LCD_PANEL_ENABLE_GPIO;
+		backlight_gpio = SDP2430_LCD_PANEL_BACKLIGHT_GPIO;
+	}
+
+	gpio_request(enable_gpio, "LCD enable");	/* LCD panel */
+	gpio_request(backlight_gpio, "LCD bl");		/* LCD backlight */
+	gpio_direction_output(enable_gpio, 0);
+	gpio_direction_output(backlight_gpio, 0);
+
+	return 0;
+}
+
+static void sdp2430_panel_cleanup(struct lcd_panel *panel)
+{
+	gpio_free(backlight_gpio);
+	gpio_free(enable_gpio);
+}
+
+static int sdp2430_panel_enable(struct lcd_panel *panel)
+{
+	u8 ded_val, ded_reg;
+	u8 grp_val, grp_reg;
+
+	if (machine_is_omap_3430sdp()) {
+		ded_reg = TWL4030_VAUX3_DEDICATED;
+		ded_val = ENABLE_VAUX3_DEDICATED;
+		grp_reg = TWL4030_VAUX3_DEV_GRP;
+		grp_val = ENABLE_VAUX3_DEV_GRP;
+
+		if (omap_rev() > OMAP3430_REV_ES1_0) {
+			t2_out(PM_RECEIVER, ENABLE_VPLL2_DEDICATED,
+					TWL4030_VPLL2_DEDICATED);
+			t2_out(PM_RECEIVER, ENABLE_VPLL2_DEV_GRP,
+					TWL4030_VPLL2_DEV_GRP);
+		}
+	} else {
+		ded_reg = TWL4030_VAUX2_DEDICATED;
+		ded_val = ENABLE_VAUX2_DEDICATED;
+		grp_reg = TWL4030_VAUX2_DEV_GRP;
+		grp_val = ENABLE_VAUX2_DEV_GRP;
+	}
+
+	gpio_set_value(enable_gpio, 1);
+	gpio_set_value(backlight_gpio, 1);
+
+	if (0 != t2_out(PM_RECEIVER, ded_val, ded_reg))
+		return -EIO;
+	if (0 != t2_out(PM_RECEIVER, grp_val, grp_reg))
+		return -EIO;
+
+	return 0;
+}
+
+static void sdp2430_panel_disable(struct lcd_panel *panel)
+{
+	gpio_set_value(enable_gpio, 0);
+	gpio_set_value(backlight_gpio, 0);
+	if (omap_rev() > OMAP3430_REV_ES1_0) {
+		t2_out(PM_RECEIVER, 0x0, TWL4030_VPLL2_DEDICATED);
+		t2_out(PM_RECEIVER, 0x0, TWL4030_VPLL2_DEV_GRP);
+		msleep(4);
+	}
+}
+
+static unsigned long sdp2430_panel_get_caps(struct lcd_panel *panel)
+{
+	return 0;
+}
+
+struct lcd_panel sdp2430_panel = {
+	.name		= "sdp2430",
+	.config		= OMAP_LCDC_PANEL_TFT | OMAP_LCDC_INV_VSYNC |
+			  OMAP_LCDC_INV_HSYNC,
+
+	.bpp		= 16,
+	.data_lines	= 16,
+	.x_res		= 240,
+	.y_res		= 320,
+	.hsw		= 3,		/* hsync_len (4) - 1 */
+	.hfp		= 3,		/* right_margin (4) - 1 */
+	.hbp		= 39,		/* left_margin (40) - 1 */
+	.vsw		= 1,		/* vsync_len (2) - 1 */
+	.vfp		= 2,		/* lower_margin */
+	.vbp		= 7,		/* upper_margin (8) - 1 */
+
+	.pixel_clock	= LCD_PIXCLOCK_MAX,
+
+	.init		= sdp2430_panel_init,
+	.cleanup	= sdp2430_panel_cleanup,
+	.enable		= sdp2430_panel_enable,
+	.disable	= sdp2430_panel_disable,
+	.get_caps	= sdp2430_panel_get_caps,
+};
+
+static int sdp2430_panel_probe(struct platform_device *pdev)
+{
+	omapfb_register_panel(&sdp2430_panel);
+	return 0;
+}
+
+static int sdp2430_panel_remove(struct platform_device *pdev)
+{
+	return 0;
+}
+
+static int sdp2430_panel_suspend(struct platform_device *pdev,
+					pm_message_t mesg)
+{
+	return 0;
+}
+
+static int sdp2430_panel_resume(struct platform_device *pdev)
+{
+	return 0;
+}
+
+struct platform_driver sdp2430_panel_driver = {
+	.probe		= sdp2430_panel_probe,
+	.remove		= sdp2430_panel_remove,
+	.suspend	= sdp2430_panel_suspend,
+	.resume		= sdp2430_panel_resume,
+	.driver		= {
+		.name	= "sdp2430_lcd",
+		.owner	= THIS_MODULE,
+	},
+};
+
+static int __init sdp2430_panel_drv_init(void)
+{
+	return platform_driver_register(&sdp2430_panel_driver);
+}
+
+static void __exit sdp2430_panel_drv_exit(void)
+{
+	platform_driver_unregister(&sdp2430_panel_driver);
+}
+
+module_init(sdp2430_panel_drv_init);
+module_exit(sdp2430_panel_drv_exit);
diff --git a/drivers/video/omap/lcd_ams_delta.c b/drivers/video/omap/lcd_ams_delta.c
new file mode 100644
index 0000000..1f743995
--- /dev/null
+++ b/drivers/video/omap/lcd_ams_delta.c
@@ -0,0 +1,137 @@
+/*
+ * Based on drivers/video/omap/lcd_inn1510.c
+ *
+ * LCD panel support for the Amstrad E3 (Delta) videophone.
+ *
+ * Copyright (C) 2006 Jonathan McDowell <noodles@earth.li>
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA  02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/io.h>
+#include <linux/delay.h>
+
+#include <mach/board-ams-delta.h>
+#include <mach/hardware.h>
+#include <mach/omapfb.h>
+
+#define AMS_DELTA_DEFAULT_CONTRAST	112
+
+static int ams_delta_panel_init(struct lcd_panel *panel,
+		struct omapfb_device *fbdev)
+{
+	return 0;
+}
+
+static void ams_delta_panel_cleanup(struct lcd_panel *panel)
+{
+}
+
+static int ams_delta_panel_enable(struct lcd_panel *panel)
+{
+	ams_delta_latch2_write(AMS_DELTA_LATCH2_LCD_NDISP,
+			AMS_DELTA_LATCH2_LCD_NDISP);
+	ams_delta_latch2_write(AMS_DELTA_LATCH2_LCD_VBLEN,
+			AMS_DELTA_LATCH2_LCD_VBLEN);
+
+	omap_writeb(1, OMAP_PWL_CLK_ENABLE);
+	omap_writeb(AMS_DELTA_DEFAULT_CONTRAST, OMAP_PWL_ENABLE);
+
+	return 0;
+}
+
+static void ams_delta_panel_disable(struct lcd_panel *panel)
+{
+	ams_delta_latch2_write(AMS_DELTA_LATCH2_LCD_VBLEN, 0);
+	ams_delta_latch2_write(AMS_DELTA_LATCH2_LCD_NDISP, 0);
+}
+
+static unsigned long ams_delta_panel_get_caps(struct lcd_panel *panel)
+{
+	return 0;
+}
+
+static struct lcd_panel ams_delta_panel = {
+	.name		= "ams-delta",
+	.config		= 0,
+
+	.bpp		= 12,
+	.data_lines	= 16,
+	.x_res		= 480,
+	.y_res		= 320,
+	.pixel_clock	= 4687,
+	.hsw		= 3,
+	.hfp		= 1,
+	.hbp		= 1,
+	.vsw		= 1,
+	.vfp		= 0,
+	.vbp		= 0,
+	.pcd		= 0,
+	.acb		= 37,
+
+	.init		= ams_delta_panel_init,
+	.cleanup	= ams_delta_panel_cleanup,
+	.enable		= ams_delta_panel_enable,
+	.disable	= ams_delta_panel_disable,
+	.get_caps	= ams_delta_panel_get_caps,
+};
+
+static int ams_delta_panel_probe(struct platform_device *pdev)
+{
+	omapfb_register_panel(&ams_delta_panel);
+	return 0;
+}
+
+static int ams_delta_panel_remove(struct platform_device *pdev)
+{
+	return 0;
+}
+
+static int ams_delta_panel_suspend(struct platform_device *pdev,
+		pm_message_t mesg)
+{
+	return 0;
+}
+
+static int ams_delta_panel_resume(struct platform_device *pdev)
+{
+	return 0;
+}
+
+struct platform_driver ams_delta_panel_driver = {
+	.probe		= ams_delta_panel_probe,
+	.remove		= ams_delta_panel_remove,
+	.suspend	= ams_delta_panel_suspend,
+	.resume		= ams_delta_panel_resume,
+	.driver		= {
+		.name	= "lcd_ams_delta",
+		.owner	= THIS_MODULE,
+	},
+};
+
+static int ams_delta_panel_drv_init(void)
+{
+	return platform_driver_register(&ams_delta_panel_driver);
+}
+
+static void ams_delta_panel_drv_cleanup(void)
+{
+	platform_driver_unregister(&ams_delta_panel_driver);
+}
+
+module_init(ams_delta_panel_drv_init);
+module_exit(ams_delta_panel_drv_cleanup);
diff --git a/drivers/video/omap/lcd_apollon.c b/drivers/video/omap/lcd_apollon.c
new file mode 100644
index 0000000..626ae3a5
--- /dev/null
+++ b/drivers/video/omap/lcd_apollon.c
@@ -0,0 +1,138 @@
+/*
+ * LCD panel support for the Samsung OMAP2 Apollon board
+ *
+ * Copyright (C) 2005,2006 Samsung Electronics
+ * Author: Kyungmin Park <kyungmin.park@samsung.com>
+ *
+ * Derived from drivers/video/omap/lcd-h4.c
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA  02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+
+#include <mach/gpio.h>
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+
+/* #define USE_35INCH_LCD 1 */
+
+static int apollon_panel_init(struct lcd_panel *panel,
+				struct omapfb_device *fbdev)
+{
+	/* configure LCD PWR_EN */
+	omap_cfg_reg(M21_242X_GPIO11);
+	return 0;
+}
+
+static void apollon_panel_cleanup(struct lcd_panel *panel)
+{
+}
+
+static int apollon_panel_enable(struct lcd_panel *panel)
+{
+	return 0;
+}
+
+static void apollon_panel_disable(struct lcd_panel *panel)
+{
+}
+
+static unsigned long apollon_panel_get_caps(struct lcd_panel *panel)
+{
+	return 0;
+}
+
+struct lcd_panel apollon_panel = {
+	.name		= "apollon",
+	.config		= OMAP_LCDC_PANEL_TFT | OMAP_LCDC_INV_VSYNC |
+			  OMAP_LCDC_INV_HSYNC,
+
+	.bpp		= 16,
+	.data_lines	= 18,
+#ifdef USE_35INCH_LCD
+	.x_res		= 240,
+	.y_res		= 320,
+	.hsw		= 2,
+	.hfp		= 3,
+	.hbp		= 9,
+	.vsw		= 4,
+	.vfp		= 3,
+	.vbp		= 5,
+#else
+	.x_res		= 480,
+	.y_res		= 272,
+	.hsw		= 41,
+	.hfp		= 2,
+	.hbp		= 2,
+	.vsw		= 10,
+	.vfp		= 2,
+	.vbp		= 2,
+#endif
+	.pixel_clock	= 6250,
+
+	.init		= apollon_panel_init,
+	.cleanup	= apollon_panel_cleanup,
+	.enable		= apollon_panel_enable,
+	.disable	= apollon_panel_disable,
+	.get_caps	= apollon_panel_get_caps,
+};
+
+static int apollon_panel_probe(struct platform_device *pdev)
+{
+	omapfb_register_panel(&apollon_panel);
+	return 0;
+}
+
+static int apollon_panel_remove(struct platform_device *pdev)
+{
+	return 0;
+}
+
+static int apollon_panel_suspend(struct platform_device *pdev,
+				  pm_message_t mesg)
+{
+	return 0;
+}
+
+static int apollon_panel_resume(struct platform_device *pdev)
+{
+	return 0;
+}
+
+struct platform_driver apollon_panel_driver = {
+	.probe		= apollon_panel_probe,
+	.remove		= apollon_panel_remove,
+	.suspend	= apollon_panel_suspend,
+	.resume		= apollon_panel_resume,
+	.driver		= {
+		.name	= "apollon_lcd",
+		.owner	= THIS_MODULE,
+	},
+};
+
+static int __init apollon_panel_drv_init(void)
+{
+	return platform_driver_register(&apollon_panel_driver);
+}
+
+static void __exit apollon_panel_drv_exit(void)
+{
+	platform_driver_unregister(&apollon_panel_driver);
+}
+
+module_init(apollon_panel_drv_init);
+module_exit(apollon_panel_drv_exit);
diff --git a/drivers/video/omap/lcd_ldp.c b/drivers/video/omap/lcd_ldp.c
new file mode 100644
index 0000000..dbfe897
--- /dev/null
+++ b/drivers/video/omap/lcd_ldp.c
@@ -0,0 +1,200 @@
+/*
+ * LCD panel support for the TI LDP board
+ *
+ * Copyright (C) 2007 WindRiver
+ * Author: Stanley Miao <stanley.miao@windriver.com>
+ *
+ * Derived from drivers/video/omap/lcd-2430sdp.c
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA  02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/delay.h>
+#include <linux/i2c/twl4030.h>
+
+#include <mach/gpio.h>
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+#include <asm/mach-types.h>
+
+#define LCD_PANEL_BACKLIGHT_GPIO	(15 + OMAP_MAX_GPIO_LINES)
+#define LCD_PANEL_ENABLE_GPIO		(7 + OMAP_MAX_GPIO_LINES)
+
+#define LCD_PANEL_RESET_GPIO		55
+#define LCD_PANEL_QVGA_GPIO		56
+
+#ifdef CONFIG_FB_OMAP_LCD_VGA
+#define LCD_XRES		480
+#define LCD_YRES		640
+#define LCD_PIXCLOCK_MAX	41700
+#else
+#define LCD_XRES		240
+#define LCD_YRES		320
+#define LCD_PIXCLOCK_MAX	185186
+#endif
+
+#define PM_RECEIVER             TWL4030_MODULE_PM_RECEIVER
+#define ENABLE_VAUX2_DEDICATED  0x09
+#define ENABLE_VAUX2_DEV_GRP    0x20
+#define ENABLE_VAUX3_DEDICATED	0x03
+#define ENABLE_VAUX3_DEV_GRP	0x20
+
+#define ENABLE_VPLL2_DEDICATED          0x05
+#define ENABLE_VPLL2_DEV_GRP            0xE0
+#define TWL4030_VPLL2_DEV_GRP           0x33
+#define TWL4030_VPLL2_DEDICATED         0x36
+
+#define t2_out(c, r, v) twl4030_i2c_write_u8(c, r, v)
+
+
+static int ldp_panel_init(struct lcd_panel *panel,
+				struct omapfb_device *fbdev)
+{
+	gpio_request(LCD_PANEL_RESET_GPIO, "lcd reset");
+	gpio_request(LCD_PANEL_QVGA_GPIO, "lcd qvga");
+	gpio_request(LCD_PANEL_ENABLE_GPIO, "lcd panel");
+	gpio_request(LCD_PANEL_BACKLIGHT_GPIO, "lcd backlight");
+
+	gpio_direction_output(LCD_PANEL_QVGA_GPIO, 0);
+	gpio_direction_output(LCD_PANEL_RESET_GPIO, 0);
+	gpio_direction_output(LCD_PANEL_ENABLE_GPIO, 0);
+	gpio_direction_output(LCD_PANEL_BACKLIGHT_GPIO, 0);
+
+#ifdef CONFIG_FB_OMAP_LCD_VGA
+	gpio_set_value(LCD_PANEL_QVGA_GPIO, 0);
+#else
+	gpio_set_value(LCD_PANEL_QVGA_GPIO, 1);
+#endif
+	gpio_set_value(LCD_PANEL_RESET_GPIO, 1);
+
+	return 0;
+}
+
+static void ldp_panel_cleanup(struct lcd_panel *panel)
+{
+	gpio_free(LCD_PANEL_BACKLIGHT_GPIO);
+	gpio_free(LCD_PANEL_ENABLE_GPIO);
+	gpio_free(LCD_PANEL_QVGA_GPIO);
+	gpio_free(LCD_PANEL_RESET_GPIO);
+}
+
+static int ldp_panel_enable(struct lcd_panel *panel)
+{
+	if (0 != t2_out(PM_RECEIVER, ENABLE_VPLL2_DEDICATED,
+			TWL4030_VPLL2_DEDICATED))
+		return -EIO;
+	if (0 != t2_out(PM_RECEIVER, ENABLE_VPLL2_DEV_GRP,
+			TWL4030_VPLL2_DEV_GRP))
+		return -EIO;
+
+	gpio_direction_output(LCD_PANEL_ENABLE_GPIO, 1);
+	gpio_direction_output(LCD_PANEL_BACKLIGHT_GPIO, 1);
+
+	if (0 != t2_out(PM_RECEIVER, ENABLE_VAUX3_DEDICATED,
+				TWL4030_VAUX3_DEDICATED))
+		return -EIO;
+	if (0 != t2_out(PM_RECEIVER, ENABLE_VAUX3_DEV_GRP,
+				TWL4030_VAUX3_DEV_GRP))
+		return -EIO;
+
+	return 0;
+}
+
+static void ldp_panel_disable(struct lcd_panel *panel)
+{
+	gpio_direction_output(LCD_PANEL_ENABLE_GPIO, 0);
+	gpio_direction_output(LCD_PANEL_BACKLIGHT_GPIO, 0);
+
+	t2_out(PM_RECEIVER, 0x0, TWL4030_VPLL2_DEDICATED);
+	t2_out(PM_RECEIVER, 0x0, TWL4030_VPLL2_DEV_GRP);
+	msleep(4);
+}
+
+static unsigned long ldp_panel_get_caps(struct lcd_panel *panel)
+{
+	return 0;
+}
+
+struct lcd_panel ldp_panel = {
+	.name		= "ldp",
+	.config		= OMAP_LCDC_PANEL_TFT | OMAP_LCDC_INV_VSYNC |
+			  OMAP_LCDC_INV_HSYNC,
+
+	.bpp		= 16,
+	.data_lines	= 18,
+	.x_res		= LCD_XRES,
+	.y_res		= LCD_YRES,
+	.hsw		= 3,		/* hsync_len (4) - 1 */
+	.hfp		= 3,		/* right_margin (4) - 1 */
+	.hbp		= 39,		/* left_margin (40) - 1 */
+	.vsw		= 1,		/* vsync_len (2) - 1 */
+	.vfp		= 2,		/* lower_margin */
+	.vbp		= 7,		/* upper_margin (8) - 1 */
+
+	.pixel_clock	= LCD_PIXCLOCK_MAX,
+
+	.init		= ldp_panel_init,
+	.cleanup	= ldp_panel_cleanup,
+	.enable		= ldp_panel_enable,
+	.disable	= ldp_panel_disable,
+	.get_caps	= ldp_panel_get_caps,
+};
+
+static int ldp_panel_probe(struct platform_device *pdev)
+{
+	omapfb_register_panel(&ldp_panel);
+	return 0;
+}
+
+static int ldp_panel_remove(struct platform_device *pdev)
+{
+	return 0;
+}
+
+static int ldp_panel_suspend(struct platform_device *pdev, pm_message_t mesg)
+{
+	return 0;
+}
+
+static int ldp_panel_resume(struct platform_device *pdev)
+{
+	return 0;
+}
+
+struct platform_driver ldp_panel_driver = {
+	.probe		= ldp_panel_probe,
+	.remove		= ldp_panel_remove,
+	.suspend	= ldp_panel_suspend,
+	.resume		= ldp_panel_resume,
+	.driver		= {
+		.name	= "ldp_lcd",
+		.owner	= THIS_MODULE,
+	},
+};
+
+static int __init ldp_panel_drv_init(void)
+{
+	return platform_driver_register(&ldp_panel_driver);
+}
+
+static void __exit ldp_panel_drv_exit(void)
+{
+	platform_driver_unregister(&ldp_panel_driver);
+}
+
+module_init(ldp_panel_drv_init);
+module_exit(ldp_panel_drv_exit);
diff --git a/drivers/video/omap/lcd_mipid.c b/drivers/video/omap/lcd_mipid.c
new file mode 100644
index 0000000..918ee89
--- /dev/null
+++ b/drivers/video/omap/lcd_mipid.c
@@ -0,0 +1,625 @@
+/*
+ * LCD driver for MIPI DBI-C / DCS compatible LCDs
+ *
+ * Copyright (C) 2006 Nokia Corporation
+ * Author: Imre Deak <imre.deak@nokia.com>
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA  02111-1307, USA.
+ */
+#include <linux/device.h>
+#include <linux/delay.h>
+#include <linux/workqueue.h>
+#include <linux/spi/spi.h>
+
+#include <mach/omapfb.h>
+#include <mach/lcd_mipid.h>
+
+#define MIPID_MODULE_NAME		"lcd_mipid"
+
+#define MIPID_CMD_READ_DISP_ID		0x04
+#define MIPID_CMD_READ_RED		0x06
+#define MIPID_CMD_READ_GREEN		0x07
+#define MIPID_CMD_READ_BLUE		0x08
+#define MIPID_CMD_READ_DISP_STATUS	0x09
+#define MIPID_CMD_RDDSDR		0x0F
+#define MIPID_CMD_SLEEP_IN		0x10
+#define MIPID_CMD_SLEEP_OUT		0x11
+#define MIPID_CMD_DISP_OFF		0x28
+#define MIPID_CMD_DISP_ON		0x29
+
+#define MIPID_ESD_CHECK_PERIOD		msecs_to_jiffies(5000)
+
+#define to_mipid_device(p)		container_of(p, struct mipid_device, \
+						panel)
+struct mipid_device {
+	int		enabled;
+	int		revision;
+	unsigned int	saved_bklight_level;
+	unsigned long	hw_guard_end;		/* next value of jiffies
+						   when we can issue the
+						   next sleep in/out command */
+	unsigned long	hw_guard_wait;		/* max guard time in jiffies */
+
+	struct omapfb_device	*fbdev;
+	struct spi_device	*spi;
+	struct mutex		mutex;
+	struct lcd_panel	panel;
+
+	struct workqueue_struct	*esd_wq;
+	struct delayed_work	esd_work;
+	void			(*esd_check)(struct mipid_device *m);
+};
+
+static void mipid_transfer(struct mipid_device *md, int cmd, const u8 *wbuf,
+			   int wlen, u8 *rbuf, int rlen)
+{
+	struct spi_message	m;
+	struct spi_transfer	*x, xfer[4];
+	u16			w;
+	int			r;
+
+	BUG_ON(md->spi == NULL);
+
+	spi_message_init(&m);
+
+	memset(xfer, 0, sizeof(xfer));
+	x = &xfer[0];
+
+	cmd &=  0xff;
+	x->tx_buf		= &cmd;
+	x->bits_per_word	= 9;
+	x->len			= 2;
+	spi_message_add_tail(x, &m);
+
+	if (wlen) {
+		x++;
+		x->tx_buf		= wbuf;
+		x->len			= wlen;
+		x->bits_per_word	= 9;
+		spi_message_add_tail(x, &m);
+	}
+
+	if (rlen) {
+		x++;
+		x->rx_buf	= &w;
+		x->len		= 1;
+		spi_message_add_tail(x, &m);
+
+		if (rlen > 1) {
+			/* Arrange for the extra clock before the first
+			 * data bit.
+			 */
+			x->bits_per_word = 9;
+			x->len		 = 2;
+
+			x++;
+			x->rx_buf	 = &rbuf[1];
+			x->len		 = rlen - 1;
+			spi_message_add_tail(x, &m);
+		}
+	}
+
+	r = spi_sync(md->spi, &m);
+	if (r < 0)
+		dev_dbg(&md->spi->dev, "spi_sync %d\n", r);
+
+	if (rlen)
+		rbuf[0] = w & 0xff;
+}
+
+static inline void mipid_cmd(struct mipid_device *md, int cmd)
+{
+	mipid_transfer(md, cmd, NULL, 0, NULL, 0);
+}
+
+static inline void mipid_write(struct mipid_device *md,
+			       int reg, const u8 *buf, int len)
+{
+	mipid_transfer(md, reg, buf, len, NULL, 0);
+}
+
+static inline void mipid_read(struct mipid_device *md,
+			      int reg, u8 *buf, int len)
+{
+	mipid_transfer(md, reg, NULL, 0, buf, len);
+}
+
+static void set_data_lines(struct mipid_device *md, int data_lines)
+{
+	u16 par;
+
+	switch (data_lines) {
+	case 16:
+		par = 0x150;
+		break;
+	case 18:
+		par = 0x160;
+		break;
+	case 24:
+		par = 0x170;
+		break;
+	}
+	mipid_write(md, 0x3a, (u8 *)&par, 2);
+}
+
+static void send_init_string(struct mipid_device *md)
+{
+	u16 initpar[] = { 0x0102, 0x0100, 0x0100 };
+
+	mipid_write(md, 0xc2, (u8 *)initpar, sizeof(initpar));
+	set_data_lines(md, md->panel.data_lines);
+}
+
+static void hw_guard_start(struct mipid_device *md, int guard_msec)
+{
+	md->hw_guard_wait = msecs_to_jiffies(guard_msec);
+	md->hw_guard_end = jiffies + md->hw_guard_wait;
+}
+
+static void hw_guard_wait(struct mipid_device *md)
+{
+	unsigned long wait = md->hw_guard_end - jiffies;
+
+	if ((long)wait > 0 && wait <= md->hw_guard_wait) {
+		set_current_state(TASK_UNINTERRUPTIBLE);
+		schedule_timeout(wait);
+	}
+}
+
+static void set_sleep_mode(struct mipid_device *md, int on)
+{
+	int cmd, sleep_time = 50;
+
+	if (on)
+		cmd = MIPID_CMD_SLEEP_IN;
+	else
+		cmd = MIPID_CMD_SLEEP_OUT;
+	hw_guard_wait(md);
+	mipid_cmd(md, cmd);
+	hw_guard_start(md, 120);
+	/*
+	 * When we enable the panel, it seems we _have_ to sleep
+	 * 120 ms before sending the init string. When disabling the
+	 * panel we'll sleep for the duration of 2 frames, so that the
+	 * controller can still provide the PCLK,HS,VS signals.
+	 */
+	if (!on)
+		sleep_time = 120;
+	msleep(sleep_time);
+}
+
+static void set_display_state(struct mipid_device *md, int enabled)
+{
+	int cmd = enabled ? MIPID_CMD_DISP_ON : MIPID_CMD_DISP_OFF;
+
+	mipid_cmd(md, cmd);
+}
+
+static int mipid_set_bklight_level(struct lcd_panel *panel, unsigned int level)
+{
+	struct mipid_device *md = to_mipid_device(panel);
+	struct mipid_platform_data *pd = md->spi->dev.platform_data;
+
+	if (pd->get_bklight_max == NULL || pd->set_bklight_level == NULL)
+		return -ENODEV;
+	if (level > pd->get_bklight_max(pd))
+		return -EINVAL;
+	if (!md->enabled) {
+		md->saved_bklight_level = level;
+		return 0;
+	}
+	pd->set_bklight_level(pd, level);
+
+	return 0;
+}
+
+static unsigned int mipid_get_bklight_level(struct lcd_panel *panel)
+{
+	struct mipid_device *md = to_mipid_device(panel);
+	struct mipid_platform_data *pd = md->spi->dev.platform_data;
+
+	if (pd->get_bklight_level == NULL)
+		return -ENODEV;
+	return pd->get_bklight_level(pd);
+}
+
+static unsigned int mipid_get_bklight_max(struct lcd_panel *panel)
+{
+	struct mipid_device *md = to_mipid_device(panel);
+	struct mipid_platform_data *pd = md->spi->dev.platform_data;
+
+	if (pd->get_bklight_max == NULL)
+		return -ENODEV;
+
+	return pd->get_bklight_max(pd);
+}
+
+static unsigned long mipid_get_caps(struct lcd_panel *panel)
+{
+	return OMAPFB_CAPS_SET_BACKLIGHT;
+}
+
+static u16 read_first_pixel(struct mipid_device *md)
+{
+	u16 pixel;
+	u8 red, green, blue;
+
+	mutex_lock(&md->mutex);
+	mipid_read(md, MIPID_CMD_READ_RED, &red, 1);
+	mipid_read(md, MIPID_CMD_READ_GREEN, &green, 1);
+	mipid_read(md, MIPID_CMD_READ_BLUE, &blue, 1);
+	mutex_unlock(&md->mutex);
+
+	switch (md->panel.data_lines) {
+	case 16:
+		pixel = ((red >> 1) << 11) | (green << 5) | (blue >> 1);
+		break;
+	case 24:
+		/* 24 bit -> 16 bit */
+		pixel = ((red >> 3) << 11) | ((green >> 2) << 5) |
+			(blue >> 3);
+		break;
+	default:
+		pixel = 0;
+		BUG();
+	}
+
+	return pixel;
+}
+
+static int mipid_run_test(struct lcd_panel *panel, int test_num)
+{
+	struct mipid_device *md = to_mipid_device(panel);
+	static const u16 test_values[4] = {
+		0x0000, 0xffff, 0xaaaa, 0x5555,
+	};
+	int i;
+
+	if (test_num != MIPID_TEST_RGB_LINES)
+		return MIPID_TEST_INVALID;
+
+	for (i = 0; i < ARRAY_SIZE(test_values); i++) {
+		int delay;
+		unsigned long tmo;
+
+		omapfb_write_first_pixel(md->fbdev, test_values[i]);
+		tmo = jiffies + msecs_to_jiffies(100);
+		delay = 25;
+		while (1) {
+			u16 pixel;
+
+			msleep(delay);
+			pixel = read_first_pixel(md);
+			if (pixel == test_values[i])
+				break;
+			if (time_after(jiffies, tmo)) {
+				dev_err(&md->spi->dev,
+					"MIPI LCD RGB I/F test failed: "
+					"expecting %04x, got %04x\n",
+					test_values[i], pixel);
+				return MIPID_TEST_FAILED;
+			}
+			delay = 10;
+		}
+	}
+
+	return 0;
+}
+
+static void ls041y3_esd_recover(struct mipid_device *md)
+{
+	dev_err(&md->spi->dev, "performing LCD ESD recovery\n");
+	set_sleep_mode(md, 1);
+	set_sleep_mode(md, 0);
+}
+
+static void ls041y3_esd_check_mode1(struct mipid_device *md)
+{
+	u8 state1, state2;
+
+	mipid_read(md, MIPID_CMD_RDDSDR, &state1, 1);
+	set_sleep_mode(md, 0);
+	mipid_read(md, MIPID_CMD_RDDSDR, &state2, 1);
+	dev_dbg(&md->spi->dev, "ESD mode 1 state1 %02x state2 %02x\n",
+		state1, state2);
+	/* Each sleep out command will trigger a self diagnostic and flip
+	* Bit6 if the test passes.
+	*/
+	if (!((state1 ^ state2) & (1 << 6)))
+		ls041y3_esd_recover(md);
+}
+
+static void ls041y3_esd_check_mode2(struct mipid_device *md)
+{
+	int i;
+	u8 rbuf[2];
+	static const struct {
+		int	cmd;
+		int	wlen;
+		u16	wbuf[3];
+	} *rd, rd_ctrl[7] = {
+		{ 0xb0, 4, { 0x0101, 0x01fe, } },
+		{ 0xb1, 4, { 0x01de, 0x0121, } },
+		{ 0xc2, 4, { 0x0100, 0x0100, } },
+		{ 0xbd, 2, { 0x0100, } },
+		{ 0xc2, 4, { 0x01fc, 0x0103, } },
+		{ 0xb4, 0, },
+		{ 0x00, 0, },
+	};
+
+	rd = rd_ctrl;
+	for (i = 0; i < 3; i++, rd++)
+		mipid_write(md, rd->cmd, (u8 *)rd->wbuf, rd->wlen);
+
+	udelay(10);
+	mipid_read(md, rd->cmd, rbuf, 2);
+	rd++;
+
+	for (i = 0; i < 3; i++, rd++) {
+		udelay(10);
+		mipid_write(md, rd->cmd, (u8 *)rd->wbuf, rd->wlen);
+	}
+
+	dev_dbg(&md->spi->dev, "ESD mode 2 state %02x\n", rbuf[1]);
+	if (rbuf[1] == 0x00)
+		ls041y3_esd_recover(md);
+}
+
+static void ls041y3_esd_check(struct mipid_device *md)
+{
+	ls041y3_esd_check_mode1(md);
+	if (md->revision >= 0x88)
+		ls041y3_esd_check_mode2(md);
+}
+
+static void mipid_esd_start_check(struct mipid_device *md)
+{
+	if (md->esd_check != NULL)
+		queue_delayed_work(md->esd_wq, &md->esd_work,
+				   MIPID_ESD_CHECK_PERIOD);
+}
+
+static void mipid_esd_stop_check(struct mipid_device *md)
+{
+	if (md->esd_check != NULL)
+		cancel_rearming_delayed_workqueue(md->esd_wq, &md->esd_work);
+}
+
+static void mipid_esd_work(struct work_struct *work)
+{
+	struct mipid_device *md = container_of(work, struct mipid_device,
+					       esd_work.work);
+
+	mutex_lock(&md->mutex);
+	md->esd_check(md);
+	mutex_unlock(&md->mutex);
+	mipid_esd_start_check(md);
+}
+
+static int mipid_enable(struct lcd_panel *panel)
+{
+	struct mipid_device *md = to_mipid_device(panel);
+
+	mutex_lock(&md->mutex);
+
+	if (md->enabled) {
+		mutex_unlock(&md->mutex);
+		return 0;
+	}
+	set_sleep_mode(md, 0);
+	md->enabled = 1;
+	send_init_string(md);
+	set_display_state(md, 1);
+	mipid_set_bklight_level(panel, md->saved_bklight_level);
+	mipid_esd_start_check(md);
+
+	mutex_unlock(&md->mutex);
+	return 0;
+}
+
+static void mipid_disable(struct lcd_panel *panel)
+{
+	struct mipid_device *md = to_mipid_device(panel);
+
+	/*
+	 * A final ESD work might be called before returning,
+	 * so do this without holding the lock.
+	 */
+	mipid_esd_stop_check(md);
+	mutex_lock(&md->mutex);
+
+	if (!md->enabled) {
+		mutex_unlock(&md->mutex);
+		return;
+	}
+	md->saved_bklight_level = mipid_get_bklight_level(panel);
+	mipid_set_bklight_level(panel, 0);
+	set_display_state(md, 0);
+	set_sleep_mode(md, 1);
+	md->enabled = 0;
+
+	mutex_unlock(&md->mutex);
+}
+
+static int panel_enabled(struct mipid_device *md)
+{
+	u32 disp_status;
+	int enabled;
+
+	mipid_read(md, MIPID_CMD_READ_DISP_STATUS, (u8 *)&disp_status, 4);
+	disp_status = __be32_to_cpu(disp_status);
+	enabled = (disp_status & (1 << 17)) && (disp_status & (1 << 10));
+	dev_dbg(&md->spi->dev,
+		"LCD panel %senabled by bootloader (status 0x%04x)\n",
+		enabled ? "" : "not ", disp_status);
+	return enabled;
+}
+
+static int mipid_init(struct lcd_panel *panel,
+			    struct omapfb_device *fbdev)
+{
+	struct mipid_device *md = to_mipid_device(panel);
+
+	md->fbdev = fbdev;
+	md->esd_wq = create_singlethread_workqueue("mipid_esd");
+	if (md->esd_wq == NULL) {
+		dev_err(&md->spi->dev, "can't create ESD workqueue\n");
+		return -ENOMEM;
+	}
+	INIT_DELAYED_WORK(&md->esd_work, mipid_esd_work);
+	mutex_init(&md->mutex);
+
+	md->enabled = panel_enabled(md);
+
+	if (md->enabled)
+		mipid_esd_start_check(md);
+	else
+		md->saved_bklight_level = mipid_get_bklight_level(panel);
+
+	return 0;
+}
+
+static void mipid_cleanup(struct lcd_panel *panel)
+{
+	struct mipid_device *md = to_mipid_device(panel);
+
+	if (md->enabled)
+		mipid_esd_stop_check(md);
+	destroy_workqueue(md->esd_wq);
+}
+
+static struct lcd_panel mipid_panel = {
+	.config		= OMAP_LCDC_PANEL_TFT,
+
+	.bpp		= 16,
+	.x_res		= 800,
+	.y_res		= 480,
+	.pixel_clock	= 21940,
+	.hsw		= 50,
+	.hfp		= 20,
+	.hbp		= 15,
+	.vsw		= 2,
+	.vfp		= 1,
+	.vbp		= 3,
+
+	.init			= mipid_init,
+	.cleanup		= mipid_cleanup,
+	.enable			= mipid_enable,
+	.disable		= mipid_disable,
+	.get_caps		= mipid_get_caps,
+	.set_bklight_level	= mipid_set_bklight_level,
+	.get_bklight_level	= mipid_get_bklight_level,
+	.get_bklight_max	= mipid_get_bklight_max,
+	.run_test		= mipid_run_test,
+};
+
+static int mipid_detect(struct mipid_device *md)
+{
+	struct mipid_platform_data *pdata;
+	u8 display_id[3];
+
+	pdata = md->spi->dev.platform_data;
+	if (pdata == NULL) {
+		dev_err(&md->spi->dev, "missing platform data\n");
+		return -ENOENT;
+	}
+
+	mipid_read(md, MIPID_CMD_READ_DISP_ID, display_id, 3);
+	dev_dbg(&md->spi->dev, "MIPI display ID: %02x%02x%02x\n",
+		display_id[0], display_id[1], display_id[2]);
+
+	switch (display_id[0]) {
+	case 0x45:
+		md->panel.name = "lph8923";
+		break;
+	case 0x83:
+		md->panel.name = "ls041y3";
+		md->esd_check = ls041y3_esd_check;
+		break;
+	default:
+		md->panel.name = "unknown";
+		dev_err(&md->spi->dev, "invalid display ID\n");
+		return -ENODEV;
+	}
+
+	md->revision = display_id[1];
+	md->panel.data_lines = pdata->data_lines;
+	pr_info("omapfb: %s rev %02x LCD detected, %d data lines\n",
+			md->panel.name, md->revision, md->panel.data_lines);
+
+	return 0;
+}
+
+static int mipid_spi_probe(struct spi_device *spi)
+{
+	struct mipid_device *md;
+	int r;
+
+	md = kzalloc(sizeof(*md), GFP_KERNEL);
+	if (md == NULL) {
+		dev_err(&spi->dev, "out of memory\n");
+		return -ENOMEM;
+	}
+
+	spi->mode = SPI_MODE_0;
+	md->spi = spi;
+	dev_set_drvdata(&spi->dev, md);
+	md->panel = mipid_panel;
+
+	r = mipid_detect(md);
+	if (r < 0)
+		return r;
+
+	omapfb_register_panel(&md->panel);
+
+	return 0;
+}
+
+static int mipid_spi_remove(struct spi_device *spi)
+{
+	struct mipid_device *md = dev_get_drvdata(&spi->dev);
+
+	mipid_disable(&md->panel);
+	kfree(md);
+
+	return 0;
+}
+
+static struct spi_driver mipid_spi_driver = {
+	.driver = {
+		.name	= MIPID_MODULE_NAME,
+		.bus	= &spi_bus_type,
+		.owner	= THIS_MODULE,
+	},
+	.probe	= mipid_spi_probe,
+	.remove	= __devexit_p(mipid_spi_remove),
+};
+
+static int mipid_drv_init(void)
+{
+	spi_register_driver(&mipid_spi_driver);
+
+	return 0;
+}
+module_init(mipid_drv_init);
+
+static void mipid_drv_cleanup(void)
+{
+	spi_unregister_driver(&mipid_spi_driver);
+}
+module_exit(mipid_drv_cleanup);
+
+MODULE_DESCRIPTION("MIPI display driver");
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/omap/lcd_omap2evm.c b/drivers/video/omap/lcd_omap2evm.c
new file mode 100644
index 0000000..7a2bbe2
--- /dev/null
+++ b/drivers/video/omap/lcd_omap2evm.c
@@ -0,0 +1,191 @@
+/*
+ * LCD panel support for the MISTRAL OMAP2EVM board
+ *
+ * Author: Arun C <arunedarath@mistralsolutions.com>
+ *
+ * Derived from drivers/video/omap/lcd_omap3evm.c
+ * Derived from drivers/video/omap/lcd-apollon.c
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA  02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/gpio.h>
+#include <linux/i2c/twl4030.h>
+
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+#include <asm/mach-types.h>
+
+#define LCD_PANEL_ENABLE_GPIO	154
+#define LCD_PANEL_LR		128
+#define LCD_PANEL_UD		129
+#define LCD_PANEL_INI		152
+#define LCD_PANEL_QVGA		148
+#define LCD_PANEL_RESB		153
+
+#define TWL_LED_LEDEN		0x00
+#define TWL_PWMA_PWMAON		0x00
+#define TWL_PWMA_PWMAOFF	0x01
+
+static unsigned int bklight_level;
+
+static int omap2evm_panel_init(struct lcd_panel *panel,
+				struct omapfb_device *fbdev)
+{
+	gpio_request(LCD_PANEL_ENABLE_GPIO, "LCD enable");
+	gpio_request(LCD_PANEL_LR, "LCD lr");
+	gpio_request(LCD_PANEL_UD, "LCD ud");
+	gpio_request(LCD_PANEL_INI, "LCD ini");
+	gpio_request(LCD_PANEL_QVGA, "LCD qvga");
+	gpio_request(LCD_PANEL_RESB, "LCD resb");
+
+	gpio_direction_output(LCD_PANEL_ENABLE_GPIO, 1);
+	gpio_direction_output(LCD_PANEL_RESB, 1);
+	gpio_direction_output(LCD_PANEL_INI, 1);
+	gpio_direction_output(LCD_PANEL_QVGA, 0);
+	gpio_direction_output(LCD_PANEL_LR, 1);
+	gpio_direction_output(LCD_PANEL_UD, 1);
+
+	twl4030_i2c_write_u8(TWL4030_MODULE_LED, 0x11, TWL_LED_LEDEN);
+	twl4030_i2c_write_u8(TWL4030_MODULE_PWMA, 0x01, TWL_PWMA_PWMAON);
+	twl4030_i2c_write_u8(TWL4030_MODULE_PWMA, 0x02, TWL_PWMA_PWMAOFF);
+	bklight_level = 100;
+
+	return 0;
+}
+
+static void omap2evm_panel_cleanup(struct lcd_panel *panel)
+{
+	gpio_free(LCD_PANEL_RESB);
+	gpio_free(LCD_PANEL_QVGA);
+	gpio_free(LCD_PANEL_INI);
+	gpio_free(LCD_PANEL_UD);
+	gpio_free(LCD_PANEL_LR);
+	gpio_free(LCD_PANEL_ENABLE_GPIO);
+}
+
+static int omap2evm_panel_enable(struct lcd_panel *panel)
+{
+	gpio_set_value(LCD_PANEL_ENABLE_GPIO, 0);
+	return 0;
+}
+
+static void omap2evm_panel_disable(struct lcd_panel *panel)
+{
+	gpio_set_value(LCD_PANEL_ENABLE_GPIO, 1);
+}
+
+static unsigned long omap2evm_panel_get_caps(struct lcd_panel *panel)
+{
+	return 0;
+}
+
+static int omap2evm_bklight_setlevel(struct lcd_panel *panel,
+						unsigned int level)
+{
+	u8 c;
+	if ((level >= 0) && (level <= 100)) {
+		c = (125 * (100 - level)) / 100 + 2;
+		twl4030_i2c_write_u8(TWL4030_MODULE_PWMA, c, TWL_PWMA_PWMAOFF);
+		bklight_level = level;
+	}
+	return 0;
+}
+
+static unsigned int omap2evm_bklight_getlevel(struct lcd_panel *panel)
+{
+	return bklight_level;
+}
+
+static unsigned int omap2evm_bklight_getmaxlevel(struct lcd_panel *panel)
+{
+	return 100;
+}
+
+struct lcd_panel omap2evm_panel = {
+	.name		= "omap2evm",
+	.config		= OMAP_LCDC_PANEL_TFT | OMAP_LCDC_INV_VSYNC |
+			  OMAP_LCDC_INV_HSYNC,
+
+	.bpp		= 16,
+	.data_lines	= 18,
+	.x_res		= 480,
+	.y_res		= 640,
+	.hsw		= 3,
+	.hfp		= 0,
+	.hbp		= 28,
+	.vsw		= 2,
+	.vfp		= 1,
+	.vbp		= 0,
+
+	.pixel_clock	= 20000,
+
+	.init		= omap2evm_panel_init,
+	.cleanup	= omap2evm_panel_cleanup,
+	.enable		= omap2evm_panel_enable,
+	.disable	= omap2evm_panel_disable,
+	.get_caps	= omap2evm_panel_get_caps,
+	.set_bklight_level      = omap2evm_bklight_setlevel,
+	.get_bklight_level      = omap2evm_bklight_getlevel,
+	.get_bklight_max        = omap2evm_bklight_getmaxlevel,
+};
+
+static int omap2evm_panel_probe(struct platform_device *pdev)
+{
+	omapfb_register_panel(&omap2evm_panel);
+	return 0;
+}
+
+static int omap2evm_panel_remove(struct platform_device *pdev)
+{
+	return 0;
+}
+
+static int omap2evm_panel_suspend(struct platform_device *pdev,
+				   pm_message_t mesg)
+{
+	return 0;
+}
+
+static int omap2evm_panel_resume(struct platform_device *pdev)
+{
+	return 0;
+}
+
+struct platform_driver omap2evm_panel_driver = {
+	.probe		= omap2evm_panel_probe,
+	.remove		= omap2evm_panel_remove,
+	.suspend	= omap2evm_panel_suspend,
+	.resume		= omap2evm_panel_resume,
+	.driver		= {
+		.name	= "omap2evm_lcd",
+		.owner	= THIS_MODULE,
+	},
+};
+
+static int __init omap2evm_panel_drv_init(void)
+{
+	return platform_driver_register(&omap2evm_panel_driver);
+}
+
+static void __exit omap2evm_panel_drv_exit(void)
+{
+	platform_driver_unregister(&omap2evm_panel_driver);
+}
+
+module_init(omap2evm_panel_drv_init);
+module_exit(omap2evm_panel_drv_exit);
diff --git a/drivers/video/omap/lcd_omap3beagle.c b/drivers/video/omap/lcd_omap3beagle.c
new file mode 100644
index 0000000..4011910
--- /dev/null
+++ b/drivers/video/omap/lcd_omap3beagle.c
@@ -0,0 +1,130 @@
+/*
+ * LCD panel support for the TI OMAP3 Beagle board
+ *
+ * Author: Koen Kooi <koen@openembedded.org>
+ *
+ * Derived from drivers/video/omap/lcd-omap3evm.c
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA  02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/gpio.h>
+#include <linux/i2c/twl4030.h>
+
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+#include <asm/mach-types.h>
+
+#define LCD_PANEL_ENABLE_GPIO       170
+
+static int omap3beagle_panel_init(struct lcd_panel *panel,
+				struct omapfb_device *fbdev)
+{
+	gpio_request(LCD_PANEL_ENABLE_GPIO, "LCD enable");
+	return 0;
+}
+
+static void omap3beagle_panel_cleanup(struct lcd_panel *panel)
+{
+	gpio_free(LCD_PANEL_ENABLE_GPIO);
+}
+
+static int omap3beagle_panel_enable(struct lcd_panel *panel)
+{
+	gpio_set_value(LCD_PANEL_ENABLE_GPIO, 1);
+	return 0;
+}
+
+static void omap3beagle_panel_disable(struct lcd_panel *panel)
+{
+	gpio_set_value(LCD_PANEL_ENABLE_GPIO, 0);
+}
+
+static unsigned long omap3beagle_panel_get_caps(struct lcd_panel *panel)
+{
+	return 0;
+}
+
+struct lcd_panel omap3beagle_panel = {
+	.name		= "omap3beagle",
+	.config		= OMAP_LCDC_PANEL_TFT,
+
+	.bpp		= 16,
+	.data_lines	= 24,
+	.x_res		= 1024,
+	.y_res		= 768,
+	.hsw		= 3,		/* hsync_len (4) - 1 */
+	.hfp		= 3,		/* right_margin (4) - 1 */
+	.hbp		= 39,		/* left_margin (40) - 1 */
+	.vsw		= 1,		/* vsync_len (2) - 1 */
+	.vfp		= 2,		/* lower_margin */
+	.vbp		= 7,		/* upper_margin (8) - 1 */
+
+	.pixel_clock	= 64000,
+
+	.init		= omap3beagle_panel_init,
+	.cleanup	= omap3beagle_panel_cleanup,
+	.enable		= omap3beagle_panel_enable,
+	.disable	= omap3beagle_panel_disable,
+	.get_caps	= omap3beagle_panel_get_caps,
+};
+
+static int omap3beagle_panel_probe(struct platform_device *pdev)
+{
+	omapfb_register_panel(&omap3beagle_panel);
+	return 0;
+}
+
+static int omap3beagle_panel_remove(struct platform_device *pdev)
+{
+	return 0;
+}
+
+static int omap3beagle_panel_suspend(struct platform_device *pdev,
+				   pm_message_t mesg)
+{
+	return 0;
+}
+
+static int omap3beagle_panel_resume(struct platform_device *pdev)
+{
+	return 0;
+}
+
+struct platform_driver omap3beagle_panel_driver = {
+	.probe		= omap3beagle_panel_probe,
+	.remove		= omap3beagle_panel_remove,
+	.suspend	= omap3beagle_panel_suspend,
+	.resume		= omap3beagle_panel_resume,
+	.driver		= {
+		.name	= "omap3beagle_lcd",
+		.owner	= THIS_MODULE,
+	},
+};
+
+static int __init omap3beagle_panel_drv_init(void)
+{
+	return platform_driver_register(&omap3beagle_panel_driver);
+}
+
+static void __exit omap3beagle_panel_drv_exit(void)
+{
+	platform_driver_unregister(&omap3beagle_panel_driver);
+}
+
+module_init(omap3beagle_panel_drv_init);
+module_exit(omap3beagle_panel_drv_exit);
diff --git a/drivers/video/omap/lcd_omap3evm.c b/drivers/video/omap/lcd_omap3evm.c
new file mode 100644
index 0000000..b6a4c2c
--- /dev/null
+++ b/drivers/video/omap/lcd_omap3evm.c
@@ -0,0 +1,192 @@
+/*
+ * LCD panel support for the TI OMAP3 EVM board
+ *
+ * Author: Steve Sakoman <steve@sakoman.com>
+ *
+ * Derived from drivers/video/omap/lcd-apollon.c
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA  02111-1307, USA.
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/gpio.h>
+#include <linux/i2c/twl4030.h>
+
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+#include <asm/mach-types.h>
+
+#define LCD_PANEL_ENABLE_GPIO       153
+#define LCD_PANEL_LR                2
+#define LCD_PANEL_UD                3
+#define LCD_PANEL_INI               152
+#define LCD_PANEL_QVGA              154
+#define LCD_PANEL_RESB              155
+
+#define ENABLE_VDAC_DEDICATED	0x03
+#define ENABLE_VDAC_DEV_GRP	0x20
+#define ENABLE_VPLL2_DEDICATED	0x05
+#define ENABLE_VPLL2_DEV_GRP	0xE0
+
+#define TWL_LED_LEDEN		0x00
+#define TWL_PWMA_PWMAON		0x00
+#define TWL_PWMA_PWMAOFF	0x01
+
+static unsigned int bklight_level;
+
+static int omap3evm_panel_init(struct lcd_panel *panel,
+				struct omapfb_device *fbdev)
+{
+	gpio_request(LCD_PANEL_LR, "LCD lr");
+	gpio_request(LCD_PANEL_UD, "LCD ud");
+	gpio_request(LCD_PANEL_INI, "LCD ini");
+	gpio_request(LCD_PANEL_RESB, "LCD resb");
+	gpio_request(LCD_PANEL_QVGA, "LCD qvga");
+
+	gpio_direction_output(LCD_PANEL_RESB, 1);
+	gpio_direction_output(LCD_PANEL_INI, 1);
+	gpio_direction_output(LCD_PANEL_QVGA, 0);
+	gpio_direction_output(LCD_PANEL_LR, 1);
+	gpio_direction_output(LCD_PANEL_UD, 1);
+
+	twl4030_i2c_write_u8(TWL4030_MODULE_LED, 0x11, TWL_LED_LEDEN);
+	twl4030_i2c_write_u8(TWL4030_MODULE_PWMA, 0x01, TWL_PWMA_PWMAON);
+	twl4030_i2c_write_u8(TWL4030_MODULE_PWMA, 0x02, TWL_PWMA_PWMAOFF);
+	bklight_level = 100;
+
+	return 0;
+}
+
+static void omap3evm_panel_cleanup(struct lcd_panel *panel)
+{
+	gpio_free(LCD_PANEL_QVGA);
+	gpio_free(LCD_PANEL_RESB);
+	gpio_free(LCD_PANEL_INI);
+	gpio_free(LCD_PANEL_UD);
+	gpio_free(LCD_PANEL_LR);
+}
+
+static int omap3evm_panel_enable(struct lcd_panel *panel)
+{
+	gpio_set_value(LCD_PANEL_ENABLE_GPIO, 0);
+	return 0;
+}
+
+static void omap3evm_panel_disable(struct lcd_panel *panel)
+{
+	gpio_set_value(LCD_PANEL_ENABLE_GPIO, 1);
+}
+
+static unsigned long omap3evm_panel_get_caps(struct lcd_panel *panel)
+{
+	return 0;
+}
+
+static int omap3evm_bklight_setlevel(struct lcd_panel *panel,
+						unsigned int level)
+{
+	u8 c;
+	if ((level >= 0) && (level <= 100)) {
+		c = (125 * (100 - level)) / 100 + 2;
+		twl4030_i2c_write_u8(TWL4030_MODULE_PWMA, c, TWL_PWMA_PWMAOFF);
+		bklight_level = level;
+	}
+	return 0;
+}
+
+static unsigned int omap3evm_bklight_getlevel(struct lcd_panel *panel)
+{
+	return bklight_level;
+}
+
+static unsigned int omap3evm_bklight_getmaxlevel(struct lcd_panel *panel)
+{
+	return 100;
+}
+
+struct lcd_panel omap3evm_panel = {
+	.name		= "omap3evm",
+	.config		= OMAP_LCDC_PANEL_TFT | OMAP_LCDC_INV_VSYNC |
+			  OMAP_LCDC_INV_HSYNC,
+
+	.bpp		= 16,
+	.data_lines	= 18,
+	.x_res		= 480,
+	.y_res		= 640,
+	.hsw		= 3,		/* hsync_len (4) - 1 */
+	.hfp		= 3,		/* right_margin (4) - 1 */
+	.hbp		= 39,		/* left_margin (40) - 1 */
+	.vsw		= 1,		/* vsync_len (2) - 1 */
+	.vfp		= 2,		/* lower_margin */
+	.vbp		= 7,		/* upper_margin (8) - 1 */
+
+	.pixel_clock	= 26000,
+
+	.init		= omap3evm_panel_init,
+	.cleanup	= omap3evm_panel_cleanup,
+	.enable		= omap3evm_panel_enable,
+	.disable	= omap3evm_panel_disable,
+	.get_caps	= omap3evm_panel_get_caps,
+	.set_bklight_level      = omap3evm_bklight_setlevel,
+	.get_bklight_level      = omap3evm_bklight_getlevel,
+	.get_bklight_max        = omap3evm_bklight_getmaxlevel,
+};
+
+static int omap3evm_panel_probe(struct platform_device *pdev)
+{
+	omapfb_register_panel(&omap3evm_panel);
+	return 0;
+}
+
+static int omap3evm_panel_remove(struct platform_device *pdev)
+{
+	return 0;
+}
+
+static int omap3evm_panel_suspend(struct platform_device *pdev,
+				   pm_message_t mesg)
+{
+	return 0;
+}
+
+static int omap3evm_panel_resume(struct platform_device *pdev)
+{
+	return 0;
+}
+
+struct platform_driver omap3evm_panel_driver = {
+	.probe		= omap3evm_panel_probe,
+	.remove		= omap3evm_panel_remove,
+	.suspend	= omap3evm_panel_suspend,
+	.resume		= omap3evm_panel_resume,
+	.driver		= {
+		.name	= "omap3evm_lcd",
+		.owner	= THIS_MODULE,
+	},
+};
+
+static int __init omap3evm_panel_drv_init(void)
+{
+	return platform_driver_register(&omap3evm_panel_driver);
+}
+
+static void __exit omap3evm_panel_drv_exit(void)
+{
+	platform_driver_unregister(&omap3evm_panel_driver);
+}
+
+module_init(omap3evm_panel_drv_init);
+module_exit(omap3evm_panel_drv_exit);
diff --git a/drivers/video/omap/lcd_overo.c b/drivers/video/omap/lcd_overo.c
new file mode 100644
index 0000000..2bc5c92
--- /dev/null
+++ b/drivers/video/omap/lcd_overo.c
@@ -0,0 +1,179 @@
+/*
+ * LCD panel support for the Gumstix Overo
+ *
+ * Author: Steve Sakoman <steve@sakoman.com>
+ *
+ * This program is free software; you can redistribute it and/or modify it
+ * under the terms of the GNU General Public License as published by the
+ * Free Software Foundation; either version 2 of the License, or (at your
+ * option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful, but
+ * WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+ * General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License along
+ * with this program; if not, write to the Free Software Foundation, Inc.,
+ * 59 Temple Place - Suite 330, Boston, MA  02111-1307, USA.
+ *
+ */
+
+#include <linux/module.h>
+#include <linux/platform_device.h>
+#include <linux/i2c/twl4030.h>
+
+#include <mach/gpio.h>
+#include <mach/mux.h>
+#include <mach/omapfb.h>
+#include <asm/mach-types.h>
+
+#define LCD_ENABLE       144
+
+static int overo_panel_init(struct lcd_panel *panel,
+				struct omapfb_device *fbdev)
+{
+	if ((gpio_request(LCD_ENABLE, "LCD_ENABLE") == 0) &&
+	    (gpio_direction_output(LCD_ENABLE, 1) == 0))
+		gpio_export(LCD_ENABLE, 0);
+	else
+		printk(KERN_ERR "could not obtain gpio for LCD_ENABLE\n");
+
+	return 0;
+}
+
+static void overo_panel_cleanup(struct lcd_panel *panel)
+{
+	gpio_free(LCD_ENABLE);
+}
+
+static int overo_panel_enable(struct lcd_panel *panel)
+{
+	gpio_set_value(LCD_ENABLE, 1);
+	return 0;
+}
+
+static void overo_panel_disable(struct lcd_panel *panel)
+{
+	gpio_set_value(LCD_ENABLE, 0);
+}
+
+static unsigned long overo_panel_get_caps(struct lcd_panel *panel)
+{
+	return 0;
+}
+
+struct lcd_panel overo_panel = {
+	.name		= "overo",
+	.config		= OMAP_LCDC_PANEL_TFT,
+	.bpp		= 16,
+	.data_lines	= 24,
+
+#if defined CONFIG_FB_OMAP_031M3R
+
+	/* 640 x 480 @ 60 Hz  Reduced blanking VESA CVT 0.31M3-R */
+	.x_res		= 640,
+	.y_res		= 480,
+	.hfp		= 48,
+	.hsw		= 32,
+	.hbp		= 80,
+	.vfp		= 3,
+	.vsw		= 4,
+	.vbp		= 7,
+	.pixel_clock	= 23500,
+
+#elif defined CONFIG_FB_OMAP_048M3R
+
+	/* 800 x 600 @ 60 Hz  Reduced blanking VESA CVT 0.48M3-R */
+	.x_res		= 800,
+	.y_res		= 600,
+	.hfp		= 48,
+	.hsw		= 32,
+	.hbp		= 80,
+	.vfp		= 3,
+	.vsw		= 4,
+	.vbp		= 11,
+	.pixel_clock	= 35500,
+
+#elif defined CONFIG_FB_OMAP_079M3R
+
+	/* 1024 x 768 @ 60 Hz  Reduced blanking VESA CVT 0.79M3-R */
+	.x_res		= 1024,
+	.y_res		= 768,
+	.hfp		= 48,
+	.hsw		= 32,
+	.hbp		= 80,
+	.vfp		= 3,
+	.vsw		= 4,
+	.vbp		= 15,
+	.pixel_clock	= 56000,
+
+#elif defined CONFIG_FB_OMAP_092M9R
+
+	/* 1280 x 720 @ 60 Hz  Reduced blanking VESA CVT 0.92M9-R */
+	.x_res		= 1280,
+	.y_res		= 720,
+	.hfp		= 48,
+	.hsw		= 32,
+	.hbp		= 80,
+	.vfp		= 3,
+	.vsw		= 5,
+	.vbp		= 13,
+	.pixel_clock	= 64000,
+
+#else
+
+	/* use 640 x 480 if no config option */
+	/* 640 x 480 @ 60 Hz  Reduced blanking VESA CVT 0.31M3-R */
+	.x_res		= 640,
+	.y_res		= 480,
+	.hfp		= 48,
+	.hsw		= 32,
+	.hbp		= 80,
+	.vfp		= 3,
+	.vsw		= 4,
+	.vbp		= 7,
+	.pixel_clock	= 23500,
+
+#endif
+
+	.init		= overo_panel_init,
+	.cleanup	= overo_panel_cleanup,
+	.enable		= overo_panel_enable,
+	.disable	= overo_panel_disable,
+	.get_caps	= overo_panel_get_caps,
+};
+
+static int overo_panel_probe(struct platform_device *pdev)
+{
+	omapfb_register_panel(&overo_panel);
+	return 0;
+}
+
+static int overo_panel_remove(struct platform_device *pdev)
+{
+	/* omapfb does not have unregister_panel */
+	return 0;
+}
+
+static struct platform_driver overo_panel_driver = {
+	.probe		= overo_panel_probe,
+	.remove		= overo_panel_remove,
+	.driver		= {
+		.name	= "overo_lcd",
+		.owner	= THIS_MODULE,
+	},
+};
+
+static int __init overo_panel_drv_init(void)
+{
+	return platform_driver_register(&overo_panel_driver);
+}
+
+static void __exit overo_panel_drv_exit(void)
+{
+	platform_driver_unregister(&overo_panel_driver);
+}
+
+module_init(overo_panel_drv_init);
+module_exit(overo_panel_drv_exit);
diff --git a/drivers/video/omap/omapfb_main.c b/drivers/video/omap/omapfb_main.c
index 8862233..125e605 100644
--- a/drivers/video/omap/omapfb_main.c
+++ b/drivers/video/omap/omapfb_main.c
@@ -67,6 +67,7 @@
 	{ OMAPFB_CAPS_WINDOW_PIXEL_DOUBLE, "pixel double window" },
 	{ OMAPFB_CAPS_WINDOW_SCALE,   "scale window" },
 	{ OMAPFB_CAPS_WINDOW_OVERLAY, "overlay window" },
+	{ OMAPFB_CAPS_WINDOW_ROTATE,  "rotate window" },
 	{ OMAPFB_CAPS_SET_BACKLIGHT,  "backlight setting" },
 };
 
@@ -215,6 +216,15 @@
 				 offset, var->xres_virtual,
 				 plane->info.pos_x, plane->info.pos_y,
 				 var->xres, var->yres, plane->color_mode);
+	if (r < 0)
+		return r;
+
+	if (fbdev->ctrl->set_rotate != NULL) {
+		r = fbdev->ctrl->set_rotate(var->rotate);
+		if (r < 0)
+			return r;
+	}
+
 	if (fbdev->ctrl->set_scale != NULL)
 		r = fbdev->ctrl->set_scale(plane->idx,
 				   var->xres, var->yres,
@@ -554,7 +564,6 @@
 		var->xoffset = var->xres_virtual - var->xres;
 	if (var->yres + var->yoffset > var->yres_virtual)
 		var->yoffset = var->yres_virtual - var->yres;
-	line_size = var->xres * bpp / 8;
 
 	if (plane->color_mode == OMAPFB_COLOR_RGB444) {
 		var->red.offset	  = 8; var->red.length	 = 4;
@@ -600,7 +609,7 @@
 	struct omapfb_device *fbdev = plane->fbdev;
 
 	omapfb_rqueue_lock(fbdev);
-	if (cpu_is_omap15xx() && rotate != fbi->var.rotate) {
+	if (rotate != fbi->var.rotate) {
 		struct fb_var_screeninfo *new_var = &fbdev->new_var;
 
 		memcpy(new_var, &fbi->var, sizeof(*new_var));
@@ -707,28 +716,42 @@
 				void (*callback)(void *),
 				void *callback_data)
 {
+	int xres, yres;
 	struct omapfb_plane_struct *plane = fbi->par;
 	struct omapfb_device *fbdev = plane->fbdev;
-	struct fb_var_screeninfo *var;
+	struct fb_var_screeninfo *var = &fbi->var;
 
-	var = &fbi->var;
-	if (win->x >= var->xres || win->y >= var->yres ||
-	    win->out_x > var->xres || win->out_y >= var->yres)
+	switch (var->rotate) {
+	case 0:
+	case 180:
+		xres = fbdev->panel->x_res;
+		yres = fbdev->panel->y_res;
+		break;
+	case 90:
+	case 270:
+		xres = fbdev->panel->y_res;
+		yres = fbdev->panel->x_res;
+		break;
+	default:
+		return -EINVAL;
+	}
+
+	if (win->x >= xres || win->y >= yres ||
+	    win->out_x > xres || win->out_y > yres)
 		return -EINVAL;
 
 	if (!fbdev->ctrl->update_window ||
 	    fbdev->ctrl->get_update_mode() != OMAPFB_MANUAL_UPDATE)
 		return -ENODEV;
 
-	if (win->x + win->width >= var->xres)
-		win->width = var->xres - win->x;
-	if (win->y + win->height >= var->yres)
-		win->height = var->yres - win->y;
-	/* The out sizes should be cropped to the LCD size */
-	if (win->out_x + win->out_width > fbdev->panel->x_res)
-		win->out_width = fbdev->panel->x_res - win->out_x;
-	if (win->out_y + win->out_height > fbdev->panel->y_res)
-		win->out_height = fbdev->panel->y_res - win->out_y;
+	if (win->x + win->width > xres)
+		win->width = xres - win->x;
+	if (win->y + win->height > yres)
+		win->height = yres - win->y;
+	if (win->out_x + win->out_width > xres)
+		win->out_width = xres - win->out_x;
+	if (win->out_y + win->out_height > yres)
+		win->out_height = yres - win->out_y;
 	if (!win->width || !win->height || !win->out_width || !win->out_height)
 		return 0;
 
@@ -1699,8 +1722,8 @@
 
 	pr_info("omapfb: configured for panel %s\n", fbdev->panel->name);
 
-	def_vxres = def_vxres ? : fbdev->panel->x_res;
-	def_vyres = def_vyres ? : fbdev->panel->y_res;
+	def_vxres = def_vxres ? def_vxres : fbdev->panel->x_res;
+	def_vyres = def_vyres ? def_vyres : fbdev->panel->y_res;
 
 	init_state++;
 
@@ -1822,8 +1845,8 @@
 {
 	struct omapfb_device *fbdev = platform_get_drvdata(pdev);
 
-	omapfb_blank(FB_BLANK_POWERDOWN, fbdev->fb_info[0]);
-
+	if (fbdev != NULL)
+		omapfb_blank(FB_BLANK_POWERDOWN, fbdev->fb_info[0]);
 	return 0;
 }
 
@@ -1832,7 +1855,8 @@
 {
 	struct omapfb_device *fbdev = platform_get_drvdata(pdev);
 
-	omapfb_blank(FB_BLANK_UNBLANK, fbdev->fb_info[0]);
+	if (fbdev != NULL)
+		omapfb_blank(FB_BLANK_UNBLANK, fbdev->fb_info[0]);
 	return 0;
 }
 
diff --git a/drivers/video/omap/rfbi.c b/drivers/video/omap/rfbi.c
index 9332d6c..ee01e84 100644
--- a/drivers/video/omap/rfbi.c
+++ b/drivers/video/omap/rfbi.c
@@ -57,6 +57,7 @@
 
 #define DISPC_BASE		0x48050400
 #define DISPC_CONTROL		0x0040
+#define DISPC_IRQ_FRAMEMASK     0x0001
 
 static struct {
 	void __iomem	*base;
@@ -553,7 +554,9 @@
 	l = (0x01 << 2);
 	rfbi_write_reg(RFBI_CONTROL, l);
 
-	if ((r = omap_dispc_request_irq(rfbi_dma_callback, NULL)) < 0) {
+	r = omap_dispc_request_irq(DISPC_IRQ_FRAMEMASK, rfbi_dma_callback,
+				   NULL);
+	if (r < 0) {
 		dev_err(fbdev->dev, "can't get DISPC irq\n");
 		rfbi_enable_clocks(0);
 		return r;
@@ -570,7 +573,7 @@
 
 static void rfbi_cleanup(void)
 {
-	omap_dispc_free_irq();
+	omap_dispc_free_irq(DISPC_IRQ_FRAMEMASK, rfbi_dma_callback, NULL);
 	rfbi_put_clocks();
 	iounmap(rfbi.base);
 }
diff --git a/drivers/video/platinumfb.c b/drivers/video/platinumfb.c
index bacfabd..0a366d8 100644
--- a/drivers/video/platinumfb.c
+++ b/drivers/video/platinumfb.c
@@ -223,10 +223,14 @@
 
 static inline int platinum_vram_reqd(int video_mode, int color_mode)
 {
-	return vmode_attrs[video_mode-1].vres *
-	       (vmode_attrs[video_mode-1].hres * (1<<color_mode) +
-		((video_mode == VMODE_832_624_75) &&
-		 (color_mode > CMODE_8)) ? 0x10 : 0x20) + 0x1000;
+	int baseval = vmode_attrs[video_mode-1].hres * (1<<color_mode);
+
+	if ((video_mode == VMODE_832_624_75) && (color_mode > CMODE_8))
+		baseval += 0x10;
+	else
+		baseval += 0x20;
+
+	return vmode_attrs[video_mode-1].vres * baseval + 0x1000;
 }
 
 #define STORE_D2(a, d) { \
diff --git a/drivers/video/s3c-fb.c b/drivers/video/s3c-fb.c
index 5a72083..adf9632 100644
--- a/drivers/video/s3c-fb.c
+++ b/drivers/video/s3c-fb.c
@@ -1036,7 +1036,7 @@
 
 static struct platform_driver s3c_fb_driver = {
 	.probe		= s3c_fb_probe,
-	.remove		= s3c_fb_remove,
+	.remove		= __devexit_p(s3c_fb_remove),
 	.suspend	= s3c_fb_suspend,
 	.resume		= s3c_fb_resume,
 	.driver		= {
diff --git a/drivers/video/s3c2410fb.c b/drivers/video/s3c2410fb.c
index 5ffca2adc..aac6612 100644
--- a/drivers/video/s3c2410fb.c
+++ b/drivers/video/s3c2410fb.c
@@ -369,7 +369,9 @@
 	void __iomem *regs = fbi->io;
 	int type = fbi->regs.lcdcon1 & S3C2410_LCDCON1_TFT;
 	struct fb_var_screeninfo *var = &info->var;
-	int clkdiv = s3c2410fb_calc_pixclk(fbi, var->pixclock) / 2;
+	int clkdiv;
+
+	clkdiv = DIV_ROUND_UP(s3c2410fb_calc_pixclk(fbi, var->pixclock), 2);
 
 	dprintk("%s: var->xres  = %d\n", __func__, var->xres);
 	dprintk("%s: var->yres  = %d\n", __func__, var->yres);
diff --git a/drivers/video/sis/sis_main.c b/drivers/video/sis/sis_main.c
index 4a067f0..a4e05e4 100644
--- a/drivers/video/sis/sis_main.c
+++ b/drivers/video/sis/sis_main.c
@@ -698,8 +698,8 @@
 						rate, sisfb_vrate[i].refresh);
 					ivideo->rate_idx = sisfb_vrate[i].idx;
 					ivideo->refresh_rate = sisfb_vrate[i].refresh;
-				} else if(((rate - sisfb_vrate[i-1].refresh) <= 2)
-						&& (sisfb_vrate[i].idx != 1)) {
+				} else if((sisfb_vrate[i].idx != 1) &&
+						((rate - sisfb_vrate[i-1].refresh) <= 2)) {
 					DPRINTK("sisfb: Adjusting rate from %d down to %d\n",
 						rate, sisfb_vrate[i-1].refresh);
 					ivideo->rate_idx = sisfb_vrate[i-1].idx;
diff --git a/drivers/video/sis/vstruct.h b/drivers/video/sis/vstruct.h
index 705c8536..bef4aae 100644
--- a/drivers/video/sis/vstruct.h
+++ b/drivers/video/sis/vstruct.h
@@ -342,7 +342,7 @@
 	unsigned short			SiS_RY4COE;
 	unsigned short			SiS_LCDHDES;
 	unsigned short			SiS_LCDVDES;
-	unsigned short			SiS_DDC_Port;
+	SISIOADDRESS			SiS_DDC_Port;
 	unsigned short			SiS_DDC_Index;
 	unsigned short			SiS_DDC_Data;
 	unsigned short			SiS_DDC_NData;
diff --git a/drivers/video/tmiofb.c b/drivers/video/tmiofb.c
index a1eb086..6913fe1 100644
--- a/drivers/video/tmiofb.c
+++ b/drivers/video/tmiofb.c
@@ -974,7 +974,7 @@
 {
 	struct fb_info *info = platform_get_drvdata(dev);
 	struct mfd_cell *cell = dev->dev.platform_data;
-	int retval;
+	int retval = 0;
 
 	acquire_console_sem();
 
diff --git a/drivers/video/via/accel.c b/drivers/video/via/accel.c
index 45c54bf..9d4f3a4 100644
--- a/drivers/video/via/accel.c
+++ b/drivers/video/via/accel.c
@@ -20,229 +20,430 @@
  */
 #include "global.h"
 
-void viafb_init_accel(void)
+static int hw_bitblt_1(void __iomem *engine, u8 op, u32 width, u32 height,
+	u8 dst_bpp, u32 dst_addr, u32 dst_pitch, u32 dst_x, u32 dst_y,
+	u32 *src_mem, u32 src_addr, u32 src_pitch, u32 src_x, u32 src_y,
+	u32 fg_color, u32 bg_color, u8 fill_rop)
 {
-	viaparinfo->fbmem_free -= CURSOR_SIZE;
-	viaparinfo->cursor_start = viaparinfo->fbmem_free;
-	viaparinfo->fbmem_used += CURSOR_SIZE;
+	u32 ge_cmd = 0, tmp, i;
 
-	/* Reverse 8*1024 memory space for cursor image */
-	viaparinfo->fbmem_free -= (CURSOR_SIZE + VQ_SIZE);
-	viaparinfo->VQ_start = viaparinfo->fbmem_free;
-	viaparinfo->VQ_end = viaparinfo->VQ_start + VQ_SIZE - 1;
-	viaparinfo->fbmem_used += (CURSOR_SIZE + VQ_SIZE); }
-
-void viafb_init_2d_engine(void)
-{
-	u32 dwVQStartAddr, dwVQEndAddr;
-	u32 dwVQLen, dwVQStartL, dwVQEndL, dwVQStartEndH;
-
-	/* init 2D engine regs to reset 2D engine */
-	writel(0x0, viaparinfo->io_virt + VIA_REG_GEMODE);
-	writel(0x0, viaparinfo->io_virt + VIA_REG_SRCPOS);
-	writel(0x0, viaparinfo->io_virt + VIA_REG_DSTPOS);
-	writel(0x0, viaparinfo->io_virt + VIA_REG_DIMENSION);
-	writel(0x0, viaparinfo->io_virt + VIA_REG_PATADDR);
-	writel(0x0, viaparinfo->io_virt + VIA_REG_FGCOLOR);
-	writel(0x0, viaparinfo->io_virt + VIA_REG_BGCOLOR);
-	writel(0x0, viaparinfo->io_virt + VIA_REG_CLIPTL);
-	writel(0x0, viaparinfo->io_virt + VIA_REG_CLIPBR);
-	writel(0x0, viaparinfo->io_virt + VIA_REG_OFFSET);
-	writel(0x0, viaparinfo->io_virt + VIA_REG_KEYCONTROL);
-	writel(0x0, viaparinfo->io_virt + VIA_REG_SRCBASE);
-	writel(0x0, viaparinfo->io_virt + VIA_REG_DSTBASE);
-	writel(0x0, viaparinfo->io_virt + VIA_REG_PITCH);
-	writel(0x0, viaparinfo->io_virt + VIA_REG_MONOPAT1);
-
-	/* Init AGP and VQ regs */
-	switch (viaparinfo->chip_info->gfx_chip_name) {
-	case UNICHROME_K8M890:
-	case UNICHROME_P4M900:
-		writel(0x00100000, viaparinfo->io_virt + VIA_REG_CR_TRANSET);
-		writel(0x680A0000, viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
-		writel(0x02000000, viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
-		break;
-
-	default:
-		writel(0x00100000, viaparinfo->io_virt + VIA_REG_TRANSET);
-		writel(0x00000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
-		writel(0x00333004, viaparinfo->io_virt + VIA_REG_TRANSPACE);
-		writel(0x60000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
-		writel(0x61000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
-		writel(0x62000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
-		writel(0x63000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
-		writel(0x64000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
-		writel(0x7D000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
-
-		writel(0xFE020000, viaparinfo->io_virt + VIA_REG_TRANSET);
-		writel(0x00000000, viaparinfo->io_virt + VIA_REG_TRANSPACE);
-		break;
+	if (!op || op > 3) {
+		printk(KERN_WARNING "hw_bitblt_1: Invalid operation: %d\n", op);
+		return -EINVAL;
 	}
-	if (viaparinfo->VQ_start != 0) {
-		/* Enable VQ */
-		dwVQStartAddr = viaparinfo->VQ_start;
-		dwVQEndAddr = viaparinfo->VQ_end;
 
-		dwVQStartL = 0x50000000 | (dwVQStartAddr & 0xFFFFFF);
-		dwVQEndL = 0x51000000 | (dwVQEndAddr & 0xFFFFFF);
-		dwVQStartEndH = 0x52000000 |
-			((dwVQStartAddr & 0xFF000000) >> 24) |
-			((dwVQEndAddr & 0xFF000000) >> 16);
-		dwVQLen = 0x53000000 | (VQ_SIZE >> 3);
-		switch (viaparinfo->chip_info->gfx_chip_name) {
-		case UNICHROME_K8M890:
-		case UNICHROME_P4M900:
-			dwVQStartL |= 0x20000000;
-			dwVQEndL |= 0x20000000;
-			dwVQStartEndH |= 0x20000000;
-			dwVQLen |= 0x20000000;
-			break;
-		default:
-			break;
+	if (op != VIA_BITBLT_FILL && !src_mem && src_addr == dst_addr) {
+		if (src_x < dst_x) {
+			ge_cmd |= 0x00008000;
+			src_x += width - 1;
+			dst_x += width - 1;
 		}
-
-		switch (viaparinfo->chip_info->gfx_chip_name) {
-		case UNICHROME_K8M890:
-		case UNICHROME_P4M900:
-			writel(0x00100000,
-				viaparinfo->io_virt + VIA_REG_CR_TRANSET);
-			writel(dwVQStartEndH,
-				viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
-			writel(dwVQStartL,
-				viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
-			writel(dwVQEndL,
-				viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
-			writel(dwVQLen,
-				viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
-			writel(0x74301001,
-				viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
-			writel(0x00000000,
-				viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
-			break;
-		default:
-			writel(0x00FE0000,
-				viaparinfo->io_virt + VIA_REG_TRANSET);
-			writel(0x080003FE,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			writel(0x0A00027C,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			writel(0x0B000260,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			writel(0x0C000274,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			writel(0x0D000264,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			writel(0x0E000000,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			writel(0x0F000020,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			writel(0x1000027E,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			writel(0x110002FE,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			writel(0x200F0060,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-
-			writel(0x00000006,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			writel(0x40008C0F,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			writel(0x44000000,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			writel(0x45080C04,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			writel(0x46800408,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-
-			writel(dwVQStartEndH,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			writel(dwVQStartL,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			writel(dwVQEndL,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			writel(dwVQLen,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			break;
-		}
-	} else {
-		/* Disable VQ */
-		switch (viaparinfo->chip_info->gfx_chip_name) {
-		case UNICHROME_K8M890:
-		case UNICHROME_P4M900:
-			writel(0x00100000,
-				viaparinfo->io_virt + VIA_REG_CR_TRANSET);
-			writel(0x74301000,
-				viaparinfo->io_virt + VIA_REG_CR_TRANSPACE);
-			break;
-		default:
-			writel(0x00FE0000,
-				viaparinfo->io_virt + VIA_REG_TRANSET);
-			writel(0x00000004,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			writel(0x40008C0F,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			writel(0x44000000,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			writel(0x45080C04,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			writel(0x46800408,
-				viaparinfo->io_virt + VIA_REG_TRANSPACE);
-			break;
+		if (src_y < dst_y) {
+			ge_cmd |= 0x00004000;
+			src_y += height - 1;
+			dst_y += height - 1;
 		}
 	}
 
-	viafb_set_2d_color_depth(viaparinfo->bpp);
+	if (op == VIA_BITBLT_FILL) {
+		switch (fill_rop) {
+		case 0x00: /* blackness */
+		case 0x5A: /* pattern inversion */
+		case 0xF0: /* pattern copy */
+		case 0xFF: /* whiteness */
+			break;
+		default:
+			printk(KERN_WARNING "hw_bitblt_1: Invalid fill rop: "
+				"%u\n", fill_rop);
+			return -EINVAL;
+		}
+	}
 
-	writel(0x0, viaparinfo->io_virt + VIA_REG_SRCBASE);
-	writel(0x0, viaparinfo->io_virt + VIA_REG_DSTBASE);
-
-	writel(VIA_PITCH_ENABLE |
-		   (((viaparinfo->hres *
-		      viaparinfo->bpp >> 3) >> 3) | (((viaparinfo->hres *
-						   viaparinfo->
-						   bpp >> 3) >> 3) << 16)),
-					viaparinfo->io_virt + VIA_REG_PITCH);
-}
-
-void viafb_set_2d_color_depth(int bpp)
-{
-	u32 dwGEMode;
-
-	dwGEMode = readl(viaparinfo->io_virt + 0x04) & 0xFFFFFCFF;
-
-	switch (bpp) {
+	switch (dst_bpp) {
+	case 8:
+		tmp = 0x00000000;
+		break;
 	case 16:
-		dwGEMode |= VIA_GEM_16bpp;
+		tmp = 0x00000100;
 		break;
 	case 32:
-		dwGEMode |= VIA_GEM_32bpp;
+		tmp = 0x00000300;
 		break;
 	default:
-		dwGEMode |= VIA_GEM_8bpp;
+		printk(KERN_WARNING "hw_bitblt_1: Unsupported bpp %d\n",
+			dst_bpp);
+		return -EINVAL;
+	}
+	writel(tmp, engine + 0x04);
+
+	if (op != VIA_BITBLT_FILL) {
+		if (src_x & (op == VIA_BITBLT_MONO ? 0xFFFF8000 : 0xFFFFF000)
+			|| src_y & 0xFFFFF000) {
+			printk(KERN_WARNING "hw_bitblt_1: Unsupported source "
+				"x/y %d %d\n", src_x, src_y);
+			return -EINVAL;
+		}
+		tmp = src_x | (src_y << 16);
+		writel(tmp, engine + 0x08);
+	}
+
+	if (dst_x & 0xFFFFF000 || dst_y & 0xFFFFF000) {
+		printk(KERN_WARNING "hw_bitblt_1: Unsupported destination x/y "
+			"%d %d\n", dst_x, dst_y);
+		return -EINVAL;
+	}
+	tmp = dst_x | (dst_y << 16);
+	writel(tmp, engine + 0x0C);
+
+	if ((width - 1) & 0xFFFFF000 || (height - 1) & 0xFFFFF000) {
+		printk(KERN_WARNING "hw_bitblt_1: Unsupported width/height "
+			"%d %d\n", width, height);
+		return -EINVAL;
+	}
+	tmp = (width - 1) | ((height - 1) << 16);
+	writel(tmp, engine + 0x10);
+
+	if (op != VIA_BITBLT_COLOR)
+		writel(fg_color, engine + 0x18);
+
+	if (op == VIA_BITBLT_MONO)
+		writel(bg_color, engine + 0x1C);
+
+	if (op != VIA_BITBLT_FILL) {
+		tmp = src_mem ? 0 : src_addr;
+		if (dst_addr & 0xE0000007) {
+			printk(KERN_WARNING "hw_bitblt_1: Unsupported source "
+				"address %X\n", tmp);
+			return -EINVAL;
+		}
+		tmp >>= 3;
+		writel(tmp, engine + 0x30);
+	}
+
+	if (dst_addr & 0xE0000007) {
+		printk(KERN_WARNING "hw_bitblt_1: Unsupported destination "
+			"address %X\n", dst_addr);
+		return -EINVAL;
+	}
+	tmp = dst_addr >> 3;
+	writel(tmp, engine + 0x34);
+
+	if (op == VIA_BITBLT_FILL)
+		tmp = 0;
+	else
+		tmp = src_pitch;
+	if (tmp & 0xFFFFC007 || dst_pitch & 0xFFFFC007) {
+		printk(KERN_WARNING "hw_bitblt_1: Unsupported pitch %X %X\n",
+			tmp, dst_pitch);
+		return -EINVAL;
+	}
+	tmp = (tmp >> 3) | (dst_pitch << (16 - 3));
+	writel(tmp, engine + 0x38);
+
+	if (op == VIA_BITBLT_FILL)
+		ge_cmd |= fill_rop << 24 | 0x00002000 | 0x00000001;
+	else {
+		ge_cmd |= 0xCC000000; /* ROP=SRCCOPY */
+		if (src_mem)
+			ge_cmd |= 0x00000040;
+		if (op == VIA_BITBLT_MONO)
+			ge_cmd |= 0x00000002 | 0x00000100 | 0x00020000;
+		else
+			ge_cmd |= 0x00000001;
+	}
+	writel(ge_cmd, engine);
+
+	if (op == VIA_BITBLT_FILL || !src_mem)
+		return 0;
+
+	tmp = (width * height * (op == VIA_BITBLT_MONO ? 1 : (dst_bpp >> 3)) +
+		3) >> 2;
+
+	for (i = 0; i < tmp; i++)
+		writel(src_mem[i], engine + VIA_MMIO_BLTBASE);
+
+	return 0;
+}
+
+static int hw_bitblt_2(void __iomem *engine, u8 op, u32 width, u32 height,
+	u8 dst_bpp, u32 dst_addr, u32 dst_pitch, u32 dst_x, u32 dst_y,
+	u32 *src_mem, u32 src_addr, u32 src_pitch, u32 src_x, u32 src_y,
+	u32 fg_color, u32 bg_color, u8 fill_rop)
+{
+	u32 ge_cmd = 0, tmp, i;
+
+	if (!op || op > 3) {
+		printk(KERN_WARNING "hw_bitblt_2: Invalid operation: %d\n", op);
+		return -EINVAL;
+	}
+
+	if (op != VIA_BITBLT_FILL && !src_mem && src_addr == dst_addr) {
+		if (src_x < dst_x) {
+			ge_cmd |= 0x00008000;
+			src_x += width - 1;
+			dst_x += width - 1;
+		}
+		if (src_y < dst_y) {
+			ge_cmd |= 0x00004000;
+			src_y += height - 1;
+			dst_y += height - 1;
+		}
+	}
+
+	if (op == VIA_BITBLT_FILL) {
+		switch (fill_rop) {
+		case 0x00: /* blackness */
+		case 0x5A: /* pattern inversion */
+		case 0xF0: /* pattern copy */
+		case 0xFF: /* whiteness */
+			break;
+		default:
+			printk(KERN_WARNING "hw_bitblt_2: Invalid fill rop: "
+				"%u\n", fill_rop);
+			return -EINVAL;
+		}
+	}
+
+	switch (dst_bpp) {
+	case 8:
+		tmp = 0x00000000;
+		break;
+	case 16:
+		tmp = 0x00000100;
+		break;
+	case 32:
+		tmp = 0x00000300;
+		break;
+	default:
+		printk(KERN_WARNING "hw_bitblt_2: Unsupported bpp %d\n",
+			dst_bpp);
+		return -EINVAL;
+	}
+	writel(tmp, engine + 0x04);
+
+	if (op == VIA_BITBLT_FILL)
+		tmp = 0;
+	else
+		tmp = src_pitch;
+	if (tmp & 0xFFFFC007 || dst_pitch & 0xFFFFC007) {
+		printk(KERN_WARNING "hw_bitblt_2: Unsupported pitch %X %X\n",
+			tmp, dst_pitch);
+		return -EINVAL;
+	}
+	tmp = (tmp >> 3) | (dst_pitch << (16 - 3));
+	writel(tmp, engine + 0x08);
+
+	if ((width - 1) & 0xFFFFF000 || (height - 1) & 0xFFFFF000) {
+		printk(KERN_WARNING "hw_bitblt_2: Unsupported width/height "
+			"%d %d\n", width, height);
+		return -EINVAL;
+	}
+	tmp = (width - 1) | ((height - 1) << 16);
+	writel(tmp, engine + 0x0C);
+
+	if (dst_x & 0xFFFFF000 || dst_y & 0xFFFFF000) {
+		printk(KERN_WARNING "hw_bitblt_2: Unsupported destination x/y "
+			"%d %d\n", dst_x, dst_y);
+		return -EINVAL;
+	}
+	tmp = dst_x | (dst_y << 16);
+	writel(tmp, engine + 0x10);
+
+	if (dst_addr & 0xE0000007) {
+		printk(KERN_WARNING "hw_bitblt_2: Unsupported destination "
+			"address %X\n", dst_addr);
+		return -EINVAL;
+	}
+	tmp = dst_addr >> 3;
+	writel(tmp, engine + 0x14);
+
+	if (op != VIA_BITBLT_FILL) {
+		if (src_x & (op == VIA_BITBLT_MONO ? 0xFFFF8000 : 0xFFFFF000)
+			|| src_y & 0xFFFFF000) {
+			printk(KERN_WARNING "hw_bitblt_2: Unsupported source "
+				"x/y %d %d\n", src_x, src_y);
+			return -EINVAL;
+		}
+		tmp = src_x | (src_y << 16);
+		writel(tmp, engine + 0x18);
+
+		tmp = src_mem ? 0 : src_addr;
+		if (dst_addr & 0xE0000007) {
+			printk(KERN_WARNING "hw_bitblt_2: Unsupported source "
+				"address %X\n", tmp);
+			return -EINVAL;
+		}
+		tmp >>= 3;
+		writel(tmp, engine + 0x1C);
+	}
+
+	if (op != VIA_BITBLT_COLOR)
+		writel(fg_color, engine + 0x4C);
+
+	if (op == VIA_BITBLT_MONO)
+		writel(bg_color, engine + 0x50);
+
+	if (op == VIA_BITBLT_FILL)
+		ge_cmd |= fill_rop << 24 | 0x00002000 | 0x00000001;
+	else {
+		ge_cmd |= 0xCC000000; /* ROP=SRCCOPY */
+		if (src_mem)
+			ge_cmd |= 0x00000040;
+		if (op == VIA_BITBLT_MONO)
+			ge_cmd |= 0x00000002 | 0x00000100 | 0x00020000;
+		else
+			ge_cmd |= 0x00000001;
+	}
+	writel(ge_cmd, engine);
+
+	if (op == VIA_BITBLT_FILL || !src_mem)
+		return 0;
+
+	tmp = (width * height * (op == VIA_BITBLT_MONO ? 1 : (dst_bpp >> 3)) +
+		3) >> 2;
+
+	for (i = 0; i < tmp; i++)
+		writel(src_mem[i], engine + VIA_MMIO_BLTBASE);
+
+	return 0;
+}
+
+int viafb_init_engine(struct fb_info *info)
+{
+	struct viafb_par *viapar = info->par;
+	void __iomem *engine;
+	u32 vq_start_addr, vq_end_addr, vq_start_low, vq_end_low, vq_high,
+		vq_len, chip_name = viapar->shared->chip_info.gfx_chip_name;
+
+	engine = ioremap_nocache(info->fix.mmio_start, info->fix.mmio_len);
+	viapar->shared->engine_mmio = engine;
+	if (!engine) {
+		printk(KERN_WARNING "viafb_init_accel: ioremap failed, "
+			"hardware acceleration disabled\n");
+		return -ENOMEM;
+	}
+
+	switch (chip_name) {
+	case UNICHROME_CLE266:
+	case UNICHROME_K400:
+	case UNICHROME_K800:
+	case UNICHROME_PM800:
+	case UNICHROME_CN700:
+	case UNICHROME_CX700:
+	case UNICHROME_CN750:
+	case UNICHROME_K8M890:
+	case UNICHROME_P4M890:
+	case UNICHROME_P4M900:
+		viapar->shared->hw_bitblt = hw_bitblt_1;
+		break;
+	case UNICHROME_VX800:
+	case UNICHROME_VX855:
+		viapar->shared->hw_bitblt = hw_bitblt_2;
+		break;
+	default:
+		viapar->shared->hw_bitblt = NULL;
+	}
+
+	viapar->fbmem_free -= CURSOR_SIZE;
+	viapar->shared->cursor_vram_addr = viapar->fbmem_free;
+	viapar->fbmem_used += CURSOR_SIZE;
+
+	viapar->fbmem_free -= VQ_SIZE;
+	viapar->shared->vq_vram_addr = viapar->fbmem_free;
+	viapar->fbmem_used += VQ_SIZE;
+
+	/* Init AGP and VQ regs */
+	switch (chip_name) {
+	case UNICHROME_K8M890:
+	case UNICHROME_P4M900:
+		writel(0x00100000, engine + VIA_REG_CR_TRANSET);
+		writel(0x680A0000, engine + VIA_REG_CR_TRANSPACE);
+		writel(0x02000000, engine + VIA_REG_CR_TRANSPACE);
+		break;
+
+	default:
+		writel(0x00100000, engine + VIA_REG_TRANSET);
+		writel(0x00000000, engine + VIA_REG_TRANSPACE);
+		writel(0x00333004, engine + VIA_REG_TRANSPACE);
+		writel(0x60000000, engine + VIA_REG_TRANSPACE);
+		writel(0x61000000, engine + VIA_REG_TRANSPACE);
+		writel(0x62000000, engine + VIA_REG_TRANSPACE);
+		writel(0x63000000, engine + VIA_REG_TRANSPACE);
+		writel(0x64000000, engine + VIA_REG_TRANSPACE);
+		writel(0x7D000000, engine + VIA_REG_TRANSPACE);
+
+		writel(0xFE020000, engine + VIA_REG_TRANSET);
+		writel(0x00000000, engine + VIA_REG_TRANSPACE);
 		break;
 	}
 
-	/* Set BPP and Pitch */
-	writel(dwGEMode, viaparinfo->io_virt + VIA_REG_GEMODE);
-}
+	/* Enable VQ */
+	vq_start_addr = viapar->shared->vq_vram_addr;
+	vq_end_addr = viapar->shared->vq_vram_addr + VQ_SIZE - 1;
 
-void viafb_hw_cursor_init(void)
-{
+	vq_start_low = 0x50000000 | (vq_start_addr & 0xFFFFFF);
+	vq_end_low = 0x51000000 | (vq_end_addr & 0xFFFFFF);
+	vq_high = 0x52000000 | ((vq_start_addr & 0xFF000000) >> 24) |
+		((vq_end_addr & 0xFF000000) >> 16);
+	vq_len = 0x53000000 | (VQ_SIZE >> 3);
+
+	switch (chip_name) {
+	case UNICHROME_K8M890:
+	case UNICHROME_P4M900:
+		vq_start_low |= 0x20000000;
+		vq_end_low |= 0x20000000;
+		vq_high |= 0x20000000;
+		vq_len |= 0x20000000;
+
+		writel(0x00100000, engine + VIA_REG_CR_TRANSET);
+		writel(vq_high, engine + VIA_REG_CR_TRANSPACE);
+		writel(vq_start_low, engine + VIA_REG_CR_TRANSPACE);
+		writel(vq_end_low, engine + VIA_REG_CR_TRANSPACE);
+		writel(vq_len, engine + VIA_REG_CR_TRANSPACE);
+		writel(0x74301001, engine + VIA_REG_CR_TRANSPACE);
+		writel(0x00000000, engine + VIA_REG_CR_TRANSPACE);
+		break;
+	default:
+		writel(0x00FE0000, engine + VIA_REG_TRANSET);
+		writel(0x080003FE, engine + VIA_REG_TRANSPACE);
+		writel(0x0A00027C, engine + VIA_REG_TRANSPACE);
+		writel(0x0B000260, engine + VIA_REG_TRANSPACE);
+		writel(0x0C000274, engine + VIA_REG_TRANSPACE);
+		writel(0x0D000264, engine + VIA_REG_TRANSPACE);
+		writel(0x0E000000, engine + VIA_REG_TRANSPACE);
+		writel(0x0F000020, engine + VIA_REG_TRANSPACE);
+		writel(0x1000027E, engine + VIA_REG_TRANSPACE);
+		writel(0x110002FE, engine + VIA_REG_TRANSPACE);
+		writel(0x200F0060, engine + VIA_REG_TRANSPACE);
+
+		writel(0x00000006, engine + VIA_REG_TRANSPACE);
+		writel(0x40008C0F, engine + VIA_REG_TRANSPACE);
+		writel(0x44000000, engine + VIA_REG_TRANSPACE);
+		writel(0x45080C04, engine + VIA_REG_TRANSPACE);
+		writel(0x46800408, engine + VIA_REG_TRANSPACE);
+
+		writel(vq_high, engine + VIA_REG_TRANSPACE);
+		writel(vq_start_low, engine + VIA_REG_TRANSPACE);
+		writel(vq_end_low, engine + VIA_REG_TRANSPACE);
+		writel(vq_len, engine + VIA_REG_TRANSPACE);
+		break;
+	}
+
 	/* Set Cursor Image Base Address */
-	writel(viaparinfo->cursor_start,
-		viaparinfo->io_virt + VIA_REG_CURSOR_MODE);
-	writel(0x0, viaparinfo->io_virt + VIA_REG_CURSOR_POS);
-	writel(0x0, viaparinfo->io_virt + VIA_REG_CURSOR_ORG);
-	writel(0x0, viaparinfo->io_virt + VIA_REG_CURSOR_BG);
-	writel(0x0, viaparinfo->io_virt + VIA_REG_CURSOR_FG);
+	writel(viapar->shared->cursor_vram_addr, engine + VIA_REG_CURSOR_MODE);
+	writel(0x0, engine + VIA_REG_CURSOR_POS);
+	writel(0x0, engine + VIA_REG_CURSOR_ORG);
+	writel(0x0, engine + VIA_REG_CURSOR_BG);
+	writel(0x0, engine + VIA_REG_CURSOR_FG);
+	return 0;
 }
 
 void viafb_show_hw_cursor(struct fb_info *info, int Status)
 {
-	u32 temp;
-	u32 iga_path = ((struct viafb_par *)(info->par))->iga_path;
+	struct viafb_par *viapar = info->par;
+	u32 temp, iga_path = viapar->iga_path;
 
-	temp = readl(viaparinfo->io_virt + VIA_REG_CURSOR_MODE);
+	temp = readl(viapar->shared->engine_mmio + VIA_REG_CURSOR_MODE);
 	switch (Status) {
 	case HW_Cursor_ON:
 		temp |= 0x1;
@@ -259,25 +460,27 @@
 	default:
 		temp &= 0x7FFFFFFF;
 	}
-	writel(temp, viaparinfo->io_virt + VIA_REG_CURSOR_MODE);
+	writel(temp, viapar->shared->engine_mmio + VIA_REG_CURSOR_MODE);
 }
 
-int viafb_wait_engine_idle(void)
+void viafb_wait_engine_idle(struct fb_info *info)
 {
+	struct viafb_par *viapar = info->par;
 	int loop = 0;
 
-	while (!(readl(viaparinfo->io_virt + VIA_REG_STATUS) &
+	while (!(readl(viapar->shared->engine_mmio + VIA_REG_STATUS) &
 			VIA_VR_QUEUE_BUSY) && (loop < MAXLOOP)) {
 		loop++;
 		cpu_relax();
 	}
 
-	while ((readl(viaparinfo->io_virt + VIA_REG_STATUS) &
+	while ((readl(viapar->shared->engine_mmio + VIA_REG_STATUS) &
 		    (VIA_CMD_RGTR_BUSY | VIA_2D_ENG_BUSY | VIA_3D_ENG_BUSY)) &&
 		    (loop < MAXLOOP)) {
 		loop++;
 		cpu_relax();
 	}
 
-	return loop >= MAXLOOP;
+	if (loop >= MAXLOOP)
+		printk(KERN_ERR "viafb_wait_engine_idle: not syncing\n");
 }
diff --git a/drivers/video/via/accel.h b/drivers/video/via/accel.h
index 29bf854..615c84a 100644
--- a/drivers/video/via/accel.h
+++ b/drivers/video/via/accel.h
@@ -159,11 +159,12 @@
 
 #define MAXLOOP                 0xFFFFFF
 
-void viafb_init_accel(void);
-void viafb_init_2d_engine(void);
-void set_2d_color_depth(int);
-void viafb_hw_cursor_init(void);
-void viafb_show_hw_cursor(struct fb_info *info, int Status); int
-viafb_wait_engine_idle(void); void viafb_set_2d_color_depth(int bpp);
+#define VIA_BITBLT_COLOR	1
+#define VIA_BITBLT_MONO		2
+#define VIA_BITBLT_FILL		3
+
+int viafb_init_engine(struct fb_info *info);
+void viafb_show_hw_cursor(struct fb_info *info, int Status);
+void viafb_wait_engine_idle(struct fb_info *info);
 
 #endif /* __ACCEL_H__ */
diff --git a/drivers/video/via/chip.h b/drivers/video/via/chip.h
index dde95ed..474f428 100644
--- a/drivers/video/via/chip.h
+++ b/drivers/video/via/chip.h
@@ -68,6 +68,9 @@
 #define     UNICHROME_VX800         11
 #define     UNICHROME_VX800_DID     0x1122
 
+#define     UNICHROME_VX855         12
+#define     UNICHROME_VX855_DID     0x5122
+
 /**************************************************/
 /* Definition TMDS Trasmitter Information         */
 /**************************************************/
@@ -122,7 +125,6 @@
 struct chip_information {
 	int gfx_chip_name;
 	int gfx_chip_revision;
-	int chip_on_slot;
 	struct tmds_chip_information tmds_chip_info;
 	struct lvds_chip_information lvds_chip_info;
 	struct lvds_chip_information lvds_chip_info2;
diff --git a/drivers/video/via/dvi.c b/drivers/video/via/dvi.c
index d696544..c5c32b6 100644
--- a/drivers/video/via/dvi.c
+++ b/drivers/video/via/dvi.c
@@ -160,7 +160,7 @@
 
 static void tmds_register_write(int index, u8 data)
 {
-	viaparinfo->i2c_stuff.i2c_port =
+	viaparinfo->shared->i2c_stuff.i2c_port =
 		viaparinfo->chip_info->tmds_chip_info.i2c_port;
 
 	viafb_i2c_writebyte(viaparinfo->chip_info->tmds_chip_info.
@@ -172,7 +172,7 @@
 {
 	u8 data;
 
-	viaparinfo->i2c_stuff.i2c_port =
+	viaparinfo->shared->i2c_stuff.i2c_port =
 		viaparinfo->chip_info->tmds_chip_info.i2c_port;
 	viafb_i2c_readbyte((u8) viaparinfo->chip_info->
 	    tmds_chip_info.tmds_chip_slave_addr,
@@ -182,7 +182,7 @@
 
 static int tmds_register_read_bytes(int index, u8 *buff, int buff_len)
 {
-	viaparinfo->i2c_stuff.i2c_port =
+	viaparinfo->shared->i2c_stuff.i2c_port =
 		viaparinfo->chip_info->tmds_chip_info.i2c_port;
 	viafb_i2c_readbytes((u8) viaparinfo->chip_info->tmds_chip_info.
 			 tmds_chip_slave_addr, (u8) index, buff, buff_len);
diff --git a/drivers/video/via/global.c b/drivers/video/via/global.c
index 468be2425..b675cdb 100644
--- a/drivers/video/via/global.c
+++ b/drivers/video/via/global.c
@@ -32,7 +32,6 @@
 int viafb_lcd_mode = LCD_OPENLDI;
 int viafb_bpp = 32;
 int viafb_bpp1 = 32;
-int viafb_accel = 1;
 int viafb_CRT_ON = 1;
 int viafb_DVI_ON;
 int viafb_LCD_ON ;
@@ -46,13 +45,11 @@
 unsigned int viafb_second_offset;
 int viafb_second_size;
 int viafb_primary_dev = None_Device;
-void __iomem *viafb_FB_MM;
 unsigned int viafb_second_xres = 640;
 unsigned int viafb_second_yres = 480;
 unsigned int viafb_second_virtual_xres;
 unsigned int viafb_second_virtual_yres;
 int viafb_lcd_panel_id = LCD_PANEL_ID_MAXIMUM + 1;
-struct fb_cursor viacursor;
 struct fb_info *viafbinfo;
 struct fb_info *viafbinfo1;
 struct viafb_par *viaparinfo;
diff --git a/drivers/video/via/global.h b/drivers/video/via/global.h
index 7543d5f..d69d0ca 100644
--- a/drivers/video/via/global.h
+++ b/drivers/video/via/global.h
@@ -77,8 +77,6 @@
 extern int viafb_hotplug_bpp;
 extern int viafb_hotplug_refresh;
 extern int viafb_primary_dev;
-extern void __iomem *viafb_FB_MM;
-extern struct fb_cursor viacursor;
 
 extern unsigned int viafb_second_xres;
 extern unsigned int viafb_second_yres;
diff --git a/drivers/video/via/hw.c b/drivers/video/via/hw.c
index c896000..3e083ff 100644
--- a/drivers/video/via/hw.c
+++ b/drivers/video/via/hw.c
@@ -21,125 +21,143 @@
 
 #include "global.h"
 
-static const struct pci_device_id_info pciidlist[] = {
-	{PCI_VIA_VENDOR_ID, UNICHROME_CLE266_DID, UNICHROME_CLE266},
-	{PCI_VIA_VENDOR_ID, UNICHROME_PM800_DID, UNICHROME_PM800},
-	{PCI_VIA_VENDOR_ID, UNICHROME_K400_DID, UNICHROME_K400},
-	{PCI_VIA_VENDOR_ID, UNICHROME_K800_DID, UNICHROME_K800},
-	{PCI_VIA_VENDOR_ID, UNICHROME_CN700_DID, UNICHROME_CN700},
-	{PCI_VIA_VENDOR_ID, UNICHROME_P4M890_DID, UNICHROME_P4M890},
-	{PCI_VIA_VENDOR_ID, UNICHROME_K8M890_DID, UNICHROME_K8M890},
-	{PCI_VIA_VENDOR_ID, UNICHROME_CX700_DID, UNICHROME_CX700},
-	{PCI_VIA_VENDOR_ID, UNICHROME_P4M900_DID, UNICHROME_P4M900},
-	{PCI_VIA_VENDOR_ID, UNICHROME_CN750_DID, UNICHROME_CN750},
-	{PCI_VIA_VENDOR_ID, UNICHROME_VX800_DID, UNICHROME_VX800},
-	{0, 0, 0}
-};
-
-struct offset offset_reg = {
-	/* IGA1 Offset Register */
-	{IGA1_OFFSET_REG_NUM, {{CR13, 0, 7}, {CR35, 5, 7} } },
-	/* IGA2 Offset Register */
-	{IGA2_OFFSET_REG_NUM, {{CR66, 0, 7}, {CR67, 0, 1} } }
-};
-
 static struct pll_map pll_value[] = {
-	{CLK_25_175M, CLE266_PLL_25_175M, K800_PLL_25_175M, CX700_25_175M},
-	{CLK_29_581M, CLE266_PLL_29_581M, K800_PLL_29_581M, CX700_29_581M},
-	{CLK_26_880M, CLE266_PLL_26_880M, K800_PLL_26_880M, CX700_26_880M},
-	{CLK_31_490M, CLE266_PLL_31_490M, K800_PLL_31_490M, CX700_31_490M},
-	{CLK_31_500M, CLE266_PLL_31_500M, K800_PLL_31_500M, CX700_31_500M},
-	{CLK_31_728M, CLE266_PLL_31_728M, K800_PLL_31_728M, CX700_31_728M},
-	{CLK_32_668M, CLE266_PLL_32_668M, K800_PLL_32_668M, CX700_32_668M},
-	{CLK_36_000M, CLE266_PLL_36_000M, K800_PLL_36_000M, CX700_36_000M},
-	{CLK_40_000M, CLE266_PLL_40_000M, K800_PLL_40_000M, CX700_40_000M},
-	{CLK_41_291M, CLE266_PLL_41_291M, K800_PLL_41_291M, CX700_41_291M},
-	{CLK_43_163M, CLE266_PLL_43_163M, K800_PLL_43_163M, CX700_43_163M},
-	{CLK_45_250M, CLE266_PLL_45_250M, K800_PLL_45_250M, CX700_45_250M},
-	{CLK_46_000M, CLE266_PLL_46_000M, K800_PLL_46_000M, CX700_46_000M},
-	{CLK_46_996M, CLE266_PLL_46_996M, K800_PLL_46_996M, CX700_46_996M},
-	{CLK_48_000M, CLE266_PLL_48_000M, K800_PLL_48_000M, CX700_48_000M},
-	{CLK_48_875M, CLE266_PLL_48_875M, K800_PLL_48_875M, CX700_48_875M},
-	{CLK_49_500M, CLE266_PLL_49_500M, K800_PLL_49_500M, CX700_49_500M},
-	{CLK_52_406M, CLE266_PLL_52_406M, K800_PLL_52_406M, CX700_52_406M},
-	{CLK_52_977M, CLE266_PLL_52_977M, K800_PLL_52_977M, CX700_52_977M},
-	{CLK_56_250M, CLE266_PLL_56_250M, K800_PLL_56_250M, CX700_56_250M},
-	{CLK_60_466M, CLE266_PLL_60_466M, K800_PLL_60_466M, CX700_60_466M},
-	{CLK_61_500M, CLE266_PLL_61_500M, K800_PLL_61_500M, CX700_61_500M},
-	{CLK_65_000M, CLE266_PLL_65_000M, K800_PLL_65_000M, CX700_65_000M},
-	{CLK_65_178M, CLE266_PLL_65_178M, K800_PLL_65_178M, CX700_65_178M},
-	{CLK_66_750M, CLE266_PLL_66_750M, K800_PLL_66_750M, CX700_66_750M},
-	{CLK_68_179M, CLE266_PLL_68_179M, K800_PLL_68_179M, CX700_68_179M},
-	{CLK_69_924M, CLE266_PLL_69_924M, K800_PLL_69_924M, CX700_69_924M},
-	{CLK_70_159M, CLE266_PLL_70_159M, K800_PLL_70_159M, CX700_70_159M},
-	{CLK_72_000M, CLE266_PLL_72_000M, K800_PLL_72_000M, CX700_72_000M},
-	{CLK_78_750M, CLE266_PLL_78_750M, K800_PLL_78_750M, CX700_78_750M},
-	{CLK_80_136M, CLE266_PLL_80_136M, K800_PLL_80_136M, CX700_80_136M},
-	{CLK_83_375M, CLE266_PLL_83_375M, K800_PLL_83_375M, CX700_83_375M},
-	{CLK_83_950M, CLE266_PLL_83_950M, K800_PLL_83_950M, CX700_83_950M},
-	{CLK_84_750M, CLE266_PLL_84_750M, K800_PLL_84_750M, CX700_84_750M},
-	{CLK_85_860M, CLE266_PLL_85_860M, K800_PLL_85_860M, CX700_85_860M},
-	{CLK_88_750M, CLE266_PLL_88_750M, K800_PLL_88_750M, CX700_88_750M},
-	{CLK_94_500M, CLE266_PLL_94_500M, K800_PLL_94_500M, CX700_94_500M},
-	{CLK_97_750M, CLE266_PLL_97_750M, K800_PLL_97_750M, CX700_97_750M},
+	{CLK_25_175M, CLE266_PLL_25_175M, K800_PLL_25_175M,
+	 CX700_25_175M, VX855_25_175M},
+	{CLK_29_581M, CLE266_PLL_29_581M, K800_PLL_29_581M,
+	 CX700_29_581M, VX855_29_581M},
+	{CLK_26_880M, CLE266_PLL_26_880M, K800_PLL_26_880M,
+	 CX700_26_880M, VX855_26_880M},
+	{CLK_31_490M, CLE266_PLL_31_490M, K800_PLL_31_490M,
+	 CX700_31_490M, VX855_31_490M},
+	{CLK_31_500M, CLE266_PLL_31_500M, K800_PLL_31_500M,
+	 CX700_31_500M, VX855_31_500M},
+	{CLK_31_728M, CLE266_PLL_31_728M, K800_PLL_31_728M,
+	 CX700_31_728M, VX855_31_728M},
+	{CLK_32_668M, CLE266_PLL_32_668M, K800_PLL_32_668M,
+	 CX700_32_668M, VX855_32_668M},
+	{CLK_36_000M, CLE266_PLL_36_000M, K800_PLL_36_000M,
+	 CX700_36_000M, VX855_36_000M},
+	{CLK_40_000M, CLE266_PLL_40_000M, K800_PLL_40_000M,
+	 CX700_40_000M, VX855_40_000M},
+	{CLK_41_291M, CLE266_PLL_41_291M, K800_PLL_41_291M,
+	 CX700_41_291M, VX855_41_291M},
+	{CLK_43_163M, CLE266_PLL_43_163M, K800_PLL_43_163M,
+	 CX700_43_163M, VX855_43_163M},
+	{CLK_45_250M, CLE266_PLL_45_250M, K800_PLL_45_250M,
+	 CX700_45_250M, VX855_45_250M},
+	{CLK_46_000M, CLE266_PLL_46_000M, K800_PLL_46_000M,
+	 CX700_46_000M, VX855_46_000M},
+	{CLK_46_996M, CLE266_PLL_46_996M, K800_PLL_46_996M,
+	 CX700_46_996M, VX855_46_996M},
+	{CLK_48_000M, CLE266_PLL_48_000M, K800_PLL_48_000M,
+	 CX700_48_000M, VX855_48_000M},
+	{CLK_48_875M, CLE266_PLL_48_875M, K800_PLL_48_875M,
+	 CX700_48_875M, VX855_48_875M},
+	{CLK_49_500M, CLE266_PLL_49_500M, K800_PLL_49_500M,
+	 CX700_49_500M, VX855_49_500M},
+	{CLK_52_406M, CLE266_PLL_52_406M, K800_PLL_52_406M,
+	 CX700_52_406M, VX855_52_406M},
+	{CLK_52_977M, CLE266_PLL_52_977M, K800_PLL_52_977M,
+	 CX700_52_977M,	VX855_52_977M},
+	{CLK_56_250M, CLE266_PLL_56_250M, K800_PLL_56_250M,
+	 CX700_56_250M, VX855_56_250M},
+	{CLK_60_466M, CLE266_PLL_60_466M, K800_PLL_60_466M,
+	 CX700_60_466M, VX855_60_466M},
+	{CLK_61_500M, CLE266_PLL_61_500M, K800_PLL_61_500M,
+	 CX700_61_500M, VX855_61_500M},
+	{CLK_65_000M, CLE266_PLL_65_000M, K800_PLL_65_000M,
+	 CX700_65_000M, VX855_65_000M},
+	{CLK_65_178M, CLE266_PLL_65_178M, K800_PLL_65_178M,
+	 CX700_65_178M, VX855_65_178M},
+	{CLK_66_750M, CLE266_PLL_66_750M, K800_PLL_66_750M,
+	 CX700_66_750M, VX855_66_750M},
+	{CLK_68_179M, CLE266_PLL_68_179M, K800_PLL_68_179M,
+	 CX700_68_179M, VX855_68_179M},
+	{CLK_69_924M, CLE266_PLL_69_924M, K800_PLL_69_924M,
+	 CX700_69_924M, VX855_69_924M},
+	{CLK_70_159M, CLE266_PLL_70_159M, K800_PLL_70_159M,
+	 CX700_70_159M, VX855_70_159M},
+	{CLK_72_000M, CLE266_PLL_72_000M, K800_PLL_72_000M,
+	 CX700_72_000M, VX855_72_000M},
+	{CLK_78_750M, CLE266_PLL_78_750M, K800_PLL_78_750M,
+	 CX700_78_750M, VX855_78_750M},
+	{CLK_80_136M, CLE266_PLL_80_136M, K800_PLL_80_136M,
+	 CX700_80_136M, VX855_80_136M},
+	{CLK_83_375M, CLE266_PLL_83_375M, K800_PLL_83_375M,
+	 CX700_83_375M, VX855_83_375M},
+	{CLK_83_950M, CLE266_PLL_83_950M, K800_PLL_83_950M,
+	 CX700_83_950M, VX855_83_950M},
+	{CLK_84_750M, CLE266_PLL_84_750M, K800_PLL_84_750M,
+	 CX700_84_750M, VX855_84_750M},
+	{CLK_85_860M, CLE266_PLL_85_860M, K800_PLL_85_860M,
+	 CX700_85_860M, VX855_85_860M},
+	{CLK_88_750M, CLE266_PLL_88_750M, K800_PLL_88_750M,
+	 CX700_88_750M, VX855_88_750M},
+	{CLK_94_500M, CLE266_PLL_94_500M, K800_PLL_94_500M,
+	 CX700_94_500M, VX855_94_500M},
+	{CLK_97_750M, CLE266_PLL_97_750M, K800_PLL_97_750M,
+	 CX700_97_750M, VX855_97_750M},
 	{CLK_101_000M, CLE266_PLL_101_000M, K800_PLL_101_000M,
-	 CX700_101_000M},
+	 CX700_101_000M, VX855_101_000M},
 	{CLK_106_500M, CLE266_PLL_106_500M, K800_PLL_106_500M,
-	 CX700_106_500M},
+	 CX700_106_500M, VX855_106_500M},
 	{CLK_108_000M, CLE266_PLL_108_000M, K800_PLL_108_000M,
-	 CX700_108_000M},
+	 CX700_108_000M, VX855_108_000M},
 	{CLK_113_309M, CLE266_PLL_113_309M, K800_PLL_113_309M,
-	 CX700_113_309M},
+	 CX700_113_309M, VX855_113_309M},
 	{CLK_118_840M, CLE266_PLL_118_840M, K800_PLL_118_840M,
-	 CX700_118_840M},
+	 CX700_118_840M, VX855_118_840M},
 	{CLK_119_000M, CLE266_PLL_119_000M, K800_PLL_119_000M,
-	 CX700_119_000M},
+	 CX700_119_000M, VX855_119_000M},
 	{CLK_121_750M, CLE266_PLL_121_750M, K800_PLL_121_750M,
-	 CX700_121_750M},
+	 CX700_121_750M, 0},
 	{CLK_125_104M, CLE266_PLL_125_104M, K800_PLL_125_104M,
-	 CX700_125_104M},
+	 CX700_125_104M, 0},
 	{CLK_133_308M, CLE266_PLL_133_308M, K800_PLL_133_308M,
-	 CX700_133_308M},
+	 CX700_133_308M, 0},
 	{CLK_135_000M, CLE266_PLL_135_000M, K800_PLL_135_000M,
-	 CX700_135_000M},
+	 CX700_135_000M, VX855_135_000M},
 	{CLK_136_700M, CLE266_PLL_136_700M, K800_PLL_136_700M,
-	 CX700_136_700M},
+	 CX700_136_700M, VX855_136_700M},
 	{CLK_138_400M, CLE266_PLL_138_400M, K800_PLL_138_400M,
-	 CX700_138_400M},
+	 CX700_138_400M, VX855_138_400M},
 	{CLK_146_760M, CLE266_PLL_146_760M, K800_PLL_146_760M,
-	 CX700_146_760M},
+	 CX700_146_760M, VX855_146_760M},
 	{CLK_153_920M, CLE266_PLL_153_920M, K800_PLL_153_920M,
-	 CX700_153_920M},
+	 CX700_153_920M, VX855_153_920M},
 	{CLK_156_000M, CLE266_PLL_156_000M, K800_PLL_156_000M,
-	 CX700_156_000M},
+	 CX700_156_000M, VX855_156_000M},
 	{CLK_157_500M, CLE266_PLL_157_500M, K800_PLL_157_500M,
-	 CX700_157_500M},
+	 CX700_157_500M, VX855_157_500M},
 	{CLK_162_000M, CLE266_PLL_162_000M, K800_PLL_162_000M,
-	 CX700_162_000M},
+	 CX700_162_000M, VX855_162_000M},
 	{CLK_187_000M, CLE266_PLL_187_000M, K800_PLL_187_000M,
-	 CX700_187_000M},
+	 CX700_187_000M, VX855_187_000M},
 	{CLK_193_295M, CLE266_PLL_193_295M, K800_PLL_193_295M,
-	 CX700_193_295M},
+	 CX700_193_295M, VX855_193_295M},
 	{CLK_202_500M, CLE266_PLL_202_500M, K800_PLL_202_500M,
-	 CX700_202_500M},
+	 CX700_202_500M, VX855_202_500M},
 	{CLK_204_000M, CLE266_PLL_204_000M, K800_PLL_204_000M,
-	 CX700_204_000M},
+	 CX700_204_000M, VX855_204_000M},
 	{CLK_218_500M, CLE266_PLL_218_500M, K800_PLL_218_500M,
-	 CX700_218_500M},
+	 CX700_218_500M, VX855_218_500M},
 	{CLK_234_000M, CLE266_PLL_234_000M, K800_PLL_234_000M,
-	 CX700_234_000M},
+	 CX700_234_000M, VX855_234_000M},
 	{CLK_267_250M, CLE266_PLL_267_250M, K800_PLL_267_250M,
-	 CX700_267_250M},
+	 CX700_267_250M, VX855_267_250M},
 	{CLK_297_500M, CLE266_PLL_297_500M, K800_PLL_297_500M,
-	 CX700_297_500M},
-	{CLK_74_481M, CLE266_PLL_74_481M, K800_PLL_74_481M, CX700_74_481M},
+	 CX700_297_500M, VX855_297_500M},
+	{CLK_74_481M, CLE266_PLL_74_481M, K800_PLL_74_481M,
+	 CX700_74_481M, VX855_74_481M},
 	{CLK_172_798M, CLE266_PLL_172_798M, K800_PLL_172_798M,
-	 CX700_172_798M},
+	 CX700_172_798M, VX855_172_798M},
 	{CLK_122_614M, CLE266_PLL_122_614M, K800_PLL_122_614M,
-	 CX700_122_614M},
-	{CLK_74_270M, CLE266_PLL_74_270M, K800_PLL_74_270M, CX700_74_270M},
+	 CX700_122_614M, VX855_122_614M},
+	{CLK_74_270M, CLE266_PLL_74_270M, K800_PLL_74_270M,
+	 CX700_74_270M, 0},
 	{CLK_148_500M, CLE266_PLL_148_500M, K800_PLL_148_500M,
-	 CX700_148_500M}
+	 CX700_148_500M, VX855_148_500M}
 };
 
 static struct fifo_depth_select display_fifo_depth_reg = {
@@ -508,7 +526,8 @@
 static void set_lcd_output_path(int set_iga, int output_interface);
 static int search_mode_setting(int ModeInfoIndex);
 static void load_fix_bit_crtc_reg(void);
-static void init_gfx_chip_info(void);
+static void init_gfx_chip_info(struct pci_dev *pdev,
+				const struct pci_device_id *pdi);
 static void init_tmds_chip_info(void);
 static void init_lvds_chip_info(void);
 static void device_screen_off(void);
@@ -518,7 +537,6 @@
 static void device_on(void);
 static void enable_second_display_channel(void);
 static void disable_second_display_channel(void);
-static int get_fb_size_from_pci(void);
 
 void viafb_write_reg(u8 index, u16 io_port, u8 data)
 {
@@ -629,70 +647,43 @@
 	}
 }
 
-void viafb_set_start_addr(void)
+void viafb_set_primary_address(u32 addr)
 {
-	unsigned long offset = 0, tmp = 0, size = 0;
-	unsigned long length;
+	DEBUG_MSG(KERN_DEBUG "viafb_set_primary_address(0x%08X)\n", addr);
+	viafb_write_reg(CR0D, VIACR, addr & 0xFF);
+	viafb_write_reg(CR0C, VIACR, (addr >> 8) & 0xFF);
+	viafb_write_reg(CR34, VIACR, (addr >> 16) & 0xFF);
+	viafb_write_reg_mask(CR48, VIACR, (addr >> 24) & 0x1F, 0x1F);
+}
 
-	DEBUG_MSG(KERN_INFO "viafb_set_start_addr!\n");
-	viafb_unlock_crt();
-	/* update starting address of IGA1 */
-	viafb_write_reg(CR0C, VIACR, 0x00);	/*initial starting address */
-	viafb_write_reg(CR0D, VIACR, 0x00);
-	viafb_write_reg(CR34, VIACR, 0x00);
-	viafb_write_reg_mask(CR48, VIACR, 0x00, 0x1F);
+void viafb_set_secondary_address(u32 addr)
+{
+	DEBUG_MSG(KERN_DEBUG "viafb_set_secondary_address(0x%08X)\n", addr);
+	/* secondary display supports only quadword aligned memory */
+	viafb_write_reg_mask(CR62, VIACR, (addr >> 2) & 0xFE, 0xFE);
+	viafb_write_reg(CR63, VIACR, (addr >> 10) & 0xFF);
+	viafb_write_reg(CR64, VIACR, (addr >> 18) & 0xFF);
+	viafb_write_reg_mask(CRA3, VIACR, (addr >> 26) & 0x07, 0x07);
+}
 
-	if (viafb_dual_fb) {
-		viaparinfo->iga_path = IGA1;
-		viaparinfo1->iga_path = IGA2;
-	}
+void viafb_set_primary_pitch(u32 pitch)
+{
+	DEBUG_MSG(KERN_DEBUG "viafb_set_primary_pitch(0x%08X)\n", pitch);
+	/* spec does not say that first adapter skips 3 bits but old
+	 * code did it and seems to be reasonable in analogy to 2nd adapter
+	 */
+	pitch = pitch >> 3;
+	viafb_write_reg(0x13, VIACR, pitch & 0xFF);
+	viafb_write_reg_mask(0x35, VIACR, (pitch >> (8 - 5)) & 0xE0, 0xE0);
+}
 
-	if (viafb_SAMM_ON == 1) {
-		if (!viafb_dual_fb) {
-			if (viafb_second_size)
-				size = viafb_second_size * 1024 * 1024;
-			else
-				size = 8 * 1024 * 1024;
-		} else {
-
-			size = viaparinfo1->memsize;
-		}
-		offset = viafb_second_offset;
-		DEBUG_MSG(KERN_INFO
-			  "viafb_second_size=%lx, second start_adddress=%lx\n",
-			  size, offset);
-	}
-	if (viafb_SAMM_ON == 1) {
-		offset = offset >> 3;
-
-		tmp = viafb_read_reg(VIACR, 0x62) & 0x01;
-		tmp |= (offset & 0x7F) << 1;
-		viafb_write_reg(CR62, VIACR, tmp);
-		viafb_write_reg(CR63, VIACR, ((offset & 0x7F80) >> 7));
-		viafb_write_reg(CR64, VIACR, ((offset & 0x7F8000) >> 15));
-		viafb_write_reg(CRA3, VIACR, ((offset & 0x3800000) >> 23));
-	} else {
-		/* update starting address */
-		viafb_write_reg(CR62, VIACR, 0x00);
-		viafb_write_reg(CR63, VIACR, 0x00);
-		viafb_write_reg(CR64, VIACR, 0x00);
-		viafb_write_reg(CRA3, VIACR, 0x00);
-	}
-
-	if (viafb_SAMM_ON == 1) {
-		if (viafb_accel) {
-			if (!viafb_dual_fb)
-				length = size - viaparinfo->fbmem_used;
-			else
-				length = size - viaparinfo1->fbmem_used;
-		} else
-			length = size;
-		offset = (unsigned long)(void *)viafb_FB_MM +
-			viafb_second_offset;
-		memset((void *)offset, 0, length);
-	}
-
-	viafb_lock_crt();
+void viafb_set_secondary_pitch(u32 pitch)
+{
+	DEBUG_MSG(KERN_DEBUG "viafb_set_secondary_pitch(0x%08X)\n", pitch);
+	pitch = pitch >> 3;
+	viafb_write_reg(0x66, VIACR, pitch & 0xFF);
+	viafb_write_reg_mask(0x67, VIACR, (pitch >> 8) & 0x03, 0x03);
+	viafb_write_reg_mask(0x71, VIACR, (pitch >> (10 - 7)) & 0x80, 0x80);
 }
 
 void viafb_set_output_path(int device, int set_iga, int output_interface)
@@ -1123,30 +1114,6 @@
 	}
 }
 
-void viafb_load_offset_reg(int h_addr, int bpp_byte, int set_iga)
-{
-	int reg_value;
-	int viafb_load_reg_num;
-	struct io_register *reg;
-
-	switch (set_iga) {
-	case IGA1_IGA2:
-	case IGA1:
-		reg_value = IGA1_OFFSET_FORMULA(h_addr, bpp_byte);
-		viafb_load_reg_num = offset_reg.iga1_offset_reg.reg_num;
-		reg = offset_reg.iga1_offset_reg.reg;
-		viafb_load_reg(reg_value, viafb_load_reg_num, reg, VIACR);
-		if (set_iga == IGA1)
-			break;
-	case IGA2:
-		reg_value = IGA2_OFFSET_FORMULA(h_addr, bpp_byte);
-		viafb_load_reg_num = offset_reg.iga2_offset_reg.reg_num;
-		reg = offset_reg.iga2_offset_reg.reg;
-		viafb_load_reg(reg_value, viafb_load_reg_num, reg, VIACR);
-		break;
-	}
-}
-
 void viafb_load_fetch_count_reg(int h_addr, int bpp_byte, int set_iga)
 {
 	int reg_value;
@@ -1277,6 +1244,15 @@
 			    VX800_IGA1_DISPLAY_QUEUE_EXPIRE_NUM;
 		}
 
+		if (viaparinfo->chip_info->gfx_chip_name == UNICHROME_VX855) {
+			iga1_fifo_max_depth = VX855_IGA1_FIFO_MAX_DEPTH;
+			iga1_fifo_threshold = VX855_IGA1_FIFO_THRESHOLD;
+			iga1_fifo_high_threshold =
+			    VX855_IGA1_FIFO_HIGH_THRESHOLD;
+			iga1_display_queue_expire_num =
+			    VX855_IGA1_DISPLAY_QUEUE_EXPIRE_NUM;
+		}
+
 		/* Set Display FIFO Depath Select */
 		reg_value = IGA1_FIFO_DEPTH_SELECT_FORMULA(iga1_fifo_max_depth);
 		viafb_load_reg_num =
@@ -1408,6 +1384,15 @@
 			    VX800_IGA2_DISPLAY_QUEUE_EXPIRE_NUM;
 		}
 
+		if (viaparinfo->chip_info->gfx_chip_name == UNICHROME_VX855) {
+			iga2_fifo_max_depth = VX855_IGA2_FIFO_MAX_DEPTH;
+			iga2_fifo_threshold = VX855_IGA2_FIFO_THRESHOLD;
+			iga2_fifo_high_threshold =
+			    VX855_IGA2_FIFO_HIGH_THRESHOLD;
+			iga2_display_queue_expire_num =
+			    VX855_IGA2_DISPLAY_QUEUE_EXPIRE_NUM;
+		}
+
 		if (viaparinfo->chip_info->gfx_chip_name == UNICHROME_K800) {
 			/* Set Display FIFO Depath Select */
 			reg_value =
@@ -1496,6 +1481,8 @@
 			case UNICHROME_P4M900:
 			case UNICHROME_VX800:
 				return pll_value[i].cx700_pll;
+			case UNICHROME_VX855:
+				return pll_value[i].vx855_pll;
 			}
 		}
 	}
@@ -1529,6 +1516,7 @@
 		case UNICHROME_P4M890:
 		case UNICHROME_P4M900:
 		case UNICHROME_VX800:
+		case UNICHROME_VX855:
 			viafb_write_reg(SR44, VIASR, CLK / 0x10000);
 			DEBUG_MSG(KERN_INFO "\nSR44=%x", CLK / 0x10000);
 			viafb_write_reg(SR45, VIASR, (CLK & 0xFFFF) / 0x100);
@@ -1557,6 +1545,7 @@
 		case UNICHROME_P4M890:
 		case UNICHROME_P4M900:
 		case UNICHROME_VX800:
+		case UNICHROME_VX855:
 			viafb_write_reg(SR4A, VIASR, CLK / 0x10000);
 			viafb_write_reg(SR4B, VIASR, (CLK & 0xFFFF) / 0x100);
 			viafb_write_reg(SR4C, VIASR, CLK % 0x100);
@@ -1916,7 +1905,6 @@
 	load_fix_bit_crtc_reg();
 	viafb_lock_crt();
 	viafb_write_reg_mask(CR17, VIACR, 0x80, BIT7);
-	viafb_load_offset_reg(h_addr, bpp_byte, set_iga);
 	viafb_load_fetch_count_reg(h_addr, bpp_byte, set_iga);
 
 	/* load FIFO */
@@ -1933,9 +1921,10 @@
 
 }
 
-void viafb_init_chip_info(void)
+void viafb_init_chip_info(struct pci_dev *pdev,
+			  const struct pci_device_id *pdi)
 {
-	init_gfx_chip_info();
+	init_gfx_chip_info(pdev, pdi);
 	init_tmds_chip_info();
 	init_lvds_chip_info();
 
@@ -2008,24 +1997,12 @@
 	}
 }
 
-static void init_gfx_chip_info(void)
+static void init_gfx_chip_info(struct pci_dev *pdev,
+			       const struct pci_device_id *pdi)
 {
-	struct pci_dev *pdev = NULL;
-	u32 i;
 	u8 tmp;
 
-	/* Indentify GFX Chip Name */
-	for (i = 0; pciidlist[i].vendor != 0; i++) {
-		pdev = pci_get_device(pciidlist[i].vendor,
-			pciidlist[i].device, 0);
-		if (pdev)
-			break;
-	}
-
-	if (!pciidlist[i].vendor)
-		return ;
-
-	viaparinfo->chip_info->gfx_chip_name = pciidlist[i].chip_index;
+	viaparinfo->chip_info->gfx_chip_name = pdi->driver_data;
 
 	/* Check revision of CLE266 Chip */
 	if (viaparinfo->chip_info->gfx_chip_name == UNICHROME_CLE266) {
@@ -2056,8 +2033,6 @@
 				CX700_REVISION_700;
 		}
 	}
-
-	pci_dev_put(pdev);
 }
 
 static void init_tmds_chip_info(void)
@@ -2271,11 +2246,12 @@
 		break;
 
 	case UNICHROME_CX700:
-		viafb_write_regx(CX700_ModeXregs, NUM_TOTAL_CX700_ModeXregs);
-
 	case UNICHROME_VX800:
-		viafb_write_regx(VX800_ModeXregs, NUM_TOTAL_VX800_ModeXregs);
+		viafb_write_regx(CX700_ModeXregs, NUM_TOTAL_CX700_ModeXregs);
+		break;
 
+	case UNICHROME_VX855:
+		viafb_write_regx(VX855_ModeXregs, NUM_TOTAL_VX855_ModeXregs);
 		break;
 	}
 
@@ -2291,7 +2267,8 @@
 		outb(VPIT.SR[i - 1], VIASR + 1);
 	}
 
-	viafb_set_start_addr();
+	viafb_set_primary_address(0);
+	viafb_set_secondary_address(viafb_SAMM_ON ? viafb_second_offset : 0);
 	viafb_set_iga_path();
 
 	/* Write CRTC */
@@ -2371,6 +2348,9 @@
 		}
 	}
 
+	viafb_set_primary_pitch(viafbinfo->fix.line_length);
+	viafb_set_secondary_pitch(viafb_dual_fb ? viafbinfo1->fix.line_length
+		: viafbinfo->fix.line_length);
 	/* Update Refresh Rate Setting */
 
 	/* Clear On Screen */
@@ -2545,38 +2525,6 @@
 	viafb_write_reg_mask(CR36, VIACR, 0x0, BIT5 + BIT4);
 }
 
-void viafb_get_mmio_info(unsigned long *mmio_base,
-	unsigned long *mmio_len)
-{
-	struct pci_dev *pdev = NULL;
-	u32 vendor, device;
-	u32 i;
-
-	for (i = 0; pciidlist[i].vendor != 0; i++)
-		if (viaparinfo->chip_info->gfx_chip_name ==
-			pciidlist[i].chip_index)
-			break;
-
-	if (!pciidlist[i].vendor)
-		return ;
-
-	vendor = pciidlist[i].vendor;
-	device = pciidlist[i].device;
-
-	pdev = pci_get_device(vendor, device, NULL);
-
-	if (!pdev) {
-		*mmio_base = 0;
-		*mmio_len = 0;
-		return ;
-	}
-
-	*mmio_base = pci_resource_start(pdev, 1);
-	*mmio_len = pci_resource_len(pdev, 1);
-
-	pci_dev_put(pdev);
-}
-
 static void enable_second_display_channel(void)
 {
 	/* to enable second display channel. */
@@ -2593,44 +2541,7 @@
 	viafb_write_reg_mask(CR6A, VIACR, BIT6, BIT6);
 }
 
-void viafb_get_fb_info(unsigned int *fb_base, unsigned int *fb_len)
-{
-	struct pci_dev *pdev = NULL;
-	u32 vendor, device;
-	u32 i;
-
-	for (i = 0; pciidlist[i].vendor != 0; i++)
-		if (viaparinfo->chip_info->gfx_chip_name ==
-			pciidlist[i].chip_index)
-			break;
-
-	if (!pciidlist[i].vendor)
-		return ;
-
-	vendor = pciidlist[i].vendor;
-	device = pciidlist[i].device;
-
-	pdev = pci_get_device(vendor, device, NULL);
-
-	if (!pdev) {
-		*fb_base = viafb_read_reg(VIASR, SR30) << 24;
-		*fb_len = viafb_get_memsize();
-		DEBUG_MSG(KERN_INFO "Get FB info from SR30!\n");
-		DEBUG_MSG(KERN_INFO "fb_base = %08x\n", *fb_base);
-		DEBUG_MSG(KERN_INFO "fb_len = %08x\n", *fb_len);
-		return ;
-	}
-
-	*fb_base = (unsigned int)pci_resource_start(pdev, 0);
-	*fb_len = get_fb_size_from_pci();
-	DEBUG_MSG(KERN_INFO "Get FB info from PCI system!\n");
-	DEBUG_MSG(KERN_INFO "fb_base = %08x\n", *fb_base);
-	DEBUG_MSG(KERN_INFO "fb_len = %08x\n", *fb_len);
-
-	pci_dev_put(pdev);
-}
-
-static int get_fb_size_from_pci(void)
+int viafb_get_fb_size_from_pci(void)
 {
 	unsigned long configid, deviceid, FBSize = 0;
 	int VideoMemSize;
@@ -2656,6 +2567,7 @@
 		case P4M890_FUNCTION3:
 		case P4M900_FUNCTION3:
 		case VX800_FUNCTION3:
+		case VX855_FUNCTION3:
 			/*case CN750_FUNCTION3: */
 			outl(configid + 0xA0, (unsigned long)0xCF8);
 			FBSize = inl((unsigned long)0xCFC);
@@ -2719,6 +2631,10 @@
 			VideoMemSize = (256 << 20);	/*256M */
 			break;
 
+		case 0x00007000:	/* Only on VX855/875 */
+			VideoMemSize = (512 << 20);	/*512M */
+			break;
+
 		default:
 			VideoMemSize = (32 << 20);	/*32M */
 			break;
@@ -2788,24 +2704,6 @@
 	}
 }
 
-void viafb_memory_pitch_patch(struct fb_info *info)
-{
-	if (info->var.xres != info->var.xres_virtual) {
-		viafb_load_offset_reg(info->var.xres_virtual,
-				info->var.bits_per_pixel >> 3, IGA1);
-
-		if (viafb_SAMM_ON) {
-			viafb_load_offset_reg(viafb_second_virtual_xres,
-				viafb_bpp1 >> 3,
-					IGA2);
-		} else {
-			viafb_load_offset_reg(info->var.xres_virtual,
-					info->var.bits_per_pixel >> 3, IGA2);
-		}
-
-	}
-}
-
 /*According var's xres, yres fill var's other timing information*/
 void viafb_fill_var_timing_info(struct fb_var_screeninfo *var, int refresh,
 			  int mode_index)
diff --git a/drivers/video/via/hw.h b/drivers/video/via/hw.h
index 6ff38fa..b874d95 100644
--- a/drivers/video/via/hw.h
+++ b/drivers/video/via/hw.h
@@ -147,14 +147,8 @@
 /* location: {CR5F,0,4} */
 #define IGA2_VER_SYNC_END_REG_NUM       1
 
-/* Define Offset and Fetch Count Register*/
+/* Define Fetch Count Register*/
 
-/* location: {CR13,0,7},{CR35,5,7} */
-#define IGA1_OFFSET_REG_NUM             2
-/* 8 bytes alignment. */
-#define IGA1_OFFSER_ALIGN_BYTE          8
-/* x: H resolution, y: color depth */
-#define IGA1_OFFSET_FORMULA(x, y)        ((x*y)/IGA1_OFFSER_ALIGN_BYTE)
 /* location: {SR1C,0,7},{SR1D,0,1} */
 #define IGA1_FETCH_COUNT_REG_NUM        2
 /* 16 bytes alignment. */
@@ -164,11 +158,6 @@
 #define IGA1_FETCH_COUNT_FORMULA(x, y)   \
 	(((x*y)/IGA1_FETCH_COUNT_ALIGN_BYTE) + IGA1_FETCH_COUNT_PATCH_VALUE)
 
-/* location: {CR66,0,7},{CR67,0,1} */
-#define IGA2_OFFSET_REG_NUM             2
-#define IGA2_OFFSET_ALIGN_BYTE          8
-/* x: H resolution, y: color depth */
-#define IGA2_OFFSET_FORMULA(x, y)        ((x*y)/IGA2_OFFSET_ALIGN_BYTE)
 /* location: {CR65,0,7},{CR67,2,3} */
 #define IGA2_FETCH_COUNT_REG_NUM        2
 #define IGA2_FETCH_COUNT_ALIGN_BYTE     16
@@ -335,6 +324,17 @@
 /* location: {CR94,0,6} */
 #define VX800_IGA2_DISPLAY_QUEUE_EXPIRE_NUM     128
 
+/* For VT3409 */
+#define VX855_IGA1_FIFO_MAX_DEPTH               400
+#define VX855_IGA1_FIFO_THRESHOLD               320
+#define VX855_IGA1_FIFO_HIGH_THRESHOLD          320
+#define VX855_IGA1_DISPLAY_QUEUE_EXPIRE_NUM     160
+
+#define VX855_IGA2_FIFO_MAX_DEPTH               200
+#define VX855_IGA2_FIFO_THRESHOLD               160
+#define VX855_IGA2_FIFO_HIGH_THRESHOLD          160
+#define VX855_IGA2_DISPLAY_QUEUE_EXPIRE_NUM     320
+
 #define IGA1_FIFO_DEPTH_SELECT_REG_NUM          1
 #define IGA1_FIFO_THRESHOLD_REG_NUM             2
 #define IGA1_FIFO_HIGH_THRESHOLD_REG_NUM        2
@@ -617,23 +617,6 @@
 	struct io_register reg[IGA2_VER_SYNC_END_REG_NUM];
 };
 
-/* IGA1 Offset Register */
-struct iga1_offset {
-	int reg_num;
-	struct io_register reg[IGA1_OFFSET_REG_NUM];
-};
-
-/* IGA2 Offset Register */
-struct iga2_offset {
-	int reg_num;
-	struct io_register reg[IGA2_OFFSET_REG_NUM];
-};
-
-struct offset {
-	struct iga1_offset iga1_offset_reg;
-	struct iga2_offset iga2_offset_reg;
-};
-
 /* IGA1 Fetch Count Register */
 struct iga1_fetch_count {
 	int reg_num;
@@ -716,6 +699,7 @@
 	u32 cle266_pll;
 	u32 k800_pll;
 	u32 cx700_pll;
+	u32 vx855_pll;
 };
 
 struct rgbLUT {
@@ -860,6 +844,8 @@
 #define P4M900_FUNCTION3    0x3364
 /* VT3353 chipset*/
 #define VX800_FUNCTION3     0x3353
+/* VT3409 chipset*/
+#define VX855_FUNCTION3     0x3409
 
 #define NUM_TOTAL_PLL_TABLE ARRAY_SIZE(pll_value)
 
@@ -883,7 +869,6 @@
 extern int viafb_LCD2_ON;
 extern int viafb_LCD_ON;
 extern int viafb_DVI_ON;
-extern int viafb_accel;
 extern int viafb_hotplug;
 
 void viafb_write_reg_mask(u8 index, int io_port, u8 data, u8 mask);
@@ -904,7 +889,6 @@
 u8 viafb_read_reg(int io_port, u8 index);
 void viafb_lock_crt(void);
 void viafb_unlock_crt(void);
-void viafb_load_offset_reg(int h_addr, int bpp_byte, int set_iga);
 void viafb_load_fetch_count_reg(int h_addr, int bpp_byte, int set_iga);
 void viafb_write_regx(struct io_reg RegTable[], int ItemNum);
 struct VideoModeTable *viafb_get_modetbl_pointer(int Index);
@@ -917,17 +901,20 @@
 int viafb_setmode(int vmode_index, int hor_res, int ver_res,
 	    int video_bpp, int vmode_index1, int hor_res1,
 	    int ver_res1, int video_bpp1);
-void viafb_init_chip_info(void);
+void viafb_init_chip_info(struct pci_dev *pdev,
+			  const struct pci_device_id *pdi);
 void viafb_init_dac(int set_iga);
 int viafb_get_pixclock(int hres, int vres, int vmode_refresh);
 int viafb_get_refresh(int hres, int vres, u32 float_refresh);
 void viafb_update_device_setting(int hres, int vres, int bpp,
 			   int vmode_refresh, int flag);
-void viafb_get_mmio_info(unsigned long *mmio_base,
-	unsigned long *mmio_len);
 
+int viafb_get_fb_size_from_pci(void);
 void viafb_set_iga_path(void);
-void viafb_set_start_addr(void);
+void viafb_set_primary_address(u32 addr);
+void viafb_set_secondary_address(u32 addr);
+void viafb_set_primary_pitch(u32 pitch);
+void viafb_set_secondary_pitch(u32 pitch);
 void viafb_get_fb_info(unsigned int *fb_base, unsigned int *fb_len);
 
 #endif /* __HW_H__ */
diff --git a/drivers/video/via/ioctl.h b/drivers/video/via/ioctl.h
index 842fe30..de89980 100644
--- a/drivers/video/via/ioctl.h
+++ b/drivers/video/via/ioctl.h
@@ -50,8 +50,6 @@
 #define VIAFB_GET_GAMMA_LUT		0x56494124
 #define VIAFB_SET_GAMMA_LUT		0x56494125
 #define VIAFB_GET_GAMMA_SUPPORT_STATE	0x56494126
-#define VIAFB_SET_VIDEO_DEVICE		0x56494127
-#define VIAFB_GET_VIDEO_DEVICE		0x56494128
 #define VIAFB_SET_SECOND_MODE		0x56494129
 #define VIAFB_SYNC_SURFACE		0x56494130
 #define VIAFB_GET_DRIVER_CAPS		0x56494131
@@ -179,9 +177,7 @@
 	unsigned short second_dev_bpp;
 	/* Indicate which device are primary display device. */
 	unsigned int primary_device;
-	/* Indicate which device will show video. only valid in duoview mode */
-	unsigned int video_device_status;
-	unsigned int struct_reserved[34];
+	unsigned int struct_reserved[35];
 	struct viafb_ioctl_lcd_attribute lcd_attributes;
 };
 
diff --git a/drivers/video/via/lcd.c b/drivers/video/via/lcd.c
index 78c6b33..e3e597f 100644
--- a/drivers/video/via/lcd.c
+++ b/drivers/video/via/lcd.c
@@ -207,13 +207,13 @@
 
 int viafb_lvds_trasmitter_identify(void)
 {
-	viaparinfo->i2c_stuff.i2c_port = I2CPORTINDEX;
+	viaparinfo->shared->i2c_stuff.i2c_port = I2CPORTINDEX;
 	if (viafb_lvds_identify_vt1636()) {
 		viaparinfo->chip_info->lvds_chip_info.i2c_port = I2CPORTINDEX;
 		DEBUG_MSG(KERN_INFO
 			  "Found VIA VT1636 LVDS on port i2c 0x31 \n");
 	} else {
-		viaparinfo->i2c_stuff.i2c_port = GPIOPORTINDEX;
+		viaparinfo->shared->i2c_stuff.i2c_port = GPIOPORTINDEX;
 		if (viafb_lvds_identify_vt1636()) {
 			viaparinfo->chip_info->lvds_chip_info.i2c_port =
 				GPIOPORTINDEX;
@@ -470,7 +470,7 @@
 {
 	u8 data;
 
-	viaparinfo->i2c_stuff.i2c_port = GPIOPORTINDEX;
+	viaparinfo->shared->i2c_stuff.i2c_port = GPIOPORTINDEX;
 	viafb_i2c_readbyte((u8) viaparinfo->chip_info->
 	    lvds_chip_info.lvds_chip_slave_addr,
 			(u8) index, &data);
@@ -952,13 +952,10 @@
 	int video_index = plvds_setting_info->lcd_panel_size;
 	int set_iga = plvds_setting_info->iga_path;
 	int mode_bpp = plvds_setting_info->bpp;
-	int viafb_load_reg_num = 0;
-	int reg_value = 0;
 	int set_hres, set_vres;
 	int panel_hres, panel_vres;
 	u32 pll_D_N;
 	int offset;
-	struct io_register *reg = NULL;
 	struct display_timing mode_crt_reg, panel_crt_reg;
 	struct crt_mode_table *panel_crt_table = NULL;
 	struct VideoModeTable *vmode_tbl = NULL;
@@ -1038,16 +1035,11 @@
 		}
 
 		/* Offset for simultaneous */
-		reg_value = offset;
-		viafb_load_reg_num = offset_reg.iga2_offset_reg.reg_num;
-		reg = offset_reg.iga2_offset_reg.reg;
-		viafb_load_reg(reg_value, viafb_load_reg_num, reg, VIACR);
+		viafb_set_secondary_pitch(offset << 3);
 		DEBUG_MSG(KERN_INFO "viafb_load_reg!!\n");
 		viafb_load_fetch_count_reg(set_hres, 4, IGA2);
 		/* Fetch count for simultaneous */
 	} else {		/* SAMM */
-		/* Offset for IGA2 only */
-		viafb_load_offset_reg(set_hres, mode_bpp / 8, set_iga);
 		/* Fetch count for IGA2 only */
 		viafb_load_fetch_count_reg(set_hres, mode_bpp / 8, set_iga);
 
diff --git a/drivers/video/via/share.h b/drivers/video/via/share.h
index 2e1254da..7cd03e2 100644
--- a/drivers/video/via/share.h
+++ b/drivers/video/via/share.h
@@ -167,6 +167,10 @@
 #define SR4B    0x4B
 #define SR4C    0x4C
 #define SR52    0x52
+#define SR57	0x57
+#define SR58	0x58
+#define SR59	0x59
+#define SR5D    0x5D
 #define SR5E    0x5E
 #define SR65    0x65
 
@@ -966,6 +970,100 @@
 #define CX700_297_500M    0x00CE0403
 #define CX700_122_614M    0x00870802
 
+/* PLL for VX855 */
+#define VX855_22_000M     0x007B1005
+#define VX855_25_175M     0x008D1005
+#define VX855_26_719M     0x00961005
+#define VX855_26_880M     0x00961005
+#define VX855_27_000M     0x00971005
+#define VX855_29_581M     0x00A51005
+#define VX855_29_829M     0x00641003
+#define VX855_31_490M     0x00B01005
+#define VX855_31_500M     0x00B01005
+#define VX855_31_728M     0x008E1004
+#define VX855_32_668M     0x00921004
+#define VX855_36_000M     0x00A11004
+#define VX855_40_000M     0x00700C05
+#define VX855_41_291M     0x00730C05
+#define VX855_43_163M     0x00790C05
+#define VX855_45_250M     0x007F0C05      /* 45.46MHz */
+#define VX855_46_000M     0x00670C04
+#define VX855_46_996M     0x00690C04
+#define VX855_48_000M     0x00860C05
+#define VX855_48_875M     0x00890C05
+#define VX855_49_500M     0x00530C03
+#define VX855_52_406M     0x00580C03
+#define VX855_52_977M     0x00940C05
+#define VX855_56_250M     0x009D0C05
+#define VX855_60_466M     0x00A90C05
+#define VX855_61_500M     0x00AC0C05
+#define VX855_65_000M     0x006D0C03
+#define VX855_65_178M     0x00B60C05
+#define VX855_66_750M     0x00700C03    /*67.116MHz */
+#define VX855_67_295M     0x00BC0C05
+#define VX855_68_179M     0x00BF0C05
+#define VX855_68_369M     0x00BF0C05
+#define VX855_69_924M     0x00C30C05
+#define VX855_70_159M     0x00C30C05
+#define VX855_72_000M     0x00A10C04
+#define VX855_73_023M     0x00CC0C05
+#define VX855_74_481M     0x00D10C05
+#define VX855_78_750M     0x006E0805
+#define VX855_79_466M     0x006F0805
+#define VX855_80_136M     0x00700805
+#define VX855_81_627M     0x00720805
+#define VX855_83_375M     0x00750805
+#define VX855_83_527M     0x00750805
+#define VX855_83_950M     0x00750805
+#define VX855_84_537M     0x00760805
+#define VX855_84_750M     0x00760805     /* 84.537Mhz */
+#define VX855_85_500M     0x00760805        /* 85.909080 MHz*/
+#define VX855_85_860M     0x00760805
+#define VX855_85_909M     0x00760805
+#define VX855_88_750M     0x007C0805
+#define VX855_89_489M     0x007D0805
+#define VX855_94_500M     0x00840805
+#define VX855_96_648M     0x00870805
+#define VX855_97_750M     0x00890805
+#define VX855_101_000M    0x008D0805
+#define VX855_106_500M    0x00950805
+#define VX855_108_000M    0x00970805
+#define VX855_110_125M    0x00990805
+#define VX855_112_000M    0x009D0805
+#define VX855_113_309M    0x009F0805
+#define VX855_115_000M    0x00A10805
+#define VX855_118_840M    0x00A60805
+#define VX855_119_000M    0x00A70805
+#define VX855_121_750M    0x00AA0805       /* 121.704MHz */
+#define VX855_122_614M    0x00AC0805
+#define VX855_126_266M    0x00B10805
+#define VX855_130_250M    0x00B60805      /* 130.250 */
+#define VX855_135_000M    0x00BD0805
+#define VX855_136_700M    0x00BF0805
+#define VX855_137_750M    0x00C10805
+#define VX855_138_400M    0x00C20805
+#define VX855_144_300M    0x00CA0805
+#define VX855_146_760M    0x00CE0805
+#define VX855_148_500M	  0x00D00805
+#define VX855_153_920M    0x00540402
+#define VX855_156_000M    0x006C0405
+#define VX855_156_867M    0x006E0405
+#define VX855_157_500M    0x006E0405
+#define VX855_162_000M    0x00710405
+#define VX855_172_798M    0x00790405
+#define VX855_187_000M    0x00830405
+#define VX855_193_295M    0x00870405
+#define VX855_202_500M    0x008E0405
+#define VX855_204_000M    0x008F0405
+#define VX855_218_500M    0x00990405
+#define VX855_229_500M    0x00A10405
+#define VX855_234_000M    0x00A40405
+#define VX855_267_250M    0x00BB0405
+#define VX855_297_500M    0x00D00405
+#define VX855_339_500M    0x00770005
+#define VX855_340_772M    0x00770005
+
+
 /* Definition CRTC Timing Index */
 #define H_TOTAL_INDEX               0
 #define H_ADDR_INDEX                1
diff --git a/drivers/video/via/via_i2c.c b/drivers/video/via/via_i2c.c
index 0f3ed4e..15543e9 100644
--- a/drivers/video/via/via_i2c.c
+++ b/drivers/video/via/via_i2c.c
@@ -97,7 +97,7 @@
 	mm1[0] = index;
 	msgs[0].len = 1; msgs[1].len = 1;
 	msgs[0].buf = mm1; msgs[1].buf = pdata;
-	i2c_transfer(&viaparinfo->i2c_stuff.adapter, msgs, 2);
+	i2c_transfer(&viaparinfo->shared->i2c_stuff.adapter, msgs, 2);
 
 	return 0;
 }
@@ -111,7 +111,7 @@
 	msgs.addr = slave_addr / 2;
 	msgs.len = 2;
 	msgs.buf = msg;
-	return i2c_transfer(&viaparinfo->i2c_stuff.adapter, &msgs, 1);
+	return i2c_transfer(&viaparinfo->shared->i2c_stuff.adapter, &msgs, 1);
 }
 
 int viafb_i2c_readbytes(u8 slave_addr, u8 index, u8 *buff, int buff_len)
@@ -125,53 +125,53 @@
 	mm1[0] = index;
 	msgs[0].len = 1; msgs[1].len = buff_len;
 	msgs[0].buf = mm1; msgs[1].buf = buff;
-	i2c_transfer(&viaparinfo->i2c_stuff.adapter, msgs, 2);
+	i2c_transfer(&viaparinfo->shared->i2c_stuff.adapter, msgs, 2);
 	return 0;
 }
 
 int viafb_create_i2c_bus(void *viapar)
 {
 	int ret;
-	struct viafb_par *par = (struct viafb_par *)viapar;
+	struct via_i2c_stuff *i2c_stuff =
+		&((struct viafb_par *)viapar)->shared->i2c_stuff;
 
-	strcpy(par->i2c_stuff.adapter.name, "via_i2c");
-	par->i2c_stuff.i2c_port = 0x0;
-	par->i2c_stuff.adapter.owner = THIS_MODULE;
-	par->i2c_stuff.adapter.id = 0x01FFFF;
-	par->i2c_stuff.adapter.class = 0;
-	par->i2c_stuff.adapter.algo_data = &par->i2c_stuff.algo;
-	par->i2c_stuff.adapter.dev.parent = NULL;
-	par->i2c_stuff.algo.setsda = via_i2c_setsda;
-	par->i2c_stuff.algo.setscl = via_i2c_setscl;
-	par->i2c_stuff.algo.getsda = via_i2c_getsda;
-	par->i2c_stuff.algo.getscl = via_i2c_getscl;
-	par->i2c_stuff.algo.udelay = 40;
-	par->i2c_stuff.algo.timeout = 20;
-	par->i2c_stuff.algo.data = &par->i2c_stuff;
+	strcpy(i2c_stuff->adapter.name, "via_i2c");
+	i2c_stuff->i2c_port = 0x0;
+	i2c_stuff->adapter.owner = THIS_MODULE;
+	i2c_stuff->adapter.id = 0x01FFFF;
+	i2c_stuff->adapter.class = 0;
+	i2c_stuff->adapter.algo_data = &i2c_stuff->algo;
+	i2c_stuff->adapter.dev.parent = NULL;
+	i2c_stuff->algo.setsda = via_i2c_setsda;
+	i2c_stuff->algo.setscl = via_i2c_setscl;
+	i2c_stuff->algo.getsda = via_i2c_getsda;
+	i2c_stuff->algo.getscl = via_i2c_getscl;
+	i2c_stuff->algo.udelay = 40;
+	i2c_stuff->algo.timeout = 20;
+	i2c_stuff->algo.data = i2c_stuff;
 
-	i2c_set_adapdata(&par->i2c_stuff.adapter, &par->i2c_stuff);
+	i2c_set_adapdata(&i2c_stuff->adapter, i2c_stuff);
 
 	/* Raise SCL and SDA */
-	par->i2c_stuff.i2c_port = I2CPORTINDEX;
-	via_i2c_setsda(&par->i2c_stuff, 1);
-	via_i2c_setscl(&par->i2c_stuff, 1);
+	i2c_stuff->i2c_port = I2CPORTINDEX;
+	via_i2c_setsda(i2c_stuff, 1);
+	via_i2c_setscl(i2c_stuff, 1);
 
-	par->i2c_stuff.i2c_port = GPIOPORTINDEX;
-	via_i2c_setsda(&par->i2c_stuff, 1);
-	via_i2c_setscl(&par->i2c_stuff, 1);
+	i2c_stuff->i2c_port = GPIOPORTINDEX;
+	via_i2c_setsda(i2c_stuff, 1);
+	via_i2c_setscl(i2c_stuff, 1);
 	udelay(20);
 
-	ret = i2c_bit_add_bus(&par->i2c_stuff.adapter);
+	ret = i2c_bit_add_bus(&i2c_stuff->adapter);
 	if (ret == 0)
-		DEBUG_MSG("I2C bus %s registered.\n",
-		par->i2c_stuff.adapter.name);
+		DEBUG_MSG("I2C bus %s registered.\n", i2c_stuff->adapter.name);
 	else
 		DEBUG_MSG("Failed to register I2C bus %s.\n",
-			par->i2c_stuff.adapter.name);
+			i2c_stuff->adapter.name);
 	return ret;
 }
 
 void viafb_delete_i2c_buss(void *par)
 {
-	i2c_del_adapter(&((struct viafb_par *)par)->i2c_stuff.adapter);
+	i2c_del_adapter(&((struct viafb_par *)par)->shared->i2c_stuff.adapter);
 }
diff --git a/drivers/video/via/viafbdev.c b/drivers/video/via/viafbdev.c
index 72833f3..56ec696 100644
--- a/drivers/video/via/viafbdev.c
+++ b/drivers/video/via/viafbdev.c
@@ -20,11 +20,12 @@
  */
 
 #include <linux/module.h>
+#include <linux/seq_file.h>
+#include <linux/stat.h>
 #define _MASTER_FILE
 
 #include "global.h"
 
-static int MAX_CURS = 32;
 static struct fb_var_screeninfo default_var;
 static char *viafb_name = "Via";
 static u32 pseudo_pal[17];
@@ -33,12 +34,11 @@
 static char *viafb_mode = "640x480";
 static char *viafb_mode1 = "640x480";
 
+static int viafb_accel = 1;
+
 /* Added for specifying active devices.*/
 char *viafb_active_dev = "";
 
-/* Added for specifying video on devices.*/
-char *viafb_video_dev = "";
-
 /*Added for specify lcd output port*/
 char *viafb_lcd_port = "";
 char *viafb_dvi_port = "";
@@ -50,71 +50,20 @@
 	*sec_var);
 static void retrieve_device_setting(struct viafb_ioctl_setting
 	*setting_info);
-static void viafb_set_video_device(u32 video_dev_info);
-static void viafb_get_video_device(u32 *video_dev_info);
-
-/* Mode information */
-static const struct viafb_modeinfo viafb_modentry[] = {
-	{480, 640, VIA_RES_480X640},
-	{640, 480, VIA_RES_640X480},
-	{800, 480, VIA_RES_800X480},
-	{800, 600, VIA_RES_800X600},
-	{1024, 768, VIA_RES_1024X768},
-	{1152, 864, VIA_RES_1152X864},
-	{1280, 1024, VIA_RES_1280X1024},
-	{1600, 1200, VIA_RES_1600X1200},
-	{1440, 1050, VIA_RES_1440X1050},
-	{1280, 768, VIA_RES_1280X768,},
-	{1280, 800, VIA_RES_1280X800},
-	{1280, 960, VIA_RES_1280X960},
-	{1920, 1440, VIA_RES_1920X1440},
-	{848, 480, VIA_RES_848X480},
-	{1400, 1050, VIA_RES_1400X1050},
-	{720, 480, VIA_RES_720X480},
-	{720, 576, VIA_RES_720X576},
-	{1024, 512, VIA_RES_1024X512},
-	{1024, 576, VIA_RES_1024X576},
-	{1024, 600, VIA_RES_1024X600},
-	{1280, 720, VIA_RES_1280X720},
-	{1920, 1080, VIA_RES_1920X1080},
-	{1366, 768, VIA_RES_1368X768},
-	{1680, 1050, VIA_RES_1680X1050},
-	{960, 600, VIA_RES_960X600},
-	{1000, 600, VIA_RES_1000X600},
-	{1024, 576, VIA_RES_1024X576},
-	{1024, 600, VIA_RES_1024X600},
-	{1088, 612, VIA_RES_1088X612},
-	{1152, 720, VIA_RES_1152X720},
-	{1200, 720, VIA_RES_1200X720},
-	{1280, 600, VIA_RES_1280X600},
-	{1360, 768, VIA_RES_1360X768},
-	{1440, 900, VIA_RES_1440X900},
-	{1600, 900, VIA_RES_1600X900},
-	{1600, 1024, VIA_RES_1600X1024},
-	{1792, 1344, VIA_RES_1792X1344},
-	{1856, 1392, VIA_RES_1856X1392},
-	{1920, 1200, VIA_RES_1920X1200},
-	{2048, 1536, VIA_RES_2048X1536},
-	{0, 0, VIA_RES_INVALID}
-};
 
 static struct fb_ops viafb_ops;
 
-static int viafb_update_fix(struct fb_fix_screeninfo *fix, struct fb_info *info)
+
+static void viafb_update_fix(struct fb_info *info)
 {
-	struct viafb_par *ppar;
-	ppar = info->par;
+	u32 bpp = info->var.bits_per_pixel;
 
-	DEBUG_MSG(KERN_INFO "viafb_update_fix!\n");
-
-	fix->visual =
-	    ppar->bpp == 8 ? FB_VISUAL_PSEUDOCOLOR : FB_VISUAL_TRUECOLOR;
-	fix->line_length = ppar->linelength;
-
-	return 0;
+	info->fix.visual =
+		bpp == 8 ? FB_VISUAL_PSEUDOCOLOR : FB_VISUAL_TRUECOLOR;
+	info->fix.line_length =
+		((info->var.xres_virtual + 7) & ~7) * bpp / 8;
 }
 
-
 static void viafb_setup_fixinfo(struct fb_fix_screeninfo *fix,
 	struct viafb_par *viaparinfo)
 {
@@ -123,8 +72,6 @@
 
 	fix->smem_start = viaparinfo->fbmem;
 	fix->smem_len = viaparinfo->fbmem_free;
-	fix->mmio_start = viaparinfo->mmio_base;
-	fix->mmio_len = viaparinfo->mmio_len;
 
 	fix->type = FB_TYPE_PACKED_PIXELS;
 	fix->type_aux = 0;
@@ -147,28 +94,12 @@
 	return 0;
 }
 
-static void viafb_update_viafb_par(struct fb_info *info)
-{
-	struct viafb_par *ppar;
-
-	ppar = info->par;
-	ppar->bpp = info->var.bits_per_pixel;
-	ppar->linelength = ((info->var.xres_virtual + 7) & ~7) * ppar->bpp / 8;
-	ppar->hres = info->var.xres;
-	ppar->vres = info->var.yres;
-	ppar->xoffset = info->var.xoffset;
-	ppar->yoffset = info->var.yoffset;
-}
-
 static int viafb_check_var(struct fb_var_screeninfo *var,
 	struct fb_info *info)
 {
 	int vmode_index, htotal, vtotal;
-	struct viafb_par *ppar;
+	struct viafb_par *ppar = info->par;
 	u32 long_refresh;
-	struct viafb_par *p_viafb_par;
-	ppar = info->par;
-
 
 	DEBUG_MSG(KERN_INFO "viafb_check_var!\n");
 	/* Sanity check */
@@ -212,23 +143,21 @@
 
 	/* Adjust var according to our driver's own table */
 	viafb_fill_var_timing_info(var, viafb_refresh, vmode_index);
-
-	/* This is indeed a patch for VT3353 */
-	if (!info->par)
-		return -1;
-	p_viafb_par = (struct viafb_par *)info->par;
-	if (p_viafb_par->chip_info->gfx_chip_name == UNICHROME_VX800)
-		var->accel_flags = 0;
+	if (info->var.accel_flags & FB_ACCELF_TEXT &&
+		!ppar->shared->engine_mmio)
+		info->var.accel_flags = 0;
 
 	return 0;
 }
 
 static int viafb_set_par(struct fb_info *info)
 {
+	struct viafb_par *viapar = info->par;
 	int vmode_index;
 	int vmode_index1 = 0;
 	DEBUG_MSG(KERN_INFO "viafb_set_par!\n");
 
+	viapar->depth = fb_get_color_depth(&info->var, &info->fix);
 	viafb_update_device_setting(info->var.xres, info->var.yres,
 			      info->var.bits_per_pixel, viafb_refresh, 0);
 
@@ -252,21 +181,12 @@
 			info->var.bits_per_pixel, vmode_index1,
 			viafb_second_xres, viafb_second_yres, viafb_bpp1);
 
-		/*We should set memory offset according virtual_x */
-		/*Fix me:put this function into viafb_setmode */
-		viafb_memory_pitch_patch(info);
-
-		/* Update ***fb_par information */
-		viafb_update_viafb_par(info);
-
-		/* Update other fixed information */
-		viafb_update_fix(&info->fix, info);
+		viafb_update_fix(info);
 		viafb_bpp = info->var.bits_per_pixel;
-		/* Update viafb_accel, it is necessary to our 2D accelerate */
-		viafb_accel = info->var.accel_flags;
-
-		if (viafb_accel)
-			viafb_set_2d_color_depth(info->var.bits_per_pixel);
+		if (info->var.accel_flags & FB_ACCELF_TEXT)
+			info->flags &= ~FBINFO_HWACCEL_DISABLED;
+		else
+			info->flags |= FBINFO_HWACCEL_DISABLED;
 	}
 
 	return 0;
@@ -503,12 +423,7 @@
 	    var->bits_per_pixel / 16;
 
 	DEBUG_MSG(KERN_INFO "\nviafb_pan_display,offset =%d ", offset);
-
-	viafb_write_reg_mask(0x48, 0x3d4, ((offset >> 24) & 0x3), 0x3);
-	viafb_write_reg_mask(0x34, 0x3d4, ((offset >> 16) & 0xff), 0xff);
-	viafb_write_reg_mask(0x0c, 0x3d4, ((offset >> 8) & 0xff), 0xff);
-	viafb_write_reg_mask(0x0d, 0x3d4, (offset & 0xff), 0xff);
-
+	viafb_set_primary_address(offset);
 	return 0;
 }
 
@@ -560,7 +475,6 @@
 
 	u32 __user *argp = (u32 __user *) arg;
 	u32 gpu32;
-	u32 video_dev_info = 0;
 
 	DEBUG_MSG(KERN_INFO "viafb_ioctl: 0x%X !!\n", cmd);
 	memset(&u, 0, sizeof(u));
@@ -792,15 +706,6 @@
 		if (put_user(state_info, argp))
 			return -EFAULT;
 		break;
-	case VIAFB_SET_VIDEO_DEVICE:
-		get_user(video_dev_info, argp);
-		viafb_set_video_device(video_dev_info);
-		break;
-	case VIAFB_GET_VIDEO_DEVICE:
-		viafb_get_video_device(&video_dev_info);
-		if (put_user(video_dev_info, argp))
-			return -EFAULT;
-		break;
 	case VIAFB_SYNC_SURFACE:
 		DEBUG_MSG(KERN_INFO "lobo VIAFB_SYNC_SURFACE\n");
 		break;
@@ -866,10 +771,12 @@
 static void viafb_fillrect(struct fb_info *info,
 	const struct fb_fillrect *rect)
 {
-	u32 col = 0, rop = 0;
-	int pitch;
+	struct viafb_par *viapar = info->par;
+	struct viafb_shared *shared = viapar->shared;
+	u32 fg_color;
+	u8 rop;
 
-	if (!viafb_accel) {
+	if (info->flags & FBINFO_HWACCEL_DISABLED || !shared->hw_bitblt) {
 		cfb_fillrect(info, rect);
 		return;
 	}
@@ -877,68 +784,31 @@
 	if (!rect->width || !rect->height)
 		return;
 
-	switch (rect->rop) {
-	case ROP_XOR:
+	if (info->fix.visual == FB_VISUAL_TRUECOLOR)
+		fg_color = ((u32 *)info->pseudo_palette)[rect->color];
+	else
+		fg_color = rect->color;
+
+	if (rect->rop == ROP_XOR)
 		rop = 0x5A;
-		break;
-	case ROP_COPY:
-	default:
+	else
 		rop = 0xF0;
-		break;
-	}
 
-	switch (info->var.bits_per_pixel) {
-	case 8:
-		col = rect->color;
-		break;
-	case 16:
-		col = ((u32 *) (info->pseudo_palette))[rect->color];
-		break;
-	case 32:
-		col = ((u32 *) (info->pseudo_palette))[rect->color];
-		break;
-	}
-
-	/* BitBlt Source Address */
-	writel(0x0, viaparinfo->io_virt + VIA_REG_SRCPOS);
-	/* Source Base Address */
-	writel(0x0, viaparinfo->io_virt + VIA_REG_SRCBASE);
-	/* Destination Base Address */
-	writel(((unsigned long) (info->screen_base) -
-		   (unsigned long) viafb_FB_MM) >> 3,
-		   viaparinfo->io_virt + VIA_REG_DSTBASE);
-	/* Pitch */
-	pitch = (info->var.xres_virtual + 7) & ~7;
-	writel(VIA_PITCH_ENABLE |
-		   (((pitch *
-		      info->var.bits_per_pixel >> 3) >> 3) |
-		      (((pitch * info->
-		      var.bits_per_pixel >> 3) >> 3) << 16)),
-		      viaparinfo->io_virt + VIA_REG_PITCH);
-	/* BitBlt Destination Address */
-	writel(((rect->dy << 16) | rect->dx),
-		viaparinfo->io_virt + VIA_REG_DSTPOS);
-	/* Dimension: width & height */
-	writel((((rect->height - 1) << 16) | (rect->width - 1)),
-		viaparinfo->io_virt + VIA_REG_DIMENSION);
-	/* Forground color or Destination color */
-	writel(col, viaparinfo->io_virt + VIA_REG_FGCOLOR);
-	/* GE Command */
-	writel((0x01 | 0x2000 | (rop << 24)),
-		viaparinfo->io_virt + VIA_REG_GECMD);
-
+	DEBUG_MSG(KERN_DEBUG "viafb 2D engine: fillrect\n");
+	if (shared->hw_bitblt(shared->engine_mmio, VIA_BITBLT_FILL,
+		rect->width, rect->height, info->var.bits_per_pixel,
+		viapar->vram_addr, info->fix.line_length, rect->dx, rect->dy,
+		NULL, 0, 0, 0, 0, fg_color, 0, rop))
+		cfb_fillrect(info, rect);
 }
 
 static void viafb_copyarea(struct fb_info *info,
 	const struct fb_copyarea *area)
 {
-	u32 dy = area->dy, sy = area->sy, direction = 0x0;
-	u32 sx = area->sx, dx = area->dx, width = area->width;
-	int pitch;
+	struct viafb_par *viapar = info->par;
+	struct viafb_shared *shared = viapar->shared;
 
-	DEBUG_MSG(KERN_INFO "viafb_copyarea!!\n");
-
-	if (!viafb_accel) {
+	if (info->flags & FBINFO_HWACCEL_DISABLED || !shared->hw_bitblt) {
 		cfb_copyarea(info, area);
 		return;
 	}
@@ -946,263 +816,148 @@
 	if (!area->width || !area->height)
 		return;
 
-	if (sy < dy) {
-		dy += area->height - 1;
-		sy += area->height - 1;
-		direction |= 0x4000;
-	}
-
-	if (sx < dx) {
-		dx += width - 1;
-		sx += width - 1;
-		direction |= 0x8000;
-	}
-
-	/* Source Base Address */
-	writel(((unsigned long) (info->screen_base) -
-		   (unsigned long) viafb_FB_MM) >> 3,
-		   viaparinfo->io_virt + VIA_REG_SRCBASE);
-	/* Destination Base Address */
-	writel(((unsigned long) (info->screen_base) -
-		   (unsigned long) viafb_FB_MM) >> 3,
-		   viaparinfo->io_virt + VIA_REG_DSTBASE);
-	/* Pitch */
-	pitch = (info->var.xres_virtual + 7) & ~7;
-	/* VIA_PITCH_ENABLE can be omitted now. */
-	writel(VIA_PITCH_ENABLE |
-		   (((pitch *
-		      info->var.bits_per_pixel >> 3) >> 3) | (((pitch *
-								info->var.
-								bits_per_pixel
-								>> 3) >> 3)
-							      << 16)),
-				viaparinfo->io_virt + VIA_REG_PITCH);
-	/* BitBlt Source Address */
-	writel(((sy << 16) | sx), viaparinfo->io_virt + VIA_REG_SRCPOS);
-	/* BitBlt Destination Address */
-	writel(((dy << 16) | dx), viaparinfo->io_virt + VIA_REG_DSTPOS);
-	/* Dimension: width & height */
-	writel((((area->height - 1) << 16) | (area->width - 1)),
-		   viaparinfo->io_virt + VIA_REG_DIMENSION);
-	/* GE Command */
-	writel((0x01 | direction | (0xCC << 24)),
-		viaparinfo->io_virt + VIA_REG_GECMD);
-
+	DEBUG_MSG(KERN_DEBUG "viafb 2D engine: copyarea\n");
+	if (shared->hw_bitblt(shared->engine_mmio, VIA_BITBLT_COLOR,
+		area->width, area->height, info->var.bits_per_pixel,
+		viapar->vram_addr, info->fix.line_length, area->dx, area->dy,
+		NULL, viapar->vram_addr, info->fix.line_length,
+		area->sx, area->sy, 0, 0, 0))
+		cfb_copyarea(info, area);
 }
 
 static void viafb_imageblit(struct fb_info *info,
 	const struct fb_image *image)
 {
-	u32 size, bg_col = 0, fg_col = 0, *udata;
-	int i;
-	int pitch;
+	struct viafb_par *viapar = info->par;
+	struct viafb_shared *shared = viapar->shared;
+	u32 fg_color = 0, bg_color = 0;
+	u8 op;
 
-	if (!viafb_accel) {
+	if (info->flags & FBINFO_HWACCEL_DISABLED || !shared->hw_bitblt ||
+		(image->depth != 1 && image->depth != viapar->depth)) {
 		cfb_imageblit(info, image);
 		return;
 	}
 
-	udata = (u32 *) image->data;
+	if (image->depth == 1) {
+		op = VIA_BITBLT_MONO;
+		if (info->fix.visual == FB_VISUAL_TRUECOLOR) {
+			fg_color =
+				((u32 *)info->pseudo_palette)[image->fg_color];
+			bg_color =
+				((u32 *)info->pseudo_palette)[image->bg_color];
+		} else {
+			fg_color = image->fg_color;
+			bg_color = image->bg_color;
+		}
+	} else
+		op = VIA_BITBLT_COLOR;
 
-	switch (info->var.bits_per_pixel) {
-	case 8:
-		bg_col = image->bg_color;
-		fg_col = image->fg_color;
-		break;
-	case 16:
-		bg_col = ((u32 *) (info->pseudo_palette))[image->bg_color];
-		fg_col = ((u32 *) (info->pseudo_palette))[image->fg_color];
-		break;
-	case 32:
-		bg_col = ((u32 *) (info->pseudo_palette))[image->bg_color];
-		fg_col = ((u32 *) (info->pseudo_palette))[image->fg_color];
-		break;
-	}
-	size = image->width * image->height;
-
-	/* Source Base Address */
-	writel(0x0, viaparinfo->io_virt + VIA_REG_SRCBASE);
-	/* Destination Base Address */
-	writel(((unsigned long) (info->screen_base) -
-		   (unsigned long) viafb_FB_MM) >> 3,
-		   viaparinfo->io_virt + VIA_REG_DSTBASE);
-	/* Pitch */
-	pitch = (info->var.xres_virtual + 7) & ~7;
-	writel(VIA_PITCH_ENABLE |
-		   (((pitch *
-		      info->var.bits_per_pixel >> 3) >> 3) | (((pitch *
-								info->var.
-								bits_per_pixel
-								>> 3) >> 3)
-							      << 16)),
-				viaparinfo->io_virt + VIA_REG_PITCH);
-	/* BitBlt Source Address */
-	writel(0x0, viaparinfo->io_virt + VIA_REG_SRCPOS);
-	/* BitBlt Destination Address */
-	writel(((image->dy << 16) | image->dx),
-		viaparinfo->io_virt + VIA_REG_DSTPOS);
-	/* Dimension: width & height */
-	writel((((image->height - 1) << 16) | (image->width - 1)),
-		   viaparinfo->io_virt + VIA_REG_DIMENSION);
-	/* fb color */
-	writel(fg_col, viaparinfo->io_virt + VIA_REG_FGCOLOR);
-	/* bg color */
-	writel(bg_col, viaparinfo->io_virt + VIA_REG_BGCOLOR);
-	/* GE Command */
-	writel(0xCC020142, viaparinfo->io_virt + VIA_REG_GECMD);
-
-	for (i = 0; i < size / 4; i++) {
-		writel(*udata, viaparinfo->io_virt + VIA_MMIO_BLTBASE);
-		udata++;
-	}
-
+	DEBUG_MSG(KERN_DEBUG "viafb 2D engine: imageblit\n");
+	if (shared->hw_bitblt(shared->engine_mmio, op,
+		image->width, image->height, info->var.bits_per_pixel,
+		viapar->vram_addr, info->fix.line_length, image->dx, image->dy,
+		(u32 *)image->data, 0, 0, 0, 0, fg_color, bg_color, 0))
+		cfb_imageblit(info, image);
 }
 
 static int viafb_cursor(struct fb_info *info, struct fb_cursor *cursor)
 {
-	u32 temp, xx, yy, bg_col = 0, fg_col = 0;
-	int i, j = 0;
-	static int hw_cursor;
-	struct viafb_par *p_viafb_par;
+	struct viafb_par *viapar = info->par;
+	void __iomem *engine = viapar->shared->engine_mmio;
+	u32 temp, xx, yy, bg_color = 0, fg_color = 0,
+		chip_name = viapar->shared->chip_info.gfx_chip_name;
+	int i, j = 0, cur_size = 64;
 
-	if (viafb_accel)
-		hw_cursor = 1;
-
-	if (!viafb_accel) {
-		if (hw_cursor) {
-			viafb_show_hw_cursor(info, HW_Cursor_OFF);
-			hw_cursor = 0;
-		}
-		return -ENODEV;
-	}
-
-	if ((((struct viafb_par *)(info->par))->iga_path == IGA2)
-	    && (viaparinfo->chip_info->gfx_chip_name == UNICHROME_CLE266))
+	if (info->flags & FBINFO_HWACCEL_DISABLED || info != viafbinfo)
 		return -ENODEV;
 
-	/* When duoview and using lcd , use soft cursor */
-	if (viafb_LCD_ON || ((struct viafb_par *)(info->par))->duoview)
+	if (chip_name == UNICHROME_CLE266 && viapar->iga_path == IGA2)
 		return -ENODEV;
 
 	viafb_show_hw_cursor(info, HW_Cursor_OFF);
-	viacursor = *cursor;
 
 	if (cursor->set & FB_CUR_SETHOT) {
-		viacursor.hot = cursor->hot;
-		temp = ((viacursor.hot.x) << 16) + viacursor.hot.y;
-		writel(temp, viaparinfo->io_virt + VIA_REG_CURSOR_ORG);
+		temp = (cursor->hot.x << 16) + cursor->hot.y;
+		writel(temp, engine + VIA_REG_CURSOR_ORG);
 	}
 
 	if (cursor->set & FB_CUR_SETPOS) {
-		viacursor.image.dx = cursor->image.dx;
-		viacursor.image.dy = cursor->image.dy;
 		yy = cursor->image.dy - info->var.yoffset;
 		xx = cursor->image.dx - info->var.xoffset;
 		temp = yy & 0xFFFF;
 		temp |= (xx << 16);
-		writel(temp, viaparinfo->io_virt + VIA_REG_CURSOR_POS);
+		writel(temp, engine + VIA_REG_CURSOR_POS);
+	}
+
+	if (cursor->image.width <= 32 && cursor->image.height <= 32)
+		cur_size = 32;
+	else if (cursor->image.width <= 64 && cursor->image.height <= 64)
+		cur_size = 64;
+	else {
+		printk(KERN_WARNING "viafb_cursor: The cursor is too large "
+			"%dx%d", cursor->image.width, cursor->image.height);
+		return -ENXIO;
 	}
 
 	if (cursor->set & FB_CUR_SETSIZE) {
-		temp = readl(viaparinfo->io_virt + VIA_REG_CURSOR_MODE);
-
-		if ((cursor->image.width <= 32)
-		    && (cursor->image.height <= 32)) {
-			MAX_CURS = 32;
+		temp = readl(engine + VIA_REG_CURSOR_MODE);
+		if (cur_size == 32)
 			temp |= 0x2;
-		} else if ((cursor->image.width <= 64)
-			   && (cursor->image.height <= 64)) {
-			MAX_CURS = 64;
-			temp &= 0xFFFFFFFD;
-		} else {
-			DEBUG_MSG(KERN_INFO
-			"The cursor image is biger than 64x64 bits...\n");
-			return -ENXIO;
-		}
-		writel(temp, viaparinfo->io_virt + VIA_REG_CURSOR_MODE);
+		else
+			temp &= ~0x2;
 
-		viacursor.image.height = cursor->image.height;
-		viacursor.image.width = cursor->image.width;
+		writel(temp, engine + VIA_REG_CURSOR_MODE);
 	}
 
 	if (cursor->set & FB_CUR_SETCMAP) {
-		viacursor.image.fg_color = cursor->image.fg_color;
-		viacursor.image.bg_color = cursor->image.bg_color;
-
-		switch (info->var.bits_per_pixel) {
-		case 8:
-		case 16:
-		case 32:
-			bg_col =
-			    (0xFF << 24) |
-			    (((info->cmap.red)[viacursor.image.bg_color] &
-			    0xFF00) << 8) |
-			    ((info->cmap.green)[viacursor.image.bg_color] &
-			    0xFF00) |
-			    (((info->cmap.blue)[viacursor.image.bg_color] &
-			    0xFF00) >> 8);
-			fg_col =
-			    (0xFF << 24) |
-			    (((info->cmap.red)[viacursor.image.fg_color] &
-			    0xFF00) << 8) |
-			    ((info->cmap.green)[viacursor.image.fg_color] &
-			    0xFF00) |
-			    (((info->cmap.blue)[viacursor.image.fg_color] &
-			    0xFF00) >> 8);
-			break;
-		default:
-			return 0;
+		fg_color = cursor->image.fg_color;
+		bg_color = cursor->image.bg_color;
+		if (chip_name == UNICHROME_CX700 ||
+			chip_name == UNICHROME_VX800 ||
+			chip_name == UNICHROME_VX855) {
+			fg_color =
+				((info->cmap.red[fg_color] & 0xFFC0) << 14) |
+				((info->cmap.green[fg_color] & 0xFFC0) << 4) |
+				((info->cmap.blue[fg_color] & 0xFFC0) >> 6);
+			bg_color =
+				((info->cmap.red[bg_color] & 0xFFC0) << 14) |
+				((info->cmap.green[bg_color] & 0xFFC0) << 4) |
+				((info->cmap.blue[bg_color] & 0xFFC0) >> 6);
+		} else {
+			fg_color =
+				((info->cmap.red[fg_color] & 0xFF00) << 8) |
+				(info->cmap.green[fg_color] & 0xFF00) |
+				((info->cmap.blue[fg_color] & 0xFF00) >> 8);
+			bg_color =
+				((info->cmap.red[bg_color] & 0xFF00) << 8) |
+				(info->cmap.green[bg_color] & 0xFF00) |
+				((info->cmap.blue[bg_color] & 0xFF00) >> 8);
 		}
 
-		/* This is indeed a patch for VT3324/VT3353 */
-		if (!info->par)
-			return 0;
-		p_viafb_par = (struct viafb_par *)info->par;
-
-		if ((p_viafb_par->chip_info->gfx_chip_name ==
-			UNICHROME_CX700) ||
-			((p_viafb_par->chip_info->gfx_chip_name ==
-			UNICHROME_VX800))) {
-			bg_col =
-			    (((info->cmap.red)[viacursor.image.bg_color] &
-			    0xFFC0) << 14) |
-			    (((info->cmap.green)[viacursor.image.bg_color] &
-			    0xFFC0) << 4) |
-			    (((info->cmap.blue)[viacursor.image.bg_color] &
-			    0xFFC0) >> 6);
-			fg_col =
-			    (((info->cmap.red)[viacursor.image.fg_color] &
-			    0xFFC0) << 14) |
-			    (((info->cmap.green)[viacursor.image.fg_color] &
-			    0xFFC0) << 4) |
-			    (((info->cmap.blue)[viacursor.image.fg_color] &
-			    0xFFC0) >> 6);
-		}
-
-		writel(bg_col, viaparinfo->io_virt + VIA_REG_CURSOR_BG);
-		writel(fg_col, viaparinfo->io_virt + VIA_REG_CURSOR_FG);
+		writel(bg_color, engine + VIA_REG_CURSOR_BG);
+		writel(fg_color, engine + VIA_REG_CURSOR_FG);
 	}
 
 	if (cursor->set & FB_CUR_SETSHAPE) {
 		struct {
-			u8 data[CURSOR_SIZE / 8];
-			u32 bak[CURSOR_SIZE / 32];
+			u8 data[CURSOR_SIZE];
+			u32 bak[CURSOR_SIZE / 4];
 		} *cr_data = kzalloc(sizeof(*cr_data), GFP_ATOMIC);
-		int size =
-		    ((viacursor.image.width + 7) >> 3) *
-		    viacursor.image.height;
+		int size = ((cursor->image.width + 7) >> 3) *
+			cursor->image.height;
 
-		if (cr_data == NULL)
-			goto out;
+		if (!cr_data)
+			return -ENOMEM;
 
-		if (MAX_CURS == 32) {
-			for (i = 0; i < (CURSOR_SIZE / 32); i++) {
+		if (cur_size == 32) {
+			for (i = 0; i < (CURSOR_SIZE / 4); i++) {
 				cr_data->bak[i] = 0x0;
 				cr_data->bak[i + 1] = 0xFFFFFFFF;
 				i += 1;
 			}
-		} else if (MAX_CURS == 64) {
-			for (i = 0; i < (CURSOR_SIZE / 32); i++) {
+		} else {
+			for (i = 0; i < (CURSOR_SIZE / 4); i++) {
 				cr_data->bak[i] = 0x0;
 				cr_data->bak[i + 1] = 0x0;
 				cr_data->bak[i + 2] = 0xFFFFFFFF;
@@ -1211,27 +966,27 @@
 			}
 		}
 
-		switch (viacursor.rop) {
+		switch (cursor->rop) {
 		case ROP_XOR:
 			for (i = 0; i < size; i++)
-				cr_data->data[i] = viacursor.mask[i];
+				cr_data->data[i] = cursor->mask[i];
 			break;
 		case ROP_COPY:
 
 			for (i = 0; i < size; i++)
-				cr_data->data[i] = viacursor.mask[i];
+				cr_data->data[i] = cursor->mask[i];
 			break;
 		default:
 			break;
 		}
 
-		if (MAX_CURS == 32) {
+		if (cur_size == 32) {
 			for (i = 0; i < size; i++) {
 				cr_data->bak[j] = (u32) cr_data->data[i];
 				cr_data->bak[j + 1] = ~cr_data->bak[j];
 				j += 2;
 			}
-		} else if (MAX_CURS == 64) {
+		} else {
 			for (i = 0; i < size; i++) {
 				cr_data->bak[j] = (u32) cr_data->data[i];
 				cr_data->bak[j + 1] = 0x0;
@@ -1241,14 +996,12 @@
 			}
 		}
 
-		memcpy(((struct viafb_par *)(info->par))->fbmem_virt +
-		       ((struct viafb_par *)(info->par))->cursor_start,
-		       cr_data->bak, CURSOR_SIZE);
-out:
+		memcpy_toio(viafbinfo->screen_base + viapar->shared->
+			cursor_vram_addr, cr_data->bak, CURSOR_SIZE);
 		kfree(cr_data);
 	}
 
-	if (viacursor.enable)
+	if (cursor->enable)
 		viafb_show_hw_cursor(info, HW_Cursor_ON);
 
 	return 0;
@@ -1256,8 +1009,8 @@
 
 static int viafb_sync(struct fb_info *info)
 {
-	if (viafb_accel)
-		viafb_wait_engine_idle();
+	if (!(info->flags & FBINFO_HWACCEL_DISABLED))
+		viafb_wait_engine_idle(info);
 	return 0;
 }
 
@@ -1266,12 +1019,16 @@
 	u32 i;
 	DEBUG_MSG(KERN_INFO "viafb_get_mode_index!\n");
 
-	for (i = 0; viafb_modentry[i].mode_index != VIA_RES_INVALID; i++)
-		if (viafb_modentry[i].xres == hres &&
-			viafb_modentry[i].yres == vres)
+	for (i = 0; i < NUM_TOTAL_MODETABLE; i++)
+		if (CLE266Modes[i].mode_array &&
+			CLE266Modes[i].crtc[0].crtc.hor_addr == hres &&
+			CLE266Modes[i].crtc[0].crtc.ver_addr == vres)
 			break;
 
-	return viafb_modentry[i].mode_index;
+	if (i == NUM_TOTAL_MODETABLE)
+		return VIA_RES_INVALID;
+
+	return CLE266Modes[i].ModeIndex;
 }
 
 static void check_available_device_to_enable(int device_id)
@@ -1375,36 +1132,11 @@
 		viafb_SAMM_ON = active_dev.samm;
 	viafb_primary_dev = active_dev.primary_dev;
 
-	viafb_set_start_addr();
+	viafb_set_primary_address(0);
+	viafb_set_secondary_address(viafb_SAMM_ON ? viafb_second_offset : 0);
 	viafb_set_iga_path();
 }
 
-static void viafb_set_video_device(u32 video_dev_info)
-{
-	viaparinfo->video_on_crt = STATE_OFF;
-	viaparinfo->video_on_dvi = STATE_OFF;
-	viaparinfo->video_on_lcd = STATE_OFF;
-
-	/* Check available device to enable: */
-	if ((video_dev_info & CRT_Device) == CRT_Device)
-		viaparinfo->video_on_crt = STATE_ON;
-	else if ((video_dev_info & DVI_Device) == DVI_Device)
-		viaparinfo->video_on_dvi = STATE_ON;
-	else if ((video_dev_info & LCD_Device) == LCD_Device)
-		viaparinfo->video_on_lcd = STATE_ON;
-}
-
-static void viafb_get_video_device(u32 *video_dev_info)
-{
-	*video_dev_info = None_Device;
-	if (viaparinfo->video_on_crt == STATE_ON)
-		*video_dev_info |= CRT_Device;
-	else if (viaparinfo->video_on_dvi == STATE_ON)
-		*video_dev_info |= DVI_Device;
-	else if (viaparinfo->video_on_lcd == STATE_ON)
-		*video_dev_info |= LCD_Device;
-}
-
 static int get_primary_device(void)
 {
 	int primary_device = 0;
@@ -1446,18 +1178,6 @@
 	return primary_device;
 }
 
-static u8 is_duoview(void)
-{
-	if (0 == viafb_SAMM_ON) {
-		if (viafb_LCD_ON + viafb_LCD2_ON +
-			viafb_DVI_ON + viafb_CRT_ON == 2)
-			return true;
-		return false;
-	} else {
-		return false;
-	}
-}
-
 static void apply_second_mode_setting(struct fb_var_screeninfo
 	*sec_var)
 {
@@ -1559,14 +1279,13 @@
 			if (viafb_SAMM_ON)
 				viafb_primary_dev = setting_info.primary_device;
 
-			viafb_set_start_addr();
+			viafb_set_primary_address(0);
+			viafb_set_secondary_address(viafb_SAMM_ON ? viafb_second_offset : 0);
 			viafb_set_iga_path();
 		}
 		need_set_mode = 1;
 	}
 
-	viaparinfo->duoview = is_duoview();
-
 	if (!need_set_mode) {
 		;
 	} else {
@@ -1589,18 +1308,6 @@
 		setting_info->device_status |= LCD_Device;
 	if (viafb_LCD2_ON == 1)
 		setting_info->device_status |= LCD2_Device;
-	if ((viaparinfo->video_on_crt == 1) && (viafb_CRT_ON == 1)) {
-		setting_info->video_device_status =
-			viaparinfo->crt_setting_info->iga_path;
-	} else if ((viaparinfo->video_on_dvi == 1) && (viafb_DVI_ON == 1)) {
-		setting_info->video_device_status =
-			viaparinfo->tmds_setting_info->iga_path;
-	} else if ((viaparinfo->video_on_lcd == 1) && (viafb_LCD_ON == 1)) {
-		setting_info->video_device_status =
-			viaparinfo->lvds_setting_info->iga_path;
-	} else {
-		setting_info->video_device_status = 0;
-	}
 
 	setting_info->samm_status = viafb_SAMM_ON;
 	setting_info->primary_device = get_primary_device();
@@ -1687,25 +1394,6 @@
 		viafb_CRT_ON = STATE_ON;
 		viafb_SAMM_ON = STATE_OFF;
 	}
-	viaparinfo->duoview = is_duoview();
-}
-
-static void parse_video_dev(void)
-{
-	viaparinfo->video_on_crt = STATE_OFF;
-	viaparinfo->video_on_dvi = STATE_OFF;
-	viaparinfo->video_on_lcd = STATE_OFF;
-
-	if (!strncmp(viafb_video_dev, "CRT", 3)) {
-		/* Video on CRT */
-		viaparinfo->video_on_crt = STATE_ON;
-	} else if (!strncmp(viafb_video_dev, "DVI", 3)) {
-		/* Video on DVI */
-		viaparinfo->video_on_dvi = STATE_ON;
-	} else if (!strncmp(viafb_video_dev, "LCD", 3)) {
-		/* Video on LCD */
-		viaparinfo->video_on_lcd = STATE_ON;
-	}
 }
 
 static int parse_port(char *opt_str, int *output_interface)
@@ -1754,10 +1442,8 @@
  * DVP1Driving, DFPHigh, DFPLow CR96,   SR2A[5], SR1B[1], SR2A[4], SR1E[2],
  * CR9B,    SR65,    CR97,    CR99
  */
-static int viafb_dvp0_proc_read(char *buf, char **start, off_t offset,
-int count, int *eof, void *data)
+static int viafb_dvp0_proc_show(struct seq_file *m, void *v)
 {
-	int len = 0;
 	u8 dvp0_data_dri = 0, dvp0_clk_dri = 0, dvp0 = 0;
 	dvp0_data_dri =
 	    (viafb_read_reg(VIASR, SR2A) & BIT5) >> 4 |
@@ -1766,13 +1452,17 @@
 	    (viafb_read_reg(VIASR, SR2A) & BIT4) >> 3 |
 	    (viafb_read_reg(VIASR, SR1E) & BIT2) >> 2;
 	dvp0 = viafb_read_reg(VIACR, CR96) & 0x0f;
-	len +=
-	    sprintf(buf + len, "%x %x %x\n", dvp0, dvp0_data_dri, dvp0_clk_dri);
-	*eof = 1;		/*Inform kernel end of data */
-	return len;
+	seq_printf(m, "%x %x %x\n", dvp0, dvp0_data_dri, dvp0_clk_dri);
+	return 0;
 }
-static int viafb_dvp0_proc_write(struct file *file,
-	const char __user *buffer, unsigned long count, void *data)
+
+static int viafb_dvp0_proc_open(struct inode *inode, struct file *file)
+{
+	return single_open(file, viafb_dvp0_proc_show, NULL);
+}
+
+static ssize_t viafb_dvp0_proc_write(struct file *file,
+	const char __user *buffer, size_t count, loff_t *pos)
 {
 	char buf[20], *value, *pbuf;
 	u8 reg_val = 0;
@@ -1816,21 +1506,33 @@
 	}
 	return count;
 }
-static int viafb_dvp1_proc_read(char *buf, char **start, off_t offset,
-	int count, int *eof, void *data)
+
+static const struct file_operations viafb_dvp0_proc_fops = {
+	.owner		= THIS_MODULE,
+	.open		= viafb_dvp0_proc_open,
+	.read		= seq_read,
+	.llseek		= seq_lseek,
+	.release	= single_release,
+	.write		= viafb_dvp0_proc_write,
+};
+
+static int viafb_dvp1_proc_show(struct seq_file *m, void *v)
 {
-	int len = 0;
 	u8 dvp1 = 0, dvp1_data_dri = 0, dvp1_clk_dri = 0;
 	dvp1 = viafb_read_reg(VIACR, CR9B) & 0x0f;
 	dvp1_data_dri = (viafb_read_reg(VIASR, SR65) & 0x0c) >> 2;
 	dvp1_clk_dri = viafb_read_reg(VIASR, SR65) & 0x03;
-	len +=
-	    sprintf(buf + len, "%x %x %x\n", dvp1, dvp1_data_dri, dvp1_clk_dri);
-	*eof = 1;		/*Inform kernel end of data */
-	return len;
+	seq_printf(m, "%x %x %x\n", dvp1, dvp1_data_dri, dvp1_clk_dri);
+	return 0;
 }
-static int viafb_dvp1_proc_write(struct file *file,
-	const char __user *buffer, unsigned long count, void *data)
+
+static int viafb_dvp1_proc_open(struct inode *inode, struct file *file)
+{
+	return single_open(file, viafb_dvp1_proc_show, NULL);
+}
+
+static ssize_t viafb_dvp1_proc_write(struct file *file,
+	const char __user *buffer, size_t count, loff_t *pos)
 {
 	char buf[20], *value, *pbuf;
 	u8 reg_val = 0;
@@ -1869,18 +1571,30 @@
 	return count;
 }
 
-static int viafb_dfph_proc_read(char *buf, char **start, off_t offset,
-	int count, int *eof, void *data)
+static const struct file_operations viafb_dvp1_proc_fops = {
+	.owner		= THIS_MODULE,
+	.open		= viafb_dvp1_proc_open,
+	.read		= seq_read,
+	.llseek		= seq_lseek,
+	.release	= single_release,
+	.write		= viafb_dvp1_proc_write,
+};
+
+static int viafb_dfph_proc_show(struct seq_file *m, void *v)
 {
-	int len = 0;
 	u8 dfp_high = 0;
 	dfp_high = viafb_read_reg(VIACR, CR97) & 0x0f;
-	len += sprintf(buf + len, "%x\n", dfp_high);
-	*eof = 1;		/*Inform kernel end of data */
-	return len;
+	seq_printf(m, "%x\n", dfp_high);
+	return 0;
 }
-static int viafb_dfph_proc_write(struct file *file,
-	const char __user *buffer, unsigned long count, void *data)
+
+static int viafb_dfph_proc_open(struct inode *inode, struct file *file)
+{
+	return single_open(file, viafb_dfph_proc_show, NULL);
+}
+
+static ssize_t viafb_dfph_proc_write(struct file *file,
+	const char __user *buffer, size_t count, loff_t *pos)
 {
 	char buf[20];
 	u8 reg_val = 0;
@@ -1895,18 +1609,31 @@
 	viafb_write_reg_mask(CR97, VIACR, reg_val, 0x0f);
 	return count;
 }
-static int viafb_dfpl_proc_read(char *buf, char **start, off_t offset,
-	int count, int *eof, void *data)
+
+static const struct file_operations viafb_dfph_proc_fops = {
+	.owner		= THIS_MODULE,
+	.open		= viafb_dfph_proc_open,
+	.read		= seq_read,
+	.llseek		= seq_lseek,
+	.release	= single_release,
+	.write		= viafb_dfph_proc_write,
+};
+
+static int viafb_dfpl_proc_show(struct seq_file *m, void *v)
 {
-	int len = 0;
 	u8 dfp_low = 0;
 	dfp_low = viafb_read_reg(VIACR, CR99) & 0x0f;
-	len += sprintf(buf + len, "%x\n", dfp_low);
-	*eof = 1;		/*Inform kernel end of data */
-	return len;
+	seq_printf(m, "%x\n", dfp_low);
+	return 0;
 }
-static int viafb_dfpl_proc_write(struct file *file,
-	const char __user *buffer, unsigned long count, void *data)
+
+static int viafb_dfpl_proc_open(struct inode *inode, struct file *file)
+{
+	return single_open(file, viafb_dfpl_proc_show, NULL);
+}
+
+static ssize_t viafb_dfpl_proc_write(struct file *file,
+	const char __user *buffer, size_t count, loff_t *pos)
 {
 	char buf[20];
 	u8 reg_val = 0;
@@ -1921,10 +1648,18 @@
 	viafb_write_reg_mask(CR99, VIACR, reg_val, 0x0f);
 	return count;
 }
-static int viafb_vt1636_proc_read(char *buf, char **start,
-	off_t offset, int count, int *eof, void *data)
+
+static const struct file_operations viafb_dfpl_proc_fops = {
+	.owner		= THIS_MODULE,
+	.open		= viafb_dfpl_proc_open,
+	.read		= seq_read,
+	.llseek		= seq_lseek,
+	.release	= single_release,
+	.write		= viafb_dfpl_proc_write,
+};
+
+static int viafb_vt1636_proc_show(struct seq_file *m, void *v)
 {
-	int len = 0;
 	u8 vt1636_08 = 0, vt1636_09 = 0;
 	switch (viaparinfo->chip_info->lvds_chip_info.lvds_chip_name) {
 	case VT1636_LVDS:
@@ -1934,7 +1669,7 @@
 		vt1636_09 =
 		    viafb_gpio_i2c_read_lvds(viaparinfo->lvds_setting_info,
 		    &viaparinfo->chip_info->lvds_chip_info, 0x09) & 0x1f;
-		len += sprintf(buf + len, "%x %x\n", vt1636_08, vt1636_09);
+		seq_printf(m, "%x %x\n", vt1636_08, vt1636_09);
 		break;
 	default:
 		break;
@@ -1947,16 +1682,21 @@
 		vt1636_09 =
 		    viafb_gpio_i2c_read_lvds(viaparinfo->lvds_setting_info2,
 			&viaparinfo->chip_info->lvds_chip_info2, 0x09) & 0x1f;
-		len += sprintf(buf + len, " %x %x\n", vt1636_08, vt1636_09);
+		seq_printf(m, " %x %x\n", vt1636_08, vt1636_09);
 		break;
 	default:
 		break;
 	}
-	*eof = 1;		/*Inform kernel end of data */
-	return len;
+	return 0;
 }
-static int viafb_vt1636_proc_write(struct file *file,
-	const char __user *buffer, unsigned long count, void *data)
+
+static int viafb_vt1636_proc_open(struct inode *inode, struct file *file)
+{
+	return single_open(file, viafb_vt1636_proc_show, NULL);
+}
+
+static ssize_t viafb_vt1636_proc_write(struct file *file,
+	const char __user *buffer, size_t count, loff_t *pos)
 {
 	char buf[30], *value, *pbuf;
 	struct IODATA reg_val;
@@ -2045,39 +1785,27 @@
 	return count;
 }
 
+static const struct file_operations viafb_vt1636_proc_fops = {
+	.owner		= THIS_MODULE,
+	.open		= viafb_vt1636_proc_open,
+	.read		= seq_read,
+	.llseek		= seq_lseek,
+	.release	= single_release,
+	.write		= viafb_vt1636_proc_write,
+};
+
 static void viafb_init_proc(struct proc_dir_entry **viafb_entry)
 {
-	struct proc_dir_entry *entry;
 	*viafb_entry = proc_mkdir("viafb", NULL);
 	if (viafb_entry) {
-		entry = create_proc_entry("dvp0", 0, *viafb_entry);
-		if (entry) {
-			entry->read_proc = viafb_dvp0_proc_read;
-			entry->write_proc = viafb_dvp0_proc_write;
-		}
-		entry = create_proc_entry("dvp1", 0, *viafb_entry);
-		if (entry) {
-			entry->read_proc = viafb_dvp1_proc_read;
-			entry->write_proc = viafb_dvp1_proc_write;
-		}
-		entry = create_proc_entry("dfph", 0, *viafb_entry);
-		if (entry) {
-			entry->read_proc = viafb_dfph_proc_read;
-			entry->write_proc = viafb_dfph_proc_write;
-		}
-		entry = create_proc_entry("dfpl", 0, *viafb_entry);
-		if (entry) {
-			entry->read_proc = viafb_dfpl_proc_read;
-			entry->write_proc = viafb_dfpl_proc_write;
-		}
+		proc_create("dvp0", 0, *viafb_entry, &viafb_dvp0_proc_fops);
+		proc_create("dvp1", 0, *viafb_entry, &viafb_dvp1_proc_fops);
+		proc_create("dfph", 0, *viafb_entry, &viafb_dfph_proc_fops);
+		proc_create("dfpl", 0, *viafb_entry, &viafb_dfpl_proc_fops);
 		if (VT1636_LVDS == viaparinfo->chip_info->lvds_chip_info.
 			lvds_chip_name || VT1636_LVDS ==
 		    viaparinfo->chip_info->lvds_chip_info2.lvds_chip_name) {
-			entry = create_proc_entry("vt1636", 0, *viafb_entry);
-			if (entry) {
-				entry->read_proc = viafb_vt1636_proc_read;
-				entry->write_proc = viafb_vt1636_proc_write;
-			}
+			proc_create("vt1636", 0, *viafb_entry, &viafb_vt1636_proc_fops);
 		}
 
 	}
@@ -2094,51 +1822,61 @@
 	remove_proc_entry("viafb", NULL);
 }
 
-static int __devinit via_pci_probe(void)
+static void parse_mode(const char *str, u32 *xres, u32 *yres)
 {
-	unsigned long default_xres, default_yres;
-	char *tmpc, *tmpm;
-	char *tmpc_sec, *tmpm_sec;
+	char *ptr;
+
+	*xres = simple_strtoul(str, &ptr, 10);
+	if (ptr[0] != 'x')
+		goto out_default;
+
+	*yres = simple_strtoul(&ptr[1], &ptr, 10);
+	if (ptr[0])
+		goto out_default;
+
+	return;
+
+out_default:
+	printk(KERN_WARNING "viafb received invalid mode string: %s\n", str);
+	*xres = 640;
+	*yres = 480;
+}
+
+static int __devinit via_pci_probe(struct pci_dev *pdev,
+				   const struct pci_device_id *ent)
+{
+	u32 default_xres, default_yres;
 	int vmode_index;
-	u32 tmds_length, lvds_length, crt_length, chip_length, viafb_par_length;
+	u32 viafb_par_length;
 
 	DEBUG_MSG(KERN_INFO "VIAFB PCI Probe!!\n");
 
 	viafb_par_length = ALIGN(sizeof(struct viafb_par), BITS_PER_LONG/8);
-	tmds_length = ALIGN(sizeof(struct tmds_setting_information),
-		BITS_PER_LONG/8);
-	lvds_length = ALIGN(sizeof(struct lvds_setting_information),
-		BITS_PER_LONG/8);
-	crt_length = ALIGN(sizeof(struct lvds_setting_information),
-		BITS_PER_LONG/8);
-	chip_length = ALIGN(sizeof(struct chip_information), BITS_PER_LONG/8);
 
 	/* Allocate fb_info and ***_par here, also including some other needed
 	 * variables
 	*/
-	viafbinfo = framebuffer_alloc(viafb_par_length + 2 * lvds_length +
-	tmds_length + crt_length + chip_length, NULL);
+	viafbinfo = framebuffer_alloc(viafb_par_length +
+		ALIGN(sizeof(struct viafb_shared), BITS_PER_LONG/8),
+		&pdev->dev);
 	if (!viafbinfo) {
 		printk(KERN_ERR"Could not allocate memory for viafb_info.\n");
 		return -ENODEV;
 	}
 
 	viaparinfo = (struct viafb_par *)viafbinfo->par;
-	viaparinfo->tmds_setting_info = (struct tmds_setting_information *)
-		((unsigned long)viaparinfo + viafb_par_length);
-	viaparinfo->lvds_setting_info = (struct lvds_setting_information *)
-		((unsigned long)viaparinfo->tmds_setting_info + tmds_length);
-	viaparinfo->lvds_setting_info2 = (struct lvds_setting_information *)
-		((unsigned long)viaparinfo->lvds_setting_info + lvds_length);
-	viaparinfo->crt_setting_info = (struct crt_setting_information *)
-		((unsigned long)viaparinfo->lvds_setting_info2 + lvds_length);
-	viaparinfo->chip_info = (struct chip_information *)
-		((unsigned long)viaparinfo->crt_setting_info + crt_length);
+	viaparinfo->shared = viafbinfo->par + viafb_par_length;
+	viaparinfo->vram_addr = 0;
+	viaparinfo->tmds_setting_info = &viaparinfo->shared->tmds_setting_info;
+	viaparinfo->lvds_setting_info = &viaparinfo->shared->lvds_setting_info;
+	viaparinfo->lvds_setting_info2 =
+		&viaparinfo->shared->lvds_setting_info2;
+	viaparinfo->crt_setting_info = &viaparinfo->shared->crt_setting_info;
+	viaparinfo->chip_info = &viaparinfo->shared->chip_info;
 
 	if (viafb_dual_fb)
 		viafb_SAMM_ON = 1;
 	parse_active_dev();
-	parse_video_dev();
 	parse_lcd_port();
 	parse_dvi_port();
 
@@ -2149,32 +1887,32 @@
 	/* Set up I2C bus stuff */
 	viafb_create_i2c_bus(viaparinfo);
 
-	viafb_init_chip_info();
-	viafb_get_fb_info(&viaparinfo->fbmem, &viaparinfo->memsize);
+	viafb_init_chip_info(pdev, ent);
+	viaparinfo->fbmem = pci_resource_start(pdev, 0);
+	viaparinfo->memsize = viafb_get_fb_size_from_pci();
 	viaparinfo->fbmem_free = viaparinfo->memsize;
 	viaparinfo->fbmem_used = 0;
-	viaparinfo->fbmem_virt = ioremap_nocache(viaparinfo->fbmem,
+	viafbinfo->screen_base = ioremap_nocache(viaparinfo->fbmem,
 		viaparinfo->memsize);
-	viafbinfo->screen_base = (char *)viaparinfo->fbmem_virt;
-
-	if (!viaparinfo->fbmem_virt) {
+	if (!viafbinfo->screen_base) {
 		printk(KERN_INFO "ioremap failed\n");
-		return -1;
+		return -ENOMEM;
 	}
 
-	viafb_get_mmio_info(&viaparinfo->mmio_base, &viaparinfo->mmio_len);
-	viaparinfo->io_virt = ioremap_nocache(viaparinfo->mmio_base,
-		viaparinfo->mmio_len);
-
+	viafbinfo->fix.mmio_start = pci_resource_start(pdev, 1);
+	viafbinfo->fix.mmio_len = pci_resource_len(pdev, 1);
 	viafbinfo->node = 0;
 	viafbinfo->fbops = &viafb_ops;
 	viafbinfo->flags = FBINFO_DEFAULT | FBINFO_HWACCEL_YPAN;
 
 	viafbinfo->pseudo_palette = pseudo_pal;
-	if (viafb_accel) {
-		viafb_init_accel();
-		viafb_init_2d_engine();
-		viafb_hw_cursor_init();
+	if (viafb_accel && !viafb_init_engine(viafbinfo)) {
+		viafbinfo->flags |= FBINFO_HWACCEL_COPYAREA |
+			FBINFO_HWACCEL_FILLRECT |  FBINFO_HWACCEL_IMAGEBLIT;
+		default_var.accel_flags = FB_ACCELF_TEXT;
+	} else {
+		viafbinfo->flags |= FBINFO_HWACCEL_DISABLED;
+		default_var.accel_flags = 0;
 	}
 
 	if (viafb_second_size && (viafb_second_size < 8)) {
@@ -2186,27 +1924,14 @@
 			viafb_second_size * 1024 * 1024;
 	}
 
-	viafb_FB_MM = viaparinfo->fbmem_virt;
-	tmpm = viafb_mode;
-	tmpc = strsep(&tmpm, "x");
-	strict_strtoul(tmpc, 0, &default_xres);
-	strict_strtoul(tmpm, 0, &default_yres);
-
+	parse_mode(viafb_mode, &default_xres, &default_yres);
 	vmode_index = viafb_get_mode_index(default_xres, default_yres);
 	DEBUG_MSG(KERN_INFO "0->index=%d\n", vmode_index);
 
 	if (viafb_SAMM_ON == 1) {
-		if (strcmp(viafb_mode, viafb_mode1)) {
-			tmpm_sec = viafb_mode1;
-			tmpc_sec = strsep(&tmpm_sec, "x");
-			strict_strtoul(tmpc_sec, 0,
-				(unsigned long *)&viafb_second_xres);
-			strict_strtoul(tmpm_sec, 0,
-				(unsigned long *)&viafb_second_yres);
-		} else {
-			viafb_second_xres = default_xres;
-			viafb_second_yres = default_yres;
-		}
+		parse_mode(viafb_mode1, &viafb_second_xres,
+			&viafb_second_yres);
+
 		if (0 == viafb_second_virtual_xres) {
 			switch (viafb_second_xres) {
 			case 1400:
@@ -2256,18 +1981,9 @@
 	default_var.lower_margin = 4;
 	default_var.hsync_len = default_var.left_margin;
 	default_var.vsync_len = 4;
-	default_var.accel_flags = 0;
-
-	if (viafb_accel) {
-		viafbinfo->flags |=
-		    (FBINFO_HWACCEL_COPYAREA | FBINFO_HWACCEL_FILLRECT |
-		     FBINFO_HWACCEL_IMAGEBLIT);
-		default_var.accel_flags |= FB_ACCELF_TEXT;
-	} else
-		viafbinfo->flags |= FBINFO_HWACCEL_DISABLED;
 
 	if (viafb_dual_fb) {
-		viafbinfo1 = framebuffer_alloc(viafb_par_length, NULL);
+		viafbinfo1 = framebuffer_alloc(viafb_par_length, &pdev->dev);
 		if (!viafbinfo1) {
 			printk(KERN_ERR
 			"allocate the second framebuffer struct error\n");
@@ -2276,11 +1992,10 @@
 		}
 		viaparinfo1 = viafbinfo1->par;
 		memcpy(viaparinfo1, viaparinfo, viafb_par_length);
+		viaparinfo1->vram_addr = viafb_second_offset;
 		viaparinfo1->memsize = viaparinfo->memsize -
 			viafb_second_offset;
 		viaparinfo->memsize = viafb_second_offset;
-		viaparinfo1->fbmem_virt = viaparinfo->fbmem_virt +
-			viafb_second_offset;
 		viaparinfo1->fbmem = viaparinfo->fbmem + viafb_second_offset;
 
 		viaparinfo1->fbmem_used = viaparinfo->fbmem_used;
@@ -2288,20 +2003,13 @@
 			viaparinfo1->fbmem_used;
 		viaparinfo->fbmem_free = viaparinfo->memsize;
 		viaparinfo->fbmem_used = 0;
-		if (viafb_accel) {
-			viaparinfo1->cursor_start =
-			    viaparinfo->cursor_start - viafb_second_offset;
-			viaparinfo1->VQ_start = viaparinfo->VQ_start -
-				viafb_second_offset;
-			viaparinfo1->VQ_end = viaparinfo->VQ_end -
-				viafb_second_offset;
-		}
 
+		viaparinfo->iga_path = IGA1;
+		viaparinfo1->iga_path = IGA2;
 		memcpy(viafbinfo1, viafbinfo, sizeof(struct fb_info));
+		viafbinfo1->par = viaparinfo1;
 		viafbinfo1->screen_base = viafbinfo->screen_base +
 			viafb_second_offset;
-		viafbinfo1->fix.smem_start = viaparinfo1->fbmem;
-		viafbinfo1->fix.smem_len = viaparinfo1->fbmem_free;
 
 		default_var.xres = viafb_second_xres;
 		default_var.yres = viafb_second_yres;
@@ -2323,15 +2031,17 @@
 		viafb_setup_fixinfo(&viafbinfo1->fix, viaparinfo1);
 		viafb_check_var(&default_var, viafbinfo1);
 		viafbinfo1->var = default_var;
-		viafb_update_viafb_par(viafbinfo);
-		viafb_update_fix(&viafbinfo1->fix, viafbinfo1);
+		viafb_update_fix(viafbinfo1);
+		viaparinfo1->depth = fb_get_color_depth(&viafbinfo1->var,
+			&viafbinfo1->fix);
 	}
 
 	viafb_setup_fixinfo(&viafbinfo->fix, viaparinfo);
 	viafb_check_var(&default_var, viafbinfo);
 	viafbinfo->var = default_var;
-	viafb_update_viafb_par(viafbinfo);
-	viafb_update_fix(&viafbinfo->fix, viafbinfo);
+	viafb_update_fix(viafbinfo);
+	viaparinfo->depth = fb_get_color_depth(&viafbinfo->var,
+		&viafbinfo->fix);
 	default_var.activate = FB_ACTIVATE_NOW;
 	fb_alloc_cmap(&viafbinfo->cmap, 256, 0);
 
@@ -2353,20 +2063,20 @@
 		  viafbinfo->node, viafbinfo->fix.id, default_var.xres,
 		  default_var.yres, default_var.bits_per_pixel);
 
-	viafb_init_proc(&viaparinfo->proc_entry);
+	viafb_init_proc(&viaparinfo->shared->proc_entry);
 	viafb_init_dac(IGA2);
 	return 0;
 }
 
-static void __devexit via_pci_remove(void)
+static void __devexit via_pci_remove(struct pci_dev *pdev)
 {
 	DEBUG_MSG(KERN_INFO "via_pci_remove!\n");
 	fb_dealloc_cmap(&viafbinfo->cmap);
 	unregister_framebuffer(viafbinfo);
 	if (viafb_dual_fb)
 		unregister_framebuffer(viafbinfo1);
-	iounmap((void *)viaparinfo->fbmem_virt);
-	iounmap(viaparinfo->io_virt);
+	iounmap((void *)viafbinfo->screen_base);
+	iounmap(viaparinfo->shared->engine_mmio);
 
 	viafb_delete_i2c_buss(viaparinfo);
 
@@ -2374,7 +2084,7 @@
 	if (viafb_dual_fb)
 		framebuffer_release(viafbinfo1);
 
-	viafb_remove_proc(viaparinfo->proc_entry);
+	viafb_remove_proc(viaparinfo->shared->proc_entry);
 }
 
 #ifndef MODULE
@@ -2441,8 +2151,6 @@
 		else if (!strncmp(this_opt, "viafb_lcd_mode=", 15))
 			strict_strtoul(this_opt + 15, 0,
 				(unsigned long *)&viafb_lcd_mode);
-		else if (!strncmp(this_opt, "viafb_video_dev=", 16))
-			viafb_video_dev = kstrdup(this_opt + 16, GFP_KERNEL);
 		else if (!strncmp(this_opt, "viafb_lcd_port=", 15))
 			viafb_lcd_port = kstrdup(this_opt + 15, GFP_KERNEL);
 		else if (!strncmp(this_opt, "viafb_dvi_port=", 15))
@@ -2452,6 +2160,40 @@
 }
 #endif
 
+static struct pci_device_id viafb_pci_table[] __devinitdata = {
+	{ PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_CLE266_DID),
+	  .driver_data = UNICHROME_CLE266 },
+	{ PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_PM800_DID),
+	  .driver_data = UNICHROME_PM800 },
+	{ PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_K400_DID),
+	  .driver_data = UNICHROME_K400 },
+	{ PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_K800_DID),
+	  .driver_data = UNICHROME_K800 },
+	{ PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_P4M890_DID),
+	  .driver_data = UNICHROME_CN700 },
+	{ PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_K8M890_DID),
+	  .driver_data = UNICHROME_K8M890 },
+	{ PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_CX700_DID),
+	  .driver_data = UNICHROME_CX700 },
+	{ PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_P4M900_DID),
+	  .driver_data = UNICHROME_P4M900 },
+	{ PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_CN750_DID),
+	  .driver_data = UNICHROME_CN750 },
+	{ PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_VX800_DID),
+	  .driver_data = UNICHROME_VX800 },
+	{ PCI_DEVICE(PCI_VENDOR_ID_VIA, UNICHROME_VX855_DID),
+	  .driver_data = UNICHROME_VX855 },
+	{ }
+};
+MODULE_DEVICE_TABLE(pci, viafb_pci_table);
+
+static struct pci_driver viafb_driver = {
+	.name		= "viafb",
+	.id_table	= viafb_pci_table,
+	.probe		= via_pci_probe,
+	.remove		= __devexit_p(via_pci_remove),
+};
+
 static int __init viafb_init(void)
 {
 #ifndef MODULE
@@ -2463,13 +2205,13 @@
 	printk(KERN_INFO
        "VIA Graphics Intergration Chipset framebuffer %d.%d initializing\n",
 	       VERSION_MAJOR, VERSION_MINOR);
-	return via_pci_probe();
+	return pci_register_driver(&viafb_driver);
 }
 
 static void __exit viafb_exit(void)
 {
 	DEBUG_MSG(KERN_INFO "viafb_exit!\n");
-	via_pci_remove();
+	pci_unregister_driver(&viafb_driver);
 }
 
 static struct fb_ops viafb_ops = {
@@ -2494,82 +2236,79 @@
 module_exit(viafb_exit);
 
 #ifdef MODULE
-module_param(viafb_memsize, int, 0);
+module_param(viafb_memsize, int, S_IRUSR);
 
-module_param(viafb_mode, charp, 0);
+module_param(viafb_mode, charp, S_IRUSR);
 MODULE_PARM_DESC(viafb_mode, "Set resolution (default=640x480)");
 
-module_param(viafb_mode1, charp, 0);
+module_param(viafb_mode1, charp, S_IRUSR);
 MODULE_PARM_DESC(viafb_mode1, "Set resolution (default=640x480)");
 
-module_param(viafb_bpp, int, 0);
+module_param(viafb_bpp, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_bpp, "Set color depth (default=32bpp)");
 
-module_param(viafb_bpp1, int, 0);
+module_param(viafb_bpp1, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_bpp1, "Set color depth (default=32bpp)");
 
-module_param(viafb_refresh, int, 0);
+module_param(viafb_refresh, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_refresh,
 	"Set CRT viafb_refresh rate (default = 60)");
 
-module_param(viafb_refresh1, int, 0);
+module_param(viafb_refresh1, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_refresh1,
 	"Set CRT refresh rate (default = 60)");
 
-module_param(viafb_lcd_panel_id, int, 0);
+module_param(viafb_lcd_panel_id, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_lcd_panel_id,
 	"Set Flat Panel type(Default=1024x768)");
 
-module_param(viafb_lcd_dsp_method, int, 0);
+module_param(viafb_lcd_dsp_method, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_lcd_dsp_method,
 	"Set Flat Panel display scaling method.(Default=Expandsion)");
 
-module_param(viafb_SAMM_ON, int, 0);
+module_param(viafb_SAMM_ON, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_SAMM_ON,
 	"Turn on/off flag of SAMM(Default=OFF)");
 
-module_param(viafb_accel, int, 0);
+module_param(viafb_accel, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_accel,
-	"Set 2D Hardware Acceleration.(Default = OFF)");
+	"Set 2D Hardware Acceleration: 0 = OFF, 1 = ON (default)");
 
-module_param(viafb_active_dev, charp, 0);
+module_param(viafb_active_dev, charp, S_IRUSR);
 MODULE_PARM_DESC(viafb_active_dev, "Specify active devices.");
 
-module_param(viafb_display_hardware_layout, int, 0);
+module_param(viafb_display_hardware_layout, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_display_hardware_layout,
 	"Display Hardware Layout (LCD Only, DVI Only...,etc)");
 
-module_param(viafb_second_size, int, 0);
+module_param(viafb_second_size, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_second_size,
 	"Set secondary device memory size");
 
-module_param(viafb_dual_fb, int, 0);
+module_param(viafb_dual_fb, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_dual_fb,
 	"Turn on/off flag of dual framebuffer devices.(Default = OFF)");
 
-module_param(viafb_platform_epia_dvi, int, 0);
+module_param(viafb_platform_epia_dvi, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_platform_epia_dvi,
 	"Turn on/off flag of DVI devices on EPIA board.(Default = OFF)");
 
-module_param(viafb_device_lcd_dualedge, int, 0);
+module_param(viafb_device_lcd_dualedge, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_device_lcd_dualedge,
 	"Turn on/off flag of dual edge panel.(Default = OFF)");
 
-module_param(viafb_bus_width, int, 0);
+module_param(viafb_bus_width, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_bus_width,
 	"Set bus width of panel.(Default = 12)");
 
-module_param(viafb_lcd_mode, int, 0);
+module_param(viafb_lcd_mode, int, S_IRUSR);
 MODULE_PARM_DESC(viafb_lcd_mode,
 	"Set Flat Panel mode(Default=OPENLDI)");
 
-module_param(viafb_video_dev, charp, 0);
-MODULE_PARM_DESC(viafb_video_dev, "Specify video devices.");
-
-module_param(viafb_lcd_port, charp, 0);
+module_param(viafb_lcd_port, charp, S_IRUSR);
 MODULE_PARM_DESC(viafb_lcd_port, "Specify LCD output port.");
 
-module_param(viafb_dvi_port, charp, 0);
+module_param(viafb_dvi_port, charp, S_IRUSR);
 MODULE_PARM_DESC(viafb_dvi_port, "Specify DVI output port.");
 
 MODULE_LICENSE("GPL");
diff --git a/drivers/video/via/viafbdev.h b/drivers/video/via/viafbdev.h
index 227b000..0c94d24 100644
--- a/drivers/video/via/viafbdev.h
+++ b/drivers/video/via/viafbdev.h
@@ -37,51 +37,50 @@
 #define VERSION_OS          0	/* 0: for 32 bits OS, 1: for 64 bits OS */
 #define VERSION_MINOR       4
 
-struct viafb_par {
-	int bpp;
-	int hres;
-	int vres;
-	int linelength;
-	u32 xoffset;
-	u32 yoffset;
-
-	void __iomem *fbmem_virt;	/*framebuffer virtual memory address */
-	void __iomem *io_virt;	/*iospace virtual memory address */
-	unsigned int fbmem;	/*framebuffer physical memory address */
-	unsigned int memsize;	/*size of fbmem */
-	unsigned int io;	/*io space address */
-	unsigned long mmio_base;	/*mmio base address */
-	unsigned long mmio_len;	/*mmio base length */
-	u32 fbmem_free;		/* Free FB memory */
-	u32 fbmem_used;		/* Use FB memory size */
-	u32 cursor_start;	/* Cursor Start Address */
-	u32 VQ_start;		/* Virtual Queue Start Address */
-	u32 VQ_end;		/* Virtual Queue End Address */
-	u32 iga_path;
+struct viafb_shared {
 	struct proc_dir_entry *proc_entry;	/*viafb proc entry */
-	u8 duoview;		/*Is working in duoview mode? */
 
 	/* I2C stuff */
 	struct via_i2c_stuff i2c_stuff;
 
 	/* All the information will be needed to set engine */
+	struct tmds_setting_information tmds_setting_info;
+	struct crt_setting_information crt_setting_info;
+	struct lvds_setting_information lvds_setting_info;
+	struct lvds_setting_information lvds_setting_info2;
+	struct chip_information chip_info;
+
+	/* hardware acceleration stuff */
+	void __iomem *engine_mmio;
+	u32 cursor_vram_addr;
+	u32 vq_vram_addr;	/* virtual queue address in video ram */
+	int (*hw_bitblt)(void __iomem *engine, u8 op, u32 width, u32 height,
+		u8 dst_bpp, u32 dst_addr, u32 dst_pitch, u32 dst_x, u32 dst_y,
+		u32 *src_mem, u32 src_addr, u32 src_pitch, u32 src_x, u32 src_y,
+		u32 fg_color, u32 bg_color, u8 fill_rop);
+};
+
+struct viafb_par {
+	u8 depth;
+	u32 vram_addr;
+
+	unsigned int fbmem;	/*framebuffer physical memory address */
+	unsigned int memsize;	/*size of fbmem */
+	u32 fbmem_free;		/* Free FB memory */
+	u32 fbmem_used;		/* Use FB memory size */
+	u32 iga_path;
+
+	struct viafb_shared *shared;
+
+	/* All the information will be needed to set engine */
+	/* depreciated, use the ones in shared directly */
 	struct tmds_setting_information *tmds_setting_info;
 	struct crt_setting_information *crt_setting_info;
 	struct lvds_setting_information *lvds_setting_info;
 	struct lvds_setting_information *lvds_setting_info2;
 	struct chip_information *chip_info;
-
-	/* some information related to video playing */
-	int video_on_crt;
-	int video_on_dvi;
-	int video_on_lcd;
-
 };
-struct viafb_modeinfo {
-	u32 xres;
-	u32 yres;
-	int mode_index;
-};
+
 extern unsigned int viafb_second_virtual_yres;
 extern unsigned int viafb_second_virtual_xres;
 extern unsigned int viafb_second_offset;
@@ -91,14 +90,12 @@
 extern int viafb_LCD2_ON;
 extern int viafb_LCD_ON;
 extern int viafb_DVI_ON;
-extern int viafb_accel;
 extern int viafb_hotplug;
 extern int viafb_memsize;
 
 extern int strict_strtoul(const char *cp, unsigned int base,
 	unsigned long *res);
 
-void viafb_memory_pitch_patch(struct fb_info *info);
 void viafb_fill_var_timing_info(struct fb_var_screeninfo *var, int refresh,
 			  int mode_index);
 int viafb_get_mode_index(int hres, int vres);
diff --git a/drivers/video/via/viamode.c b/drivers/video/via/viamode.c
index 6dcf583..b74f8a6 100644
--- a/drivers/video/via/viamode.c
+++ b/drivers/video/via/viamode.c
@@ -100,12 +100,8 @@
 {VIACR, CR0F, 0xFF, 0x00},	/* Cursor Localtion Low                */
 {VIACR, CR32, 0xFF, 0x00},
 {VIACR, CR33, 0xFF, 0x00},
-{VIACR, CR34, 0xFF, 0x00},
 {VIACR, CR35, 0xFF, 0x00},
 {VIACR, CR36, 0x08, 0x00},
-{VIACR, CR62, 0xFF, 0x00},	/* Secondary Display Starting Address  */
-{VIACR, CR63, 0xFF, 0x00},	/* Secondary Display Starting Address  */
-{VIACR, CR64, 0xFF, 0x00},	/* Secondary Display Starting Address  */
 {VIACR, CR69, 0xFF, 0x00},
 {VIACR, CR6A, 0xFF, 0x40},
 {VIACR, CR6B, 0xFF, 0x00},
@@ -159,16 +155,12 @@
 {VIASR, CR30, 0xFF, 0x04},
 {VIACR, CR32, 0xFF, 0x00},
 {VIACR, CR33, 0x7F, 0x00},
-{VIACR, CR34, 0xFF, 0x00},
 {VIACR, CR35, 0xFF, 0x00},
 {VIACR, CR36, 0xFF, 0x31},
 {VIACR, CR41, 0xFF, 0x80},
 {VIACR, CR42, 0xFF, 0x00},
 {VIACR, CR55, 0x80, 0x00},
 {VIACR, CR5D, 0x80, 0x00},	/*Horizontal Retrace Start bit[11] should be 0*/
-{VIACR, CR62, 0xFF, 0x00},	/* Secondary Display Starting Address */
-{VIACR, CR63, 0xFF, 0x00},	/* Secondary Display Starting Address */
-{VIACR, CR64, 0xFF, 0x00},	/* Secondary Display Starting Address */
 {VIACR, CR68, 0xFF, 0x67},	/* Default FIFO For IGA2 */
 {VIACR, CR69, 0xFF, 0x00},
 {VIACR, CR6A, 0xFD, 0x40},
@@ -233,9 +225,6 @@
 	{VIACR, CR55, 0x80, 0x00},
 	{VIACR, CR5D, 0x80, 0x00},
 	{VIACR, CR36, 0xFF, 0x01},	/* Power Mangement 3                  */
-	{VIACR, CR62, 0xFF, 0x00},	/* Secondary Display Starting Address */
-	{VIACR, CR63, 0xFF, 0x00},	/* Secondary Display Starting Address */
-	{VIACR, CR64, 0xFF, 0x00},	/* Secondary Display Starting Address */
 	{VIACR, CR68, 0xFF, 0x67},	/* Default FIFO For IGA2              */
 	{VIACR, CR6A, 0x20, 0x20},	/* Extended FIFO On                   */
 	{VIACR, CR7A, 0xFF, 0x01},	/* LCD Scaling Parameter 1            */
@@ -285,14 +274,9 @@
 {VIACR, CR0F, 0xFF, 0x00},	/* Cursor Localtion Low                */
 {VIACR, CR32, 0xFF, 0x00},
 {VIACR, CR33, 0xFF, 0x00},
-{VIACR, CR34, 0xFF, 0x00},
 {VIACR, CR35, 0xFF, 0x00},
 {VIACR, CR36, 0x08, 0x00},
 {VIACR, CR47, 0xC8, 0x00},	/* Clear VCK Plus. */
-{VIACR, CR62, 0xFF, 0x00},	/* Secondary Display Starting Address  */
-{VIACR, CR63, 0xFF, 0x00},	/* Secondary Display Starting Address  */
-{VIACR, CR64, 0xFF, 0x00},	/* Secondary Display Starting Address  */
-{VIACR, CRA3, 0xFF, 0x00},	/* Secondary Display Starting Address  */
 {VIACR, CR69, 0xFF, 0x00},
 {VIACR, CR6A, 0xFF, 0x40},
 {VIACR, CR6B, 0xFF, 0x00},
@@ -325,69 +309,61 @@
 {VIACR, CR96, 0xFF, 0x00},
 {VIACR, CR97, 0xFF, 0x00},
 {VIACR, CR99, 0xFF, 0x00},
-{VIACR, CR9B, 0xFF, 0x00},
-{VIACR, CRD2, 0xFF, 0xFF}	/* TMDS/LVDS control register.         */
+{VIACR, CR9B, 0xFF, 0x00}
 };
 
-/* For VT3353: Common Setting for Video Mode */
-struct io_reg VX800_ModeXregs[] = { {VIASR, SR10, 0xFF, 0x01},
+struct io_reg VX855_ModeXregs[] = {
+{VIASR, SR10, 0xFF, 0x01},
 {VIASR, SR15, 0x02, 0x02},
 {VIASR, SR16, 0xBF, 0x08},
 {VIASR, SR17, 0xFF, 0x1F},
 {VIASR, SR18, 0xFF, 0x4E},
 {VIASR, SR1A, 0xFB, 0x08},
 {VIASR, SR1B, 0xFF, 0xF0},
-{VIASR, SR1E, 0xFF, 0x01},
-{VIASR, SR2A, 0xFF, 0x00},
+{VIASR, SR1E, 0x07, 0x01},
+{VIASR, SR2A, 0xF0, 0x00},
+{VIASR, SR58, 0xFF, 0x00},
+{VIASR, SR59, 0xFF, 0x00},
 {VIASR, SR2D, 0xFF, 0xFF},	/* VCK and LCK PLL power on.           */
+{VIACR, CR09, 0xFF, 0x00},	/* Initial CR09=0*/
+{VIACR, CR11, 0x8F, 0x00},	/* IGA1 initial  Vertical end       */
+{VIACR, CR17, 0x7F, 0x00}, 	/* IGA1 CRT Mode control init   */
 {VIACR, CR0A, 0xFF, 0x1E},	/* Cursor Start                        */
 {VIACR, CR0B, 0xFF, 0x00},	/* Cursor End                          */
 {VIACR, CR0E, 0xFF, 0x00},	/* Cursor Location High                */
 {VIACR, CR0F, 0xFF, 0x00},	/* Cursor Localtion Low                */
 {VIACR, CR32, 0xFF, 0x00},
-{VIACR, CR33, 0xFF, 0x00},
-{VIACR, CR34, 0xFF, 0x00},
+{VIACR, CR33, 0x7F, 0x00},
 {VIACR, CR35, 0xFF, 0x00},
 {VIACR, CR36, 0x08, 0x00},
-{VIACR, CR47, 0xC8, 0x00},	/* Clear VCK Plus. */
-{VIACR, CR62, 0xFF, 0x00},	/* Secondary Display Starting Address  */
-{VIACR, CR63, 0xFF, 0x00},	/* Secondary Display Starting Address  */
-{VIACR, CR64, 0xFF, 0x00},	/* Secondary Display Starting Address  */
-{VIACR, CRA3, 0xFF, 0x00},	/* Secondary Display Starting Address  */
 {VIACR, CR69, 0xFF, 0x00},
-{VIACR, CR6A, 0xFF, 0x40},
+{VIACR, CR6A, 0xFD, 0x60},
 {VIACR, CR6B, 0xFF, 0x00},
 {VIACR, CR6C, 0xFF, 0x00},
-{VIACR, CR7A, 0xFF, 0x01},	/* LCD Scaling Parameter 1             */
-{VIACR, CR7B, 0xFF, 0x02},	/* LCD Scaling Parameter 2             */
-{VIACR, CR7C, 0xFF, 0x03},	/* LCD Scaling Parameter 3             */
-{VIACR, CR7D, 0xFF, 0x04},	/* LCD Scaling Parameter 4             */
-{VIACR, CR7E, 0xFF, 0x07},	/* LCD Scaling Parameter 5             */
-{VIACR, CR7F, 0xFF, 0x0A},	/* LCD Scaling Parameter 6             */
-{VIACR, CR80, 0xFF, 0x0D},	/* LCD Scaling Parameter 7             */
-{VIACR, CR81, 0xFF, 0x13},	/* LCD Scaling Parameter 8             */
-{VIACR, CR82, 0xFF, 0x16},	/* LCD Scaling Parameter 9             */
-{VIACR, CR83, 0xFF, 0x19},	/* LCD Scaling Parameter 10            */
-{VIACR, CR84, 0xFF, 0x1C},	/* LCD Scaling Parameter 11            */
-{VIACR, CR85, 0xFF, 0x1D},	/* LCD Scaling Parameter 12            */
-{VIACR, CR86, 0xFF, 0x1E},	/* LCD Scaling Parameter 13            */
-{VIACR, CR87, 0xFF, 0x1F},	/* LCD Scaling Parameter 14            */
-{VIACR, CR88, 0xFF, 0x40},	/* LCD Panel Type                      */
-{VIACR, CR89, 0xFF, 0x00},	/* LCD Timing Control 0                */
-{VIACR, CR8A, 0xFF, 0x88},	/* LCD Timing Control 1                */
-{VIACR, CRD4, 0xFF, 0x81},	/* Second power sequence control       */
-{VIACR, CR8B, 0xFF, 0x5D},	/* LCD Power Sequence Control 0        */
-{VIACR, CR8C, 0xFF, 0x2B},	/* LCD Power Sequence Control 1        */
-{VIACR, CR8D, 0xFF, 0x6F},	/* LCD Power Sequence Control 2        */
-{VIACR, CR8E, 0xFF, 0x2B},	/* LCD Power Sequence Control 3        */
-{VIACR, CR8F, 0xFF, 0x01},	/* LCD Power Sequence Control 4        */
-{VIACR, CR90, 0xFF, 0x01},	/* LCD Power Sequence Control 5        */
-{VIACR, CR91, 0xFF, 0x80},	/* 24/12 bit LVDS Data off             */
+{VIACR, CR7A, 0xFF, 0x01},          /* LCD Scaling Parameter 1             */
+{VIACR, CR7B, 0xFF, 0x02},          /* LCD Scaling Parameter 2             */
+{VIACR, CR7C, 0xFF, 0x03},          /* LCD Scaling Parameter 3             */
+{VIACR, CR7D, 0xFF, 0x04},          /* LCD Scaling Parameter 4             */
+{VIACR, CR7E, 0xFF, 0x07},          /* LCD Scaling Parameter 5             */
+{VIACR, CR7F, 0xFF, 0x0A},          /* LCD Scaling Parameter 6             */
+{VIACR, CR80, 0xFF, 0x0D},          /* LCD Scaling Parameter 7             */
+{VIACR, CR81, 0xFF, 0x13},          /* LCD Scaling Parameter 8             */
+{VIACR, CR82, 0xFF, 0x16},          /* LCD Scaling Parameter 9             */
+{VIACR, CR83, 0xFF, 0x19},          /* LCD Scaling Parameter 10            */
+{VIACR, CR84, 0xFF, 0x1C},          /* LCD Scaling Parameter 11            */
+{VIACR, CR85, 0xFF, 0x1D},          /* LCD Scaling Parameter 12            */
+{VIACR, CR86, 0xFF, 0x1E},          /* LCD Scaling Parameter 13            */
+{VIACR, CR87, 0xFF, 0x1F},          /* LCD Scaling Parameter 14            */
+{VIACR, CR88, 0xFF, 0x40},          /* LCD Panel Type                      */
+{VIACR, CR89, 0xFF, 0x00},          /* LCD Timing Control 0                */
+{VIACR, CR8A, 0xFF, 0x88},          /* LCD Timing Control 1                */
+{VIACR, CRD4, 0xFF, 0x81},          /* Second power sequence control       */
+{VIACR, CR91, 0xFF, 0x80},          /* 24/12 bit LVDS Data off             */
 {VIACR, CR96, 0xFF, 0x00},
 {VIACR, CR97, 0xFF, 0x00},
 {VIACR, CR99, 0xFF, 0x00},
 {VIACR, CR9B, 0xFF, 0x00},
-{VIACR, CRD2, 0xFF, 0xFF}	/* TMDS/LVDS control register.         */
+{VIACR, CRD2, 0xFF, 0xFF}           /* TMDS/LVDS control register.         */
 };
 
 /* Video Mode Table */
@@ -401,7 +377,6 @@
 {VIASR, SR1A, 0xFB, 0x08},
 
 {VIACR, CR32, 0xFF, 0x00},
-{VIACR, CR34, 0xFF, 0x00},
 {VIACR, CR35, 0xFF, 0x00},
 {VIACR, CR36, 0x08, 0x00},
 {VIACR, CR6A, 0xFF, 0x80},
@@ -1084,3 +1059,14 @@
 	{VIA_RES_1280X720, CEAM1280x720, ARRAY_SIZE(CEAM1280x720)},
 	{VIA_RES_1920X1080, CEAM1920x1080, ARRAY_SIZE(CEAM1920x1080)}
 };
+
+int NUM_TOTAL_RES_MAP_REFRESH = ARRAY_SIZE(res_map_refresh_tbl);
+int NUM_TOTAL_CEA_MODES = ARRAY_SIZE(CEA_HDMI_Modes);
+int NUM_TOTAL_CN400_ModeXregs = ARRAY_SIZE(CN400_ModeXregs);
+int NUM_TOTAL_CN700_ModeXregs = ARRAY_SIZE(CN700_ModeXregs);
+int NUM_TOTAL_KM400_ModeXregs = ARRAY_SIZE(KM400_ModeXregs);
+int NUM_TOTAL_CX700_ModeXregs = ARRAY_SIZE(CX700_ModeXregs);
+int NUM_TOTAL_VX855_ModeXregs = ARRAY_SIZE(VX855_ModeXregs);
+int NUM_TOTAL_CLE266_ModeXregs = ARRAY_SIZE(CLE266_ModeXregs);
+int NUM_TOTAL_PATCH_MODE = ARRAY_SIZE(res_patch_table);
+int NUM_TOTAL_MODETABLE = ARRAY_SIZE(CLE266Modes);
diff --git a/drivers/video/via/viamode.h b/drivers/video/via/viamode.h
index 1a5de50..a9d6554 100644
--- a/drivers/video/via/viamode.h
+++ b/drivers/video/via/viamode.h
@@ -50,128 +50,35 @@
 	int vmode_refresh;
 };
 
-#define NUM_TOTAL_RES_MAP_REFRESH ARRAY_SIZE(res_map_refresh_tbl)
-#define NUM_TOTAL_CEA_MODES  ARRAY_SIZE(CEA_HDMI_Modes)
-#define NUM_TOTAL_CN400_ModeXregs ARRAY_SIZE(CN400_ModeXregs)
-#define NUM_TOTAL_CN700_ModeXregs ARRAY_SIZE(CN700_ModeXregs)
-#define NUM_TOTAL_KM400_ModeXregs ARRAY_SIZE(KM400_ModeXregs)
-#define NUM_TOTAL_CX700_ModeXregs ARRAY_SIZE(CX700_ModeXregs)
-#define NUM_TOTAL_VX800_ModeXregs ARRAY_SIZE(VX800_ModeXregs)
-#define NUM_TOTAL_CLE266_ModeXregs ARRAY_SIZE(CLE266_ModeXregs)
-#define NUM_TOTAL_PATCH_MODE ARRAY_SIZE(res_patch_table)
-#define NUM_TOTAL_MODETABLE ARRAY_SIZE(CLE266Modes)
+extern int NUM_TOTAL_RES_MAP_REFRESH;
+extern int NUM_TOTAL_CEA_MODES;
+extern int NUM_TOTAL_CN400_ModeXregs;
+extern int NUM_TOTAL_CN700_ModeXregs;
+extern int NUM_TOTAL_KM400_ModeXregs;
+extern int NUM_TOTAL_CX700_ModeXregs;
+extern int NUM_TOTAL_VX855_ModeXregs;
+extern int NUM_TOTAL_CLE266_ModeXregs;
+extern int NUM_TOTAL_PATCH_MODE;
+extern int NUM_TOTAL_MODETABLE;
 
 /********************/
 /* Mode Table       */
 /********************/
 
-/* 480x640 */
-extern struct crt_mode_table CRTM480x640[1];
-/* 640x480*/
-extern struct crt_mode_table CRTM640x480[5];
-/*720x480 (GTF)*/
-extern struct crt_mode_table CRTM720x480[1];
-/*720x576 (GTF)*/
-extern struct crt_mode_table CRTM720x576[1];
-/* 800x480 (CVT) */
-extern struct crt_mode_table CRTM800x480[1];
-/* 800x600*/
-extern struct crt_mode_table CRTM800x600[5];
-/* 848x480 (CVT) */
-extern struct crt_mode_table CRTM848x480[1];
-/*856x480 (GTF) convert to 852x480*/
-extern struct crt_mode_table CRTM852x480[1];
-/*1024x512 (GTF)*/
-extern struct crt_mode_table CRTM1024x512[1];
-/* 1024x600*/
-extern struct crt_mode_table CRTM1024x600[1];
-/* 1024x768*/
-extern struct crt_mode_table CRTM1024x768[4];
-/* 1152x864*/
-extern struct crt_mode_table CRTM1152x864[1];
-/* 1280x720 (HDMI 720P)*/
-extern struct crt_mode_table CRTM1280x720[2];
-/*1280x768 (GTF)*/
-extern struct crt_mode_table CRTM1280x768[2];
-/* 1280x800 (CVT) */
-extern struct crt_mode_table CRTM1280x800[1];
-/*1280x960*/
-extern struct crt_mode_table CRTM1280x960[1];
-/* 1280x1024*/
-extern struct crt_mode_table CRTM1280x1024[3];
-/* 1368x768 (GTF) */
-extern struct crt_mode_table CRTM1368x768[1];
-/*1440x1050 (GTF)*/
-extern struct crt_mode_table CRTM1440x1050[1];
-/* 1600x1200*/
-extern struct crt_mode_table CRTM1600x1200[2];
-/* 1680x1050 (CVT) */
-extern struct crt_mode_table CRTM1680x1050[2];
-/* 1680x1050 (CVT Reduce Blanking) */
-extern struct crt_mode_table CRTM1680x1050_RB[1];
-/* 1920x1080 (CVT)*/
-extern struct crt_mode_table CRTM1920x1080[1];
-/* 1920x1080 (CVT with Reduce Blanking) */
-extern struct crt_mode_table CRTM1920x1080_RB[1];
-/* 1920x1440*/
-extern struct crt_mode_table CRTM1920x1440[2];
-/* 1400x1050 (CVT) */
-extern struct crt_mode_table CRTM1400x1050[2];
-/* 1400x1050 (CVT Reduce Blanking) */
-extern struct crt_mode_table CRTM1400x1050_RB[1];
-/* 960x600 (CVT) */
-extern struct crt_mode_table CRTM960x600[1];
-/* 1000x600 (GTF) */
-extern struct crt_mode_table CRTM1000x600[1];
-/* 1024x576 (GTF) */
-extern struct crt_mode_table CRTM1024x576[1];
-/* 1088x612 (CVT) */
-extern struct crt_mode_table CRTM1088x612[1];
-/* 1152x720 (CVT) */
-extern struct crt_mode_table CRTM1152x720[1];
-/* 1200x720 (GTF) */
-extern struct crt_mode_table CRTM1200x720[1];
-/* 1280x600 (GTF) */
-extern struct crt_mode_table CRTM1280x600[1];
-/* 1360x768 (CVT) */
-extern struct crt_mode_table CRTM1360x768[1];
-/* 1360x768 (CVT Reduce Blanking) */
-extern struct crt_mode_table CRTM1360x768_RB[1];
-/* 1366x768 (GTF) */
-extern struct crt_mode_table CRTM1366x768[2];
-/* 1440x900 (CVT) */
-extern struct crt_mode_table CRTM1440x900[2];
-/* 1440x900 (CVT Reduce Blanking) */
-extern struct crt_mode_table CRTM1440x900_RB[1];
-/* 1600x900 (CVT) */
-extern struct crt_mode_table CRTM1600x900[1];
-/* 1600x900 (CVT Reduce Blanking) */
-extern struct crt_mode_table CRTM1600x900_RB[1];
-/* 1600x1024 (GTF) */
-extern struct crt_mode_table CRTM1600x1024[1];
-/* 1792x1344 (DMT) */
-extern struct crt_mode_table CRTM1792x1344[1];
-/* 1856x1392 (DMT) */
-extern struct crt_mode_table CRTM1856x1392[1];
-/* 1920x1200 (CVT) */
-extern struct crt_mode_table CRTM1920x1200[1];
-/* 1920x1200 (CVT with Reduce Blanking) */
-extern struct crt_mode_table CRTM1920x1200_RB[1];
-/* 2048x1536 (CVT) */
-extern struct crt_mode_table CRTM2048x1536[1];
-extern struct VideoModeTable CLE266Modes[47];
-extern struct crt_mode_table CEAM1280x720[1];
-extern struct crt_mode_table CEAM1920x1080[1];
-extern struct VideoModeTable CEA_HDMI_Modes[2];
+extern struct VideoModeTable CLE266Modes[];
+extern struct crt_mode_table CEAM1280x720[];
+extern struct crt_mode_table CEAM1920x1080[];
+extern struct VideoModeTable CEA_HDMI_Modes[];
 
-extern struct res_map_refresh res_map_refresh_tbl[61];
-extern struct io_reg CN400_ModeXregs[52];
-extern struct io_reg CN700_ModeXregs[66];
-extern struct io_reg KM400_ModeXregs[55];
-extern struct io_reg CX700_ModeXregs[58];
-extern struct io_reg VX800_ModeXregs[58];
-extern struct io_reg CLE266_ModeXregs[32];
-extern struct io_reg PM1024x768[2];
-extern struct patch_table res_patch_table[1];
+extern struct res_map_refresh res_map_refresh_tbl[];
+extern struct io_reg CN400_ModeXregs[];
+extern struct io_reg CN700_ModeXregs[];
+extern struct io_reg KM400_ModeXregs[];
+extern struct io_reg CX700_ModeXregs[];
+extern struct io_reg VX800_ModeXregs[];
+extern struct io_reg VX855_ModeXregs[];
+extern struct io_reg CLE266_ModeXregs[];
+extern struct io_reg PM1024x768[];
+extern struct patch_table res_patch_table[];
 extern struct VPITTable VPIT;
 #endif /* __VIAMODE_H__ */
diff --git a/drivers/video/via/vt1636.c b/drivers/video/via/vt1636.c
index 322a9f9..a6b3749 100644
--- a/drivers/video/via/vt1636.c
+++ b/drivers/video/via/vt1636.c
@@ -27,7 +27,7 @@
 {
 	u8 data;
 
-	viaparinfo->i2c_stuff.i2c_port = plvds_chip_info->i2c_port;
+	viaparinfo->shared->i2c_stuff.i2c_port = plvds_chip_info->i2c_port;
 	viafb_i2c_readbyte(plvds_chip_info->lvds_chip_slave_addr, index, &data);
 
 	return data;
@@ -39,7 +39,7 @@
 {
 	int index, data;
 
-	viaparinfo->i2c_stuff.i2c_port = plvds_chip_info->i2c_port;
+	viaparinfo->shared->i2c_stuff.i2c_port = plvds_chip_info->i2c_port;
 
 	index = io_data.Index;
 	data = viafb_gpio_i2c_read_lvds(plvds_setting_info, plvds_chip_info,
diff --git a/drivers/vlynq/vlynq.c b/drivers/vlynq/vlynq.c
index f05d2a3..ba3d71f 100644
--- a/drivers/vlynq/vlynq.c
+++ b/drivers/vlynq/vlynq.c
@@ -28,7 +28,6 @@
 #include <linux/errno.h>
 #include <linux/platform_device.h>
 #include <linux/interrupt.h>
-#include <linux/device.h>
 #include <linux/delay.h>
 #include <linux/io.h>
 
diff --git a/firmware/ihex2fw.c b/firmware/ihex2fw.c
index 8f7fdaa9..5a03ba8 100644
--- a/firmware/ihex2fw.c
+++ b/firmware/ihex2fw.c
@@ -56,7 +56,7 @@
 static int sort_records = 0;
 static int wide_records = 0;
 
-int usage(void)
+static int usage(void)
 {
 	fprintf(stderr, "ihex2fw: Convert ihex files into binary "
 		"representation for use by Linux kernel\n");
diff --git a/fs/afs/proc.c b/fs/afs/proc.c
index 8630615..852739d 100644
--- a/fs/afs/proc.c
+++ b/fs/afs/proc.c
@@ -28,7 +28,7 @@
 static ssize_t afs_proc_cells_write(struct file *file, const char __user *buf,
 				    size_t size, loff_t *_pos);
 
-static struct seq_operations afs_proc_cells_ops = {
+static const struct seq_operations afs_proc_cells_ops = {
 	.start	= afs_proc_cells_start,
 	.next	= afs_proc_cells_next,
 	.stop	= afs_proc_cells_stop,
@@ -70,7 +70,7 @@
 static void afs_proc_cell_volumes_stop(struct seq_file *p, void *v);
 static int afs_proc_cell_volumes_show(struct seq_file *m, void *v);
 
-static struct seq_operations afs_proc_cell_volumes_ops = {
+static const struct seq_operations afs_proc_cell_volumes_ops = {
 	.start	= afs_proc_cell_volumes_start,
 	.next	= afs_proc_cell_volumes_next,
 	.stop	= afs_proc_cell_volumes_stop,
@@ -95,7 +95,7 @@
 static void afs_proc_cell_vlservers_stop(struct seq_file *p, void *v);
 static int afs_proc_cell_vlservers_show(struct seq_file *m, void *v);
 
-static struct seq_operations afs_proc_cell_vlservers_ops = {
+static const struct seq_operations afs_proc_cell_vlservers_ops = {
 	.start	= afs_proc_cell_vlservers_start,
 	.next	= afs_proc_cell_vlservers_next,
 	.stop	= afs_proc_cell_vlservers_stop,
@@ -119,7 +119,7 @@
 static void afs_proc_cell_servers_stop(struct seq_file *p, void *v);
 static int afs_proc_cell_servers_show(struct seq_file *m, void *v);
 
-static struct seq_operations afs_proc_cell_servers_ops = {
+static const struct seq_operations afs_proc_cell_servers_ops = {
 	.start	= afs_proc_cell_servers_start,
 	.next	= afs_proc_cell_servers_next,
 	.stop	= afs_proc_cell_servers_stop,
diff --git a/fs/aio.c b/fs/aio.c
index fc21c23..02a2c93 100644
--- a/fs/aio.c
+++ b/fs/aio.c
@@ -78,6 +78,7 @@
 
 	return 0;
 }
+__initcall(aio_setup);
 
 static void aio_free_ring(struct kioctx *ctx)
 {
@@ -380,6 +381,7 @@
 	__set_current_state(TASK_RUNNING);
 	return iocb->ki_user_data;
 }
+EXPORT_SYMBOL(wait_on_sync_kiocb);
 
 /* exit_aio: called when the last user of mm goes away.  At this point, 
  * there is no way for any new requests to be submited or any of the 
@@ -573,6 +575,7 @@
 	spin_unlock_irq(&ctx->ctx_lock);
 	return ret;
 }
+EXPORT_SYMBOL(aio_put_req);
 
 static struct kioctx *lookup_ioctx(unsigned long ctx_id)
 {
@@ -992,6 +995,7 @@
 	spin_unlock_irqrestore(&ctx->ctx_lock, flags);
 	return ret;
 }
+EXPORT_SYMBOL(aio_complete);
 
 /* aio_read_evt
  *	Pull an event off of the ioctx's event ring.  Returns the number of 
@@ -1780,9 +1784,3 @@
 	asmlinkage_protect(5, ret, ctx_id, min_nr, nr, events, timeout);
 	return ret;
 }
-
-__initcall(aio_setup);
-
-EXPORT_SYMBOL(aio_complete);
-EXPORT_SYMBOL(aio_put_req);
-EXPORT_SYMBOL(wait_on_sync_kiocb);
diff --git a/fs/anon_inodes.c b/fs/anon_inodes.c
index 47d4a01..d11c51f 100644
--- a/fs/anon_inodes.c
+++ b/fs/anon_inodes.c
@@ -77,28 +77,24 @@
  *
  * Creates a new file by hooking it on a single inode. This is useful for files
  * that do not need to have a full-fledged inode in order to operate correctly.
- * All the files created with anon_inode_getfd() will share a single inode,
+ * All the files created with anon_inode_getfile() will share a single inode,
  * hence saving memory and avoiding code duplication for the file/inode/dentry
- * setup.  Returns new descriptor or -error.
+ * setup.  Returns the newly created file* or an error pointer.
  */
-int anon_inode_getfd(const char *name, const struct file_operations *fops,
-		     void *priv, int flags)
+struct file *anon_inode_getfile(const char *name,
+				const struct file_operations *fops,
+				void *priv, int flags)
 {
 	struct qstr this;
 	struct dentry *dentry;
 	struct file *file;
-	int error, fd;
+	int error;
 
 	if (IS_ERR(anon_inode_inode))
-		return -ENODEV;
+		return ERR_PTR(-ENODEV);
 
 	if (fops->owner && !try_module_get(fops->owner))
-		return -ENOENT;
-
-	error = get_unused_fd_flags(flags);
-	if (error < 0)
-		goto err_module;
-	fd = error;
+		return ERR_PTR(-ENOENT);
 
 	/*
 	 * Link the inode to a directory entry by creating a unique name
@@ -110,7 +106,7 @@
 	this.hash = 0;
 	dentry = d_alloc(anon_inode_mnt->mnt_sb->s_root, &this);
 	if (!dentry)
-		goto err_put_unused_fd;
+		goto err_module;
 
 	/*
 	 * We know the anon_inode inode count is always greater than zero,
@@ -136,16 +132,54 @@
 	file->f_version = 0;
 	file->private_data = priv;
 
+	return file;
+
+err_dput:
+	dput(dentry);
+err_module:
+	module_put(fops->owner);
+	return ERR_PTR(error);
+}
+EXPORT_SYMBOL_GPL(anon_inode_getfile);
+
+/**
+ * anon_inode_getfd - creates a new file instance by hooking it up to an
+ *                    anonymous inode, and a dentry that describe the "class"
+ *                    of the file
+ *
+ * @name:    [in]    name of the "class" of the new file
+ * @fops:    [in]    file operations for the new file
+ * @priv:    [in]    private data for the new file (will be file's private_data)
+ * @flags:   [in]    flags
+ *
+ * Creates a new file by hooking it on a single inode. This is useful for files
+ * that do not need to have a full-fledged inode in order to operate correctly.
+ * All the files created with anon_inode_getfd() will share a single inode,
+ * hence saving memory and avoiding code duplication for the file/inode/dentry
+ * setup.  Returns new descriptor or an error code.
+ */
+int anon_inode_getfd(const char *name, const struct file_operations *fops,
+		     void *priv, int flags)
+{
+	int error, fd;
+	struct file *file;
+
+	error = get_unused_fd_flags(flags);
+	if (error < 0)
+		return error;
+	fd = error;
+
+	file = anon_inode_getfile(name, fops, priv, flags);
+	if (IS_ERR(file)) {
+		error = PTR_ERR(file);
+		goto err_put_unused_fd;
+	}
 	fd_install(fd, file);
 
 	return fd;
 
-err_dput:
-	dput(dentry);
 err_put_unused_fd:
 	put_unused_fd(fd);
-err_module:
-	module_put(fops->owner);
 	return error;
 }
 EXPORT_SYMBOL_GPL(anon_inode_getfd);
diff --git a/fs/buffer.c b/fs/buffer.c
index 90a9886..209f7f1 100644
--- a/fs/buffer.c
+++ b/fs/buffer.c
@@ -52,6 +52,7 @@
 	bh->b_end_io = handler;
 	bh->b_private = private;
 }
+EXPORT_SYMBOL(init_buffer);
 
 static int sync_buffer(void *word)
 {
@@ -80,6 +81,7 @@
 	smp_mb__after_clear_bit();
 	wake_up_bit(&bh->b_state, BH_Lock);
 }
+EXPORT_SYMBOL(unlock_buffer);
 
 /*
  * Block until a buffer comes unlocked.  This doesn't stop it
@@ -90,6 +92,7 @@
 {
 	wait_on_bit(&bh->b_state, BH_Lock, sync_buffer, TASK_UNINTERRUPTIBLE);
 }
+EXPORT_SYMBOL(__wait_on_buffer);
 
 static void
 __clear_page_buffers(struct page *page)
@@ -144,6 +147,7 @@
 	__end_buffer_read_notouch(bh, uptodate);
 	put_bh(bh);
 }
+EXPORT_SYMBOL(end_buffer_read_sync);
 
 void end_buffer_write_sync(struct buffer_head *bh, int uptodate)
 {
@@ -164,6 +168,7 @@
 	unlock_buffer(bh);
 	put_bh(bh);
 }
+EXPORT_SYMBOL(end_buffer_write_sync);
 
 /*
  * Various filesystems appear to want __find_get_block to be non-blocking.
@@ -272,6 +277,7 @@
 	invalidate_bh_lrus();
 	invalidate_mapping_pages(mapping, 0, -1);
 }
+EXPORT_SYMBOL(invalidate_bdev);
 
 /*
  * Kick pdflush then try to free up some ZONE_NORMAL memory.
@@ -410,6 +416,7 @@
 	local_irq_restore(flags);
 	return;
 }
+EXPORT_SYMBOL(end_buffer_async_write);
 
 /*
  * If a page's buffers are under async readin (end_buffer_async_read
@@ -438,8 +445,8 @@
 	set_buffer_async_read(bh);
 }
 
-void mark_buffer_async_write_endio(struct buffer_head *bh,
-				   bh_end_io_t *handler)
+static void mark_buffer_async_write_endio(struct buffer_head *bh,
+					  bh_end_io_t *handler)
 {
 	bh->b_end_io = handler;
 	set_buffer_async_write(bh);
@@ -553,7 +560,7 @@
 	return err;
 }
 
-void do_thaw_all(struct work_struct *work)
+static void do_thaw_all(struct work_struct *work)
 {
 	struct super_block *sb;
 	char b[BDEVNAME_SIZE];
@@ -1172,6 +1179,7 @@
 		}
 	}
 }
+EXPORT_SYMBOL(mark_buffer_dirty);
 
 /*
  * Decrement a buffer_head's reference count.  If all buffers against a page
@@ -1188,6 +1196,7 @@
 	}
 	WARN(1, KERN_ERR "VFS: brelse: Trying to free free buffer\n");
 }
+EXPORT_SYMBOL(__brelse);
 
 /*
  * bforget() is like brelse(), except it discards any
@@ -1206,6 +1215,7 @@
 	}
 	__brelse(bh);
 }
+EXPORT_SYMBOL(__bforget);
 
 static struct buffer_head *__bread_slow(struct buffer_head *bh)
 {
@@ -2218,6 +2228,7 @@
 	}
 	return 0;
 }
+EXPORT_SYMBOL(block_read_full_page);
 
 /* utility function for filesystems that need to do work on expanding
  * truncates.  Uses filesystem pagecache writes to allow the filesystem to
@@ -2252,6 +2263,7 @@
 out:
 	return err;
 }
+EXPORT_SYMBOL(generic_cont_expand_simple);
 
 static int cont_expand_zero(struct file *file, struct address_space *mapping,
 			    loff_t pos, loff_t *bytes)
@@ -2352,6 +2364,7 @@
 out:
 	return err;
 }
+EXPORT_SYMBOL(cont_write_begin);
 
 int block_prepare_write(struct page *page, unsigned from, unsigned to,
 			get_block_t *get_block)
@@ -2362,6 +2375,7 @@
 		ClearPageUptodate(page);
 	return err;
 }
+EXPORT_SYMBOL(block_prepare_write);
 
 int block_commit_write(struct page *page, unsigned from, unsigned to)
 {
@@ -2369,6 +2383,7 @@
 	__block_commit_write(inode,page,from,to);
 	return 0;
 }
+EXPORT_SYMBOL(block_commit_write);
 
 /*
  * block_page_mkwrite() is not allowed to change the file size as it gets
@@ -2426,6 +2441,7 @@
 out:
 	return ret;
 }
+EXPORT_SYMBOL(block_page_mkwrite);
 
 /*
  * nobh_write_begin()'s prereads are special: the buffer_heads are freed
@@ -2849,6 +2865,7 @@
 out:
 	return err;
 }
+EXPORT_SYMBOL(block_truncate_page);
 
 /*
  * The generic ->writepage function for buffer-backed address_spaces
@@ -2890,6 +2907,7 @@
 	zero_user_segment(page, offset, PAGE_CACHE_SIZE);
 	return __block_write_full_page(inode, page, get_block, wbc, handler);
 }
+EXPORT_SYMBOL(block_write_full_page_endio);
 
 /*
  * The generic ->writepage function for buffer-backed address_spaces
@@ -2900,7 +2918,7 @@
 	return block_write_full_page_endio(page, get_block, wbc,
 					   end_buffer_async_write);
 }
-
+EXPORT_SYMBOL(block_write_full_page);
 
 sector_t generic_block_bmap(struct address_space *mapping, sector_t block,
 			    get_block_t *get_block)
@@ -2913,6 +2931,7 @@
 	get_block(inode, block, &tmp, 0);
 	return tmp.b_blocknr;
 }
+EXPORT_SYMBOL(generic_block_bmap);
 
 static void end_bio_bh_io_sync(struct bio *bio, int err)
 {
@@ -2982,6 +3001,7 @@
 	bio_put(bio);
 	return ret;
 }
+EXPORT_SYMBOL(submit_bh);
 
 /**
  * ll_rw_block: low-level access to block devices (DEPRECATED)
@@ -3043,6 +3063,7 @@
 		unlock_buffer(bh);
 	}
 }
+EXPORT_SYMBOL(ll_rw_block);
 
 /*
  * For a data-integrity writeout, we need to wait upon any in-progress I/O
@@ -3071,6 +3092,7 @@
 	}
 	return ret;
 }
+EXPORT_SYMBOL(sync_dirty_buffer);
 
 /*
  * try_to_free_buffers() checks if all the buffers on this particular page
@@ -3185,6 +3207,7 @@
 	if (mapping)
 		blk_run_backing_dev(mapping->backing_dev_info, page);
 }
+EXPORT_SYMBOL(block_sync_page);
 
 /*
  * There are no bdflush tunables left.  But distributions are
@@ -3361,29 +3384,3 @@
 	max_buffer_heads = nrpages * (PAGE_SIZE / sizeof(struct buffer_head));
 	hotcpu_notifier(buffer_cpu_notify, 0);
 }
-
-EXPORT_SYMBOL(__bforget);
-EXPORT_SYMBOL(__brelse);
-EXPORT_SYMBOL(__wait_on_buffer);
-EXPORT_SYMBOL(block_commit_write);
-EXPORT_SYMBOL(block_prepare_write);
-EXPORT_SYMBOL(block_page_mkwrite);
-EXPORT_SYMBOL(block_read_full_page);
-EXPORT_SYMBOL(block_sync_page);
-EXPORT_SYMBOL(block_truncate_page);
-EXPORT_SYMBOL(block_write_full_page);
-EXPORT_SYMBOL(block_write_full_page_endio);
-EXPORT_SYMBOL(cont_write_begin);
-EXPORT_SYMBOL(end_buffer_read_sync);
-EXPORT_SYMBOL(end_buffer_write_sync);
-EXPORT_SYMBOL(end_buffer_async_write);
-EXPORT_SYMBOL(file_fsync);
-EXPORT_SYMBOL(generic_block_bmap);
-EXPORT_SYMBOL(generic_cont_expand_simple);
-EXPORT_SYMBOL(init_buffer);
-EXPORT_SYMBOL(invalidate_bdev);
-EXPORT_SYMBOL(ll_rw_block);
-EXPORT_SYMBOL(mark_buffer_dirty);
-EXPORT_SYMBOL(submit_bh);
-EXPORT_SYMBOL(sync_dirty_buffer);
-EXPORT_SYMBOL(unlock_buffer);
diff --git a/fs/compat.c b/fs/compat.c
index 6d6f98f..3aa4883 100644
--- a/fs/compat.c
+++ b/fs/compat.c
@@ -100,13 +100,6 @@
 		    get_compat_timespec(&tv[1], &t[1]))
 			return -EFAULT;
 
-		if ((tv[0].tv_nsec == UTIME_OMIT || tv[0].tv_nsec == UTIME_NOW)
-		    && tv[0].tv_sec != 0)
-			return -EINVAL;
-		if ((tv[1].tv_nsec == UTIME_OMIT || tv[1].tv_nsec == UTIME_NOW)
-		    && tv[1].tv_sec != 0)
-			return -EINVAL;
-
 		if (tv[0].tv_nsec == UTIME_OMIT && tv[1].tv_nsec == UTIME_OMIT)
 			return 0;
 	}
diff --git a/fs/devpts/inode.c b/fs/devpts/inode.c
index 75efb02..d5f8c96 100644
--- a/fs/devpts/inode.c
+++ b/fs/devpts/inode.c
@@ -18,14 +18,13 @@
 #include <linux/mount.h>
 #include <linux/tty.h>
 #include <linux/mutex.h>
+#include <linux/magic.h>
 #include <linux/idr.h>
 #include <linux/devpts_fs.h>
 #include <linux/parser.h>
 #include <linux/fsnotify.h>
 #include <linux/seq_file.h>
 
-#define DEVPTS_SUPER_MAGIC 0x1cd1
-
 #define DEVPTS_DEFAULT_MODE 0600
 /*
  * ptmx is a new node in /dev/pts and will be unused in legacy (single-
diff --git a/fs/dlm/debug_fs.c b/fs/dlm/debug_fs.c
index 1d1d274..1c8bb8c 100644
--- a/fs/dlm/debug_fs.c
+++ b/fs/dlm/debug_fs.c
@@ -386,9 +386,9 @@
 	return rv;
 }
 
-static struct seq_operations format1_seq_ops;
-static struct seq_operations format2_seq_ops;
-static struct seq_operations format3_seq_ops;
+static const struct seq_operations format1_seq_ops;
+static const struct seq_operations format2_seq_ops;
+static const struct seq_operations format3_seq_ops;
 
 static void *table_seq_start(struct seq_file *seq, loff_t *pos)
 {
@@ -534,21 +534,21 @@
 	}
 }
 
-static struct seq_operations format1_seq_ops = {
+static const struct seq_operations format1_seq_ops = {
 	.start = table_seq_start,
 	.next  = table_seq_next,
 	.stop  = table_seq_stop,
 	.show  = table_seq_show,
 };
 
-static struct seq_operations format2_seq_ops = {
+static const struct seq_operations format2_seq_ops = {
 	.start = table_seq_start,
 	.next  = table_seq_next,
 	.stop  = table_seq_stop,
 	.show  = table_seq_show,
 };
 
-static struct seq_operations format3_seq_ops = {
+static const struct seq_operations format3_seq_ops = {
 	.start = table_seq_start,
 	.next  = table_seq_next,
 	.stop  = table_seq_stop,
diff --git a/fs/eventfd.c b/fs/eventfd.c
index 31d12de8..8b47e42 100644
--- a/fs/eventfd.c
+++ b/fs/eventfd.c
@@ -68,11 +68,16 @@
 }
 EXPORT_SYMBOL_GPL(eventfd_signal);
 
+static void eventfd_free_ctx(struct eventfd_ctx *ctx)
+{
+	kfree(ctx);
+}
+
 static void eventfd_free(struct kref *kref)
 {
 	struct eventfd_ctx *ctx = container_of(kref, struct eventfd_ctx, kref);
 
-	kfree(ctx);
+	eventfd_free_ctx(ctx);
 }
 
 /**
@@ -298,9 +303,23 @@
 }
 EXPORT_SYMBOL_GPL(eventfd_ctx_fileget);
 
-SYSCALL_DEFINE2(eventfd2, unsigned int, count, int, flags)
+/**
+ * eventfd_file_create - Creates an eventfd file pointer.
+ * @count: Initial eventfd counter value.
+ * @flags: Flags for the eventfd file.
+ *
+ * This function creates an eventfd file pointer, w/out installing it into
+ * the fd table. This is useful when the eventfd file is used during the
+ * initialization of data structures that require extra setup after the eventfd
+ * creation. So the eventfd creation is split into the file pointer creation
+ * phase, and the file descriptor installation phase.
+ * In this way races with userspace closing the newly installed file descriptor
+ * can be avoided.
+ * Returns an eventfd file pointer, or a proper error pointer.
+ */
+struct file *eventfd_file_create(unsigned int count, int flags)
 {
-	int fd;
+	struct file *file;
 	struct eventfd_ctx *ctx;
 
 	/* Check the EFD_* constants for consistency.  */
@@ -308,26 +327,48 @@
 	BUILD_BUG_ON(EFD_NONBLOCK != O_NONBLOCK);
 
 	if (flags & ~EFD_FLAGS_SET)
-		return -EINVAL;
+		return ERR_PTR(-EINVAL);
 
 	ctx = kmalloc(sizeof(*ctx), GFP_KERNEL);
 	if (!ctx)
-		return -ENOMEM;
+		return ERR_PTR(-ENOMEM);
 
 	kref_init(&ctx->kref);
 	init_waitqueue_head(&ctx->wqh);
 	ctx->count = count;
 	ctx->flags = flags;
 
-	/*
-	 * When we call this, the initialization must be complete, since
-	 * anon_inode_getfd() will install the fd.
-	 */
-	fd = anon_inode_getfd("[eventfd]", &eventfd_fops, ctx,
-			      flags & EFD_SHARED_FCNTL_FLAGS);
-	if (fd < 0)
-		kfree(ctx);
+	file = anon_inode_getfile("[eventfd]", &eventfd_fops, ctx,
+				  flags & EFD_SHARED_FCNTL_FLAGS);
+	if (IS_ERR(file))
+		eventfd_free_ctx(ctx);
+
+	return file;
+}
+
+SYSCALL_DEFINE2(eventfd2, unsigned int, count, int, flags)
+{
+	int fd, error;
+	struct file *file;
+
+	error = get_unused_fd_flags(flags & EFD_SHARED_FCNTL_FLAGS);
+	if (error < 0)
+		return error;
+	fd = error;
+
+	file = eventfd_file_create(count, flags);
+	if (IS_ERR(file)) {
+		error = PTR_ERR(file);
+		goto err_put_unused_fd;
+	}
+	fd_install(fd, file);
+
 	return fd;
+
+err_put_unused_fd:
+	put_unused_fd(fd);
+
+	return error;
 }
 
 SYSCALL_DEFINE1(eventfd, unsigned int, count)
diff --git a/fs/exec.c b/fs/exec.c
index 434dba7..5c833c1 100644
--- a/fs/exec.c
+++ b/fs/exec.c
@@ -845,6 +845,9 @@
 	sig->notify_count = 0;
 
 no_thread_group:
+	if (current->mm)
+		setmax_mm_hiwater_rss(&sig->maxrss, current->mm);
+
 	exit_itimers(sig);
 	flush_itimer_signals();
 
@@ -1354,6 +1357,8 @@
 	if (retval < 0)
 		goto out;
 
+	current->stack_start = current->mm->start_stack;
+
 	/* execve succeeded */
 	current->fs->in_exec = 0;
 	current->in_execve = 0;
diff --git a/fs/ext2/namei.c b/fs/ext2/namei.c
index 23701f2..dd7175c 100644
--- a/fs/ext2/namei.c
+++ b/fs/ext2/namei.c
@@ -70,7 +70,7 @@
 			if (PTR_ERR(inode) == -ESTALE) {
 				ext2_error(dir->i_sb, __func__,
 						"deleted inode referenced: %lu",
-						ino);
+						(unsigned long) ino);
 				return ERR_PTR(-EIO);
 			} else {
 				return ERR_CAST(inode);
diff --git a/fs/hugetlbfs/inode.c b/fs/hugetlbfs/inode.c
index 06b7c26..eba6d552d 100644
--- a/fs/hugetlbfs/inode.c
+++ b/fs/hugetlbfs/inode.c
@@ -31,12 +31,10 @@
 #include <linux/statfs.h>
 #include <linux/security.h>
 #include <linux/ima.h>
+#include <linux/magic.h>
 
 #include <asm/uaccess.h>
 
-/* some random number */
-#define HUGETLBFS_MAGIC	0x958458f6
-
 static const struct super_operations hugetlbfs_ops;
 static const struct address_space_operations hugetlbfs_aops;
 const struct file_operations hugetlbfs_file_operations;
diff --git a/fs/inode.c b/fs/inode.c
index f5ff71c..76582b06 100644
--- a/fs/inode.c
+++ b/fs/inode.c
@@ -14,6 +14,7 @@
 #include <linux/module.h>
 #include <linux/backing-dev.h>
 #include <linux/wait.h>
+#include <linux/rwsem.h>
 #include <linux/hash.h>
 #include <linux/swap.h>
 #include <linux/security.h>
@@ -87,14 +88,18 @@
 DEFINE_SPINLOCK(inode_lock);
 
 /*
- * iprune_mutex provides exclusion between the kswapd or try_to_free_pages
+ * iprune_sem provides exclusion between the kswapd or try_to_free_pages
  * icache shrinking path, and the umount path.  Without this exclusion,
  * by the time prune_icache calls iput for the inode whose pages it has
  * been invalidating, or by the time it calls clear_inode & destroy_inode
  * from its final dispose_list, the struct super_block they refer to
  * (for inode->i_sb->s_op) may already have been freed and reused.
+ *
+ * We make this an rwsem because the fastpath is icache shrinking. In
+ * some cases a filesystem may be doing a significant amount of work in
+ * its inode reclaim code, so this should improve parallelism.
  */
-static DEFINE_MUTEX(iprune_mutex);
+static DECLARE_RWSEM(iprune_sem);
 
 /*
  * Statistics gathering..
@@ -381,7 +386,7 @@
 		/*
 		 * We can reschedule here without worrying about the list's
 		 * consistency because the per-sb list of inodes must not
-		 * change during umount anymore, and because iprune_mutex keeps
+		 * change during umount anymore, and because iprune_sem keeps
 		 * shrink_icache_memory() away.
 		 */
 		cond_resched_lock(&inode_lock);
@@ -420,7 +425,7 @@
 	int busy;
 	LIST_HEAD(throw_away);
 
-	mutex_lock(&iprune_mutex);
+	down_write(&iprune_sem);
 	spin_lock(&inode_lock);
 	inotify_unmount_inodes(&sb->s_inodes);
 	fsnotify_unmount_inodes(&sb->s_inodes);
@@ -428,7 +433,7 @@
 	spin_unlock(&inode_lock);
 
 	dispose_list(&throw_away);
-	mutex_unlock(&iprune_mutex);
+	up_write(&iprune_sem);
 
 	return busy;
 }
@@ -467,7 +472,7 @@
 	int nr_scanned;
 	unsigned long reap = 0;
 
-	mutex_lock(&iprune_mutex);
+	down_read(&iprune_sem);
 	spin_lock(&inode_lock);
 	for (nr_scanned = 0; nr_scanned < nr_to_scan; nr_scanned++) {
 		struct inode *inode;
@@ -509,7 +514,7 @@
 	spin_unlock(&inode_lock);
 
 	dispose_list(&freeable);
-	mutex_unlock(&iprune_mutex);
+	up_read(&iprune_sem);
 }
 
 /*
diff --git a/fs/jbd2/journal.c b/fs/jbd2/journal.c
index a8a358b..53b86e1 100644
--- a/fs/jbd2/journal.c
+++ b/fs/jbd2/journal.c
@@ -768,7 +768,7 @@
 {
 }
 
-static struct seq_operations jbd2_seq_history_ops = {
+static const struct seq_operations jbd2_seq_history_ops = {
 	.start  = jbd2_seq_history_start,
 	.next   = jbd2_seq_history_next,
 	.stop   = jbd2_seq_history_stop,
@@ -872,7 +872,7 @@
 {
 }
 
-static struct seq_operations jbd2_seq_info_ops = {
+static const struct seq_operations jbd2_seq_info_ops = {
 	.start  = jbd2_seq_info_start,
 	.next   = jbd2_seq_info_next,
 	.stop   = jbd2_seq_info_stop,
diff --git a/fs/minix/dir.c b/fs/minix/dir.c
index d407e7a..6198731 100644
--- a/fs/minix/dir.c
+++ b/fs/minix/dir.c
@@ -308,14 +308,18 @@
 	struct inode *inode = (struct inode*)mapping->host;
 	char *kaddr = page_address(page);
 	loff_t pos = page_offset(page) + (char*)de - kaddr;
-	unsigned len = minix_sb(inode->i_sb)->s_dirsize;
+	struct minix_sb_info *sbi = minix_sb(inode->i_sb);
+	unsigned len = sbi->s_dirsize;
 	int err;
 
 	lock_page(page);
 	err = __minix_write_begin(NULL, mapping, pos, len,
 					AOP_FLAG_UNINTERRUPTIBLE, &page, NULL);
 	if (err == 0) {
-		de->inode = 0;
+		if (sbi->s_version == MINIX_V3)
+			((minix3_dirent *) de)->inode = 0;
+		else
+			de->inode = 0;
 		err = dir_commit_chunk(page, pos, len);
 	} else {
 		unlock_page(page);
@@ -440,7 +444,10 @@
 	err = __minix_write_begin(NULL, mapping, pos, sbi->s_dirsize,
 					AOP_FLAG_UNINTERRUPTIBLE, &page, NULL);
 	if (err == 0) {
-		de->inode = inode->i_ino;
+		if (sbi->s_version == MINIX_V3)
+			((minix3_dirent *) de)->inode = inode->i_ino;
+		else
+			de->inode = inode->i_ino;
 		err = dir_commit_chunk(page, pos, sbi->s_dirsize);
 	} else {
 		unlock_page(page);
@@ -470,7 +477,14 @@
 	ino_t res = 0;
 
 	if (de) {
-		res = de->inode;
+		struct address_space *mapping = page->mapping;
+		struct inode *inode = mapping->host;
+		struct minix_sb_info *sbi = minix_sb(inode->i_sb);
+
+		if (sbi->s_version == MINIX_V3)
+			res = ((minix3_dirent *) de)->inode;
+		else
+			res = de->inode;
 		dir_put_page(page);
 	}
 	return res;
diff --git a/fs/ncpfs/dir.c b/fs/ncpfs/dir.c
index 9c59072..b8b5b30 100644
--- a/fs/ncpfs/dir.c
+++ b/fs/ncpfs/dir.c
@@ -1241,7 +1241,7 @@
 		month = 2;
 	} else {
 		nl_day = (year & 3) || day <= 59 ? day : day - 1;
-		for (month = 0; month < 12; month++)
+		for (month = 1; month < 12; month++)
 			if (day_n[month] > nl_day)
 				break;
 	}
diff --git a/fs/ncpfs/ioctl.c b/fs/ncpfs/ioctl.c
index fa038df..53a7ed7 100644
--- a/fs/ncpfs/ioctl.c
+++ b/fs/ncpfs/ioctl.c
@@ -442,7 +442,7 @@
 			if (dentry) {
 				struct inode* s_inode = dentry->d_inode;
 				
-				if (inode) {
+				if (s_inode) {
 					NCP_FINFO(s_inode)->volNumber = vnum;
 					NCP_FINFO(s_inode)->dirEntNum = de;
 					NCP_FINFO(s_inode)->DosDirNum = dosde;
diff --git a/fs/nfs/client.c b/fs/nfs/client.c
index a7ce15d..1520253 100644
--- a/fs/nfs/client.c
+++ b/fs/nfs/client.c
@@ -1531,7 +1531,7 @@
 static void nfs_server_list_stop(struct seq_file *p, void *v);
 static int nfs_server_list_show(struct seq_file *m, void *v);
 
-static struct seq_operations nfs_server_list_ops = {
+static const struct seq_operations nfs_server_list_ops = {
 	.start	= nfs_server_list_start,
 	.next	= nfs_server_list_next,
 	.stop	= nfs_server_list_stop,
@@ -1552,7 +1552,7 @@
 static void nfs_volume_list_stop(struct seq_file *p, void *v);
 static int nfs_volume_list_show(struct seq_file *m, void *v);
 
-static struct seq_operations nfs_volume_list_ops = {
+static const struct seq_operations nfs_volume_list_ops = {
 	.start	= nfs_volume_list_start,
 	.next	= nfs_volume_list_next,
 	.stop	= nfs_volume_list_stop,
diff --git a/fs/nfsd/export.c b/fs/nfsd/export.c
index 984a5eb..c1c9e03 100644
--- a/fs/nfsd/export.c
+++ b/fs/nfsd/export.c
@@ -1517,7 +1517,7 @@
 	return svc_export_show(m, &svc_export_cache, cp);
 }
 
-struct seq_operations nfs_exports_op = {
+const struct seq_operations nfs_exports_op = {
 	.start	= e_start,
 	.next	= e_next,
 	.stop	= e_stop,
diff --git a/fs/ntfs/file.c b/fs/ntfs/file.c
index 4350d49..663c0e3 100644
--- a/fs/ntfs/file.c
+++ b/fs/ntfs/file.c
@@ -2146,46 +2146,6 @@
 }
 
 /**
- * ntfs_file_writev -
- *
- * Basically the same as generic_file_writev() except that it ends up calling
- * ntfs_file_aio_write_nolock() instead of __generic_file_aio_write_nolock().
- */
-static ssize_t ntfs_file_writev(struct file *file, const struct iovec *iov,
-		unsigned long nr_segs, loff_t *ppos)
-{
-	struct address_space *mapping = file->f_mapping;
-	struct inode *inode = mapping->host;
-	struct kiocb kiocb;
-	ssize_t ret;
-
-	mutex_lock(&inode->i_mutex);
-	init_sync_kiocb(&kiocb, file);
-	ret = ntfs_file_aio_write_nolock(&kiocb, iov, nr_segs, ppos);
-	if (ret == -EIOCBQUEUED)
-		ret = wait_on_sync_kiocb(&kiocb);
-	mutex_unlock(&inode->i_mutex);
-	if (ret > 0) {
-		int err = generic_write_sync(file, *ppos - ret, ret);
-		if (err < 0)
-			ret = err;
-	}
-	return ret;
-}
-
-/**
- * ntfs_file_write - simple wrapper for ntfs_file_writev()
- */
-static ssize_t ntfs_file_write(struct file *file, const char __user *buf,
-		size_t count, loff_t *ppos)
-{
-	struct iovec local_iov = { .iov_base = (void __user *)buf,
-				   .iov_len = count };
-
-	return ntfs_file_writev(file, &local_iov, 1, ppos);
-}
-
-/**
  * ntfs_file_fsync - sync a file to disk
  * @filp:	file to be synced
  * @dentry:	dentry describing the file to sync
@@ -2247,7 +2207,7 @@
 	.read		= do_sync_read,		 /* Read from file. */
 	.aio_read	= generic_file_aio_read, /* Async read from file. */
 #ifdef NTFS_RW
-	.write		= ntfs_file_write,	 /* Write to file. */
+	.write		= do_sync_write,	 /* Write to file. */
 	.aio_write	= ntfs_file_aio_write,	 /* Async write to file. */
 	/*.release	= ,*/			 /* Last file is closed.  See
 						    fs/ext2/file.c::
diff --git a/fs/ocfs2/cluster/netdebug.c b/fs/ocfs2/cluster/netdebug.c
index f842487..cfb2be7 100644
--- a/fs/ocfs2/cluster/netdebug.c
+++ b/fs/ocfs2/cluster/netdebug.c
@@ -163,7 +163,7 @@
 {
 }
 
-static struct seq_operations nst_seq_ops = {
+static const struct seq_operations nst_seq_ops = {
 	.start = nst_seq_start,
 	.next = nst_seq_next,
 	.stop = nst_seq_stop,
@@ -344,7 +344,7 @@
 {
 }
 
-static struct seq_operations sc_seq_ops = {
+static const struct seq_operations sc_seq_ops = {
 	.start = sc_seq_start,
 	.next = sc_seq_next,
 	.stop = sc_seq_stop,
diff --git a/fs/ocfs2/dlm/dlmdebug.c b/fs/ocfs2/dlm/dlmdebug.c
index df52f70..c5c8812 100644
--- a/fs/ocfs2/dlm/dlmdebug.c
+++ b/fs/ocfs2/dlm/dlmdebug.c
@@ -683,7 +683,7 @@
 	return 0;
 }
 
-static struct seq_operations debug_lockres_ops = {
+static const struct seq_operations debug_lockres_ops = {
 	.start =	lockres_seq_start,
 	.stop =		lockres_seq_stop,
 	.next =		lockres_seq_next,
diff --git a/fs/proc/array.c b/fs/proc/array.c
index 725a650..0c6bc60 100644
--- a/fs/proc/array.c
+++ b/fs/proc/array.c
@@ -82,6 +82,7 @@
 #include <linux/pid_namespace.h>
 #include <linux/ptrace.h>
 #include <linux/tracehook.h>
+#include <linux/swapops.h>
 
 #include <asm/pgtable.h>
 #include <asm/processor.h>
@@ -321,6 +322,87 @@
 			p->nivcsw);
 }
 
+struct stack_stats {
+	struct vm_area_struct *vma;
+	unsigned long	startpage;
+	unsigned long	usage;
+};
+
+static int stack_usage_pte_range(pmd_t *pmd, unsigned long addr,
+				unsigned long end, struct mm_walk *walk)
+{
+	struct stack_stats *ss = walk->private;
+	struct vm_area_struct *vma = ss->vma;
+	pte_t *pte, ptent;
+	spinlock_t *ptl;
+	int ret = 0;
+
+	pte = pte_offset_map_lock(vma->vm_mm, pmd, addr, &ptl);
+	for (; addr != end; pte++, addr += PAGE_SIZE) {
+		ptent = *pte;
+
+#ifdef CONFIG_STACK_GROWSUP
+		if (pte_present(ptent) || is_swap_pte(ptent))
+			ss->usage = addr - ss->startpage + PAGE_SIZE;
+#else
+		if (pte_present(ptent) || is_swap_pte(ptent)) {
+			ss->usage = ss->startpage - addr + PAGE_SIZE;
+			pte++;
+			ret = 1;
+			break;
+		}
+#endif
+	}
+	pte_unmap_unlock(pte - 1, ptl);
+	cond_resched();
+	return ret;
+}
+
+static inline unsigned long get_stack_usage_in_bytes(struct vm_area_struct *vma,
+				struct task_struct *task)
+{
+	struct stack_stats ss;
+	struct mm_walk stack_walk = {
+		.pmd_entry = stack_usage_pte_range,
+		.mm = vma->vm_mm,
+		.private = &ss,
+	};
+
+	if (!vma->vm_mm || is_vm_hugetlb_page(vma))
+		return 0;
+
+	ss.vma = vma;
+	ss.startpage = task->stack_start & PAGE_MASK;
+	ss.usage = 0;
+
+#ifdef CONFIG_STACK_GROWSUP
+	walk_page_range(KSTK_ESP(task) & PAGE_MASK, vma->vm_end,
+		&stack_walk);
+#else
+	walk_page_range(vma->vm_start, (KSTK_ESP(task) & PAGE_MASK) + PAGE_SIZE,
+		&stack_walk);
+#endif
+	return ss.usage;
+}
+
+static inline void task_show_stack_usage(struct seq_file *m,
+						struct task_struct *task)
+{
+	struct vm_area_struct	*vma;
+	struct mm_struct	*mm = get_task_mm(task);
+
+	if (mm) {
+		down_read(&mm->mmap_sem);
+		vma = find_vma(mm, task->stack_start);
+		if (vma)
+			seq_printf(m, "Stack usage:\t%lu kB\n",
+				get_stack_usage_in_bytes(vma, task) >> 10);
+
+		up_read(&mm->mmap_sem);
+		mmput(mm);
+	}
+}
+
 int proc_pid_status(struct seq_file *m, struct pid_namespace *ns,
 			struct pid *pid, struct task_struct *task)
 {
@@ -340,6 +422,7 @@
 	task_show_regs(m, task);
 #endif
 	task_context_switch_counts(m, task);
+	task_show_stack_usage(m, task);
 	return 0;
 }
 
@@ -481,7 +564,7 @@
 		rsslim,
 		mm ? mm->start_code : 0,
 		mm ? mm->end_code : 0,
-		(permitted && mm) ? mm->start_stack : 0,
+		(permitted) ? task->stack_start : 0,
 		esp,
 		eip,
 		/* The signal information here is obsolete.
diff --git a/fs/proc/base.c b/fs/proc/base.c
index 55c4c80..837469a 100644
--- a/fs/proc/base.c
+++ b/fs/proc/base.c
@@ -458,7 +458,7 @@
 };
 
 static const struct limit_names lnames[RLIM_NLIMITS] = {
-	[RLIMIT_CPU] = {"Max cpu time", "ms"},
+	[RLIMIT_CPU] = {"Max cpu time", "seconds"},
 	[RLIMIT_FSIZE] = {"Max file size", "bytes"},
 	[RLIMIT_DATA] = {"Max data size", "bytes"},
 	[RLIMIT_STACK] = {"Max stack size", "bytes"},
@@ -1187,17 +1187,16 @@
 		count = sizeof(buffer) - 1;
 	if (copy_from_user(buffer, buf, count))
 		return -EFAULT;
-	make_it_fail = simple_strtol(buffer, &end, 0);
-	if (*end == '\n')
-		end++;
+	make_it_fail = simple_strtol(strstrip(buffer), &end, 0);
+	if (*end)
+		return -EINVAL;
 	task = get_proc_task(file->f_dentry->d_inode);
 	if (!task)
 		return -ESRCH;
 	task->make_it_fail = make_it_fail;
 	put_task_struct(task);
-	if (end - buffer == 0)
-		return -EIO;
-	return end - buffer;
+
+	return count;
 }
 
 static const struct file_operations proc_fault_inject_operations = {
@@ -2604,9 +2603,6 @@
 		dput(dentry);
 	}
 
-	if (tgid == 0)
-		goto out;
-
 	name.name = buf;
 	name.len = snprintf(buf, sizeof(buf), "%d", tgid);
 	leader = d_hash_and_lookup(mnt->mnt_root, &name);
@@ -2663,17 +2659,16 @@
 void proc_flush_task(struct task_struct *task)
 {
 	int i;
-	struct pid *pid, *tgid = NULL;
+	struct pid *pid, *tgid;
 	struct upid *upid;
 
 	pid = task_pid(task);
-	if (thread_group_leader(task))
-		tgid = task_tgid(task);
+	tgid = task_tgid(task);
 
 	for (i = 0; i <= pid->level; i++) {
 		upid = &pid->numbers[i];
 		proc_flush_task_mnt(upid->ns->proc_mnt, upid->nr,
-			tgid ? tgid->numbers[i].nr : 0);
+					tgid->numbers[i].nr);
 	}
 
 	upid = &pid->numbers[pid->level];
diff --git a/fs/proc/kcore.c b/fs/proc/kcore.c
index f06f45b4..5601337 100644
--- a/fs/proc/kcore.c
+++ b/fs/proc/kcore.c
@@ -17,9 +17,15 @@
 #include <linux/elfcore.h>
 #include <linux/vmalloc.h>
 #include <linux/highmem.h>
+#include <linux/bootmem.h>
 #include <linux/init.h>
 #include <asm/uaccess.h>
 #include <asm/io.h>
+#include <linux/list.h>
+#include <linux/ioport.h>
+#include <linux/mm.h>
+#include <linux/memory.h>
+#include <asm/sections.h>
 
 #define CORE_STR "CORE"
 
@@ -29,17 +35,6 @@
 
 static struct proc_dir_entry *proc_root_kcore;
 
-static int open_kcore(struct inode * inode, struct file * filp)
-{
-	return capable(CAP_SYS_RAWIO) ? 0 : -EPERM;
-}
-
-static ssize_t read_kcore(struct file *, char __user *, size_t, loff_t *);
-
-static const struct file_operations proc_kcore_operations = {
-	.read		= read_kcore,
-	.open		= open_kcore,
-};
 
 #ifndef kc_vaddr_to_offset
 #define	kc_vaddr_to_offset(v) ((v) - PAGE_OFFSET)
@@ -57,18 +52,19 @@
 	void *data;
 };
 
-static struct kcore_list *kclist;
+static LIST_HEAD(kclist_head);
 static DEFINE_RWLOCK(kclist_lock);
+static int kcore_need_update = 1;
 
 void
-kclist_add(struct kcore_list *new, void *addr, size_t size)
+kclist_add(struct kcore_list *new, void *addr, size_t size, int type)
 {
 	new->addr = (unsigned long)addr;
 	new->size = size;
+	new->type = type;
 
 	write_lock(&kclist_lock);
-	new->next = kclist;
-	kclist = new;
+	list_add_tail(&new->list, &kclist_head);
 	write_unlock(&kclist_lock);
 }
 
@@ -80,7 +76,7 @@
 	*nphdr = 1; /* PT_NOTE */
 	size = 0;
 
-	for (m=kclist; m; m=m->next) {
+	list_for_each_entry(m, &kclist_head, list) {
 		try = kc_vaddr_to_offset((size_t)m->addr + m->size);
 		if (try > size)
 			size = try;
@@ -97,6 +93,177 @@
 	return size + *elf_buflen;
 }
 
+static void free_kclist_ents(struct list_head *head)
+{
+	struct kcore_list *tmp, *pos;
+
+	list_for_each_entry_safe(pos, tmp, head, list) {
+		list_del(&pos->list);
+		kfree(pos);
+	}
+}
+/*
+ * Replace all KCORE_RAM/KCORE_VMEMMAP information with passed list.
+ */
+static void __kcore_update_ram(struct list_head *list)
+{
+	int nphdr;
+	size_t size;
+	struct kcore_list *tmp, *pos;
+	LIST_HEAD(garbage);
+
+	write_lock(&kclist_lock);
+	if (kcore_need_update) {
+		list_for_each_entry_safe(pos, tmp, &kclist_head, list) {
+			if (pos->type == KCORE_RAM
+				|| pos->type == KCORE_VMEMMAP)
+				list_move(&pos->list, &garbage);
+		}
+		list_splice_tail(list, &kclist_head);
+	} else
+		list_splice(list, &garbage);
+	kcore_need_update = 0;
+	proc_root_kcore->size = get_kcore_size(&nphdr, &size);
+	write_unlock(&kclist_lock);
+
+	free_kclist_ents(&garbage);
+}
+
+
+#ifdef CONFIG_HIGHMEM
+/*
+ * If no highmem, we can assume [0...max_low_pfn) continuous range of memory
+ * because memory hole is not as big as !HIGHMEM case.
+ * (HIGHMEM is special because part of memory is _invisible_ from the kernel.)
+ */
+static int kcore_update_ram(void)
+{
+	LIST_HEAD(head);
+	struct kcore_list *ent;
+	int ret = 0;
+
+	ent = kmalloc(sizeof(*ent), GFP_KERNEL);
+	if (!ent)
+		return -ENOMEM;
+	ent->addr = (unsigned long)__va(0);
+	ent->size = max_low_pfn << PAGE_SHIFT;
+	ent->type = KCORE_RAM;
+	list_add(&ent->list, &head);
+	__kcore_update_ram(&head);
+	return ret;
+}
+
+#else /* !CONFIG_HIGHMEM */
+
+#ifdef CONFIG_SPARSEMEM_VMEMMAP
+/* calculate vmemmap's address from given system ram pfn and register it */
+int get_sparsemem_vmemmap_info(struct kcore_list *ent, struct list_head *head)
+{
+	unsigned long pfn = __pa(ent->addr) >> PAGE_SHIFT;
+	unsigned long nr_pages = ent->size >> PAGE_SHIFT;
+	unsigned long start, end;
+	struct kcore_list *vmm, *tmp;
+
+
+	start = ((unsigned long)pfn_to_page(pfn)) & PAGE_MASK;
+	end = ((unsigned long)pfn_to_page(pfn + nr_pages)) - 1;
+	end = ALIGN(end, PAGE_SIZE);
+	/* overlap check (because we have to align page */
+	list_for_each_entry(tmp, head, list) {
+		if (tmp->type != KCORE_VMEMMAP)
+			continue;
+		if (start < tmp->addr + tmp->size)
+			if (end > tmp->addr)
+				end = tmp->addr;
+	}
+	if (start < end) {
+		vmm = kmalloc(sizeof(*vmm), GFP_KERNEL);
+		if (!vmm)
+			return 0;
+		vmm->addr = start;
+		vmm->size = end - start;
+		vmm->type = KCORE_VMEMMAP;
+		list_add_tail(&vmm->list, head);
+	}
+	return 1;
+
+}
+#else
+int get_sparsemem_vmemmap_info(struct kcore_list *ent, struct list_head *head)
+{
+	return 1;
+}
+
+#endif
+
+static int
+kclist_add_private(unsigned long pfn, unsigned long nr_pages, void *arg)
+{
+	struct list_head *head = (struct list_head *)arg;
+	struct kcore_list *ent;
+
+	ent = kmalloc(sizeof(*ent), GFP_KERNEL);
+	if (!ent)
+		return -ENOMEM;
+	ent->addr = (unsigned long)__va((pfn << PAGE_SHIFT));
+	ent->size = nr_pages << PAGE_SHIFT;
+
+	/* Sanity check: Can happen in 32bit arch...maybe */
+	if (ent->addr < (unsigned long) __va(0))
+		goto free_out;
+
+	/* cut not-mapped area. ....from ppc-32 code. */
+	if (ULONG_MAX - ent->addr < ent->size)
+		ent->size = ULONG_MAX - ent->addr;
+
+	/* cut when vmalloc() area is higher than direct-map area */
+	if (VMALLOC_START > (unsigned long)__va(0)) {
+		if (ent->addr > VMALLOC_START)
+			goto free_out;
+		if (VMALLOC_START - ent->addr < ent->size)
+			ent->size = VMALLOC_START - ent->addr;
+	}
+
+	ent->type = KCORE_RAM;
+	list_add_tail(&ent->list, head);
+
+	if (!get_sparsemem_vmemmap_info(ent, head)) {
+		list_del(&ent->list);
+		goto free_out;
+	}
+
+	return 0;
+free_out:
+	kfree(ent);
+	return 1;
+}
+
+static int kcore_update_ram(void)
+{
+	int nid, ret;
+	unsigned long end_pfn;
+	LIST_HEAD(head);
+
+	/* Not inialized....update now */
+	/* find out "max pfn" */
+	end_pfn = 0;
+	for_each_node_state(nid, N_HIGH_MEMORY) {
+		unsigned long node_end;
+		node_end  = NODE_DATA(nid)->node_start_pfn +
+			NODE_DATA(nid)->node_spanned_pages;
+		if (end_pfn < node_end)
+			end_pfn = node_end;
+	}
+	/* scan 0 to max_pfn */
+	ret = walk_system_ram_range(0, end_pfn, &head, kclist_add_private);
+	if (ret) {
+		free_kclist_ents(&head);
+		return -ENOMEM;
+	}
+	__kcore_update_ram(&head);
+	return ret;
+}
+#endif /* CONFIG_HIGHMEM */
 
 /*****************************************************************************/
 /*
@@ -192,7 +359,7 @@
 	nhdr->p_align	= 0;
 
 	/* setup ELF PT_LOAD program header for every area */
-	for (m=kclist; m; m=m->next) {
+	list_for_each_entry(m, &kclist_head, list) {
 		phdr = (struct elf_phdr *) bufp;
 		bufp += sizeof(struct elf_phdr);
 		offset += sizeof(struct elf_phdr);
@@ -265,7 +432,8 @@
 	unsigned long start;
 
 	read_lock(&kclist_lock);
-	proc_root_kcore->size = size = get_kcore_size(&nphdr, &elf_buflen);
+	size = get_kcore_size(&nphdr, &elf_buflen);
+
 	if (buflen == 0 || *fpos >= size) {
 		read_unlock(&kclist_lock);
 		return 0;
@@ -317,7 +485,7 @@
 		struct kcore_list *m;
 
 		read_lock(&kclist_lock);
-		for (m=kclist; m; m=m->next) {
+		list_for_each_entry(m, &kclist_head, list) {
 			if (start >= m->addr && start < (m->addr+m->size))
 				break;
 		}
@@ -326,7 +494,7 @@
 		if (m == NULL) {
 			if (clear_user(buffer, tsz))
 				return -EFAULT;
-		} else if (is_vmalloc_addr((void *)start)) {
+		} else if (is_vmalloc_or_module_addr((void *)start)) {
 			char * elf_buf;
 
 			elf_buf = kzalloc(tsz, GFP_KERNEL);
@@ -371,12 +539,96 @@
 	return acc;
 }
 
+
+static int open_kcore(struct inode *inode, struct file *filp)
+{
+	if (!capable(CAP_SYS_RAWIO))
+		return -EPERM;
+	if (kcore_need_update)
+		kcore_update_ram();
+	if (i_size_read(inode) != proc_root_kcore->size) {
+		mutex_lock(&inode->i_mutex);
+		i_size_write(inode, proc_root_kcore->size);
+		mutex_unlock(&inode->i_mutex);
+	}
+	return 0;
+}
+
+
+static const struct file_operations proc_kcore_operations = {
+	.read		= read_kcore,
+	.open		= open_kcore,
+};
+
+#ifdef CONFIG_MEMORY_HOTPLUG
+/* just remember that we have to update kcore */
+static int __meminit kcore_callback(struct notifier_block *self,
+				    unsigned long action, void *arg)
+{
+	switch (action) {
+	case MEM_ONLINE:
+	case MEM_OFFLINE:
+		write_lock(&kclist_lock);
+		kcore_need_update = 1;
+		write_unlock(&kclist_lock);
+	}
+	return NOTIFY_OK;
+}
+#endif
+
+
+static struct kcore_list kcore_vmalloc;
+
+#ifdef CONFIG_ARCH_PROC_KCORE_TEXT
+static struct kcore_list kcore_text;
+/*
+ * If defined, special segment is used for mapping kernel text instead of
+ * direct-map area. We need to create special TEXT section.
+ */
+static void __init proc_kcore_text_init(void)
+{
+	kclist_add(&kcore_text, _stext, _end - _stext, KCORE_TEXT);
+}
+#else
+static void __init proc_kcore_text_init(void)
+{
+}
+#endif
+
+#if defined(CONFIG_MODULES) && defined(MODULES_VADDR)
+/*
+ * MODULES_VADDR has no intersection with VMALLOC_ADDR.
+ */
+struct kcore_list kcore_modules;
+static void __init add_modules_range(void)
+{
+	kclist_add(&kcore_modules, (void *)MODULES_VADDR,
+			MODULES_END - MODULES_VADDR, KCORE_VMALLOC);
+}
+#else
+static void __init add_modules_range(void)
+{
+}
+#endif
+
 static int __init proc_kcore_init(void)
 {
-	proc_root_kcore = proc_create("kcore", S_IRUSR, NULL, &proc_kcore_operations);
-	if (proc_root_kcore)
-		proc_root_kcore->size =
-				(size_t)high_memory - PAGE_OFFSET + PAGE_SIZE;
+	proc_root_kcore = proc_create("kcore", S_IRUSR, NULL,
+				      &proc_kcore_operations);
+	if (!proc_root_kcore) {
+		printk(KERN_ERR "couldn't create /proc/kcore\n");
+		return 0; /* Always returns 0. */
+	}
+	/* Store text area if it's special */
+	proc_kcore_text_init();
+	/* Store vmalloc area */
+	kclist_add(&kcore_vmalloc, (void *)VMALLOC_START,
+		VMALLOC_END - VMALLOC_START, KCORE_VMALLOC);
+	add_modules_range();
+	/* Store direct-map area from physical memory map */
+	kcore_update_ram();
+	hotplug_memory_notifier(kcore_callback, 0);
+
 	return 0;
 }
 module_init(proc_kcore_init);
diff --git a/fs/proc/nommu.c b/fs/proc/nommu.c
index 7e14d1a..9fe7d7e 100644
--- a/fs/proc/nommu.c
+++ b/fs/proc/nommu.c
@@ -109,7 +109,7 @@
 	return rb_next((struct rb_node *) v);
 }
 
-static struct seq_operations proc_nommu_region_list_seqop = {
+static const struct seq_operations proc_nommu_region_list_seqop = {
 	.start	= nommu_region_list_start,
 	.next	= nommu_region_list_next,
 	.stop	= nommu_region_list_stop,
diff --git a/fs/proc/task_mmu.c b/fs/proc/task_mmu.c
index 59e98fe..2a1bef9 100644
--- a/fs/proc/task_mmu.c
+++ b/fs/proc/task_mmu.c
@@ -243,6 +243,25 @@
 				} else if (vma->vm_start <= mm->start_stack &&
 					   vma->vm_end >= mm->start_stack) {
 					name = "[stack]";
+				} else {
+					unsigned long stack_start;
+					struct proc_maps_private *pmp;
+
+					pmp = m->private;
+					stack_start = pmp->task->stack_start;
+
+					if (vma->vm_start <= stack_start &&
+					    vma->vm_end >= stack_start) {
+						pad_len_spaces(m, len);
+						seq_printf(m,
+						 "[threadstack:%08lx]",
+#ifdef CONFIG_STACK_GROWSUP
+						 vma->vm_end - stack_start
+#else
+						 stack_start - vma->vm_start
+#endif
+						);
+					}
 				}
 			} else {
 				name = "[vdso]";
@@ -473,21 +492,20 @@
 				size_t count, loff_t *ppos)
 {
 	struct task_struct *task;
-	char buffer[PROC_NUMBUF], *end;
+	char buffer[PROC_NUMBUF];
 	struct mm_struct *mm;
 	struct vm_area_struct *vma;
-	int type;
+	long type;
 
 	memset(buffer, 0, sizeof(buffer));
 	if (count > sizeof(buffer) - 1)
 		count = sizeof(buffer) - 1;
 	if (copy_from_user(buffer, buf, count))
 		return -EFAULT;
-	type = simple_strtol(buffer, &end, 0);
+	if (strict_strtol(strstrip(buffer), 10, &type))
+		return -EINVAL;
 	if (type < CLEAR_REFS_ALL || type > CLEAR_REFS_MAPPED)
 		return -EINVAL;
-	if (*end == '\n')
-		end++;
 	task = get_proc_task(file->f_path.dentry->d_inode);
 	if (!task)
 		return -ESRCH;
@@ -523,9 +541,8 @@
 		mmput(mm);
 	}
 	put_task_struct(task);
-	if (end - buffer == 0)
-		return -EIO;
-	return end - buffer;
+
+	return count;
 }
 
 const struct file_operations proc_clear_refs_operations = {
diff --git a/fs/qnx4/Kconfig b/fs/qnx4/Kconfig
index be8e0e1..5f60899 100644
--- a/fs/qnx4/Kconfig
+++ b/fs/qnx4/Kconfig
@@ -6,20 +6,9 @@
 	  QNX 4 and QNX 6 (the latter is also called QNX RTP).
 	  Further information is available at <http://www.qnx.com/>.
 	  Say Y if you intend to mount QNX hard disks or floppies.
-	  Unless you say Y to "QNX4FS read-write support" below, you will
-	  only be able to read these file systems.
 
 	  To compile this file system support as a module, choose M here: the
 	  module will be called qnx4.
 
 	  If you don't know whether you need it, then you don't need it:
 	  answer N.
-
-config QNX4FS_RW
-	bool "QNX4FS write support (DANGEROUS)"
-	depends on QNX4FS_FS && EXPERIMENTAL && BROKEN
-	help
-	  Say Y if you want to test write support for QNX4 file systems.
-
-	  It's currently broken, so for now:
-	  answer N.
diff --git a/fs/qnx4/Makefile b/fs/qnx4/Makefile
index e4d408c..4a283b3 100644
--- a/fs/qnx4/Makefile
+++ b/fs/qnx4/Makefile
@@ -4,4 +4,4 @@
 
 obj-$(CONFIG_QNX4FS_FS) += qnx4.o
 
-qnx4-objs := inode.o dir.o namei.o file.o bitmap.o truncate.o
+qnx4-objs := inode.o dir.o namei.o bitmap.o
diff --git a/fs/qnx4/bitmap.c b/fs/qnx4/bitmap.c
index e1cd061..0afba06 100644
--- a/fs/qnx4/bitmap.c
+++ b/fs/qnx4/bitmap.c
@@ -78,84 +78,3 @@
 
 	return total_free;
 }
-
-#ifdef CONFIG_QNX4FS_RW
-
-int qnx4_is_free(struct super_block *sb, long block)
-{
-	int start = le32_to_cpu(qnx4_sb(sb)->BitMap->di_first_xtnt.xtnt_blk) - 1;
-	int size = le32_to_cpu(qnx4_sb(sb)->BitMap->di_size);
-	struct buffer_head *bh;
-	const char *g;
-	int ret = -EIO;
-
-	start += block / (QNX4_BLOCK_SIZE * 8);
-	QNX4DEBUG(("qnx4: is_free requesting block [%lu], bitmap in block [%lu]\n",
-		   (unsigned long) block, (unsigned long) start));
-	(void) size;		/* CHECKME */
-	bh = sb_bread(sb, start);
-	if (bh == NULL) {
-		return -EIO;
-	}
-	g = bh->b_data + (block % QNX4_BLOCK_SIZE);
-	if (((*g) & (1 << (block % 8))) == 0) {
-		QNX4DEBUG(("qnx4: is_free -> block is free\n"));
-		ret = 1;
-	} else {
-		QNX4DEBUG(("qnx4: is_free -> block is busy\n"));
-		ret = 0;
-	}
-	brelse(bh);
-
-	return ret;
-}
-
-int qnx4_set_bitmap(struct super_block *sb, long block, int busy)
-{
-	int start = le32_to_cpu(qnx4_sb(sb)->BitMap->di_first_xtnt.xtnt_blk) - 1;
-	int size = le32_to_cpu(qnx4_sb(sb)->BitMap->di_size);
-	struct buffer_head *bh;
-	char *g;
-
-	start += block / (QNX4_BLOCK_SIZE * 8);
-	QNX4DEBUG(("qnx4: set_bitmap requesting block [%lu], bitmap in block [%lu]\n",
-		   (unsigned long) block, (unsigned long) start));
-	(void) size;		/* CHECKME */
-	bh = sb_bread(sb, start);
-	if (bh == NULL) {
-		return -EIO;
-	}
-	g = bh->b_data + (block % QNX4_BLOCK_SIZE);
-	if (busy == 0) {
-		(*g) &= ~(1 << (block % 8));
-	} else {
-		(*g) |= (1 << (block % 8));
-	}
-	mark_buffer_dirty(bh);
-	brelse(bh);
-
-	return 0;
-}
-
-static void qnx4_clear_inode(struct inode *inode)
-{
-	struct qnx4_inode_entry *qnx4_ino = qnx4_raw_inode(inode);
-	/* What for? */
-	memset(qnx4_ino->di_fname, 0, sizeof qnx4_ino->di_fname);
-	qnx4_ino->di_size = 0;
-	qnx4_ino->di_num_xtnts = 0;
-	qnx4_ino->di_mode = 0;
-	qnx4_ino->di_status = 0;
-}
-
-void qnx4_free_inode(struct inode *inode)
-{
-	if (inode->i_ino < 1) {
-		printk("free_inode: inode 0 or nonexistent inode\n");
-		return;
-	}
-	qnx4_clear_inode(inode);
-	clear_inode(inode);
-}
-
-#endif
diff --git a/fs/qnx4/dir.c b/fs/qnx4/dir.c
index 003c68f..86cc39c 100644
--- a/fs/qnx4/dir.c
+++ b/fs/qnx4/dir.c
@@ -85,9 +85,4 @@
 const struct inode_operations qnx4_dir_inode_operations =
 {
 	.lookup		= qnx4_lookup,
-#ifdef CONFIG_QNX4FS_RW
-	.create		= qnx4_create,
-	.unlink		= qnx4_unlink,
-	.rmdir		= qnx4_rmdir,
-#endif
 };
diff --git a/fs/qnx4/file.c b/fs/qnx4/file.c
deleted file mode 100644
index 09b170a..0000000
--- a/fs/qnx4/file.c
+++ /dev/null
@@ -1,40 +0,0 @@
-/*
- * QNX4 file system, Linux implementation.
- *
- * Version : 0.2.1
- *
- * Using parts of the xiafs filesystem.
- *
- * History :
- *
- * 25-05-1998 by Richard Frowijn : first release.
- * 21-06-1998 by Frank Denis : wrote qnx4_readpage to use generic_file_read.
- * 27-06-1998 by Frank Denis : file overwriting.
- */
-
-#include "qnx4.h"
-
-/*
- * We have mostly NULL's here: the current defaults are ok for
- * the qnx4 filesystem.
- */
-const struct file_operations qnx4_file_operations =
-{
-	.llseek		= generic_file_llseek,
-	.read		= do_sync_read,
-	.aio_read	= generic_file_aio_read,
-	.mmap		= generic_file_mmap,
-	.splice_read	= generic_file_splice_read,
-#ifdef CONFIG_QNX4FS_RW
-	.write		= do_sync_write,
-	.aio_write	= generic_file_aio_write,
-	.fsync		= simple_fsync,
-#endif
-};
-
-const struct inode_operations qnx4_file_inode_operations =
-{
-#ifdef CONFIG_QNX4FS_RW
-	.truncate	= qnx4_truncate,
-#endif
-};
diff --git a/fs/qnx4/inode.c b/fs/qnx4/inode.c
index 681df5f..d2cd179 100644
--- a/fs/qnx4/inode.c
+++ b/fs/qnx4/inode.c
@@ -28,73 +28,6 @@
 
 static const struct super_operations qnx4_sops;
 
-#ifdef CONFIG_QNX4FS_RW
-
-static void qnx4_delete_inode(struct inode *inode)
-{
-	QNX4DEBUG(("qnx4: deleting inode [%lu]\n", (unsigned long) inode->i_ino));
-	truncate_inode_pages(&inode->i_data, 0);
-	inode->i_size = 0;
-	qnx4_truncate(inode);
-	lock_kernel();
-	qnx4_free_inode(inode);
-	unlock_kernel();
-}
-
-static int qnx4_write_inode(struct inode *inode, int do_sync)
-{
-	struct qnx4_inode_entry *raw_inode;
-	int block, ino;
-	struct buffer_head *bh;
-	ino = inode->i_ino;
-
-	QNX4DEBUG(("qnx4: write inode 1.\n"));
-	if (inode->i_nlink == 0) {
-		return 0;
-	}
-	if (!ino) {
-		printk("qnx4: bad inode number on dev %s: %d is out of range\n",
-		       inode->i_sb->s_id, ino);
-		return -EIO;
-	}
-	QNX4DEBUG(("qnx4: write inode 2.\n"));
-	block = ino / QNX4_INODES_PER_BLOCK;
-	lock_kernel();
-	if (!(bh = sb_bread(inode->i_sb, block))) {
-		printk("qnx4: major problem: unable to read inode from dev "
-		       "%s\n", inode->i_sb->s_id);
-		unlock_kernel();
-		return -EIO;
-	}
-	raw_inode = ((struct qnx4_inode_entry *) bh->b_data) +
-	    (ino % QNX4_INODES_PER_BLOCK);
-	raw_inode->di_mode  = cpu_to_le16(inode->i_mode);
-	raw_inode->di_uid   = cpu_to_le16(fs_high2lowuid(inode->i_uid));
-	raw_inode->di_gid   = cpu_to_le16(fs_high2lowgid(inode->i_gid));
-	raw_inode->di_nlink = cpu_to_le16(inode->i_nlink);
-	raw_inode->di_size  = cpu_to_le32(inode->i_size);
-	raw_inode->di_mtime = cpu_to_le32(inode->i_mtime.tv_sec);
-	raw_inode->di_atime = cpu_to_le32(inode->i_atime.tv_sec);
-	raw_inode->di_ctime = cpu_to_le32(inode->i_ctime.tv_sec);
-	raw_inode->di_first_xtnt.xtnt_size = cpu_to_le32(inode->i_blocks);
-	mark_buffer_dirty(bh);
-	if (do_sync) {
-		sync_dirty_buffer(bh);
-		if (buffer_req(bh) && !buffer_uptodate(bh)) {
-			printk("qnx4: IO error syncing inode [%s:%08x]\n",
-					inode->i_sb->s_id, ino);
-			brelse(bh);
-			unlock_kernel();
-			return -EIO;
-		}
-	}
-	brelse(bh);
-	unlock_kernel();
-	return 0;
-}
-
-#endif
-
 static void qnx4_put_super(struct super_block *sb);
 static struct inode *qnx4_alloc_inode(struct super_block *sb);
 static void qnx4_destroy_inode(struct inode *inode);
@@ -108,10 +41,6 @@
 	.put_super	= qnx4_put_super,
 	.statfs		= qnx4_statfs,
 	.remount_fs	= qnx4_remount,
-#ifdef CONFIG_QNX4FS_RW
-	.write_inode	= qnx4_write_inode,
-	.delete_inode	= qnx4_delete_inode,
-#endif
 };
 
 static int qnx4_remount(struct super_block *sb, int *flags, char *data)
@@ -120,15 +49,7 @@
 
 	qs = qnx4_sb(sb);
 	qs->Version = QNX4_VERSION;
-#ifndef CONFIG_QNX4FS_RW
 	*flags |= MS_RDONLY;
-#endif
-	if (*flags & MS_RDONLY) {
-		return 0;
-	}
-
-	mark_buffer_dirty(qs->sb_buf);
-
 	return 0;
 }
 
@@ -354,9 +275,7 @@
 	}
 	s->s_op = &qnx4_sops;
 	s->s_magic = QNX4_SUPER_MAGIC;
-#ifndef CONFIG_QNX4FS_RW
 	s->s_flags |= MS_RDONLY;	/* Yup, read-only yet */
-#endif
 	qnx4_sb(s)->sb_buf = bh;
 	qnx4_sb(s)->sb = (struct qnx4_super_block *) bh->b_data;
 
@@ -489,8 +408,7 @@
 
 	memcpy(qnx4_inode, raw_inode, QNX4_DIR_ENTRY_SIZE);
 	if (S_ISREG(inode->i_mode)) {
-		inode->i_op = &qnx4_file_inode_operations;
-		inode->i_fop = &qnx4_file_operations;
+		inode->i_fop = &generic_ro_fops;
 		inode->i_mapping->a_ops = &qnx4_aops;
 		qnx4_i(inode)->mmu_private = inode->i_size;
 	} else if (S_ISDIR(inode->i_mode)) {
diff --git a/fs/qnx4/namei.c b/fs/qnx4/namei.c
index 5972ed2..ae1e7ed 100644
--- a/fs/qnx4/namei.c
+++ b/fs/qnx4/namei.c
@@ -134,108 +134,3 @@
 
 	return NULL;
 }
-
-#ifdef CONFIG_QNX4FS_RW
-int qnx4_create(struct inode *dir, struct dentry *dentry, int mode,
-		struct nameidata *nd)
-{
-	QNX4DEBUG(("qnx4: qnx4_create\n"));
-	if (dir == NULL) {
-		return -ENOENT;
-	}
-	return -ENOSPC;
-}
-
-int qnx4_rmdir(struct inode *dir, struct dentry *dentry)
-{
-	struct buffer_head *bh;
-	struct qnx4_inode_entry *de;
-	struct inode *inode;
-	int retval;
-	int ino;
-
-	QNX4DEBUG(("qnx4: qnx4_rmdir [%s]\n", dentry->d_name.name));
-	lock_kernel();
-	bh = qnx4_find_entry(dentry->d_name.len, dir, dentry->d_name.name,
-			     &de, &ino);
-	if (bh == NULL) {
-		unlock_kernel();
-		return -ENOENT;
-	}
-	inode = dentry->d_inode;
-	if (inode->i_ino != ino) {
-		retval = -EIO;
-		goto end_rmdir;
-	}
-#if 0
-	if (!empty_dir(inode)) {
-		retval = -ENOTEMPTY;
-		goto end_rmdir;
-	}
-#endif
-	if (inode->i_nlink != 2) {
-		QNX4DEBUG(("empty directory has nlink!=2 (%d)\n", inode->i_nlink));
-	}
-	QNX4DEBUG(("qnx4: deleting directory\n"));
-	de->di_status = 0;
-	memset(de->di_fname, 0, sizeof de->di_fname);
-	de->di_mode = 0;
-	mark_buffer_dirty_inode(bh, dir);
-	clear_nlink(inode);
-	mark_inode_dirty(inode);
-	inode->i_ctime = dir->i_ctime = dir->i_mtime = CURRENT_TIME_SEC;
-	inode_dec_link_count(dir);
-	retval = 0;
-
-      end_rmdir:
-	brelse(bh);
-
-	unlock_kernel();
-	return retval;
-}
-
-int qnx4_unlink(struct inode *dir, struct dentry *dentry)
-{
-	struct buffer_head *bh;
-	struct qnx4_inode_entry *de;
-	struct inode *inode;
-	int retval;
-	int ino;
-
-	QNX4DEBUG(("qnx4: qnx4_unlink [%s]\n", dentry->d_name.name));
-	lock_kernel();
-	bh = qnx4_find_entry(dentry->d_name.len, dir, dentry->d_name.name,
-			     &de, &ino);
-	if (bh == NULL) {
-		unlock_kernel();
-		return -ENOENT;
-	}
-	inode = dentry->d_inode;
-	if (inode->i_ino != ino) {
-		retval = -EIO;
-		goto end_unlink;
-	}
-	retval = -EPERM;
-	if (!inode->i_nlink) {
-		QNX4DEBUG(("Deleting nonexistent file (%s:%lu), %d\n",
-			   inode->i_sb->s_id,
-			   inode->i_ino, inode->i_nlink));
-		inode->i_nlink = 1;
-	}
-	de->di_status = 0;
-	memset(de->di_fname, 0, sizeof de->di_fname);
-	de->di_mode = 0;
-	mark_buffer_dirty_inode(bh, dir);
-	dir->i_ctime = dir->i_mtime = CURRENT_TIME_SEC;
-	mark_inode_dirty(dir);
-	inode->i_ctime = dir->i_ctime;
-	inode_dec_link_count(inode);
-	retval = 0;
-
-end_unlink:
-	unlock_kernel();
-	brelse(bh);
-
-	return retval;
-}
-#endif
diff --git a/fs/qnx4/qnx4.h b/fs/qnx4/qnx4.h
index 9efc089..33a6085 100644
--- a/fs/qnx4/qnx4.h
+++ b/fs/qnx4/qnx4.h
@@ -29,17 +29,9 @@
 
 extern struct buffer_head *qnx4_bread(struct inode *, int, int);
 
-extern const struct inode_operations qnx4_file_inode_operations;
 extern const struct inode_operations qnx4_dir_inode_operations;
-extern const struct file_operations qnx4_file_operations;
 extern const struct file_operations qnx4_dir_operations;
 extern int qnx4_is_free(struct super_block *sb, long block);
-extern int qnx4_set_bitmap(struct super_block *sb, long block, int busy);
-extern int qnx4_create(struct inode *inode, struct dentry *dentry, int mode, struct nameidata *nd);
-extern void qnx4_truncate(struct inode *inode);
-extern void qnx4_free_inode(struct inode *inode);
-extern int qnx4_unlink(struct inode *dir, struct dentry *dentry);
-extern int qnx4_rmdir(struct inode *dir, struct dentry *dentry);
 
 static inline struct qnx4_sb_info *qnx4_sb(struct super_block *sb)
 {
diff --git a/fs/qnx4/truncate.c b/fs/qnx4/truncate.c
deleted file mode 100644
index d94d9ee..0000000
--- a/fs/qnx4/truncate.c
+++ /dev/null
@@ -1,34 +0,0 @@
-/* 
- * QNX4 file system, Linux implementation.
- * 
- * Version : 0.1
- * 
- * Using parts of the xiafs filesystem.
- * 
- * History :
- * 
- * 30-06-1998 by Frank DENIS : ugly filler.
- */
-
-#include <linux/smp_lock.h>
-#include "qnx4.h"
-
-#ifdef CONFIG_QNX4FS_RW
-
-void qnx4_truncate(struct inode *inode)
-{
-	if (!(S_ISREG(inode->i_mode) || S_ISDIR(inode->i_mode) ||
-	      S_ISLNK(inode->i_mode))) {
-		return;
-	}
-	lock_kernel();
-	if (!(S_ISDIR(inode->i_mode))) {
-		/* TODO */
-	}
-	QNX4DEBUG(("qnx4: qnx4_truncate called\n"));
-	inode->i_mtime = inode->i_ctime = CURRENT_TIME_SEC;
-	mark_inode_dirty(inode);
-	unlock_kernel();
-}
-
-#endif
diff --git a/fs/ramfs/inode.c b/fs/ramfs/inode.c
index a7f0110..a6090aa 100644
--- a/fs/ramfs/inode.c
+++ b/fs/ramfs/inode.c
@@ -34,12 +34,10 @@
 #include <linux/ramfs.h>
 #include <linux/sched.h>
 #include <linux/parser.h>
+#include <linux/magic.h>
 #include <asm/uaccess.h>
 #include "internal.h"
 
-/* some random number */
-#define RAMFS_MAGIC	0x858458f6
-
 #define RAMFS_DEFAULT_MODE	0755
 
 static const struct super_operations ramfs_ops;
diff --git a/fs/select.c b/fs/select.c
index 8084834..a201fc3 100644
--- a/fs/select.c
+++ b/fs/select.c
@@ -41,22 +41,28 @@
  * better solutions..
  */
 
+#define MAX_SLACK	(100 * NSEC_PER_MSEC)
+
 static long __estimate_accuracy(struct timespec *tv)
 {
 	long slack;
 	int divfactor = 1000;
 
+	if (tv->tv_sec < 0)
+		return 0;
+
 	if (task_nice(current) > 0)
 		divfactor = divfactor / 5;
 
+	if (tv->tv_sec > MAX_SLACK / (NSEC_PER_SEC/divfactor))
+		return MAX_SLACK;
+
 	slack = tv->tv_nsec / divfactor;
 	slack += tv->tv_sec * (NSEC_PER_SEC/divfactor);
 
-	if (slack > 100 * NSEC_PER_MSEC)
-		slack =  100 * NSEC_PER_MSEC;
+	if (slack > MAX_SLACK)
+		return MAX_SLACK;
 
-	if (slack < 0)
-		slack = 0;
 	return slack;
 }
 
diff --git a/fs/smbfs/proc.c b/fs/smbfs/proc.c
index 9468168..71c29b6 100644
--- a/fs/smbfs/proc.c
+++ b/fs/smbfs/proc.c
@@ -509,7 +509,7 @@
 		month = 2;
 	} else {
 		nl_day = (year & 3) || day <= 59 ? day : day - 1;
-		for (month = 0; month < 12; month++)
+		for (month = 1; month < 12; month++)
 			if (day_n[month] > nl_day)
 				break;
 	}
diff --git a/fs/sync.c b/fs/sync.c
index c08467a..d104591 100644
--- a/fs/sync.c
+++ b/fs/sync.c
@@ -183,6 +183,7 @@
 		ret = err;
 	return ret;
 }
+EXPORT_SYMBOL(file_fsync);
 
 /**
  * vfs_fsync_range - helper to sync a range of data & metadata to disk
diff --git a/include/asm-generic/gpio.h b/include/asm-generic/gpio.h
index d6c379d..9cca3785 100644
--- a/include/asm-generic/gpio.h
+++ b/include/asm-generic/gpio.h
@@ -141,6 +141,8 @@
  * but more typically is configured entirely from userspace.
  */
 extern int gpio_export(unsigned gpio, bool direction_may_change);
+extern int gpio_export_link(struct device *dev, const char *name,
+			unsigned gpio);
 extern void gpio_unexport(unsigned gpio);
 
 #endif	/* CONFIG_GPIO_SYSFS */
@@ -185,6 +187,12 @@
 	return -ENOSYS;
 }
 
+static inline int gpio_export_link(struct device *dev, const char *name,
+				unsigned gpio)
+{
+	return -ENOSYS;
+}
+
 static inline void gpio_unexport(unsigned gpio)
 {
 }
diff --git a/include/asm-generic/kmap_types.h b/include/asm-generic/kmap_types.h
index eddbce0..e5f234a 100644
--- a/include/asm-generic/kmap_types.h
+++ b/include/asm-generic/kmap_types.h
@@ -2,34 +2,35 @@
 #define _ASM_GENERIC_KMAP_TYPES_H
 
 #ifdef __WITH_KM_FENCE
-# define D(n) __KM_FENCE_##n ,
+# define KMAP_D(n) __KM_FENCE_##n ,
 #else
-# define D(n)
+# define KMAP_D(n)
 #endif
 
 enum km_type {
-D(0)	KM_BOUNCE_READ,
-D(1)	KM_SKB_SUNRPC_DATA,
-D(2)	KM_SKB_DATA_SOFTIRQ,
-D(3)	KM_USER0,
-D(4)	KM_USER1,
-D(5)	KM_BIO_SRC_IRQ,
-D(6)	KM_BIO_DST_IRQ,
-D(7)	KM_PTE0,
-D(8)	KM_PTE1,
-D(9)	KM_IRQ0,
-D(10)	KM_IRQ1,
-D(11)	KM_SOFTIRQ0,
-D(12)	KM_SOFTIRQ1,
-D(13)	KM_SYNC_ICACHE,
-D(14)	KM_SYNC_DCACHE,
-D(15)	KM_UML_USERCOPY, /* UML specific, for copy_*_user - used in do_op_one_page */
-D(16)	KM_IRQ_PTE,
-D(17)	KM_NMI,
-D(18)	KM_NMI_PTE,
-D(19)	KM_TYPE_NR
+KMAP_D(0)	KM_BOUNCE_READ,
+KMAP_D(1)	KM_SKB_SUNRPC_DATA,
+KMAP_D(2)	KM_SKB_DATA_SOFTIRQ,
+KMAP_D(3)	KM_USER0,
+KMAP_D(4)	KM_USER1,
+KMAP_D(5)	KM_BIO_SRC_IRQ,
+KMAP_D(6)	KM_BIO_DST_IRQ,
+KMAP_D(7)	KM_PTE0,
+KMAP_D(8)	KM_PTE1,
+KMAP_D(9)	KM_IRQ0,
+KMAP_D(10)	KM_IRQ1,
+KMAP_D(11)	KM_SOFTIRQ0,
+KMAP_D(12)	KM_SOFTIRQ1,
+KMAP_D(13)	KM_SYNC_ICACHE,
+KMAP_D(14)	KM_SYNC_DCACHE,
+/* UML specific, for copy_*_user - used in do_op_one_page */
+KMAP_D(15)	KM_UML_USERCOPY,
+KMAP_D(16)	KM_IRQ_PTE,
+KMAP_D(17)	KM_NMI,
+KMAP_D(18)	KM_NMI_PTE,
+KMAP_D(19)	KM_TYPE_NR
 };
 
-#undef D
+#undef KMAP_D
 
 #endif
diff --git a/include/asm-generic/sections.h b/include/asm-generic/sections.h
index d083561..b3bfabc 100644
--- a/include/asm-generic/sections.h
+++ b/include/asm-generic/sections.h
@@ -23,4 +23,20 @@
 #define dereference_function_descriptor(p) (p)
 #endif
 
+/* random extra sections (if any).  Override
+ * in asm/sections.h */
+#ifndef arch_is_kernel_text
+static inline int arch_is_kernel_text(unsigned long addr)
+{
+	return 0;
+}
+#endif
+
+#ifndef arch_is_kernel_data
+static inline int arch_is_kernel_data(unsigned long addr)
+{
+	return 0;
+}
+#endif
+
 #endif /* _ASM_GENERIC_SECTIONS_H_ */
diff --git a/include/asm-generic/syscall.h b/include/asm-generic/syscall.h
index ea8087b5..5c122ae 100644
--- a/include/asm-generic/syscall.h
+++ b/include/asm-generic/syscall.h
@@ -1,7 +1,7 @@
 /*
  * Access to user system call parameters and results
  *
- * Copyright (C) 2008 Red Hat, Inc.  All rights reserved.
+ * Copyright (C) 2008-2009 Red Hat, Inc.  All rights reserved.
  *
  * This copyrighted material is made available to anyone wishing to use,
  * modify, copy, or redistribute it subject to the terms and conditions
@@ -32,9 +32,13 @@
  * If @task is not executing a system call, i.e. it's blocked
  * inside the kernel for a fault or signal, returns -1.
  *
+ * Note this returns int even on 64-bit machines.  Only 32 bits of
+ * system call number can be meaningful.  If the actual arch value
+ * is 64 bits, this truncates to 32 bits so 0xffffffff means -1.
+ *
  * It's only valid to call this when @task is known to be blocked.
  */
-long syscall_get_nr(struct task_struct *task, struct pt_regs *regs);
+int syscall_get_nr(struct task_struct *task, struct pt_regs *regs);
 
 /**
  * syscall_rollback - roll back registers after an aborted system call
diff --git a/include/linux/anon_inodes.h b/include/linux/anon_inodes.h
index e0a0cdc..69a21e0 100644
--- a/include/linux/anon_inodes.h
+++ b/include/linux/anon_inodes.h
@@ -8,6 +8,9 @@
 #ifndef _LINUX_ANON_INODES_H
 #define _LINUX_ANON_INODES_H
 
+struct file *anon_inode_getfile(const char *name,
+				const struct file_operations *fops,
+				void *priv, int flags);
 int anon_inode_getfd(const char *name, const struct file_operations *fops,
 		     void *priv, int flags);
 
diff --git a/include/linux/cn_proc.h b/include/linux/cn_proc.h
index b8125b2..47dac5e 100644
--- a/include/linux/cn_proc.h
+++ b/include/linux/cn_proc.h
@@ -52,6 +52,7 @@
 		PROC_EVENT_EXEC = 0x00000002,
 		PROC_EVENT_UID  = 0x00000004,
 		PROC_EVENT_GID  = 0x00000040,
+		PROC_EVENT_SID  = 0x00000080,
 		/* "next" should be 0x00000400 */
 		/* "last" is the last process event: exit */
 		PROC_EVENT_EXIT = 0x80000000
@@ -89,6 +90,11 @@
 			} e;
 		} id;
 
+		struct sid_proc_event {
+			__kernel_pid_t process_pid;
+			__kernel_pid_t process_tgid;
+		} sid;
+
 		struct exit_proc_event {
 			__kernel_pid_t process_pid;
 			__kernel_pid_t process_tgid;
@@ -102,6 +108,7 @@
 void proc_fork_connector(struct task_struct *task);
 void proc_exec_connector(struct task_struct *task);
 void proc_id_connector(struct task_struct *task, int which_id);
+void proc_sid_connector(struct task_struct *task);
 void proc_exit_connector(struct task_struct *task);
 #else
 static inline void proc_fork_connector(struct task_struct *task)
@@ -114,6 +121,9 @@
 				     int which_id)
 {}
 
+static inline void proc_sid_connector(struct task_struct *task)
+{}
+
 static inline void proc_exit_connector(struct task_struct *task)
 {}
 #endif	/* CONFIG_PROC_EVENTS */
diff --git a/include/linux/cpumask.h b/include/linux/cpumask.h
index 796df12..9b1d458 100644
--- a/include/linux/cpumask.h
+++ b/include/linux/cpumask.h
@@ -715,6 +715,18 @@
 }
 
 /**
+ * cpumask_test_and_clear_cpu - atomically test and clear a cpu in a cpumask
+ * @cpu: cpu number (< nr_cpu_ids)
+ * @cpumask: the cpumask pointer
+ *
+ * test_and_clear_bit wrapper for cpumasks.
+ */
+static inline int cpumask_test_and_clear_cpu(int cpu, struct cpumask *cpumask)
+{
+	return test_and_clear_bit(cpumask_check(cpu), cpumask_bits(cpumask));
+}
+
+/**
  * cpumask_setall - set all cpus (< nr_cpu_ids) in a cpumask
  * @dstp: the cpumask pointer
  */
diff --git a/include/linux/eventfd.h b/include/linux/eventfd.h
index 3b85ba6..94dd103 100644
--- a/include/linux/eventfd.h
+++ b/include/linux/eventfd.h
@@ -27,6 +27,7 @@
 
 #ifdef CONFIG_EVENTFD
 
+struct file *eventfd_file_create(unsigned int count, int flags);
 struct eventfd_ctx *eventfd_ctx_get(struct eventfd_ctx *ctx);
 void eventfd_ctx_put(struct eventfd_ctx *ctx);
 struct file *eventfd_fget(int fd);
@@ -40,6 +41,11 @@
  * Ugly ugly ugly error layer to support modules that uses eventfd but
  * pretend to work in !CONFIG_EVENTFD configurations. Namely, AIO.
  */
+static inline struct file *eventfd_file_create(unsigned int count, int flags)
+{
+	return ERR_PTR(-ENOSYS);
+}
+
 static inline struct eventfd_ctx *eventfd_ctx_fdget(int fd)
 {
 	return ERR_PTR(-ENOSYS);
diff --git a/include/linux/gfp.h b/include/linux/gfp.h
index f53e9b8..557bdad 100644
--- a/include/linux/gfp.h
+++ b/include/linux/gfp.h
@@ -220,7 +220,7 @@
 					 ((1 << ZONES_SHIFT) - 1);
 
 	if (__builtin_constant_p(bit))
-		BUILD_BUG_ON((GFP_ZONE_BAD >> bit) & 1);
+		MAYBE_BUILD_BUG_ON((GFP_ZONE_BAD >> bit) & 1);
 	else {
 #ifdef CONFIG_DEBUG_VM
 		BUG_ON((GFP_ZONE_BAD >> bit) & 1);
diff --git a/include/linux/gpio.h b/include/linux/gpio.h
index e10c49a..059bd18 100644
--- a/include/linux/gpio.h
+++ b/include/linux/gpio.h
@@ -12,6 +12,8 @@
 #include <linux/types.h>
 #include <linux/errno.h>
 
+struct device;
+
 /*
  * Some platforms don't support the GPIO programming interface.
  *
@@ -89,6 +91,15 @@
 	return -EINVAL;
 }
 
+static inline int gpio_export_link(struct device *dev, const char *name,
+				unsigned gpio)
+{
+	/* GPIO can never have been exported */
+	WARN_ON(1);
+	return -EINVAL;
+}
+
+
 static inline void gpio_unexport(unsigned gpio)
 {
 	/* GPIO can never have been exported */
diff --git a/include/linux/ioport.h b/include/linux/ioport.h
index 786e7b8..83aa812 100644
--- a/include/linux/ioport.h
+++ b/include/linux/ioport.h
@@ -184,5 +184,9 @@
 extern int iomem_map_sanity_check(resource_size_t addr, unsigned long size);
 extern int iomem_is_exclusive(u64 addr);
 
+extern int
+walk_system_ram_range(unsigned long start_pfn, unsigned long nr_pages,
+		void *arg, int (*func)(unsigned long, unsigned long, void *));
+
 #endif /* __ASSEMBLY__ */
 #endif	/* _LINUX_IOPORT_H */
diff --git a/include/linux/jbd.h b/include/linux/jbd.h
index a1187a0..331530c 100644
--- a/include/linux/jbd.h
+++ b/include/linux/jbd.h
@@ -556,7 +556,7 @@
 	 * This transaction is being forced and some process is
 	 * waiting for it to finish.
 	 */
-	int t_synchronous_commit:1;
+	unsigned int t_synchronous_commit:1;
 };
 
 /**
diff --git a/include/linux/kernel.h b/include/linux/kernel.h
index 2b5b1e0..d3cd23f 100644
--- a/include/linux/kernel.h
+++ b/include/linux/kernel.h
@@ -146,7 +146,7 @@
 #define might_sleep_if(cond) do { if (cond) might_sleep(); } while (0)
 
 #define abs(x) ({				\
-		int __x = (x);			\
+		long __x = (x);			\
 		(__x < 0) ? -__x : __x;		\
 	})
 
@@ -246,14 +246,16 @@
 extern bool printk_timed_ratelimit(unsigned long *caller_jiffies,
 				   unsigned int interval_msec);
 
+extern int printk_delay_msec;
+
 /*
  * Print a one-time message (analogous to WARN_ONCE() et al):
  */
 #define printk_once(x...) ({			\
-	static int __print_once = 1;		\
+	static bool __print_once = true;	\
 						\
 	if (__print_once) {			\
-		__print_once = 0;		\
+		__print_once = false;		\
 		printk(x);			\
 	}					\
 })
@@ -676,13 +678,17 @@
 };
 
 /* Force a compilation error if condition is true */
-#define BUILD_BUG_ON(condition) ((void)sizeof(char[1 - 2*!!(condition)]))
+#define BUILD_BUG_ON(condition) ((void)BUILD_BUG_ON_ZERO(condition))
+
+/* Force a compilation error if condition is constant and true */
+#define MAYBE_BUILD_BUG_ON(cond) ((void)sizeof(char[1 - 2 * !!(cond)]))
 
 /* Force a compilation error if condition is true, but also produce a
    result (of value 0 and type size_t), so the expression can be used
    e.g. in a structure initializer (or where-ever else comma expressions
    aren't permitted). */
-#define BUILD_BUG_ON_ZERO(e) (sizeof(char[1 - 2 * !!(e)]) - 1)
+#define BUILD_BUG_ON_ZERO(e) (sizeof(struct { int:-!!(e); }))
+#define BUILD_BUG_ON_NULL(e) ((void *)sizeof(struct { int:-!!(e); }))
 
 /* Trap pasters of __FUNCTION__ at compile-time */
 #define __FUNCTION__ (__func__)
diff --git a/include/linux/kmemcheck.h b/include/linux/kmemcheck.h
index c800660..e880d4cf9 100644
--- a/include/linux/kmemcheck.h
+++ b/include/linux/kmemcheck.h
@@ -145,12 +145,14 @@
 
 #define kmemcheck_annotate_bitfield(ptr, name)				\
 	do {								\
+		int _n;							\
+									\
 		if (!ptr)						\
 			break;						\
 									\
-		int _n = (long) &((ptr)->name##_end)			\
+		_n = (long) &((ptr)->name##_end)			\
 			- (long) &((ptr)->name##_begin);		\
-		BUILD_BUG_ON(_n < 0);					\
+		MAYBE_BUILD_BUG_ON(_n < 0);				\
 									\
 		kmemcheck_mark_initialized(&((ptr)->name##_begin), _n);	\
 	} while (0)
diff --git a/include/linux/magic.h b/include/linux/magic.h
index 1923327..76285e0 100644
--- a/include/linux/magic.h
+++ b/include/linux/magic.h
@@ -12,7 +12,9 @@
 #define SYSFS_MAGIC		0x62656572
 #define SECURITYFS_MAGIC	0x73636673
 #define SELINUX_MAGIC		0xf97cff8c
+#define RAMFS_MAGIC		0x858458f6	/* some random number */
 #define TMPFS_MAGIC		0x01021994
+#define HUGETLBFS_MAGIC 	0x958458f6	/* some random number */
 #define SQUASHFS_MAGIC		0x73717368
 #define EFS_SUPER_MAGIC		0x414A53
 #define EXT2_SUPER_MAGIC	0xEF53
@@ -53,4 +55,8 @@
 #define INOTIFYFS_SUPER_MAGIC	0x2BAD1DEA
 
 #define STACK_END_MAGIC		0x57AC6E9D
+
+#define DEVPTS_SUPER_MAGIC	0x1cd1
+#define SOCKFS_MAGIC		0x534F434B
+
 #endif /* __LINUX_MAGIC_H__ */
diff --git a/include/linux/memory_hotplug.h b/include/linux/memory_hotplug.h
index d95f72e..fed9692 100644
--- a/include/linux/memory_hotplug.h
+++ b/include/linux/memory_hotplug.h
@@ -191,14 +191,6 @@
 
 #endif /* ! CONFIG_MEMORY_HOTPLUG */
 
-/*
- * Walk through all memory which is registered as resource.
- * arg is (start_pfn, nr_pages, private_arg_pointer)
- */
-extern int walk_memory_resource(unsigned long start_pfn,
-			unsigned long nr_pages, void *arg,
-			int (*func)(unsigned long, unsigned long, void *));
-
 #ifdef CONFIG_MEMORY_HOTREMOVE
 
 extern int is_mem_section_removable(unsigned long pfn, unsigned long nr_pages);
diff --git a/include/linux/mm.h b/include/linux/mm.h
index 5946e2f..b6eae5e 100644
--- a/include/linux/mm.h
+++ b/include/linux/mm.h
@@ -285,6 +285,14 @@
 	return 0;
 #endif
 }
+#ifdef CONFIG_MMU
+extern int is_vmalloc_or_module_addr(const void *x);
+#else
+static int is_vmalloc_or_module_addr(const void *x)
+{
+	return 0;
+}
+#endif
 
 static inline struct page *compound_head(struct page *page)
 {
diff --git a/include/linux/mmc/card.h b/include/linux/mmc/card.h
index 403aa50..2ee22e8 100644
--- a/include/linux/mmc/card.h
+++ b/include/linux/mmc/card.h
@@ -40,6 +40,8 @@
 };
 
 struct mmc_ext_csd {
+	u8			rev;
+	unsigned int		sa_timeout;		/* Units: 100ns */
 	unsigned int		hs_max_dtr;
 	unsigned int		sectors;
 };
@@ -62,7 +64,8 @@
 				low_speed:1,
 				wide_bus:1,
 				high_power:1,
-				high_speed:1;
+				high_speed:1,
+				disable_cd:1;
 };
 
 struct sdio_cis {
@@ -94,6 +97,8 @@
 #define MMC_STATE_READONLY	(1<<1)		/* card is read-only */
 #define MMC_STATE_HIGHSPEED	(1<<2)		/* card is in high speed mode */
 #define MMC_STATE_BLOCKADDR	(1<<3)		/* card uses block-addressing */
+	unsigned int		quirks; 	/* card quirks */
+#define MMC_QUIRK_LENIENT_FN0	(1<<0)		/* allow SDIO FN0 writes outside of the VS CCCR range */
 
 	u32			raw_cid[4];	/* raw card CID */
 	u32			raw_csd[4];	/* raw card CSD */
@@ -129,6 +134,11 @@
 #define mmc_card_set_highspeed(c) ((c)->state |= MMC_STATE_HIGHSPEED)
 #define mmc_card_set_blockaddr(c) ((c)->state |= MMC_STATE_BLOCKADDR)
 
+static inline int mmc_card_lenient_fn0(const struct mmc_card *c)
+{
+	return c->quirks & MMC_QUIRK_LENIENT_FN0;
+}
+
 #define mmc_card_name(c)	((c)->cid.prod_name)
 #define mmc_card_id(c)		(dev_name(&(c)->dev))
 
diff --git a/include/linux/mmc/core.h b/include/linux/mmc/core.h
index 7ac8b50..e4898e9 100644
--- a/include/linux/mmc/core.h
+++ b/include/linux/mmc/core.h
@@ -139,6 +139,7 @@
 
 extern int __mmc_claim_host(struct mmc_host *host, atomic_t *abort);
 extern void mmc_release_host(struct mmc_host *host);
+extern int mmc_try_claim_host(struct mmc_host *host);
 
 /**
  *	mmc_claim_host - exclusively claim a host
diff --git a/include/linux/mmc/host.h b/include/linux/mmc/host.h
index 3e7615e..81bb423 100644
--- a/include/linux/mmc/host.h
+++ b/include/linux/mmc/host.h
@@ -51,6 +51,35 @@
 };
 
 struct mmc_host_ops {
+	/*
+	 * Hosts that support power saving can use the 'enable' and 'disable'
+	 * methods to exit and enter power saving states. 'enable' is called
+	 * when the host is claimed and 'disable' is called (or scheduled with
+	 * a delay) when the host is released. The 'disable' is scheduled if
+	 * the disable delay set by 'mmc_set_disable_delay()' is non-zero,
+	 * otherwise 'disable' is called immediately. 'disable' may be
+	 * scheduled repeatedly, to permit ever greater power saving at the
+	 * expense of ever greater latency to re-enable. Rescheduling is
+	 * determined by the return value of the 'disable' method. A positive
+	 * value gives the delay in milliseconds.
+	 *
+	 * In the case where a host function (like set_ios) may be called
+	 * with or without the host claimed, enabling and disabling can be
+	 * done directly and will nest correctly. Call 'mmc_host_enable()' and
+	 * 'mmc_host_lazy_disable()' for this purpose, but note that these
+	 * functions must be paired.
+	 *
+	 * Alternatively, 'mmc_host_enable()' may be paired with
+	 * 'mmc_host_disable()' which calls 'disable' immediately.  In this
+	 * case the 'disable' method will be called with 'lazy' set to 0.
+	 * This is mainly useful for error paths.
+	 *
+	 * Because lazy disable may be called from a work queue, the 'disable'
+	 * method must claim the host when 'lazy' != 0, which will work
+	 * correctly because recursion is detected and handled.
+	 */
+	int (*enable)(struct mmc_host *host);
+	int (*disable)(struct mmc_host *host, int lazy);
 	void	(*request)(struct mmc_host *host, struct mmc_request *req);
 	/*
 	 * Avoid calling these three functions too often or in a "fast path",
@@ -118,6 +147,9 @@
 #define MMC_CAP_SPI		(1 << 4)	/* Talks only SPI protocols */
 #define MMC_CAP_NEEDS_POLL	(1 << 5)	/* Needs polling for card-detection */
 #define MMC_CAP_8_BIT_DATA	(1 << 6)	/* Can the host do 8 bit transfers */
+#define MMC_CAP_DISABLE		(1 << 7)	/* Can the host be disabled */
+#define MMC_CAP_NONREMOVABLE	(1 << 8)	/* Nonremovable e.g. eMMC */
+#define MMC_CAP_WAIT_WHILE_BUSY	(1 << 9)	/* Waits while card is busy */
 
 	/* host specific block data */
 	unsigned int		max_seg_size;	/* see blk_queue_max_segment_size */
@@ -142,9 +174,18 @@
 	unsigned int		removed:1;	/* host is being removed */
 #endif
 
+	/* Only used with MMC_CAP_DISABLE */
+	int			enabled;	/* host is enabled */
+	int			nesting_cnt;	/* "enable" nesting count */
+	int			en_dis_recurs;	/* detect recursion */
+	unsigned int		disable_delay;	/* disable delay in msecs */
+	struct delayed_work	disable;	/* disabling work */
+
 	struct mmc_card		*card;		/* device attached to this host */
 
 	wait_queue_head_t	wq;
+	struct task_struct	*claimer;	/* task that has host claimed */
+	int			claim_cnt;	/* "claim" nesting count */
 
 	struct delayed_work	detect;
 
@@ -183,6 +224,9 @@
 extern int mmc_suspend_host(struct mmc_host *, pm_message_t);
 extern int mmc_resume_host(struct mmc_host *);
 
+extern void mmc_power_save_host(struct mmc_host *host);
+extern void mmc_power_restore_host(struct mmc_host *host);
+
 extern void mmc_detect_change(struct mmc_host *, unsigned long delay);
 extern void mmc_request_done(struct mmc_host *, struct mmc_request *);
 
@@ -197,5 +241,19 @@
 int mmc_regulator_get_ocrmask(struct regulator *supply);
 int mmc_regulator_set_ocr(struct regulator *supply, unsigned short vdd_bit);
 
+int mmc_card_awake(struct mmc_host *host);
+int mmc_card_sleep(struct mmc_host *host);
+int mmc_card_can_sleep(struct mmc_host *host);
+
+int mmc_host_enable(struct mmc_host *host);
+int mmc_host_disable(struct mmc_host *host);
+int mmc_host_lazy_disable(struct mmc_host *host);
+
+static inline void mmc_set_disable_delay(struct mmc_host *host,
+					 unsigned int disable_delay)
+{
+	host->disable_delay = disable_delay;
+}
+
 #endif
 
diff --git a/include/linux/mmc/mmc.h b/include/linux/mmc/mmc.h
index 14b81f3..c02c8db 100644
--- a/include/linux/mmc/mmc.h
+++ b/include/linux/mmc/mmc.h
@@ -31,6 +31,7 @@
 #define MMC_ALL_SEND_CID          2   /* bcr                     R2  */
 #define MMC_SET_RELATIVE_ADDR     3   /* ac   [31:16] RCA        R1  */
 #define MMC_SET_DSR               4   /* bc   [31:16] RCA            */
+#define MMC_SLEEP_AWAKE		  5   /* ac   [31:16] RCA 15:flg R1b */
 #define MMC_SWITCH                6   /* ac   [31:0] See below   R1b */
 #define MMC_SELECT_CARD           7   /* ac   [31:16] RCA        R1  */
 #define MMC_SEND_EXT_CSD          8   /* adtc                    R1  */
@@ -127,6 +128,7 @@
 #define R1_STATUS(x)            (x & 0xFFFFE000)
 #define R1_CURRENT_STATE(x)	((x & 0x00001E00) >> 9)	/* sx, b (4 bits) */
 #define R1_READY_FOR_DATA	(1 << 8)	/* sx, a */
+#define R1_SWITCH_ERROR		(1 << 7)	/* sx, c */
 #define R1_APP_CMD		(1 << 5)	/* sr, c */
 
 /*
@@ -254,6 +256,7 @@
 #define EXT_CSD_CARD_TYPE	196	/* RO */
 #define EXT_CSD_REV		192	/* RO */
 #define EXT_CSD_SEC_CNT		212	/* RO, 4 bytes */
+#define EXT_CSD_S_A_TIMEOUT	217
 
 /*
  * EXT_CSD field definitions
diff --git a/include/linux/mmc/sdio_func.h b/include/linux/mmc/sdio_func.h
index 451bdfc..ac3ab68 100644
--- a/include/linux/mmc/sdio_func.h
+++ b/include/linux/mmc/sdio_func.h
@@ -67,6 +67,7 @@
 
 #define sdio_get_drvdata(f)	dev_get_drvdata(&(f)->dev)
 #define sdio_set_drvdata(f,d)	dev_set_drvdata(&(f)->dev, d)
+#define dev_to_sdio_func(d)	container_of(d, struct sdio_func, dev)
 
 /*
  * SDIO function device driver
@@ -81,6 +82,8 @@
 	struct device_driver drv;
 };
 
+#define to_sdio_driver(d)	container_of(d, struct sdio_driver, drv)
+
 /**
  * SDIO_DEVICE - macro used to describe a specific SDIO device
  * @vend: the 16 bit manufacturer code
diff --git a/include/linux/mod_devicetable.h b/include/linux/mod_devicetable.h
index 1bf5900..f58e9d83 100644
--- a/include/linux/mod_devicetable.h
+++ b/include/linux/mod_devicetable.h
@@ -399,6 +399,17 @@
 			__attribute__((aligned(sizeof(kernel_ulong_t))));
 };
 
+/* spi */
+
+#define SPI_NAME_SIZE	32
+#define SPI_MODULE_PREFIX "spi:"
+
+struct spi_device_id {
+	char name[SPI_NAME_SIZE];
+	kernel_ulong_t driver_data	/* Data private to the driver */
+			__attribute__((aligned(sizeof(kernel_ulong_t))));
+};
+
 /* dmi */
 enum dmi_field {
 	DMI_NONE,
diff --git a/include/linux/nfsd/nfsd.h b/include/linux/nfsd/nfsd.h
index 03bbe9039..510ffdd 100644
--- a/include/linux/nfsd/nfsd.h
+++ b/include/linux/nfsd/nfsd.h
@@ -60,7 +60,7 @@
 extern unsigned int		nfsd_drc_max_mem;
 extern unsigned int		nfsd_drc_mem_used;
 
-extern struct seq_operations nfs_exports_op;
+extern const struct seq_operations nfs_exports_op;
 
 /*
  * Function prototypes.
diff --git a/include/linux/proc_fs.h b/include/linux/proc_fs.h
index e6e77d3..379eaed 100644
--- a/include/linux/proc_fs.h
+++ b/include/linux/proc_fs.h
@@ -78,10 +78,19 @@
 	struct list_head pde_openers;	/* who did ->open, but not ->release */
 };
 
+enum kcore_type {
+	KCORE_TEXT,
+	KCORE_VMALLOC,
+	KCORE_RAM,
+	KCORE_VMEMMAP,
+	KCORE_OTHER,
+};
+
 struct kcore_list {
-	struct kcore_list *next;
+	struct list_head list;
 	unsigned long addr;
 	size_t size;
+	int type;
 };
 
 struct vmcore {
@@ -233,11 +242,12 @@
 #endif /* CONFIG_PROC_FS */
 
 #if !defined(CONFIG_PROC_KCORE)
-static inline void kclist_add(struct kcore_list *new, void *addr, size_t size)
+static inline void
+kclist_add(struct kcore_list *new, void *addr, size_t size, int type)
 {
 }
 #else
-extern void kclist_add(struct kcore_list *, void *, size_t);
+extern void kclist_add(struct kcore_list *, void *, size_t, int type);
 #endif
 
 union proc_op {
diff --git a/include/linux/sched.h b/include/linux/sched.h
index 97b10da..3cbc6c0 100644
--- a/include/linux/sched.h
+++ b/include/linux/sched.h
@@ -426,6 +426,15 @@
 	return max(mm->hiwater_rss, get_mm_rss(mm));
 }
 
+static inline void setmax_mm_hiwater_rss(unsigned long *maxrss,
+					 struct mm_struct *mm)
+{
+	unsigned long hiwater_rss = get_mm_hiwater_rss(mm);
+
+	if (*maxrss < hiwater_rss)
+		*maxrss = hiwater_rss;
+}
+
 static inline unsigned long get_mm_hiwater_vm(struct mm_struct *mm)
 {
 	return max(mm->hiwater_vm, mm->total_vm);
@@ -612,6 +621,7 @@
 	unsigned long nvcsw, nivcsw, cnvcsw, cnivcsw;
 	unsigned long min_flt, maj_flt, cmin_flt, cmaj_flt;
 	unsigned long inblock, oublock, cinblock, coublock;
+	unsigned long maxrss, cmaxrss;
 	struct task_io_accounting ioac;
 
 	/*
@@ -1519,6 +1529,7 @@
 	/* bitmask of trace recursion */
 	unsigned long trace_recursion;
 #endif /* CONFIG_TRACING */
+	unsigned long stack_start;
 };
 
 /* Future-safe accessor for struct task_struct's cpus_allowed. */
diff --git a/include/linux/spi/mc33880.h b/include/linux/spi/mc33880.h
new file mode 100644
index 0000000..82ffccd
--- /dev/null
+++ b/include/linux/spi/mc33880.h
@@ -0,0 +1,10 @@
+#ifndef LINUX_SPI_MC33880_H
+#define LINUX_SPI_MC33880_H
+
+struct mc33880_platform_data {
+	/* number assigned to the first GPIO */
+	unsigned	base;
+};
+
+#endif
+
diff --git a/include/linux/spi/spi.h b/include/linux/spi/spi.h
index c47c4b4..97b60b3 100644
--- a/include/linux/spi/spi.h
+++ b/include/linux/spi/spi.h
@@ -20,6 +20,7 @@
 #define __LINUX_SPI_H
 
 #include <linux/device.h>
+#include <linux/mod_devicetable.h>
 
 /*
  * INTERFACES between SPI master-side drivers and SPI infrastructure.
@@ -86,7 +87,7 @@
 	int			irq;
 	void			*controller_state;
 	void			*controller_data;
-	char			modalias[32];
+	char			modalias[SPI_NAME_SIZE];
 
 	/*
 	 * likely need more hooks for more protocol options affecting how
@@ -145,6 +146,7 @@
 
 /**
  * struct spi_driver - Host side "protocol" driver
+ * @id_table: List of SPI devices supported by this driver
  * @probe: Binds this driver to the spi device.  Drivers can verify
  *	that the device is actually present, and may need to configure
  *	characteristics (such as bits_per_word) which weren't needed for
@@ -170,6 +172,7 @@
  * MMC, RTC, filesystem character device nodes, and hardware monitoring.
  */
 struct spi_driver {
+	const struct spi_device_id *id_table;
 	int			(*probe)(struct spi_device *spi);
 	int			(*remove)(struct spi_device *spi);
 	void			(*shutdown)(struct spi_device *spi);
@@ -207,6 +210,8 @@
  *	each slave has a chipselect signal, but it's common that not
  *	every chipselect is connected to a slave.
  * @dma_alignment: SPI controller constraint on DMA buffers alignment.
+ * @mode_bits: flags understood by this controller driver
+ * @flags: other constraints relevant to this driver
  * @setup: updates the device mode and clocking records used by a
  *	device's SPI controller; protocol code may call this.  This
  *	must fail if an unrecognized or unsupported mode is requested.
@@ -253,6 +258,8 @@
 	/* other constraints relevant to this driver */
 	u16			flags;
 #define SPI_MASTER_HALF_DUPLEX	BIT(0)		/* can't do full duplex */
+#define SPI_MASTER_NO_RX	BIT(1)		/* can't do buffer read */
+#define SPI_MASTER_NO_TX	BIT(2)		/* can't do buffer write */
 
 	/* Setup mode and clock, etc (spi driver may call many times).
 	 *
@@ -533,42 +540,7 @@
 }
 
 extern int spi_setup(struct spi_device *spi);
-
-/**
- * spi_async - asynchronous SPI transfer
- * @spi: device with which data will be exchanged
- * @message: describes the data transfers, including completion callback
- * Context: any (irqs may be blocked, etc)
- *
- * This call may be used in_irq and other contexts which can't sleep,
- * as well as from task contexts which can sleep.
- *
- * The completion callback is invoked in a context which can't sleep.
- * Before that invocation, the value of message->status is undefined.
- * When the callback is issued, message->status holds either zero (to
- * indicate complete success) or a negative error code.  After that
- * callback returns, the driver which issued the transfer request may
- * deallocate the associated memory; it's no longer in use by any SPI
- * core or controller driver code.
- *
- * Note that although all messages to a spi_device are handled in
- * FIFO order, messages may go to different devices in other orders.
- * Some device might be higher priority, or have various "hard" access
- * time requirements, for example.
- *
- * On detection of any fault during the transfer, processing of
- * the entire message is aborted, and the device is deselected.
- * Until returning from the associated message completion callback,
- * no other spi_message queued to that device will be processed.
- * (This rule applies equally to all the synchronous transfer calls,
- * which are wrappers around this core asynchronous primitive.)
- */
-static inline int
-spi_async(struct spi_device *spi, struct spi_message *message)
-{
-	message->spi = spi;
-	return spi->master->transfer(spi, message);
-}
+extern int spi_async(struct spi_device *spi, struct spi_message *message);
 
 /*---------------------------------------------------------------------------*/
 
@@ -732,7 +704,7 @@
 	 * controller_data goes to spi_device.controller_data,
 	 * irq is copied too
 	 */
-	char		modalias[32];
+	char		modalias[SPI_NAME_SIZE];
 	const void	*platform_data;
 	void		*controller_data;
 	int		irq;
@@ -800,4 +772,7 @@
 		device_unregister(&spi->dev);
 }
 
+extern const struct spi_device_id *
+spi_get_device_id(const struct spi_device *sdev);
+
 #endif /* __LINUX_SPI_H */
diff --git a/include/linux/ucb1400.h b/include/linux/ucb1400.h
index ae779bb..adb4406 100644
--- a/include/linux/ucb1400.h
+++ b/include/linux/ucb1400.h
@@ -26,6 +26,7 @@
 #include <sound/ac97_codec.h>
 #include <linux/mutex.h>
 #include <linux/platform_device.h>
+#include <linux/gpio.h>
 
 /*
  * UCB1400 AC-link registers
@@ -82,6 +83,17 @@
 #define UCB_ID			0x7e
 #define UCB_ID_1400             0x4304
 
+struct ucb1400_gpio_data {
+	int gpio_offset;
+	int (*gpio_setup)(struct device *dev, int ngpio);
+	int (*gpio_teardown)(struct device *dev, int ngpio);
+};
+
+struct ucb1400_gpio {
+	struct gpio_chip	gc;
+	struct snd_ac97		*ac97;
+};
+
 struct ucb1400_ts {
 	struct input_dev	*ts_idev;
 	struct task_struct	*ts_task;
@@ -95,6 +107,7 @@
 
 struct ucb1400 {
 	struct platform_device	*ucb1400_ts;
+	struct platform_device	*ucb1400_gpio;
 };
 
 static inline u16 ucb1400_reg_read(struct snd_ac97 *ac97, u16 reg)
@@ -147,4 +160,10 @@
 unsigned int ucb1400_adc_read(struct snd_ac97 *ac97, u16 adc_channel,
 			      int adcsync);
 
+#ifdef CONFIG_GPIO_UCB1400
+void __init ucb1400_gpio_set_data(struct ucb1400_gpio_data *data);
+#else
+static inline void ucb1400_gpio_set_data(struct ucb1400_gpio_data *data) {}
+#endif
+
 #endif
diff --git a/include/linux/virtio_config.h b/include/linux/virtio_config.h
index e547e3c..0093dd7 100644
--- a/include/linux/virtio_config.h
+++ b/include/linux/virtio_config.h
@@ -109,8 +109,7 @@
 				      unsigned int fbit)
 {
 	/* Did you forget to fix assumptions on max features? */
-	if (__builtin_constant_p(fbit))
-		BUILD_BUG_ON(fbit >= 32);
+	MAYBE_BUILD_BUG_ON(fbit >= 32);
 
 	if (fbit < VIRTIO_TRANSPORT_F_START)
 		virtio_check_driver_offered_feature(vdev, fbit);
diff --git a/include/video/da8xx-fb.h b/include/video/da8xx-fb.h
new file mode 100644
index 0000000..c051a50
--- /dev/null
+++ b/include/video/da8xx-fb.h
@@ -0,0 +1,103 @@
+/*
+ * Header file for TI DA8XX LCD controller platform data.
+ *
+ * Copyright (C) 2008-2009 MontaVista Software Inc.
+ * Copyright (C) 2008-2009 Texas Instruments Inc
+ *
+ * This file is licensed under the terms of the GNU General Public License
+ * version 2. This program is licensed "as is" without any warranty of any
+ * kind, whether express or implied.
+ */
+
+#ifndef DA8XX_FB_H
+#define DA8XX_FB_H
+
+enum panel_type {
+	QVGA = 0
+};
+
+enum panel_shade {
+	MONOCHROME = 0,
+	COLOR_ACTIVE,
+	COLOR_PASSIVE,
+};
+
+enum raster_load_mode {
+	LOAD_DATA = 1,
+	LOAD_PALETTE,
+};
+
+struct display_panel {
+	enum panel_type panel_type; /* QVGA */
+	int max_bpp;
+	int min_bpp;
+	enum panel_shade panel_shade;
+};
+
+struct da8xx_lcdc_platform_data {
+	const char manu_name[10];
+	void *controller_data;
+	const char type[25];
+};
+
+struct lcd_ctrl_config {
+	const struct display_panel *p_disp_panel;
+
+	/* AC Bias Pin Frequency */
+	int ac_bias;
+
+	/* AC Bias Pin Transitions per Interrupt */
+	int ac_bias_intrpt;
+
+	/* DMA burst size */
+	int dma_burst_sz;
+
+	/* Bits per pixel */
+	int bpp;
+
+	/* FIFO DMA Request Delay */
+	int fdd;
+
+	/* TFT Alternative Signal Mapping (Only for active) */
+	unsigned char tft_alt_mode;
+
+	/* 12 Bit Per Pixel (5-6-5) Mode (Only for passive) */
+	unsigned char stn_565_mode;
+
+	/* Mono 8-bit Mode: 1=D0-D7 or 0=D0-D3 */
+	unsigned char mono_8bit_mode;
+
+	/* Invert line clock */
+	unsigned char invert_line_clock;
+
+	/* Invert frame clock  */
+	unsigned char invert_frm_clock;
+
+	/* Horizontal and Vertical Sync Edge: 0=rising 1=falling */
+	unsigned char sync_edge;
+
+	/* Horizontal and Vertical Sync: Control: 0=ignore */
+	unsigned char sync_ctrl;
+
+	/* Raster Data Order Select: 1=Most-to-least 0=Least-to-most */
+	unsigned char raster_order;
+};
+
+struct lcd_sync_arg {
+	int back_porch;
+	int front_porch;
+	int pulse_width;
+};
+
+/* ioctls */
+#define FBIOGET_CONTRAST	_IOR('F', 1, int)
+#define FBIOPUT_CONTRAST	_IOW('F', 2, int)
+#define FBIGET_BRIGHTNESS	_IOR('F', 3, int)
+#define FBIPUT_BRIGHTNESS	_IOW('F', 3, int)
+#define FBIGET_COLOR		_IOR('F', 5, int)
+#define FBIPUT_COLOR		_IOW('F', 6, int)
+#define FBIPUT_HSYNC		_IOW('F', 9, int)
+#define FBIPUT_VSYNC		_IOW('F', 10, int)
+
+#endif  /* ifndef DA8XX_FB_H */
+
diff --git a/ipc/util.c b/ipc/util.c
index b8e4ba9..79ce84e 100644
--- a/ipc/util.c
+++ b/ipc/util.c
@@ -942,7 +942,7 @@
 	return iface->show(s, it);
 }
 
-static struct seq_operations sysvipc_proc_seqops = {
+static const struct seq_operations sysvipc_proc_seqops = {
 	.start = sysvipc_proc_start,
 	.stop  = sysvipc_proc_stop,
 	.next  = sysvipc_proc_next,
diff --git a/kernel/cgroup.c b/kernel/cgroup.c
index 213b7f9..cd83d99 100644
--- a/kernel/cgroup.c
+++ b/kernel/cgroup.c
@@ -2314,7 +2314,7 @@
 	return seq_printf(s, "%d\n", *(int *)v);
 }
 
-static struct seq_operations cgroup_tasks_seq_operations = {
+static const struct seq_operations cgroup_tasks_seq_operations = {
 	.start = cgroup_tasks_start,
 	.stop = cgroup_tasks_stop,
 	.next = cgroup_tasks_next,
diff --git a/kernel/exit.c b/kernel/exit.c
index e47ee8a..60d6fdc 100644
--- a/kernel/exit.c
+++ b/kernel/exit.c
@@ -359,8 +359,10 @@
 {
 	struct task_struct *curr = current->group_leader;
 
-	if (task_session(curr) != pid)
+	if (task_session(curr) != pid) {
 		change_pid(curr, PIDTYPE_SID, pid);
+		proc_sid_connector(curr);
+	}
 
 	if (task_pgrp(curr) != pid)
 		change_pid(curr, PIDTYPE_PGID, pid);
@@ -945,6 +947,8 @@
 	if (group_dead) {
 		hrtimer_cancel(&tsk->signal->real_timer);
 		exit_itimers(tsk->signal);
+		if (tsk->mm)
+			setmax_mm_hiwater_rss(&tsk->signal->maxrss, tsk->mm);
 	}
 	acct_collect(code, group_dead);
 	if (group_dead)
@@ -1208,6 +1212,7 @@
 	if (likely(!traced) && likely(!task_detached(p))) {
 		struct signal_struct *psig;
 		struct signal_struct *sig;
+		unsigned long maxrss;
 
 		/*
 		 * The resource counters for the group leader are in its
@@ -1256,6 +1261,9 @@
 		psig->coublock +=
 			task_io_get_oublock(p) +
 			sig->oublock + sig->coublock;
+		maxrss = max(sig->maxrss, sig->cmaxrss);
+		if (psig->cmaxrss < maxrss)
+			psig->cmaxrss = maxrss;
 		task_io_accounting_add(&psig->ioac, &p->ioac);
 		task_io_accounting_add(&psig->ioac, &sig->ioac);
 		spin_unlock_irq(&p->real_parent->sighand->siglock);
diff --git a/kernel/fork.c b/kernel/fork.c
index 1020977..8f45b0e 100644
--- a/kernel/fork.c
+++ b/kernel/fork.c
@@ -866,6 +866,7 @@
 	sig->nvcsw = sig->nivcsw = sig->cnvcsw = sig->cnivcsw = 0;
 	sig->min_flt = sig->maj_flt = sig->cmin_flt = sig->cmaj_flt = 0;
 	sig->inblock = sig->oublock = sig->cinblock = sig->coublock = 0;
+	sig->maxrss = sig->cmaxrss = 0;
 	task_io_accounting_init(&sig->ioac);
 	sig->sum_sched_runtime = 0;
 	taskstats_tgid_init(sig);
@@ -1094,6 +1095,8 @@
 
 	p->bts = NULL;
 
+	p->stack_start = stack_start;
+
 	/* Perform scheduler related setup. Assign this task to a CPU. */
 	sched_fork(p, clone_flags);
 
diff --git a/kernel/kallsyms.c b/kernel/kallsyms.c
index 3a29dbe..8b6b8b6 100644
--- a/kernel/kallsyms.c
+++ b/kernel/kallsyms.c
@@ -59,7 +59,8 @@
 
 static inline int is_kernel_text(unsigned long addr)
 {
-	if (addr >= (unsigned long)_stext && addr <= (unsigned long)_etext)
+	if ((addr >= (unsigned long)_stext && addr <= (unsigned long)_etext) ||
+	    arch_is_kernel_text(addr))
 		return 1;
 	return in_gate_area_no_task(addr);
 }
diff --git a/kernel/kmod.c b/kernel/kmod.c
index 9fcb53a..689d20f 100644
--- a/kernel/kmod.c
+++ b/kernel/kmod.c
@@ -143,6 +143,7 @@
 static int ____call_usermodehelper(void *data)
 {
 	struct subprocess_info *sub_info = data;
+	enum umh_wait wait = sub_info->wait;
 	int retval;
 
 	BUG_ON(atomic_read(&sub_info->cred->usage) != 1);
@@ -184,10 +185,14 @@
 	 */
 	set_user_nice(current, 0);
 
+	if (wait == UMH_WAIT_EXEC)
+		complete(sub_info->complete);
+
 	retval = kernel_execve(sub_info->path, sub_info->argv, sub_info->envp);
 
 	/* Exec failed? */
-	sub_info->retval = retval;
+	if (wait != UMH_WAIT_EXEC)
+		sub_info->retval = retval;
 	do_exit(0);
 }
 
@@ -266,16 +271,14 @@
 
 	switch (wait) {
 	case UMH_NO_WAIT:
+	case UMH_WAIT_EXEC:
 		break;
 
 	case UMH_WAIT_PROC:
 		if (pid > 0)
 			break;
 		sub_info->retval = pid;
-		/* FALLTHROUGH */
-
-	case UMH_WAIT_EXEC:
-		complete(sub_info->complete);
+		break;
 	}
 }
 
diff --git a/kernel/kprobes.c b/kernel/kprobes.c
index ef177d6..cfadc12 100644
--- a/kernel/kprobes.c
+++ b/kernel/kprobes.c
@@ -1321,7 +1321,7 @@
 	return 0;
 }
 
-static struct seq_operations kprobes_seq_ops = {
+static const struct seq_operations kprobes_seq_ops = {
 	.start = kprobe_seq_start,
 	.next  = kprobe_seq_next,
 	.stop  = kprobe_seq_stop,
diff --git a/kernel/lockdep.c b/kernel/lockdep.c
index f74d2d7..3815ac1d 100644
--- a/kernel/lockdep.c
+++ b/kernel/lockdep.c
@@ -578,6 +578,9 @@
 	if ((addr >= start) && (addr < end))
 		return 1;
 
+	if (arch_is_kernel_data(addr))
+		return 1;
+
 #ifdef CONFIG_SMP
 	/*
 	 * percpu var?
diff --git a/kernel/lockdep_proc.c b/kernel/lockdep_proc.c
index d4b3dbc..d4aba4f 100644
--- a/kernel/lockdep_proc.c
+++ b/kernel/lockdep_proc.c
@@ -594,7 +594,7 @@
 	return 0;
 }
 
-static struct seq_operations lockstat_ops = {
+static const struct seq_operations lockstat_ops = {
 	.start	= ls_start,
 	.next	= ls_next,
 	.stop	= ls_stop,
diff --git a/kernel/printk.c b/kernel/printk.c
index 602033a..f38b07f 100644
--- a/kernel/printk.c
+++ b/kernel/printk.c
@@ -206,12 +206,11 @@
 #ifdef CONFIG_BOOT_PRINTK_DELAY
 
 static unsigned int boot_delay; /* msecs delay after each printk during bootup */
-static unsigned long long printk_delay_msec; /* per msec, based on boot_delay */
+static unsigned long long loops_per_msec;	/* based on boot_delay */
 
 static int __init boot_delay_setup(char *str)
 {
 	unsigned long lpj;
-	unsigned long long loops_per_msec;
 
 	lpj = preset_lpj ? preset_lpj : 1000000;	/* some guess */
 	loops_per_msec = (unsigned long long)lpj / 1000 * HZ;
@@ -220,10 +219,9 @@
 	if (boot_delay > 10 * 1000)
 		boot_delay = 0;
 
-	printk_delay_msec = loops_per_msec;
-	printk(KERN_DEBUG "boot_delay: %u, preset_lpj: %ld, lpj: %lu, "
-		"HZ: %d, printk_delay_msec: %llu\n",
-		boot_delay, preset_lpj, lpj, HZ, printk_delay_msec);
+	pr_debug("boot_delay: %u, preset_lpj: %ld, lpj: %lu, "
+		"HZ: %d, loops_per_msec: %llu\n",
+		boot_delay, preset_lpj, lpj, HZ, loops_per_msec);
 	return 1;
 }
 __setup("boot_delay=", boot_delay_setup);
@@ -236,7 +234,7 @@
 	if (boot_delay == 0 || system_state != SYSTEM_BOOTING)
 		return;
 
-	k = (unsigned long long)printk_delay_msec * boot_delay;
+	k = (unsigned long long)loops_per_msec * boot_delay;
 
 	timeout = jiffies + msecs_to_jiffies(boot_delay);
 	while (k) {
@@ -655,6 +653,20 @@
 static int new_text_line = 1;
 static char printk_buf[1024];
 
+int printk_delay_msec __read_mostly;
+
+static inline void printk_delay(void)
+{
+	if (unlikely(printk_delay_msec)) {
+		int m = printk_delay_msec;
+
+		while (m--) {
+			mdelay(1);
+			touch_nmi_watchdog();
+		}
+	}
+}
+
 asmlinkage int vprintk(const char *fmt, va_list args)
 {
 	int printed_len = 0;
@@ -664,6 +676,7 @@
 	char *p;
 
 	boot_delay_msec();
+	printk_delay();
 
 	preempt_disable();
 	/* This stops the holder of console_sem just where we want him */
diff --git a/kernel/resource.c b/kernel/resource.c
index 78b0872..fb11a58 100644
--- a/kernel/resource.c
+++ b/kernel/resource.c
@@ -223,13 +223,13 @@
 
 EXPORT_SYMBOL(release_resource);
 
-#if defined(CONFIG_MEMORY_HOTPLUG) && !defined(CONFIG_ARCH_HAS_WALK_MEMORY)
+#if !defined(CONFIG_ARCH_HAS_WALK_MEMORY)
 /*
  * Finds the lowest memory reosurce exists within [res->start.res->end)
- * the caller must specify res->start, res->end, res->flags.
+ * the caller must specify res->start, res->end, res->flags and "name".
  * If found, returns 0, res is overwritten, if not found, returns -1.
  */
-static int find_next_system_ram(struct resource *res)
+static int find_next_system_ram(struct resource *res, char *name)
 {
 	resource_size_t start, end;
 	struct resource *p;
@@ -245,6 +245,8 @@
 		/* system ram is just marked as IORESOURCE_MEM */
 		if (p->flags != res->flags)
 			continue;
+		if (name && strcmp(p->name, name))
+			continue;
 		if (p->start > end) {
 			p = NULL;
 			break;
@@ -262,19 +264,26 @@
 		res->end = p->end;
 	return 0;
 }
-int
-walk_memory_resource(unsigned long start_pfn, unsigned long nr_pages, void *arg,
-			int (*func)(unsigned long, unsigned long, void *))
+
+/*
+ * This function calls callback against all memory range of "System RAM"
+ * which are marked as IORESOURCE_MEM and IORESOUCE_BUSY.
+ * Now, this function is only for "System RAM".
+ */
+int walk_system_ram_range(unsigned long start_pfn, unsigned long nr_pages,
+		void *arg, int (*func)(unsigned long, unsigned long, void *))
 {
 	struct resource res;
 	unsigned long pfn, len;
 	u64 orig_end;
 	int ret = -1;
+
 	res.start = (u64) start_pfn << PAGE_SHIFT;
 	res.end = ((u64)(start_pfn + nr_pages) << PAGE_SHIFT) - 1;
 	res.flags = IORESOURCE_MEM | IORESOURCE_BUSY;
 	orig_end = res.end;
-	while ((res.start < res.end) && (find_next_system_ram(&res) >= 0)) {
+	while ((res.start < res.end) &&
+		(find_next_system_ram(&res, "System RAM") >= 0)) {
 		pfn = (unsigned long)(res.start >> PAGE_SHIFT);
 		len = (unsigned long)((res.end + 1 - res.start) >> PAGE_SHIFT);
 		ret = (*func)(pfn, len, arg);
diff --git a/kernel/smp.c b/kernel/smp.c
index 8e21850..fd47a25 100644
--- a/kernel/smp.c
+++ b/kernel/smp.c
@@ -29,8 +29,7 @@
 
 struct call_function_data {
 	struct call_single_data	csd;
-	spinlock_t		lock;
-	unsigned int		refs;
+	atomic_t		refs;
 	cpumask_var_t		cpumask;
 };
 
@@ -39,9 +38,7 @@
 	spinlock_t		lock;
 };
 
-static DEFINE_PER_CPU(struct call_function_data, cfd_data) = {
-	.lock			= __SPIN_LOCK_UNLOCKED(cfd_data.lock),
-};
+static DEFINE_PER_CPU(struct call_function_data, cfd_data);
 
 static int
 hotplug_cfd(struct notifier_block *nfb, unsigned long action, void *hcpu)
@@ -196,25 +193,18 @@
 	list_for_each_entry_rcu(data, &call_function.queue, csd.list) {
 		int refs;
 
-		spin_lock(&data->lock);
-		if (!cpumask_test_cpu(cpu, data->cpumask)) {
-			spin_unlock(&data->lock);
+		if (!cpumask_test_and_clear_cpu(cpu, data->cpumask))
 			continue;
-		}
-		cpumask_clear_cpu(cpu, data->cpumask);
-		spin_unlock(&data->lock);
 
 		data->csd.func(data->csd.info);
 
-		spin_lock(&data->lock);
-		WARN_ON(data->refs == 0);
-		refs = --data->refs;
+		refs = atomic_dec_return(&data->refs);
+		WARN_ON(refs < 0);
 		if (!refs) {
 			spin_lock(&call_function.lock);
 			list_del_rcu(&data->csd.list);
 			spin_unlock(&call_function.lock);
 		}
-		spin_unlock(&data->lock);
 
 		if (refs)
 			continue;
@@ -419,23 +409,20 @@
 	data = &__get_cpu_var(cfd_data);
 	csd_lock(&data->csd);
 
-	spin_lock_irqsave(&data->lock, flags);
 	data->csd.func = func;
 	data->csd.info = info;
 	cpumask_and(data->cpumask, mask, cpu_online_mask);
 	cpumask_clear_cpu(this_cpu, data->cpumask);
-	data->refs = cpumask_weight(data->cpumask);
+	atomic_set(&data->refs, cpumask_weight(data->cpumask));
 
-	spin_lock(&call_function.lock);
+	spin_lock_irqsave(&call_function.lock, flags);
 	/*
 	 * Place entry at the _HEAD_ of the list, so that any cpu still
 	 * observing the entry in generic_smp_call_function_interrupt()
 	 * will not miss any other list entries:
 	 */
 	list_add_rcu(&data->csd.list, &call_function.queue);
-	spin_unlock(&call_function.lock);
-
-	spin_unlock_irqrestore(&data->lock, flags);
+	spin_unlock_irqrestore(&call_function.lock, flags);
 
 	/*
 	 * Make the list addition visible before sending the ipi.
diff --git a/kernel/sys.c b/kernel/sys.c
index ea5c3bc..ebcb156 100644
--- a/kernel/sys.c
+++ b/kernel/sys.c
@@ -1338,6 +1338,7 @@
 	unsigned long flags;
 	cputime_t utime, stime;
 	struct task_cputime cputime;
+	unsigned long maxrss = 0;
 
 	memset((char *) r, 0, sizeof *r);
 	utime = stime = cputime_zero;
@@ -1346,6 +1347,7 @@
 		utime = task_utime(current);
 		stime = task_stime(current);
 		accumulate_thread_rusage(p, r);
+		maxrss = p->signal->maxrss;
 		goto out;
 	}
 
@@ -1363,6 +1365,7 @@
 			r->ru_majflt = p->signal->cmaj_flt;
 			r->ru_inblock = p->signal->cinblock;
 			r->ru_oublock = p->signal->coublock;
+			maxrss = p->signal->cmaxrss;
 
 			if (who == RUSAGE_CHILDREN)
 				break;
@@ -1377,6 +1380,8 @@
 			r->ru_majflt += p->signal->maj_flt;
 			r->ru_inblock += p->signal->inblock;
 			r->ru_oublock += p->signal->oublock;
+			if (maxrss < p->signal->maxrss)
+				maxrss = p->signal->maxrss;
 			t = p;
 			do {
 				accumulate_thread_rusage(t, r);
@@ -1392,6 +1397,15 @@
 out:
 	cputime_to_timeval(utime, &r->ru_utime);
 	cputime_to_timeval(stime, &r->ru_stime);
+
+	if (who != RUSAGE_CHILDREN) {
+		struct mm_struct *mm = get_task_mm(p);
+		if (mm) {
+			setmax_mm_hiwater_rss(&maxrss, mm);
+			mmput(mm);
+		}
+	}
+	r->ru_maxrss = maxrss * (PAGE_SIZE / 1024); /* convert pages to KBs */
 }
 
 int getrusage(struct task_struct *p, int who, struct rusage __user *ru)
diff --git a/kernel/sysctl.c b/kernel/sysctl.c
index 6ba49c7..0dfaa47 100644
--- a/kernel/sysctl.c
+++ b/kernel/sysctl.c
@@ -106,6 +106,9 @@
 static int __maybe_unused two = 2;
 static unsigned long one_ul = 1;
 static int one_hundred = 100;
+#ifdef CONFIG_PRINTK
+static int ten_thousand = 10000;
+#endif
 
 /* this is needed for the proc_doulongvec_minmax of vm_dirty_bytes */
 static unsigned long dirty_bytes_min = 2 * PAGE_SIZE;
@@ -722,6 +725,17 @@
 		.mode		= 0644,
 		.proc_handler	= &proc_dointvec,
 	},
+	{
+		.ctl_name	= CTL_UNNUMBERED,
+		.procname	= "printk_delay",
+		.data		= &printk_delay_msec,
+		.maxlen		= sizeof(int),
+		.mode		= 0644,
+		.proc_handler	= &proc_dointvec_minmax,
+		.strategy	= &sysctl_intvec,
+		.extra1		= &zero,
+		.extra2		= &ten_thousand,
+	},
 #endif
 	{
 		.ctl_name	= KERN_NGROUPS_MAX,
diff --git a/kernel/trace/ftrace.c b/kernel/trace/ftrace.c
index c71e91b..23df7771 100644
--- a/kernel/trace/ftrace.c
+++ b/kernel/trace/ftrace.c
@@ -1520,7 +1520,7 @@
 	return 0;
 }
 
-static struct seq_operations show_ftrace_seq_ops = {
+static const struct seq_operations show_ftrace_seq_ops = {
 	.start = t_start,
 	.next = t_next,
 	.stop = t_stop,
@@ -2459,7 +2459,7 @@
 	return 0;
 }
 
-static struct seq_operations ftrace_graph_seq_ops = {
+static const struct seq_operations ftrace_graph_seq_ops = {
 	.start = g_start,
 	.next = g_next,
 	.stop = g_stop,
diff --git a/kernel/trace/trace.c b/kernel/trace/trace.c
index a35925d..6c0f6a8 100644
--- a/kernel/trace/trace.c
+++ b/kernel/trace/trace.c
@@ -1949,7 +1949,7 @@
 	return 0;
 }
 
-static struct seq_operations tracer_seq_ops = {
+static const struct seq_operations tracer_seq_ops = {
 	.start		= s_start,
 	.next		= s_next,
 	.stop		= s_stop,
@@ -2163,7 +2163,7 @@
 	return 0;
 }
 
-static struct seq_operations show_traces_seq_ops = {
+static const struct seq_operations show_traces_seq_ops = {
 	.start		= t_start,
 	.next		= t_next,
 	.stop		= t_stop,
diff --git a/mm/Makefile b/mm/Makefile
index 728a9fd..88193d7 100644
--- a/mm/Makefile
+++ b/mm/Makefile
@@ -11,10 +11,10 @@
 			   maccess.o page_alloc.o page-writeback.o \
 			   readahead.o swap.o truncate.o vmscan.o shmem.o \
 			   prio_tree.o util.o mmzone.o vmstat.o backing-dev.o \
-			   page_isolation.o mm_init.o mmu_context.o $(mmu-y)
+			   page_isolation.o mm_init.o mmu_context.o \
+			   pagewalk.o $(mmu-y)
 obj-y += init-mm.o
 
-obj-$(CONFIG_PROC_PAGE_MONITOR) += pagewalk.o
 obj-$(CONFIG_BOUNCE)	+= bounce.o
 obj-$(CONFIG_SWAP)	+= page_io.o swap_state.o swapfile.o thrash.o
 obj-$(CONFIG_HAS_DMA)	+= dmapool.o
diff --git a/mm/memory_hotplug.c b/mm/memory_hotplug.c
index efe3e0e..821dee5 100644
--- a/mm/memory_hotplug.c
+++ b/mm/memory_hotplug.c
@@ -413,7 +413,7 @@
 	if (!populated_zone(zone))
 		need_zonelists_rebuild = 1;
 
-	ret = walk_memory_resource(pfn, nr_pages, &onlined_pages,
+	ret = walk_system_ram_range(pfn, nr_pages, &onlined_pages,
 		online_pages_range);
 	if (ret) {
 		printk(KERN_DEBUG "online_pages %lx at %lx failed\n",
@@ -705,7 +705,7 @@
 static void
 offline_isolated_pages(unsigned long start_pfn, unsigned long end_pfn)
 {
-	walk_memory_resource(start_pfn, end_pfn - start_pfn, NULL,
+	walk_system_ram_range(start_pfn, end_pfn - start_pfn, NULL,
 				offline_isolated_pages_cb);
 }
 
@@ -731,7 +731,7 @@
 	long offlined = 0;
 	int ret;
 
-	ret = walk_memory_resource(start_pfn, end_pfn - start_pfn, &offlined,
+	ret = walk_system_ram_range(start_pfn, end_pfn - start_pfn, &offlined,
 			check_pages_isolated_cb);
 	if (ret < 0)
 		offlined = (long)ret;
diff --git a/mm/vmalloc.c b/mm/vmalloc.c
index 5535da1..69511e6 100644
--- a/mm/vmalloc.c
+++ b/mm/vmalloc.c
@@ -184,7 +184,7 @@
 	return ret;
 }
 
-static inline int is_vmalloc_or_module_addr(const void *x)
+int is_vmalloc_or_module_addr(const void *x)
 {
 	/*
 	 * ARM, x86-64 and sparc64 put modules in a special place,
diff --git a/net/ipv6/ip6mr.c b/net/ipv6/ip6mr.c
index 3907510..090675e 100644
--- a/net/ipv6/ip6mr.c
+++ b/net/ipv6/ip6mr.c
@@ -324,7 +324,7 @@
 	return 0;
 }
 
-static struct seq_operations ipmr_mfc_seq_ops = {
+static const struct seq_operations ipmr_mfc_seq_ops = {
 	.start = ipmr_mfc_seq_start,
 	.next  = ipmr_mfc_seq_next,
 	.stop  = ipmr_mfc_seq_stop,
diff --git a/net/socket.c b/net/socket.c
index 0ad02ae..49917a1 100644
--- a/net/socket.c
+++ b/net/socket.c
@@ -86,6 +86,7 @@
 #include <linux/audit.h>
 #include <linux/wireless.h>
 #include <linux/nsproxy.h>
+#include <linux/magic.h>
 
 #include <asm/uaccess.h>
 #include <asm/unistd.h>
@@ -235,8 +236,6 @@
 	return __put_user(klen, ulen);
 }
 
-#define SOCKFS_MAGIC 0x534F434B
-
 static struct kmem_cache *sock_inode_cachep __read_mostly;
 
 static struct inode *sock_alloc_inode(struct super_block *sb)
diff --git a/scripts/conmakehash.c b/scripts/conmakehash.c
index e0c6891..263a44d 100644
--- a/scripts/conmakehash.c
+++ b/scripts/conmakehash.c
@@ -24,14 +24,14 @@
 
 typedef unsigned short unicode;
 
-void usage(char *argv0)
+static void usage(char *argv0)
 {
   fprintf(stderr, "Usage: \n"
          "        %s chartable [hashsize] [hashstep] [maxhashlevel]\n", argv0);
   exit(EX_USAGE);
 }
 
-int getunicode(char **p0)
+static int getunicode(char **p0)
 {
   char *p = *p0;
 
@@ -49,7 +49,7 @@
 				/* Massive overkill, but who cares? */
 int unicount[MAX_FONTLEN];
 
-void addpair(int fp, int un)
+static void addpair(int fp, int un)
 {
   int i;
 
diff --git a/scripts/genksyms/genksyms.c b/scripts/genksyms/genksyms.c
index 3a8297b..af6b836 100644
--- a/scripts/genksyms/genksyms.c
+++ b/scripts/genksyms/genksyms.c
@@ -176,7 +176,7 @@
 			strcmp(defn->string, "{") == 0);
 }
 
-struct symbol *__add_symbol(const char *name, enum symbol_type type,
+static struct symbol *__add_symbol(const char *name, enum symbol_type type,
 			    struct string_list *defn, int is_extern,
 			    int is_reference)
 {
@@ -265,7 +265,7 @@
 	return __add_symbol(name, type, defn, is_extern, 0);
 }
 
-struct symbol *add_reference_symbol(const char *name, enum symbol_type type,
+static struct symbol *add_reference_symbol(const char *name, enum symbol_type type,
 				    struct string_list *defn, int is_extern)
 {
 	return __add_symbol(name, type, defn, is_extern, 1);
@@ -313,7 +313,7 @@
 
 #define ARRAY_SIZE(arr) (sizeof(arr) / sizeof((arr)[0]))
 
-struct string_list *read_node(FILE *f)
+static struct string_list *read_node(FILE *f)
 {
 	char buffer[256];
 	struct string_list node = {
diff --git a/scripts/kallsyms.c b/scripts/kallsyms.c
index 64343cc..86c3896 100644
--- a/scripts/kallsyms.c
+++ b/scripts/kallsyms.c
@@ -585,7 +585,7 @@
 {
 	const char *tail = str;
 
-	while (*tail != '_')
+	while (*tail == '_')
 		tail++;
 
 	return tail - str;
diff --git a/scripts/mod/file2alias.c b/scripts/mod/file2alias.c
index 40e0045..62a9025 100644
--- a/scripts/mod/file2alias.c
+++ b/scripts/mod/file2alias.c
@@ -657,6 +657,15 @@
 	return 1;
 }
 
+/* Looks like: spi:S */
+static int do_spi_entry(const char *filename, struct spi_device_id *id,
+			char *alias)
+{
+	sprintf(alias, SPI_MODULE_PREFIX "%s", id->name);
+
+	return 1;
+}
+
 static const struct dmifield {
 	const char *prefix;
 	int field;
@@ -853,6 +862,10 @@
 		do_table(symval, sym->st_size,
 			 sizeof(struct i2c_device_id), "i2c",
 			 do_i2c_entry, mod);
+	else if (sym_is(symname, "__mod_spi_device_table"))
+		do_table(symval, sym->st_size,
+			 sizeof(struct spi_device_id), "spi",
+			 do_spi_entry, mod);
 	else if (sym_is(symname, "__mod_dmi_device_table"))
 		do_table(symval, sym->st_size,
 			 sizeof(struct dmi_system_id), "dmi",
diff --git a/scripts/mod/modpost.c b/scripts/mod/modpost.c
index 4522948..801a16a 100644
--- a/scripts/mod/modpost.c
+++ b/scripts/mod/modpost.c
@@ -691,7 +691,7 @@
  *   The $ syntax is for sections where ld append a dot number
  *   to make section name unique.
  */
-int match(const char *sym, const char * const pat[])
+static int match(const char *sym, const char * const pat[])
 {
 	const char *p;
 	while (*pat) {
@@ -1746,7 +1746,7 @@
 	buf_printf(b, "};\n");
 }
 
-void add_staging_flag(struct buffer *b, const char *name)
+static void add_staging_flag(struct buffer *b, const char *name)
 {
 	static const char *staging_dir = "drivers/staging";
 
diff --git a/scripts/selinux/mdp/mdp.c b/scripts/selinux/mdp/mdp.c
index ca757d4..b4ced85 100644
--- a/scripts/selinux/mdp/mdp.c
+++ b/scripts/selinux/mdp/mdp.c
@@ -31,13 +31,13 @@
 
 #include "flask.h"
 
-void usage(char *name)
+static void usage(char *name)
 {
 	printf("usage: %s [-m] policy_file context_file\n", name);
 	exit(1);
 }
 
-void find_common_name(char *cname, char *dest, int len)
+static void find_common_name(char *cname, char *dest, int len)
 {
 	char *start, *end;
 
diff --git a/security/integrity/ima/ima_fs.c b/security/integrity/ima/ima_fs.c
index 6bfc7ea..8e9777b 100644
--- a/security/integrity/ima/ima_fs.c
+++ b/security/integrity/ima/ima_fs.c
@@ -146,7 +146,7 @@
 	return 0;
 }
 
-static struct seq_operations ima_measurments_seqops = {
+static const struct seq_operations ima_measurments_seqops = {
 	.start = ima_measurements_start,
 	.next = ima_measurements_next,
 	.stop = ima_measurements_stop,
@@ -221,7 +221,7 @@
 	return 0;
 }
 
-static struct seq_operations ima_ascii_measurements_seqops = {
+static const struct seq_operations ima_ascii_measurements_seqops = {
 	.start = ima_measurements_start,
 	.next = ima_measurements_next,
 	.stop = ima_measurements_stop,
diff --git a/security/smack/smack_lsm.c b/security/smack/smack_lsm.c
index acae7ef4..c33b6bb 100644
--- a/security/smack/smack_lsm.c
+++ b/security/smack/smack_lsm.c
@@ -30,17 +30,11 @@
 #include <net/netlabel.h>
 #include <net/cipso_ipv4.h>
 #include <linux/audit.h>
+#include <linux/magic.h>
 #include "smack.h"
 
 #define task_security(task)	(task_cred_xxx((task), security))
 
-/*
- * I hope these are the hokeyist lines of code in the module. Casey.
- */
-#define DEVPTS_SUPER_MAGIC	0x1cd1
-#define SOCKFS_MAGIC		0x534F434B
-#define TMPFS_MAGIC		0x01021994
-
 /**
  * smk_fetch - Fetch the smack label from a file.
  * @ip: a pointer to the inode
diff --git a/security/smack/smackfs.c b/security/smack/smackfs.c
index f83a809..aeead75 100644
--- a/security/smack/smackfs.c
+++ b/security/smack/smackfs.c
@@ -187,7 +187,7 @@
 	/* No-op */
 }
 
-static struct seq_operations load_seq_ops = {
+static const struct seq_operations load_seq_ops = {
 	.start = load_seq_start,
 	.next  = load_seq_next,
 	.show  = load_seq_show,
@@ -503,7 +503,7 @@
 	/* No-op */
 }
 
-static struct seq_operations cipso_seq_ops = {
+static const struct seq_operations cipso_seq_ops = {
 	.start = cipso_seq_start,
 	.stop  = cipso_seq_stop,
 	.next  = cipso_seq_next,
@@ -697,7 +697,7 @@
 	/* No-op */
 }
 
-static struct seq_operations netlbladdr_seq_ops = {
+static const struct seq_operations netlbladdr_seq_ops = {
 	.start = netlbladdr_seq_start,
 	.stop  = netlbladdr_seq_stop,
 	.next  = netlbladdr_seq_next,
diff --git a/usr/gen_init_cpio.c b/usr/gen_init_cpio.c
index f1d3fe3..83b3dde 100644
--- a/usr/gen_init_cpio.c
+++ b/usr/gen_init_cpio.c
@@ -446,7 +446,7 @@
 	return rc;
 }
 
-void usage(const char *prog)
+static void usage(const char *prog)
 {
 	fprintf(stderr, "Usage:\n"
 		"\t%s <cpio_list>\n"